chore: bump version to 0.10.8

feat: add /e/:eventId path for individual event rendering

CHANGELOG.md

@@ -7,6 +7,309 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ## [Unreleased]
 
+## [0.10.7] - 2025-10-21
+
+### Fixed
+
+- Profile pages now display all writings correctly
+  - Events are now stored in eventStore as they stream in from relays
+  - `fetchBlogPostsFromAuthors` now accepts `eventStore` parameter like other fetch functions
+  - Ensures all writings appear on `/p/` routes, not just the first few
+  - Background fetching of highlights and writings uses consistent patterns
+
+### Changed
+
+- Simplified profile background fetching logic for better maintainability
+  - Extracted relay URLs to variable for clarity
+  - Consistent error handling patterns across fetch functions
+  - Clearer comments about no-limit fetching behavior
+
+## [0.10.6] - 2025-10-21
+
+### Added
+
+- Text-to-speech reliability improvements
+  - Chunking support for long-form content to prevent WebSpeech API cutoffs
+  - Automatic chunk-based resumption for interrupted playback
+  - Better handling of content exceeding browser TTS limits
+
+### Fixed
+
+- Tab switching regression on `/me` page
+  - Resolved infinite update loop caused by circular dependency in `useCallback` hooks
+  - Tab navigation now properly updates UI when URL changes
+  - Removed `loadedTabs` from dependency arrays to prevent re-render cycles
+- Explore page data loading patterns
+  - Implemented subscribe-first, non-blocking loading model
+  - Removed all timeouts in favor of immediate subscription and progressive hydration
+  - Contacts, writings, and highlights now stream results as they arrive
+  - Nostrverse content loads in background without blocking UI
+- Text-to-speech handler cleanup
+  - Removed no-op self-assignment in rate change handler
+
+## [0.10.4] - 2025-10-21
+
+### Added
+
+- Web Share Target support for PWA (system-level share integration)
+  - Boris can now receive shared URLs from other apps on mobile and desktop
+  - Implements POST-based Web Share Target API per Chrome standards
+  - Service worker intercepts share requests and redirects to handler route
+  - ShareTargetHandler component auto-saves shared URLs as web bookmarks
+  - Android compatibility with URL extraction from text field when url param is missing
+  - Automatic navigation to bookmarks list after successful save
+  - Login prompt when sharing while logged out
+
+### Changed
+
+- Manifest now includes `share_target` configuration for system share menu integration
+- Service worker handles POST requests to `/share-target` endpoint
+- Added `/share-target` route for processing incoming shared content
+
+## [0.10.3] - 2025-10-21
+
+### Added
+
+- Content filtering setting to hide articles posted by bots
+  - New "Hide content posted by bots" checkbox in Explore settings (enabled by default)
+  - Filters articles where author's profile name or display_name contains "bot" (case-insensitive)
+  - Applies to both Explore page and Me section writings
+
+### Fixed
+
+- Resolved all linting and type checking issues
+  - Added missing React Hook dependencies to `useMemo` and `useEffect`
+  - Wrapped loader functions in `useCallback` to prevent unnecessary re-renders
+  - Removed unused variables (`queryTime`, `startTime`, `allEvents`)
+  - All ESLint warnings and TypeScript errors now resolved
+
+## [0.10.2] - 2025-10-20
+
+### Added
+
+- Text-to-speech (TTS) speaker language selection mode
+  - New "Speaker language" dropdown in TTS settings (system or content)
+  - Detects content language using tinyld for accurate voice matching
+  - Falls back to system language when content detection unavailable
+  - Top 10 languages featured in dropdown for quick access
+- TTS example text section in settings
+  - Test TTS voices directly in the settings panel
+  - Uses Boris mission statement as example text
+  - Real-time speaker selection testing
+
+### Changed
+
+- TTS language selection now uses "Speaker language" terminology
+  - Distinguishes between American English (en-US) and British English (en-GB)
+  - Improved language detection with content-aware voice selection
+  - Streamlined dropdown for better UX
+
+### Fixed
+
+- TTS voice detection and selection logic
+  - Proper empty catch block handling instead of silently failing
+  - Consistent use of `setting-select` class for dropdown styling
+  - Improved dropdown spacing with adequate padding-right
+
+## [0.10.0] - 2025-01-27
+
+### Added
+
+- Centralized bookmark loading with streaming and auto-decrypt
+  - Bookmarks now load progressively with streaming updates
+  - Auto-decrypt bookmarks as they arrive from relays
+  - Individual decrypt buttons for encrypted bookmark events
+  - Centralized bookmark controller for consistent loading across the app
+- Enhanced debug page with comprehensive diagnostics
+  - Interactive NIP-04 and NIP-44 encryption/decryption testing
+  - Live performance timing with stopwatch display
+  - Bookmark loading and decryption diagnostics
+  - Real-time bunker logs with filtering and clearing
+  - Version and git commit footer
+- Bunker (NIP-46) authentication support
+  - Support for remote signing via Nostr Connect protocol
+  - Bunker URI input with validation and error handling
+  - Automatic reconnection on app restore with proper permissions
+  - Signer suggestions in error messages (Amber, nsec.app, Nostrum)
+
+### Changed
+
+- Improved bookmark loading performance
+  - Non-blocking, progressive bookmark updates via callback pattern
+  - Batched background hydration using EventLoader and AddressLoader
+  - Shorter timeouts for debug page bookmark loading
+  - Sequential decryption instead of concurrent to avoid queue issues
+- Enhanced bunker error messages
+  - Formatted error messages with signer suggestions
+  - Links to nos2x, Amber, nsec.app, and Nostrum signers
+  - Better error handling for missing signer extensions
+- Centralized bookmark loading architecture
+  - Single shared bookmark controller for consistent loading
+  - Unified bookmark loading with streaming and auto-decrypt
+  - Consolidated bookmark loading into single centralized function
+
+### Fixed
+
+- NIP-46 bunker signing and decryption
+  - NostrConnectSigner properly reconnects with permissions on app restore
+  - Bunker relays added to relay pool for signing requests
+  - Proper setup of pool and relays before bunker reconnection
+  - Expose nip04/nip44 on NostrConnectAccount for bookmark decryption
+  - Cache wrapped nip04/nip44 objects instead of using getters
+  - Wait for bunker relay connections before marking signer ready
+  - Validate bunker URI (remote must differ from user pubkey)
+  - Accept remote===pubkey for Amber compatibility
+- Bookmark loading and decryption
+  - Bookmarks load and complete properly with streaming
+  - Auto-decrypt private bookmarks with NIP-04 detection
+  - Include decrypted private bookmarks in sidebar
+  - Skip background event fetching when there are too many IDs
+  - Only build bookmarks from ready events (unencrypted or decrypted)
+  - Restore Debug page decrypt display via onDecryptComplete callback
+  - Make controller onEvent non-blocking for queryEvents completion
+  - Proper timeout handling for bookmark decryption (no hanging)
+  - Smart encryption detection with consistent padlock display
+  - Sequential decryption instead of concurrent to avoid queue issues
+  - Add extraRelays to EventLoader and AddressLoader
+- TypeScript and linting errors throughout
+  - Replace empty catch blocks with warnings
+  - Fix explicit any types
+  - Add missing useEffect dependencies
+  - Resolve all linting issues in App.tsx, Debug.tsx, and async utilities
+
+### Performance
+
+- Non-blocking NIP-46 operations
+  - Fire-and-forget NIP-46 publish for better UI responsiveness
+  - Non-blocking bookmark decryption with sequential processing
+  - Make controller onEvent non-blocking for queryEvents completion
+- Optimized bookmark loading
+  - Batched background hydration using EventLoader and AddressLoader
+  - Progressive, non-blocking bookmark loading with streaming
+  - Shorter timeouts for debug page bookmark loading
+  - Remove artificial delays from bookmark decryption
+
+### Refactored
+
+- Centralized bookmark controller architecture
+  - Extract bookmark streaming helpers and centralize loading
+  - Consolidated bookmark loading into single function
+  - Remove deprecated bookmark service files
+  - Share bookmark controller between components
+- Debug page organization
+  - Extract VersionFooter component to eliminate duplication
+  - Structured sections with proper layout and styling
+  - Apply settings page styling structure
+- Simplified bunker implementation following applesauce patterns
+  - Clean up bunker implementation for better maintainability
+  - Import RELAYS from central config (DRY principle)
+  - Update RELAYS list with relay.nsec.app
+
+### Documentation
+
+- Comprehensive Amber.md documentation
+  - Amethyst-style bookmarks section
+  - Bunker decrypt investigation summary
+  - Critical queue disabling requirement
+  - NIP-46 setup and troubleshooting
+
+## [0.9.1] - 2025-10-20
+
+### Added
+
+- Video embedding for nostr-native content
+  - Detect and embed `<video>...</video>` blocks (including nested `<source>`)
+  - Detect and embed `<img src="…(mp4|webm|ogg|mov|avi|mkv|m4v)">` tags
+  - Detect and embed bare video file URLs and platform-classified video links
+- Media display settings
+  - New "Render video links as embeds" setting (defaults to enabled)
+  - New "Full-width images" display option
+  - Dedicated "Media Display" settings section
+- Article view improvements
+  - Center images by default in reader
+  - Writings list sorted by publication date (newest first)
+
+### Changed
+
+- Enable media display options by default for a better out‑of‑the‑box experience
+- Constrain video player to reader width to prevent horizontal overflow
+
+### Fixed
+
+- Prevent double video player rendering when both processor and panel attempted to embed
+- Remove text artifacts and broken tags when converting markdown image/video URLs
+  - Improved URL regex and robust tag replacement
+  - Avoid injecting unknown img props from markdown renderer
+- Resolved remaining ESLint and TypeScript issues
+
+### Performance
+
+- Optimized Support page loading with instant display and skeletons
+
+## [0.9.0] - 2025-01-20
+
+### Added
+
+- User relay list integration (NIP-65) and blocked relays (NIP-51)
+  - Automatically loads user's relay list from kind 10002 events
+  - Supports blocked relay filtering from kind 10006 mute lists
+  - Integrates with existing relay pool for seamless user experience
+- Relay list debug section in Debug component
+  - Enhanced debugging capabilities for relay list loading
+  - Detailed logging for relay query diagnostics
+
+### Changed
+
+- Improved relay list loading performance
+  - Added streaming callback to relay list service for faster results
+  - User relay list now streams into pool immediately and finalizes after blocked relays
+  - Made relay list loading non-blocking in App.tsx
+- Enhanced relay URL handling
+  - Normalized relay URLs to match applesauce-relay internal format
+  - Removed relay.dergigi.com from default relays
+  - Use user's relay list exclusively when logged in
+
+### Fixed
+
+- Resolved all linting issues across the codebase
+- Fixed TypeScript type issues in relayListService
+  - Replaced any types with proper NostrEvent types
+  - Improved type safety and code quality
+- Cleaned up temporary test relays from hardcoded list
+- Removed non-relay console.log statements and debug output
+
+### Technical
+
+- Enhanced relay initialization logging for better diagnostics
+- Improved error handling and timeout management for relay queries
+- Better separation of concerns between relay loading and application startup
+
+## [0.8.6] - 2025-10-20
+
+### Fixed
+
+- React Hooks violations in NostrMentionLink component
+  - Fixed useEffect dependency warnings by removing isMounted from dependencies
+  - Reverted to inline mount tracking with useRef for safer lifecycle handling
+
+## [0.8.4] - 2024-10-20
+
+### Added
+
+- Progressive article hydration for reads tab
+  - Articles now load titles, summaries, images, and author information progressively
+  - Implemented readsController following the same pattern as bookmarkController
+  - Uses AddressLoader for efficient batched article event retrieval
+  - Articles rehydrate as data arrives from relays without blocking initial display
+  - Event store integration for caching article events
+  - Centralized reads data fetching following DRY principles
+
+### Fixed
+
+- Fixed React type imports in useArticleLoader
+  - Import `Dispatch` and `SetStateAction` directly from 'react' instead of using `React.` prefix
+  - Resolves ESLint no-undef errors
+
 ## [0.8.3] - 2025-01-19
 
