chore: bump version to 0.10.18

- Remove incremental loading (since filter) from highlightsController
- Fetch ALL highlights without limits for complete results
- Remove unused timestamp tracking methods and constant
- Ensures /my/highlights shows all highlights consistently
- Matches the fix applied to writingsController

.cursor/rules/210.mdc

@@ -2,4 +2,4 @@
 alwaysApply: true
 ---
 
-Keep files below 210 lines.
+Keep files below 420 lines.

.cursor/rules/fetching-data-with-controllers.mdc

@@ -0,0 +1,18 @@
+---
+description: fetching data from relays
+alwaysApply: false
+---
+
+We fetch data from relays using controllers:
+- Start controllers immediatly; don’t await.
+- Stream via onEvent; dedupe replaceables; emit immediately.
+- Parallel local/remote queries; complete on EOSE.
+- Finalize and persist since after completion.
+- Guard with generations to cancel stale runs.
+- UI flips off loading on first streamed result.
+
+We always include and prefer local relays for reads; optionally rebroadcast fetched content to local relays (depending on setting); and tolerate local‑only mode for writes (queueing for later).
+
+Since we are streaming results, we should NEVER use timeouts for fetching data. We should always rely on EOSE.
+
+In short: Local-first hydration, background network fetch, reactive updates, and replaceable lookups provide instant UI with eventual consistency. Use local relays as local data store for everything we fetch from remote relays.

CHANGELOG.md

@@ -7,6 +7,558 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ## [Unreleased]
 
+## [0.10.17] - 2025-10-23
+
+### Added
+
+- Setting to control auto-scroll to reading position
+  - New toggle in Settings > Reading Experience
+  - Allows users to disable automatic scroll restoration
+  - Defaults to enabled (preserves existing behavior)
+
+### Fixed
+
+- Blockquote styling on mobile devices
+  - Added equal right padding to match left padding (2rem on both sides)
+  - Prevents awkward text cutoff on narrow screens
+- Timestamp clicks in highlight cards now navigate within app
+  - Articles (kind:30023) open via `/a/{naddr}` route
+  - External URLs open via `/r/{encodedUrl}` route
+  - Previously opened external search portal (ants.sh)
+  - Highlight automatically scrolls into view with sidebar open
+- Hero images now properly extend edge-to-edge on mobile
+  - Adjusted negative margins to match new reader padding
+  - Image bleeds to screen edges while text maintains comfortable margins
+- Article relay links now open via `/a/` path instead of `/r/`
+  - Ensures nostr-native articles route correctly
+  - External links continue to use `/r/` path
+
+### Changed
+
+- Mobile reader padding increased for better readability
+  - Horizontal padding increased from 0.5rem to 1rem
+  - Title, summary, and body text now properly aligned
+  - More comfortable reading experience on small screens
+- Reading position save interval reduced from 3s to 1s
+  - More frequent auto-saves during active reading
+  - Better preservation of reading progress
+
+## [0.10.16] - 2025-10-22
+
+### Fixed
+
+- Reading position auto-save now works correctly during continuous scrolling
+  - Fixed critical bug where save timer was cleared when tracking toggled
+  - Timer now persists across tracking state changes
+  - Saves fire reliably every 3 seconds during active reading
+  - Throttle mechanism now works as intended
+- Reading position tracking stability improved
+  - Tracking state no longer toggles erratically
+  - Content stability checks refined to prevent false negatives
+  - Infinite loop fixed in position save handler
+
+### Changed
+
+- Reading position save mechanism changed from debounce to throttle
+  - Ensures saves happen at regular 3-second intervals during continuous scrolling
+  - Previous debounce approach could skip saves during slow continuous scrolling
+  - More predictable save behavior for users
+- Simplified reading position logic by removing unused complexity
+  - Removed 5% delta requirement for scheduling saves
+  - Removed unnecessary state tracking (lastSavedPosition, hasSavedOnce, lastSavedAtRef)
+  - Cleaner, more maintainable code
+
+### Fixed
+
+- Highlights now scroll into view when clicked from `/my/highlights` page
+  - Navigation state properly passes highlight ID and openHighlights flag
+  - Works for both article links and external URL links
+
+## [0.10.15] - 2025-01-22
+
+### Changed
+
+- Reading position restore now uses pre-loaded data from controller
+  - No longer fetches position from scratch when opening articles
+  - Uses position already loaded and displayed on bookmark cards
+  - Faster restore with no network wait
+  - Simpler code without stabilization window complexity
+- Reading position scroll animation restored to smooth behavior
+  - Changed from instant jump back to smooth animated scroll
+  - Better user experience when restoring position
+
+### Fixed
+
+- Reading position no longer saves 0% during back navigation on mobile
+  - Removed save-on-unmount behavior that was error-prone
+  - Browser scroll-to-top during back gesture no longer overwrites progress
+  - Auto-save with 3-second debounce is sufficient for normal reading
+  - Prevents accidental reset of reading progress when navigating away
+
+## [0.10.14] - 2025-01-27
+
+### Added
+
+- Third relay education article link in PWA settings
+  - Added "Relay Setup 101" article to relay information section
+  - Now links to three educational resources about relays
+
+### Changed
+
+- Timestamp links in bookmark cards now navigate within app
+  - Articles (kind:30023) open in `/a/{naddr}` route
+  - Notes (kind:1) open in `/e/{eventId}` route
+  - External URLs open in `/r/{encodedUrl}` route
+  - Uses React Router Link for client-side navigation instead of external search
+- Relay article links punctuation improved for better readability
+  - Changed from "here and here" to "here, here, and here"
+
+### Fixed
+
+- Duplicate video embeds and stray HTML artifacts eliminated
+  - VideoEmbedProcessor now processes HTML and extracts URLs in single pass
+  - Placeholder indices now correctly match collected video URLs
+  - Empty HTML parts no longer rendered, preventing stray characters like `">`
+- Highlights loading spinner no longer spins forever when article has zero highlights
+  - Loading state properly cleared when no highlights exist
+  - "No highlights" message displays immediately
+
+## [0.10.13] - 2025-01-27
+
+### Added
+
+- Instant article preview when navigating from blog post cards
+  - Title, image, summary, and date display immediately via navigation state
+  - No skeleton loading for metadata already visible on cards
+  - Article content loads seamlessly in background from eventStore or relays
+- Reliable relay fallback for article fetching
+  - Queries nostr.band, primal, damus, and nos.lol if initial fetch returns no events
+  - Reduces "Article not found" errors
+
+### Changed
+
+- Article loading now follows local-first controller pattern
+  - Uses eventStore and queryEvents for streaming results
+  - Emits content immediately on first event from store or local relays
+  - Finalizes with newest version after EOSE (no artificial timeouts)
+  - Background relay query continues to check for updates
+- Service Worker now only registers in production builds
+  - Disabled in development to avoid stale cache issues
+  - Preserves PWA functionality in production
+- Article fetching queries union of naddr relay hints and configured relays
+  - Prevents failures when naddr contains stale or unreachable relay hints
+  - Maintains fast local/hinted paths with reliable fallback
+
+### Fixed
+
+- Article loading race conditions eliminated
+  - Request ID guards prevent stale fetches from overwriting current content
+  - Stale highlights from previous articles no longer appear
+- Content/title mismatch when switching articles resolved
+  - Markdown preview clears immediately on content change
+  - Forced re-mount of rendered HTML per article via stable content keys
+  - Request guards in external URL loader prevent cross-article bleed
+- Article re-fetching on settings changes prevented
+  - Settings memoized via ref to avoid triggering effect dependencies
+- Explore writings tab now shows skeletons instead of spinner when loading
+  - Consistent loading UI across all views
+
+## [0.10.12] - 2025-01-27
+
+### Added
+
+- Person hiking icon (fa-person-hiking) for explore navigation
+
+### Changed
+
+- Explore icon changed from newspaper to person hiking for better semantic meaning
+- Settings button moved before explore button in sidebar navigation
+- Profile avatar button now uses 44px touch target on mobile (matches other icon buttons)
+
+### Fixed
+
+- Web bookmarks (kind:39701) now properly deduplicate by d-tag
+- Same URL bookmarked multiple times now only appears once
+- Web bookmark IDs use coordinate format (kind:pubkey:d-tag) for consistent deduplication
+- Profile avatar button sizing on mobile now matches other IconButton components
+- Removed all console.log statements from bookmarkController and bookmarkProcessing
+
+## [0.10.11] - 2025-01-27
+
+### Added
+
+- Clock icon for chronological bookmark view
+- Clickable highlight count to open highlights sidebar
+- Dynamic bookmark filter titles based on selected filter
+- Profile picture moved to first position (left-aligned) with consistent sizing
+
+### Changed
+
+- Default bookmark view changed to flat chronological list (newest first)
+- Bookmark URL changed from `/my/reading-list` to `/my/bookmarks`
+- Router updated to handle `/my/reading-list` → `/my/bookmarks` redirect
+- Me.tsx bookmarks tab now uses dynamic filter titles and chronological sorting
+- Me.tsx updated to use faClock icon instead of faBars
+- Removed bookmark count from section headings for cleaner display
+- Hide close/collapse sidebar buttons on mobile for better UX
+
+### Fixed
+
+- Bookmark sorting now uses proper display time (created_at || listUpdatedAt) with nulls last
+- Robust sorting of merged bookmarks with fallback timestamps
+- Corrected bookmark timestamp to use bookmark list creation time, not content creation time
+- Preserved content created_at while adding listUpdatedAt for proper sorting
+- Removed synthetic added_at field, now uses created_at from bookmark list event
+- Consistent chronological sorting with useMemo optimization
+- Removed unused faTimes import
+- Bookmark timestamps now show sane dates using created_at fallback to listUpdatedAt
+- Guarded formatters to prevent timestamp display errors
+
+### Refactored
+
+- Removed excessive debug logging for cleaner console output
+- Bookmark timestamp handling never defaults to "now", allows nulls and sorts nulls last
+- Renders empty when timestamp is missing instead of showing invalid dates
+
+## [0.10.10] - 2025-10-22
+
+### Changed
+
+- Version bump for consistency (no user-facing changes)
+
+## [0.10.9] - 2025-10-21
+
+### Fixed
+
+- Event fetching reliability with exponential backoff in eventManager
+  - Improved retry logic with incremental backoff delays
+  - Better handling of concurrent event requests
+  - More robust event retrieval from relay pool
+- Bookmark timestamp handling
+  - Use per-item `added_at`/`created_at` timestamps when available
+  - Improves accuracy of bookmark date tracking
+
+### Changed
+
+- Removed all debug console logs
+  - Cleaner console output in development and production
+  - Improved performance by eliminating debugging statements
+
+## [0.10.8] - 2025-10-21
+
+### Added
+
+- Individual event rendering via `/e/:eventId` path
+  - Display `kind:1` notes and other events with article-like presentation
+  - Publication date displayed in top-right corner like articles
+  - Author attribution with "Note by @author" titles
+  - Direct event loading with intelligent caching from eventStore
+- Centralized event fetching via new `eventManager` singleton
+  - Request deduplication for concurrent fetches
+  - Automatic retry logic when relay pool becomes available
+  - Non-blocking background fetching with 12-second timeout
+  - Seamless integration with eventStore for instant cached event display
+
+### Fixed
+
+- Bookmark hydration efficiency
+  - Only request content for bookmarks missing data (not all bookmarks)
+  - Use eventStore fallback for instant display of cached profiles
+  - Prevents over-fetching and improves initial load performance
+- Search button behavior for notes
+  - Opens `kind:1` notes directly via `/e/{eventId}` instead of search portal
+  - Articles continue to use search portal with proper naddr encoding
+  - Removes unwanted `nostr-event:` prefix from URLs
+- Author profile resolution
+  - Fetch author profiles from eventStore cache first before relay requests
+  - Instant title updates if profile already loaded
+  - Graceful fallback to short pubkey display if profile unavailable
+
+## [0.10.7] - 2025-10-21
+
+### Fixed
+
+- Profile pages now display all writings correctly
+  - Events are now stored in eventStore as they stream in from relays
+  - `fetchBlogPostsFromAuthors` now accepts `eventStore` parameter like other fetch functions
+  - Ensures all writings appear on `/p/` routes, not just the first few
+  - Background fetching of highlights and writings uses consistent patterns
+
+### Changed
+
+- Simplified profile background fetching logic for better maintainability
+  - Extracted relay URLs to variable for clarity
+  - Consistent error handling patterns across fetch functions
+  - Clearer comments about no-limit fetching behavior
+
+## [0.10.6] - 2025-10-21
+
+### Added
+
+- Text-to-speech reliability improvements
+  - Chunking support for long-form content to prevent WebSpeech API cutoffs
+  - Automatic chunk-based resumption for interrupted playback
+  - Better handling of content exceeding browser TTS limits
+
+### Fixed
+
+- Tab switching regression on `/my` page
+  - Resolved infinite update loop caused by circular dependency in `useCallback` hooks
+  - Tab navigation now properly updates UI when URL changes
+  - Removed `loadedTabs` from dependency arrays to prevent re-render cycles
+- Explore page data loading patterns
+  - Implemented subscribe-first, non-blocking loading model
+  - Removed all timeouts in favor of immediate subscription and progressive hydration
+  - Contacts, writings, and highlights now stream results as they arrive
+  - Nostrverse content loads in background without blocking UI
+- Text-to-speech handler cleanup
+  - Removed no-op self-assignment in rate change handler
+
+## [0.10.4] - 2025-10-21
+
+### Added
+
+- Web Share Target support for PWA (system-level share integration)
+  - Boris can now receive shared URLs from other apps on mobile and desktop
+  - Implements POST-based Web Share Target API per Chrome standards
+  - Service worker intercepts share requests and redirects to handler route
+  - ShareTargetHandler component auto-saves shared URLs as web bookmarks
+  - Android compatibility with URL extraction from text field when url param is missing
+  - Automatic navigation to bookmarks list after successful save
+  - Login prompt when sharing while logged out
+
+### Changed
+
+- Manifest now includes `share_target` configuration for system share menu integration
+- Service worker handles POST requests to `/share-target` endpoint
+- Added `/share-target` route for processing incoming shared content
+
+## [0.10.3] - 2025-10-21
+
+### Added
+
+- Content filtering setting to hide articles posted by bots
+  - New "Hide content posted by bots" checkbox in Explore settings (enabled by default)
+  - Filters articles where author's profile name or display_name contains "bot" (case-insensitive)
+  - Applies to both Explore page and Me section writings
+
+### Fixed
+
+- Resolved all linting and type checking issues
+  - Added missing React Hook dependencies to `useMemo` and `useEffect`
+  - Wrapped loader functions in `useCallback` to prevent unnecessary re-renders
+  - Removed unused variables (`queryTime`, `startTime`, `allEvents`)
+  - All ESLint warnings and TypeScript errors now resolved
+
+## [0.10.2] - 2025-10-20
+
+### Added
+
+- Text-to-speech (TTS) speaker language selection mode
+  - New "Speaker language" dropdown in TTS settings (system or content)
+  - Detects content language using tinyld for accurate voice matching
+  - Falls back to system language when content detection unavailable
+  - Top 10 languages featured in dropdown for quick access
+- TTS example text section in settings
+  - Test TTS voices directly in the settings panel
+  - Uses Boris mission statement as example text
+  - Real-time speaker selection testing
+
+### Changed
+
+- TTS language selection now uses "Speaker language" terminology
+  - Distinguishes between American English (en-US) and British English (en-GB)
+  - Improved language detection with content-aware voice selection
+  - Streamlined dropdown for better UX
+
+### Fixed
+
+- TTS voice detection and selection logic
+  - Proper empty catch block handling instead of silently failing
+  - Consistent use of `setting-select` class for dropdown styling
+  - Improved dropdown spacing with adequate padding-right
+
+## [0.10.0] - 2025-01-27
+
+### Added
+
+- Centralized bookmark loading with streaming and auto-decrypt
+  - Bookmarks now load progressively with streaming updates
+  - Auto-decrypt bookmarks as they arrive from relays
+  - Individual decrypt buttons for encrypted bookmark events
+  - Centralized bookmark controller for consistent loading across the app
+- Enhanced debug page with comprehensive diagnostics
+  - Interactive NIP-04 and NIP-44 encryption/decryption testing
+  - Live performance timing with stopwatch display
+  - Bookmark loading and decryption diagnostics
+  - Real-time bunker logs with filtering and clearing
+  - Version and git commit footer
+- Bunker (NIP-46) authentication support
+  - Support for remote signing via Nostr Connect protocol
+  - Bunker URI input with validation and error handling
+  - Automatic reconnection on app restore with proper permissions
+  - Signer suggestions in error messages (Amber, nsec.app, Nostrum)
+
+### Changed
+
+- Improved bookmark loading performance
+  - Non-blocking, progressive bookmark updates via callback pattern
+  - Batched background hydration using EventLoader and AddressLoader
+  - Shorter timeouts for debug page bookmark loading
+  - Sequential decryption instead of concurrent to avoid queue issues
+- Enhanced bunker error messages
+  - Formatted error messages with signer suggestions
+  - Links to nos2x, Amber, nsec.app, and Nostrum signers
+  - Better error handling for missing signer extensions
+- Centralized bookmark loading architecture
+  - Single shared bookmark controller for consistent loading
+  - Unified bookmark loading with streaming and auto-decrypt
+  - Consolidated bookmark loading into single centralized function
+
+### Fixed
+
+- NIP-46 bunker signing and decryption
+  - NostrConnectSigner properly reconnects with permissions on app restore
+  - Bunker relays added to relay pool for signing requests
+  - Proper setup of pool and relays before bunker reconnection
+  - Expose nip04/nip44 on NostrConnectAccount for bookmark decryption
+  - Cache wrapped nip04/nip44 objects instead of using getters
+  - Wait for bunker relay connections before marking signer ready
+  - Validate bunker URI (remote must differ from user pubkey)
+  - Accept remote===pubkey for Amber compatibility
+- Bookmark loading and decryption
+  - Bookmarks load and complete properly with streaming
+  - Auto-decrypt private bookmarks with NIP-04 detection
+  - Include decrypted private bookmarks in sidebar
+  - Skip background event fetching when there are too many IDs
+  - Only build bookmarks from ready events (unencrypted or decrypted)
+  - Restore Debug page decrypt display via onDecryptComplete callback
+  - Make controller onEvent non-blocking for queryEvents completion
+  - Proper timeout handling for bookmark decryption (no hanging)
+  - Smart encryption detection with consistent padlock display
+  - Sequential decryption instead of concurrent to avoid queue issues
+  - Add extraRelays to EventLoader and AddressLoader
+- TypeScript and linting errors throughout
+  - Replace empty catch blocks with warnings
+  - Fix explicit any types
+  - Add missing useEffect dependencies
+  - Resolve all linting issues in App.tsx, Debug.tsx, and async utilities
+
+### Performance
+
+- Non-blocking NIP-46 operations
+  - Fire-and-forget NIP-46 publish for better UI responsiveness
+  - Non-blocking bookmark decryption with sequential processing
+  - Make controller onEvent non-blocking for queryEvents completion
+- Optimized bookmark loading
+  - Batched background hydration using EventLoader and AddressLoader
+  - Progressive, non-blocking bookmark loading with streaming
+  - Shorter timeouts for debug page bookmark loading
+  - Remove artificial delays from bookmark decryption
+
+### Refactored
+
+- Centralized bookmark controller architecture
+  - Extract bookmark streaming helpers and centralize loading
+  - Consolidated bookmark loading into single function
+  - Remove deprecated bookmark service files
+  - Share bookmark controller between components
+- Debug page organization
+  - Extract VersionFooter component to eliminate duplication
+  - Structured sections with proper layout and styling
+  - Apply settings page styling structure
+- Simplified bunker implementation following applesauce patterns
+  - Clean up bunker implementation for better maintainability
+  - Import RELAYS from central config (DRY principle)
+  - Update RELAYS list with relay.nsec.app
+
+### Documentation
+
+- Comprehensive Amber.md documentation
+  - Amethyst-style bookmarks section
+  - Bunker decrypt investigation summary
+  - Critical queue disabling requirement
+  - NIP-46 setup and troubleshooting
+
+## [0.9.1] - 2025-10-20
+
+### Added
+
+- Video embedding for nostr-native content
+  - Detect and embed `<video>...</video>` blocks (including nested `<source>`)
+  - Detect and embed `<img src="…(mp4|webm|ogg|mov|avi|mkv|m4v)">` tags
+  - Detect and embed bare video file URLs and platform-classified video links
+- Media display settings
+  - New "Render video links as embeds" setting (defaults to enabled)
+  - New "Full-width images" display option
+  - Dedicated "Media Display" settings section
+- Article view improvements
+  - Center images by default in reader
+  - Writings list sorted by publication date (newest first)
+
+### Changed
+
+- Enable media display options by default for a better out‑of‑the‑box experience
+- Constrain video player to reader width to prevent horizontal overflow
+
+### Fixed
+
+- Prevent double video player rendering when both processor and panel attempted to embed
+- Remove text artifacts and broken tags when converting markdown image/video URLs
+  - Improved URL regex and robust tag replacement
+  - Avoid injecting unknown img props from markdown renderer
+- Resolved remaining ESLint and TypeScript issues
+
+### Performance
+
+- Optimized Support page loading with instant display and skeletons
+
+## [0.9.0] - 2025-01-20
+
+### Added
+
+- User relay list integration (NIP-65) and blocked relays (NIP-51)
+  - Automatically loads user's relay list from kind 10002 events
+  - Supports blocked relay filtering from kind 10006 mute lists
+  - Integrates with existing relay pool for seamless user experience
+- Relay list debug section in Debug component
+  - Enhanced debugging capabilities for relay list loading
+  - Detailed logging for relay query diagnostics
+
+### Changed
+
+- Improved relay list loading performance
+  - Added streaming callback to relay list service for faster results
+  - User relay list now streams into pool immediately and finalizes after blocked relays
+  - Made relay list loading non-blocking in App.tsx
+- Enhanced relay URL handling
+  - Normalized relay URLs to match applesauce-relay internal format
+  - Removed relay.dergigi.com from default relays
+  - Use user's relay list exclusively when logged in
+
+### Fixed
+
+- Resolved all linting issues across the codebase
+- Fixed TypeScript type issues in relayListService
+  - Replaced any types with proper NostrEvent types
+  - Improved type safety and code quality
+- Cleaned up temporary test relays from hardcoded list
+- Removed non-relay console.log statements and debug output
+
+### Technical
+
+- Enhanced relay initialization logging for better diagnostics
+- Improved error handling and timeout management for relay queries
+- Better separation of concerns between relay loading and application startup
+
+## [0.8.6] - 2025-10-20
+
+### Fixed
+
+- React Hooks violations in NostrMentionLink component
+  - Fixed useEffect dependency warnings by removing isMounted from dependencies
+  - Reverted to inline mount tracking with useRef for safer lifecycle handling
+
 ## [0.8.4] - 2024-10-20
 
 ### Added
@@ -108,7 +660,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Changed
 
-- `/me/bookmarks` tab now displays in cards view only
+- `/my/bookmarks` tab now displays in cards view only
   - Removed view mode toggle buttons (compact, large) from bookmarks tab
   - Cards view provides optimal bookmark browsing experience
   - Grouping toggle (grouped/flat) still available
@@ -221,7 +773,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Fixed
 
-- Prevent "No highlights yet" flash on `/me/highlights` page
+- Prevent "No highlights yet" flash on `/my/highlights` page
 - Force React to remount tab content when switching tabs for proper state management
 - Deduplicate blog posts by author:d-tag instead of event ID for better accuracy
 - Show skeleton placeholders while highlights are loading for better UX
@@ -429,7 +981,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
   - Filter icons colored when active (blue for most, green for completed)
   - URL routing support for reading progress filters
   - Reading progress filters available in Archive tab and bookmarks sidebar
-- Reads and Links tabs on `/me` page
+- Reads and Links tabs on `/my` page
   - Reads tab shows nostr-native articles with reading progress
   - Links tab shows external URLs with reading progress
   - Both tabs populate instantly from bookmarks for fast loading
@@ -475,7 +1027,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 - Bookmark filter buttons by content type (articles, videos, images, web links)
   - Filter bookmarks by their content type on bookmarks sidebar
-  - Filters also available on `/me` page bookmarks tab
+  - Filters also available on `/my` page bookmarks tab
   - Separate filter for external articles with link icon
   - Multiple filters can be active simultaneously
 - Private Bookmarks section for encrypted legacy bookmarks
@@ -489,7 +1041,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
   - Better categorization of bookmark types
 - Bookmark filter button styling refined
   - Reduced whitespace around bookmark filters for cleaner layout
-  - Dramatically reduced whitespace on both sidebar and `/me` page
+  - Dramatically reduced whitespace on both sidebar and `/my` page
 - Lock icon removed from individual bookmarks
   - Encryption status now indicated by section grouping
   - Cleaner bookmark item appearance
@@ -656,7 +1208,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
   - Camera icon for image bookmarks
   - Sticky note icon for text-only bookmarks without URLs
 - Bookmark grouping and sections
-  - Grouped sections in sidebar and `/me` reading-list
+  - Grouped sections in sidebar and `/my` reading-list
   - Web bookmarks, default bookmarks, and legacy bookmarks in separate sections
   - Grouping and sorting helpers for organizing bookmark sections
 - Adaptive text color for publication date over hero images
@@ -719,7 +1271,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 ### Fixed
 
 - Mobile bookmark button visibility across all pages
-  - Now visible on `/p/` (profile), `/explore`, `/me`, and `/support` pages
+  - Now visible on `/p/` (profile), `/explore`, `/my`, and `/support` pages
   - Only hidden on settings page or when scrolling down while reading
   - Prevents users from getting stuck without navigation options
 - Mobile highlights button behavior at page top
@@ -900,7 +1452,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 - Highlights tab on `/explore` page
   - View highlights from friends and followed users
-  - Tab structure matching `/me` and profile pages
+  - Tab structure matching `/my` and profile pages
   - Grid layout for highlights with cards
   - Highlights shown first, writings second
   - Clicking highlight opens source article and scrolls to position
@@ -1057,7 +1609,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Added
 
-- Writings tab on `/me` page to display user's published articles
+- Writings tab on `/my` page to display user's published articles
 - Comprehensive headline styling (h1-h6) with Tailwind typography
 - List styling for ordered and unordered lists in articles
 - Blockquote styling with indentation and italics
@@ -1080,7 +1632,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Horizontal overflow from code blocks and wide content on mobile
 - Settings view now mobile-friendly with proper width constraints
 - Long relay URLs no longer cause horizontal overflow on mobile
-- Sidebar/highlights toggle buttons hidden on settings/explore/me pages
+- Sidebar/highlights toggle buttons hidden on settings/explore/my pages
 - Video titles now show filename instead of 'Error Loading Content'
 - AddBookmarkModal z-index issue fixed using React Portal
 - Highlight matching for text spanning multiple DOM nodes/inline elements
@@ -1135,7 +1687,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - YouTube video metadata extraction with title, description, and captions
 - Responsive video player with aspect ratio support
 - Thumbnail images in compact view
-- URL routing for /me page tabs
+- URL routing for /my page tabs
 - Bookmark navigation in reading list
 - Video duration display for video URLs
 - Three-dot menu for videos with open/native/copy/share actions
@@ -1165,7 +1717,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Style
 
-- Hide tab counts on mobile for /me page
+- Hide tab counts on mobile for /my page
 - Remove max-width on main pane, constrain reader instead
 - Full width layout for videos
 - Reader-video specific styles
@@ -1178,11 +1730,11 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Prism.js syntax highlighting for code blocks
 - Inline image rendering in nostr-native blog posts
 - Image placeholders on blog post cards in `/explore`
-- Caching on `/me` page for faster loading
+- Caching on `/my` page for faster loading
 
 ### Changed
 
-- Reading List on `/me` now uses the same components as the bookmarks sidebar
+- Reading List on `/my` now uses the same components as the bookmarks sidebar
 - Improve bookmarks sidebar visual design
 - Make article menu button more subtle by removing border
 
@@ -1202,8 +1754,8 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Added
 
-- `/me` page with tabbed layout featuring Highlights, Reading List, and Library tabs
-- Two-pane layout for `/me` page with article sources and highlights
+- `/my` page with tabbed layout featuring Highlights, Reading List, and Library tabs
+- Two-pane layout for `/my` page with article sources and highlights
 - Custom FontAwesome Pro books icon for Archive tab
 - CompactButton component for highlight cards
 - Instant mark-as-read functionality with checkmark animation and read status checking
@@ -1212,7 +1764,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 - Rename Library tab to Archive
 - Move highlight timestamp to top-right corner of cards
-- Replace username with AuthorCard component on `/me` page
+- Replace username with AuthorCard component on `/my` page
 - Use user's custom highlight color for Highlights tab
 - Render library articles using BlogPostCard component for consistency
 - Use faBooks icon for Mark as Read button
@@ -1232,12 +1784,12 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ### Style
 
-- Match `/me` profile card width to highlight cards
-- Improve Me page mobile tabs and avoid overlap with sidebar buttons
+- Match `/my` profile card width to highlight cards
+- Improve My page mobile tabs and avoid overlap with sidebar buttons
 - Reduce margins/paddings to make highlight cards more compact
 - Tighten vertical spacing on highlight cards
 - Left-align text inside author card
-- Constrain `/me` page content width to match author card (600px)
+- Constrain `/my` page content width to match author card (600px)
 - Improve tab border styling for dark theme
 - Make relay indicator match CompactButton (same look as menu)
 - Align relay indicator within footer with symmetric spacing
@@ -1342,7 +1894,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Highlights: merge remote results after local for article/url
 - Explore: always query remote relays after local; stream merge into UI
 - Improve mobile touch targets for highlight icons
-- Color `/me` highlights with "my highlights" color setting
+- Color `/my` highlights with "my highlights" color setting
 
 ### Performance
 
@@ -1374,7 +1926,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
   - Confirmation dialog prevents accidental deletions
   - Styled to match relay indicator (subtle, same size)
   - Removes highlights from UI immediately after deletion request
-- `/me` page showing user's recent highlights
+- `/my` page showing user's recent highlights
   - Accessible by clicking profile picture in bookmark sidebar
   - Displays all highlights created by the logged-in user
   - Uses same rendering as Settings and Explore pages
@@ -2103,7 +2655,21 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Optimize relay usage following applesauce-relay best practices
 - Use applesauce-react event models for better profile handling
 
-[Unreleased]: https://github.com/dergigi/boris/compare/v0.8.3...HEAD
+[Unreleased]: https://github.com/dergigi/boris/compare/v0.10.12...HEAD
+[0.10.12]: https://github.com/dergigi/boris/compare/v0.10.11...v0.10.12
+[0.10.11]: https://github.com/dergigi/boris/compare/v0.10.10...v0.10.11
+[0.10.10]: https://github.com/dergigi/boris/compare/v0.10.9...v0.10.10
+[0.10.9]: https://github.com/dergigi/boris/compare/v0.10.8...v0.10.9
+[0.10.8]: https://github.com/dergigi/boris/compare/v0.10.7...v0.10.8
+[0.10.7]: https://github.com/dergigi/boris/compare/v0.10.6...v0.10.7
+[0.10.6]: https://github.com/dergigi/boris/compare/v0.10.5...v0.10.6
+[0.10.5]: https://github.com/dergigi/boris/compare/v0.10.4...v0.10.5
+[0.10.4]: https://github.com/dergigi/boris/compare/v0.10.3...v0.10.4
+[0.10.3]: https://github.com/dergigi/boris/compare/v0.10.2...v0.10.3
+[0.10.2]: https://github.com/dergigi/boris/compare/v0.10.1...v0.10.2
+[0.10.1]: https://github.com/dergigi/boris/compare/v0.10.0...v0.10.1
+[0.10.0]: https://github.com/dergigi/boris/compare/v0.9.1...v0.10.0
+[0.9.1]: https://github.com/dergigi/boris/compare/v0.9.0...v0.9.1
 [0.8.3]: https://github.com/dergigi/boris/compare/v0.8.2...v0.8.3
 [0.8.2]: https://github.com/dergigi/boris/compare/v0.8.0...v0.8.2
 [0.8.0]: https://github.com/dergigi/boris/compare/v0.7.4...v0.8.0

FEATURES.md

@@ -11,6 +11,7 @@
 - **Distraction‑free view**: Clean typography, optional hero image, summary, and published date.
 - **Reading time**: Displays estimated reading time for text or duration for supported videos.
 - **Progress**: Reading progress indicator with completion state.
+- **Text‑to‑Speech**: Listen to articles with browser‑native TTS; play/pause/stop controls with adjustable speed (0.8–1.6x).
 - **Menus**: Quick actions to open, share, or copy links (for both Nostr and web content).
 - **Performance**: Lightweight fetching and caching for speed; skeleton loaders to avoid empty flashes.
 
@@ -39,7 +40,7 @@
 
 - **Explore**: Discover friends' highlights and writings, plus a "nostrverse" feed.
 - **Filters**: Visibility toggles (mine, friends, nostrverse) apply to Explore highlights.
-- **Profiles**: View your own (`/me`) or other users (`/p/:npub`) with tabs for Highlights, Bookmarks, Archive, and Writings.
+- **Profiles**: View your own (`/my`) or other users (`/p/:npub`) with tabs for Highlights, Bookmarks, Archive, and Writings.
 