 ### Fixed
@@ -2085,7 +2388,13 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Optimize relay usage following applesauce-relay best practices
 - Use applesauce-react event models for better profile handling
 
-[Unreleased]: https://github.com/dergigi/boris/compare/v0.8.3...HEAD
+[Unreleased]: https://github.com/dergigi/boris/compare/v0.10.4...HEAD
+[0.10.4]: https://github.com/dergigi/boris/compare/v0.10.3...v0.10.4
+[0.10.3]: https://github.com/dergigi/boris/compare/v0.10.2...v0.10.3
+[0.10.2]: https://github.com/dergigi/boris/compare/v0.10.1...v0.10.2
+[0.10.1]: https://github.com/dergigi/boris/compare/v0.10.0...v0.10.1
+[0.10.0]: https://github.com/dergigi/boris/compare/v0.9.1...v0.10.0
+[0.9.1]: https://github.com/dergigi/boris/compare/v0.9.0...v0.9.1
 [0.8.3]: https://github.com/dergigi/boris/compare/v0.8.2...v0.8.3
 [0.8.2]: https://github.com/dergigi/boris/compare/v0.8.0...v0.8.2
 [0.8.0]: https://github.com/dergigi/boris/compare/v0.7.4...v0.8.0

FEATURES.md

@@ -11,6 +11,7 @@
 - **Distraction‑free view**: Clean typography, optional hero image, summary, and published date.
 - **Reading time**: Displays estimated reading time for text or duration for supported videos.
 - **Progress**: Reading progress indicator with completion state.
+- **Text‑to‑Speech**: Listen to articles with browser‑native TTS; play/pause/stop controls with adjustable speed (0.8–1.6x).
 - **Menus**: Quick actions to open, share, or copy links (for both Nostr and web content).
 - **Performance**: Lightweight fetching and caching for speed; skeleton loaders to avoid empty flashes.
 

package-lock.json

@@ -1,12 +1,12 @@
 {
   "name": "boris",
-  "version": "0.8.4",
+  "version": "0.10.5",
   "lockfileVersion": 3,
   "requires": true,
   "packages": {
     "": {
       "name": "boris",
-      "version": "0.8.4",
+      "version": "0.10.5",
       "dependencies": {
         "@fortawesome/fontawesome-svg-core": "^7.1.0",
         "@fortawesome/free-regular-svg-icons": "^7.1.0",
@@ -35,6 +35,7 @@
         "rehype-prism-plus": "^2.0.1",
         "rehype-raw": "^7.0.0",
         "remark-gfm": "^4.0.1",
+        "tinyld": "^1.3.4",
         "use-pull-to-refresh": "^2.4.1"
       },
       "devDependencies": {
@@ -11215,6 +11216,22 @@
         "url": "https://github.com/sponsors/jonschlinkert"
       }
     },
+    "node_modules/tinyld": {
+      "version": "1.3.4",
+      "resolved": "https://registry.npmjs.org/tinyld/-/tinyld-1.3.4.tgz",
+      "integrity": "sha512-u26CNoaInA4XpDU+8s/6Cq8xHc2T5M4fXB3ICfXPokUQoLzmPgSZU02TAkFwFMJCWTjk53gtkS8pETTreZwCqw==",
+      "license": "MIT",
+      "bin": {
+        "tinyld": "bin/tinyld.js",
+        "tinyld-heavy": "bin/tinyld-heavy.js",
+        "tinyld-light": "bin/tinyld-light.js"
+      },
+      "engines": {
+        "node": ">= 12.10.0",
+        "npm": ">= 6.12.0",
+        "yarn": ">= 1.20.0"
+      }
+    },
     "node_modules/to-regex-range": {
       "version": "5.0.1",
       "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",

package.json

@@ -1,6 +1,6 @@
 {
   "name": "boris",
-  "version": "0.8.4",
+  "version": "0.10.8",
   "description": "A minimal nostr client for bookmark management",
   "homepage": "https://read.withboris.com/",
   "type": "module",
@@ -38,6 +38,7 @@
     "rehype-prism-plus": "^2.0.1",
     "rehype-raw": "^7.0.0",
     "remark-gfm": "^4.0.1",
+    "tinyld": "^1.3.4",
     "use-pull-to-refresh": "^2.4.1"
   },
   "devDependencies": {

public/manifest.webmanifest

@@ -9,6 +9,16 @@
   "background_color": "#0b1220",
   "orientation": "any",
   "categories": ["productivity", "social", "utilities"],
+  "share_target": {
+    "action": "/share-target",
+    "method": "POST",
+    "enctype": "multipart/form-data",
+    "params": {
+      "title": "title",
+      "text": "text",
+      "url": "link"
+    }
+  },
   "icons": [
     {
       "src": "/icon-192.png",

src/App.tsx

@@ -8,17 +8,20 @@ import { AccountManager, Accounts } from 'applesauce-accounts'
 import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
 import { RelayPool } from 'applesauce-relay'
 import { NostrConnectSigner } from 'applesauce-signers'
+import type { NostrEvent } from 'nostr-tools'
 import { getDefaultBunkerPermissions } from './services/nostrConnect'
 import { createAddressLoader } from 'applesauce-loaders/loaders'
 import Debug from './components/Debug'
 import Bookmarks from './components/Bookmarks'
 import RouteDebug from './components/RouteDebug'
 import Toast from './components/Toast'
+import ShareTargetHandler from './components/ShareTargetHandler'
 import { useToast } from './hooks/useToast'
 import { useOnlineStatus } from './hooks/useOnlineStatus'
 import { RELAYS } from './config/relays'
 import { SkeletonThemeProvider } from './components/Skeletons'
-import { DebugBus } from './utils/debugBus'
+import { loadUserRelayList, loadBlockedRelays, computeRelaySet } from './services/relayListService'
+import { applyRelaySetToPool, getActiveRelayUrls, ALWAYS_LOCAL_RELAYS, HARDCODED_RELAYS } from './services/relayManager'
 import { Bookmark } from './types/bookmarks'
 import { bookmarkController } from './services/bookmarkController'
 import { contactsController } from './services/contactsController'
@@ -92,7 +95,7 @@ function AppRoutes({
       
       // Load bookmarks
       if (bookmarks.length === 0 && !bookmarksLoading) {
-        bookmarkController.start({ relayPool, activeAccount, accountManager })
+        bookmarkController.start({ relayPool, activeAccount, accountManager, eventStore: eventStore || undefined })
       }
       
       // Load contacts
@@ -157,6 +160,10 @@ function AppRoutes({
 
   return (
     <Routes>
+      <Route 
+        path="/share-target" 
+        element={<ShareTargetHandler relayPool={relayPool} />} 
+      />
       <Route 
         path="/a/:naddr" 
         element={
@@ -341,6 +348,18 @@ function AppRoutes({
           />
         } 
       />
+      <Route 
+        path="/e/:eventId" 
+        element={
+          <Bookmarks 
+            relayPool={relayPool}
+            onLogout={handleLogout}
+            bookmarks={bookmarks}
+            bookmarksLoading={bookmarksLoading}
+            onRefreshBookmarks={handleRefreshBookmarks}
+          />
+        } 
+      />
       <Route 
         path="/debug" 
         element={
@@ -385,16 +404,9 @@ function App() {
       // Wire the signer to use this pool; make publish non-blocking so callers don't
       // wait for every relay send to finish. Responses still resolve the pending request.
       NostrConnectSigner.subscriptionMethod = pool.subscription.bind(pool)
-      NostrConnectSigner.publishMethod = (relays: string[], event: unknown) => {
-        // eslint-disable-next-line @typescript-eslint/no-explicit-any
-        const result: any = pool.publish(relays, event as any)
-        // eslint-disable-next-line @typescript-eslint/no-explicit-any
-        if (result && typeof (result as any).subscribe === 'function') {
-          // Subscribe to the observable but ignore completion/errors (fire-and-forget)
-          // eslint-disable-next-line @typescript-eslint/no-explicit-any
-          try { (result as any).subscribe({ complete: () => { /* noop */ }, error: () => { /* noop */ } }) } catch { /* ignore */ }
-        }
-        // Return an already-resolved promise so upstream await finishes immediately
+      NostrConnectSigner.publishMethod = (relays: string[], event: NostrEvent) => {
+        // Fire-and-forget publish; do not block callers
+        pool.publish(relays, event).catch(() => { /* ignore errors */ })
         return Promise.resolve()
       }
       
@@ -417,14 +429,10 @@ function App() {
           
           if (account) {
             accounts.setActive(activeId)
-          } else {
-            console.warn('[bunker] ⚠️  Active ID found but account not in list')
           }
-        } else {
-          // No active account ID in localStorage
         }
       } catch (err) {
-        console.error('[bunker] ❌ Failed to load accounts from storage:', err)
+        console.error('Failed to load accounts from storage:', err)
       }
       
       // Subscribe to accounts changes and persist to localStorage
@@ -493,61 +501,27 @@ function App() {
                   try {
                     const mergedRelays = Array.from(new Set([...(signerData.relays || []), ...RELAYS]))
                     recreatedSigner.relays = mergedRelays
-                  } catch (err) { console.warn('[bunker] failed to merge signer relays', err) }
+                  } catch (err) { /* ignore */ }
                   
                   // Replace the signer on the account
                   nostrConnectAccount.signer = recreatedSigner
                   
-                  // Debug: log publish/subscription calls made by signer (decrypt/sign requests)
+                  // Fire-and-forget publish for bunker: trigger but don't wait for completion
                   // IMPORTANT: bind originals to preserve `this` context used internally by the signer
                   const originalPublish = (recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod.bind(recreatedSigner)
                   ;(recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod = (relays: string[], event: unknown) => {
-                    try {
-                      let method: string | undefined
-                      const content = (event as { content?: unknown })?.content
-                      if (typeof content === 'string') {
-                        try {
-                          const parsed = JSON.parse(content) as { method?: string; id?: unknown }
-                          method = parsed?.method
-                        } catch (err) { console.warn('[bunker] failed to parse event content', err) }
-                      }
-                      const summary = {
-                        relays,
-                        kind: (event as { kind?: number })?.kind,
-                        method,
-                        // include tags array for debugging (NIP-46 expects method tag)
-                        tags: (event as { tags?: unknown })?.tags,
-                        contentLength: typeof content === 'string' ? content.length : undefined
-                      }
-                      try { DebugBus.info('bunker', 'publish', summary) } catch (err) { console.warn('[bunker] failed to log to DebugBus', err) }
-                    } catch (err) { console.warn('[bunker] failed to log publish summary', err) }
-                    // Fire-and-forget publish: trigger the publish but do not return the
-                    // Observable/Promise to upstream to avoid their awaiting of completion.
                     const result = originalPublish(relays, event)
                     if (result && typeof (result as { subscribe?: unknown }).subscribe === 'function') {
-                      // Subscribe to the observable but ignore completion/errors (fire-and-forget)
                       try { (result as { subscribe: (h: { complete?: () => void; error?: (e: unknown) => void }) => unknown }).subscribe({ complete: () => { /* noop */ }, error: () => { /* noop */ } }) } catch { /* ignore */ }
                     }
-                    // If it's a Promise, simply ignore it (no await) so it resolves in the background.
-                    // Return a benign object so callers that probe for a "subscribe" property
-                    // (e.g., applesauce makeRequest) won't throw on `"subscribe" in result`.
                     return {} as unknown as never
                   }
-                  const originalSubscribe = (recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod.bind(recreatedSigner)
-                  ;(recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod = (relays: string[], filters: unknown[]) => {
-                    try {
-                      try { DebugBus.info('bunker', 'subscribe', { relays, filters }) } catch (err) { console.warn('[bunker] failed to log subscribe to DebugBus', err) }
-                    } catch (err) { console.warn('[bunker] failed to log subscribe summary', err) }
-                    return originalSubscribe(relays, filters)
-                  }
 