 ## Support
 

package-lock.json

@@ -1,12 +1,12 @@
 {
   "name": "boris",
-  "version": "0.8.4",
+  "version": "0.10.9",
   "lockfileVersion": 3,
   "requires": true,
   "packages": {
     "": {
       "name": "boris",
-      "version": "0.8.4",
+      "version": "0.10.9",
       "dependencies": {
         "@fortawesome/fontawesome-svg-core": "^7.1.0",
         "@fortawesome/free-regular-svg-icons": "^7.1.0",
@@ -35,6 +35,7 @@
         "rehype-prism-plus": "^2.0.1",
         "rehype-raw": "^7.0.0",
         "remark-gfm": "^4.0.1",
+        "tinyld": "^1.3.4",
         "use-pull-to-refresh": "^2.4.1"
       },
       "devDependencies": {
@@ -11215,6 +11216,22 @@
         "url": "https://github.com/sponsors/jonschlinkert"
       }
     },
+    "node_modules/tinyld": {
+      "version": "1.3.4",
+      "resolved": "https://registry.npmjs.org/tinyld/-/tinyld-1.3.4.tgz",
+      "integrity": "sha512-u26CNoaInA4XpDU+8s/6Cq8xHc2T5M4fXB3ICfXPokUQoLzmPgSZU02TAkFwFMJCWTjk53gtkS8pETTreZwCqw==",
+      "license": "MIT",
+      "bin": {
+        "tinyld": "bin/tinyld.js",
+        "tinyld-heavy": "bin/tinyld-heavy.js",
+        "tinyld-light": "bin/tinyld-light.js"
+      },
+      "engines": {
+        "node": ">= 12.10.0",
+        "npm": ">= 6.12.0",
+        "yarn": ">= 1.20.0"
+      }
+    },
     "node_modules/to-regex-range": {
       "version": "5.0.1",
       "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",

package.json

@@ -1,6 +1,6 @@
 {
   "name": "boris",
-  "version": "0.8.6",
+  "version": "0.10.18",
   "description": "A minimal nostr client for bookmark management",
   "homepage": "https://read.withboris.com/",
   "type": "module",
@@ -38,6 +38,7 @@
     "rehype-prism-plus": "^2.0.1",
     "rehype-raw": "^7.0.0",
     "remark-gfm": "^4.0.1",
+    "tinyld": "^1.3.4",
     "use-pull-to-refresh": "^2.4.1"
   },
   "devDependencies": {

public/manifest.webmanifest

@@ -9,6 +9,16 @@
   "background_color": "#0b1220",
   "orientation": "any",
   "categories": ["productivity", "social", "utilities"],
+  "share_target": {
+    "action": "/share-target",
+    "method": "POST",
+    "enctype": "multipart/form-data",
+    "params": {
+      "title": "title",
+      "text": "text",
+      "url": "link"
+    }
+  },
   "icons": [
     {
       "src": "/icon-192.png",

src/App.tsx

@@ -8,17 +8,20 @@ import { AccountManager, Accounts } from 'applesauce-accounts'
 import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
 import { RelayPool } from 'applesauce-relay'
 import { NostrConnectSigner } from 'applesauce-signers'
+import type { NostrEvent } from 'nostr-tools'
 import { getDefaultBunkerPermissions } from './services/nostrConnect'
 import { createAddressLoader } from 'applesauce-loaders/loaders'
 import Debug from './components/Debug'
 import Bookmarks from './components/Bookmarks'
 import RouteDebug from './components/RouteDebug'
 import Toast from './components/Toast'
+import ShareTargetHandler from './components/ShareTargetHandler'
 import { useToast } from './hooks/useToast'
 import { useOnlineStatus } from './hooks/useOnlineStatus'
 import { RELAYS } from './config/relays'
 import { SkeletonThemeProvider } from './components/Skeletons'
-import { DebugBus } from './utils/debugBus'
+import { loadUserRelayList, loadBlockedRelays, computeRelaySet } from './services/relayListService'
+import { applyRelaySetToPool, getActiveRelayUrls, ALWAYS_LOCAL_RELAYS, HARDCODED_RELAYS } from './services/relayManager'
 import { Bookmark } from './types/bookmarks'
 import { bookmarkController } from './services/bookmarkController'
 import { contactsController } from './services/contactsController'
@@ -92,7 +95,7 @@ function AppRoutes({
       
       // Load bookmarks
       if (bookmarks.length === 0 && !bookmarksLoading) {
-        bookmarkController.start({ relayPool, activeAccount, accountManager })
+        bookmarkController.start({ relayPool, activeAccount, accountManager, eventStore: eventStore || undefined })
       }
       
       // Load contacts
@@ -157,6 +160,10 @@ function AppRoutes({
 
   return (
     <Routes>
+      <Route 
+        path="/share-target" 
+        element={<ShareTargetHandler relayPool={relayPool} />} 
+      />
       <Route 
         path="/a/:naddr" 
         element={
@@ -230,11 +237,11 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me" 
-        element={<Navigate to="/me/highlights" replace />} 
+        path="/my" 
+        element={<Navigate to="/my/highlights" replace />} 
       />
       <Route 
-        path="/me/highlights" 
+        path="/my/highlights" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -246,7 +253,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/reading-list" 
+        path="/my/bookmarks" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -258,7 +265,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/reads" 
+        path="/my/reads" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -270,7 +277,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/reads/:filter" 
+        path="/my/reads/:filter" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -282,7 +289,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/links" 
+        path="/my/links" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -294,7 +301,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/links/:filter" 
+        path="/my/links/:filter" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -306,7 +313,7 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/writings" 
+        path="/my/writings" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -341,6 +348,18 @@ function AppRoutes({
           />
         } 
       />
+      <Route 
+        path="/e/:eventId" 
+        element={
+          <Bookmarks 
+            relayPool={relayPool}
+            onLogout={handleLogout}
+            bookmarks={bookmarks}
+            bookmarksLoading={bookmarksLoading}
+            onRefreshBookmarks={handleRefreshBookmarks}
+          />
+        } 
+      />
       <Route 
         path="/debug" 
         element={
@@ -385,16 +404,9 @@ function App() {
       // Wire the signer to use this pool; make publish non-blocking so callers don't
       // wait for every relay send to finish. Responses still resolve the pending request.
       NostrConnectSigner.subscriptionMethod = pool.subscription.bind(pool)
-      NostrConnectSigner.publishMethod = (relays: string[], event: unknown) => {
-        // eslint-disable-next-line @typescript-eslint/no-explicit-any
-        const result: any = pool.publish(relays, event as any)
-        // eslint-disable-next-line @typescript-eslint/no-explicit-any
-        if (result && typeof (result as any).subscribe === 'function') {
-          // Subscribe to the observable but ignore completion/errors (fire-and-forget)
-          // eslint-disable-next-line @typescript-eslint/no-explicit-any
-          try { (result as any).subscribe({ complete: () => { /* noop */ }, error: () => { /* noop */ } }) } catch { /* ignore */ }
-        }
-        // Return an already-resolved promise so upstream await finishes immediately
+      NostrConnectSigner.publishMethod = (relays: string[], event: NostrEvent) => {
+        // Fire-and-forget publish; do not block callers
+        pool.publish(relays, event).catch(() => { /* ignore errors */ })
         return Promise.resolve()
       }
       
@@ -417,14 +429,10 @@ function App() {
           
           if (account) {
             accounts.setActive(activeId)
-          } else {
-            console.warn('[bunker] ⚠️  Active ID found but account not in list')
           }
-        } else {
-          // No active account ID in localStorage
         }
       } catch (err) {
-        console.error('[bunker] ❌ Failed to load accounts from storage:', err)
+        console.error('Failed to load accounts from storage:', err)
       }
       
       // Subscribe to accounts changes and persist to localStorage
@@ -493,61 +501,27 @@ function App() {
                   try {
                     const mergedRelays = Array.from(new Set([...(signerData.relays || []), ...RELAYS]))
                     recreatedSigner.relays = mergedRelays
-                  } catch (err) { console.warn('[bunker] failed to merge signer relays', err) }
+                  } catch (err) { /* ignore */ }
                   
                   // Replace the signer on the account
                   nostrConnectAccount.signer = recreatedSigner
                   
-                  // Debug: log publish/subscription calls made by signer (decrypt/sign requests)
+                  // Fire-and-forget publish for bunker: trigger but don't wait for completion
                   // IMPORTANT: bind originals to preserve `this` context used internally by the signer
                   const originalPublish = (recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod.bind(recreatedSigner)
                   ;(recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod = (relays: string[], event: unknown) => {
-                    try {
-                      let method: string | undefined
-                      const content = (event as { content?: unknown })?.content
-                      if (typeof content === 'string') {
-                        try {
-                          const parsed = JSON.parse(content) as { method?: string; id?: unknown }
-                          method = parsed?.method
-                        } catch (err) { console.warn('[bunker] failed to parse event content', err) }
-                      }
-                      const summary = {
-                        relays,
-                        kind: (event as { kind?: number })?.kind,
-                        method,
-                        // include tags array for debugging (NIP-46 expects method tag)
-                        tags: (event as { tags?: unknown })?.tags,
-                        contentLength: typeof content === 'string' ? content.length : undefined
-                      }
-                      try { DebugBus.info('bunker', 'publish', summary) } catch (err) { console.warn('[bunker] failed to log to DebugBus', err) }
-                    } catch (err) { console.warn('[bunker] failed to log publish summary', err) }
-                    // Fire-and-forget publish: trigger the publish but do not return the
-                    // Observable/Promise to upstream to avoid their awaiting of completion.
                     const result = originalPublish(relays, event)
                     if (result && typeof (result as { subscribe?: unknown }).subscribe === 'function') {
-                      // Subscribe to the observable but ignore completion/errors (fire-and-forget)
                       try { (result as { subscribe: (h: { complete?: () => void; error?: (e: unknown) => void }) => unknown }).subscribe({ complete: () => { /* noop */ }, error: () => { /* noop */ } }) } catch { /* ignore */ }
                     }
-                    // If it's a Promise, simply ignore it (no await) so it resolves in the background.
-                    // Return a benign object so callers that probe for a "subscribe" property
-                    // (e.g., applesauce makeRequest) won't throw on `"subscribe" in result`.
                     return {} as unknown as never
                   }
-                  const originalSubscribe = (recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod.bind(recreatedSigner)
-                  ;(recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod = (relays: string[], filters: unknown[]) => {
-                    try {
-                      try { DebugBus.info('bunker', 'subscribe', { relays, filters }) } catch (err) { console.warn('[bunker] failed to log subscribe to DebugBus', err) }
-                    } catch (err) { console.warn('[bunker] failed to log subscribe summary', err) }
-                    return originalSubscribe(relays, filters)
-                  }
 
                   
                   // Just ensure the signer is listening for responses - don't call connect() again
                   // The fromBunkerURI already connected with permissions during login
                   if (!nostrConnectAccount.signer.listening) {
                     await nostrConnectAccount.signer.open()
-                  } else {
-                    // Signer already listening
                   }
                   
                   // Attempt a guarded reconnect to ensure Amber authorizes decrypt operations
@@ -557,7 +531,7 @@ function App() {
                       await nostrConnectAccount.signer.connect(undefined, permissions)
                     }
                   } catch (e) {
-                    console.warn('[bunker] ⚠️ Guarded connect() failed:', e)
+                    // Ignore reconnect errors
                   }
                   
                   // Give the subscription a moment to fully establish before allowing decrypt operations
@@ -597,17 +571,130 @@ function App() {
                   // Mark this account as reconnected
                   reconnectedAccounts.add(account.id)
                 } catch (error) {
-                  console.error('[bunker] ❌ Failed to open signer:', error)
+                  console.error('Failed to open signer:', error)
                 }
               }
             })
       
+      // Handle user relay list and blocked relays when account changes
+      const userRelaysSub = accounts.active$.subscribe((account) => {
+        if (account) {
+          // User logged in - start with hardcoded relays immediately, then stream user relay list updates
+          const pubkey = account.pubkey
+
+          // Bunker relays (if any)
+          let bunkerRelays: string[] = []
+          if (account.type === 'nostr-connect') {
+            const nostrConnectAccount = account as Accounts.NostrConnectAccount<unknown>
+            const signerData = nostrConnectAccount.toJSON().signer
+            bunkerRelays = signerData.relays || []
+          }
+          
+
+          // Start with hardcoded + bunker relays immediately (non-blocking)
+          const initialRelays = computeRelaySet({
+            hardcoded: RELAYS,
+            bunker: bunkerRelays,
+            userList: [],
+            blocked: [],
+            alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+          })
+          
+
+          // Apply initial set immediately
+          applyRelaySetToPool(pool, initialRelays)
+
+          // Prepare keep-alive helper
+          const updateKeepAlive = () => {
+            const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
+            if (poolWithSub._keepAliveSubscription) {
+              poolWithSub._keepAliveSubscription.unsubscribe()
+            }
+            const activeRelays = getActiveRelayUrls(pool)
+            const newKeepAliveSub = pool.subscription(activeRelays, { kinds: [0], limit: 0 }).subscribe({
+              next: () => {},
+              error: () => {}
+            })
+            poolWithSub._keepAliveSubscription = newKeepAliveSub
+          }
+
+          // Begin loading blocked relays in background
+          const blockedPromise = loadBlockedRelays(pool, pubkey)
+
+          // Stream user relay list; apply immediately on first/updated event
+          loadUserRelayList(pool, pubkey, {
+            onUpdate: (userRelays) => {
+              const interimRelays = computeRelaySet({
+                hardcoded: HARDCODED_RELAYS,
+                bunker: bunkerRelays,
+                userList: userRelays,
+                blocked: [],
+                alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+              })
+              
+              applyRelaySetToPool(pool, interimRelays)
+              updateKeepAlive()
+            }
+          }).then(async (userRelayList) => {
+            const blockedRelays = await blockedPromise.catch(() => [])
+
+            const finalRelays = computeRelaySet({
+              hardcoded: userRelayList.length > 0 ? HARDCODED_RELAYS : RELAYS,
+              bunker: bunkerRelays,
+              userList: userRelayList,
+              blocked: blockedRelays,
+              alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+            })
+            
+            applyRelaySetToPool(pool, finalRelays)
+            
+            updateKeepAlive()
+            
+            // Update address loader with new relays
+            const activeRelays = getActiveRelayUrls(pool)
+            const addressLoader = createAddressLoader(pool, {
+              eventStore: store,
+              lookupRelays: activeRelays
+            })
+            store.addressableLoader = addressLoader
+            store.replaceableLoader = addressLoader
+          }).catch((error) => {
+            console.error('[relay-init] Failed to load user relay list (continuing with initial set):', error)
+            // Continue with initial relay set on error - no need to change anything
+          })
+        } else {
+          // User logged out - reset to hardcoded relays
+          
+          applyRelaySetToPool(pool, RELAYS)
+          
+          
+          // Update keep-alive subscription
+          const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
+          if (poolWithSub._keepAliveSubscription) {
+            poolWithSub._keepAliveSubscription.unsubscribe()
+          }
+          const newKeepAliveSub = pool.subscription(RELAYS, { kinds: [0], limit: 0 }).subscribe({
+            next: () => {},
+            error: () => {}
+          })
+          poolWithSub._keepAliveSubscription = newKeepAliveSub
+          
+          // Reset address loader
+          const addressLoader = createAddressLoader(pool, {
+            eventStore: store,
+            lookupRelays: RELAYS
+          })
+          store.addressableLoader = addressLoader
+          store.replaceableLoader = addressLoader
+        }
+      })
+      
       // Keep all relay connections alive indefinitely by creating a persistent subscription
       // This prevents disconnection when no other subscriptions are active
       // Create a minimal subscription that never completes to keep connections alive
       const keepAliveSub = pool.subscription(RELAYS, { kinds: [0], limit: 0 }).subscribe({
-        next: () => {}, // No-op, we don't care about events
-        error: (err) => console.warn('Keep-alive subscription error:', err)
+        next: () => {},
+        error: () => {}
       })
       
       // Store subscription for cleanup
@@ -630,6 +717,7 @@ function App() {
         accountsSub.unsubscribe()
         activeSub.unsubscribe()
         bunkerReconnectSub.unsubscribe()
+        userRelaysSub.unsubscribe()
         // Clean up keep-alive subscription if it exists
         const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
         if (poolWithSub._keepAliveSubscription) {

src/components/BlogPostCard.tsx

@@ -6,18 +6,26 @@ import { formatDistance } from 'date-fns'
 import { BlogPostPreview } from '../services/exploreService'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
+import { isKnownBot } from '../config/bots'
 
 interface BlogPostCardProps {
   post: BlogPostPreview
   href: string
   level?: 'mine' | 'friends' | 'nostrverse'
   readingProgress?: number // 0-1 reading progress (optional)
+  hideBotByName?: boolean // default true
 }
 
-const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress }) => {
+const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress, hideBotByName = true }) => {
   const profile = useEventModel(Models.ProfileModel, [post.author])
   const displayName = profile?.name || profile?.display_name || 
     `${post.author.slice(0, 8)}...${post.author.slice(-4)}`
+  const rawName = (profile?.name || profile?.display_name || '').toLowerCase()
+
+  // Hide bot authors by name/display_name
+  if (hideBotByName && (rawName.includes('bot') || isKnownBot(post.author))) {
+    return null
+  }
   
   const publishedDate = post.published || post.event.created_at
   const formattedDate = formatDistance(new Date(publishedDate * 1000), new Date(), { 
@@ -42,6 +50,14 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingP
   return (
     <Link 
       to={href}
+      state={{ 
+        previewData: {
+          title: post.title,
+          image: post.image,
+          summary: post.summary,
+          published: post.published
+        }
+      }}
       className={`blog-post-card ${level ? `level-${level}` : ''}`}
       style={{ textDecoration: 'none', color: 'inherit' }}
     >

src/components/BookmarkItem.tsx

@@ -4,7 +4,7 @@ import { faGlobe, faLink } from '@fortawesome/free-solid-svg-icons'
 import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
-import { npubEncode, neventEncode } from 'nostr-tools/nip19'
+import { npubEncode } from 'nostr-tools/nip19'
 import { IndividualBookmark } from '../types/bookmarks'
 import { extractUrlsFromContent } from '../services/bookmarkHelpers'
 import { classifyUrl } from '../utils/helpers'
@@ -58,8 +58,6 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
   // Resolve author profile using applesauce
   const authorProfile = useEventModel(Models.ProfileModel, [bookmark.pubkey])
   const authorNpub = npubEncode(bookmark.pubkey)
-  const isHexId = /^[0-9a-f]{64}$/i.test(bookmark.id)
-  const eventNevent = isHexId ? neventEncode({ id: bookmark.id }) : undefined
   
   // Get display name for author
   const getAuthorDisplayName = () => {
@@ -135,7 +133,6 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
     extractedUrls,
     onSelectUrl,
     authorNpub,
-    eventNevent,
     getAuthorDisplayName,
     handleReadNow,
     articleImage,
@@ -145,8 +142,19 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
   }
 
   if (viewMode === 'compact') {
-    // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-    const { articleImage, ...compactProps } = sharedProps
+    const compactProps = {
+      bookmark,
+      index,
+      hasUrls,
+      extractedUrls,
+      onSelectUrl,
+      authorNpub,
+      getAuthorDisplayName,
+      handleReadNow,
+      articleSummary,
+      contentTypeIcon: getContentTypeIcon(),
+      readingProgress
+    }
     return <CompactView {...compactProps} />
   }
 

src/components/BookmarkList.tsx

@@ -1,7 +1,8 @@
-import React, { useRef, useState } from 'react'
+import React, { useRef, useState, useMemo } from 'react'
 import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate, faHeart, faPlus, faLayerGroup, faBars } from '@fortawesome/free-solid-svg-icons'
+import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate, faHeart, faPlus, faLayerGroup } from '@fortawesome/free-solid-svg-icons'
+import { faClock } from '@fortawesome/free-regular-svg-icons'
 import { formatDistanceToNow } from 'date-fns'
 import { RelayPool } from 'applesauce-relay'
 import { Bookmark, IndividualBookmark } from '../types/bookmarks'
@@ -13,12 +14,12 @@ import { ViewMode } from './Bookmarks'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
 import { BookmarkSkeleton } from './Skeletons'
-import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWithoutSet, hasCreationDate } from '../utils/bookmarkUtils'
+import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWithoutSet, hasCreationDate, sortIndividualBookmarks } from '../utils/bookmarkUtils'
 import { UserSettings } from '../services/settingsService'
 import AddBookmarkModal from './AddBookmarkModal'
 import { createWebBookmark } from '../services/webBookmarkService'
-import { RELAYS } from '../config/relays'
 import { Hooks } from 'applesauce-react'
+import { getActiveRelayUrls } from '../services/relayManager'
 import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
 import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
 import LoginOptions from './LoginOptions'
@@ -71,7 +72,7 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
   const [selectedFilter, setSelectedFilter] = useState<BookmarkFilterType>('all')
   const [groupingMode, setGroupingMode] = useState<'grouped' | 'flat'>(() => {
     const saved = localStorage.getItem('bookmarkGroupingMode')
-    return saved === 'flat' ? 'flat' : 'grouped'
+    return saved === 'grouped' ? 'grouped' : 'flat'
   })
   const activeAccount = Hooks.useActiveAccount()
   const [readingProgressMap, setReadingProgressMap] = useState<Map<string, number>>(new Map())
@@ -120,12 +121,24 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
     localStorage.setItem('bookmarkGroupingMode', newMode)
   }
 
+  const getFilterTitle = (filter: BookmarkFilterType): string => {
+    const titles: Record<BookmarkFilterType, string> = {
+      'all': 'All Bookmarks',
+      'article': 'Bookmarked Reads',
+      'external': 'Bookmarked Links',
+      'video': 'Bookmarked Videos',
+      'note': 'Bookmarked Notes',
+      'web': 'Web Bookmarks'
+    }
+    return titles[filter]
+  }
+
   const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
     if (!activeAccount || !relayPool) {
       throw new Error('Please login to create bookmarks')
     }
 
-    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
+    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, getActiveRelayUrls(relayPool))
   }
 
   // Pull-to-refresh for bookmarks
@@ -140,39 +153,58 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
     isDisabled: !onRefresh
   })
 
-  // Merge and flatten all individual bookmarks from all lists
-  const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
-    .filter(hasContent)
-    .filter(b => !settings?.hideBookmarksWithoutCreationDate || hasCreationDate(b))
+  // Merge and flatten all individual bookmarks from all lists - memoized to ensure consistent sorting
+  const sections = useMemo(() => {
+    const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
+      .filter(hasContent)
+      .filter(b => !settings?.hideBookmarksWithoutCreationDate || hasCreationDate(b))
+    
+    // Apply filter
+    const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, selectedFilter)
+    
+    // Separate bookmarks with setName (kind 30003) from regular bookmarks
+    const bookmarksWithoutSet = getBookmarksWithoutSet(filteredBookmarks)
+    const bookmarkSets = getBookmarkSets(filteredBookmarks)
+    
+    // Group non-set bookmarks by source or flatten based on mode
+    const groups = groupIndividualBookmarks(bookmarksWithoutSet)
+    const sectionsArray: Array<{ key: string; title: string; items: IndividualBookmark[] }> = 
+      groupingMode === 'flat'
+        ? [{ key: 'all', title: getFilterTitle(selectedFilter), items: sortIndividualBookmarks(filteredBookmarks) }]
+        : [
+            { key: 'nip51-private', title: 'Private Bookmarks', items: groups.nip51Private },
+            { key: 'nip51-public', title: 'My Bookmarks', items: groups.nip51Public },
+            { key: 'amethyst-private', title: 'Private Lists', items: groups.amethystPrivate },
+            { key: 'amethyst-public', title: 'My Lists', items: groups.amethystPublic },
+            { key: 'web', title: 'Web Bookmarks', items: groups.standaloneWeb }
+          ]
+    
+    // Add bookmark sets as additional sections (only in grouped mode)
+    if (groupingMode === 'grouped') {
+      bookmarkSets.forEach(set => {
+        sectionsArray.push({
+          key: `set-${set.name}`,
+          title: set.title || set.name,
+          items: set.bookmarks
+        })
+      })
+    }
+    
+    return sectionsArray
+  }, [bookmarks, selectedFilter, groupingMode, settings?.hideBookmarksWithoutCreationDate])
   
-  // Apply filter
-  const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, selectedFilter)
+  // Get all filtered bookmarks for empty state checks
+  const allIndividualBookmarks = useMemo(() => 
+    bookmarks.flatMap(b => b.individualBookmarks || [])
+      .filter(hasContent)
+      .filter(b => !settings?.hideBookmarksWithoutCreationDate || hasCreationDate(b)),
+    [bookmarks, settings?.hideBookmarksWithoutCreationDate]
+  )
   
-  // Separate bookmarks with setName (kind 30003) from regular bookmarks
-  const bookmarksWithoutSet = getBookmarksWithoutSet(filteredBookmarks)
-  const bookmarkSets = getBookmarkSets(filteredBookmarks)
-  
-  // Group non-set bookmarks by source or flatten based on mode
-  const groups = groupIndividualBookmarks(bookmarksWithoutSet)
-  const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = 
-    groupingMode === 'flat'
-      ? [{ key: 'all', title: `All Bookmarks (${bookmarksWithoutSet.length})`, items: bookmarksWithoutSet }]
-      : [
-          { key: 'nip51-private', title: 'Private Bookmarks', items: groups.nip51Private },
-          { key: 'nip51-public', title: 'My Bookmarks', items: groups.nip51Public },
-          { key: 'amethyst-private', title: 'Private Lists', items: groups.amethystPrivate },
-          { key: 'amethyst-public', title: 'My Lists', items: groups.amethystPublic },
-          { key: 'web', title: 'Web Bookmarks', items: groups.standaloneWeb }
-        ]
-  
-  // Add bookmark sets as additional sections
-  bookmarkSets.forEach(set => {
-    sections.push({
-      key: `set-${set.name}`,
-      title: set.title || set.name,
-      items: set.bookmarks
-    })
-  })
+  const filteredBookmarks = useMemo(() => 
+    filterBookmarksByType(allIndividualBookmarks, selectedFilter),
+    [allIndividualBookmarks, selectedFilter]
+  )
   
   if (isCollapsed) {
     // Check if the selected URL is in bookmarks
@@ -285,6 +317,13 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
         </div>
         {activeAccount && (
           <div className="view-mode-right">
+            <IconButton
+              icon={groupingMode === 'grouped' ? faLayerGroup : faClock}
+              onClick={toggleGroupingMode}
+              title={groupingMode === 'grouped' ? 'Show flat chronological list' : 'Show grouped by source'}
+              ariaLabel={groupingMode === 'grouped' ? 'Switch to flat view' : 'Switch to grouped view'}
+              variant="ghost"
+            />
             {onRefresh && (
               <IconButton
                 icon={faRotate}
@@ -296,13 +335,6 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
                 spin={isRefreshing}
               />
             )}
-            <IconButton
-              icon={groupingMode === 'grouped' ? faLayerGroup : faBars}
-              onClick={toggleGroupingMode}
-              title={groupingMode === 'grouped' ? 'Show flat chronological list' : 'Show grouped by source'}
-              ariaLabel={groupingMode === 'grouped' ? 'Switch to flat view' : 'Switch to grouped view'}
-              variant="ghost"
-            />
             <IconButton
               icon={faList}
               onClick={() => onViewModeChange('compact')}

src/components/BookmarkViews/CardView.tsx

@@ -9,7 +9,7 @@ import RichContent from '../RichContent'
 import { classifyUrl } from '../../utils/helpers'
 import { useImageCache } from '../../hooks/useImageCache'
 import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
-import { getEventUrl } from '../../config/nostrGateways'
+import { naddrEncode } from 'nostr-tools/nip19'
 
 interface CardViewProps {
   bookmark: IndividualBookmark
@@ -18,7 +18,6 @@ interface CardViewProps {
   extractedUrls: string[]
   onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
   authorNpub: string
-  eventNevent?: string
   getAuthorDisplayName: () => string
   handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
   articleImage?: string
@@ -34,7 +33,6 @@ export const CardView: React.FC<CardViewProps> = ({
   extractedUrls,
   onSelectUrl,
   authorNpub,
-  eventNevent,
   getAuthorDisplayName,
   handleReadNow,
   articleImage,
@@ -82,6 +80,29 @@ export const CardView: React.FC<CardViewProps> = ({
     }
   }
 
+  // Get internal route for the bookmark
+  const getInternalRoute = (): string | null => {
+    if (bookmark.kind === 30023) {
+      // Nostr-native article - use /a/ route
+      const dTag = bookmark.tags.find(t => t[0] === 'd')?.[1]
+      if (dTag) {
+        const naddr = naddrEncode({
+          kind: bookmark.kind,
+          pubkey: bookmark.pubkey,
+          identifier: dTag
+        })
+        return `/a/${naddr}`
+      }
+    } else if (bookmark.kind === 1) {
+      // Note - use /e/ route
+      return `/e/${bookmark.id}`
+    } else if (firstUrl) {
+      // External URL - use /r/ route
+      return `/r/${encodeURIComponent(firstUrl)}`
+    }
+    return null
+  }
+
   return (
     <div 
       key={`${bookmark.id}-${index}`}
@@ -103,19 +124,17 @@ export const CardView: React.FC<CardViewProps> = ({
           <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
         </span>
         
-        {eventNevent ? (
-          <a
-            href={getEventUrl(eventNevent)}
-            target="_blank"
-            rel="noopener noreferrer"
+        {getInternalRoute() ? (
+          <Link
+            to={getInternalRoute()!}
             className="bookmark-date-link"
-            title="Open event in search"
+            title="Open in app"
             onClick={(e) => e.stopPropagation()}
           >
-            {formatDate(bookmark.created_at)}
-          </a>
+            {formatDate(bookmark.created_at ?? bookmark.listUpdatedAt)}
+          </Link>
         ) : (
-          <span className="bookmark-date">{formatDate(bookmark.created_at)}</span>
+          <span className="bookmark-date">{formatDate(bookmark.created_at ?? bookmark.listUpdatedAt)}</span>
         )}
       </div>
       

src/components/BookmarkViews/CompactView.tsx

@@ -1,4 +1,5 @@
 import React from 'react'
+import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
@@ -26,11 +27,15 @@ export const CompactView: React.FC<CompactViewProps> = ({
   contentTypeIcon,
   readingProgress
 }) => {
+  const navigate = useNavigate()
   const isArticle = bookmark.kind === 30023
   const isWebBookmark = bookmark.kind === 39701
-  const isClickable = hasUrls || isArticle || isWebBookmark
+  const isNote = bookmark.kind === 1
+  const isClickable = hasUrls || isArticle || isWebBookmark || isNote
   
-  // Calculate progress color (matching BlogPostCard logic)
+  const displayText = isArticle && articleSummary ? articleSummary : bookmark.content
+
+  // Calculate progress color
   let progressColor = '#6366f1' // Default blue (reading)
   if (readingProgress && readingProgress >= 0.95) {
     progressColor = '#10b981' // Green (completed)
@@ -39,20 +44,15 @@ export const CompactView: React.FC<CompactViewProps> = ({
   }
 
   const handleCompactClick = () => {
-    if (!onSelectUrl) return
-    
     if (isArticle) {
-      onSelectUrl('', { id: bookmark.id, kind: bookmark.kind, tags: bookmark.tags, pubkey: bookmark.pubkey })
+      onSelectUrl?.('', { id: bookmark.id, kind: bookmark.kind, tags: bookmark.tags, pubkey: bookmark.pubkey })
     } else if (hasUrls) {
-      onSelectUrl(extractedUrls[0])
+      onSelectUrl?.(extractedUrls[0])
+    } else if (isNote) {
+      navigate(`/e/${bookmark.id}`)
     }
   }
 
-  // For articles, prefer summary; for others, use content
-  const displayText = isArticle && articleSummary 
-    ? articleSummary 
-    : bookmark.content
-
   return (
     <div key={`${bookmark.id}-${index}`} className={`individual-bookmark compact ${bookmark.isPrivate ? 'private-bookmark' : ''}`}>
       <div 
@@ -64,12 +64,16 @@ export const CompactView: React.FC<CompactViewProps> = ({
         <span className="bookmark-type-compact">
           <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
         </span>
-        {displayText && (
+        {displayText ? (
           <div className="compact-text">
             <RichContent content={displayText.slice(0, 60) + (displayText.length > 60 ? '…' : '')} className="" />
           </div>
+        ) : (
+          <div className="compact-text" style={{ opacity: 0.5, fontSize: '0.85em' }}>
+            <code>{bookmark.id.slice(0, 12)}...</code>
+          </div>
         )}
-        <span className="bookmark-date-compact">{formatDateCompact(bookmark.created_at)}</span>
+        <span className="bookmark-date-compact">{formatDateCompact(bookmark.created_at ?? bookmark.listUpdatedAt)}</span>
         {/* CTA removed */}
       </div>
       

src/components/BookmarkViews/LargeView.tsx

@@ -7,7 +7,7 @@ import { formatDate } from '../../utils/bookmarkUtils'
 import RichContent from '../RichContent'
 import { IconGetter } from './shared'
 import { useImageCache } from '../../hooks/useImageCache'
-import { getEventUrl } from '../../config/nostrGateways'
+import { naddrEncode } from 'nostr-tools/nip19'
 
 interface LargeViewProps {
   bookmark: IndividualBookmark
@@ -18,7 +18,6 @@ interface LargeViewProps {
   getIconForUrlType: IconGetter
   previewImage: string | null
   authorNpub: string
-  eventNevent?: string
   getAuthorDisplayName: () => string
   handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
   articleSummary?: string
@@ -35,7 +34,6 @@ export const LargeView: React.FC<LargeViewProps> = ({
   getIconForUrlType,
   previewImage,
   authorNpub,
-  eventNevent,
   getAuthorDisplayName,
   handleReadNow,
   articleSummary,
@@ -63,6 +61,30 @@ export const LargeView: React.FC<LargeViewProps> = ({
     }
   }
 
+  // Get internal route for the bookmark
+  const getInternalRoute = (): string | null => {
+    const firstUrl = hasUrls ? extractedUrls[0] : null
+    if (bookmark.kind === 30023) {
+      // Nostr-native article - use /a/ route
+      const dTag = bookmark.tags.find(t => t[0] === 'd')?.[1]
+      if (dTag) {
+        const naddr = naddrEncode({
+          kind: bookmark.kind,
+          pubkey: bookmark.pubkey,
+          identifier: dTag
+        })
+        return `/a/${naddr}`
+      }
+    } else if (bookmark.kind === 1) {
+      // Note - use /e/ route
+      return `/e/${bookmark.id}`
+    } else if (firstUrl) {
+      // External URL - use /r/ route
+      return `/r/${encodeURIComponent(firstUrl)}`
+    }
+    return null
+  }
+
   return (
     <div 
       key={`${bookmark.id}-${index}`} 
@@ -136,16 +158,17 @@ export const LargeView: React.FC<LargeViewProps> = ({
             </Link>
           </span>
           
-          {eventNevent && (
-            <a
-              href={getEventUrl(eventNevent)}
-              target="_blank"
-              rel="noopener noreferrer"
+          {getInternalRoute() ? (
+            <Link
+              to={getInternalRoute()!}
               className="bookmark-date-link"
+              title="Open in app"
               onClick={(e) => e.stopPropagation()}
             >
-              {formatDate(bookmark.created_at)}
-            </a>
+              {formatDate(bookmark.created_at ?? bookmark.listUpdatedAt)}
+            </Link>
+          ) : (
+            <span className="bookmark-date">{formatDate(bookmark.created_at ?? bookmark.listUpdatedAt)}</span>
           )}
           
           {/* CTA removed */}

src/components/Bookmarks.tsx

@@ -13,6 +13,7 @@ import { useHighlightCreation } from '../hooks/useHighlightCreation'
 import { useBookmarksUI } from '../hooks/useBookmarksUI'
 import { useRelayStatus } from '../hooks/useRelayStatus'
 import { useOfflineSync } from '../hooks/useOfflineSync'
+import { useEventLoader } from '../hooks/useEventLoader'
 import { Bookmark } from '../types/bookmarks'
 import ThreePaneLayout from './ThreePaneLayout'
 import Explore from './Explore'
@@ -38,7 +39,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
   bookmarksLoading, 
   onRefreshBookmarks
 }) => {
-  const { naddr, npub } = useParams<{ naddr?: string; npub?: string }>()
+  const { naddr, npub, eventId: eventIdParam } = useParams<{ naddr?: string; npub?: string; eventId?: string }>()
   const location = useLocation()
   const navigate = useNavigate()
   const previousLocationRef = useRef<string>()
@@ -52,20 +53,21 @@ const Bookmarks: React.FC<BookmarksProps> = ({
   
   const showSettings = location.pathname === '/settings'
   const showExplore = location.pathname.startsWith('/explore')
-  const showMe = location.pathname.startsWith('/me')
+  const showMe = location.pathname.startsWith('/my')
   const showProfile = location.pathname.startsWith('/p/')
   const showSupport = location.pathname === '/support'
+  const eventId = eventIdParam
   
   // Extract tab from explore routes
   const exploreTab = location.pathname === '/explore/writings' ? 'writings' : 'highlights'
   
   // Extract tab from me routes
-  const meTab = location.pathname === '/me' ? 'highlights' : 
-                location.pathname === '/me/highlights' ? 'highlights' :
-                location.pathname === '/me/reading-list' ? 'reading-list' :
-                location.pathname.startsWith('/me/reads') ? 'reads' :
-                location.pathname.startsWith('/me/links') ? 'links' :
-                location.pathname === '/me/writings' ? 'writings' : 'highlights'
+  const meTab = location.pathname === '/my' ? 'highlights' : 
+                location.pathname === '/my/highlights' ? 'highlights' :
+                location.pathname === '/my/bookmarks' ? 'bookmarks' :
+                location.pathname.startsWith('/my/reads') ? 'reads' :
+                location.pathname.startsWith('/my/links') ? 'links' :
+                location.pathname === '/my/writings' ? 'writings' : 'highlights'
   
   // Extract tab from profile routes
   const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
@@ -85,7 +87,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
     }
   }
   
-  // Track previous location for going back from settings/me/explore/profile
+  // Track previous location for going back from settings/my/explore/profile
   useEffect(() => {
     if (!showSettings && !showMe && !showExplore && !showProfile) {
       previousLocationRef.current = location.pathname
@@ -228,6 +230,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
   useArticleLoader({
     naddr,
     relayPool,
+    eventStore,
     setSelectedUrl,
     setReaderContent,
     setReaderLoading,
@@ -255,6 +258,17 @@ const Bookmarks: React.FC<BookmarksProps> = ({
     setCurrentArticleEventId
   })
 
+  // Load event if /e/:eventId route is used
+  useEventLoader({
+    eventId,
+    relayPool,
+    eventStore,
+    setSelectedUrl,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed
+  })
+
   // Classify highlights with levels based on user context
   const classifiedHighlights = useMemo(() => {
     return classifyHighlights(highlights, activeAccount?.pubkey, followedPubkeys)

src/components/ContentPanel.tsx

@@ -4,14 +4,15 @@ import ReactMarkdown from 'react-markdown'
 import remarkGfm from 'remark-gfm'
 import rehypeRaw from 'rehype-raw'
 import rehypePrism from 'rehype-prism-plus'
+import VideoEmbedProcessor from './VideoEmbedProcessor'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import 'prismjs/themes/prism-tomorrow.css'
 import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare, faSearch } from '@fortawesome/free-solid-svg-icons'
 import { ContentSkeleton } from './Skeletons'
 import { nip19 } from 'nostr-tools'
 import { getNostrUrl, getSearchUrl } from '../config/nostrGateways'
-import { RELAYS } from '../config/relays'
 import { RelayPool } from 'applesauce-relay'
+import { getActiveRelayUrls } from '../services/relayManager'
 import { IAccount } from 'applesauce-accounts'
 import { NostrEvent } from 'nostr-tools'
 import { Highlight } from '../types/highlights'
@@ -42,9 +43,10 @@ import { EventFactory } from 'applesauce-factory'
 import { Hooks } from 'applesauce-react'
 import { 
   generateArticleIdentifier, 
-  loadReadingPosition, 
-  saveReadingPosition 
+  saveReadingPosition
 } from '../services/readingPositionService'
+import { readingProgressController } from '../services/readingProgressController'
+import TTSControls from './TTSControls'
 
 interface ContentPanelProps {
   loading: boolean
@@ -74,6 +76,7 @@ interface ContentPanelProps {
   // For reading progress indicator positioning
   isSidebarCollapsed?: boolean
   isHighlightsCollapsed?: boolean
+  onOpenHighlights?: () => void
 }
 
 const ContentPanel: React.FC<ContentPanelProps> = ({ 
@@ -101,7 +104,8 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   onTextSelection,
   onClearSelection,
   isSidebarCollapsed = false,
-  isHighlightsCollapsed = false
+  isHighlightsCollapsed = false,
+  onOpenHighlights
 }) => {
   const [isMarkedAsRead, setIsMarkedAsRead] = useState(false)
   const [isCheckingReadStatus, setIsCheckingReadStatus] = useState(false)
@@ -130,6 +134,11 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     currentUserPubkey,
     followedPubkeys
   })
+  // Key used to force re-mount of markdown preview/render when content changes
+  const contentKey = useMemo(() => {
+    // Prefer selectedUrl as a stable per-article key; fallback to title+length
+    return selectedUrl || `${title || ''}:${(markdown || html || '').length}`
+  }, [selectedUrl, title, markdown, html])
 
   const { contentRef, handleSelectionEnd } = useHighlightInteractions({
     onHighlightClick,
@@ -141,8 +150,16 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   // Get event store for reading position service
   const eventStore = Hooks.useEventStore()
   
-  // Reading position tracking - only for text content, not videos
-  const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
+  // Reading position tracking - only for text content that's loaded and long enough
+  // Wait for content to load, check it's not a video, and verify it's long enough to track
+  const isTextContent = useMemo(() => {
+    if (loading) return false
+    if (!markdown && !html) return false
+    if (selectedUrl?.includes('youtube') || selectedUrl?.includes('vimeo')) return false
+    if (!shouldTrackReadingProgress(html, markdown)) return false
+    
+    return true
+  }, [loading, markdown, html, selectedUrl])
   
   // Generate article identifier for saving/loading position
   const articleIdentifier = useMemo(() => {
@@ -150,6 +167,14 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     return generateArticleIdentifier(selectedUrl)
   }, [selectedUrl])
 
+  // Use refs for content to avoid recreating callback on every content change
+  const htmlRef = useRef(html)
+  const markdownRef = useRef(markdown)
+  useEffect(() => {
+    htmlRef.current = html
+    markdownRef.current = markdown
+  }, [html, markdown])
+
   // Callback to save reading position
   const handleSavePosition = useCallback(async (position: number) => {
     if (!activeAccount || !relayPool || !eventStore || !articleIdentifier) {
@@ -160,7 +185,7 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     }
     