                   
                   // Just ensure the signer is listening for responses - don't call connect() again
                   // The fromBunkerURI already connected with permissions during login
                   if (!nostrConnectAccount.signer.listening) {
                     await nostrConnectAccount.signer.open()
-                  } else {
-                    // Signer already listening
                   }
                   
                   // Attempt a guarded reconnect to ensure Amber authorizes decrypt operations
@@ -557,7 +531,7 @@ function App() {
                       await nostrConnectAccount.signer.connect(undefined, permissions)
                     }
                   } catch (e) {
-                    console.warn('[bunker] ⚠️ Guarded connect() failed:', e)
+                    // Ignore reconnect errors
                   }
                   
                   // Give the subscription a moment to fully establish before allowing decrypt operations
@@ -597,17 +571,132 @@ function App() {
                   // Mark this account as reconnected
                   reconnectedAccounts.add(account.id)
                 } catch (error) {
-                  console.error('[bunker] ❌ Failed to open signer:', error)
+                  console.error('Failed to open signer:', error)
                 }
               }
             })
       
+      // Handle user relay list and blocked relays when account changes
+      const userRelaysSub = accounts.active$.subscribe((account) => {
+        console.log('[relay-init] userRelaysSub fired, account:', account ? 'logged in' : 'logged out')
+        console.log('[relay-init] Pool has', Array.from(pool.relays.keys()).length, 'relays before applying changes')
+        if (account) {
+          // User logged in - start with hardcoded relays immediately, then stream user relay list updates
+          const pubkey = account.pubkey
+
+          // Bunker relays (if any)
+          let bunkerRelays: string[] = []
+          if (account.type === 'nostr-connect') {
+            const nostrConnectAccount = account as Accounts.NostrConnectAccount<unknown>
+            const signerData = nostrConnectAccount.toJSON().signer
+            bunkerRelays = signerData.relays || []
+          }
+          
+
+          // Start with hardcoded + bunker relays immediately (non-blocking)
+          const initialRelays = computeRelaySet({
+            hardcoded: RELAYS,
+            bunker: bunkerRelays,
+            userList: [],
+            blocked: [],
+            alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+          })
+          
+
+          // Apply initial set immediately
+          applyRelaySetToPool(pool, initialRelays)
+
+          // Prepare keep-alive helper
+          const updateKeepAlive = () => {
+            const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
+            if (poolWithSub._keepAliveSubscription) {
+              poolWithSub._keepAliveSubscription.unsubscribe()
+            }
+            const activeRelays = getActiveRelayUrls(pool)
+            const newKeepAliveSub = pool.subscription(activeRelays, { kinds: [0], limit: 0 }).subscribe({
+              next: () => {},
+              error: () => {}
+            })
+            poolWithSub._keepAliveSubscription = newKeepAliveSub
+          }
+
+          // Begin loading blocked relays in background
+          const blockedPromise = loadBlockedRelays(pool, pubkey)
+
+          // Stream user relay list; apply immediately on first/updated event
+          loadUserRelayList(pool, pubkey, {
+            onUpdate: (userRelays) => {
+              const interimRelays = computeRelaySet({
+                hardcoded: HARDCODED_RELAYS,
+                bunker: bunkerRelays,
+                userList: userRelays,
+                blocked: [],
+                alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+              })
+              
+              applyRelaySetToPool(pool, interimRelays)
+              updateKeepAlive()
+            }
+          }).then(async (userRelayList) => {
+            const blockedRelays = await blockedPromise.catch(() => [])
+
+            const finalRelays = computeRelaySet({
+              hardcoded: userRelayList.length > 0 ? HARDCODED_RELAYS : RELAYS,
+              bunker: bunkerRelays,
+              userList: userRelayList,
+              blocked: blockedRelays,
+              alwaysIncludeLocal: ALWAYS_LOCAL_RELAYS
+            })
+            
+            applyRelaySetToPool(pool, finalRelays)
+            
+            updateKeepAlive()
+            
+            // Update address loader with new relays
+            const activeRelays = getActiveRelayUrls(pool)
+            const addressLoader = createAddressLoader(pool, {
+              eventStore: store,
+              lookupRelays: activeRelays
+            })
+            store.addressableLoader = addressLoader
+            store.replaceableLoader = addressLoader
+          }).catch((error) => {
+            console.error('[relay-init] Failed to load user relay list (continuing with initial set):', error)
+            // Continue with initial relay set on error - no need to change anything
+          })
+        } else {
+          // User logged out - reset to hardcoded relays
+          
+          applyRelaySetToPool(pool, RELAYS)
+          
+          
+          // Update keep-alive subscription
+          const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
+          if (poolWithSub._keepAliveSubscription) {
+            poolWithSub._keepAliveSubscription.unsubscribe()
+          }
+          const newKeepAliveSub = pool.subscription(RELAYS, { kinds: [0], limit: 0 }).subscribe({
+            next: () => {},
+            error: () => {}
+          })
+          poolWithSub._keepAliveSubscription = newKeepAliveSub
+          
+          // Reset address loader
+          const addressLoader = createAddressLoader(pool, {
+            eventStore: store,
+            lookupRelays: RELAYS
+          })
+          store.addressableLoader = addressLoader
+          store.replaceableLoader = addressLoader
+        }
+      })
+      
       // Keep all relay connections alive indefinitely by creating a persistent subscription
       // This prevents disconnection when no other subscriptions are active
       // Create a minimal subscription that never completes to keep connections alive
       const keepAliveSub = pool.subscription(RELAYS, { kinds: [0], limit: 0 }).subscribe({
-        next: () => {}, // No-op, we don't care about events
-        error: (err) => console.warn('Keep-alive subscription error:', err)
+        next: () => {},
+        error: () => {}
       })
       
       // Store subscription for cleanup
@@ -630,6 +719,7 @@ function App() {
         accountsSub.unsubscribe()
         activeSub.unsubscribe()
         bunkerReconnectSub.unsubscribe()
+        userRelaysSub.unsubscribe()
         // Clean up keep-alive subscription if it exists
         const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
         if (poolWithSub._keepAliveSubscription) {

src/components/BlogPostCard.tsx

@@ -6,18 +6,26 @@ import { formatDistance } from 'date-fns'
 import { BlogPostPreview } from '../services/exploreService'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
+import { isKnownBot } from '../config/bots'
 
 interface BlogPostCardProps {
   post: BlogPostPreview
   href: string
   level?: 'mine' | 'friends' | 'nostrverse'
   readingProgress?: number // 0-1 reading progress (optional)
+  hideBotByName?: boolean // default true
 }
 
-const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress }) => {
+const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress, hideBotByName = true }) => {
   const profile = useEventModel(Models.ProfileModel, [post.author])
   const displayName = profile?.name || profile?.display_name || 
     `${post.author.slice(0, 8)}...${post.author.slice(-4)}`
+  const rawName = (profile?.name || profile?.display_name || '').toLowerCase()
+
+  // Hide bot authors by name/display_name
+  if (hideBotByName && (rawName.includes('bot') || isKnownBot(post.author))) {
+    return null
+  }
   
   const publishedDate = post.published || post.event.created_at
   const formattedDate = formatDistance(new Date(publishedDate * 1000), new Date(), { 

src/components/BookmarkItem.tsx

@@ -145,8 +145,20 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
   }
 
   if (viewMode === 'compact') {
-    // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-    const { articleImage, ...compactProps } = sharedProps
+    const compactProps = {
+      bookmark,
+      index,
+      hasUrls,
+      extractedUrls,
+      onSelectUrl,
+      authorNpub,
+      eventNevent,
+      getAuthorDisplayName,
+      handleReadNow,
+      articleSummary,
+      contentTypeIcon: getContentTypeIcon(),
+      readingProgress
+    }
     return <CompactView {...compactProps} />
   }
 

src/components/BookmarkList.tsx

@@ -17,8 +17,8 @@ import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWith
 import { UserSettings } from '../services/settingsService'
 import AddBookmarkModal from './AddBookmarkModal'
 import { createWebBookmark } from '../services/webBookmarkService'
-import { RELAYS } from '../config/relays'
 import { Hooks } from 'applesauce-react'
+import { getActiveRelayUrls } from '../services/relayManager'
 import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
 import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
 import LoginOptions from './LoginOptions'
@@ -125,7 +125,7 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
       throw new Error('Please login to create bookmarks')
     }
 
-    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
+    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, getActiveRelayUrls(relayPool))
   }
 
   // Pull-to-refresh for bookmarks
@@ -285,6 +285,13 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
         </div>
         {activeAccount && (
           <div className="view-mode-right">
+            <IconButton
+              icon={groupingMode === 'grouped' ? faLayerGroup : faBars}
+              onClick={toggleGroupingMode}
+              title={groupingMode === 'grouped' ? 'Show flat chronological list' : 'Show grouped by source'}
+              ariaLabel={groupingMode === 'grouped' ? 'Switch to flat view' : 'Switch to grouped view'}
+              variant="ghost"
+            />
             {onRefresh && (
               <IconButton
                 icon={faRotate}
@@ -296,13 +303,6 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
                 spin={isRefreshing}
               />
             )}
-            <IconButton
-              icon={groupingMode === 'grouped' ? faLayerGroup : faBars}
-              onClick={toggleGroupingMode}
-              title={groupingMode === 'grouped' ? 'Show flat chronological list' : 'Show grouped by source'}
-              ariaLabel={groupingMode === 'grouped' ? 'Switch to flat view' : 'Switch to grouped view'}
-              variant="ghost"
-            />
             <IconButton
               icon={faList}
               onClick={() => onViewModeChange('compact')}

src/components/BookmarkViews/CardView.tsx

@@ -5,7 +5,7 @@ import { faChevronDown, faChevronUp } from '@fortawesome/free-solid-svg-icons'
 import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
-import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
+import RichContent from '../RichContent'
 import { classifyUrl } from '../../utils/helpers'
 import { useImageCache } from '../../hooks/useImageCache'
 import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
@@ -147,19 +147,15 @@ export const CardView: React.FC<CardViewProps> = ({
       )}
       
       {isArticle && articleSummary ? (
-        <div className="bookmark-content article-summary">
-          <ContentWithResolvedProfiles content={articleSummary} />
-        </div>
+        <RichContent content={articleSummary} className="bookmark-content article-summary" />
       ) : bookmark.parsedContent ? (
         <div className="bookmark-content">
           {shouldTruncate && bookmark.content
-            ? <ContentWithResolvedProfiles content={`${bookmark.content.slice(0, 210).trimEnd()}…`} />
+            ? <RichContent content={`${bookmark.content.slice(0, 210).trimEnd()}…`} className="" />
             : renderParsedContent(bookmark.parsedContent)}
         </div>
       ) : bookmark.content && (
-        <div className="bookmark-content">
-          <ContentWithResolvedProfiles content={shouldTruncate ? `${bookmark.content.slice(0, 210).trimEnd()}…` : bookmark.content} />
-        </div>
+        <RichContent content={shouldTruncate ? `${bookmark.content.slice(0, 210).trimEnd()}…` : bookmark.content} />
       )}
 
       {contentLength > 210 && (

src/components/BookmarkViews/CompactView.tsx

@@ -1,9 +1,10 @@
 import React from 'react'
+import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDateCompact } from '../../utils/bookmarkUtils'
-import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
+import RichContent from '../RichContent'
 
 interface CompactViewProps {
   bookmark: IndividualBookmark
@@ -26,11 +27,15 @@ export const CompactView: React.FC<CompactViewProps> = ({
   contentTypeIcon,
   readingProgress
 }) => {
+  const navigate = useNavigate()
   const isArticle = bookmark.kind === 30023
   const isWebBookmark = bookmark.kind === 39701
-  const isClickable = hasUrls || isArticle || isWebBookmark
+  const isNote = bookmark.kind === 1
+  const isClickable = hasUrls || isArticle || isWebBookmark || isNote
   
-  // Calculate progress color (matching BlogPostCard logic)
+  const displayText = isArticle && articleSummary ? articleSummary : bookmark.content
+
+  // Calculate progress color
   let progressColor = '#6366f1' // Default blue (reading)
   if (readingProgress && readingProgress >= 0.95) {
     progressColor = '#10b981' // Green (completed)
@@ -39,20 +44,15 @@ export const CompactView: React.FC<CompactViewProps> = ({
   }
 
   const handleCompactClick = () => {
-    if (!onSelectUrl) return
-    
     if (isArticle) {
-      onSelectUrl('', { id: bookmark.id, kind: bookmark.kind, tags: bookmark.tags, pubkey: bookmark.pubkey })
+      onSelectUrl?.('', { id: bookmark.id, kind: bookmark.kind, tags: bookmark.tags, pubkey: bookmark.pubkey })
     } else if (hasUrls) {
-      onSelectUrl(extractedUrls[0])
+      onSelectUrl?.(extractedUrls[0])
+    } else if (isNote) {
+      navigate(`/e/${bookmark.id}`)
     }
   }
 
-  // For articles, prefer summary; for others, use content
-  const displayText = isArticle && articleSummary 
-    ? articleSummary 
-    : bookmark.content
-
   return (
     <div key={`${bookmark.id}-${index}`} className={`individual-bookmark compact ${bookmark.isPrivate ? 'private-bookmark' : ''}`}>
       <div 
@@ -64,9 +64,13 @@ export const CompactView: React.FC<CompactViewProps> = ({
         <span className="bookmark-type-compact">
           <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
         </span>
-        {displayText && (
+        {displayText ? (
           <div className="compact-text">
-            <ContentWithResolvedProfiles content={displayText.slice(0, 60) + (displayText.length > 60 ? '…' : '')} />
+            <RichContent content={displayText.slice(0, 60) + (displayText.length > 60 ? '…' : '')} className="" />
+          </div>
+        ) : (
+          <div className="compact-text" style={{ opacity: 0.5, fontSize: '0.85em' }}>
+            <code>{bookmark.id.slice(0, 12)}...</code>
           </div>
         )}
         <span className="bookmark-date-compact">{formatDateCompact(bookmark.created_at)}</span>

src/components/BookmarkViews/LargeView.tsx

@@ -4,7 +4,7 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDate } from '../../utils/bookmarkUtils'
-import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
+import RichContent from '../RichContent'
 import { IconGetter } from './shared'
 import { useImageCache } from '../../hooks/useImageCache'
 import { getEventUrl } from '../../config/nostrGateways'
@@ -95,13 +95,9 @@ export const LargeView: React.FC<LargeViewProps> = ({
       
       <div className="large-content">
         {isArticle && articleSummary ? (
-          <div className="large-text article-summary">
-            <ContentWithResolvedProfiles content={articleSummary} />
-          </div>
+          <RichContent content={articleSummary} className="large-text article-summary" />
         ) : bookmark.content && (
-          <div className="large-text">
-            <ContentWithResolvedProfiles content={bookmark.content} />
-          </div>
+          <RichContent content={bookmark.content} className="large-text" />
         )}
         
         {/* Reading progress indicator for articles - shown only if there's progress */}

src/components/Bookmarks.tsx

@@ -13,6 +13,7 @@ import { useHighlightCreation } from '../hooks/useHighlightCreation'
 import { useBookmarksUI } from '../hooks/useBookmarksUI'
 import { useRelayStatus } from '../hooks/useRelayStatus'
 import { useOfflineSync } from '../hooks/useOfflineSync'
+import { useEventLoader } from '../hooks/useEventLoader'
 import { Bookmark } from '../types/bookmarks'
 import ThreePaneLayout from './ThreePaneLayout'
 import Explore from './Explore'
@@ -38,7 +39,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
   bookmarksLoading, 
   onRefreshBookmarks
 }) => {
-  const { naddr, npub } = useParams<{ naddr?: string; npub?: string }>()
+  const { naddr, npub, eventId: eventIdParam } = useParams<{ naddr?: string; npub?: string; eventId?: string }>()
   const location = useLocation()
   const navigate = useNavigate()
   const previousLocationRef = useRef<string>()
@@ -55,6 +56,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
   const showMe = location.pathname.startsWith('/me')
   const showProfile = location.pathname.startsWith('/p/')
   const showSupport = location.pathname === '/support'
+  const eventId = eventIdParam
   
   // Extract tab from explore routes
   const exploreTab = location.pathname === '/explore/writings' ? 'writings' : 'highlights'
@@ -255,6 +257,17 @@ const Bookmarks: React.FC<BookmarksProps> = ({
     setCurrentArticleEventId
   })
 
+  // Load event if /e/:eventId route is used
+  useEventLoader({
+    eventId,
+    relayPool,
+    eventStore,
+    setSelectedUrl,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed
+  })
+
   // Classify highlights with levels based on user context
   const classifiedHighlights = useMemo(() => {
     return classifyHighlights(highlights, activeAccount?.pubkey, followedPubkeys)
@@ -328,7 +341,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({
         relayPool ? <Explore relayPool={relayPool} eventStore={eventStore} settings={settings} activeTab={exploreTab} /> : null
       ) : undefined}
       me={showMe ? (
-        relayPool ? <Me relayPool={relayPool} eventStore={eventStore} activeTab={meTab} bookmarks={bookmarks} bookmarksLoading={bookmarksLoading} /> : null
+        relayPool ? <Me relayPool={relayPool} eventStore={eventStore} activeTab={meTab} bookmarks={bookmarks} bookmarksLoading={bookmarksLoading} settings={settings} /> : null
       ) : undefined}
       profile={showProfile && profilePubkey ? (
         relayPool ? <Profile relayPool={relayPool} eventStore={eventStore} pubkey={profilePubkey} activeTab={profileTab} /> : null

src/components/ContentPanel.tsx

@@ -4,14 +4,15 @@ import ReactMarkdown from 'react-markdown'
 import remarkGfm from 'remark-gfm'
 import rehypeRaw from 'rehype-raw'
 import rehypePrism from 'rehype-prism-plus'
+import VideoEmbedProcessor from './VideoEmbedProcessor'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import 'prismjs/themes/prism-tomorrow.css'
 import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare, faSearch } from '@fortawesome/free-solid-svg-icons'
 import { ContentSkeleton } from './Skeletons'
 import { nip19 } from 'nostr-tools'
 import { getNostrUrl, getSearchUrl } from '../config/nostrGateways'
-import { RELAYS } from '../config/relays'
 import { RelayPool } from 'applesauce-relay'
+import { getActiveRelayUrls } from '../services/relayManager'
 import { IAccount } from 'applesauce-accounts'
 import { NostrEvent } from 'nostr-tools'
 import { Highlight } from '../types/highlights'
@@ -45,6 +46,7 @@ import {
   loadReadingPosition, 
   saveReadingPosition 
 } from '../services/readingPositionService'
+import TTSControls from './TTSControls'
 
 interface ContentPanelProps {
   loading: boolean
@@ -320,6 +322,25 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
 
   const hasHighlights = relevantHighlights.length > 0
 
+  // Extract plain text for TTS
+  const baseHtml = useMemo(() => {
+    if (markdown) return renderedMarkdownHtml && finalHtml ? finalHtml : ''
+    return finalHtml || html || ''
+  }, [markdown, renderedMarkdownHtml, finalHtml, html])
+
+  const articleText = useMemo(() => {
+    const parts: string[] = []
+    if (title) parts.push(title)
+    if (summary) parts.push(summary)
+    if (baseHtml) {
+      const div = document.createElement('div')
+      div.innerHTML = baseHtml
+      const txt = (div.textContent || '').replace(/\s+/g, ' ').trim()
+      if (txt) parts.push(txt)
+    }
+    return parts.join('. ')
+  }, [title, summary, baseHtml])
+
   // Determine if we're on a nostr-native article (/a/) or external URL (/r/)
   const isNostrArticle = selectedUrl && selectedUrl.startsWith('nostr:')
   const isExternalVideo = !isNostrArticle && !!selectedUrl && ['youtube', 'video'].includes(classifyUrl(selectedUrl).type)
@@ -357,7 +378,8 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     if (!currentArticle) return null
 
     const dTag = currentArticle.tags.find(t => t[0] === 'd')?.[1] || ''
-    const relayHints = RELAYS.filter(r => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayHints = activeRelays.filter(r => 
       !r.includes('localhost') && !r.includes('127.0.0.1')
     ).slice(0, 3)
 
@@ -463,7 +485,12 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   }
 
   const handleOpenSearch = () => {
-    if (articleLinks) {
+    // For regular notes (kind:1), open via /e/ path
+    if (currentArticle?.kind === 1) {
+      const borisUrl = `${window.location.origin}/e/${currentArticle.id}`
+      window.open(borisUrl, '_blank', 'noopener,noreferrer')
+    } else if (articleLinks) {
+      // For articles, use search portal
       window.open(getSearchUrl(articleLinks.naddr), '_blank', 'noopener,noreferrer')
     }
     setShowArticleMenu(false)
@@ -579,9 +606,8 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             try {
               const naddr = nip19.naddrEncode({ kind: 30023, pubkey: currentArticle.pubkey, identifier: dTag })
               hasRead = hasRead || archiveController.isMarked(naddr)
-              console.log('[archive][content] check article', { naddr: naddr.slice(0, 24) + '...', hasRead })
             } catch (e) {
-              console.warn('[archive][content] encode naddr failed', e)
+              // Silently ignore encoding errors
             }
           }
         } else {
@@ -593,7 +619,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
           // Also check archiveController
           const ctrl = archiveController.isMarked(selectedUrl)
           hasRead = hasRead || ctrl
-          console.log('[archive][content] check url', { url: selectedUrl, hasRead, ctrl })
         }
         setIsMarkedAsRead(hasRead)
       } catch (error) {
@@ -674,7 +699,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             if (dTag) {
               const naddr = nip19.naddrEncode({ kind: 30023, pubkey: currentArticle.pubkey, identifier: dTag })
               archiveController.mark(naddr)
-              console.log('[archive][content] optimistic mark article', naddr.slice(0, 24) + '...')
             }
           } catch (err) {
             console.warn('[archive][content] optimistic article mark failed', err)
@@ -686,7 +710,6 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             relayPool
           )
           archiveController.mark(selectedUrl)
-          console.log('[archive][content] optimistic mark url', selectedUrl)
         }
       } catch (error) {
         console.error('Failed to mark as read:', error)
@@ -736,11 +759,10 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
             remarkPlugins={[remarkGfm]}
             rehypePlugins={[rehypeRaw, rehypePrism]}
             components={{
-              img: ({ src, alt, ...props }) => (
+              img: ({ src, alt }) => (
                 <img 
                   src={src} 
                   alt={alt} 
-                  {...props}
                 />
               )
             }}
@@ -762,6 +784,11 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
         highlights={relevantHighlights}
         highlightVisibility={highlightVisibility}
       />
+      {isTextContent && articleText && (
+        <div style={{ padding: '0 0.75rem 0.5rem 0.75rem' }}>
+          <TTSControls text={articleText} defaultLang={navigator?.language} settings={settings} />
+        </div>
+      )}
       {isExternalVideo ? (
         <>
           <div className="reader-video">
@@ -846,10 +873,11 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
         <>
           {markdown ? (
             renderedMarkdownHtml && finalHtml ? (
-              <div 
-                ref={contentRef} 
-                className="reader-markdown" 
-                dangerouslySetInnerHTML={{ __html: finalHtml }}
+              <VideoEmbedProcessor
+                ref={contentRef}
+                html={finalHtml}
+                renderVideoLinksAsEmbeds={settings?.renderVideoLinksAsEmbeds === true && !isExternalVideo}
+                className="reader-markdown"
                 onMouseUp={handleSelectionEnd}
                 onTouchEnd={handleSelectionEnd}
               />
@@ -861,10 +889,11 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
               </div>
             )
           ) : (
-            <div 
-              ref={contentRef} 
-              className="reader-html" 
-              dangerouslySetInnerHTML={{ __html: finalHtml || html || '' }}
+            <VideoEmbedProcessor
+              ref={contentRef}
+              html={finalHtml || html || ''}
+              renderVideoLinksAsEmbeds={settings?.renderVideoLinksAsEmbeds === true && !isExternalVideo}
+              className="reader-html"
               onMouseUp={handleSelectionEnd}
               onTouchEnd={handleSelectionEnd}
             />

src/components/Debug.tsx

@@ -114,6 +114,12 @@ const Debug: React.FC<DebugProps> = ({
   const [markAsReadReactions, setMarkAsReadReactions] = useState<NostrEvent[]>([])
   const [tLoadMarkAsRead, setTLoadMarkAsRead] = useState<number | null>(null)
   const [tFirstMarkAsRead, setTFirstMarkAsRead] = useState<number | null>(null)
+
+  // Relay list loading state
+  const [isLoadingRelayList, setIsLoadingRelayList] = useState(false)
+  const [relayListEvents, setRelayListEvents] = useState<NostrEvent[]>([])
+  const [tLoadRelayList, setTLoadRelayList] = useState<number | null>(null)
+  const [tFirstRelayList, setTFirstRelayList] = useState<number | null>(null)
   