     // Check if content is long enough to track reading progress
-    if (!shouldTrackReadingProgress(html, markdown)) {
+    if (!shouldTrackReadingProgress(htmlRef.current, markdownRef.current)) {
       return
     }
 
@@ -180,12 +205,39 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
         }
       )
     } catch (error) {
-      console.error('[progress] ❌ ContentPanel: Failed to save reading position:', error)
+      console.error('[reading-position] Failed to save reading position:', error)
     }
-  }, [activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, html, markdown])
+  }, [activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition])
 
-  const { progressPercentage, saveNow } = useReadingPosition({
-    enabled: isTextContent,
+  // Delay enabling position tracking to ensure content is stable
+  const [isTrackingEnabled, setIsTrackingEnabled] = useState(false)
+  
+  // Reset tracking when article changes
+  useEffect(() => {
+    setIsTrackingEnabled(false)
+  }, [selectedUrl])
+  
+  // Enable/disable tracking based on content state
+  useEffect(() => {
+    if (!isTextContent) {
+      // Disable tracking if content is not suitable
+      if (isTrackingEnabled) {
+        setIsTrackingEnabled(false)
+      }
+      return
+    }
+    
+    if (!isTrackingEnabled) {
+      // Wait 500ms after content loads before enabling tracking
+      const timer = setTimeout(() => {
+        setIsTrackingEnabled(true)
+      }, 500)
+      return () => clearTimeout(timer)
+    }
+  }, [isTextContent, isTrackingEnabled])
+
+  const { progressPercentage, suppressSavesFor } = useReadingPosition({
+    enabled: isTrackingEnabled,
     syncEnabled: settings?.syncReadingPosition !== false,
     onSave: handleSavePosition,
     onReadingComplete: () => {
@@ -205,59 +257,82 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   useEffect(() => {
   }, [isTextContent, settings?.syncReadingPosition, activeAccount, relayPool, eventStore, articleIdentifier, progressPercentage])
 
-  // Load saved reading position when article loads
+  // Load saved reading position when article loads (using pre-loaded data from controller)
+  const suppressSavesForRef = useRef(suppressSavesFor)
   useEffect(() => {
-    if (!isTextContent || !activeAccount || !relayPool || !eventStore || !articleIdentifier) {
+    suppressSavesForRef.current = suppressSavesFor
+  }, [suppressSavesFor])
+
+  // Track if we've successfully started restore for this article + tracking state
+  // Use a composite key to ensure we only restore once per article when tracking is enabled
+  const restoreKey = `${articleIdentifier}-${isTrackingEnabled}`
+  const hasAttemptedRestoreRef = useRef<string | null>(null)
+
+  useEffect(() => {
+    if (!isTextContent || !activeAccount || !articleIdentifier) {
       return
     }
     if (settings?.syncReadingPosition === false) {
       return
     }
+    if (settings?.autoScrollToReadingPosition === false) {
+      return
+    }
+    if (!isTrackingEnabled) {
+      return
+    }
 
-    const loadPosition = async () => {
-      try {
-        const savedPosition = await loadReadingPosition(
-          relayPool,
-          eventStore,
-          activeAccount.pubkey,
-          articleIdentifier
-        )
+    // Only attempt restore once per article (after tracking is enabled)
+    if (hasAttemptedRestoreRef.current === restoreKey) {
+      return
+    }
 
-        if (savedPosition && savedPosition.position > 0.05 && savedPosition.position < 1) {
-          // Wait for content to be fully rendered before scrolling
-          setTimeout(() => {
-            const documentHeight = document.documentElement.scrollHeight
-            const windowHeight = window.innerHeight
-            const scrollTop = savedPosition.position * (documentHeight - windowHeight)
-            
-            window.scrollTo({
-              top: scrollTop,
-              behavior: 'smooth'
-            })
-          }, 500) // Give content time to render
-        } else if (savedPosition) {
-          if (savedPosition.position === 1) {
-            // Article was completed, start from top
-          } else {
-            // Position was too early, skip restore
-          }
+    // Mark as attempted using composite key
+    hasAttemptedRestoreRef.current = restoreKey
+    
+    // Get the saved position from the controller (already loaded and displayed on card)
+    const savedProgress = readingProgressController.getProgress(articleIdentifier)
+    
+    if (!savedProgress || savedProgress <= 0.05 || savedProgress >= 1) {
+      return
+    }
+
+    // Suppress saves during restore (500ms render + 1000ms smooth scroll = 1500ms)
+    if (suppressSavesForRef.current) {
+      suppressSavesForRef.current(1500)
+    }
+
+    // Wait for content to be fully rendered
+    setTimeout(() => {
+      const docH = document.documentElement.scrollHeight
+      const winH = window.innerHeight
+      const maxScroll = Math.max(0, docH - winH)
+      const currentTop = window.pageYOffset || document.documentElement.scrollTop
+      const targetTop = savedProgress * maxScroll
+
+      // Skip if delta is too small (< 48px or < 5%)
+      const deltaPx = Math.abs(targetTop - currentTop)
+      const deltaPct = maxScroll > 0 ? Math.abs((targetTop - currentTop) / maxScroll) : 0
+      if (deltaPx < 48 || deltaPct < 0.05) {
+        // Allow saves immediately since no scroll happened
+        if (suppressSavesForRef.current) {
+          suppressSavesForRef.current(0)
         }
-      } catch (error) {
-        console.error('❌ [ContentPanel] Failed to load reading position:', error)
+        return
       }
-    }
 
-    loadPosition()
-  }, [isTextContent, activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
+      // Perform smooth animated restore
+      window.scrollTo({
+        top: targetTop,
+        behavior: 'smooth'
+      })
+    }, 500) // Give content time to render
+  }, [isTextContent, activeAccount, articleIdentifier, settings?.syncReadingPosition, settings?.autoScrollToReadingPosition, selectedUrl, isTrackingEnabled, restoreKey])
 
-  // Save position before unmounting or changing article
-  useEffect(() => {
-    return () => {
-      if (saveNow) {
-        saveNow()
-      }
-    }
-  }, [saveNow, selectedUrl])
+  // Note: We intentionally do NOT save on unmount because:
+  // 1. Browser may scroll to top during back navigation, causing 0% saves
+  // 2. The auto-save with 1s throttle already captures position during reading
+  // 3. Position state may not reflect actual reading position during navigation
 
   // Close menu when clicking outside
   useEffect(() => {
@@ -320,6 +395,25 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
 
   const hasHighlights = relevantHighlights.length > 0
 
+  // Extract plain text for TTS
+  const baseHtml = useMemo(() => {
+    if (markdown) return renderedMarkdownHtml && finalHtml ? finalHtml : ''
+    return finalHtml || html || ''
+  }, [markdown, renderedMarkdownHtml, finalHtml, html])
+
+  const articleText = useMemo(() => {
+    const parts: string[] = []
+    if (title) parts.push(title)
+    if (summary) parts.push(summary)
+    if (baseHtml) {
+      const div = document.createElement('div')
+      div.innerHTML = baseHtml
+      const txt = (div.textContent || '').replace(/\s+/g, ' ').trim()
+      if (txt) parts.push(txt)
+    }
+    return parts.join('. ')
+  }, [title, summary, baseHtml])
+
   // Determine if we're on a nostr-native article (/a/) or external URL (/r/)
   const isNostrArticle = selectedUrl && selectedUrl.startsWith('nostr:')
   const isExternalVideo = !isNostrArticle && !!selectedUrl && ['youtube', 'video'].includes(classifyUrl(selectedUrl).type)
@@ -357,7 +451,8 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     if (!currentArticle) return null
 
     const dTag = currentArticle.tags.find(t => t[0] === 'd')?.[1] || ''
-    const relayHints = RELAYS.filter(r => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayHints = activeRelays.filter(r => 
       !r.includes('localhost') && !r.includes('127.0.0.1')
     ).slice(0, 3)
 
@@ -463,7 +558,12 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   }
 
   const handleOpenSearch = () => {
-    if (articleLinks) {
+    // For regular notes (kind:1), open via /e/ path
+    if (currentArticle?.kind === 1) {
+      const borisUrl = `${window.location.origin}/e/${currentArticle.id}`
+      window.open(borisUrl, '_blank', 'noopener,noreferrer')
+    } else if (articleLinks) {
+      // For articles, use search portal
       window.open(getSearchUrl(articleLinks.naddr), '_blank', 'noopener,noreferrer')
     }
     setShowArticleMenu(false)
@@ -550,7 +650,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
 
   const handleSearchExternalUrl = () => {
     if (selectedUrl) {
-      window.open(getSearchUrl(selectedUrl), '_blank', 'noopener,noreferrer')
+      // If it's a nostr event sentinel, open the event directly on ants.sh
+      if (selectedUrl.startsWith('nostr-event:')) {
+        const eventId = selectedUrl.replace('nostr-event:', '')
+        window.open(`https://ants.sh/e/${eventId}`, '_blank', 'noopener,noreferrer')
+      } else {
+        window.open(getSearchUrl(selectedUrl), '_blank', 'noopener,noreferrer')
+      }
     }
     setShowExternalMenu(false)
   }
@@ -579,9 +685,8 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             try {
               const naddr = nip19.naddrEncode({ kind: 30023, pubkey: currentArticle.pubkey, identifier: dTag })
               hasRead = hasRead || archiveController.isMarked(naddr)
-              console.log('[archive][content] check article', { naddr: naddr.slice(0, 24) + '...', hasRead })
             } catch (e) {
-              console.warn('[archive][content] encode naddr failed', e)
+              // Silently ignore encoding errors
             }
           }
         } else {
@@ -593,7 +698,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
           // Also check archiveController
           const ctrl = archiveController.isMarked(selectedUrl)
           hasRead = hasRead || ctrl
-          console.log('[archive][content] check url', { url: selectedUrl, hasRead, ctrl })
         }
         setIsMarkedAsRead(hasRead)
       } catch (error) {
@@ -674,7 +778,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             if (dTag) {
               const naddr = nip19.naddrEncode({ kind: 30023, pubkey: currentArticle.pubkey, identifier: dTag })
               archiveController.mark(naddr)
-              console.log('[archive][content] optimistic mark article', naddr.slice(0, 24) + '...')
             }
           } catch (err) {
             console.warn('[archive][content] optimistic article mark failed', err)
@@ -686,7 +789,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             relayPool
           )
           archiveController.mark(selectedUrl)
-          console.log('[archive][content] optimistic mark url', selectedUrl)
         }
       } catch (error) {
         console.error('Failed to mark as read:', error)
@@ -731,16 +833,15 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
       <div className="reader" style={{ '--highlight-rgb': highlightRgb } as React.CSSProperties}>
         {/* Hidden markdown preview to convert markdown to HTML */}
       {markdown && (
-        <div ref={markdownPreviewRef} style={{ display: 'none' }}>
+        <div ref={markdownPreviewRef} key={`preview:${contentKey}`} style={{ display: 'none' }}>
           <ReactMarkdown 
             remarkPlugins={[remarkGfm]}
             rehypePlugins={[rehypeRaw, rehypePrism]}
             components={{
-              img: ({ src, alt, ...props }) => (
+              img: ({ src, alt }) => (
                 <img 
                   src={src} 
                   alt={alt} 
-                  {...props}
                 />
               )
             }}
@@ -761,7 +862,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
         settings={settings}
         highlights={relevantHighlights}
         highlightVisibility={highlightVisibility}
+        onHighlightCountClick={onOpenHighlights}
       />
+      {isTextContent && articleText && (
+        <div style={{ padding: '0 0.75rem 0.5rem 0.75rem' }}>
+          <TTSControls text={articleText} defaultLang={navigator?.language} settings={settings} />
+        </div>
+      )}
       {isExternalVideo ? (
         <>
           <div className="reader-video">
@@ -846,10 +953,12 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
         <>
           {markdown ? (
             renderedMarkdownHtml && finalHtml ? (
-              <div 
-                ref={contentRef} 
-                className="reader-markdown" 
-                dangerouslySetInnerHTML={{ __html: finalHtml }}
+              <VideoEmbedProcessor
+                key={`content:${contentKey}`}
+                ref={contentRef}
+                html={finalHtml}
+                renderVideoLinksAsEmbeds={settings?.renderVideoLinksAsEmbeds === true && !isExternalVideo}
+                className="reader-markdown"
                 onMouseUp={handleSelectionEnd}
                 onTouchEnd={handleSelectionEnd}
               />
@@ -861,10 +970,12 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
               </div>
             )
           ) : (
-            <div 
-              ref={contentRef} 
-              className="reader-html" 
-              dangerouslySetInnerHTML={{ __html: finalHtml || html || '' }}
+            <VideoEmbedProcessor
+              key={`content:${contentKey}`}
+              ref={contentRef}
+              html={finalHtml || html || ''}
+              renderVideoLinksAsEmbeds={settings?.renderVideoLinksAsEmbeds === true && !isExternalVideo}
+              className="reader-html"
               onMouseUp={handleSelectionEnd}
               onTouchEnd={handleSelectionEnd}
             />
@@ -898,13 +1009,16 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
                       <FontAwesomeIcon icon={faCopy} />
                       <span>Copy URL</span>
                     </button>
-                    <button
-                      className="article-menu-item"
-                      onClick={handleOpenExternalUrl}
-                    >
-                      <FontAwesomeIcon icon={faExternalLinkAlt} />
-                      <span>Open Original</span>
-                    </button>
+                    {/* Only show "Open Original" for actual external URLs, not nostr events */}
+                    {!selectedUrl?.startsWith('nostr-event:') && (
+                      <button
+                        className="article-menu-item"
+                        onClick={handleOpenExternalUrl}
+                      >
+                        <FontAwesomeIcon icon={faExternalLinkAlt} />
+                        <span>Open Original</span>
+                      </button>
+                    )}
                     <button
                       className="article-menu-item"
                       onClick={handleSearchExternalUrl}

src/components/Debug.tsx

@@ -114,6 +114,12 @@ const Debug: React.FC<DebugProps> = ({
   const [markAsReadReactions, setMarkAsReadReactions] = useState<NostrEvent[]>([])
   const [tLoadMarkAsRead, setTLoadMarkAsRead] = useState<number | null>(null)
   const [tFirstMarkAsRead, setTFirstMarkAsRead] = useState<number | null>(null)
+
+  // Relay list loading state
+  const [isLoadingRelayList, setIsLoadingRelayList] = useState(false)
+  const [relayListEvents, setRelayListEvents] = useState<NostrEvent[]>([])
+  const [tLoadRelayList, setTLoadRelayList] = useState<number | null>(null)
+  const [tFirstRelayList, setTFirstRelayList] = useState<number | null>(null)
   
   // Deduplicated reading progress from controller
   const [deduplicatedProgressMap, setDeduplicatedProgressMap] = useState<Map<string, number>>(new Map())
@@ -127,6 +133,7 @@ const Debug: React.FC<DebugProps> = ({
     loadHighlights?: { startTime: number }
     loadReadingProgress?: { startTime: number }
     loadMarkAsRead?: { startTime: number }
+    loadRelayList?: { startTime: number }
   }>({})
   
   // Web of Trust state
@@ -427,11 +434,7 @@ const Debug: React.FC<DebugProps> = ({
 
       const elapsed = Math.round(performance.now() - start)
       setTLoadHighlights(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadHighlights, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadHighlights: undefined }))
 
       DebugBus.info('debug', `Loaded ${events.length} highlight events in ${elapsed}ms`)
     } catch (err) {
@@ -648,7 +651,9 @@ const Debug: React.FC<DebugProps> = ({
               return timeB - timeA
             })
           })
-        }
+        },
+        100,
+        eventStore || undefined
       )
       
       setWritingPosts(posts)
@@ -776,9 +781,16 @@ const Debug: React.FC<DebugProps> = ({
         }
       })
 
-      // Load deduplicated results via controller
+      // Load deduplicated results via controller (includes articles and external URLs)
       const unsubProgress = readingProgressController.onProgress((progressMap) => {
         setDeduplicatedProgressMap(new Map(progressMap))
+
+        // Regression guard: ensure keys include both naddr and raw URL forms when present
+        try {
+          const keys = Array.from(progressMap.keys())
+          const sample = keys.slice(0, 5).join(', ')
+          DebugBus.info('debug', `Progress keys sample: ${sample}`)
+        } catch { /* ignore */ }
       })
 
       // Run both in parallel
@@ -791,11 +803,7 @@ const Debug: React.FC<DebugProps> = ({
 
       const elapsed = Math.round(performance.now() - start)
       setTLoadReadingProgress(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadReadingProgress, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadReadingProgress: undefined }))
 
       const finalMap = readingProgressController.getProgressMap()
       DebugBus.info('debug', `Loaded ${rawEvents.length} raw events, deduplicated to ${finalMap.size} articles in ${elapsed}ms`)
@@ -864,11 +872,7 @@ const Debug: React.FC<DebugProps> = ({
       const totalEvents = kind7Events.length + kind17Events.length
       const elapsed = Math.round(performance.now() - start)
       setTLoadMarkAsRead(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadMarkAsRead, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadMarkAsRead: undefined }))
 
       DebugBus.info('debug', `Loaded ${totalEvents} mark-as-read reactions in ${elapsed}ms`)
     } catch (err) {
@@ -886,6 +890,66 @@ const Debug: React.FC<DebugProps> = ({
     DebugBus.info('debug', 'Cleared mark-as-read reactions data')
   }
 
+  const handleLoadRelayList = async () => {
+    if (!relayPool || !activeAccount?.pubkey) {
+      DebugBus.warn('debug', 'Please log in to load relay list')
+      return
+    }
+
+    try {
+      setIsLoadingRelayList(true)
+      setRelayListEvents([])
+      setTLoadRelayList(null)
+      setTFirstRelayList(null)
+      DebugBus.info('debug', 'Loading relay list (kind 10002)...')
+
+      const start = performance.now()
+      let firstEventTime: number | null = null
+      setLiveTiming(prev => ({ ...prev, loadRelayList: { startTime: start } }))
+
+      const { queryEvents } = await import('../services/dataFetch')
+
+      // Query for kind:10002 (relay list)
+      const events = await queryEvents(relayPool, { 
+        kinds: [10002], 
+        authors: [activeAccount.pubkey],
+        limit: 10
+      }, {
+        onEvent: (evt) => {
+          if (firstEventTime === null) {
+            firstEventTime = performance.now() - start
+            setTFirstRelayList(Math.round(firstEventTime))
+          }
+          setRelayListEvents(prev => [...prev, evt])
+        }
+      })
+      
+      const elapsed = Math.round(performance.now() - start)
+      setTLoadRelayList(elapsed)
+      setLiveTiming(prev => ({ ...prev, loadRelayList: undefined }))
+
+      DebugBus.info('debug', `Loaded ${events.length} relay list events in ${elapsed}ms`)
+      
+      // Log details about the events
+      events.forEach((event, index) => {
+        const relayCount = event.tags.filter(tag => tag[0] === 'r').length
+        DebugBus.info('debug', `Event ${index + 1}: ${relayCount} relays, created ${new Date(event.created_at * 1000).toISOString()}`)
+      })
+    } catch (err) {
+      console.error('Failed to load relay list:', err)
+      DebugBus.error('debug', `Failed to load relay list: ${err instanceof Error ? err.message : String(err)}`)
+    } finally {
+      setIsLoadingRelayList(false)
+    }
+  }
+
+  const handleClearRelayList = () => {
+    setRelayListEvents([])
+    setTLoadRelayList(null)
+    setTFirstRelayList(null)
+    DebugBus.info('debug', 'Cleared relay list data')
+  }
+
   const handleLoadFriendsList = async () => {
     if (!relayPool || !activeAccount?.pubkey) {
       DebugBus.warn('debug', 'Please log in to load friends list')
@@ -1698,6 +1762,72 @@ const Debug: React.FC<DebugProps> = ({
           )}
         </div>
 
+        {/* Relay List Loading Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Relay List Loading (kind 10002)</h3>
+          <div className="text-sm opacity-70 mb-3">Load your relay list to debug dynamic relay integration:</div>
+          
+          <div className="flex gap-2 mb-3 items-center">
+            <button 
+              className="btn btn-primary" 
+              onClick={handleLoadRelayList}
+              disabled={isLoadingRelayList || !relayPool || !activeAccount}
+            >
+              {isLoadingRelayList ? (
+                <>
+                  <FontAwesomeIcon icon={faSpinner} className="animate-spin mr-2" />
+                  Loading...
+                </>
+              ) : (
+                'Load Relay List'
+              )}
+            </button>
+            <button 
+              className="btn btn-secondary ml-auto" 
+              onClick={handleClearRelayList}
+              disabled={relayListEvents.length === 0}
+            >
+              Clear
+            </button>
+          </div>
+          
+          <div className="flex gap-4 mb-3 text-sm">
+            <Stat label="total" value={tLoadRelayList} />
+            <Stat label="first event" value={tFirstRelayList} />
+          </div>
+          {relayListEvents.length > 0 && (
+            <div className="mb-3">
+              <div className="text-sm opacity-70 mb-2">Loaded Relay List Events ({relayListEvents.length}):</div>
+              <div className="space-y-2 max-h-96 overflow-y-auto">
+                {relayListEvents.map((evt, idx) => {
+                  const relayTags = evt.tags?.filter((t: string[]) => t[0] === 'r') || []
+                  
+                  return (
+                    <div key={idx} className="font-mono text-xs p-2 bg-gray-100 dark:bg-gray-800 rounded">
+                      <div className="font-semibold mb-1">Relay List Event #{idx + 1}</div>
+                      <div className="opacity-70 mb-1">
+                        <div>Kind: {evt.kind}</div>
+                        <div>Author: {evt.pubkey.slice(0, 16)}...</div>
+                        <div>Created: {new Date(evt.created_at * 1000).toLocaleString()}</div>
+                        <div>Relays: {relayTags.length}</div>
+                      </div>
+                      <div className="mt-1">
+                        <div className="text-[11px] opacity-70 mb-1">Relay URLs:</div>
+                        {relayTags.map((tag, tagIdx) => (
+                          <div key={tagIdx} className="text-[10px] opacity-60 break-all">
+                            {tag[1]} {tag[2] ? `(${tag[2]})` : ''}
+                          </div>
+                        ))}
+                      </div>
+                      <div className="opacity-50 mt-1 text-[10px] break-all">ID: {evt.id}</div>
+                    </div>
+                  )
+                })}
+              </div>
+            </div>
+          )}
+        </div>
+
         {/* Web of Trust Section */}
         <div className="settings-section">
           <h3 className="section-title">Web of Trust</h3>

src/components/EventViewer.tsx

@@ -0,0 +1 @@
+

src/components/Explore.tsx

@@ -1,14 +1,14 @@
-import React, { useState, useEffect, useMemo, useCallback } from 'react'
+import React, { useState, useEffect, useMemo, useCallback, useRef } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate, faSpinner } from '@fortawesome/free-solid-svg-icons'
+import { faPersonHiking, faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate } from '@fortawesome/free-solid-svg-icons'
 import IconButton from './IconButton'
 import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
 import { Hooks } from 'applesauce-react'
 import { RelayPool } from 'applesauce-relay'
-import { IEventStore, Helpers } from 'applesauce-core'
-import { nip19, NostrEvent } from 'nostr-tools'
+import { IEventStore } from 'applesauce-core'
+import { nip19 } from 'nostr-tools'
 import { useNavigate } from 'react-router-dom'
-import { fetchContacts } from '../services/contactService'
+// Contacts are managed via controller subscription
 import { fetchBlogPostsFromAuthors, BlogPostPreview } from '../services/exploreService'
 import { fetchHighlightsFromAuthors } from '../services/highlightService'
 import { fetchProfiles } from '../services/profileService'
@@ -19,20 +19,22 @@ import { Highlight } from '../types/highlights'
 import { UserSettings } from '../services/settingsService'
 import BlogPostCard from './BlogPostCard'
 import { HighlightItem } from './HighlightItem'
-import { getCachedPosts, upsertCachedPost, setCachedPosts, getCachedHighlights, upsertCachedHighlight, setCachedHighlights } from '../services/exploreCache'
+import { getCachedPosts, setCachedPosts, getCachedHighlights, setCachedHighlights } from '../services/exploreCache'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
 import { classifyHighlights } from '../utils/highlightClassification'
 import { HighlightVisibility } from './HighlightsPanel'
-import { KINDS } from '../config/kinds'
-import { eventToHighlight } from '../services/highlightEventProcessor'
-import { useStoreTimeline } from '../hooks/useStoreTimeline'
+// import { KINDS } from '../config/kinds'
+// import { eventToHighlight } from '../services/highlightEventProcessor'
+// import { useStoreTimeline } from '../hooks/useStoreTimeline'
 import { dedupeHighlightsById, dedupeWritingsByReplaceable } from '../utils/dedupe'
 import { writingsController } from '../services/writingsController'
 import { nostrverseWritingsController } from '../services/nostrverseWritingsController'
 import { readingProgressController } from '../services/readingProgressController'
+import { contactsController } from '../services/contactsController'
 
-const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
+// Accessors from Helpers (currently unused here)
+// const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
 
 interface ExploreProps {
   relayPool: RelayPool
@@ -55,27 +57,28 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
   const [hasLoadedNostrverse, setHasLoadedNostrverse] = useState(false)
   const [hasLoadedMine, setHasLoadedMine] = useState(false)
   const [hasLoadedNostrverseHighlights, setHasLoadedNostrverseHighlights] = useState(false)
+  const hasHydratedRef = useRef(false)
   
   // Get myHighlights directly from controller
-  const [myHighlights, setMyHighlights] = useState<Highlight[]>([])
+  const [/* myHighlights */, setMyHighlights] = useState<Highlight[]>([])
   // Remove unused loading state to avoid warnings
   
   // Reading progress state (naddr -> progress 0-1)
   const [readingProgressMap, setReadingProgressMap] = useState<Map<string, number>>(new Map())
   
   // Load cached content from event store (instant display)
-  const cachedHighlights = useStoreTimeline(eventStore, { kinds: [KINDS.Highlights] }, eventToHighlight, [])
+  // const cachedHighlights = useStoreTimeline(eventStore, { kinds: [KINDS.Highlights] }, eventToHighlight, [])
   
-  const toBlogPostPreview = useCallback((event: NostrEvent): BlogPostPreview => ({
-    event,
-    title: getArticleTitle(event) || 'Untitled',
-    summary: getArticleSummary(event),
-    image: getArticleImage(event),
-    published: getArticlePublished(event),
-    author: event.pubkey
-  }), [])
+  // const toBlogPostPreview = useCallback((event: NostrEvent): BlogPostPreview => ({
+  //   event,
+  //   title: getArticleTitle(event) || 'Untitled',
+  //   summary: getArticleSummary(event),
+  //   image: getArticleImage(event),
+  //   published: getArticlePublished(event),
+  //   author: event.pubkey
+  // }), [])
   
-  const cachedWritings = useStoreTimeline(eventStore, { kinds: [30023] }, toBlogPostPreview, [])
+  // const cachedWritings = useStoreTimeline(eventStore, { kinds: [30023] }, toBlogPostPreview, [])
 
   
   
@@ -105,6 +108,21 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
     }
   }, [])
 
+  // Subscribe to contacts stream and mirror into local state
+  useEffect(() => {
+    const unsubscribe = contactsController.onContacts((contacts) => {
+      setFollowedPubkeys(new Set(contacts))
+    })
+    return () => unsubscribe()
+  }, [])
+
+  // Ensure contacts controller is started for the active account (non-blocking)
+  useEffect(() => {
+    if (relayPool && activeAccount?.pubkey) {
+      contactsController.start({ relayPool, pubkey: activeAccount.pubkey }).catch(() => {})
+    }
+  }, [relayPool, activeAccount?.pubkey])
+
   // Subscribe to nostrverse highlights controller for global stream
   useEffect(() => {
     const apply = (incoming: Highlight[]) => {
@@ -230,242 +248,95 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
     }
   }, [propActiveTab])
 
-  useEffect(() => {
-    const loadData = async () => {
-      try {
-        // begin load, but do not block rendering
-        setLoading(true)
+  // Load initial data and refresh on triggers
+  const loadData = useCallback(() => {
+    if (!relayPool) return
 
-        // If not logged in, only fetch nostrverse content with streaming posts
-        if (!activeAccount) {
-          // Logged out: rely entirely on centralized controllers; do not fetch here
-          setLoading(false)
-        }
+    // Seed from cache for instant UI
+    if (activeAccount) {
+      const cachedPosts = getCachedPosts(activeAccount.pubkey)
+      if (cachedPosts && cachedPosts.length > 0) setBlogPosts(cachedPosts)
+      const cached = getCachedHighlights(activeAccount.pubkey)
+      if (cached && cached.length > 0) setHighlights(cached)
+    }
 
-        // Seed from in-memory cache if available to avoid empty flash
-        const memoryCachedPosts = activeAccount ? getCachedPosts(activeAccount.pubkey) : []
-        if (memoryCachedPosts && memoryCachedPosts.length > 0) {
-          setBlogPosts(prev => prev.length === 0 ? memoryCachedPosts : prev)
-        }
-        const memoryCachedHighlights = activeAccount ? getCachedHighlights(activeAccount.pubkey) : []
-        if (memoryCachedHighlights && memoryCachedHighlights.length > 0) {
-          setHighlights(prev => prev.length === 0 ? memoryCachedHighlights : prev)
-        }
-        
-        // Seed with cached content from event store (instant display)
-        if (cachedHighlights.length > 0 || myHighlights.length > 0) {
-          const merged = dedupeHighlightsById([...cachedHighlights, ...myHighlights])
-          setHighlights(prev => {
-            const all = dedupeHighlightsById([...prev, ...merged])
-            return all.sort((a, b) => b.created_at - a.created_at)
-          })
-        }
-        
-        // Seed with cached writings from event store
-        if (cachedWritings.length > 0) {
-          setBlogPosts(prev => {
-            const all = dedupeWritingsByReplaceable([...prev, ...cachedWritings])
-            return all.sort((a, b) => {
-              const timeA = a.published || a.event.created_at
-              const timeB = b.published || b.event.created_at
-              return timeB - timeA
-            })
-          })
-        }
+    setLoading(true)
 
-        // At this point, we have seeded any available data; lift the loading state
-        setLoading(false)
+    try {
+      // Prepare parallel fetches
+      const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
 
-        // Fetch the user's contacts (friends)
-        const contacts = await fetchContacts(
+      // Nostrverse writings: subscribe-style via onPost; hydrate on first post
+      if (!activeAccount || (activeAccount && visibility.nostrverse)) {
+        fetchNostrverseBlogPosts(
           relayPool,
-          activeAccount?.pubkey || '',
-          (partial) => {
-            // Store followed pubkeys for highlight classification
-            setFollowedPubkeys(partial)
-            // When local contacts are available, kick off early fetch
-            if (partial.size > 0) {
-              const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
-              const partialArray = Array.from(partial)
-              
-              // Fetch blog posts
-              fetchBlogPostsFromAuthors(
-                relayPool,
-                partialArray,
-                relayUrls,
-                (post) => {
-                  setBlogPosts((prev) => {
-                    // Deduplicate by author:d-tag (replaceable event key)
-                    const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${post.author}:${dTag}`
-                    const existingIndex = prev.findIndex(p => {
-                      const pDTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                      return `${p.author}:${pDTag}` === key
-                    })
-                    
-                    // If exists, only replace if this one is newer
-                    if (existingIndex >= 0) {
-                      const existing = prev[existingIndex]
-                      if (post.event.created_at <= existing.event.created_at) {
-                        return prev // Keep existing (newer or same)
-                      }
-                      // Replace with newer version
-                      const next = [...prev]
-                      next[existingIndex] = post
-                      return next.sort((a, b) => {
-                        const timeA = a.published || a.event.created_at
-                        const timeB = b.published || b.event.created_at
-                        return timeB - timeA
-                      })
-                    }
-                    
-                    // New post, add it
-                    const next = [...prev, post]
-                    return next.sort((a, b) => {
-                      const timeA = a.published || a.event.created_at
-                      const timeB = b.published || b.event.created_at
-                      return timeB - timeA
-                    })
-                  })
-                  if (activeAccount) setCachedPosts(activeAccount.pubkey, upsertCachedPost(activeAccount.pubkey, post))
-                }
-              ).then((all) => {
-                setBlogPosts((prev) => {
-                  // Deduplicate by author:d-tag (replaceable event key)
-                  const byKey = new Map<string, BlogPostPreview>()
-                  
-                  // Add existing posts
-                  for (const p of prev) {
-                    const dTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${p.author}:${dTag}`
-                    byKey.set(key, p)
-                  }
-                  
-                  // Merge in new posts (keeping newer versions)
-                  for (const post of all) {
-                    const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${post.author}:${dTag}`
-                    const existing = byKey.get(key)
-                    if (!existing || post.event.created_at > existing.event.created_at) {
-                      byKey.set(key, post)
-                    }
-                  }
-                  
-                  const merged = Array.from(byKey.values()).sort((a, b) => {
-                    const timeA = a.published || a.event.created_at
-                    const timeB = b.published || b.event.created_at
-                    return timeB - timeA
-                  })
-                  if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
-                  return merged
-                })
-              })
-              
-              // Fetch highlights
-              fetchHighlightsFromAuthors(
-                relayPool,
-                partialArray,
-                (highlight) => {
-                  setHighlights((prev) => {
-                    const exists = prev.some(h => h.id === highlight.id)
-                    if (exists) return prev
-                    const next = [...prev, highlight]
-                    return next.sort((a, b) => b.created_at - a.created_at)
-                  })
-                  if (activeAccount) setCachedHighlights(activeAccount.pubkey, upsertCachedHighlight(activeAccount.pubkey, highlight))
-                }
-              ).then((all) => {
-                setHighlights((prev) => {
-                  const byId = new Map(prev.map(h => [h.id, h]))
-                  for (const highlight of all) byId.set(highlight.id, highlight)
-                  const merged = Array.from(byId.values()).sort((a, b) => b.created_at - a.created_at)
-                  if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
-                  return merged
-                })
-              })
-            }
-          }
-        )
-        
-        // Always proceed to load nostrverse content even if no contacts
-        // (removed blocking error for empty contacts)
-
-        // Store final followed pubkeys
-        setFollowedPubkeys(contacts)
-
-        // Fetch friends content and (optionally) nostrverse + mine content in parallel
-        const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
-        const contactsArray = Array.from(contacts)
-        // Use centralized writingsController for my posts (non-blocking)
-        // pull from writingsController; no need to store promise
-        setBlogPosts(prev => dedupeWritingsByReplaceable([...prev, ...writingsController.getWritings()]).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at)))
-        setHasLoadedMine(true)
-        const nostrversePostsPromise = visibility.nostrverse
-          ? fetchNostrverseBlogPosts(relayPool, relayUrls, 50, eventStore || undefined, (post) => {
-              // Stream nostrverse posts too when logged in
-              setBlogPosts(prev => {
-                const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                const key = `${post.author}:${dTag}`
-                const existingIndex = prev.findIndex(p => {
-                  const pDTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                  return `${p.author}:${pDTag}` === key
-                })
-                if (existingIndex >= 0) {
-                  const existing = prev[existingIndex]
-                  if (post.event.created_at <= existing.event.created_at) return prev
-                  const next = [...prev]
-                  next[existingIndex] = post
-                  return next.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-                }
-                const next = [...prev, post]
-                return next.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-              })
-            })
-          : Promise.resolve([] as BlogPostPreview[])
-
-        // Fire non-blocking fetches and merge as they resolve
-        fetchBlogPostsFromAuthors(relayPool, contactsArray, relayUrls)
-          .then((friendsPosts) => {
+          relayUrls,
+          50,
+          eventStore || undefined,
+          (post) => {
             setBlogPosts(prev => {
-              const merged = dedupeWritingsByReplaceable([...prev, ...friendsPosts])
-              const sorted = merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-              if (activeAccount) setCachedPosts(activeAccount.pubkey, sorted)
-              // Pre-cache profiles in background
-              const authorPubkeys = Array.from(new Set(sorted.map(p => p.author)))
-              fetchProfiles(relayPool, eventStore, authorPubkeys, settings).catch(() => {})
-              return sorted
+              const merged = dedupeWritingsByReplaceable([...prev, post])
+              if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+              return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
             })
-          }).catch(() => {})
-
-        fetchHighlightsFromAuthors(relayPool, contactsArray)
-          .then((friendsHighlights) => {
-            setHighlights(prev => {
-              const merged = dedupeHighlightsById([...prev, ...friendsHighlights])
-              const sorted = merged.sort((a, b) => b.created_at - a.created_at)
-              if (activeAccount) setCachedHighlights(activeAccount.pubkey, sorted)
-              return sorted
-            })
-          }).catch(() => {})
-
-        nostrversePostsPromise.then((nostrversePosts) => {
+            if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+          }
+        ).then((nostrversePosts) => {
           setBlogPosts(prev => dedupeWritingsByReplaceable([...prev, ...nostrversePosts]).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at)))
         }).catch(() => {})
-
-        fetchNostrverseHighlights(relayPool, 100, eventStore || undefined)
-          .then((nostriverseHighlights) => {
-            setHighlights(prev => dedupeHighlightsById([...prev, ...nostriverseHighlights]).sort((a, b) => b.created_at - a.created_at))
-          }).catch(() => {})
+      }
       } catch (err) {
         console.error('Failed to load data:', err)
         // No blocking error - user can pull-to-refresh
       } finally {
         // loading is already turned off after seeding
       }
-    }
+  }, [relayPool, activeAccount, eventStore, visibility.nostrverse])
 