   // Deduplicated reading progress from controller
   const [deduplicatedProgressMap, setDeduplicatedProgressMap] = useState<Map<string, number>>(new Map())
@@ -127,6 +133,7 @@ const Debug: React.FC<DebugProps> = ({
     loadHighlights?: { startTime: number }
     loadReadingProgress?: { startTime: number }
     loadMarkAsRead?: { startTime: number }
+    loadRelayList?: { startTime: number }
   }>({})
   
   // Web of Trust state
@@ -427,11 +434,7 @@ const Debug: React.FC<DebugProps> = ({
 
       const elapsed = Math.round(performance.now() - start)
       setTLoadHighlights(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadHighlights, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadHighlights: undefined }))
 
       DebugBus.info('debug', `Loaded ${events.length} highlight events in ${elapsed}ms`)
     } catch (err) {
@@ -648,7 +651,9 @@ const Debug: React.FC<DebugProps> = ({
               return timeB - timeA
             })
           })
-        }
+        },
+        100,
+        eventStore || undefined
       )
       
       setWritingPosts(posts)
@@ -791,11 +796,7 @@ const Debug: React.FC<DebugProps> = ({
 
       const elapsed = Math.round(performance.now() - start)
       setTLoadReadingProgress(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadReadingProgress, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadReadingProgress: undefined }))
 
       const finalMap = readingProgressController.getProgressMap()
       DebugBus.info('debug', `Loaded ${rawEvents.length} raw events, deduplicated to ${finalMap.size} articles in ${elapsed}ms`)
@@ -864,11 +865,7 @@ const Debug: React.FC<DebugProps> = ({
       const totalEvents = kind7Events.length + kind17Events.length
       const elapsed = Math.round(performance.now() - start)
       setTLoadMarkAsRead(elapsed)
-      setLiveTiming(prev => {
-        // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
-        const { loadMarkAsRead, ...rest } = prev
-        return rest
-      })
+      setLiveTiming(prev => ({ ...prev, loadMarkAsRead: undefined }))
 
       DebugBus.info('debug', `Loaded ${totalEvents} mark-as-read reactions in ${elapsed}ms`)
     } catch (err) {
@@ -886,6 +883,66 @@ const Debug: React.FC<DebugProps> = ({
     DebugBus.info('debug', 'Cleared mark-as-read reactions data')
   }
 
+  const handleLoadRelayList = async () => {
+    if (!relayPool || !activeAccount?.pubkey) {
+      DebugBus.warn('debug', 'Please log in to load relay list')
+      return
+    }
+
+    try {
+      setIsLoadingRelayList(true)
+      setRelayListEvents([])
+      setTLoadRelayList(null)
+      setTFirstRelayList(null)
+      DebugBus.info('debug', 'Loading relay list (kind 10002)...')
+
+      const start = performance.now()
+      let firstEventTime: number | null = null
+      setLiveTiming(prev => ({ ...prev, loadRelayList: { startTime: start } }))
+
+      const { queryEvents } = await import('../services/dataFetch')
+
+      // Query for kind:10002 (relay list)
+      const events = await queryEvents(relayPool, { 
+        kinds: [10002], 
+        authors: [activeAccount.pubkey],
+        limit: 10
+      }, {
+        onEvent: (evt) => {
+          if (firstEventTime === null) {
+            firstEventTime = performance.now() - start
+            setTFirstRelayList(Math.round(firstEventTime))
+          }
+          setRelayListEvents(prev => [...prev, evt])
+        }
+      })
+      
+      const elapsed = Math.round(performance.now() - start)
+      setTLoadRelayList(elapsed)
+      setLiveTiming(prev => ({ ...prev, loadRelayList: undefined }))
+
+      DebugBus.info('debug', `Loaded ${events.length} relay list events in ${elapsed}ms`)
+      
+      // Log details about the events
+      events.forEach((event, index) => {
+        const relayCount = event.tags.filter(tag => tag[0] === 'r').length
+        DebugBus.info('debug', `Event ${index + 1}: ${relayCount} relays, created ${new Date(event.created_at * 1000).toISOString()}`)
+      })
+    } catch (err) {
+      console.error('Failed to load relay list:', err)
+      DebugBus.error('debug', `Failed to load relay list: ${err instanceof Error ? err.message : String(err)}`)
+    } finally {
+      setIsLoadingRelayList(false)
+    }
+  }
+
+  const handleClearRelayList = () => {
+    setRelayListEvents([])
+    setTLoadRelayList(null)
+    setTFirstRelayList(null)
+    DebugBus.info('debug', 'Cleared relay list data')
+  }
+
   const handleLoadFriendsList = async () => {
     if (!relayPool || !activeAccount?.pubkey) {
       DebugBus.warn('debug', 'Please log in to load friends list')
@@ -1698,6 +1755,72 @@ const Debug: React.FC<DebugProps> = ({
           )}
         </div>
 
+        {/* Relay List Loading Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Relay List Loading (kind 10002)</h3>
+          <div className="text-sm opacity-70 mb-3">Load your relay list to debug dynamic relay integration:</div>
+          
+          <div className="flex gap-2 mb-3 items-center">
+            <button 
+              className="btn btn-primary" 
+              onClick={handleLoadRelayList}
+              disabled={isLoadingRelayList || !relayPool || !activeAccount}
+            >
+              {isLoadingRelayList ? (
+                <>
+                  <FontAwesomeIcon icon={faSpinner} className="animate-spin mr-2" />
+                  Loading...
+                </>
+              ) : (
+                'Load Relay List'
+              )}
+            </button>
+            <button 
+              className="btn btn-secondary ml-auto" 
+              onClick={handleClearRelayList}
+              disabled={relayListEvents.length === 0}
+            >
+              Clear
+            </button>
+          </div>
+          
+          <div className="flex gap-4 mb-3 text-sm">
+            <Stat label="total" value={tLoadRelayList} />
+            <Stat label="first event" value={tFirstRelayList} />
+          </div>
+          {relayListEvents.length > 0 && (
+            <div className="mb-3">
+              <div className="text-sm opacity-70 mb-2">Loaded Relay List Events ({relayListEvents.length}):</div>
+              <div className="space-y-2 max-h-96 overflow-y-auto">
+                {relayListEvents.map((evt, idx) => {
+                  const relayTags = evt.tags?.filter((t: string[]) => t[0] === 'r') || []
+                  
+                  return (
+                    <div key={idx} className="font-mono text-xs p-2 bg-gray-100 dark:bg-gray-800 rounded">
+                      <div className="font-semibold mb-1">Relay List Event #{idx + 1}</div>
+                      <div className="opacity-70 mb-1">
+                        <div>Kind: {evt.kind}</div>
+                        <div>Author: {evt.pubkey.slice(0, 16)}...</div>
+                        <div>Created: {new Date(evt.created_at * 1000).toLocaleString()}</div>
+                        <div>Relays: {relayTags.length}</div>
+                      </div>
+                      <div className="mt-1">
+                        <div className="text-[11px] opacity-70 mb-1">Relay URLs:</div>
+                        {relayTags.map((tag, tagIdx) => (
+                          <div key={tagIdx} className="text-[10px] opacity-60 break-all">
+                            {tag[1]} {tag[2] ? `(${tag[2]})` : ''}
+                          </div>
+                        ))}
+                      </div>
+                      <div className="opacity-50 mt-1 text-[10px] break-all">ID: {evt.id}</div>
+                    </div>
+                  )
+                })}
+              </div>
+            </div>
+          )}
+        </div>
+
         {/* Web of Trust Section */}
         <div className="settings-section">
           <h3 className="section-title">Web of Trust</h3>

src/components/EventViewer.tsx

@@ -0,0 +1 @@
+

src/components/Explore.tsx

@@ -1,14 +1,14 @@
-import React, { useState, useEffect, useMemo, useCallback } from 'react'
+import React, { useState, useEffect, useMemo, useCallback, useRef } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate, faSpinner } from '@fortawesome/free-solid-svg-icons'
 import IconButton from './IconButton'
 import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
 import { Hooks } from 'applesauce-react'
 import { RelayPool } from 'applesauce-relay'
-import { IEventStore, Helpers } from 'applesauce-core'
-import { nip19, NostrEvent } from 'nostr-tools'
+import { IEventStore } from 'applesauce-core'
+import { nip19 } from 'nostr-tools'
 import { useNavigate } from 'react-router-dom'
-import { fetchContacts } from '../services/contactService'
+// Contacts are managed via controller subscription
 import { fetchBlogPostsFromAuthors, BlogPostPreview } from '../services/exploreService'
 import { fetchHighlightsFromAuthors } from '../services/highlightService'
 import { fetchProfiles } from '../services/profileService'
@@ -19,20 +19,22 @@ import { Highlight } from '../types/highlights'
 import { UserSettings } from '../services/settingsService'
 import BlogPostCard from './BlogPostCard'
 import { HighlightItem } from './HighlightItem'
-import { getCachedPosts, upsertCachedPost, setCachedPosts, getCachedHighlights, upsertCachedHighlight, setCachedHighlights } from '../services/exploreCache'
+import { getCachedPosts, setCachedPosts, getCachedHighlights, setCachedHighlights } from '../services/exploreCache'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
 import { classifyHighlights } from '../utils/highlightClassification'
 import { HighlightVisibility } from './HighlightsPanel'
-import { KINDS } from '../config/kinds'
-import { eventToHighlight } from '../services/highlightEventProcessor'
-import { useStoreTimeline } from '../hooks/useStoreTimeline'
+// import { KINDS } from '../config/kinds'
+// import { eventToHighlight } from '../services/highlightEventProcessor'
+// import { useStoreTimeline } from '../hooks/useStoreTimeline'
 import { dedupeHighlightsById, dedupeWritingsByReplaceable } from '../utils/dedupe'
 import { writingsController } from '../services/writingsController'
 import { nostrverseWritingsController } from '../services/nostrverseWritingsController'
 import { readingProgressController } from '../services/readingProgressController'
+import { contactsController } from '../services/contactsController'
 
-const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
+// Accessors from Helpers (currently unused here)
+// const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
 
 interface ExploreProps {
   relayPool: RelayPool
@@ -55,27 +57,28 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
   const [hasLoadedNostrverse, setHasLoadedNostrverse] = useState(false)
   const [hasLoadedMine, setHasLoadedMine] = useState(false)
   const [hasLoadedNostrverseHighlights, setHasLoadedNostrverseHighlights] = useState(false)
+  const hasHydratedRef = useRef(false)
   
   // Get myHighlights directly from controller
-  const [myHighlights, setMyHighlights] = useState<Highlight[]>([])
+  const [/* myHighlights */, setMyHighlights] = useState<Highlight[]>([])
   // Remove unused loading state to avoid warnings
   
   // Reading progress state (naddr -> progress 0-1)
   const [readingProgressMap, setReadingProgressMap] = useState<Map<string, number>>(new Map())
   
   // Load cached content from event store (instant display)
-  const cachedHighlights = useStoreTimeline(eventStore, { kinds: [KINDS.Highlights] }, eventToHighlight, [])
+  // const cachedHighlights = useStoreTimeline(eventStore, { kinds: [KINDS.Highlights] }, eventToHighlight, [])
   
-  const toBlogPostPreview = useCallback((event: NostrEvent): BlogPostPreview => ({
-    event,
-    title: getArticleTitle(event) || 'Untitled',
-    summary: getArticleSummary(event),
-    image: getArticleImage(event),
-    published: getArticlePublished(event),
-    author: event.pubkey
-  }), [])
+  // const toBlogPostPreview = useCallback((event: NostrEvent): BlogPostPreview => ({
+  //   event,
+  //   title: getArticleTitle(event) || 'Untitled',
+  //   summary: getArticleSummary(event),
+  //   image: getArticleImage(event),
+  //   published: getArticlePublished(event),
+  //   author: event.pubkey
+  // }), [])
   
-  const cachedWritings = useStoreTimeline(eventStore, { kinds: [30023] }, toBlogPostPreview, [])
+  // const cachedWritings = useStoreTimeline(eventStore, { kinds: [30023] }, toBlogPostPreview, [])
 
   
   
@@ -105,6 +108,21 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
     }
   }, [])
 
+  // Subscribe to contacts stream and mirror into local state
+  useEffect(() => {
+    const unsubscribe = contactsController.onContacts((contacts) => {
+      setFollowedPubkeys(new Set(contacts))
+    })
+    return () => unsubscribe()
+  }, [])
+
+  // Ensure contacts controller is started for the active account (non-blocking)
+  useEffect(() => {
+    if (relayPool && activeAccount?.pubkey) {
+      contactsController.start({ relayPool, pubkey: activeAccount.pubkey }).catch(() => {})
+    }
+  }, [relayPool, activeAccount?.pubkey])
+
   // Subscribe to nostrverse highlights controller for global stream
   useEffect(() => {
     const apply = (incoming: Highlight[]) => {
@@ -230,242 +248,95 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
     }
   }, [propActiveTab])
 
-  useEffect(() => {
-    const loadData = async () => {
-      try {
-        // begin load, but do not block rendering
-        setLoading(true)
+  // Load initial data and refresh on triggers
+  const loadData = useCallback(() => {
+    if (!relayPool) return
 
-        // If not logged in, only fetch nostrverse content with streaming posts
-        if (!activeAccount) {
-          // Logged out: rely entirely on centralized controllers; do not fetch here
-          setLoading(false)
-        }
+    // Seed from cache for instant UI
+    if (activeAccount) {
+      const cachedPosts = getCachedPosts(activeAccount.pubkey)
+      if (cachedPosts && cachedPosts.length > 0) setBlogPosts(cachedPosts)
+      const cached = getCachedHighlights(activeAccount.pubkey)
+      if (cached && cached.length > 0) setHighlights(cached)
+    }
 
-        // Seed from in-memory cache if available to avoid empty flash
-        const memoryCachedPosts = activeAccount ? getCachedPosts(activeAccount.pubkey) : []
-        if (memoryCachedPosts && memoryCachedPosts.length > 0) {
-          setBlogPosts(prev => prev.length === 0 ? memoryCachedPosts : prev)
-        }
-        const memoryCachedHighlights = activeAccount ? getCachedHighlights(activeAccount.pubkey) : []
-        if (memoryCachedHighlights && memoryCachedHighlights.length > 0) {
-          setHighlights(prev => prev.length === 0 ? memoryCachedHighlights : prev)
-        }
-        
-        // Seed with cached content from event store (instant display)
-        if (cachedHighlights.length > 0 || myHighlights.length > 0) {
-          const merged = dedupeHighlightsById([...cachedHighlights, ...myHighlights])
-          setHighlights(prev => {
-            const all = dedupeHighlightsById([...prev, ...merged])
-            return all.sort((a, b) => b.created_at - a.created_at)
-          })
-        }
-        
-        // Seed with cached writings from event store
-        if (cachedWritings.length > 0) {
-          setBlogPosts(prev => {
-            const all = dedupeWritingsByReplaceable([...prev, ...cachedWritings])
-            return all.sort((a, b) => {
-              const timeA = a.published || a.event.created_at
-              const timeB = b.published || b.event.created_at
-              return timeB - timeA
-            })
-          })
-        }
+    setLoading(true)
 
-        // At this point, we have seeded any available data; lift the loading state
-        setLoading(false)
+    try {
+      // Prepare parallel fetches
+      const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
 
-        // Fetch the user's contacts (friends)
-        const contacts = await fetchContacts(
+      // Nostrverse writings: subscribe-style via onPost; hydrate on first post
+      if (!activeAccount || (activeAccount && visibility.nostrverse)) {
+        fetchNostrverseBlogPosts(
           relayPool,
-          activeAccount?.pubkey || '',
-          (partial) => {
-            // Store followed pubkeys for highlight classification
-            setFollowedPubkeys(partial)
-            // When local contacts are available, kick off early fetch
-            if (partial.size > 0) {
-              const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
-              const partialArray = Array.from(partial)
-              
-              // Fetch blog posts
-              fetchBlogPostsFromAuthors(
-                relayPool,
-                partialArray,
-                relayUrls,
-                (post) => {
-                  setBlogPosts((prev) => {
-                    // Deduplicate by author:d-tag (replaceable event key)
-                    const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${post.author}:${dTag}`
-                    const existingIndex = prev.findIndex(p => {
-                      const pDTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                      return `${p.author}:${pDTag}` === key
-                    })
-                    
-                    // If exists, only replace if this one is newer
-                    if (existingIndex >= 0) {
-                      const existing = prev[existingIndex]
-                      if (post.event.created_at <= existing.event.created_at) {
-                        return prev // Keep existing (newer or same)
-                      }
-                      // Replace with newer version
-                      const next = [...prev]
-                      next[existingIndex] = post
-                      return next.sort((a, b) => {
-                        const timeA = a.published || a.event.created_at
-                        const timeB = b.published || b.event.created_at
-                        return timeB - timeA
-                      })
-                    }
-                    
-                    // New post, add it
-                    const next = [...prev, post]
-                    return next.sort((a, b) => {
-                      const timeA = a.published || a.event.created_at
-                      const timeB = b.published || b.event.created_at
-                      return timeB - timeA
-                    })
-                  })
-                  if (activeAccount) setCachedPosts(activeAccount.pubkey, upsertCachedPost(activeAccount.pubkey, post))
-                }
-              ).then((all) => {
-                setBlogPosts((prev) => {
-                  // Deduplicate by author:d-tag (replaceable event key)
-                  const byKey = new Map<string, BlogPostPreview>()
-                  
-                  // Add existing posts
-                  for (const p of prev) {
-                    const dTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${p.author}:${dTag}`
-                    byKey.set(key, p)
-                  }
-                  
-                  // Merge in new posts (keeping newer versions)
-                  for (const post of all) {
-                    const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                    const key = `${post.author}:${dTag}`
-                    const existing = byKey.get(key)
-                    if (!existing || post.event.created_at > existing.event.created_at) {
-                      byKey.set(key, post)
-                    }
-                  }
-                  
-                  const merged = Array.from(byKey.values()).sort((a, b) => {
-                    const timeA = a.published || a.event.created_at
-                    const timeB = b.published || b.event.created_at
-                    return timeB - timeA
-                  })
-                  if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
-                  return merged
-                })
-              })
-              
-              // Fetch highlights
-              fetchHighlightsFromAuthors(
-                relayPool,
-                partialArray,
-                (highlight) => {
-                  setHighlights((prev) => {
-                    const exists = prev.some(h => h.id === highlight.id)
-                    if (exists) return prev
-                    const next = [...prev, highlight]
-                    return next.sort((a, b) => b.created_at - a.created_at)
-                  })
-                  if (activeAccount) setCachedHighlights(activeAccount.pubkey, upsertCachedHighlight(activeAccount.pubkey, highlight))
-                }
-              ).then((all) => {
-                setHighlights((prev) => {
-                  const byId = new Map(prev.map(h => [h.id, h]))
-                  for (const highlight of all) byId.set(highlight.id, highlight)
-                  const merged = Array.from(byId.values()).sort((a, b) => b.created_at - a.created_at)
-                  if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
-                  return merged
-                })
-              })
-            }
-          }
-        )
-        
-        // Always proceed to load nostrverse content even if no contacts
-        // (removed blocking error for empty contacts)
-
-        // Store final followed pubkeys
-        setFollowedPubkeys(contacts)
-
-        // Fetch friends content and (optionally) nostrverse + mine content in parallel
-        const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
-        const contactsArray = Array.from(contacts)
-        // Use centralized writingsController for my posts (non-blocking)
-        // pull from writingsController; no need to store promise
-        setBlogPosts(prev => dedupeWritingsByReplaceable([...prev, ...writingsController.getWritings()]).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at)))
-        setHasLoadedMine(true)
-        const nostrversePostsPromise = visibility.nostrverse
-          ? fetchNostrverseBlogPosts(relayPool, relayUrls, 50, eventStore || undefined, (post) => {
-              // Stream nostrverse posts too when logged in
-              setBlogPosts(prev => {
-                const dTag = post.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                const key = `${post.author}:${dTag}`
-                const existingIndex = prev.findIndex(p => {
-                  const pDTag = p.event.tags.find(t => t[0] === 'd')?.[1] || ''
-                  return `${p.author}:${pDTag}` === key
-                })
-                if (existingIndex >= 0) {
-                  const existing = prev[existingIndex]
-                  if (post.event.created_at <= existing.event.created_at) return prev
-                  const next = [...prev]
-                  next[existingIndex] = post
-                  return next.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-                }
-                const next = [...prev, post]
-                return next.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-              })
-            })
-          : Promise.resolve([] as BlogPostPreview[])
-
-        // Fire non-blocking fetches and merge as they resolve
-        fetchBlogPostsFromAuthors(relayPool, contactsArray, relayUrls)
-          .then((friendsPosts) => {
+          relayUrls,
+          50,
+          eventStore || undefined,
+          (post) => {
             setBlogPosts(prev => {
-              const merged = dedupeWritingsByReplaceable([...prev, ...friendsPosts])
-              const sorted = merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
-              if (activeAccount) setCachedPosts(activeAccount.pubkey, sorted)
-              // Pre-cache profiles in background
-              const authorPubkeys = Array.from(new Set(sorted.map(p => p.author)))
-              fetchProfiles(relayPool, eventStore, authorPubkeys, settings).catch(() => {})
-              return sorted
+              const merged = dedupeWritingsByReplaceable([...prev, post])
+              if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+              return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
             })
-          }).catch(() => {})
-
-        fetchHighlightsFromAuthors(relayPool, contactsArray)
-          .then((friendsHighlights) => {
-            setHighlights(prev => {
-              const merged = dedupeHighlightsById([...prev, ...friendsHighlights])
-              const sorted = merged.sort((a, b) => b.created_at - a.created_at)
-              if (activeAccount) setCachedHighlights(activeAccount.pubkey, sorted)
-              return sorted
-            })
-          }).catch(() => {})
-
-        nostrversePostsPromise.then((nostrversePosts) => {
+            if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+          }
+        ).then((nostrversePosts) => {
           setBlogPosts(prev => dedupeWritingsByReplaceable([...prev, ...nostrversePosts]).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at)))
         }).catch(() => {})
-
-        fetchNostrverseHighlights(relayPool, 100, eventStore || undefined)
-          .then((nostriverseHighlights) => {
-            setHighlights(prev => dedupeHighlightsById([...prev, ...nostriverseHighlights]).sort((a, b) => b.created_at - a.created_at))
-          }).catch(() => {})
+      }
       } catch (err) {
         console.error('Failed to load data:', err)
         // No blocking error - user can pull-to-refresh
       } finally {
         // loading is already turned off after seeding
       }
-    }
+  }, [relayPool, activeAccount, eventStore, visibility.nostrverse])
 