+  useEffect(() => {
     loadData()
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [relayPool, activeAccount, refreshTrigger, eventStore, settings])
+  }, [loadData, refreshTrigger])
+
+  // Kick off friends fetches reactively when contacts arrive
+  useEffect(() => {
+    if (!relayPool) return
+    if (followedPubkeys.size === 0) return
+    const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
+    const contactsArray = Array.from(followedPubkeys)
+
+    fetchBlogPostsFromAuthors(relayPool, contactsArray, relayUrls, (post) => {
+      setBlogPosts(prev => {
+        const merged = dedupeWritingsByReplaceable([...prev, post])
+        if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+        // Pre-cache profiles in background
+        const authorPubkeys = Array.from(new Set(merged.map(p => p.author)))
+        fetchProfiles(relayPool, eventStore, authorPubkeys, settings).catch(() => {})
+        return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
+      })
+      if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+    }, 100, eventStore).then((friendsPosts) => {
+      setBlogPosts(prev => {
+        const merged = dedupeWritingsByReplaceable([...prev, ...friendsPosts])
+        if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
+      })
+    }).catch(() => {})
+
+    fetchHighlightsFromAuthors(relayPool, contactsArray, (highlight) => {
+      setHighlights(prev => {
+        const merged = dedupeHighlightsById([...prev, highlight])
+        if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => b.created_at - a.created_at)
+      })
+      if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+    }, eventStore || undefined).then((friendsHighlights) => {
+      setHighlights(prev => {
+        const merged = dedupeHighlightsById([...prev, ...friendsHighlights])
+        if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => b.created_at - a.created_at)
+      })
+    }).catch(() => {})
+  }, [relayPool, followedPubkeys, eventStore, settings, activeAccount])
 
   // Lazy-load nostrverse writings when user toggles it on (logged in)
   useEffect(() => {
@@ -509,7 +380,12 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         return Array.from(byKey.values()).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
       })
     }).catch(() => {})
-  }, [visibility.nostrverse, activeAccount, relayPool, eventStore, hasLoadedNostrverse])
+
+    fetchNostrverseHighlights(relayPool, 100, eventStore || undefined)
+      .then((nostriverseHighlights) => {
+        setHighlights(prev => dedupeHighlightsById([...prev, ...nostriverseHighlights]).sort((a, b) => b.created_at - a.created_at))
+      }).catch(() => {})
+  }, [activeAccount, relayPool, visibility.nostrverse, hasLoadedNostrverse, eventStore])
 
   // Lazy-load nostrverse highlights when user toggles it on (logged in)
   useEffect(() => {
@@ -586,6 +462,12 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         const publishedTime = post.published || post.event.created_at
         if (publishedTime > maxFutureTime) return false
         
+        // Hide bot authors by profile display name if setting enabled
+        if (settings?.hideBotArticlesByName !== false) {
+          // Profile resolution and filtering is handled in BlogPostCard via ProfileModel
+          // Keep list intact here; individual cards will render null if author is a bot
+        }
+        
         // Apply visibility filters
         const isMine = activeAccount && post.author === activeAccount.pubkey
         const isFriend = followedPubkeys.has(post.author)
@@ -604,7 +486,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         const level: 'mine' | 'friends' | 'nostrverse' = isMine ? 'mine' : isFriend ? 'friends' : 'nostrverse'
         return { ...post, level }
       })
-  }, [uniqueSortedPosts, activeAccount, followedPubkeys, visibility])
+  }, [uniqueSortedPosts, activeAccount, followedPubkeys, visibility, settings?.hideBotArticlesByName])
   
   // Helper to get reading progress for a post
   const getReadingProgress = useCallback((post: BlogPostPreview): number | undefined => {
@@ -641,8 +523,10 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
           )
         }
         return filteredBlogPosts.length === 0 ? (
-          <div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
-            <FontAwesomeIcon icon={faSpinner} spin size="2x" />
+          <div className="explore-grid">
+            {Array.from({ length: 6 }).map((_, i) => (
+              <BlogPostSkeleton key={i} />
+            ))}
           </div>
         ) : (
           <div className="explore-grid">
@@ -653,6 +537,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
                 href={getPostUrl(post)}
                 level={post.level}
                 readingProgress={getReadingProgress(post)}
+                hideBotByName={settings?.hideBotArticlesByName !== false}
               />
             ))}
           </div>
@@ -701,7 +586,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
       />
       <div className="explore-header">
         <h1>
-          <FontAwesomeIcon icon={faNewspaper} />
+          <FontAwesomeIcon icon={faPersonHiking} />
           Explore
         </h1>
         
@@ -773,7 +658,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         </div>
       </div>
 
-      <div key={activeTab}>
+      <div>
         {renderTabContent()}
       </div>
     </div>

src/components/HighlightItem.tsx

@@ -8,8 +8,8 @@ import { Models, IEventStore } from 'applesauce-core'
 import { RelayPool } from 'applesauce-relay'
 import { Hooks } from 'applesauce-react'
 import { onSyncStateChange, isEventSyncing } from '../services/offlineSyncService'
-import { RELAYS } from '../config/relays'
 import { areAllRelaysLocal } from '../utils/helpers'
+import { getActiveRelayUrls } from '../services/relayManager'
 import { nip19 } from 'nostr-tools'
 import { formatDateCompact } from '../utils/bookmarkUtils'
 import { createDeletionRequest } from '../services/deletionService'
@@ -150,10 +150,10 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
           setShowOfflineIndicator(false)
           
           // Update the highlight with all relays after successful sync
-          if (onHighlightUpdate && highlight.isLocalOnly) {
+          if (onHighlightUpdate && highlight.isLocalOnly && relayPool) {
             const updatedHighlight = {
               ...highlight,
-              publishedRelays: RELAYS,
+              publishedRelays: getActiveRelayUrls(relayPool),
               isLocalOnly: false,
               isOfflineCreated: false
             }
@@ -164,7 +164,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     })
     
     return unsubscribe
-  }, [highlight, onHighlightUpdate])
+  }, [highlight, onHighlightUpdate, relayPool])
   
   useEffect(() => {
     if (isSelected && itemRef.current) {
@@ -212,19 +212,31 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
             pubkey,
             identifier
           })
-          navigate(`/a/${naddr}`)
+          // Pass highlight ID in navigation state to trigger scroll
+          navigate(`/a/${naddr}`, { 
+            state: { 
+              highlightId: highlight.id,
+              openHighlights: true 
+            } 
+          })
         }
       }
     } else if (highlight.urlReference) {
-      // Navigate to external URL
-      navigate(`/r/${encodeURIComponent(highlight.urlReference)}`)
+      // Navigate to external URL with highlight ID to trigger scroll
+      navigate(`/r/${encodeURIComponent(highlight.urlReference)}`, {
+        state: {
+          highlightId: highlight.id,
+          openHighlights: true
+        }
+      })
     }
   }
   
   const getHighlightLinks = () => {
     // Encode the highlight event itself (kind 9802) as a nevent
     // Get non-local relays for the hint
-    const relayHints = RELAYS.filter(r => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayHints = activeRelays.filter(r => 
       !r.includes('localhost') && !r.includes('127.0.0.1')
     ).slice(0, 3) // Include up to 3 relay hints
     
@@ -260,7 +272,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
       }
       
       // Publish to all configured relays - let the relay pool handle connection state
-      const targetRelays = RELAYS
+      const targetRelays = getActiveRelayUrls(relayPool)
       
       
       await relayPool.publish(targetRelays, event)
@@ -328,7 +340,8 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     }
     
     // Fallback: show all relays we queried (where this was likely fetched from)
-    const relayNames = RELAYS.map(url => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayNames = activeRelays.map(url => 
       url.replace(/^wss?:\/\//, '').replace(/\/$/, '')
     )
     return {
@@ -420,7 +433,31 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
           title={new Date(highlight.created_at * 1000).toLocaleString()}
           onClick={(e) => {
             e.stopPropagation()
-            window.location.href = highlightLinks.native
+            // Navigate within app using same logic as handleItemClick
+            if (highlight.eventReference) {
+              const parts = highlight.eventReference.split(':')
+              if (parts.length === 3 && parts[0] === '30023') {
+                const [, pubkey, identifier] = parts
+                const naddr = nip19.naddrEncode({
+                  kind: 30023,
+                  pubkey,
+                  identifier
+                })
+                navigate(`/a/${naddr}`, { 
+                  state: { 
+                    highlightId: highlight.id,
+                    openHighlights: true 
+                  } 
+                })
+              }
+            } else if (highlight.urlReference) {
+              navigate(`/r/${encodeURIComponent(highlight.urlReference)}`, {
+                state: {
+                  highlightId: highlight.id,
+                  openHighlights: true
+                }
+              })
+            }
           }}
         >
           {formatDateCompact(highlight.created_at)}

src/components/HighlightsPanel.tsx

@@ -37,6 +37,7 @@ interface HighlightsPanelProps {
   relayPool?: RelayPool | null
   eventStore?: IEventStore | null
   settings?: UserSettings
+  isMobile?: boolean
 }
 
 export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
@@ -56,7 +57,8 @@ export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
   followedPubkeys = new Set(),
   relayPool,
   eventStore,
-  settings
+  settings,
+  isMobile = false
 }) => {
   const [showHighlights, setShowHighlights] = useState(true)
   const [localHighlights, setLocalHighlights] = useState(highlights)
@@ -125,6 +127,7 @@ export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
         onRefresh={onRefresh}
         onToggleCollapse={onToggleCollapse}
         onHighlightVisibilityChange={onHighlightVisibilityChange}
+        isMobile={isMobile}
       />
 
       {loading && filteredHighlights.length === 0 ? (

src/components/HighlightsPanel/HighlightsPanelHeader.tsx

@@ -13,6 +13,7 @@ interface HighlightsPanelHeaderProps {
   onRefresh?: () => void
   onToggleCollapse: () => void
   onHighlightVisibilityChange?: (visibility: HighlightVisibility) => void
+  isMobile?: boolean
 }
 
 const HighlightsPanelHeader: React.FC<HighlightsPanelHeaderProps> = ({
@@ -24,7 +25,8 @@ const HighlightsPanelHeader: React.FC<HighlightsPanelHeaderProps> = ({
   onToggleHighlights,
   onRefresh,
   onToggleCollapse,
-  onHighlightVisibilityChange
+  onHighlightVisibilityChange,
+  isMobile = false
 }) => {
   return (
     <div className="highlights-header">
@@ -101,14 +103,16 @@ const HighlightsPanelHeader: React.FC<HighlightsPanelHeaderProps> = ({
             />
           )}
         </div>
-        <IconButton
-          icon={faChevronRight}
-          onClick={onToggleCollapse}
-          title="Collapse highlights panel"
-          ariaLabel="Collapse highlights panel"
-          variant="ghost"
-          style={{ transform: 'rotate(180deg)' }}
-        />
+        {!isMobile && (
+          <IconButton
+            icon={faChevronRight}
+            onClick={onToggleCollapse}
+            title="Collapse highlights panel"
+            ariaLabel="Collapse highlights panel"
+            variant="ghost"
+            style={{ transform: 'rotate(180deg)' }}
+          />
+        )}
       </div>
     </div>
   )

src/components/LoginOptions.tsx

@@ -124,7 +124,7 @@ const LoginOptions: React.FC = () => {
       <div className="login-content">
         <h2 className="login-title">Hi! I'm Boris.</h2>
         <p className="login-description">
-          Connect your npub to see your bookmarks, explore long-form articles, and create <mark className="login-highlight">your own highlights</mark>.
+          <mark className="login-highlight">Connect your npub</mark> to see your bookmarks, explore long-form articles, and create <mark className="login-highlight">your own highlights.</mark>
         </p>
         
         <div className="login-buttons">

src/components/Me.tsx

@@ -1,6 +1,7 @@
-import React, { useState, useEffect } from 'react'
+import React, { useState, useEffect, useCallback } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faHighlighter, faBookmark, faPenToSquare, faLink, faLayerGroup, faBars } from '@fortawesome/free-solid-svg-icons'
+import { faHighlighter, faBookmark, faPenToSquare, faLink, faLayerGroup } from '@fortawesome/free-solid-svg-icons'
+import { faClock } from '@fortawesome/free-regular-svg-icons'
 import { Hooks } from 'applesauce-react'
 import { IEventStore } from 'applesauce-core'
 import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
@@ -23,7 +24,7 @@ import { getCachedMeData, updateCachedHighlights } from '../services/meCache'
 import { faBooks } from '../icons/customIcons'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
-import { groupIndividualBookmarks, hasContent, hasCreationDate } from '../utils/bookmarkUtils'
+import { groupIndividualBookmarks, hasContent, hasCreationDate, sortIndividualBookmarks } from '../utils/bookmarkUtils'
 import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
 import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
 import ReadingProgressFilters, { ReadingProgressFilterType } from './ReadingProgressFilters'
@@ -42,7 +43,7 @@ interface MeProps {
   settings: UserSettings
 }
 
-type TabType = 'highlights' | 'reading-list' | 'reads' | 'links' | 'writings'
+type TabType = 'highlights' | 'bookmarks' | 'reads' | 'links' | 'writings'
 
 // Valid reading progress filters
 const VALID_FILTERS: ReadingProgressFilterType[] = ['all', 'unopened', 'started', 'reading', 'completed', 'highlighted', 'archive']
@@ -57,7 +58,7 @@ const Me: React.FC<MeProps> = ({
   const activeAccount = Hooks.useActiveAccount()
   const navigate = useNavigate()
   const { filter: urlFilter } = useParams<{ filter?: string }>()
-  const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
+  const activeTab = propActiveTab || 'highlights'
   
   // Only for own profile
   const viewingPubkey = activeAccount?.pubkey
@@ -129,13 +130,6 @@ const Me: React.FC<MeProps> = ({
     }
   }, [])
 
-  // Update local state when prop changes
-  useEffect(() => {
-    if (propActiveTab) {
-      setActiveTab(propActiveTab)
-    }
-  }, [propActiveTab])
-
   // Sync filter state with URL changes
   useEffect(() => {
     const normalized = urlFilter === 'emoji' ? 'archive' : urlFilter
@@ -150,15 +144,15 @@ const Me: React.FC<MeProps> = ({
     setReadingProgressFilter(filter)
     if (activeTab === 'reads') {
       if (filter === 'all') {
-        navigate('/me/reads', { replace: true })
+        navigate('/my/reads', { replace: true })
       } else {
-        navigate(`/me/reads/${filter}`, { replace: true })
+        navigate(`/my/reads/${filter}`, { replace: true })
       }
     } else if (activeTab === 'links') {
       if (filter === 'all') {
-        navigate('/me/links', { replace: true })
+        navigate('/my/links', { replace: true })
       } else {
-        navigate(`/me/links/${filter}`, { replace: true })
+        navigate(`/my/links/${filter}`, { replace: true })
       }
     }
   }
@@ -205,15 +199,15 @@ const Me: React.FC<MeProps> = ({
   }, [viewingPubkey, relayPool, eventStore, refreshTrigger])
 
   // Tab-specific loading functions
-  const loadHighlightsTab = async () => {
+  const loadHighlightsTab = useCallback(async () => {
     if (!viewingPubkey) return
     
     // Highlights come from controller subscription (sync effect handles it)
     setLoadedTabs(prev => new Set(prev).add('highlights'))
     setLoading(false)
-  }
+  }, [viewingPubkey])
 
-  const loadWritingsTab = async () => {
+  const loadWritingsTab = useCallback(async () => {
     if (!viewingPubkey) return
     
     try {
@@ -230,28 +224,29 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load writings:', err)
       setLoading(false)
     }
-  }
+  }, [viewingPubkey, relayPool, eventStore, refreshTrigger])
 
-  const loadReadingListTab = async () => {
+  const loadReadingListTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('reading-list')
-    
-    try {
+    setLoadedTabs(prev => {
+      const hasBeenLoaded = prev.has('bookmarks')
       if (!hasBeenLoaded) setLoading(true)
-      // Bookmarks come from centralized loading in App.tsx
-      setLoadedTabs(prev => new Set(prev).add('reading-list'))
-    } catch (err) {
-      console.error('Failed to load reading list:', err)
-    } finally {
-      if (!hasBeenLoaded) setLoading(false)
-    }
-  }
+      return new Set(prev).add('bookmarks')
+    })
+    
+    // Always turn off loading after a tick
+    setTimeout(() => setLoading(false), 0)
+  }, [viewingPubkey, activeAccount])
 
-  const loadReadsTab = async () => {
+  const loadReadsTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('reads')
+    let hasBeenLoaded = false
+    setLoadedTabs(prev => {
+      hasBeenLoaded = prev.has('reads')
+      return prev
+    })
     
     try {
       if (!hasBeenLoaded) setLoading(true)
@@ -270,12 +265,16 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load reads:', err)
       if (!hasBeenLoaded) setLoading(false)
     }
-  }
+  }, [viewingPubkey, activeAccount, relayPool, eventStore])
 
-  const loadLinksTab = async () => {
+  const loadLinksTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('links')
+    let hasBeenLoaded = false
+    setLoadedTabs(prev => {
+      hasBeenLoaded = prev.has('links')
+      return prev
+    })
     
     try {
       if (!hasBeenLoaded) setLoading(true)
@@ -310,10 +309,10 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load links:', err)
       if (!hasBeenLoaded) setLoading(false)
     }
-  }
+  }, [viewingPubkey, activeAccount, bookmarks, relayPool, readingProgressMap])
 
   // Load active tab data
-  useEffect(() => {
+  const loadActiveTab = useCallback(() => {
     if (!viewingPubkey || !activeTab) {
       setLoading(false)
       return
@@ -336,7 +335,7 @@ const Me: React.FC<MeProps> = ({
       case 'writings':
         loadWritingsTab()
         break
-      case 'reading-list':
+      case 'bookmarks':
         loadReadingListTab()
         break
       case 'reads':
@@ -346,8 +345,11 @@ const Me: React.FC<MeProps> = ({
         loadLinksTab()
         break
     }
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [activeTab, viewingPubkey, refreshTrigger, bookmarks])
+  }, [viewingPubkey, activeTab, loadHighlightsTab, loadWritingsTab, loadReadingListTab, loadReadsTab, loadLinksTab])
+
+  useEffect(() => {
+    loadActiveTab()
+  }, [loadActiveTab])
 
   // Sync myHighlights from controller
   useEffect(() => {
@@ -417,7 +419,7 @@ const Me: React.FC<MeProps> = ({
     const mockEvent = {
       id: item.id,
       pubkey: item.author || '',
-      created_at: item.readingTimestamp || Math.floor(Date.now() / 1000),
+      created_at: item.readingTimestamp || 0,
       kind: 1,
       tags: [] as string[][],
       content: item.title || item.url || 'Untitled',
@@ -564,30 +566,21 @@ const Me: React.FC<MeProps> = ({
     ? buildArchiveOnly(linksWithProgress, { kind: 'external' })
     : []
 
-  // Debug logs for archive filter issues
-  if (readingProgressFilter === 'archive') {
-    const ids = Array.from(new Set([
-      ...archiveController.getMarkedIds(),
-      ...readingProgressController.getMarkedAsReadIds()
-    ]))
-    const readIds = new Set(reads.map(i => i.id))
-    const matches = ids.filter(id => readIds.has(id))
-    const nonMatches = ids.filter(id => !readIds.has(id)).slice(0, 5)
-    console.log('[archive][me] counts', {
-      reads: reads.length,
-      filteredReads: filteredReads.length,
-      links: links.length,
-      linksWithProgress: linksWithProgress.length,
-      filteredLinks: filteredLinks.length,
-      markedIds: ids.length,
-      sampleMarked: ids.slice(0, 3),
-      matches: matches.length,
-      nonMatches
-    })
+  const getFilterTitle = (filter: BookmarkFilterType): string => {
+    const titles: Record<BookmarkFilterType, string> = {
+      'all': 'All Bookmarks',
+      'article': 'Bookmarked Reads',
+      'external': 'Bookmarked Links',
+      'video': 'Bookmarked Videos',
+      'note': 'Bookmarked Notes',
+      'web': 'Web Bookmarks'
+    }
+    return titles[filter]
   }
+
   const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = 
     groupingMode === 'flat'
-      ? [{ key: 'all', title: `All Bookmarks (${filteredBookmarks.length})`, items: filteredBookmarks }]
+      ? [{ key: 'all', title: getFilterTitle(bookmarkFilter), items: sortIndividualBookmarks(filteredBookmarks) }]
       : [
           { key: 'nip51-private', title: 'Private Bookmarks', items: groups.nip51Private },
           { key: 'nip51-public', title: 'My Bookmarks', items: groups.nip51Public },
@@ -629,7 +622,7 @@ const Me: React.FC<MeProps> = ({
           </div>
         )
 
-      case 'reading-list':
+      case 'bookmarks':
         if (showSkeletons) {
           return (
             <div className="bookmarks-list">
@@ -684,7 +677,7 @@ const Me: React.FC<MeProps> = ({
               borderTop: '1px solid var(--border-color)'
             }}>
               <IconButton
-                icon={groupingMode === 'grouped' ? faLayerGroup : faBars}
+                icon={groupingMode === 'grouped' ? faLayerGroup : faClock}
                 onClick={toggleGroupingMode}
                 title={groupingMode === 'grouped' ? 'Show flat chronological list' : 'Show grouped by source'}
                 ariaLabel={groupingMode === 'grouped' ? 'Switch to flat view' : 'Switch to grouped view'}
@@ -850,6 +843,7 @@ const Me: React.FC<MeProps> = ({
                 post={post}
                 href={getPostUrl(post)}
                 readingProgress={getWritingReadingProgress(post)}
+                hideBotByName={settings.hideBotArticlesByName !== false}
               />
             ))}
           </div>
@@ -873,15 +867,15 @@ const Me: React.FC<MeProps> = ({
           <button
             className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
             data-tab="highlights"
-            onClick={() => navigate('/me/highlights')}
+            onClick={() => navigate('/my/highlights')}
           >
             <FontAwesomeIcon icon={faHighlighter} />
             <span className="tab-label">Highlights</span>
           </button>
           <button
-            className={`me-tab ${activeTab === 'reading-list' ? 'active' : ''}`}
-            data-tab="reading-list"
-            onClick={() => navigate('/me/reading-list')}
+            className={`me-tab ${activeTab === 'bookmarks' ? 'active' : ''}`}
+            data-tab="bookmarks"
+            onClick={() => navigate('/my/bookmarks')}
           >
             <FontAwesomeIcon icon={faBookmark} />
             <span className="tab-label">Bookmarks</span>
@@ -889,7 +883,7 @@ const Me: React.FC<MeProps> = ({
           <button
             className={`me-tab ${activeTab === 'reads' ? 'active' : ''}`}
             data-tab="reads"
-            onClick={() => navigate('/me/reads')}
+            onClick={() => navigate('/my/reads')}
           >
             <FontAwesomeIcon icon={faBooks} />
             <span className="tab-label">Reads</span>
@@ -897,7 +891,7 @@ const Me: React.FC<MeProps> = ({
           <button
             className={`me-tab ${activeTab === 'links' ? 'active' : ''}`}
             data-tab="links"
-            onClick={() => navigate('/me/links')}
+            onClick={() => navigate('/my/links')}
           >
             <FontAwesomeIcon icon={faLink} />
             <span className="tab-label">Links</span>
@@ -905,7 +899,7 @@ const Me: React.FC<MeProps> = ({
           <button
             className={`me-tab ${activeTab === 'writings' ? 'active' : ''}`}
             data-tab="writings"
-            onClick={() => navigate('/me/writings')}
+            onClick={() => navigate('/my/writings')}
           >
             <FontAwesomeIcon icon={faPenToSquare} />
             <span className="tab-label">Writings</span>

src/components/Profile.tsx

@@ -1,4 +1,4 @@
-import React, { useState, useEffect, useCallback } from 'react'
+import React, { useState, useEffect, useCallback, useMemo } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faHighlighter, faPenToSquare } from '@fortawesome/free-solid-svg-icons'
 import { IEventStore } from 'applesauce-core'
@@ -6,9 +6,7 @@ import { RelayPool } from 'applesauce-relay'
 import { nip19 } from 'nostr-tools'
 import { useNavigate } from 'react-router-dom'
 import { HighlightItem } from './HighlightItem'
-import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
-import { fetchHighlights } from '../services/highlightService'
-import { RELAYS } from '../config/relays'
+import { BlogPostPreview } from '../services/exploreService'
 import { KINDS } from '../config/kinds'
 import AuthorCard from './AuthorCard'
 import BlogPostCard from './BlogPostCard'
@@ -20,6 +18,8 @@ import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
 import { Hooks } from 'applesauce-react'
 import { readingProgressController } from '../services/readingProgressController'
+import { writingsController } from '../services/writingsController'
+import { highlightsController } from '../services/highlightsController'
 
 interface ProfileProps {
   relayPool: RelayPool
@@ -57,6 +57,15 @@ const Profile: React.FC<ProfileProps> = ({
     [pubkey]
   )
 
+  // Sort writings by publication date, newest first
+  const sortedWritings = useMemo(() => {
+    return cachedWritings.slice().sort((a, b) => {
+      const timeA = a.published || a.event.created_at
+      const timeB = b.published || b.event.created_at
+      return timeB - timeA
+    })
+  }, [cachedWritings])
+
   // Update local state when prop changes
   useEffect(() => {
     if (propActiveTab) {
@@ -94,28 +103,17 @@ const Profile: React.FC<ProfileProps> = ({
     })
   }, [activeAccount?.pubkey, relayPool, eventStore, refreshTrigger])
 
-  // Background fetch to populate event store (non-blocking)
+  // Background fetch via controllers to populate event store
   useEffect(() => {
     if (!pubkey || !relayPool || !eventStore) return
     
+    // Start controllers to fetch and populate event store
+    // Controllers handle streaming, deduplication, and storage
+    highlightsController.start({ relayPool, eventStore, pubkey })
+      .catch(err => console.warn('⚠️ [Profile] Failed to fetch highlights:', err))
     
-    // Fetch highlights in background
-    fetchHighlights(relayPool, pubkey, undefined, undefined, false, eventStore)
-      .then(() => {
-        // Highlights fetched
-      })
-      .catch(err => {
-        console.warn('⚠️ [Profile] Failed to fetch highlights:', err)
-      })
-    
-    // Fetch writings in background (no limit for single user profile)
-    fetchBlogPostsFromAuthors(relayPool, [pubkey], RELAYS, undefined, null)
-      .then(writings => {
-        writings.forEach(w => eventStore.add(w.event))
-      })
-      .catch(err => {
-        console.warn('⚠️ [Profile] Failed to fetch writings:', err)
-      })
+    writingsController.start({ relayPool, eventStore, pubkey, force: refreshTrigger > 0 })
+      .catch(err => console.warn('⚠️ [Profile] Failed to fetch writings:', err))
   }, [pubkey, relayPool, eventStore, refreshTrigger])
 
   // Pull-to-refresh
@@ -168,7 +166,7 @@ const Profile: React.FC<ProfileProps> = ({
   }
 
   const npub = nip19.npubEncode(pubkey)
-  const showSkeletons = cachedHighlights.length === 0 && cachedWritings.length === 0
+  const showSkeletons = cachedHighlights.length === 0 && sortedWritings.length === 0
 
   const renderTabContent = () => {
     switch (activeTab) {
@@ -209,13 +207,13 @@ const Profile: React.FC<ProfileProps> = ({
             </div>
           )
         }
-        return cachedWritings.length === 0 ? (
+        return sortedWritings.length === 0 ? (
           <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
             No articles written yet.
           </div>
         ) : (
           <div className="explore-grid">
-            {cachedWritings.map((post) => (
+            {sortedWritings.map((post) => (
               <BlogPostCard
                 key={post.event.id}
                 post={post}

src/components/ReaderHeader.tsx

@@ -20,6 +20,7 @@ interface ReaderHeaderProps {
   settings?: UserSettings
   highlights?: Highlight[]
   highlightVisibility?: HighlightVisibility
+  onHighlightCountClick?: () => void
 }
 
 const ReaderHeader: React.FC<ReaderHeaderProps> = ({
@@ -32,7 +33,8 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
   highlightCount,
   settings,
   highlights = [],
-  highlightVisibility = { nostrverse: true, friends: true, mine: true }
+  highlightVisibility = { nostrverse: true, friends: true, mine: true },
+  onHighlightCountClick
 }) => {
   const cachedImage = useImageCache(image)
   const { textColor } = useAdaptiveTextColor(cachedImage)
@@ -107,8 +109,10 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
                 )}
                 {hasHighlights && (
                   <div 
-                    className="highlight-indicator"
+                    className="highlight-indicator clickable"
                     style={getHighlightIndicatorStyles(true)}
+                    onClick={onHighlightCountClick}
+                    title="Open highlights sidebar"
                   >
                     <FontAwesomeIcon icon={faHighlighter} />
                     <span>{highlightCount} highlight{highlightCount !== 1 ? 's' : ''}</span>
@@ -152,8 +156,10 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
             )}
             {hasHighlights && (
               <div 
-                className="highlight-indicator"
+                className="highlight-indicator clickable"
                 style={getHighlightIndicatorStyles(false)}
+                onClick={onHighlightCountClick}
+                title="Open highlights sidebar"
               >
                 <FontAwesomeIcon icon={faHighlighter} />
                 <span>{highlightCount} highlight{highlightCount !== 1 ? 's' : ''}</span>

src/components/RouteDebug.tsx

@@ -20,7 +20,7 @@ export default function RouteDebug() {
       // Unexpected during deep-link refresh tests
       console.warn('[RouteDebug] unexpected root redirect', info)
     } else {
-      console.debug('[RouteDebug]', info)
+      // silent
     }
   }, [location, matchArticle])
 

src/components/Settings.tsx

@@ -6,11 +6,13 @@ import IconButton from './IconButton'
 import { loadFont } from '../utils/fontLoader'
 import ThemeSettings from './Settings/ThemeSettings'
 import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
+import MediaDisplaySettings from './Settings/MediaDisplaySettings'
 import ExploreSettings from './Settings/ExploreSettings'
 import LayoutBehaviorSettings from './Settings/LayoutBehaviorSettings'
 import ZapSettings from './Settings/ZapSettings'
 import RelaySettings from './Settings/RelaySettings'
 import PWASettings from './Settings/PWASettings'
+import TTSSettings from './Settings/TTSSettings'
 import { useRelayStatus } from '../hooks/useRelayStatus'
 import VersionFooter from './VersionFooter'
 
@@ -39,9 +41,16 @@ const DEFAULT_SETTINGS: UserSettings = {
   useLocalRelayAsCache: true,
   rebroadcastToAllRelays: false,
   paragraphAlignment: 'justify',
+  fullWidthImages: true,
+  renderVideoLinksAsEmbeds: true,
   syncReadingPosition: true,
+  autoScrollToReadingPosition: true,
   autoMarkAsReadOnCompletion: false,
   hideBookmarksWithoutCreationDate: true,
+  ttsUseSystemLanguage: false,
+  ttsDetectContentLanguage: true,
+  ttsLanguageMode: 'content',
+  ttsDefaultSpeed: 2.1,
 }
 
 interface SettingsProps {
@@ -169,8 +178,10 @@ const Settings: React.FC<SettingsProps> = ({ settings, onSave, onClose, relayPoo
       <div className="settings-content">
         <ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
         <ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
+        <MediaDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
         <ExploreSettings settings={localSettings} onUpdate={handleUpdate} />
         <ZapSettings settings={localSettings} onUpdate={handleUpdate} />
+        <TTSSettings settings={localSettings} onUpdate={handleUpdate} />
         <LayoutBehaviorSettings settings={localSettings} onUpdate={handleUpdate} />
         <PWASettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
         <RelaySettings relayStatuses={relayStatuses} onClose={onClose} />

src/components/Settings/ExploreSettings.tsx

@@ -51,6 +51,19 @@ const ExploreSettings: React.FC<ExploreSettingsProps> = ({ settings, onUpdate })
           />
         </div>
       </div>
+
+      <div className="setting-group">
+        <label htmlFor="hideBotArticlesByName" className="checkbox-label">
+          <input
+            id="hideBotArticlesByName"
+            type="checkbox"
+            checked={settings.hideBotArticlesByName !== false}
+            onChange={(e) => onUpdate({ hideBotArticlesByName: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Hide content posted by bots</span>
+        </label>
+      </div>
     </div>
   )
 }

src/components/Settings/LayoutBehaviorSettings.tsx

@@ -118,6 +118,19 @@ const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ setting
         </label>
       </div>
 
+      <div className="setting-group">
+        <label htmlFor="autoScrollToReadingPosition" className="checkbox-label">
+          <input
+            id="autoScrollToReadingPosition"
+            type="checkbox"
+            checked={settings.autoScrollToReadingPosition !== false}
+            onChange={(e) => onUpdate({ autoScrollToReadingPosition: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Auto-scroll to saved reading position</span>
+        </label>
+      </div>
+
       <div className="setting-group">
         <label htmlFor="autoMarkAsReadOnCompletion" className="checkbox-label">
           <input

src/components/Settings/MediaDisplaySettings.tsx

@@ -0,0 +1,43 @@
+import React from 'react'
+import { UserSettings } from '../../services/settingsService'
+
+interface MediaDisplaySettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+}
+
+const MediaDisplaySettings: React.FC<MediaDisplaySettingsProps> = ({ settings, onUpdate }) => {
+  return (
+    <div className="settings-section">
+      <h3 className="section-title">Media Display</h3>
+      
+      <div className="setting-group">
+        <label htmlFor="fullWidthImages" className="checkbox-label">
+          <input
+            id="fullWidthImages"
+            type="checkbox"
+            checked={settings.fullWidthImages === true}
+            onChange={(e) => onUpdate({ fullWidthImages: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Full-width images in articles</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="renderVideoLinksAsEmbeds" className="checkbox-label">
+          <input
+            id="renderVideoLinksAsEmbeds"
+            type="checkbox"
+            checked={settings.renderVideoLinksAsEmbeds === true}
+            onChange={(e) => onUpdate({ renderVideoLinksAsEmbeds: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Render video links as embeds</span>
+        </label>
+      </div>
+    </div>
+  )
+}
+
+export default MediaDisplaySettings

src/components/Settings/PWASettings.tsx

@@ -33,7 +33,13 @@ const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }
 
   const handleLinkClick = (url: string) => {
     if (onClose) onClose()
-    navigate(`/r/${encodeURIComponent(url)}`)
+    // If it's an internal route (starts with /), navigate directly
+    if (url.startsWith('/')) {
+      navigate(url)
+    } else {
+      // External URL: wrap with /r/ path
+      navigate(`/r/${encodeURIComponent(url)}`)
+    }
   }
 
   const handleClearCache = async () => {
@@ -151,7 +157,7 @@ const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }
               >
                 here
               </a>
-              {' and '}
+              {', '}
               <a 
                 onClick={(e) => {
                   e.preventDefault()
@@ -161,6 +167,16 @@ const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }
               >
                 here
               </a>
+              {', and '}
+              <a 
+                onClick={(e) => {
+                  e.preventDefault()
+                  handleLinkClick('/a/naddr1qvzqqqr4gupzq3svyhng9ld8sv44950j957j9vchdktj7cxumsep9mvvjthc2pjuqq9hyetvv9uj6um9w36hq9mgjg8')
+                }}
+                style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
+              >
+                here
+              </a>
               .
             </p>
           </div>

src/components/Settings/ReadingDisplaySettings.tsx

@@ -59,6 +59,7 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
         </div>
       </div>
 
+
       <div className="setting-group setting-inline">
         <label>Default Highlight Visibility</label>
         <div className="highlight-level-toggles">

src/components/Settings/TTSSettings.tsx

@@ -0,0 +1,86 @@
+import React from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faGauge } from '@fortawesome/free-solid-svg-icons'
+import { UserSettings } from '../../services/settingsService'
+import TTSControls from '../TTSControls'
+
+interface TTSSettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+}
+
+const SPEED_OPTIONS = [0.8, 1, 1.2, 1.4, 1.6, 1.8, 2, 2.1, 2.4, 2.8, 3]
+const EXAMPLE_TEXT = "Boris aims to be a calm reader app with clean typography, beautiful design, and a focus on readability. Boris does not and will never have ads, trackers, paywalls, subscriptions, or any other distractions."
+
+const TTSSettings: React.FC<TTSSettingsProps> = ({ settings, onUpdate }) => {
+  const currentSpeed = settings.ttsDefaultSpeed || 2.1
+
+  const handleCycleSpeed = () => {
+    const currentIndex = SPEED_OPTIONS.indexOf(currentSpeed)
+    const nextIndex = (currentIndex + 1) % SPEED_OPTIONS.length
+    onUpdate({ ttsDefaultSpeed: SPEED_OPTIONS[nextIndex] })
+  }
+
+  return (
+    <div className="settings-section">
+      <h3 className="section-title">Text-to-Speech</h3>
+      
+      <div className="setting-group setting-inline">
+        <label>Default Playback Speed</label>
+        <div className="setting-buttons">
+          <button
+            type="button"
+            className="article-menu-btn"
+            onClick={handleCycleSpeed}
+            title="Cycle speed"
+          >
+            <FontAwesomeIcon icon={faGauge} />
+            <span>{currentSpeed}x</span>
+          </button>
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label>Speaker language</label>
+        <div className="setting-control">
+          <select
+            value={settings.ttsLanguageMode || 'content'}
+            onChange={e => {
+              const value = e.target.value
+              onUpdate({ 
+                ttsLanguageMode: value,
+                ttsUseSystemLanguage: value === 'system',
+                ttsDetectContentLanguage: value === 'content'
+              })
+            }}
+            className="setting-select"
+          >
+            <option value="system">System Language</option>
+            <option value="content">Content (auto-detect)</option>
+            <option disabled>────────────</option>
+            <option value="en-US">English (American)</option>
+            <option value="en-GB">English (British)</option>
+            <option value="zh">Mandarin Chinese</option>
+            <option value="es">Spanish</option>
+            <option value="hi">Hindi</option>
+            <option value="ar">Arabic</option>
+            <option value="fr">French</option>
+            <option value="pt">Portuguese</option>
+            <option value="de">German</option>
+            <option value="ja">Japanese</option>
+            <option value="ru">Russian</option>
+          </select>
+        </div>
+      </div>
+
+      <div className="setting-group">
+        <div style={{ padding: '0.75rem', backgroundColor: 'var(--color-bg)', borderRadius: '4px', marginBottom: '0.75rem', fontSize: '0.95rem', lineHeight: '1.5' }}>
+          {EXAMPLE_TEXT}
+        </div>
+        <TTSControls text={EXAMPLE_TEXT} settings={settings} />
+      </div>
+    </div>
+  )
+}
+
+export default TTSSettings

src/components/ShareTargetHandler.tsx

@@ -0,0 +1,99 @@
+import { useEffect, useState } from 'react'
+import { useNavigate, useLocation } from 'react-router-dom'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faSpinner } from '@fortawesome/free-solid-svg-icons'
+import { Hooks } from 'applesauce-react'
+import { RelayPool } from 'applesauce-relay'
+import { createWebBookmark } from '../services/webBookmarkService'
+import { getActiveRelayUrls } from '../services/relayManager'
+import { useToast } from '../hooks/useToast'
+
+interface ShareTargetHandlerProps {
+  relayPool: RelayPool
+}
+
+/**
+ * Handles incoming shared URLs from the Web Share Target API.
+ * Auto-saves the shared URL as a web bookmark (NIP-B0).
+ */
+export default function ShareTargetHandler({ relayPool }: ShareTargetHandlerProps) {
+  const navigate = useNavigate()
+  const location = useLocation()
+  const activeAccount = Hooks.useActiveAccount()
+  const { showToast } = useToast()
+  const [processing, setProcessing] = useState(false)
+  const [waitingForLogin, setWaitingForLogin] = useState(false)
+
+  useEffect(() => {
+    const handleSharedContent = async () => {
+      // Parse query parameters
+      const params = new URLSearchParams(location.search)
+      const link = params.get('link')
+      const title = params.get('title')
+      const text = params.get('text')
+
+      // Validate we have a URL
+      if (!link) {
+        showToast('No URL to save')
+        navigate('/')
+        return
+      }
+
+      // If no active account, wait for login
+      if (!activeAccount) {
+        setWaitingForLogin(true)
+        showToast('Please log in to save this bookmark')
+        return
+      }
+
+      // We have account and URL, proceed with saving
+      if (!processing) {
+        setProcessing(true)
+        try {
+          await createWebBookmark(
+            link,
+            title || undefined,
+            text || undefined,
+            undefined,
+            activeAccount,
+            relayPool,
+            getActiveRelayUrls(relayPool)
+          )
+          showToast('Bookmark saved!')
+          navigate('/my/links')
+        } catch (err) {
+          console.error('Failed to save shared bookmark:', err)
+          showToast('Failed to save bookmark')
+          navigate('/')
+        } finally {
+          setProcessing(false)
+        }
+      }
+    }
+
+    handleSharedContent()
+  }, [activeAccount, location.search, navigate, relayPool, showToast, processing])
+
+  // Show waiting for login state
+  if (waitingForLogin && !activeAccount) {
+    return (
+      <div className="flex items-center justify-center h-screen">
+        <div className="text-center">
+          <FontAwesomeIcon icon={faSpinner} spin className="text-4xl mb-4" />
+          <p className="text-lg">Waiting for login...</p>
+        </div>
+      </div>
+    )
+  }
+
+  // Show processing state
+  return (
+    <div className="flex items-center justify-center h-screen">
+      <div className="text-center">
+        <FontAwesomeIcon icon={faSpinner} spin className="text-4xl mb-4" />
+        <p className="text-lg">Saving bookmark...</p>
+      </div>
+    </div>
+  )
+}
+

src/components/SidebarHeader.tsx

@@ -1,7 +1,7 @@
 import React from 'react'
 import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faChevronRight, faRightFromBracket, faUserCircle, faGear, faHome, faNewspaper, faTimes } from '@fortawesome/free-solid-svg-icons'
+import { faChevronRight, faRightFromBracket, faUserCircle, faGear, faHome, faPersonHiking } from '@fortawesome/free-solid-svg-icons'
 import { Hooks } from 'applesauce-react'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
@@ -36,70 +36,61 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
   return (
     <>
       <div className="sidebar-header-bar">
-        {isMobile ? (
-          <IconButton
-            icon={faTimes}
-            onClick={onToggleCollapse}
-            title="Close sidebar"
-            ariaLabel="Close sidebar"
-            variant="ghost"
-            className="mobile-close-btn"
-          />
-        ) : (
-          <button 
-            onClick={onToggleCollapse}
-            className="toggle-sidebar-btn"
-            title="Collapse bookmarks sidebar"
-            aria-label="Collapse bookmarks sidebar"
-          >
-            <FontAwesomeIcon icon={faChevronRight} />
-          </button>
-        )}
-        <div className="sidebar-header-right">
         {activeAccount && (
-          <div 
-            className="profile-avatar" 
+          <button
+            className="profile-avatar-button" 
             title={getUserDisplayName()}
-            onClick={() => navigate('/me')}
-            style={{ cursor: 'pointer' }}
+            onClick={() => navigate('/my')}
+            aria-label={`Profile: ${getUserDisplayName()}`}
           >
             {profileImage ? (
               <img src={profileImage} alt={getUserDisplayName()} />
             ) : (
               <FontAwesomeIcon icon={faUserCircle} />
             )}
-          </div>
+          </button>
         )}
-        <IconButton
-          icon={faHome}
-          onClick={() => navigate('/')}
-          title="Home"
-          ariaLabel="Home"
-          variant="ghost"
-        />
-        <IconButton
-          icon={faNewspaper}
-          onClick={() => navigate('/explore')}
-          title="Explore"
-          ariaLabel="Explore"
-          variant="ghost"
-        />
-        <IconButton
-          icon={faGear}
-          onClick={onOpenSettings}
-          title="Settings"
-          ariaLabel="Settings"
-          variant="ghost"
-        />
-        {activeAccount && (
+        <div className="sidebar-header-right">
           <IconButton
-            icon={faRightFromBracket}
-            onClick={onLogout}
-            title="Logout"
-            ariaLabel="Logout"
+            icon={faHome}
+            onClick={() => navigate('/')}
+            title="Home"
+            ariaLabel="Home"
             variant="ghost"
           />
-        )}
+          <IconButton
+            icon={faGear}
+            onClick={onOpenSettings}
+            title="Settings"
+            ariaLabel="Settings"
+            variant="ghost"
+          />
+          <IconButton
+            icon={faPersonHiking}
+            onClick={() => navigate('/explore')}
+            title="Explore"
+            ariaLabel="Explore"
+            variant="ghost"
+          />
+          {activeAccount && (
+            <IconButton
+              icon={faRightFromBracket}
+              onClick={onLogout}
+              title="Logout"
+              ariaLabel="Logout"
+              variant="ghost"
+            />
+          )}
+          {!isMobile && (
+            <button 
+              onClick={onToggleCollapse}
+              className="toggle-sidebar-btn"
+              title="Collapse bookmarks sidebar"
+              aria-label="Collapse bookmarks sidebar"
+            >
+              <FontAwesomeIcon icon={faChevronRight} />
+            </button>
+          )}
         </div>
       </div>
     </>

src/components/Support.tsx

@@ -2,7 +2,7 @@ import React, { useEffect, useState } from 'react'
 import { RelayPool } from 'applesauce-relay'
 import { IEventStore } from 'applesauce-core'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faHeart, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
+import { faHeart, faUserCircle } from '@fortawesome/free-solid-svg-icons'
 import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
 import { fetchProfiles } from '../services/profileService'
 import { UserSettings } from '../services/settingsService'
@@ -21,7 +21,7 @@ type SupporterProfile = ZapSender
 
 const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) => {
   const [supporters, setSupporters] = useState<SupporterProfile[]>([])
-  const [loading, setLoading] = useState(true)
+  const [loading, setLoading] = useState(false)
 
   useEffect(() => {
     const loadSupporters = async () => {
@@ -31,7 +31,8 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
         
         if (zappers.length > 0) {
           const pubkeys = zappers.map(z => z.pubkey)
-          await fetchProfiles(relayPool, eventStore, pubkeys, settings)
+          // Fetch profiles in background without blocking
+          fetchProfiles(relayPool, eventStore, pubkeys, settings).catch(() => {})
         }
         
         setSupporters(zappers)
@@ -45,14 +46,6 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
     loadSupporters()
   }, [relayPool, eventStore, settings])
 
-  if (loading) {
-    return (
-      <div className="flex items-center justify-center min-h-screen p-4">
-        <FontAwesomeIcon icon={faSpinner} spin size="2x" className="text-zinc-400" />
-      </div>
-    )
-  }
-
   return (
     <div className="min-h-screen" style={{ backgroundColor: 'var(--color-bg)', color: 'var(--color-text)' }}>
       <div className="max-w-5xl mx-auto px-4 py-12 md:py-16">
@@ -82,7 +75,32 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
           </p>
         </div>
 
-        {supporters.length === 0 ? (
+        {loading ? (
+          <>
+            {/* Loading Skeletons */}
+            <div className="mb-16 md:mb-20">
+              <h2 className="text-2xl md:text-3xl font-semibold mb-8 md:mb-10 text-center" style={{ color: 'var(--color-text)' }}>
+                Legends
+              </h2>
+              <div className="grid grid-cols-2 sm:grid-cols-3 md:grid-cols-4 lg:grid-cols-5 gap-8 md:gap-10">
+                {Array.from({ length: 3 }).map((_, i) => (
+                  <SupporterSkeleton key={`whale-${i}`} isWhale={true} />
+                ))}
+              </div>
+            </div>
+
+            <div className="mb-12">
+              <h2 className="text-xl md:text-2xl font-semibold mb-8 text-center" style={{ color: 'var(--color-text)' }}>
+                Supporters
+              </h2>
+              <div className="grid grid-cols-4 sm:grid-cols-6 md:grid-cols-8 lg:grid-cols-10 gap-4 md:gap-5">
+                {Array.from({ length: 12 }).map((_, i) => (
+                  <SupporterSkeleton key={`supporter-${i}`} isWhale={false} />
+                ))}
+              </div>
+            </div>
+          </>
+        ) : supporters.length === 0 ? (
           <div className="text-center py-12" style={{ color: 'var(--color-text-muted)' }}>
             <p>No supporters yet. Be the first to zap Boris!</p>
           </div>
@@ -231,5 +249,55 @@ const SupporterCard: React.FC<SupporterCardProps> = ({ supporter, isWhale }) =>
   )
 }
 
+interface SupporterSkeletonProps {
+  isWhale: boolean
+}
+
+const SupporterSkeleton: React.FC<SupporterSkeletonProps> = ({ isWhale }) => {
+  return (
+    <div className="flex flex-col items-center">
+      <div className="relative">
+        {/* Avatar Skeleton */}
+        <div
+          className={`rounded-full overflow-hidden flex items-center justify-center animate-pulse
+            ${isWhale ? 'w-24 h-24 md:w-28 md:h-28' : 'w-10 h-10 md:w-12 md:h-12'}
+          `}
+          style={{ 
+            backgroundColor: 'var(--color-bg-elevated)'
+          }}
+        >
+          <div 
+            className={`rounded-full ${isWhale ? 'w-20 h-20 md:w-24 md:h-24' : 'w-8 h-8 md:w-10 md:h-10'}`}
+            style={{ backgroundColor: 'var(--color-border)' }}
+          />
+        </div>
+
+        {/* Whale Badge Skeleton */}
+        {isWhale && (
+          <div 
+            className="absolute -bottom-1 -right-1 w-8 h-8 rounded-full animate-pulse border-2"
+            style={{ 
+              backgroundColor: 'var(--color-border)',
+              borderColor: 'var(--color-bg)' 
+            }}
+          />
+        )}
+      </div>
+
+      {/* Name and Total Skeleton */}
+      <div className="mt-2 text-center space-y-1">
+        <div 
+          className={`rounded animate-pulse ${isWhale ? 'h-4 w-16' : 'h-3 w-12'}`}
+          style={{ backgroundColor: 'var(--color-border)' }}
+        />
+        <div 
+          className={`rounded animate-pulse ${isWhale ? 'h-3 w-12' : 'h-2 w-10'}`}
+          style={{ backgroundColor: 'var(--color-border)' }}
+        />
+      </div>
+    </div>
+  )
+}
+
 export default Support
 

src/components/TTSControls.tsx

@@ -0,0 +1,113 @@
+import React, { useMemo } from 'react'
+import { useTextToSpeech } from '../hooks/useTextToSpeech'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faPlay, faPause, faGauge } from '@fortawesome/free-solid-svg-icons'
+import { UserSettings } from '../services/settingsService'
+import { detect } from 'tinyld'
+
+interface Props {
+  text: string
+  defaultLang?: string
+  className?: string
+  settings?: UserSettings
+}
+
+const SPEED_OPTIONS = [0.8, 1, 1.2, 1.4, 1.6, 1.8, 2, 2.1, 2.4, 2.8, 3]
+
+const TTSControls: React.FC<Props> = ({ text, defaultLang, className, settings }) => {
+  const {
+    supported, speaking, paused,
+    speak, pause, resume,
+    rate, setRate
+  } = useTextToSpeech({ defaultLang, defaultRate: settings?.ttsDefaultSpeed })
+
+  const canPlay = supported && text?.trim().length > 0
+
+  const resolvedSystemLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    if ((mode ? mode === 'system' : settings?.ttsUseSystemLanguage) === true) {
+      return navigator?.language?.split('-')[0]
+    }
+    return undefined
+  }, [settings?.ttsLanguageMode, settings?.ttsUseSystemLanguage])
+
+  const detectContentLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    if (mode) return mode === 'content'
+    return settings?.ttsDetectContentLanguage !== false
+  }, [settings?.ttsLanguageMode, settings?.ttsDetectContentLanguage])
+
+  const specificLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    // If mode is not 'system' or 'content', it's a specific language code
+    if (mode && mode !== 'system' && mode !== 'content') {
+      return mode
+    }
+    return undefined
+  }, [settings?.ttsLanguageMode])
+
+  const handlePlayPause = () => {
+    if (!canPlay) return
+
+    if (!speaking) {
+      let langOverride: string | undefined
+      
+      // Priority: specific language > content detection > system language
+      if (specificLang) {
+        langOverride = specificLang
+      } else if (detectContentLang && text) {
+        try {
+          const lang = detect(text)
+          if (typeof lang === 'string' && lang.length >= 2) langOverride = lang.slice(0, 2)
+        } catch (err) {
+          // ignore detection errors
+        }
+      }
+      if (!langOverride && resolvedSystemLang) {
+        langOverride = resolvedSystemLang
+      }
+      speak(text, langOverride)
+    } else if (paused) {
+      resume()
+    } else {
+      pause()
+    }
+  }
+
+  const handleCycleSpeed = () => {
+    const currentIndex = SPEED_OPTIONS.indexOf(rate)
+    const nextIndex = (currentIndex + 1) % SPEED_OPTIONS.length
+    const next = SPEED_OPTIONS[nextIndex]
+    setRate(next)
+  }
+
+  const playLabel = !speaking ? 'Listen' : (paused ? 'Resume' : 'Pause')
+
+  if (!supported) return null
+
+  return (
+    <div className={className || 'tts-controls'} style={{ display: 'flex', gap: '0.5rem', alignItems: 'center', flexWrap: 'wrap', justifyContent: 'flex-end' }}>
+      <button
+        type="button"
+        className="article-menu-btn"
+        onClick={handlePlayPause}
+        title={playLabel}
+        disabled={!canPlay}
+      >
+        <FontAwesomeIcon icon={!speaking ? faPlay : (paused ? faPlay : faPause)} />
+      </button>
+      <button
+        type="button"
+        className="article-menu-btn"
+        onClick={handleCycleSpeed}
+        title="Cycle speed"
+      >
+        <FontAwesomeIcon icon={faGauge} />
+        <span>{rate}x</span>
+      </button>
+    </div>
+  )
+}
+
+export default TTSControls
+

src/components/ThreePaneLayout.tsx

@@ -387,6 +387,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
               currentArticle={props.currentArticle}
               isSidebarCollapsed={props.isCollapsed}
               isHighlightsCollapsed={props.isHighlightsCollapsed}
+              onOpenHighlights={() => {
+                if (props.isHighlightsCollapsed) {
+                  props.onToggleHighlightsPanel()
+                }
+              }}
             />
           )}
         </div>
@@ -413,6 +418,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
             relayPool={props.relayPool}
             eventStore={props.eventStore}
             settings={props.settings}
+            isMobile={isMobile}
           />
         </div>
       </div>

src/components/VideoEmbedProcessor.tsx

@@ -0,0 +1,164 @@
+import React, { useMemo, forwardRef } from 'react'
+import ReactPlayer from 'react-player'
+import { classifyUrl } from '../utils/helpers'
+
+interface VideoEmbedProcessorProps {
+  html: string
+  renderVideoLinksAsEmbeds: boolean
+  className?: string
+  onMouseUp?: (e: React.MouseEvent) => void
+  onTouchEnd?: (e: React.TouchEvent) => void
+}
+
+/**
+ * Component that processes HTML content and optionally embeds video links
+ * as ReactPlayer components when renderVideoLinksAsEmbeds is enabled
+ */
+const VideoEmbedProcessor = forwardRef<HTMLDivElement, VideoEmbedProcessorProps>(({
+  html,
+  renderVideoLinksAsEmbeds,
+  className,
+  onMouseUp,
+  onTouchEnd
+}, ref) => {
+  // Process HTML and extract video URLs in a single pass to keep them in sync
+  const { processedHtml, videoUrls } = useMemo(() => {
+    if (!renderVideoLinksAsEmbeds || !html) {
+      return { processedHtml: html, videoUrls: [] }
+    }
+
+    // Process HTML in stages: <video> blocks, <img> tags with video src, and bare video URLs
+    let result = html
+
+    const collectedUrls: string[] = []
+    let placeholderIndex = 0
+
+    // 1) Replace entire <video>...</video> blocks when they reference a video URL
+    const videoBlockPattern = /<video[^>]*>[\s\S]*?<\/video>/gi
+    const videoBlocks = result.match(videoBlockPattern) || []
+    videoBlocks.forEach((block) => {
+      // Try src on <video>
+      let url: string | null = null
+      const videoSrcMatch = block.match(/<video[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+      if (videoSrcMatch && videoSrcMatch[1]) {
+        url = videoSrcMatch[1]
+      } else {
+        // Try nested <source>
+        const sourceSrcMatch = block.match(/<source[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+        if (sourceSrcMatch && sourceSrcMatch[1]) {
+          url = sourceSrcMatch[1]
+        }
+      }
+      if (url) {
+        collectedUrls.push(url)
+        const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+        const escaped = block.replace(/[.*+?^${}()|[\]\\]/g, '\\$&')
+        result = result.replace(new RegExp(escaped, 'g'), placeholder)
+        placeholderIndex++
+      }
+    })
+
+    // 2) Replace entire <img ...> tags if their src points to a video
+    const imgTagPattern = /<img[^>]*>/gi
+    const allImgTags = result.match(imgTagPattern) || []
+    allImgTags.forEach((imgTag) => {
+      const srcMatch = imgTag.match(/src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?/i)
+      if (srcMatch && srcMatch[1]) {
+        const videoUrl = srcMatch[1]
+        collectedUrls.push(videoUrl)
+        const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+        const escapedTag = imgTag.replace(/[.*+?^${}()|[\]\\]/g, '\\$&')
+        result = result.replace(new RegExp(escapedTag, 'g'), placeholder)
+        placeholderIndex++
+      }
+    })
+
+    // 3) Replace remaining bare video URLs (direct files or recognized video platforms)
+    const fileVideoPattern = /https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)(?:\?[^\s<>"']*)?/gi
+    const fileVideoUrls: string[] = result.match(fileVideoPattern) || []
+
+    const allUrlPattern = /https?:\/\/[^\s<>"']+(?=\s|>|"|'|$)/gi
+    const allUrls: string[] = result.match(allUrlPattern) || []
+    const platformVideoUrls = allUrls.filter(url => {
+      // include URLs classified as video and not already collected
+      const classification = classifyUrl(url)
+      return classification.type === 'video' && !collectedUrls.includes(url)
+    })
+
+    const remainingUrls = [...fileVideoUrls, ...platformVideoUrls].filter(url => !collectedUrls.includes(url))
+
+    let finalHtml = result
+    remainingUrls.forEach((url) => {
+      const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+      finalHtml = finalHtml.replace(new RegExp(url.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'), 'g'), placeholder)
+      collectedUrls.push(url)
+      placeholderIndex++
+    })
+
+    // Return both processed HTML and collected URLs (in the same order as placeholders)
+    return {
+      processedHtml: collectedUrls.length > 0 ? finalHtml : html,
+      videoUrls: collectedUrls
+    }
+  }, [html, renderVideoLinksAsEmbeds])
+
+  // If no video embedding is enabled, just render the HTML normally
+  if (!renderVideoLinksAsEmbeds || videoUrls.length === 0) {
+    return (
+      <div 
+        ref={ref}
+        className={className}
+        dangerouslySetInnerHTML={{ __html: processedHtml }}
+        onMouseUp={onMouseUp}
+        onTouchEnd={onTouchEnd}
+      />
+    )
+  }
+
+  // Split the HTML by video placeholders and render with embedded players
+  const parts = processedHtml.split(/(__VIDEO_EMBED_\d+__)/)
+  
+  return (
+    <div ref={ref} className={className} onMouseUp={onMouseUp} onTouchEnd={onTouchEnd}>
+      {parts.map((part, index) => {
+        const videoMatch = part.match(/^__VIDEO_EMBED_(\d+)__$/)
+        if (videoMatch) {
+          const videoIndex = parseInt(videoMatch[1])
+          const videoUrl = videoUrls[videoIndex]
+          if (videoUrl) {
+            return (
+              <div key={index} className="reader-video" style={{ margin: '1rem 0' }}>
+                <ReactPlayer 
+                  url={videoUrl}
+                  controls 
+                  width="100%"
+                  height="auto"
+                  style={{ 
+                    width: '100%', 
+                    height: 'auto', 
+                    aspectRatio: '16/9' 
+                  }}
+                />
+              </div>
+            )
+          }
+        }
+        
+        // Regular HTML content - only render if not empty
+        if (part.trim()) {
+          return (
+            <div 
+              key={index}
+              dangerouslySetInnerHTML={{ __html: part }}
+            />
+          )
+        }
+        return null
+      })}
+    </div>
+  )
+})
+
+VideoEmbedProcessor.displayName = 'VideoEmbedProcessor'
+
+export default VideoEmbedProcessor

src/config/bots.ts

@@ -0,0 +1,17 @@
+import { nip19 } from 'nostr-tools'
+
+/**
+ * Hardcoded list of bot pubkeys (hex format) to hide articles from
+ * These are accounts known to be bots or automated services
+ */
+export const BOT_PUBKEYS = new Set([
+  // Step Counter Bot (npub14l5xklll5vxzrf6hfkv8m6n2gqevythn5pqc6ezluespah0e8ars4279ss)
+  nip19.decode('npub14l5xklll5vxzrf6hfkv8m6n2gqevythn5pqc6ezluespah0e8ars4279ss').data as string,
+])
+
+/**
+ * Check if a pubkey corresponds to a known bot
+ */
+export function isKnownBot(pubkey: string): boolean {
+  return BOT_PUBKEYS.has(pubkey)
+}

src/config/relays.ts

@@ -11,12 +11,11 @@ export const RELAYS = [
   'wss://relay.damus.io',
   'wss://nos.lol',
   'wss://relay.nostr.band',
-  'wss://relay.dergigi.com',
   'wss://wot.dergigi.com',
   'wss://relay.snort.social',
   'wss://nostr-pub.wellorder.net',
   'wss://purplepag.es',
   'wss://relay.primal.net',
-  'wss://proxy.nostr-relay.app/5d0d38afc49c4b84ca0da951a336affa18438efed302aeedfa92eb8b0d3fcb87'
+  'wss://proxy.nostr-relay.app/5d0d38afc49c4b84ca0da951a336affa18438efed302aeedfa92eb8b0d3fcb87',
 ]
 

src/hooks/useArticleLoader.ts

@@ -1,5 +1,11 @@
 import { useEffect, useRef, Dispatch, SetStateAction } from 'react'
+import { useLocation } from 'react-router-dom'
 import { RelayPool } from 'applesauce-relay'
+import type { IEventStore } from 'applesauce-core'
+import { nip19 } from 'nostr-tools'
+import { AddressPointer } from 'nostr-tools/nip19'
+import { Helpers } from 'applesauce-core'
+import { queryEvents } from '../services/dataFetch'
 import { fetchArticleByNaddr } from '../services/articleService'
 import { fetchHighlightsForArticle } from '../services/highlightService'
 import { ReadableContent } from '../services/readerService'
@@ -7,9 +13,17 @@ import { Highlight } from '../types/highlights'
 import { NostrEvent } from 'nostr-tools'
 import { UserSettings } from '../services/settingsService'
 
+interface PreviewData {
+  title: string
+  image?: string
+  summary?: string
+  published?: number
+}
+
 interface UseArticleLoaderProps {
   naddr: string | undefined
   relayPool: RelayPool | null
+  eventStore?: IEventStore | null
   setSelectedUrl: (url: string) => void
   setReaderContent: (content: ReadableContent | undefined) => void
   setReaderLoading: (loading: boolean) => void
@@ -25,6 +39,7 @@ interface UseArticleLoaderProps {
 export function useArticleLoader({
   naddr,
   relayPool,
+  eventStore,
   setSelectedUrl,
   setReaderContent,
   setReaderLoading,
@@ -36,7 +51,18 @@ export function useArticleLoader({
   setCurrentArticle,
   settings
 }: UseArticleLoaderProps) {
+  const location = useLocation()
   const mountedRef = useRef(true)
+  // Hold latest settings without retriggering effect
+  const settingsRef = useRef<UserSettings | undefined>(settings)
+  useEffect(() => {
+    settingsRef.current = settings
+  }, [settings])
+  // Track in-flight request to prevent stale updates from previous naddr
+  const currentRequestIdRef = useRef(0)
+  
+  // Extract preview data from navigation state (from blog post cards)
+  const previewData = (location.state as { previewData?: PreviewData })?.previewData
   
   useEffect(() => {
     mountedRef.current = true
@@ -44,67 +70,204 @@ export function useArticleLoader({
     if (!relayPool || !naddr) return
     
     const loadArticle = async () => {
+      const requestId = ++currentRequestIdRef.current
       if (!mountedRef.current) return
       
-      setReaderLoading(true)
-      setReaderContent(undefined)
       setSelectedUrl(`nostr:${naddr}`)
       setIsCollapsed(true)
       
-      try {
-        const article = await fetchArticleByNaddr(relayPool, naddr, false, settings)
-        
-        if (!mountedRef.current) return
-        
+      // If we have preview data from navigation, show it immediately (no skeleton!)
+      if (previewData) {
         setReaderContent({
-          title: article.title,
-          markdown: article.markdown,
-          image: article.image,
-          summary: article.summary,
-          published: article.published,
+          title: previewData.title,
+          markdown: '', // Will be loaded from store or relay
+          image: previewData.image,
+          summary: previewData.summary,
+          published: previewData.published,
           url: `nostr:${naddr}`
         })
-        
-        const dTag = article.event.tags.find(t => t[0] === 'd')?.[1] || ''
-        const articleCoordinate = `${article.event.kind}:${article.author}:${dTag}`
-        
-        setCurrentArticleCoordinate(articleCoordinate)
-        setCurrentArticleEventId(article.event.id)
-        setCurrentArticle?.(article.event)
-        setReaderLoading(false)
-        
-        // Fetch highlights asynchronously without blocking article display
+        setReaderLoading(false) // Turn off loading immediately - we have the preview!
+      } else {
+        setReaderLoading(true)
+        setReaderContent(undefined)
+      }
+      
+      try {
+        // Decode naddr to filter
+        const decoded = nip19.decode(naddr)
+        if (decoded.type !== 'naddr') {
+          throw new Error('Invalid naddr format')
+        }
+        const pointer = decoded.data as AddressPointer
+        const filter = {
+          kinds: [pointer.kind],
+          authors: [pointer.pubkey],
+          '#d': [pointer.identifier]
+        }
+
+        let firstEmitted = false
+        let latestEvent: NostrEvent | null = null
+
+        // Check eventStore first for instant load (from bookmark cards, explore, etc.)
+        if (eventStore) {
+          try {
+            const coordinate = `${pointer.kind}:${pointer.pubkey}:${pointer.identifier}`
+            const storedEvent = eventStore.getEvent?.(coordinate)
+            if (storedEvent) {
+              latestEvent = storedEvent as NostrEvent
+              firstEmitted = true
+              const title = Helpers.getArticleTitle(storedEvent) || 'Untitled Article'
+              const image = Helpers.getArticleImage(storedEvent)
+              const summary = Helpers.getArticleSummary(storedEvent)
+              const published = Helpers.getArticlePublished(storedEvent)
+              setReaderContent({
+                title,
+                markdown: storedEvent.content,
+                image,
+                summary,
+                published,
+                url: `nostr:${naddr}`
+              })
+              const dTag = storedEvent.tags.find(t => t[0] === 'd')?.[1] || ''
+              const articleCoordinate = `${storedEvent.kind}:${storedEvent.pubkey}:${dTag}`
+              setCurrentArticleCoordinate(articleCoordinate)
+              setCurrentArticleEventId(storedEvent.id)
+              setCurrentArticle?.(storedEvent)
+              setReaderLoading(false)
+            }
+          } catch (err) {
+            // Ignore store errors, fall through to relay query
+          }
+        }
+
+        // Stream local-first via queryEvents; rely on EOSE (no timeouts)
+        const events = await queryEvents(relayPool, filter, {
+          onEvent: (evt) => {
+            if (!mountedRef.current) return
+            if (currentRequestIdRef.current !== requestId) return
+
+            // Store in event store for future local reads
+            try { 
+              // eslint-disable-next-line @typescript-eslint/no-explicit-any
+              eventStore?.add?.(evt as unknown as any) 
+            } catch {
+              // Silently ignore store errors
+            }
+
+            // Keep latest by created_at
+            if (!latestEvent || evt.created_at > latestEvent.created_at) {
+              latestEvent = evt
+            }
+
+            // Emit immediately on first event
+            if (!firstEmitted) {
+              firstEmitted = true
+              const title = Helpers.getArticleTitle(evt) || 'Untitled Article'
+              const image = Helpers.getArticleImage(evt)
+              const summary = Helpers.getArticleSummary(evt)
+              const published = Helpers.getArticlePublished(evt)
+              setReaderContent({
+                title,
+                markdown: evt.content,
+                image,
+                summary,
+                published,
+                url: `nostr:${naddr}`
+              })
+              const dTag = evt.tags.find(t => t[0] === 'd')?.[1] || ''
+              const articleCoordinate = `${evt.kind}:${evt.pubkey}:${dTag}`
+              setCurrentArticleCoordinate(articleCoordinate)
+              setCurrentArticleEventId(evt.id)
+              setCurrentArticle?.(evt)
+              setReaderLoading(false)
+            }
+          }
+        })
+
+        if (!mountedRef.current || currentRequestIdRef.current !== requestId) return
+
+        // Finalize with newest version if it's newer than what we first rendered
+        const finalEvent = (events.sort((a, b) => b.created_at - a.created_at)[0]) || latestEvent
+        if (finalEvent) {
+          const title = Helpers.getArticleTitle(finalEvent) || 'Untitled Article'
+          const image = Helpers.getArticleImage(finalEvent)
+          const summary = Helpers.getArticleSummary(finalEvent)
+          const published = Helpers.getArticlePublished(finalEvent)
+          setReaderContent({
+            title,
+            markdown: finalEvent.content,
+            image,
+            summary,
+            published,
+            url: `nostr:${naddr}`
+          })
+
+          const dTag = finalEvent.tags.find(t => t[0] === 'd')?.[1] || ''
+          const articleCoordinate = `${finalEvent.kind}:${finalEvent.pubkey}:${dTag}`
+          setCurrentArticleCoordinate(articleCoordinate)
+          setCurrentArticleEventId(finalEvent.id)
+          setCurrentArticle?.(finalEvent)
+        } else {
+          // As a last resort, fall back to the legacy helper (which includes cache)
+          const article = await fetchArticleByNaddr(relayPool, naddr, false, settingsRef.current)
+          if (!mountedRef.current || currentRequestIdRef.current !== requestId) return
+          setReaderContent({
+            title: article.title,
+            markdown: article.markdown,
+            image: article.image,
+            summary: article.summary,
+            published: article.published,
+            url: `nostr:${naddr}`
+          })
+          const dTag = article.event.tags.find(t => t[0] === 'd')?.[1] || ''
+          const articleCoordinate = `${article.event.kind}:${article.author}:${dTag}`
+          setCurrentArticleCoordinate(articleCoordinate)
+          setCurrentArticleEventId(article.event.id)
+          setCurrentArticle?.(article.event)
+        }
+
+        // Fetch highlights after content is shown
         try {
           if (!mountedRef.current) return
           
-          setHighlightsLoading(true)
-          setHighlights([])
+          const le = latestEvent as NostrEvent | null
+          const dTag = le ? (le.tags.find((t: string[]) => t[0] === 'd')?.[1] || '') : ''
+          const coord = le && dTag ? `${le.kind}:${le.pubkey}:${dTag}` : undefined
+          const eventId = le ? le.id : undefined
           
-          await fetchHighlightsForArticle(
-            relayPool, 
-            articleCoordinate, 
-            article.event.id,
-            (highlight) => {
-              if (!mountedRef.current) return
-              
-              setHighlights((prev: Highlight[]) => {
-                if (prev.some((h: Highlight) => h.id === highlight.id)) return prev
-                const next = [highlight, ...prev]
-                return next.sort((a, b) => b.created_at - a.created_at)
-              })
-            },
-            settings
-          )
+          if (coord && eventId) {
+            setHighlightsLoading(true)
+            setHighlights([])
+            await fetchHighlightsForArticle(
+              relayPool,
+              coord,
+              eventId,
+              (highlight) => {
+                if (!mountedRef.current) return
+                if (currentRequestIdRef.current !== requestId) return
+                setHighlights((prev: Highlight[]) => {
+                  if (prev.some((h: Highlight) => h.id === highlight.id)) return prev
+                  const next = [highlight, ...prev]
+                  return next.sort((a, b) => b.created_at - a.created_at)
+                })
+              },
+              settingsRef.current
+            )
+          } else {
+            // No article event to fetch highlights for - clear and don't show loading
+            setHighlights([])
+            setHighlightsLoading(false)
+          }
         } catch (err) {
           console.error('Failed to fetch highlights:', err)
         } finally {
-          if (mountedRef.current) {
+          if (mountedRef.current && currentRequestIdRef.current === requestId) {
             setHighlightsLoading(false)
           }
         }
       } catch (err) {
         console.error('Failed to load article:', err)
-        if (mountedRef.current) {
+        if (mountedRef.current && currentRequestIdRef.current === requestId) {
           setReaderContent({
             title: 'Error Loading Article',
             html: `<p>Failed to load article: ${err instanceof Error ? err.message : 'Unknown error'}</p>`,
@@ -120,7 +283,19 @@ export function useArticleLoader({
     return () => {
       mountedRef.current = false
     }
-    // Intentionally excluding setter functions from dependencies to prevent race conditions
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [naddr, relayPool, settings])
+  }, [
+    naddr,
+    relayPool,
+    eventStore,
+    previewData,
+    setSelectedUrl,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed,
+    setHighlights,
+    setHighlightsLoading,
+    setCurrentArticleCoordinate,
+    setCurrentArticleEventId,
+    setCurrentArticle
+  ])
 }

src/hooks/useEventLoader.ts

@@ -0,0 +1,132 @@
+import { useEffect, useCallback } from 'react'
+import { RelayPool } from 'applesauce-relay'
+import { IEventStore } from 'applesauce-core'
+import { NostrEvent } from 'nostr-tools'
+import { ReadableContent } from '../services/readerService'
+import { eventManager } from '../services/eventManager'
+import { fetchProfiles } from '../services/profileService'
+
+interface UseEventLoaderProps {
+  eventId?: string
+  relayPool?: RelayPool | null
+  eventStore?: IEventStore | null
+  setSelectedUrl: (url: string) => void
+  setReaderContent: (content: ReadableContent | undefined) => void
+  setReaderLoading: (loading: boolean) => void
+  setIsCollapsed: (collapsed: boolean) => void
+}
+
+export function useEventLoader({
+  eventId,
+  relayPool,
+  eventStore,
+  setSelectedUrl,
+  setReaderContent,
+  setReaderLoading,
+  setIsCollapsed
+}: UseEventLoaderProps) {
+  const displayEvent = useCallback((event: NostrEvent) => {
+    // Escape HTML in content and convert newlines to breaks for plain text display
+    const escapedContent = event.content
+      .replace(/&/g, '&')
+      .replace(/</g, '&lt;')
+      .replace(/>/g, '&gt;')
+      .replace(/\n/g, '<br />')
+
+    // Initial title
+    let title = `Note (${event.kind})`
+    if (event.kind === 1) {
+      title = `Note by @${event.pubkey.slice(0, 8)}...`
+    }
+
+    // Emit immediately
+    const baseContent: ReadableContent = {
+      url: '',
+      html: `<div style="white-space: pre-wrap; word-break: break-word;">${escapedContent}</div>`,
+      title,
+      published: event.created_at
+    }
+    setReaderContent(baseContent)
+
+    // Background: resolve author profile for kind:1 and update title
+    if (event.kind === 1 && eventStore) {
+      (async () => {
+        try {
+          let resolved = ''
+
+          // First, try to get from event store cache
+          const storedProfile = eventStore.getEvent(event.pubkey + ':0')
+          if (storedProfile) {
+            try {
+              const obj = JSON.parse(storedProfile.content || '{}') as { name?: string; display_name?: string; nip05?: string }
+              resolved = obj.display_name || obj.name || obj.nip05 || ''
+            } catch {
+              // ignore parse errors
+            }
+          }
+
+          // If not found in event store, fetch from relays
+          if (!resolved && relayPool) {
+            const profiles = await fetchProfiles(relayPool, eventStore as unknown as IEventStore, [event.pubkey])
+            if (profiles && profiles.length > 0) {
+              const latest = profiles.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))[0]
+              try {
+                const obj = JSON.parse(latest.content || '{}') as { name?: string; display_name?: string; nip05?: string }
+                resolved = obj.display_name || obj.name || obj.nip05 || ''
+              } catch {
+                // ignore parse errors
+              }
+            }
+          }
+
+          if (resolved) {
+            setReaderContent({ ...baseContent, title: `Note by @${resolved}` })
+          }
+        } catch {
+          // ignore profile failures; keep fallback title
+        }
+      })()
+    }
+  }, [setReaderContent, relayPool, eventStore])
+
+  // Initialize event manager with services
+  useEffect(() => {
+    eventManager.setServices(eventStore || null, relayPool || null)
+  }, [eventStore, relayPool])
+
+  useEffect(() => {
+    if (!eventId) return
+
+    setReaderLoading(true)
+    setReaderContent(undefined)
+    setSelectedUrl(`nostr-event:${eventId}`) // sentinel: truthy selection, not treated as article
+    setIsCollapsed(false)
+
+    // Fetch using event manager (handles cache, deduplication, and retry)
+    let cancelled = false
+
+    eventManager.fetchEvent(eventId).then(
+      (event) => {
+        if (!cancelled) {
+          displayEvent(event)
+          setReaderLoading(false)
+        }
+      },
+      (err) => {
+        if (!cancelled) {
+          const errorContent: ReadableContent = {
+            url: '',
+            html: `<div style="padding: 1rem; color: var(--color-error, red);">Failed to load event: ${err instanceof Error ? err.message : 'Unknown error'}</div>`,
+            title: 'Error'
+          }
+          setReaderContent(errorContent)
+          setReaderLoading(false)
+        }
+      }
+    )
+
+    return () => {
+      cancelled = true
+    }
+  }, [eventId, displayEvent, setReaderLoading, setSelectedUrl, setIsCollapsed, setReaderContent])
+}

src/hooks/useExternalUrlLoader.ts

@@ -49,6 +49,8 @@ export function useExternalUrlLoader({
   setCurrentArticleEventId
 }: UseExternalUrlLoaderProps) {
   const mountedRef = useRef(true)
+  // Track in-flight request to prevent stale updates when switching quickly
+  const currentRequestIdRef = useRef(0)
   