+  useEffect(() => {
     loadData()
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [relayPool, activeAccount, refreshTrigger, eventStore, settings])
+  }, [loadData, refreshTrigger])
+
+  // Kick off friends fetches reactively when contacts arrive
+  useEffect(() => {
+    if (!relayPool) return
+    if (followedPubkeys.size === 0) return
+    const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
+    const contactsArray = Array.from(followedPubkeys)
+
+    fetchBlogPostsFromAuthors(relayPool, contactsArray, relayUrls, (post) => {
+      setBlogPosts(prev => {
+        const merged = dedupeWritingsByReplaceable([...prev, post])
+        if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+        // Pre-cache profiles in background
+        const authorPubkeys = Array.from(new Set(merged.map(p => p.author)))
+        fetchProfiles(relayPool, eventStore, authorPubkeys, settings).catch(() => {})
+        return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
+      })
+      if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+    }, 100, eventStore).then((friendsPosts) => {
+      setBlogPosts(prev => {
+        const merged = dedupeWritingsByReplaceable([...prev, ...friendsPosts])
+        if (activeAccount) setCachedPosts(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
+      })
+    }).catch(() => {})
+
+    fetchHighlightsFromAuthors(relayPool, contactsArray, (highlight) => {
+      setHighlights(prev => {
+        const merged = dedupeHighlightsById([...prev, highlight])
+        if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => b.created_at - a.created_at)
+      })
+      if (!hasHydratedRef.current) { hasHydratedRef.current = true; setLoading(false) }
+    }, eventStore || undefined).then((friendsHighlights) => {
+      setHighlights(prev => {
+        const merged = dedupeHighlightsById([...prev, ...friendsHighlights])
+        if (activeAccount) setCachedHighlights(activeAccount.pubkey, merged)
+        return merged.sort((a, b) => b.created_at - a.created_at)
+      })
+    }).catch(() => {})
+  }, [relayPool, followedPubkeys, eventStore, settings, activeAccount])
 
   // Lazy-load nostrverse writings when user toggles it on (logged in)
   useEffect(() => {
@@ -509,7 +380,12 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         return Array.from(byKey.values()).sort((a, b) => (b.published || b.event.created_at) - (a.published || a.event.created_at))
       })
     }).catch(() => {})
-  }, [visibility.nostrverse, activeAccount, relayPool, eventStore, hasLoadedNostrverse])
+
+    fetchNostrverseHighlights(relayPool, 100, eventStore || undefined)
+      .then((nostriverseHighlights) => {
+        setHighlights(prev => dedupeHighlightsById([...prev, ...nostriverseHighlights]).sort((a, b) => b.created_at - a.created_at))
+      }).catch(() => {})
+  }, [activeAccount, relayPool, visibility.nostrverse, hasLoadedNostrverse, eventStore])
 
   // Lazy-load nostrverse highlights when user toggles it on (logged in)
   useEffect(() => {
@@ -586,6 +462,12 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         const publishedTime = post.published || post.event.created_at
         if (publishedTime > maxFutureTime) return false
         
+        // Hide bot authors by profile display name if setting enabled
+        if (settings?.hideBotArticlesByName !== false) {
+          // Profile resolution and filtering is handled in BlogPostCard via ProfileModel
+          // Keep list intact here; individual cards will render null if author is a bot
+        }
+        
         // Apply visibility filters
         const isMine = activeAccount && post.author === activeAccount.pubkey
         const isFriend = followedPubkeys.has(post.author)
@@ -604,7 +486,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
         const level: 'mine' | 'friends' | 'nostrverse' = isMine ? 'mine' : isFriend ? 'friends' : 'nostrverse'
         return { ...post, level }
       })
-  }, [uniqueSortedPosts, activeAccount, followedPubkeys, visibility])
+  }, [uniqueSortedPosts, activeAccount, followedPubkeys, visibility, settings?.hideBotArticlesByName])
   
   // Helper to get reading progress for a post
   const getReadingProgress = useCallback((post: BlogPostPreview): number | undefined => {
@@ -653,6 +535,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
                 href={getPostUrl(post)}
                 level={post.level}
                 readingProgress={getReadingProgress(post)}
+                hideBotByName={settings?.hideBotArticlesByName !== false}
               />
             ))}
           </div>

src/components/HighlightItem.tsx

@@ -8,8 +8,8 @@ import { Models, IEventStore } from 'applesauce-core'
 import { RelayPool } from 'applesauce-relay'
 import { Hooks } from 'applesauce-react'
 import { onSyncStateChange, isEventSyncing } from '../services/offlineSyncService'
-import { RELAYS } from '../config/relays'
 import { areAllRelaysLocal } from '../utils/helpers'
+import { getActiveRelayUrls } from '../services/relayManager'
 import { nip19 } from 'nostr-tools'
 import { formatDateCompact } from '../utils/bookmarkUtils'
 import { createDeletionRequest } from '../services/deletionService'
@@ -17,6 +17,7 @@ import { getNostrUrl } from '../config/nostrGateways'
 import CompactButton from './CompactButton'
 import { HighlightCitation } from './HighlightCitation'
 import { useNavigate } from 'react-router-dom'
+import NostrMentionLink from './NostrMentionLink'
 
 // Helper to detect if a URL is an image
 const isImageUrl = (url: string): boolean => {
@@ -29,99 +30,6 @@ const isImageUrl = (url: string): boolean => {
   }
 }
 
-// Helper to render a nostr identifier
-const renderNostrId = (nostrUri: string, index: number): React.ReactElement => {
-  try {
-    // Remove nostr: prefix
-    const identifier = nostrUri.replace(/^nostr:/, '')
-    const decoded = nip19.decode(identifier)
-    
-    switch (decoded.type) {
-      case 'npub': {
-        const pubkey = decoded.data
-        return (
-          <a
-            key={index}
-            href={`/p/${nip19.npubEncode(pubkey)}`}
-            className="highlight-comment-link"
-            onClick={(e) => e.stopPropagation()}
-          >
-            @{pubkey.slice(0, 8)}...
-          </a>
-        )
-      }
-      case 'nprofile': {
-        const { pubkey } = decoded.data
-        const npub = nip19.npubEncode(pubkey)
-        return (
-          <a
-            key={index}
-            href={`/p/${npub}`}
-            className="highlight-comment-link"
-            onClick={(e) => e.stopPropagation()}
-          >
-            @{pubkey.slice(0, 8)}...
-          </a>
-        )
-      }
-      case 'naddr': {
-        const { kind, pubkey, identifier } = decoded.data
-        // Check if it's a blog post (kind:30023)
-        if (kind === 30023) {
-          const naddr = nip19.naddrEncode({ kind, pubkey, identifier })
-          return (
-            <a
-              key={index}
-              href={`/a/${naddr}`}
-              className="highlight-comment-link"
-              onClick={(e) => e.stopPropagation()}
-            >
-              {identifier || 'Article'}
-            </a>
-          )
-        }
-        // For other kinds, show shortened identifier
-        return (
-          <span key={index} className="highlight-comment-nostr-id">
-            nostr:{identifier.slice(0, 12)}...
-          </span>
-        )
-      }
-      case 'note': {
-        const eventId = decoded.data
-        return (
-          <span key={index} className="highlight-comment-nostr-id">
-            note:{eventId.slice(0, 12)}...
-          </span>
-        )
-      }
-      case 'nevent': {
-        const { id } = decoded.data
-        return (
-          <span key={index} className="highlight-comment-nostr-id">
-            event:{id.slice(0, 12)}...
-          </span>
-        )
-      }
-      default:
-        // Fallback for unrecognized types
-        return (
-          <span key={index} className="highlight-comment-nostr-id">
-            {identifier.slice(0, 20)}...
-          </span>
-        )
-    }
-  } catch (error) {
-    // If decoding fails, show shortened identifier
-    const identifier = nostrUri.replace(/^nostr:/, '')
-    return (
-      <span key={index} className="highlight-comment-nostr-id">
-        {identifier.slice(0, 20)}...
-      </span>
-    )
-  }
-}
-
 // Component to render comment with links, inline images, and nostr identifiers
 const CommentContent: React.FC<{ text: string }> = ({ text }) => {
   // Pattern to match both http(s) URLs and nostr: URIs
@@ -131,9 +39,15 @@ const CommentContent: React.FC<{ text: string }> = ({ text }) => {
   return (
     <>
       {parts.map((part, index) => {
-        // Handle nostr: URIs
+        // Handle nostr: URIs - now with profile resolution
         if (part.startsWith('nostr:')) {
-          return renderNostrId(part, index)
+          return (
+            <NostrMentionLink
+              key={index}
+              nostrUri={part}
+              onClick={(e) => e.stopPropagation()}
+            />
+          )
         }
         
         // Handle http(s) URLs
@@ -236,10 +150,10 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
           setShowOfflineIndicator(false)
           
           // Update the highlight with all relays after successful sync
-          if (onHighlightUpdate && highlight.isLocalOnly) {
+          if (onHighlightUpdate && highlight.isLocalOnly && relayPool) {
             const updatedHighlight = {
               ...highlight,
-              publishedRelays: RELAYS,
+              publishedRelays: getActiveRelayUrls(relayPool),
               isLocalOnly: false,
               isOfflineCreated: false
             }
@@ -250,7 +164,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     })
     
     return unsubscribe
-  }, [highlight, onHighlightUpdate])
+  }, [highlight, onHighlightUpdate, relayPool])
   
   useEffect(() => {
     if (isSelected && itemRef.current) {
@@ -310,7 +224,8 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
   const getHighlightLinks = () => {
     // Encode the highlight event itself (kind 9802) as a nevent
     // Get non-local relays for the hint
-    const relayHints = RELAYS.filter(r => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayHints = activeRelays.filter(r => 
       !r.includes('localhost') && !r.includes('127.0.0.1')
     ).slice(0, 3) // Include up to 3 relay hints
     
@@ -346,7 +261,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
       }
       
       // Publish to all configured relays - let the relay pool handle connection state
-      const targetRelays = RELAYS
+      const targetRelays = getActiveRelayUrls(relayPool)
       
       
       await relayPool.publish(targetRelays, event)
@@ -414,7 +329,8 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     }
     
     // Fallback: show all relays we queried (where this was likely fetched from)
-    const relayNames = RELAYS.map(url => 
+    const activeRelays = relayPool ? getActiveRelayUrls(relayPool) : []
+    const relayNames = activeRelays.map(url => 
       url.replace(/^wss?:\/\//, '').replace(/\/$/, '')
     )
     return {

src/components/LoginOptions.tsx

@@ -124,7 +124,7 @@ const LoginOptions: React.FC = () => {
       <div className="login-content">
         <h2 className="login-title">Hi! I'm Boris.</h2>
         <p className="login-description">
-          Connect your npub to see your bookmarks, explore long-form articles, and create <mark className="login-highlight">your own highlights</mark>.
+          <mark className="login-highlight">Connect your npub</mark> to see your bookmarks, explore long-form articles, and create <mark className="login-highlight">your own highlights.</mark>
         </p>
         