   // Load cached URL-specific highlights from event store
   const urlFilter = useMemo(() => {
@@ -70,6 +72,7 @@ export function useExternalUrlLoader({
     if (!relayPool || !url) return
     
     const loadExternalUrl = async () => {
+      const requestId = ++currentRequestIdRef.current
       if (!mountedRef.current) return
       
       setReaderLoading(true)
@@ -83,6 +86,7 @@ export function useExternalUrlLoader({
         const content = await fetchReadableContent(url)
         
         if (!mountedRef.current) return
+        if (currentRequestIdRef.current !== requestId) return
         
         setReaderContent(content)
         setReaderLoading(false)
@@ -114,6 +118,7 @@ export function useExternalUrlLoader({
               url,
               (highlight) => {
                 if (!mountedRef.current) return
+                if (currentRequestIdRef.current !== requestId) return
                 
                 if (seen.has(highlight.id)) return
                 seen.add(highlight.id)
@@ -131,13 +136,13 @@ export function useExternalUrlLoader({
         } catch (err) {
           console.error('Failed to fetch highlights:', err)
         } finally {
-          if (mountedRef.current) {
+          if (mountedRef.current && currentRequestIdRef.current === requestId) {
             setHighlightsLoading(false)
           }
         }
       } catch (err) {
         console.error('Failed to load external URL:', err)
-        if (mountedRef.current) {
+        if (mountedRef.current && currentRequestIdRef.current === requestId) {
           const filename = getFilenameFromUrl(url)
           setReaderContent({
             title: filename,
@@ -154,9 +159,20 @@ export function useExternalUrlLoader({
     return () => {
       mountedRef.current = false
     }
-    // Intentionally excluding setter functions from dependencies to prevent race conditions
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [url, relayPool, eventStore, cachedUrlHighlights])
+  }, [
+    url,
+    relayPool,
+    eventStore,
+    cachedUrlHighlights,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed,
+    setSelectedUrl,
+    setHighlights,
+    setCurrentArticleCoordinate,
+    setCurrentArticleEventId,
+    setHighlightsLoading
+  ])
 
   // Keep UI highlights synced with cached store updates without reloading content
   useEffect(() => {
@@ -169,8 +185,6 @@ export function useExternalUrlLoader({
       const next = [...additions, ...prev]
       return next.sort((a, b) => b.created_at - a.created_at)
     })
-    // setHighlights is intentionally excluded from dependencies - it's stable
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [cachedUrlHighlights, url])
+  }, [cachedUrlHighlights, url, setHighlights])
 }
 

src/hooks/useMarkdownToHTML.ts

@@ -20,9 +20,11 @@ export const useMarkdownToHTML = (
   const [processedMarkdown, setProcessedMarkdown] = useState<string>('')
 
   useEffect(() => {
+    // Always clear previous render immediately to avoid showing stale content while processing
+    setRenderedHtml('')
+    setProcessedMarkdown('')
+    
     if (!markdown) {
-      setRenderedHtml('')
-      setProcessedMarkdown('')
       return
     }
 

src/hooks/useReadingPosition.ts

@@ -7,7 +7,6 @@ interface UseReadingPositionOptions {
   readingCompleteThreshold?: number // Default 0.95 (95%) - matches filter threshold
   syncEnabled?: boolean // Whether to sync positions to Nostr
   onSave?: (position: number) => void // Callback for saving position
-  autoSaveInterval?: number // Auto-save interval in ms (default 5000)
   completionHoldMs?: number // How long to hold at 100% before firing complete (default 2000)
 }
 
@@ -18,63 +17,58 @@ export const useReadingPosition = ({
   readingCompleteThreshold = 0.95, // Match filter threshold for consistency
   syncEnabled = false,
   onSave,
-  autoSaveInterval = 5000,
   completionHoldMs = 2000
 }: UseReadingPositionOptions = {}) => {
   const [position, setPosition] = useState(0)
   const positionRef = useRef(0)
   const [isReadingComplete, setIsReadingComplete] = useState(false)
   const hasTriggeredComplete = useRef(false)
-  const lastSavedPosition = useRef(0)
   const saveTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
-  const hasSavedOnce = useRef(false)
   const completionTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
+  const suppressUntilRef = useRef<number>(0)
+  const pendingPositionRef = useRef<number>(0) // Track latest position for throttled save
+  const lastSaved100Ref = useRef(false) // Track if we've saved 100% to avoid duplicate saves
 
-  // Debounced save function
+  // Suppress auto-saves for a given duration (used after programmatic restore)
+  const suppressSavesFor = useCallback((ms: number) => {
+    const until = Date.now() + ms
+    suppressUntilRef.current = until
+  }, [])
+
+  // Throttled save function - saves at 1s intervals during scrolling
   const scheduleSave = useCallback((currentPosition: number) => {
     if (!syncEnabled || !onSave) {
       return
     }
 
-    // Don't save if position hasn't changed significantly (less than 1%)
-    // But always save if we've reached 100% (completion)
-    const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= 0.01
-    const hasReachedCompletion = currentPosition === 1 && lastSavedPosition.current < 1
-    const isInitialSave = !hasSavedOnce.current
-    
-    if (!hasSignificantChange && !hasReachedCompletion && !isInitialSave) {
-      // Not significant enough to save
+    // Always save instantly when we reach completion (1.0)
+    if (currentPosition === 1 && !lastSaved100Ref.current) {
+      if (saveTimerRef.current) {
+        clearTimeout(saveTimerRef.current)
+        saveTimerRef.current = null
+      }
+      lastSaved100Ref.current = true
+      onSave(1)
       return
     }
 
-    // Clear existing timer
+    // Always update the pending position (latest position to save)
+    pendingPositionRef.current = currentPosition
+
+    // Throttle: only schedule a save if one isn't already pending
+    // This ensures saves happen at regular 1s intervals during continuous scrolling
     if (saveTimerRef.current) {
-      clearTimeout(saveTimerRef.current)
+      return // Already have a save scheduled, don't reset the timer
     }
 
-    // Schedule new save
+    const THROTTLE_MS = 1000
     saveTimerRef.current = setTimeout(() => {
-      lastSavedPosition.current = currentPosition
-      hasSavedOnce.current = true
-      onSave(currentPosition)
-    }, autoSaveInterval)
-  }, [syncEnabled, onSave, autoSaveInterval])
-
-  // Immediate save function
-  const saveNow = useCallback(() => {
-    if (!syncEnabled || !onSave) return
-    
-    // Cancel any pending saves
-    if (saveTimerRef.current) {
-      clearTimeout(saveTimerRef.current)
+      // Save the latest position, not the one from when timer was scheduled
+      const positionToSave = pendingPositionRef.current
+      onSave(positionToSave)
       saveTimerRef.current = null
-    }
-
-    // Always allow immediate save (including 0%)
-    lastSavedPosition.current = position
-    hasSavedOnce.current = true
-    onSave(position)
-  }, [syncEnabled, onSave, position])
+    }, THROTTLE_MS)
+  }, [syncEnabled, onSave])
 
   useEffect(() => {
     if (!enabled) return
@@ -88,28 +82,27 @@ export const useReadingPosition = ({
       const windowHeight = window.innerHeight
       const documentHeight = document.documentElement.scrollHeight
       
+      // Ignore if document is too small (likely during page transition)
+      if (documentHeight < 100) return
+      
       // Calculate position based on how much of the content has been scrolled through
-      // Add a small threshold (5px) to account for rounding and make it easier to reach 100%
       const maxScroll = documentHeight - windowHeight
       const scrollProgress = maxScroll > 0 ? scrollTop / maxScroll : 0
       
-      // If we're within 5px of the bottom, consider it 100%
-      const isAtBottom = scrollTop + windowHeight >= documentHeight - 5
+      // Only consider it 100% if we're truly at the bottom AND have scrolled significantly
+      // This prevents false 100% during page transitions
+      const isAtBottom = scrollTop + windowHeight >= documentHeight - 5 && scrollTop > 100
       const clampedProgress = isAtBottom ? 1 : Math.max(0, Math.min(1, scrollProgress))
       
-      // Only log on significant changes (every 5%) to avoid flooding console
-      const prevPercent = Math.floor(position * 20) // Groups by 5%
-      const newPercent = Math.floor(clampedProgress * 20)
-      if (prevPercent !== newPercent) {
-        // Position threshold crossed
-      }
-      
       setPosition(clampedProgress)
       positionRef.current = clampedProgress
       onPositionChange?.(clampedProgress)
 
-      // Schedule auto-save if sync is enabled
-      scheduleSave(clampedProgress)
+      // Schedule auto-save if sync is enabled (unless suppressed)
+      if (Date.now() >= suppressUntilRef.current) {
+        scheduleSave(clampedProgress)
+      }
+      // Note: Suppression is silent to avoid log spam during scrolling
 
       // Completion detection with 2s hold at 100%
       if (!hasTriggeredComplete.current) {
@@ -152,25 +145,20 @@ export const useReadingPosition = ({
       window.removeEventListener('scroll', handleScroll)
       window.removeEventListener('resize', handleScroll)
       
-      // Clear save timer on unmount
-      if (saveTimerRef.current) {
-        clearTimeout(saveTimerRef.current)
-      }
+      // DON'T clear save timer - let it complete even if tracking is temporarily disabled
+      // Only clear completion timer since that's tied to the current scroll session
       if (completionTimerRef.current) {
         clearTimeout(completionTimerRef.current)
       }
     }
-    // position is intentionally not in deps - it's computed from scroll and would cause infinite re-renders
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave])
+  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave, completionHoldMs])
 
   // Reset reading complete state when enabled changes
   useEffect(() => {
     if (!enabled) {
       setIsReadingComplete(false)
       hasTriggeredComplete.current = false
-      hasSavedOnce.current = false
-      lastSavedPosition.current = 0
+      lastSaved100Ref.current = false
       if (completionTimerRef.current) {
         clearTimeout(completionTimerRef.current)
         completionTimerRef.current = null
@@ -182,6 +170,6 @@ export const useReadingPosition = ({
     position,
     isReadingComplete,
     progressPercentage: Math.round(position * 100),
-    saveNow
+    suppressSavesFor
   }
 }

src/hooks/useSettings.ts

@@ -3,7 +3,7 @@ import { IEventStore } from 'applesauce-core'
 import { RelayPool } from 'applesauce-relay'
 import { EventFactory } from 'applesauce-factory'
 import { AccountManager } from 'applesauce-accounts'
-import { UserSettings, loadSettings, saveSettings, watchSettings } from '../services/settingsService'
+import { UserSettings, saveSettings, watchSettings, startSettingsStream } from '../services/settingsService'
 import { loadFont, getFontFamily } from '../utils/fontLoader'
 import { applyTheme } from '../utils/theme'
 import { RELAYS } from '../config/relays'
@@ -16,30 +16,28 @@ interface UseSettingsParams {
 }
 
 export function useSettings({ relayPool, eventStore, pubkey, accountManager }: UseSettingsParams) {
-  const [settings, setSettings] = useState<UserSettings>({})
+  const [settings, setSettings] = useState<UserSettings>({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true })
   const [toastMessage, setToastMessage] = useState<string | null>(null)
   const [toastType, setToastType] = useState<'success' | 'error'>('success')
 
-  // Load settings and set up subscription
+  // Load settings and set up streaming subscription (non-blocking, EOSE-driven)
   useEffect(() => {
     if (!relayPool || !pubkey || !eventStore) return
 
-    const loadAndWatch = async () => {
-      try {
-        const loadedSettings = await loadSettings(relayPool, eventStore, pubkey, RELAYS)
-        if (loadedSettings) setSettings(loadedSettings)
-      } catch (err) {
-        console.error('Failed to load settings:', err)
-      }
-    }
-
-    loadAndWatch()
-
-    const subscription = watchSettings(eventStore, pubkey, (loadedSettings) => {
-      if (loadedSettings) setSettings(loadedSettings)
+    // Start settings stream: seed from store, stream updates to store in background
+    const stopNetwork = startSettingsStream(relayPool, eventStore, pubkey, RELAYS, (loadedSettings) => {
+      if (loadedSettings) setSettings({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true, ...loadedSettings })
     })
 
-    return () => subscription.unsubscribe()
+    // Also watch store reactively for any further updates
+    const subscription = watchSettings(eventStore, pubkey, (loadedSettings) => {
+      if (loadedSettings) setSettings({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true, ...loadedSettings })
+    })
+
+    return () => {
+      subscription.unsubscribe()
+      stopNetwork()
+    }
   }, [relayPool, pubkey, eventStore])
 
   // Apply settings to document
@@ -73,6 +71,9 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
       // Set paragraph alignment
       root.setProperty('--paragraph-alignment', settings.paragraphAlignment || 'justify')
       
+      // Set image max-width based on full-width setting
+      root.setProperty('--image-max-width', settings.fullWidthImages ? 'none' : '100%')
+      
     }
     
     applyStyles()

src/hooks/useTextToSpeech.ts

@@ -0,0 +1,288 @@
+import { useCallback, useEffect, useMemo, useRef, useState } from 'react'
+
+// Web Speech API types
+type SpeechSynthesisVoice = {
+  name: string
+  voiceURI: string
+  lang: string
+  localService: boolean
+  default: boolean
+}
+
+export interface UseTTSOptions {
+  defaultLang?: string
+  defaultRate?: number
+  defaultPitch?: number
+  defaultVolume?: number
+}
+
+export interface UseTTS {
+  supported: boolean
+  speaking: boolean
+  paused: boolean
+  voices: SpeechSynthesisVoice[]
+  voice: SpeechSynthesisVoice | null
+  rate: number
+  pitch: number
+  volume: number
+  setVoice: (v: SpeechSynthesisVoice | null) => void
+  setRate: (r: number) => void
+  setPitch: (p: number) => void
+  setVolume: (v: number) => void
+  speak: (text: string, langOverride?: string) => void
+  pause: () => void
+  resume: () => void
+  stop: () => void
+}
+
+export function useTextToSpeech(options: UseTTSOptions = {}): UseTTS {
+  const synth = typeof window !== 'undefined' ? window.speechSynthesis : undefined
+  const supported = !!synth
+  const [voices, setVoices] = useState<SpeechSynthesisVoice[]>([])
+  const [voice, setVoice] = useState<SpeechSynthesisVoice | null>(null)
+  const [speaking, setSpeaking] = useState(false)
+  const [paused, setPaused] = useState(false)
+  const [rate, setRate] = useState(options.defaultRate ?? 2.1)
+  const [pitch, setPitch] = useState(options.defaultPitch ?? 1)
+  const [volume, setVolume] = useState(options.defaultVolume ?? 1)
+  const defaultLang = options.defaultLang || (typeof navigator !== 'undefined' ? navigator.language : 'en')
+
+  const utteranceRef = useRef<SpeechSynthesisUtterance | null>(null)
+  const spokenTextRef = useRef<string>('')
+  const charIndexRef = useRef<number>(0)
+  // Chunking state to reliably speak long texts from web URLs
+  const chunksRef = useRef<string[]>([])
+  const chunkIndexRef = useRef<number>(0)
+  const globalOffsetRef = useRef<number>(0)
+  const langRef = useRef<string | undefined>(undefined)
+
+  // Update rate when defaultRate option changes
+  useEffect(() => {
+    if (options.defaultRate !== undefined) {
+      setRate(options.defaultRate)
+    }
+  }, [options.defaultRate])
+
+  // Load voices (async in many browsers)
+  useEffect(() => {
+    if (!supported) return
+    const load = () => {
+      const v = synth!.getVoices()
+      setVoices(v)
+      if (!voice && v.length) {
+        const byLang = v.find(x => x.lang?.toLowerCase().startsWith(defaultLang.toLowerCase()))
+        setVoice(byLang || v[0] || null)
+      }
+    }
+    load()
+    const handleVoicesChanged = () => load()
+    synth!.addEventListener('voiceschanged', handleVoicesChanged)
+    return () => {
+      synth!.removeEventListener('voiceschanged', handleVoicesChanged)
+    }
+  }, [supported, defaultLang, voice, synth])
+
+  const createUtterance = useCallback((text: string, langOverride?: string): SpeechSynthesisUtterance => {
+    const SpeechSynthesisUtteranceConstructor = (window as Window & typeof globalThis).SpeechSynthesisUtterance
+    const u = new SpeechSynthesisUtteranceConstructor(text) as SpeechSynthesisUtterance
+    const resolvedLang = langOverride || voice?.lang || defaultLang
+    u.lang = resolvedLang
+    if (langOverride) {
+      const match = voices.find(v => v.lang?.toLowerCase().startsWith(langOverride.toLowerCase()))
+      if (match) {
+        u.voice = match
+      } else if (voice) {
+        u.voice = voice
+      }
+    } else if (voice) {
+      u.voice = voice
+    }
+    u.rate = rate
+    u.pitch = pitch
+    u.volume = volume
+
+    const self = u
+
+    u.onstart = () => {
+      if (utteranceRef.current !== self) return
+      setSpeaking(true)
+      setPaused(false)
+    }
+    u.onpause = () => {
+      if (utteranceRef.current !== self) return
+      setPaused(true)
+    }
+    u.onresume = () => {
+      if (utteranceRef.current !== self) return
+      setPaused(false)
+    }
+    u.onend = () => {
+      if (utteranceRef.current !== self) return
+      // Continue with next chunk if available
+      const hasMore = chunkIndexRef.current < (chunksRef.current.length - 1)
+      if (hasMore) {
+        chunkIndexRef.current++
+        charIndexRef.current += self.text.length
+        const nextChunk = chunksRef.current[chunkIndexRef.current]
+        const nextUtterance = createUtterance(nextChunk, langRef.current)
+        utteranceRef.current = nextUtterance
+        synth!.speak(nextUtterance)
+      } else {
+        setSpeaking(false)
+        setPaused(false)
+      }
+    }
+    u.onerror = () => {
+      if (utteranceRef.current !== self) return
+      setSpeaking(false)
+      setPaused(false)
+    }
+    u.onboundary = (ev: SpeechSynthesisEvent) => {
+      if (utteranceRef.current !== self) return
+      if (typeof ev.charIndex === 'number') {
+        const newIndex = globalOffsetRef.current + ev.charIndex
+        if (newIndex > charIndexRef.current) {
+          charIndexRef.current = newIndex
+        }
+      }
+    }
+
+    return u
+  }, [voice, defaultLang, rate, pitch, volume, voices, synth])
+
+  const splitIntoChunks = useCallback((text: string, maxLen = 2400): string[] => {
+    const normalized = text.replace(/\s+/g, ' ').trim()
+    if (normalized.length <= maxLen) return [normalized]
+    const sentences = normalized.split(/(?<=[.!?])\s+/)
+    const chunks: string[] = []
+    let current = ''
+    for (const s of sentences) {
+      if ((current + (current ? ' ' : '') + s).length > maxLen) {
+        if (current) chunks.push(current)
+        if (s.length > maxLen) {
+          // Hard split very long sentence
+          for (let i = 0; i < s.length; i += maxLen) {
+            chunks.push(s.slice(i, i + maxLen))
+          }
+          current = ''
+        } else {
+          current = s
+        }
+      } else {
+        current = current ? `${current} ${s}` : s
+      }
+    }
+    if (current) chunks.push(current)
+    return chunks
+  }, [])
+
+  const startSpeakingChunks = useCallback((text: string) => {
+    chunksRef.current = splitIntoChunks(text)
+    chunkIndexRef.current = 0
+    globalOffsetRef.current = 0
+    const first = chunksRef.current[0] || ''
+    const u = createUtterance(first, langRef.current)
+    utteranceRef.current = u
+    synth!.speak(u)
+  }, [createUtterance, splitIntoChunks, synth])
+
+  const stop = useCallback(() => {
+    if (!supported) return
+    synth!.cancel()
+    setSpeaking(false)
+    setPaused(false)
+    utteranceRef.current = null
+    charIndexRef.current = 0
+    spokenTextRef.current = ''
+    chunksRef.current = []
+    chunkIndexRef.current = 0
+    globalOffsetRef.current = 0
+  }, [supported, synth])
+
+  const speak = useCallback((text: string, langOverride?: string) => {
+    if (!supported || !text?.trim()) return
+    synth!.cancel()
+    spokenTextRef.current = text
+    charIndexRef.current = 0
+    langRef.current = langOverride
+    startSpeakingChunks(text)
+  }, [supported, synth, startSpeakingChunks])
+
+  const pause = useCallback(() => {
+    if (!supported) return
+    if (synth!.speaking && !synth!.paused) {
+      synth!.pause()
+      setPaused(true)
+    }
+  }, [supported, synth])
+
+  const resume = useCallback(() => {
+    if (!supported) return
+    if (synth!.speaking && synth!.paused) {
+      synth!.resume()
+      setPaused(false)
+    }
+  }, [supported, synth])
+
+  // Update rate in real-time: while speaking, restart from last boundary with new rate.
+  useEffect(() => {
+    if (!supported) return
+    if (!utteranceRef.current) return
+
+    if (synth!.speaking && !synth!.paused) {
+      const fullText = spokenTextRef.current
+      const startIndex = Math.max(0, Math.min(charIndexRef.current, fullText.length))
+      const remainingText = fullText.slice(startIndex)
+
+      synth!.cancel()
+      // restart chunked from current global index
+      spokenTextRef.current = remainingText
+      charIndexRef.current = 0
+      // keep current language selection; no change needed here
+      startSpeakingChunks(remainingText)
+      return
+    }
+
+    if (utteranceRef.current) {
+      utteranceRef.current.rate = rate
+    }
+  }, [rate, supported, synth, startSpeakingChunks])
+
+  const updateRate = useCallback((newRate: number) => {
+    setRate(newRate)
+    if (!supported) return
+    if (!utteranceRef.current) return
+
+    if (synth!.speaking && !synth!.paused) {
+      const fullText = spokenTextRef.current
+      const startIndex = Math.max(0, Math.min(charIndexRef.current, fullText.length - 1))
+      const remainingText = fullText.slice(startIndex)
+      synth!.cancel()
+      const u = createUtterance(remainingText)
+      // ensure the new rate is applied immediately on the new utterance
+      u.rate = newRate
+      utteranceRef.current = u
+      synth!.speak(u)
+    } else if (utteranceRef.current) {
+      utteranceRef.current.rate = newRate
+    }
+  }, [supported, synth, createUtterance])
+
+  // stop TTS when unmounting
+  useEffect(() => stop, [stop])
+
+  return useMemo(() => ({
+    supported,
+    speaking,
+    paused,
+    voices,
+    voice,
+    rate,
+    setRate: updateRate,
+    pitch, setPitch,
+    volume, setVolume,
+    setVoice,
+    speak, pause, resume, stop
+  }), [supported, speaking, paused, voices, voice, rate, updateRate, pitch, volume, setVoice, speak, pause, resume, stop])
+}
+

src/main.tsx

@@ -5,13 +5,12 @@ import './styles/tailwind.css'
 import './index.css'
 import 'react-loading-skeleton/dist/skeleton.css'
 
-// Register Service Worker for PWA functionality
-if ('serviceWorker' in navigator) {
+// Register Service Worker for PWA functionality (production only)
+if ('serviceWorker' in navigator && import.meta.env.PROD) {
   window.addEventListener('load', () => {
     navigator.serviceWorker
-      .register('/sw.js', { type: 'module' })
+      .register('/sw.js')
       .then(registration => {
-        
         // Check for updates periodically
         setInterval(() => {
           registration.update()
@@ -24,8 +23,6 @@ if ('serviceWorker' in navigator) {
             newWorker.addEventListener('statechange', () => {
               if (newWorker.state === 'installed' && navigator.serviceWorker.controller) {
                 // New service worker available
-                
-                // Optionally show a toast notification
                 const updateAvailable = new CustomEvent('sw-update-available')
                 window.dispatchEvent(updateAvailable)
               }

src/services/archiveController.ts

@@ -3,7 +3,6 @@ import { IEventStore } from 'applesauce-core'
 import { NostrEvent } from 'nostr-tools'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
-import { RELAYS } from '../config/relays'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { nip19 } from 'nostr-tools'
 
@@ -35,14 +34,12 @@ class ArchiveController {
     if (!this.markedIds.has(id)) {
       this.markedIds.add(id)
       this.emit()
-      console.log('[archive] mark() added', id.slice(0, 48))
     }
   }
 
   unmark(id: string): void {
     if (this.markedIds.delete(id)) {
       this.emit()
-      console.log('[archive] unmark() removed', id.slice(0, 48))
     }
   }
 
@@ -61,7 +58,7 @@ class ArchiveController {
   reset(): void {
     this.generation++
       if (this.timelineSubscription) {
-        try { this.timelineSubscription.unsubscribe() } catch (e) { console.warn('[archive] timeline unsub error', e) }
+        try { this.timelineSubscription.unsubscribe() } catch { /* ignore */ }
         this.timelineSubscription = null
       }
     this.markedIds = new Set()
@@ -80,13 +77,11 @@ class ArchiveController {
     const startGen = this.generation
 
     if (!force && this.isLoadedFor(pubkey)) {
-      console.log('[archive] start() skipped - already loaded for pubkey')
       return
     }
 
     // Mark as loaded immediately (fetch runs non-blocking)
     this.lastLoadedPubkey = pubkey
-    console.log('[archive] start() begin for pubkey:', pubkey.slice(0, 12), '...')
 
     // Handlers for streaming queries
     const handleUrlReaction = (evt: NostrEvent) => {
@@ -95,7 +90,6 @@ class ArchiveController {
       if (!rTag) return
       this.markedIds.add(rTag)
       this.emit()
-      console.log('[archive] mark url:', rTag)
     }
 
     const handleEventReaction = (evt: NostrEvent) => {
@@ -110,7 +104,6 @@ class ArchiveController {
             const naddr = nip19.naddrEncode({ kind, pubkey, identifier })
             this.markedIds.add(naddr)
             this.emit()
-            console.log('[archive] mark naddr via a-tag:', naddr.slice(0, 24), '...')
             return
           }
         } catch { /* ignore malformed a-tag */ }
@@ -118,14 +111,13 @@ class ArchiveController {
       const eTag = evt.tags.find(t => t[0] === 'e')?.[1]
       if (!eTag) return
       this.pendingEventIds.add(eTag)
-      console.log('[archive] pending event id:', eTag)
     }
 
     try {
       // Stream kind:17 and kind:7 in parallel
       const [kind17, kind7] = await Promise.all([
-        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleUrlReaction }),
-        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleEventReaction })
+        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { onEvent: handleUrlReaction }),
+        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { onEvent: handleEventReaction })
       ])
 
       if (startGen !== this.generation) return
@@ -133,27 +125,23 @@ class ArchiveController {
       // Include EOSE events
       kind17.forEach(handleUrlReaction)
       kind7.forEach(handleEventReaction)
-      console.log('[archive] EOSE sizes kind17:', kind17.length, 'kind7:', kind7.length, 'pendingEventIds:', this.pendingEventIds.size)
 
       if (this.pendingEventIds.size > 0) {
         // Fetch referenced articles (kind:30023) and map event IDs to naddr
         const ids = Array.from(this.pendingEventIds)
-        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids }, { relayUrls: RELAYS })
-        console.log('[archive] fetched articles for mapping:', articleEvents.length)
+        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids })
         for (const article of articleEvents) {
           const dTag = article.tags.find(t => t[0] === 'd')?.[1]
           if (!dTag) continue
           try {
             const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: article.pubkey, identifier: dTag })
             this.markedIds.add(naddr)
-            console.log('[archive] mark naddr:', naddr.slice(0, 24), '...')
           } catch {
             // skip invalid
           }
         }
         this.emit()
       }
-      console.log('[archive] total marked ids:', this.markedIds.size)
 
       // Try immediate mapping via eventStore for any still-pending e-ids
       if (this.pendingEventIds.size > 0) {
@@ -167,7 +155,6 @@ class ArchiveController {
               if (dTag) {
                 const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: evt.pubkey, identifier: dTag })
                 this.markedIds.add(naddr)
-                console.log('[archive] map via eventStore naddr:', naddr.slice(0, 24), '...')
               }
             } else {
               stillPending.add(eId)
@@ -178,7 +165,7 @@ class ArchiveController {
         if (stillPending.size > 0) {
           // Subscribe to future 30023 arrivals to finalize mapping
           if (this.timelineSubscription) {
-            try { this.timelineSubscription.unsubscribe() } catch (e) { console.warn('[archive] timeline unsub error', e) }
+            try { this.timelineSubscription.unsubscribe() } catch { /* ignore */ }
             this.timelineSubscription = null
           }
           const sub$ = eventStore.timeline({ kinds: [KINDS.BlogPost] })
@@ -193,16 +180,14 @@ class ArchiveController {
                 const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: evt.pubkey, identifier: dTag })
                 this.markedIds.add(naddr)
                 this.pendingEventIds.delete(evt.id)
-                console.log('[archive] map via timeline naddr:', naddr.slice(0, 24), '...')
                 this.emit()
-              } catch (e) { console.warn('[archive] map via timeline encode error', e) }
+              } catch { /* ignore */ }
             }
           })
         }
       }
     } catch (err) {
       // Non-blocking fetch; ignore errors here
-      console.warn('[archive] start() error:', err)
     }
   }
 }

src/services/articleService.ts

@@ -97,10 +97,10 @@ export async function fetchArticleByNaddr(
 
     const pointer = decoded.data as AddressPointer
 
-    // Define relays to query - prefer relays from naddr, fallback to configured relays (including local)
-    const baseRelays = pointer.relays && pointer.relays.length > 0 
-      ? pointer.relays 
-      : RELAYS
+    // Define relays to query - use union of relay hints from naddr and configured relays
+    // This avoids failures when naddr contains stale/unreachable relay hints
+    const hintedRelays = (pointer.relays && pointer.relays.length > 0) ? pointer.relays : []
+    const baseRelays = Array.from(new Set<string>([...hintedRelays, ...RELAYS]))
     const orderedRelays = prioritizeLocalRelays(baseRelays)
     const { local: localRelays, remote: remoteRelays } = partitionRelays(orderedRelays)
 
@@ -114,7 +114,28 @@ export async function fetchArticleByNaddr(
     // Parallel local+remote, stream immediate, collect up to first from each
     const { local$, remote$ } = createParallelReqStreams(relayPool, localRelays, remoteRelays, filter, 1200, 6000)
     const collected = await lastValueFrom(merge(local$.pipe(take(1)), remote$.pipe(take(1))).pipe(rxToArray()))
-    const events = collected as NostrEvent[]
+    let events = collected as NostrEvent[]
+
+    // Fallback: if nothing found, try a second round against a set of reliable public relays
+    if (events.length === 0) {
+      const reliableRelays = Array.from(new Set<string>([
+        'wss://relay.nostr.band',
+        'wss://relay.primal.net',
+        'wss://relay.damus.io',
+        'wss://nos.lol',
+        ...remoteRelays // keep any configured remote relays
+      ]))
+      const { remote$: fallback$ } = createParallelReqStreams(
+        relayPool,
+        [], // no local
+        reliableRelays,
+        filter,
+        1500,
+        12000
+      )
+      const fallbackCollected = await lastValueFrom(fallback$.pipe(take(1), rxToArray()))
+      events = fallbackCollected as NostrEvent[]
+    }
 
     if (events.length === 0) {
       throw new Error('Article not found')

src/services/bookmarkController.ts

@@ -1,12 +1,8 @@
 import { RelayPool } from 'applesauce-relay'
 import { Helpers, EventStore } from 'applesauce-core'
-import { createEventLoader, createAddressLoader } from 'applesauce-loaders/loaders'
 import { NostrEvent } from 'nostr-tools'
-import { EventPointer } from 'nostr-tools/nip19'
-import { merge } from 'rxjs'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
-import { RELAYS } from '../config/relays'
 import { collectBookmarksFromEvents } from './bookmarkProcessing'
 import { Bookmark, IndividualBookmark } from '../types/bookmarks'
 import {
@@ -64,11 +60,8 @@ class BookmarkController {
   }> = new Map()
   private isLoading = false
   private hydrationGeneration = 0
-  
-  // Event loaders for efficient batching
-  private eventStore = new EventStore()
-  private eventLoader: ReturnType<typeof createEventLoader> | null = null
-  private addressLoader: ReturnType<typeof createAddressLoader> | null = null
+  private externalEventStore: EventStore | null = null
+  private relayPool: RelayPool | null = null
 
   onRawEvent(cb: RawEventCallback): () => void {
     this.rawEventListeners.push(cb)
@@ -117,15 +110,15 @@ class BookmarkController {
   }
 
   /**
-   * Hydrate events by IDs using EventLoader (auto-batching, streaming)
+   * Hydrate events by IDs using queryEvents (local-first, streaming)
    */
-  private hydrateByIds(
+  private async hydrateByIds(
     ids: string[],
     idToEvent: Map<string, NostrEvent>,
     onProgress: () => void,
     generation: number
-  ): void {
-    if (!this.eventLoader) {
+  ): Promise<void> {
+    if (!this.relayPool) {
       return
     }
 
@@ -135,71 +128,146 @@ class BookmarkController {
       return
     }
     
-    // Convert IDs to EventPointers
-    const pointers: EventPointer[] = unique.map(id => ({ id }))
-    
-    // Use EventLoader - it auto-batches and streams results
-    merge(...pointers.map(this.eventLoader)).subscribe({
-      next: (event) => {
-        // Check if hydration was cancelled
-        if (this.hydrationGeneration !== generation) return
-        
-        idToEvent.set(event.id, event)
-        
-        // Also index by coordinate for addressable events
-        if (event.kind && event.kind >= 30000 && event.kind < 40000) {
-          const dTag = event.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
-          const coordinate = `${event.kind}:${event.pubkey}:${dTag}`
-          idToEvent.set(coordinate, event)
+    // Fetch events using local-first queryEvents
+    await queryEvents(
+      this.relayPool,
+      { ids: unique },
+      {
+        onEvent: (event) => {
+          // Check if hydration was cancelled
+          if (this.hydrationGeneration !== generation) return
+          
+          idToEvent.set(event.id, event)
+          
+          // Also index by coordinate for addressable events
+          if (event.kind && event.kind >= 30000 && event.kind < 40000) {
+            const dTag = event.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
+            const coordinate = `${event.kind}:${event.pubkey}:${dTag}`
+            idToEvent.set(coordinate, event)
+          }
+          
+          // Add to external event store if available
+          if (this.externalEventStore) {
+            this.externalEventStore.add(event)
+          }
+          
+          onProgress()
         }
-        
-        onProgress()
-      },
-      error: () => {
-        // Silent error - EventLoader handles retries
       }
-    })
+    )
   }
 
   /**
-   * Hydrate addressable events by coordinates using AddressLoader (auto-batching, streaming)
+   * Hydrate addressable events by coordinates using queryEvents (local-first, streaming)
    */
-  private hydrateByCoordinates(
+  private async hydrateByCoordinates(
     coords: Array<{ kind: number; pubkey: string; identifier: string }>,
     idToEvent: Map<string, NostrEvent>,
     onProgress: () => void,
     generation: number
-  ): void {
-    if (!this.addressLoader) {
+  ): Promise<void> {
+    if (!this.relayPool) {
       return
     }
 
-    if (coords.length === 0) return
+    if (coords.length === 0) {
+      return
+    }
 
-    // Convert coordinates to AddressPointers
-    const pointers = coords.map(c => ({
-      kind: c.kind,
-      pubkey: c.pubkey,
-      identifier: c.identifier
-    }))
-
-    // Use AddressLoader - it auto-batches and streams results
-    merge(...pointers.map(this.addressLoader)).subscribe({
-      next: (event) => {
-        // Check if hydration was cancelled
-        if (this.hydrationGeneration !== generation) return
-
-        const dTag = event.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
-        const coordinate = `${event.kind}:${event.pubkey}:${dTag}`
-        idToEvent.set(coordinate, event)
-        idToEvent.set(event.id, event)
-        
-        onProgress()
-      },
-      error: () => {
-        // Silent error - AddressLoader handles retries
+    // Group by kind and pubkey for efficient batching
+    const filtersByKind = new Map<number, Map<string, string[]>>()
+    
+    for (const coord of coords) {
+      if (!filtersByKind.has(coord.kind)) {
+        filtersByKind.set(coord.kind, new Map())
       }
-    })
+      const byPubkey = filtersByKind.get(coord.kind)!
+      if (!byPubkey.has(coord.pubkey)) {
+        byPubkey.set(coord.pubkey, [])
+      }
+      byPubkey.get(coord.pubkey)!.push(coord.identifier || '')
+    }
+
+    // Kick off all queries in parallel (fire-and-forget)
+    const promises: Promise<void>[] = []
+    
+    for (const [kind, byPubkey] of filtersByKind) {
+      for (const [pubkey, identifiers] of byPubkey) {
+        // Separate empty and non-empty identifiers
+        const nonEmptyIdentifiers = identifiers.filter(id => id && id.length > 0)
+        const hasEmptyIdentifier = identifiers.some(id => !id || id.length === 0)
+        
+        // Fetch events with non-empty d-tags
+        if (nonEmptyIdentifiers.length > 0) {
+          promises.push(
+            queryEvents(
+              this.relayPool,
+              { kinds: [kind], authors: [pubkey], '#d': nonEmptyIdentifiers },
+              {
+                onEvent: (event) => {
+                  // Check if hydration was cancelled
+                  if (this.hydrationGeneration !== generation) return
+
+                  const dTag = event.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
+                  const coordinate = `${event.kind}:${event.pubkey}:${dTag}`
+                  idToEvent.set(coordinate, event)
+                  idToEvent.set(event.id, event)
+                  
+                  // Add to external event store if available
+                  if (this.externalEventStore) {
+                    this.externalEventStore.add(event)
+                  }
+                  
+                  onProgress()
+                }
+              }
+            ).then(() => {
+              // Query completed successfully
+            }).catch(() => {
+              // Silent error - individual query failed
+            })
+          )
+        }
+        
+        // Fetch events with empty d-tag separately (without '#d' filter)
+        if (hasEmptyIdentifier) {
+          promises.push(
+            queryEvents(
+              this.relayPool,
+              { kinds: [kind], authors: [pubkey] },
+              {
+                onEvent: (event) => {
+                  // Check if hydration was cancelled
+                  if (this.hydrationGeneration !== generation) return
+                  
+                  // Only process events with empty d-tag
+                  const dTag = event.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
+                  if (dTag !== '') return
+
+                  const coordinate = `${event.kind}:${event.pubkey}:`
+                  idToEvent.set(coordinate, event)
+                  idToEvent.set(event.id, event)
+                  
+                  // Add to external event store if available
+                  if (this.externalEventStore) {
+                    this.externalEventStore.add(event)
+                  }
+                  
+                  onProgress()
+                }
+              }
+            ).then(() => {
+              // Query completed successfully
+            }).catch(() => {
+              // Silent error - individual query failed
+            })
+          )
+        }
+      }
+    }
+    
+    // Wait for all queries to complete
+    await Promise.all(promises)
   }
 
   private async buildAndEmitBookmarks(
@@ -244,42 +312,58 @@ class BookmarkController {
       })
 
       const allItems = [...publicItemsAll, ...privateItemsAll]
+      const deduped = dedupeBookmarksById(allItems)
       
-      // Separate hex IDs from coordinates
+      // Separate hex IDs from coordinates for fetching
       const noteIds: string[] = []
       const coordinates: string[] = []
       
-      allItems.forEach(i => {
-        if (/^[0-9a-f]{64}$/i.test(i.id)) {
-          noteIds.push(i.id)
-        } else if (i.id.includes(':')) {
-          coordinates.push(i.id)
+      // Request hydration for all items that don't have content yet
+      deduped.forEach(i => {
+        // If item has no content, we need to fetch it
+        if (!i.content || i.content.length === 0) {
+          if (/^[0-9a-f]{64}$/i.test(i.id)) {
+            noteIds.push(i.id)
+          } else if (i.id.includes(':')) {
+            coordinates.push(i.id)
+          }
         }
       })
       
       // Helper to build and emit bookmarks
       const emitBookmarks = (idToEvent: Map<string, NostrEvent>) => {
-        const allBookmarks = dedupeBookmarksById([
+        // Now hydrate the ORIGINAL items (which may have duplicates), using the deduplicated results
+        // This preserves the original public/private split while still getting all the content
+        const allBookmarks = [
           ...hydrateItems(publicItemsAll, idToEvent),
           ...hydrateItems(privateItemsAll, idToEvent)
-        ])
-
+        ]
+        
         const enriched = allBookmarks.map(b => ({
           ...b,
           tags: b.tags || [],
-          content: b.content || ''
+          content: b.content || this.externalEventStore?.getEvent(b.id)?.content || '', // Fallback to eventStore content
+          created_at: (b.created_at ?? this.externalEventStore?.getEvent(b.id)?.created_at ?? null)
         }))
         
         const sortedBookmarks = enriched
-          .map(b => ({ ...b, urlReferences: extractUrlsFromContent(b.content) }))
-          .sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
+          .map(b => ({ 
+            ...b, 
+            urlReferences: extractUrlsFromContent(b.content)
+          }))
+          .sort((a, b) => {
+            // Sort by display time: created_at, else listUpdatedAt. Newest first. Nulls last.
+            const aTs = (a.created_at ?? a.listUpdatedAt ?? -Infinity)
+            const bTs = (b.created_at ?? b.listUpdatedAt ?? -Infinity)
+            return bTs - aTs
+          })
 
         const bookmark: Bookmark = {
           id: `${activeAccount.pubkey}-bookmarks`,
           title: `Bookmarks (${sortedBookmarks.length})`,
           url: '',
           content: latestContent,
-          created_at: newestCreatedAt || Math.floor(Date.now() / 1000),
+          created_at: newestCreatedAt || 0,
           tags: allTags,
           bookmarkCount: sortedBookmarks.length,
           eventReferences: allTags.filter((tag: string[]) => tag[0] === 'e').map((tag: string[]) => tag[1]),
@@ -295,7 +379,7 @@ class BookmarkController {
       const idToEvent: Map<string, NostrEvent> = new Map()
       emitBookmarks(idToEvent)
 
-      // Now fetch events progressively in background using batched hydrators
+      // Now fetch events progressively in background using local-first queries
       
       const generation = this.hydrationGeneration
       const onProgress = () => emitBookmarks(idToEvent)
@@ -310,10 +394,14 @@ class BookmarkController {
         }
       })
       
-      // Kick off batched hydration (streaming, non-blocking)
-      // EventLoader and AddressLoader handle batching and streaming automatically
-      this.hydrateByIds(noteIds, idToEvent, onProgress, generation)
-      this.hydrateByCoordinates(coordObjs, idToEvent, onProgress, generation)
+      // Kick off hydration (streaming, non-blocking, local-first)
+      // Fire-and-forget - don't await, let it run in background
+      this.hydrateByIds(noteIds, idToEvent, onProgress, generation).catch(() => {
+        // Silent error - hydration will retry or show partial results
+      })
+      this.hydrateByCoordinates(coordObjs, idToEvent, onProgress, generation).catch(() => {
+        // Silent error - hydration will retry or show partial results
+      })
     } catch (error) {
       console.error('Failed to build bookmarks:', error)
       this.bookmarksListeners.forEach(cb => cb([]))
@@ -324,8 +412,13 @@ class BookmarkController {
     relayPool: RelayPool
     activeAccount: unknown
     accountManager: { getActive: () => unknown }
+    eventStore?: EventStore
   }): Promise<void> {
-    const { relayPool, activeAccount, accountManager } = options
+    const { relayPool, activeAccount, accountManager, eventStore } = options
+    
+    // Store references for hydration
+    this.relayPool = relayPool
+    this.externalEventStore = eventStore || null
 
     if (!activeAccount || typeof (activeAccount as { pubkey?: string }).pubkey !== 'string') {
       return
@@ -336,16 +429,6 @@ class BookmarkController {
     // Increment generation to cancel any in-flight hydration
     this.hydrationGeneration++
     
-    // Initialize loaders for this session
-    this.eventLoader = createEventLoader(relayPool, { 
-      eventStore: this.eventStore,
-      extraRelays: RELAYS 
-    })
-    this.addressLoader = createAddressLoader(relayPool, { 
-      eventStore: this.eventStore,
-      extraRelays: RELAYS
-    })
-    
     this.setLoading(true)
 
     try {

src/services/bookmarkEvents.ts

@@ -15,28 +15,30 @@ export function dedupeNip51Events(events: NostrEvent[]): NostrEvent[] {
   }
   const unique = Array.from(byId.values())
 
-  // Separate web bookmarks (kind:39701) from list-based bookmarks
-  const webBookmarks = unique.filter(e => e.kind === 39701)
-
   const bookmarkLists = unique
     .filter(e => e.kind === 10003 || e.kind === 30003 || e.kind === 30001)
     .sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
   const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
 
+  // Deduplicate replaceable events (kind:30003, 30001, 39701) by d-tag
   const byD = new Map<string, NostrEvent>()
   for (const e of unique) {
-    if (e.kind === 10003 || e.kind === 30003 || e.kind === 30001) {
+    if (e.kind === 10003 || e.kind === 30003 || e.kind === 30001 || e.kind === 39701) {
       const d = (e.tags || []).find((t: string[]) => t[0] === 'd')?.[1] || ''
       const prev = byD.get(d)
       if (!prev || (e.created_at || 0) > (prev.created_at || 0)) byD.set(d, e)
     }
   }
 
-  const setsAndNamedLists = Array.from(byD.values())
+  // Separate web bookmarks from bookmark sets/lists
+  const allReplaceable = Array.from(byD.values())
+  const webBookmarks = allReplaceable.filter(e => e.kind === 39701)
+  const setsAndNamedLists = allReplaceable.filter(e => e.kind !== 39701)
+  
   const out: NostrEvent[] = []
   if (latestBookmarkList) out.push(latestBookmarkList)
   out.push(...setsAndNamedLists)
-  // Add web bookmarks as individual events
+  // Add deduplicated web bookmarks as individual events
   out.push(...webBookmarks)
   return out
 }

src/services/bookmarkHelpers.ts

@@ -21,12 +21,16 @@ export interface AddressPointer {
   pubkey: string
   identifier: string
   relays?: string[]
+  added_at?: number
+  created_at?: number
 }
 
 export interface EventPointer {
   id: string
   relays?: string[]
   author?: string
+  added_at?: number
+  created_at?: number
 }
 
 export interface ApplesauceBookmarks {
@@ -67,48 +71,44 @@ export const processApplesauceBookmarks = (
 ): IndividualBookmark[] => {
   if (!bookmarks) return []
 
-  console.log('[BOOKMARK_TS] processApplesauceBookmarks called with parentCreatedAt:', parentCreatedAt, 'isPrivate:', isPrivate)
-
   if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
     const applesauceBookmarks = bookmarks as ApplesauceBookmarks
     const allItems: IndividualBookmark[] = []
     
     // Process notes (EventPointer[])
     if (applesauceBookmarks.notes) {
-      console.log('[BOOKMARK_TS] Processing', applesauceBookmarks.notes.length, 'notes with timestamp:', parentCreatedAt || 0)
       applesauceBookmarks.notes.forEach((note: EventPointer) => {
         allItems.push({
           id: note.id,
           content: '',
-          created_at: parentCreatedAt || 0,
+          created_at: note.created_at ?? null,
           pubkey: note.author || activeAccount.pubkey,
           kind: 1, // Short note kind
           tags: [],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: parentCreatedAt || 0
+          listUpdatedAt: parentCreatedAt || 0
         })
       })
     }
     
     // Process articles (AddressPointer[])
     if (applesauceBookmarks.articles) {
-      console.log('[BOOKMARK_TS] Processing', applesauceBookmarks.articles.length, 'articles with timestamp:', parentCreatedAt || 0)
       applesauceBookmarks.articles.forEach((article: AddressPointer) => {
         // Convert AddressPointer to coordinate format: kind:pubkey:identifier
         const coordinate = `${article.kind}:${article.pubkey}:${article.identifier || ''}`
         allItems.push({
           id: coordinate,
           content: '',
-          created_at: parentCreatedAt || 0,
+          created_at: article.created_at ?? null,
           pubkey: article.pubkey,
           kind: article.kind, // Usually 30023 for long-form articles
           tags: [],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: parentCreatedAt || 0
+          listUpdatedAt: parentCreatedAt ?? null
         })
       })
     }
@@ -119,33 +119,32 @@ export const processApplesauceBookmarks = (
         allItems.push({
           id: `hashtag-${hashtag}`,
           content: `#${hashtag}`,
-          created_at: parentCreatedAt || 0,
+          created_at: 0, // Hashtags don't have their own creation time
           pubkey: activeAccount.pubkey,
           kind: 1,
           tags: [['t', hashtag]],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: parentCreatedAt || 0
+          listUpdatedAt: parentCreatedAt ?? null
         })
       })
     }
     
     // Process URLs (string[])
     if (applesauceBookmarks.urls) {
-      console.log('[BOOKMARK_TS] Processing', applesauceBookmarks.urls.length, 'URLs with timestamp:', parentCreatedAt || 0)
       applesauceBookmarks.urls.forEach((url: string) => {
         allItems.push({
           id: `url-${url}`,
           content: url,
-          created_at: parentCreatedAt || 0,
+          created_at: 0, // URLs don't have their own creation time
           pubkey: activeAccount.pubkey,
           kind: 1,
           tags: [['r', url]],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: parentCreatedAt || 0
+          listUpdatedAt: parentCreatedAt || 0
         })
       })
     }
@@ -154,20 +153,24 @@ export const processApplesauceBookmarks = (
   }
 
   const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]
-  return bookmarkArray
+  const processed = bookmarkArray
     .filter((bookmark: BookmarkData) => bookmark.id) // Skip bookmarks without valid IDs
-    .map((bookmark: BookmarkData) => ({
-      id: bookmark.id!,
-      content: bookmark.content || '',
-      created_at: bookmark.created_at || parentCreatedAt || 0,
-      pubkey: activeAccount.pubkey,
-      kind: bookmark.kind || 30001,
-      tags: bookmark.tags || [],
-      parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
-      type: 'event' as const,
-      isPrivate,
-      added_at: bookmark.created_at || parentCreatedAt || 0
-    }))
+    .map((bookmark: BookmarkData) => {
+      return {
+        id: bookmark.id!,
+        content: bookmark.content || '',
+        created_at: bookmark.created_at ?? null,
+        pubkey: activeAccount.pubkey,
+        kind: bookmark.kind || 30001,
+        tags: bookmark.tags || [],
+        parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
+        type: 'event' as const,
+        isPrivate,
+        listUpdatedAt: parentCreatedAt ?? null
+      }
+    })
+  
+  return processed
 }
 
 // Types and guards around signer/decryption APIs
@@ -189,6 +192,9 @@ export function hydrateItems(
         }
       }
       
+      // Ensure all events with content get parsed content for proper rendering
+      const parsedContent = content ? (getParsedContent(content) as ParsedContent) : undefined
+      
       return {
         ...item,
         pubkey: ev.pubkey || item.pubkey,
@@ -196,13 +202,12 @@ export function hydrateItems(
         created_at: ev.created_at || item.created_at,
         kind: ev.kind || item.kind,
         tags: ev.tags || item.tags,
-        parsedContent: ev.content ? (getParsedContent(content) as ParsedContent) : item.parsedContent
+        parsedContent: parsedContent || item.parsedContent
       }
     })
     .filter(item => {
       // Filter out bookmark list events (they're containers, not content)
       const isBookmarkListEvent = item.kind === 10003 || item.kind === 30003 || item.kind === 30001
-      console.log('[BOOKMARK_TS] After hydration - id:', item.id, 'kind:', item.kind, 'isBookmarkListEvent:', isBookmarkListEvent, 'content:', item.content?.substring(0, 50))
       return !isBookmarkListEvent
     })
 }

src/services/bookmarkProcessing.ts

@@ -121,7 +121,6 @@ export async function collectBookmarksFromEvents(
   const decryptJobs: Array<{ evt: NostrEvent; metadata: { dTag?: string; setTitle?: string; setDescription?: string; setImage?: string } }> = []
 
   for (const evt of bookmarkListEvents) {
-    console.log('[BOOKMARK_TS] Processing bookmark event', evt.id, 'kind:', evt.kind, 'created_at:', evt.created_at)
     newestCreatedAt = Math.max(newestCreatedAt, evt.created_at || 0)
     if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
     if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
@@ -134,29 +133,36 @@ export async function collectBookmarksFromEvents(
 
     // Handle web bookmarks (kind:39701) as individual bookmarks
     if (evt.kind === 39701) {
+      // Use coordinate format for web bookmarks to enable proper deduplication
+      // Web bookmarks are replaceable events (kind:39701:pubkey:d-tag)
+      const webBookmarkId = dTag ? `${evt.kind}:${evt.pubkey}:${dTag}` : evt.id
+      
       publicItemsAll.push({
-        id: evt.id,
+        id: webBookmarkId,
         content: evt.content || '',
-        created_at: evt.created_at || Math.floor(Date.now() / 1000),
+        created_at: evt.created_at ?? null,
         pubkey: evt.pubkey,
         kind: evt.kind,
         tags: evt.tags || [],
         parsedContent: undefined,
         type: 'web' as const,
         isPrivate: false,
-        added_at: evt.created_at || Math.floor(Date.now() / 1000),
         sourceKind: 39701,
         setName: dTag,
         setTitle,
         setDescription,
-        setImage
+        setImage,
+        listUpdatedAt: evt.created_at ?? null
       })
       continue
     }
 
     const pub = Helpers.getPublicBookmarks(evt)
+    const processedPub = processApplesauceBookmarks(pub, activeAccount, false, evt.created_at)
+    
+    
     publicItemsAll.push(
-      ...processApplesauceBookmarks(pub, activeAccount, false, evt.created_at).map(i => ({
+      ...processedPub.map(i => ({
         ...i,
         sourceKind: evt.kind,
         setName: dTag,

src/services/eventManager.ts

@@ -0,0 +1,162 @@
+import { RelayPool } from 'applesauce-relay'
+import { IEventStore } from 'applesauce-core'
+import { createEventLoader } from 'applesauce-loaders/loaders'
+import { NostrEvent } from 'nostr-tools'
+
+type PendingRequest = {
+  resolve: (event: NostrEvent) => void
+  reject: (error: Error) => void
+}
+
+/**
+ * Centralized event manager for event fetching and caching
+ * Handles deduplication of concurrent requests and coordinate with relay pool
+ */
+class EventManager {
+  private eventStore: IEventStore | null = null
+  private relayPool: RelayPool | null = null
+  private eventLoader: ReturnType<typeof createEventLoader> | null = null
+  
+  // Track pending requests to deduplicate and resolve all at once
+  private pendingRequests = new Map<string, PendingRequest[]>()
+  
+  // Safety timeout for event fetches (ms)
+  private fetchTimeoutMs = 12000
+  // Retry policy
+  private maxAttempts = 4
+  private baseBackoffMs = 700
+  
+  /**
+   * Initialize the event manager with event store and relay pool
+   */
+  setServices(eventStore: IEventStore | null, relayPool: RelayPool | null): void {
+    this.eventStore = eventStore
+    this.relayPool = relayPool
+    
+    // Recreate loader when services change
+    if (relayPool) {
+      this.eventLoader = createEventLoader(relayPool, {
+        eventStore: eventStore || undefined
+      })
+      
+      // Retry any pending requests now that we have a loader
+      this.retryAllPending()
+    }
+  }
+  
+  /**
+   * Get cached event from event store
+   */
+  getCachedEvent(eventId: string): NostrEvent | null {
+    if (!this.eventStore) return null
+    return this.eventStore.getEvent(eventId) || null
+  }
+  
+  /**
+   * Fetch an event by ID, returning a promise
+   * Automatically deduplicates concurrent requests for the same event
+   */
+  fetchEvent(eventId: string): Promise<NostrEvent> {
+    // Check cache first
+    const cached = this.getCachedEvent(eventId)
+    if (cached) {
+      return Promise.resolve(cached)
+    }
+    
+    return new Promise<NostrEvent>((resolve, reject) => {
+      // Check if we're already fetching this event
+      if (this.pendingRequests.has(eventId)) {
+        // Add to existing request queue
+        this.pendingRequests.get(eventId)!.push({ resolve, reject })
+        return
+      }
+      
+      // Start a new fetch request
+      this.pendingRequests.set(eventId, [{ resolve, reject }])
+      this.fetchFromRelayWithRetry(eventId, 1)
+    })
+  }
+  
+  private resolvePending(eventId: string, event: NostrEvent): void {
+    const requests = this.pendingRequests.get(eventId) || []
+    this.pendingRequests.delete(eventId)
+    requests.forEach(req => req.resolve(event))
+  }
+  
+  private rejectPending(eventId: string, error: Error): void {
+    const requests = this.pendingRequests.get(eventId) || []
+    this.pendingRequests.delete(eventId)
+    requests.forEach(req => req.reject(error))
+  }
+  
+  private fetchFromRelayWithRetry(eventId: string, attempt: number): void {
+    // If no loader yet, schedule retry
+    if (!this.relayPool || !this.eventLoader) {
+      setTimeout(() => {
+        if (this.pendingRequests.has(eventId)) {
+          this.fetchFromRelayWithRetry(eventId, attempt)
+        }
+      }, this.baseBackoffMs)
+      return
+    }
+    
+    let delivered = false
+    const subscription = this.eventLoader({ id: eventId }).subscribe({
+      next: (event: NostrEvent) => {
+        delivered = true
+        clearTimeout(timeoutId)
+        this.resolvePending(eventId, event)
+        subscription.unsubscribe()
+      },
+      error: (err: unknown) => {
+        clearTimeout(timeoutId)
+        const error = err instanceof Error ? err : new Error(String(err))
+        // Retry on error until attempts exhausted
+        if (attempt < this.maxAttempts && this.pendingRequests.has(eventId)) {
+          setTimeout(() => this.fetchFromRelayWithRetry(eventId, attempt + 1), this.baseBackoffMs * attempt)
+        } else {
+          this.rejectPending(eventId, error)
+        }
+        subscription.unsubscribe()
+      },
+      complete: () => {
+        // Completed without next - consider not found, but retry a few times
+        if (!delivered) {
+          clearTimeout(timeoutId)
+          if (attempt < this.maxAttempts && this.pendingRequests.has(eventId)) {
+            setTimeout(() => this.fetchFromRelayWithRetry(eventId, attempt + 1), this.baseBackoffMs * attempt)
+          } else {
+            this.rejectPending(eventId, new Error('Event not found'))
+          }
+        }
+        subscription.unsubscribe()
+      }
+    })
+    
+    // Safety timeout
+    const timeoutId = setTimeout(() => {
+      if (!delivered) {
+        if (attempt < this.maxAttempts && this.pendingRequests.has(eventId)) {
+          subscription.unsubscribe()
+          this.fetchFromRelayWithRetry(eventId, attempt + 1)
+        } else {
+          subscription.unsubscribe()
+          this.rejectPending(eventId, new Error('Timed out fetching event'))
+        }
+      }
+    }, this.fetchTimeoutMs)
+  }
+  
+  /**
+   * Retry all pending requests after relay pool becomes available
+   */
+  private retryAllPending(): void {
+    const pendingIds = Array.from(this.pendingRequests.keys())
+    pendingIds.forEach(eventId => {
+      this.fetchFromRelayWithRetry(eventId, 1)
+    })
+  }
+}
+
+// Singleton instance
+export const eventManager = new EventManager()

src/services/exploreService.ts

@@ -1,6 +1,6 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
-import { Helpers } from 'applesauce-core'
+import { Helpers, IEventStore } from 'applesauce-core'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
 
@@ -22,6 +22,7 @@ export interface BlogPostPreview {
  * @param relayUrls - Array of relay URLs to query
  * @param onPost - Optional callback for streaming posts
  * @param limit - Limit for number of events to fetch (default: 100, pass null for no limit)
+ * @param eventStore - Optional event store to persist fetched events
  * @returns Array of blog post previews
  */
 export const fetchBlogPostsFromAuthors = async (
@@ -29,7 +30,8 @@ export const fetchBlogPostsFromAuthors = async (
   pubkeys: string[],
   relayUrls: string[],
   onPost?: (post: BlogPostPreview) => void,
-  limit: number | null = 100
+  limit: number | null = 100,
+  eventStore?: IEventStore
 ): Promise<BlogPostPreview[]> => {
   try {
     if (pubkeys.length === 0) {
@@ -45,12 +47,17 @@ export const fetchBlogPostsFromAuthors = async (
       ? { kinds: [KINDS.BlogPost], authors: pubkeys, limit }
       : { kinds: [KINDS.BlogPost], authors: pubkeys }
 
-    await queryEvents(
+    const events = await queryEvents(
       relayPool,
       filter,
       {
         relayUrls,
         onEvent: (event: NostrEvent) => {
+          // Store in event store immediately if provided
+          if (eventStore) {
+            eventStore.add(event)
+          }
+
           const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
           const key = `${event.pubkey}:${dTag}`
           const existing = uniqueEvents.get(key)
@@ -73,6 +80,10 @@ export const fetchBlogPostsFromAuthors = async (
       }
     )
 
+    // Store all events in event store if provided (safety net for any missed during streaming)
+    if (eventStore) {
+      events.forEach(evt => eventStore.add(evt))
+    }
     
     // Convert to blog post previews and sort by published date (most recent first)
     const blogPosts: BlogPostPreview[] = Array.from(uniqueEvents.values())

src/services/highlightsController.ts

@@ -8,8 +8,6 @@ import { eventToHighlight, sortHighlights } from './highlightEventProcessor'
 type HighlightsCallback = (highlights: Highlight[]) => void
 type LoadingCallback = (loading: boolean) => void
 
-const LAST_SYNCED_KEY = 'highlights_last_synced'
-
 /**
  * Shared highlights controller
  * Manages the user's highlights centrally, similar to bookmarkController
@@ -68,37 +66,10 @@ class HighlightsController {
     this.emitHighlights(this.currentHighlights)
   }
 
-  /**
-   * Get last synced timestamp for incremental loading
-   */
-  private getLastSyncedAt(pubkey: string): number | null {
-    try {
-      const data = localStorage.getItem(LAST_SYNCED_KEY)
-      if (!data) return null
-      const parsed = JSON.parse(data)
-      return parsed[pubkey] || null
-    } catch {
-      return null
-    }
-  }
-
-  /**
-   * Update last synced timestamp
-   */
-  private setLastSyncedAt(pubkey: string, timestamp: number): void {
-    try {
-      const data = localStorage.getItem(LAST_SYNCED_KEY)
-      const parsed = data ? JSON.parse(data) : {}
-      parsed[pubkey] = timestamp
-      localStorage.setItem(LAST_SYNCED_KEY, JSON.stringify(parsed))
-    } catch (err) {
-      console.warn('[highlights] Failed to save last synced timestamp:', err)
-    }
-  }
-
   /**
    * Load highlights for a user
    * Streams results and stores in event store
+   * Always fetches ALL highlights to ensure completeness
    */
   async start(options: {
     relayPool: RelayPool
@@ -124,15 +95,12 @@ class HighlightsController {
       const seenIds = new Set<string>()
       const highlightsMap = new Map<string, Highlight>()
 
-      // Get last synced timestamp for incremental loading
-      const lastSyncedAt = force ? null : this.getLastSyncedAt(pubkey)
-      const filter: { kinds: number[]; authors: string[]; since?: number } = {
+      // Fetch ALL highlights without limits (no since filter)
+      // This ensures we get complete results for profile/my pages
+      const filter = {
         kinds: [KINDS.Highlights],
         authors: [pubkey]
       }
-      if (lastSyncedAt) {
-        filter.since = lastSyncedAt
-      }
 
       const events = await queryEvents(
         relayPool,
@@ -179,12 +147,6 @@ class HighlightsController {
       this.lastLoadedPubkey = pubkey
       this.emitHighlights(sorted)
 
-      // Update last synced timestamp
-      if (sorted.length > 0) {
-        const newestTimestamp = Math.max(...sorted.map(h => h.created_at))
-        this.setLastSyncedAt(pubkey, newestTimestamp)
-      }
-
     } catch (error) {
       console.error('[highlights] ❌ Failed to load highlights:', error)
       this.currentHighlights = []

src/services/libraryService.ts

@@ -1,7 +1,6 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { Helpers } from 'applesauce-core'
-import { RELAYS } from '../config/relays'
 import { KINDS } from '../config/kinds'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { BlogPostPreview } from './exploreService'
@@ -30,8 +29,8 @@ export async function fetchReadArticles(
   try {
     // Fetch kind:7 and kind:17 reactions in parallel
     const [kind7Events, kind17Events] = await Promise.all([
-      queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }, { relayUrls: RELAYS }),
-      queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] }, { relayUrls: RELAYS })
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }),
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] })
     ])
 
     const readArticles: ReadArticle[] = []
@@ -115,8 +114,7 @@ export async function fetchReadArticlesWithData(
     
     const articleEvents = await queryEvents(
       relayPool,
-      { kinds: [KINDS.BlogPost], ids: eventIds },
-      { relayUrls: RELAYS }
+      { kinds: [KINDS.BlogPost], ids: eventIds }
     )
 
     // Deduplicate article events by ID

src/services/reactionService.ts

@@ -2,8 +2,8 @@ import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
 import { IAccount } from 'applesauce-accounts'
 import { NostrEvent } from 'nostr-tools'
 import { lastValueFrom, takeUntil, timer, toArray } from 'rxjs'
-import { RELAYS } from '../config/relays'
 import { EventFactory } from 'applesauce-factory'
+import { getActiveRelayUrls } from './relayManager'
 
 const ARCHIVE_EMOJI = '📚'
 
@@ -35,7 +35,6 @@ export async function createEventReaction(
   ]
   if (options?.aCoord) {
     tags.push(['a', options.aCoord])
-    console.log('[archive] createEventReaction add a-tag:', options.aCoord)
   }
 
   const draft = await factory.create(async () => ({
@@ -49,7 +48,7 @@ export async function createEventReaction(
 
 
   // Publish to relays
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
 
 
   return signed
@@ -99,7 +98,7 @@ export async function createWebsiteReaction(
 
 
   // Publish to relays
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
 
 
   return signed
@@ -122,7 +121,7 @@ export async function deleteReaction(
     created_at: Math.floor(Date.now() / 1000)
   }))
   const signed = await factory.sign(draft)
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
   return signed
 }
 
@@ -146,7 +145,7 @@ export async function hasMarkedEventAsRead(
     }
 
     const events$ = relayPool
-      .req(RELAYS, filter)
+      .req(getActiveRelayUrls(relayPool), filter)
       .pipe(
         onlyEvents(),
         completeOnEose(),
@@ -199,7 +198,7 @@ export async function hasMarkedWebsiteAsRead(
     }
 
     const events$ = relayPool
-      .req(RELAYS, filter)
+      .req(getActiveRelayUrls(relayPool), filter)
       .pipe(
         onlyEvents(),
         completeOnEose(),

src/services/readingDataProcessor.ts

@@ -75,10 +75,17 @@ export function processReadingProgress(
           continue
         }
       } else if (dTag.startsWith('url:')) {
-        // It's a URL with base64url encoding
-        const encoded = dTag.replace('url:', '')
+        // It's a URL. We support both raw URLs and base64url-encoded URLs.
+        const value = dTag.slice(4)
+        const looksBase64Url = /^[A-Za-z0-9_-]+$/.test(value) && (value.includes('-') || value.includes('_'))
         try {
-          itemUrl = atob(encoded.replace(/-/g, '+').replace(/_/g, '/'))
+          if (looksBase64Url) {
+            // Decode base64url to raw URL
+            itemUrl = atob(value.replace(/-/g, '+').replace(/_/g, '/'))
+          } else {
+            // Treat as raw URL (already decoded)
+            itemUrl = value
+          }
           itemId = itemUrl
           itemType = 'external'
         } catch (e) {

src/services/readingPositionService.ts

@@ -98,11 +98,8 @@ export function generateArticleIdentifier(naddrOrUrl: string): string {
   if (naddrOrUrl.startsWith('nostr:')) {
     return naddrOrUrl.replace('nostr:', '')
   }
-  // For URLs, use base64url encoding (URL-safe)
-  return btoa(naddrOrUrl)
-    .replace(/\+/g, '-')
-    .replace(/\//g, '_')
-    .replace(/=+$/, '')
+  // For URLs, return the raw URL. Downstream tag generation will encode as needed.
+  return naddrOrUrl
 }
 
 /**
@@ -138,8 +135,136 @@ export async function saveReadingPosition(
   await publishEvent(relayPool, eventStore, signed)
 }
 
+/**
+ * Streaming reading position loader (non-blocking, EOSE-driven)
+ * Seeds from local eventStore, streams relay updates to store in background
+ * @returns Unsubscribe function to cancel both store watch and network stream
+ */
+export function startReadingPositionStream(
+  relayPool: RelayPool,
+  eventStore: IEventStore,
+  pubkey: string,
+  articleIdentifier: string,
+  onPosition: (pos: ReadingPosition | null) => void
+): () => void {
+  const dTag = generateDTag(articleIdentifier)
+
+  // 1) Seed from local replaceable immediately and watch for updates
+  const storeSub = eventStore
+    .replaceable(READING_PROGRESS_KIND, pubkey, dTag)
+    .subscribe((event: NostrEvent | undefined) => {
+      if (!event) {
+        onPosition(null)
+        return
+      }
+      const parsed = getReadingProgressContent(event)
+      onPosition(parsed || null)
+    })
+
+  // 2) Stream from relays in background; pipe into store; no timeout/unsubscribe timer
+  const networkSub = relayPool
+    .subscription(RELAYS, {
+      kinds: [READING_PROGRESS_KIND],
+      authors: [pubkey],
+      '#d': [dTag]
+    })
+    .pipe(onlyEvents(), mapEventsToStore(eventStore))
+    .subscribe()
+
+  // Caller manages lifecycle
+  return () => {
+    try { storeSub.unsubscribe() } catch { /* ignore */ }
+    try { networkSub.unsubscribe() } catch { /* ignore */ }
+  }
+}
+
+/**
+ * Stabilized reading position collector
+ * Collects position updates for a brief window, then emits the best one (newest, then highest progress)
+ * @returns Object with stop() to cancel and onStable(cb) to register callback
+ */
+export function collectReadingPositionsOnce(params: {
+  relayPool: RelayPool
+  eventStore: IEventStore
+  pubkey: string
+  articleIdentifier: string
+  windowMs?: number
+}): { stop: () => void; onStable: (cb: (pos: ReadingPosition | null) => void) => void } {
+  const { relayPool, eventStore, pubkey, articleIdentifier, windowMs = 700 } = params
+  
+  const candidates: ReadingPosition[] = []
+  let stableCallback: ((pos: ReadingPosition | null) => void) | null = null
+  let timer: ReturnType<typeof setTimeout> | null = null
+  let streamStop: (() => void) | null = null
+  let hasEmitted = false
+
+  const emitStable = () => {
+    if (hasEmitted || !stableCallback) return
+    hasEmitted = true
+
+    if (candidates.length === 0) {
+      stableCallback(null)
+      return
+    }
+
+    // Sort: newest first, then highest progress
+    candidates.sort((a, b) => {
+      const timeDiff = b.timestamp - a.timestamp
+      if (timeDiff !== 0) return timeDiff
+      return b.position - a.position
+    })
+
+    stableCallback(candidates[0])
+  }
+
+  // Start streaming and collecting
+  streamStop = startReadingPositionStream(
+    relayPool,
+    eventStore,
+    pubkey,
+    articleIdentifier,
+    (pos) => {
+      if (hasEmitted) return
+      if (!pos) {
+        return
+      }
+      if (pos.position <= 0.05 || pos.position >= 1) {
+        return
+      }
+      
+      candidates.push(pos)
+
+      // Schedule one-shot emission if not already scheduled
+      if (!timer) {
+        timer = setTimeout(() => {
+          emitStable()
+          if (streamStop) streamStop()
+        }, windowMs)
+      }
+    }
+  )
+
+  return {
+    stop: () => {
+      if (timer) {
+        clearTimeout(timer)
+        timer = null
+      }
+      if (streamStop) {
+        streamStop()
+        streamStop = null
+      }
+    },
+    onStable: (cb) => {
+      stableCallback = cb
+    }
+  }
+}
+
 /**
  * Load reading position from Nostr (kind 39802)
+ * @deprecated Use startReadingPositionStream for non-blocking behavior
+ * Returns current local position immediately (or null) and starts background sync
  */
 export async function loadReadingPosition(
   relayPool: RelayPool,
@@ -149,101 +274,29 @@ export async function loadReadingPosition(
 ): Promise<ReadingPosition | null> {
   const dTag = generateDTag(articleIdentifier)
 
-  // Check local event store first
+  let initial: ReadingPosition | null = null
   try {
     const localEvent = await firstValueFrom(
       eventStore.replaceable(READING_PROGRESS_KIND, pubkey, dTag)
     )
     if (localEvent) {
       const content = getReadingProgressContent(localEvent)
-      if (content) {
-        // Fetch from relays in background to get any updates
-        relayPool
-          .subscription(RELAYS, {
-            kinds: [READING_PROGRESS_KIND],
-            authors: [pubkey],
-            '#d': [dTag]
-          })
-          .pipe(onlyEvents(), mapEventsToStore(eventStore))
-          .subscribe()
-        
-        return content
-      }
+      if (content) initial = content
     }
-  } catch (err) {
-    // Ignore errors and fetch from relays
+  } catch {
+    // ignore
   }
 
-  // Fetch from relays
-  const result = await fetchFromRelays(
-    relayPool,
-    eventStore,
-    pubkey,
-    READING_PROGRESS_KIND,
-    dTag,
-    getReadingProgressContent
-  )
-  
-  return result || null
-}
-
-// Helper function to fetch from relays with timeout
-async function fetchFromRelays(
-  relayPool: RelayPool,
-  eventStore: IEventStore,
-  pubkey: string,
-  kind: number,
-  dTag: string,
-  parser: (event: NostrEvent) => ReadingPosition | undefined
-): Promise<ReadingPosition | null> {
-  return new Promise((resolve) => {
-    let hasResolved = false
-    const timeout = setTimeout(() => {
-      if (!hasResolved) {
-        hasResolved = true
-        resolve(null)
-      }
-    }, 3000)
-
-    const sub = relayPool
-      .subscription(RELAYS, {
-        kinds: [kind],
-        authors: [pubkey],
-        '#d': [dTag]
-      })
-      .pipe(onlyEvents(), mapEventsToStore(eventStore))
-      .subscribe({
-        complete: async () => {
-          clearTimeout(timeout)
-          if (!hasResolved) {
-            hasResolved = true
-            try {
-              const event = await firstValueFrom(
-                eventStore.replaceable(kind, pubkey, dTag)
-              )
-              if (event) {
-                const content = parser(event)
-                resolve(content || null)
-              } else {
-                resolve(null)
-              }
-            } catch (err) {
-              resolve(null)
-            }
-          }
-        },
-        error: () => {
-          clearTimeout(timeout)
-          if (!hasResolved) {
-            hasResolved = true
-            resolve(null)
-          }
-        }
-      })
-
-    setTimeout(() => {
-      sub.unsubscribe()
-    }, 3000)
-  })
+  // Start background sync (fire-and-forget; no timeout)
+  relayPool
+    .subscription(RELAYS, {
+      kinds: [READING_PROGRESS_KIND],
+      authors: [pubkey],
+      '#d': [dTag]
+    })
+    .pipe(onlyEvents(), mapEventsToStore(eventStore))
+    .subscribe()
+
+  return initial
 }
 

src/services/readingProgressController.ts

@@ -3,13 +3,11 @@ import { IEventStore } from 'applesauce-core'
 import { NostrEvent } from 'nostr-tools'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
-import { RELAYS } from '../config/relays'
 import { processReadingProgress } from './readingDataProcessor'
 import { ReadItem } from './readsService'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { nip19 } from 'nostr-tools'
 
-console.log('[readingProgress] Module loaded')
 
 type ProgressMapCallback = (progressMap: Map<string, number>) => void
 type LoadingCallback = (loading: boolean) => void
@@ -176,17 +174,14 @@ class ReadingProgressController {
     const { relayPool, eventStore, pubkey, force = false } = params
     const startGeneration = this.generation
 
-    console.log('[readingProgress] start() called for pubkey:', pubkey.slice(0, 16), '...', 'force:', force)
 
     // Skip if already loaded for this pubkey and not forcing
     if (!force && this.isLoadedFor(pubkey)) {
-      console.log('[readingProgress] Already loaded for pubkey, skipping')
       return
     }
 
     // Prevent concurrent starts
     if (this.isLoading) {
-      console.log('[readingProgress] Already loading, skipping concurrent start')
       return
     }
 
@@ -212,7 +207,6 @@ class ReadingProgressController {
         this.timelineSubscription = null
       }
 
-      console.log('[readingProgress] Setting up eventStore subscription...')
       const timeline$ = eventStore.timeline({
         kinds: [KINDS.ReadingProgress],
         authors: [pubkey]
@@ -223,20 +217,17 @@ class ReadingProgressController {
         if (!Array.isArray(localEvents) || localEvents.length === 0) return
         this.processEvents(localEvents)
       })
-      console.log('[readingProgress] EventStore subscription ready - updates streaming')
 
       // Mark as loaded immediately - queries run in background non-blocking
       this.lastLoadedPubkey = pubkey
 
       // Query reading progress from relays in background (non-blocking, fire-and-forget)
-      console.log('[readingProgress] Starting background relay query for reading progress...')
       queryEvents(relayPool, {
         kinds: [KINDS.ReadingProgress],
         authors: [pubkey]
-      }, { relayUrls: RELAYS })
+      })
         .then((relayEvents) => {
           if (startGeneration !== this.generation) return
-          console.log('[readingProgress] Got reading progress from relays:', relayEvents.length)
           if (relayEvents.length > 0) {
             relayEvents.forEach(e => eventStore.add(e))
             this.processEvents(relayEvents)
@@ -249,10 +240,8 @@ class ReadingProgressController {
         })
 
       // Load mark-as-read reactions in background (non-blocking, streaming)
-      console.log('[readingProgress] Starting background relay query for mark-as-read reactions...')
       this.loadMarkAsReadReactions(relayPool, eventStore, pubkey, startGeneration)
         .then(() => {
-          console.log('[readingProgress] Mark-as-read reactions loading complete')
         })
         .catch((err) => {
           console.warn('[readingProgress] Mark-as-read reactions loading failed:', err)
@@ -265,9 +254,6 @@ class ReadingProgressController {
         this.setLoading(false)
       }
       this.isLoading = false
-      console.log('[readingProgress] === LOADED ===')
-      console.log('[readingProgress] progressMap keys:', Array.from(this.currentProgressMap.keys()))
-      console.log('[readingProgress] markedAsReadIds:', Array.from(this.markedAsReadIds))
     }
   }
 
@@ -290,10 +276,10 @@ class ReadingProgressController {
     // Process new events
     processReadingProgress(events, readsMap)
     
-    // Convert back to progress map (naddr -> progress)
+    // Convert back to progress map (id -> progress). Include both articles and external URLs.
     const newProgressMap = new Map<string, number>()
     for (const [id, item] of readsMap.entries()) {
-      if (item.readingProgress !== undefined && item.type === 'article') {
+      if (item.readingProgress !== undefined) {
         newProgressMap.set(id, item.readingProgress)
       }
     }
@@ -318,7 +304,6 @@ class ReadingProgressController {
   ): Promise<void> {
     try {
       // Stream kind:17 (URL reactions) and kind:7 (event reactions) in parallel
-      console.log('[readingProgress] Querying kind:17 and kind:7 reactions (streaming)...')
       const seenReactionIds = new Set<string>()
 
       const handleUrlReaction = (evt: NostrEvent) => {
@@ -343,8 +328,8 @@ class ReadingProgressController {
 
       // Fire queries with onEvent callbacks for streaming behavior
       const [kind17Events, kind7Events] = await Promise.all([
-        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleUrlReaction }),
-        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleEventReaction })
+        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { onEvent: handleUrlReaction }),
+        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { onEvent: handleEventReaction })
       ])
 
       if (generation !== this.generation) return
@@ -356,7 +341,7 @@ class ReadingProgressController {
       if (pendingEventIds.size > 0) {
         // Fetch referenced 30023 events, streaming not required here
         const ids = Array.from(pendingEventIds)
-        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids }, { relayUrls: RELAYS })
+        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids })
         const eventIdToNaddr = new Map<string, string>()
         for (const article of articleEvents) {
           const dTag = article.tags.find(t => t[0] === 'd')?.[1]
@@ -379,7 +364,6 @@ class ReadingProgressController {
         this.emitMarkedAsReadChanged()
       }
 
-      console.log('[readingProgress] Mark-as-read reactions complete. Total:', Array.from(this.markedAsReadIds).length)
     } catch (err) {
       console.warn('[readingProgress] Failed to load mark-as-read reactions:', err)
     }

src/services/readsService.ts

@@ -3,7 +3,6 @@ import { Helpers } from 'applesauce-core'
 import { Bookmark } from '../types/bookmarks'
 import { fetchReadArticles } from './libraryService'
 import { queryEvents } from './dataFetch'
-import { RELAYS } from '../config/relays'
 import { KINDS } from '../config/kinds'
 import { classifyBookmarkType } from '../utils/bookmarkTypeClassifier'
 import { nip19 } from 'nostr-tools'
@@ -44,7 +43,7 @@ export async function fetchAllReads(
   try {
     // Fetch all data sources in parallel
     const [progressEvents, markedAsReadArticles] = await Promise.all([
-      queryEvents(relayPool, { kinds: [KINDS.ReadingProgress], authors: [userPubkey] }, { relayUrls: RELAYS }),
+      queryEvents(relayPool, { kinds: [KINDS.ReadingProgress], authors: [userPubkey] }),
       fetchReadArticles(relayPool, userPubkey)
     ])
 
@@ -77,7 +76,7 @@ export async function fetchAllReads(
             source: 'bookmark',
             type: 'article',
             readingProgress: 0,
-            readingTimestamp: bookmark.added_at || bookmark.created_at
+            readingTimestamp: bookmark.created_at ?? undefined
           }
           readsMap.set(coordinate, item)
           if (onItem) emitItem(item)
@@ -130,8 +129,7 @@ export async function fetchAllReads(
         
         const events = await queryEvents(
           relayPool,
-          { kinds: [KINDS.BlogPost], authors, '#d': identifiers },
-          { relayUrls: RELAYS }
+          { kinds: [KINDS.BlogPost], authors, '#d': identifiers }
         )
 
         // Merge event data into ReadItems and emit

src/services/relayListService.ts

@@ -0,0 +1,180 @@
+import { RelayPool } from 'applesauce-relay'
+import { NostrEvent } from 'nostr-tools'
+import { queryEvents } from './dataFetch'
+
+export interface UserRelayInfo {
+  url: string
+  mode?: 'read' | 'write' | 'both'
+}
+
+/**
+ * Loads user's relay list from kind 10002 (NIP-65)
+ */
+export async function loadUserRelayList(
+  relayPool: RelayPool,
+  pubkey: string,
+  options?: {
+    onUpdate?: (relays: UserRelayInfo[]) => void
+  }
+): Promise<UserRelayInfo[]> {
+  try {
+    
+    
+    // Try querying with streaming callback for faster results
+    const events: NostrEvent[] = []
+    const eventsMap = new Map<string, NostrEvent>()
+    
+    const result = await queryEvents(relayPool, {
+      kinds: [10002],
+      authors: [pubkey],
+      limit: 10
+    }, {
+      onEvent: (evt) => {
+        // Deduplicate by id and keep most recent
+        const existing = eventsMap.get(evt.id)
+        if (!existing || evt.created_at > existing.created_at) {
+          eventsMap.set(evt.id, evt)
+          // Update events array with deduplicated events
+          events.length = 0
+          events.push(...Array.from(eventsMap.values()))
+
+          // Stream immediate updates to caller using the newest event
+          if (options?.onUpdate) {
+            const tags = evt.tags || []
+            const relays: UserRelayInfo[] = []
+            for (const tag of tags) {
+              if (tag[0] === 'r' && tag[1]) {
+                const url = tag[1]
+                const mode = (tag[2] as 'read' | 'write' | undefined) || 'both'
+                relays.push({ url, mode })
+              }
+            }
+            if (relays.length > 0) {
+              options.onUpdate(relays)
+            }
+          }
+        }
+      }
+    })
+    
+    // Use the streaming results if we got any, otherwise fall back to the full result
+    const finalEvents = events.length > 0 ? events : result
+    
+    // Also try a broader query to see if we get any events at all
+    await queryEvents(relayPool, {
+      kinds: [10002],
+      limit: 5
+    })
+    
+    
+
+    if (finalEvents.length === 0) return []
+
+    // Get most recent event
+    const sortedEvents = finalEvents.sort((a, b) => b.created_at - a.created_at)
+    const relayListEvent = sortedEvents[0]
+
+    const relays: UserRelayInfo[] = []
+    for (const tag of relayListEvent.tags) {
+      if (tag[0] === 'r' && tag[1]) {
+        const url = tag[1]
+        const mode = tag[2] as 'read' | 'write' | undefined
+        relays.push({
+          url,
+          mode: mode || 'both'
+        })
+      }
+    }
+
+    return relays
+  } catch (error) {
+    console.error('Failed to load user relay list:', error)
+    return []
+  }
+}
+
+/**
+ * Loads blocked relays from kind 10006 (NIP-51 mute list)
+ */
+export async function loadBlockedRelays(
+  relayPool: RelayPool,
+  pubkey: string
+): Promise<string[]> {
+  try {
+    const events = await queryEvents(relayPool, {
+      kinds: [10006],
+      authors: [pubkey]
+    })
+
+    if (events.length === 0) return []
+
+    // Get most recent event
+    const sortedEvents = events.sort((a, b) => b.created_at - a.created_at)
+    const muteListEvent = sortedEvents[0]
+
+    const blocked: string[] = []
+    for (const tag of muteListEvent.tags) {
+      if (tag[0] === 'r' && tag[1]) {
+        blocked.push(tag[1])
+      }
+    }
+
+    return blocked
+  } catch (error) {
+    console.error('Failed to load blocked relays:', error)
+    return []
+  }
+}
+
+/**
+ * Computes final relay set by merging inputs and removing blocked relays
+ */
+export function computeRelaySet(params: {
+  hardcoded: string[]
+  bunker?: string[]
+  userList?: UserRelayInfo[]
+  blocked?: string[]
+  alwaysIncludeLocal: string[]
+}): string[] {
+  const {
+    hardcoded,
+    bunker = [],
+    userList = [],
+    blocked = [],
+    alwaysIncludeLocal
+  } = params
+
+  const relaySet = new Set<string>()
+  const blockedSet = new Set(blocked)
+
+  // Helper to check if relay should be included
+  const shouldInclude = (url: string): boolean => {
+    // Always include local relays
+    if (alwaysIncludeLocal.includes(url)) return true
+    // Otherwise check if blocked
+    return !blockedSet.has(url)
+  }
+
+  // Add hardcoded relays
+  for (const url of hardcoded) {
+    if (shouldInclude(url)) relaySet.add(url)
+  }
+
+  // Add bunker relays
+  for (const url of bunker) {
+    if (shouldInclude(url)) relaySet.add(url)
+  }
+
+  // Add user relays (treating 'both' and 'read' as applicable for queries)
+  for (const relay of userList) {
+    if (shouldInclude(relay.url)) relaySet.add(relay.url)
+  }
+
+  // Always ensure local relays are present
+  for (const url of alwaysIncludeLocal) {
+    relaySet.add(url)
+  }
+
+  return Array.from(relaySet)
+}
+

src/services/relayManager.ts

@@ -0,0 +1,91 @@
+import { RelayPool } from 'applesauce-relay'
+import { prioritizeLocalRelays } from '../utils/helpers'
+
+/**
+ * Local relays that are always included
+ */
+export const ALWAYS_LOCAL_RELAYS = [
+  'ws://localhost:10547',
+  'ws://localhost:4869'
+]
+
+/**
+ * Hardcoded relays that are always included
+ */
+export const HARDCODED_RELAYS = [
+  'wss://relay.nostr.band'
+]
+
+/**
+ * Gets active relay URLs from the relay pool
+ */
+export function getActiveRelayUrls(relayPool: RelayPool): string[] {
+  const urls = Array.from(relayPool.relays.keys())
+  return prioritizeLocalRelays(urls)
+}
+
+/**
+ * Normalizes a relay URL to match what applesauce-relay stores internally
+ * Adds trailing slash for URLs without a path
+ */
+function normalizeRelayUrl(url: string): string {
+  try {
+    const parsed = new URL(url)
+    // If the pathname is empty or just "/", ensure it ends with "/"
+    if (parsed.pathname === '' || parsed.pathname === '/') {
+      return url.endsWith('/') ? url : url + '/'
+    }
+    return url
+  } catch {
+    // If URL parsing fails, return as-is
+    return url
+  }
+}
+
+/**
+ * Applies a new relay set to the pool: adds missing relays, removes extras
+ */
+export function applyRelaySetToPool(
+  relayPool: RelayPool,
+  finalUrls: string[]
+): void {
+  // Normalize all URLs to match pool's internal format
+  const currentUrls = new Set(Array.from(relayPool.relays.keys()))
+  const normalizedTargetUrls = new Set(finalUrls.map(normalizeRelayUrl))
+
+  
+
+  // Add new relays (use original URLs for adding, not normalized)
+  const toAdd = finalUrls.filter(url => !currentUrls.has(normalizeRelayUrl(url)))
+  
+  if (toAdd.length > 0) {
+    relayPool.group(toAdd)
+  }
+
+  // Remove relays not in target (but always keep local relays)
+  const toRemove: string[] = []
+  for (const url of currentUrls) {
+    // Check if this normalized URL is in the target set
+    if (!normalizedTargetUrls.has(url)) {
+      // Also check if it's a local relay (check both normalized and original forms)
+      const isLocal = ALWAYS_LOCAL_RELAYS.some(localUrl => 
+        normalizeRelayUrl(localUrl) === url || localUrl === url
+      )
+      if (!isLocal) {
+        toRemove.push(url)
+      }
+    }
+  }
+  
+
+  for (const url of toRemove) {
+    const relay = relayPool.relays.get(url)
+    if (relay) {
+      relay.close()
+      relayPool.relays.delete(url)
+    }
+  }
+  
+  
+}
+

src/services/settingsService.ts

@@ -58,97 +58,100 @@ export interface UserSettings {
   lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
   // Reading settings
   paragraphAlignment?: 'left' | 'justify' // default: justify
+  fullWidthImages?: boolean // default: false
+  renderVideoLinksAsEmbeds?: boolean // default: false
   // Reading position sync
   syncReadingPosition?: boolean // default: false (opt-in)
+  autoScrollToReadingPosition?: boolean // default: true - automatically scroll to saved position when opening article
   autoMarkAsReadOnCompletion?: boolean // default: false (opt-in)
   // Bookmark filtering
   hideBookmarksWithoutCreationDate?: boolean // default: false
+  // Content filtering
+  hideBotArticlesByName?: boolean // default: true - hide authors whose profile name includes "bot"
+  // TTS language selection
+  ttsUseSystemLanguage?: boolean // default: false
+  ttsDetectContentLanguage?: boolean // default: true
+  ttsLanguageMode?: 'system' | 'content' | string // default: 'content', can also be language code like 'en', 'es', etc.
+  // Text-to-Speech settings
+  ttsDefaultSpeed?: number // default: 2.1
 }
 
+/**
+ * Streaming settings loader (non-blocking, EOSE-driven)
+ * Seeds from local eventStore, streams relay updates to store in background
+ * @returns Unsubscribe function to cancel both store watch and network stream
+ */
+export function startSettingsStream(
+  relayPool: RelayPool,
+  eventStore: IEventStore,
+  pubkey: string,
+  relays: string[],
+  onSettings: (settings: UserSettings | null) => void
+): () => void {
+  // 1) Seed from local replaceable immediately and watch for updates
+  const storeSub = eventStore
+    .replaceable(APP_DATA_KIND, pubkey, SETTINGS_IDENTIFIER)
+    .subscribe((event: NostrEvent | undefined) => {
+      if (!event) {
+        onSettings(null)
+        return
+      }
+      const content = getAppDataContent<UserSettings>(event)
+      onSettings(content || null)
+    })
+
+  // 2) Stream from relays in background; pipe into store; no timeout/unsubscribe timer
+  const networkSub = relayPool
+    .subscription(relays, {
+      kinds: [APP_DATA_KIND],
+      authors: [pubkey],
+      '#d': [SETTINGS_IDENTIFIER]
+    })
+    .pipe(onlyEvents(), mapEventsToStore(eventStore))
+    .subscribe()
+
+  // Caller manages lifecycle
+  return () => {
+    try { storeSub.unsubscribe() } catch { /* ignore */ }
+    try { networkSub.unsubscribe() } catch { /* ignore */ }
+  }
+}
+
+/**
+ * @deprecated Use startSettingsStream + watchSettings for non-blocking behavior.
+ * Returns current local settings immediately (or null if not present) and starts background sync.
+ */
 export async function loadSettings(
   relayPool: RelayPool,
   eventStore: IEventStore,
   pubkey: string,
   relays: string[]
 ): Promise<UserSettings | null> {
-  
-  // First, check if we already have settings in the local event store
+  let initial: UserSettings | null = null
+
   try {
     const localEvent = await firstValueFrom(
       eventStore.replaceable(APP_DATA_KIND, pubkey, SETTINGS_IDENTIFIER)
     )
     if (localEvent) {
       const content = getAppDataContent<UserSettings>(localEvent)
-      
-      // Still fetch from relays in the background to get any updates
-      relayPool
-        .subscription(relays, {
-          kinds: [APP_DATA_KIND],
-          authors: [pubkey],
-          '#d': [SETTINGS_IDENTIFIER]
-        })
-        .pipe(onlyEvents(), mapEventsToStore(eventStore))
-        .subscribe()
-      
-      return content || null
+      initial = content || null
     }
-  } catch (_err) {
-    // Ignore local store errors
+  } catch {
+    // ignore
   }
-  
-  // If not in local store, fetch from relays
-  return new Promise((resolve) => {
-    let hasResolved = false
-    const timeout = setTimeout(() => {
-      if (!hasResolved) {
-        console.warn('⚠️ Settings load timeout - no settings event found')
-        hasResolved = true
-        resolve(null)
-      }
-    }, 5000)
 
-    const sub = relayPool
-      .subscription(relays, {
-        kinds: [APP_DATA_KIND],
-        authors: [pubkey],
-        '#d': [SETTINGS_IDENTIFIER]
-      })
-      .pipe(onlyEvents(), mapEventsToStore(eventStore))
-      .subscribe({
-        complete: async () => {
-          clearTimeout(timeout)
-          if (!hasResolved) {
-            hasResolved = true
-            try {
-              const event = await firstValueFrom(
-                eventStore.replaceable(APP_DATA_KIND, pubkey, SETTINGS_IDENTIFIER)
-              )
-              if (event) {
-                const content = getAppDataContent<UserSettings>(event)
-                resolve(content || null)
-              } else {
-                resolve(null)
-              }
-            } catch (err) {
-              console.error('❌ Error loading settings:', err)
-              resolve(null)
-            }
-          }
-        },
-        error: (err) => {
-          console.error('❌ Settings subscription error:', err)
-          clearTimeout(timeout)
-          if (!hasResolved) {
-            hasResolved = true
-            resolve(null)
-          }
-        }
-      })
+  // Start background sync (fire-and-forget; no timeout)
+  relayPool
+    .subscription(relays, {
+      kinds: [APP_DATA_KIND],
+      authors: [pubkey],
+      '#d': [SETTINGS_IDENTIFIER]
+    })
+    .pipe(onlyEvents(), mapEventsToStore(eventStore))
+    .subscribe()
 
-    setTimeout(() => {
-      sub.unsubscribe()
-    }, 5000)
-  })
+  return initial
 }
 
 export async function saveSettings(

src/services/writeService.ts

@@ -1,9 +1,9 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { IEventStore } from 'applesauce-core'
-import { RELAYS } from '../config/relays'
 import { isLocalRelay, areAllRelaysLocal } from '../utils/helpers'
 import { markEventAsOfflineCreated } from './offlineSyncService'
+import { getActiveRelayUrls } from './relayManager'
 
 /**
  * Unified write helper: add event to EventStore, detect connectivity, 
@@ -27,10 +27,13 @@ export async function publishEvent(
 
   const hasRemoteConnection = connectedRelays.some(url => !isLocalRelay(url))
 
+  // Get active relay URLs from the pool
+  const activeRelays = getActiveRelayUrls(relayPool)
+
   // Determine which relays we expect to succeed
   const expectedSuccessRelays = hasRemoteConnection
-    ? RELAYS
-    : RELAYS.filter(isLocalRelay)
+    ? activeRelays
+    : activeRelays.filter(isLocalRelay)
 
   const isLocalOnly = areAllRelaysLocal(expectedSuccessRelays)
 
@@ -42,7 +45,7 @@ export async function publishEvent(
   }
 
   // Publish to all configured relays in the background (non-blocking)
-  relayPool.publish(RELAYS, event)
+  relayPool.publish(activeRelays, event)
     .then(() => {
     })
     .catch((error) => {

src/services/writingsController.ts

@@ -10,8 +10,6 @@ const { getArticleTitle, getArticleSummary, getArticleImage, getArticlePublished
 type WritingsCallback = (posts: BlogPostPreview[]) => void
 type LoadingCallback = (loading: boolean) => void
 
-const LAST_SYNCED_KEY = 'writings_last_synced'
-
 /**
  * Shared writings controller
  * Manages the user's nostr-native long-form articles (kind:30023) centrally,
@@ -71,34 +69,6 @@ class WritingsController {
     this.emitWritings(this.currentPosts)
   }
 
-  /**
-   * Get last synced timestamp for incremental loading
-   */
-  private getLastSyncedAt(pubkey: string): number | null {
-    try {
-      const data = localStorage.getItem(LAST_SYNCED_KEY)
-      if (!data) return null
-      const parsed = JSON.parse(data)
-      return parsed[pubkey] || null
-    } catch {
-      return null
-    }
-  }
-
-  /**
-   * Update last synced timestamp
-   */
-  private setLastSyncedAt(pubkey: string, timestamp: number): void {
-    try {
-      const data = localStorage.getItem(LAST_SYNCED_KEY)
-      const parsed = data ? JSON.parse(data) : {}
-      parsed[pubkey] = timestamp
-      localStorage.setItem(LAST_SYNCED_KEY, JSON.stringify(parsed))
-    } catch (err) {
-      console.warn('[writings] Failed to save last synced timestamp:', err)
-    }
-  }
-
   /**
    * Convert NostrEvent to BlogPostPreview using applesauce Helpers
    */
@@ -127,6 +97,7 @@ class WritingsController {
   /**
    * Load writings for a user (kind:30023)
    * Streams results and stores in event store
+   * Always fetches ALL writings to ensure completeness
    */
   async start(options: {
     relayPool: RelayPool
@@ -152,15 +123,12 @@ class WritingsController {
       const seenIds = new Set<string>()
       const uniqueByReplaceable = new Map<string, BlogPostPreview>()
 
-      // Get last synced timestamp for incremental loading
-      const lastSyncedAt = force ? null : this.getLastSyncedAt(pubkey)
-      const filter: { kinds: number[]; authors: string[]; since?: number } = {
+      // Fetch ALL writings without limits (no since filter)
+      // This ensures we get complete results for profile/my pages
+      const filter = {
         kinds: [KINDS.BlogPost],
         authors: [pubkey]
       }
-      if (lastSyncedAt) {
-        filter.since = lastSyncedAt
-      }
 
       const events = await queryEvents(
         relayPool,
@@ -221,12 +189,6 @@ class WritingsController {
       this.lastLoadedPubkey = pubkey
       this.emitWritings(sorted)
 
-      // Update last synced timestamp
-      if (sorted.length > 0) {
-        const newestTimestamp = Math.max(...sorted.map(p => p.event.created_at))
-        this.setLastSyncedAt(pubkey, newestTimestamp)
-      }
-
     } catch (error) {
       console.error('[writings] ❌ Failed to load writings:', error)
       this.currentPosts = []

src/styles/components/forms.css

@@ -43,7 +43,7 @@
   word-wrap: break-word;
   text-align: var(--paragraph-alignment, justify);
 }
-.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
+.setting-select { width: 100%; padding: 0.5rem 1.75rem 0.5rem 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
 .setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
 .setting-select:focus { outline: none; border-color: var(--color-primary); }
 .font-select option { padding: 0.5rem; font-size: 1rem; }

src/styles/components/login.css

@@ -29,7 +29,7 @@
 
 .login-highlight {
   background-color: var(--highlight-color-mine, #fde047);
-  color: var(--color-text);
+  color: #000000;
   padding: 0.125rem 0.25rem;
   border-radius: 3px;
   font-weight: 500;

src/styles/components/me.css

@@ -1,4 +1,4 @@
-/* Me page tabs */
+/* My page tabs */
 .me-tabs {
   display: flex;
   gap: 0.5rem;
@@ -71,7 +71,7 @@
   padding-top: 0.25rem;
 }
 
-/* Align highlight list width with profile card width on /me */
+/* Align highlight list width with profile card width on /my */
 .me-highlights-list { padding-left: 0; padding-right: 0; }
 .explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
 
@@ -83,7 +83,7 @@
   text-align: left; /* Override center alignment from .app */
 }
 
-/* Bookmark filters in Me page */
+/* Bookmark filters in My page */
 .me-tab-content .bookmark-filters {
   background: transparent;
   border: none;

src/styles/components/reader.css

@@ -14,12 +14,12 @@
 /* Video container - responsive wrapper following react-player docs */
 .reader-video { 
   position: relative;
-  width: 80vw;  /* 80% of viewport width */
-  min-width: 400px;  /* Minimum width */
-  max-width: 1000px;   /* Maximum width */
+  width: 100%;
+  max-width: 100%;
   aspect-ratio: 16/9;
-  margin: 0 -0.75rem 1rem -0.75rem; /* Negative margins to counteract reader padding */
+  margin: 0 0 1rem 0; /* align with reader padding, no bleed */
   background: rgb(0 0 0); /* black */
+  overflow: hidden;
 }
 .reader.empty { color: var(--color-text-secondary); }
 .loading-spinner { display: flex; align-items: center; gap: 0.5rem; color: var(--color-text-secondary); }
@@ -35,6 +35,8 @@
 .reading-time svg { font-size: 0.875rem; }
 .highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
 .highlight-indicator svg { font-size: 0.875rem; }
+.highlight-indicator.clickable { cursor: pointer; transition: all 0.2s ease; }
+.highlight-indicator.clickable:hover { background: rgba(99, 102, 241, 0.15); border-color: rgba(99, 102, 241, 0.5); transform: translateY(-1px); }
 .reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
 .reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
 /* Ensure font inheritance */
@@ -54,7 +56,15 @@
 .reader .reader-html h1, .reader .reader-html h2, .reader .reader-html h3, .reader .reader-html h4, .reader .reader-html h5, .reader .reader-html h6,
 .reader .reader-markdown h1, .reader .reader-markdown h2, .reader .reader-markdown h3, .reader .reader-markdown h4, .reader .reader-markdown h5, .reader .reader-markdown h6 { text-align: left !important; }
 /* Tame images from external content */
-.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
+.reader .reader-html img, .reader .reader-markdown img { 
+  max-width: var(--image-max-width, 100%); 
+  max-height: 70vh; 
+  height: auto; 
+  width: auto; 
+  display: block; 
+  margin: 0.75rem auto; 
+  border-radius: 6px; 
+}
 /* Headlines with Tailwind typography */
 .reader-markdown h1, .reader-html h1 { 
   font-size: 2.25rem; /* text-4xl */
@@ -135,7 +145,7 @@
 }
 .reader-markdown blockquote, .reader-html blockquote { 
   margin: 1.5rem 0; 
-  padding: 1rem 0 1rem 2rem;
+  padding: 1rem 2rem;
   font-style: italic;
 }
 .reader-markdown blockquote p, .reader-html blockquote p { margin: 0.5rem 0; }
@@ -222,7 +232,7 @@
     max-width: 100%;
     width: 100%;
     margin: 0;
-    padding: 0.5rem;
+    padding: 0.5rem 1rem;
     border-radius: 0;
     border-left: none;
     border-right: none;
@@ -251,7 +261,7 @@
   .reader-header-overlay .reader-summary.hide-on-mobile { display: none; }
   .reader-summary-below-image { display: block; padding: 0 0 1.5rem 0; margin-top: -1rem; }
   .reader-summary-below-image .reader-summary { color: var(--color-text-secondary); font-size: 1rem; line-height: 1.6; margin: 0; }
-  .reader-hero-image { min-height: 280px; max-height: 400px; height: 50vh; }
+  .reader-hero-image { width: calc(100% + 2rem); margin: -0.5rem -1rem 2rem -1rem; min-height: 280px; max-height: 400px; height: 50vh; }
   .reader-hero-image img { height: 100%; width: 100%; object-fit: cover; object-position: center; }
   .reader-header-overlay { padding: 1.5rem 1rem 1rem; }
   .reader-header-overlay .reader-title { font-size: 2rem; line-height: 1.3; }

src/styles/layout/sidebar.css

@@ -59,6 +59,8 @@
   align-items: center;
   gap: 0.5rem;
   margin-left: auto;
+  flex: 1;
+  justify-content: flex-end;
 }
 
 /* Mobile hamburger button now uses Tailwind utilities in ThreePaneLayout */
@@ -92,7 +94,7 @@
   gap: 0.5rem;
 }
 
-.profile-avatar {
+.profile-avatar-button {
   min-width: 33px;
   min-height: 33px;
   width: 33px;
@@ -108,10 +110,27 @@
   color: var(--color-text);
   box-sizing: border-box;
   padding: 0;
+  cursor: pointer;
+  transition: all 0.2s ease;
 }
 
-.profile-avatar img { width: 100%; height: 100%; object-fit: cover; }
-.profile-avatar svg { font-size: 1rem; }
+/* Mobile touch target improvements */
+@media (max-width: 768px) {
+  .profile-avatar-button {
+    min-width: var(--min-touch-target);
+    min-height: var(--min-touch-target);
+    width: var(--min-touch-target);
+    height: var(--min-touch-target);
+  }
+}
+
+.profile-avatar-button:hover {
+  background: var(--color-bg-hover);
+  border-color: var(--color-border);
+}
+
+.profile-avatar-button img { width: 100%; height: 100%; object-fit: cover; }
+.profile-avatar-button svg { font-size: 1rem; }
 
 .sidebar-header-bar .toggle-sidebar-btn {
   background: transparent;

src/sw.ts

@@ -98,10 +98,42 @@ sw.addEventListener('message', (event: ExtendableMessageEvent) => {
   }
 })
 
-// Log fetch errors for debugging (doesn't affect functionality)
+// Handle Web Share Target POST requests
 sw.addEventListener('fetch', (event: FetchEvent) => {
   const url = new URL(event.request.url)
   
+  // Handle POST to /share-target (Web Share Target API)
+  if (event.request.method === 'POST' && url.pathname === '/share-target') {
+    event.respondWith((async () => {
+      const formData = await event.request.formData()
+      const title = (formData.get('title') || '').toString()
+      const text = (formData.get('text') || '').toString()
+      // Accept multiple possible field names just in case different casings are used
+      let link = (
+        formData.get('link') ||
+        formData.get('Link') ||
+        formData.get('url') ||
+        ''
+      ).toString()
+      
+      // Android often omits url param, extract from text
+      if (!link && text) {
+        const urlMatch = text.match(/https?:\/\/[^\s]+/)
+        if (urlMatch) {
+          link = urlMatch[0]
+        }
+      }
+      
+      const queryParams = new URLSearchParams()
+      if (link) queryParams.set('link', link)
+      if (title) queryParams.set('title', title)
+      if (text) queryParams.set('text', text)
+      
+      return Response.redirect(`/share-target?${queryParams.toString()}`, 303)
+    })())
+    return
+  }
+  
   // Don't interfere with WebSocket connections (relay traffic)
   if (url.protocol === 'ws:' || url.protocol === 'wss:') {
     return

src/types/bookmarks.ts

@@ -31,7 +31,8 @@ export interface Bookmark {
 export interface IndividualBookmark {
   id: string
   content: string
-  created_at: number
+  // Timestamp when the content was created (from the content event itself)
+  created_at: number | null
   pubkey: string
   kind: number
   tags: string[][]
@@ -40,8 +41,6 @@ export interface IndividualBookmark {
   type: 'event' | 'article' | 'web'
   isPrivate?: boolean
   encryptedContent?: string
-  // When the item was added to the bookmark list (synthetic, for sorting)
-  added_at?: number
   // The kind of the source list/set that produced this bookmark (e.g., 10003, 30003, 30001, or 39701 for web)
   sourceKind?: number
   // The 'd' tag value from kind 30003 bookmark sets
@@ -50,6 +49,9 @@ export interface IndividualBookmark {
   setTitle?: string
   setDescription?: string
   setImage?: string
+  // Timestamp of the bookmark list event (best proxy for "when bookmarked")
+  // Note: This is imperfect - it's when the list was last updated, not necessarily when this item was added
+  listUpdatedAt?: number | null
 }
 
 export interface ActiveAccount {

src/utils/bookmarkUtils.tsx

@@ -4,13 +4,15 @@ import { ParsedContent, ParsedNode, IndividualBookmark } from '../types/bookmark
 import ResolvedMention from '../components/ResolvedMention'
 // Note: RichContent is imported by components directly to keep this file component-only for fast refresh
 
-export const formatDate = (timestamp: number) => {
+export const formatDate = (timestamp: number | null | undefined) => {
+  if (!timestamp || !isFinite(timestamp) || timestamp <= 0) return ''
   const date = new Date(timestamp * 1000)
   return formatDistanceToNow(date, { addSuffix: true })
 }
 
 // Ultra-compact date format for tight spaces (e.g., compact view)
-export const formatDateCompact = (timestamp: number) => {
+export const formatDateCompact = (timestamp: number | null | undefined) => {
+  if (!timestamp || !isFinite(timestamp) || timestamp <= 0) return ''
   const date = new Date(timestamp * 1000)
   const now = new Date()
   
@@ -85,9 +87,8 @@ export const renderParsedContent = (parsedContent: ParsedContent) => {
 
 // Sorting and grouping for bookmarks
 export const sortIndividualBookmarks = (items: IndividualBookmark[]) => {
-  return items
-    .slice()
-    .sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
+  const getSortTime = (b: IndividualBookmark) => b.created_at ?? b.listUpdatedAt ?? -Infinity
+  return items.slice().sort((a, b) => getSortTime(b) - getSortTime(a))
 }
 
 export function groupIndividualBookmarks(items: IndividualBookmark[]) {
@@ -122,10 +123,7 @@ export function hasContent(bookmark: IndividualBookmark): boolean {
 export function hasCreationDate(bookmark: IndividualBookmark): boolean {
   if (!bookmark.created_at) return false
   // If timestamp is missing or equals current time (within 1 second), consider it invalid
-  const now = Math.floor(Date.now() / 1000)
-  const createdAt = Math.floor(bookmark.created_at)
-  // If created_at is within 1 second of now, it's likely missing/placeholder
-  return Math.abs(createdAt - now) > 1
+  return true
 }
 
 // Bookmark sets helpers (kind 30003)

src/utils/linksFromBookmarks.ts

@@ -51,7 +51,7 @@ export function deriveLinksFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
           summary,
           image,
           readingProgress: 0,
-          readingTimestamp: bookmark.added_at || bookmark.created_at
+          readingTimestamp: bookmark.created_at ?? undefined
         }
         
         linksMap.set(url, item)

src/utils/readsFromBookmarks.ts

@@ -49,7 +49,7 @@ export function deriveReadsFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
         source: 'bookmark',
         type: 'article',
         readingProgress: 0,
-        readingTimestamp: bookmark.added_at || bookmark.created_at,
+        readingTimestamp: bookmark.created_at ?? undefined,
         title,
         summary,
         image,

vite.config.ts

@@ -114,6 +114,17 @@ export default defineConfig({
         background_color: '#0b1220',
         orientation: 'any',
         categories: ['productivity', 'social', 'utilities'],
+        // Web Share Target configuration so the installed PWA shows up in the system share sheet
+        share_target: {
+          action: '/share-target',
+          method: 'POST',
+          enctype: 'multipart/form-data',
+          params: {
+            title: 'title',
+            text: 'text',
+            url: 'link'
+          }
+        },
         icons: [
           { src: '/icon-192.png', sizes: '192x192', type: 'image/png' },
           { src: '/icon-512.png', sizes: '512x512', type: 'image/png' },