         <div className="login-buttons">

src/components/Me.tsx

@@ -1,4 +1,4 @@
-import React, { useState, useEffect } from 'react'
+import React, { useState, useEffect, useCallback } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faHighlighter, faBookmark, faPenToSquare, faLink, faLayerGroup, faBars } from '@fortawesome/free-solid-svg-icons'
 import { Hooks } from 'applesauce-react'
@@ -23,7 +23,7 @@ import { getCachedMeData, updateCachedHighlights } from '../services/meCache'
 import { faBooks } from '../icons/customIcons'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
-import { groupIndividualBookmarks, hasContent } from '../utils/bookmarkUtils'
+import { groupIndividualBookmarks, hasContent, hasCreationDate } from '../utils/bookmarkUtils'
 import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
 import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
 import ReadingProgressFilters, { ReadingProgressFilterType } from './ReadingProgressFilters'
@@ -31,6 +31,7 @@ import { filterByReadingProgress } from '../utils/readingProgressUtils'
 import { deriveLinksFromBookmarks } from '../utils/linksFromBookmarks'
 import { readingProgressController } from '../services/readingProgressController'
 import { archiveController } from '../services/archiveController'
+import { UserSettings } from '../services/settingsService'
 
 interface MeProps {
   relayPool: RelayPool
@@ -38,6 +39,7 @@ interface MeProps {
   activeTab?: TabType
   bookmarks: Bookmark[] // From centralized App.tsx state
   bookmarksLoading?: boolean // From centralized App.tsx state (reserved for future use)
+  settings: UserSettings
 }
 
 type TabType = 'highlights' | 'reading-list' | 'reads' | 'links' | 'writings'
@@ -49,12 +51,13 @@ const Me: React.FC<MeProps> = ({
   relayPool, 
   eventStore,
   activeTab: propActiveTab,
-  bookmarks
+  bookmarks,
+  settings
 }) => {
   const activeAccount = Hooks.useActiveAccount()
   const navigate = useNavigate()
   const { filter: urlFilter } = useParams<{ filter?: string }>()
-  const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
+  const activeTab = propActiveTab || 'highlights'
   
   // Only for own profile
   const viewingPubkey = activeAccount?.pubkey
@@ -126,13 +129,6 @@ const Me: React.FC<MeProps> = ({
     }
   }, [])
 
-  // Update local state when prop changes
-  useEffect(() => {
-    if (propActiveTab) {
-      setActiveTab(propActiveTab)
-    }
-  }, [propActiveTab])
-
   // Sync filter state with URL changes
   useEffect(() => {
     const normalized = urlFilter === 'emoji' ? 'archive' : urlFilter
@@ -202,15 +198,15 @@ const Me: React.FC<MeProps> = ({
   }, [viewingPubkey, relayPool, eventStore, refreshTrigger])
 
   // Tab-specific loading functions
-  const loadHighlightsTab = async () => {
+  const loadHighlightsTab = useCallback(async () => {
     if (!viewingPubkey) return
     
     // Highlights come from controller subscription (sync effect handles it)
     setLoadedTabs(prev => new Set(prev).add('highlights'))
     setLoading(false)
-  }
+  }, [viewingPubkey])
 
-  const loadWritingsTab = async () => {
+  const loadWritingsTab = useCallback(async () => {
     if (!viewingPubkey) return
     
     try {
@@ -227,28 +223,29 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load writings:', err)
       setLoading(false)
     }
-  }
+  }, [viewingPubkey, relayPool, eventStore, refreshTrigger])
 
-  const loadReadingListTab = async () => {
+  const loadReadingListTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('reading-list')
-    
-    try {
+    setLoadedTabs(prev => {
+      const hasBeenLoaded = prev.has('reading-list')
       if (!hasBeenLoaded) setLoading(true)
-      // Bookmarks come from centralized loading in App.tsx
-      setLoadedTabs(prev => new Set(prev).add('reading-list'))
-    } catch (err) {
-      console.error('Failed to load reading list:', err)
-    } finally {
-      if (!hasBeenLoaded) setLoading(false)
-    }
-  }
+      return new Set(prev).add('reading-list')
+    })
+    
+    // Always turn off loading after a tick
+    setTimeout(() => setLoading(false), 0)
+  }, [viewingPubkey, activeAccount])
 
-  const loadReadsTab = async () => {
+  const loadReadsTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('reads')
+    let hasBeenLoaded = false
+    setLoadedTabs(prev => {
+      hasBeenLoaded = prev.has('reads')
+      return prev
+    })
     
     try {
       if (!hasBeenLoaded) setLoading(true)
@@ -267,12 +264,16 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load reads:', err)
       if (!hasBeenLoaded) setLoading(false)
     }
-  }
+  }, [viewingPubkey, activeAccount, relayPool, eventStore])
 
-  const loadLinksTab = async () => {
+  const loadLinksTab = useCallback(async () => {
     if (!viewingPubkey || !activeAccount) return
     
-    const hasBeenLoaded = loadedTabs.has('links')
+    let hasBeenLoaded = false
+    setLoadedTabs(prev => {
+      hasBeenLoaded = prev.has('links')
+      return prev
+    })
     
     try {
       if (!hasBeenLoaded) setLoading(true)
@@ -307,10 +308,10 @@ const Me: React.FC<MeProps> = ({
       console.error('Failed to load links:', err)
       if (!hasBeenLoaded) setLoading(false)
     }
-  }
+  }, [viewingPubkey, activeAccount, bookmarks, relayPool, readingProgressMap])
 
   // Load active tab data
-  useEffect(() => {
+  const loadActiveTab = useCallback(() => {
     if (!viewingPubkey || !activeTab) {
       setLoading(false)
       return
@@ -343,8 +344,11 @@ const Me: React.FC<MeProps> = ({
         loadLinksTab()
         break
     }
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [activeTab, viewingPubkey, refreshTrigger, bookmarks])
+  }, [viewingPubkey, activeTab, loadHighlightsTab, loadWritingsTab, loadReadingListTab, loadReadsTab, loadLinksTab])
+
+  useEffect(() => {
+    loadActiveTab()
+  }, [loadActiveTab])
 
   // Sync myHighlights from controller
   useEffect(() => {
@@ -489,6 +493,7 @@ const Me: React.FC<MeProps> = ({
   // Merge and flatten all individual bookmarks
   const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
     .filter(hasContent)
+    .filter(b => !settings?.hideBookmarksWithoutCreationDate || hasCreationDate(b))
   
   // Apply bookmark filter
   const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, bookmarkFilter)
@@ -560,27 +565,6 @@ const Me: React.FC<MeProps> = ({
     ? buildArchiveOnly(linksWithProgress, { kind: 'external' })
     : []
 
-  // Debug logs for archive filter issues
-  if (readingProgressFilter === 'archive') {
-    const ids = Array.from(new Set([
-      ...archiveController.getMarkedIds(),
-      ...readingProgressController.getMarkedAsReadIds()
-    ]))
-    const readIds = new Set(reads.map(i => i.id))
-    const matches = ids.filter(id => readIds.has(id))
-    const nonMatches = ids.filter(id => !readIds.has(id)).slice(0, 5)
-    console.log('[archive][me] counts', {
-      reads: reads.length,
-      filteredReads: filteredReads.length,
-      links: links.length,
-      linksWithProgress: linksWithProgress.length,
-      filteredLinks: filteredLinks.length,
-      markedIds: ids.length,
-      sampleMarked: ids.slice(0, 3),
-      matches: matches.length,
-      nonMatches
-    })
-  }
   const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = 
     groupingMode === 'flat'
       ? [{ key: 'all', title: `All Bookmarks (${filteredBookmarks.length})`, items: filteredBookmarks }]
@@ -846,6 +830,7 @@ const Me: React.FC<MeProps> = ({
                 post={post}
                 href={getPostUrl(post)}
                 readingProgress={getWritingReadingProgress(post)}
+                hideBotByName={settings.hideBotArticlesByName !== false}
               />
             ))}
           </div>

src/components/NostrMentionLink.tsx

@@ -0,0 +1,134 @@
+import React from 'react'
+import { nip19 } from 'nostr-tools'
+import { useEventModel } from 'applesauce-react/hooks'
+import { Models } from 'applesauce-core'
+
+interface NostrMentionLinkProps {
+  nostrUri: string
+  onClick?: (e: React.MouseEvent) => void
+  className?: string
+}
+
+/**
+ * Component to render nostr mentions with resolved profile names
+ * Handles npub, nprofile, note, nevent, and naddr URIs
+ */
+const NostrMentionLink: React.FC<NostrMentionLinkProps> = ({ 
+  nostrUri, 
+  onClick,
+  className = 'highlight-comment-link'
+}) => {
+  // Decode the nostr URI first
+  let decoded: ReturnType<typeof nip19.decode> | null = null
+  let pubkey: string | undefined
+  
+  try {
+    const identifier = nostrUri.replace(/^nostr:/, '')
+    decoded = nip19.decode(identifier)
+    
+    // Extract pubkey for profile fetching (works for npub and nprofile)
+    if (decoded.type === 'npub') {
+      pubkey = decoded.data
+    } else if (decoded.type === 'nprofile') {
+      pubkey = decoded.data.pubkey
+    }
+  } catch (error) {
+    // Decoding failed, will fallback to shortened identifier
+  }
+  
+  // Fetch profile at top level (Rules of Hooks)
+  const profile = useEventModel(Models.ProfileModel, pubkey ? [pubkey] : null)
+  
+  // If decoding failed, show shortened identifier
+  if (!decoded) {
+    const identifier = nostrUri.replace(/^nostr:/, '')
+    return (
+      <span className="highlight-comment-nostr-id">
+        {identifier.slice(0, 20)}...
+      </span>
+    )
+  }
+  
+  // Render based on decoded type
+  switch (decoded.type) {
+    case 'npub': {
+      const pk = decoded.data
+      const displayName = profile?.name || profile?.display_name || profile?.nip05 || `${pk.slice(0, 8)}...`
+      
+      return (
+        <a
+          href={`/p/${nip19.npubEncode(pk)}`}
+          className={className}
+          onClick={onClick}
+        >
+          @{displayName}
+        </a>
+      )
+    }
+    case 'nprofile': {
+      const { pubkey: pk } = decoded.data
+      const displayName = profile?.name || profile?.display_name || profile?.nip05 || `${pk.slice(0, 8)}...`
+      const npub = nip19.npubEncode(pk)
+      
+      return (
+        <a
+          href={`/p/${npub}`}
+          className={className}
+          onClick={onClick}
+        >
+          @{displayName}
+        </a>
+      )
+    }
+    case 'naddr': {
+      const { kind, pubkey: pk, identifier: addrIdentifier } = decoded.data
+      // Check if it's a blog post (kind:30023)
+      if (kind === 30023) {
+        const naddr = nip19.naddrEncode({ kind, pubkey: pk, identifier: addrIdentifier })
+        return (
+          <a
+            href={`/a/${naddr}`}
+            className={className}
+            onClick={onClick}
+          >
+            {addrIdentifier || 'Article'}
+          </a>
+        )
+      }
+      // For other kinds, show shortened identifier
+      return (
+        <span className="highlight-comment-nostr-id">
+          nostr:{addrIdentifier.slice(0, 12)}...
+        </span>
+      )
+    }
+    case 'note': {
+      const eventId = decoded.data
+      return (
+        <span className="highlight-comment-nostr-id">
+          note:{eventId.slice(0, 12)}...
+        </span>
+      )
+    }
+    case 'nevent': {
+      const { id } = decoded.data
+      return (
+        <span className="highlight-comment-nostr-id">
+          event:{id.slice(0, 12)}...
+        </span>
+      )
+    }
+    default: {
+      // Fallback for unrecognized types
+      const identifier = nostrUri.replace(/^nostr:/, '')
+      return (
+        <span className="highlight-comment-nostr-id">
+          {identifier.slice(0, 20)}...
+        </span>
+      )
+    }
+  }
+}
+
+export default NostrMentionLink
+

src/components/Profile.tsx

@@ -1,4 +1,4 @@
-import React, { useState, useEffect, useCallback } from 'react'
+import React, { useState, useEffect, useCallback, useMemo } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faHighlighter, faPenToSquare } from '@fortawesome/free-solid-svg-icons'
 import { IEventStore } from 'applesauce-core'
@@ -8,8 +8,8 @@ import { useNavigate } from 'react-router-dom'
 import { HighlightItem } from './HighlightItem'
 import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
 import { fetchHighlights } from '../services/highlightService'
-import { RELAYS } from '../config/relays'
 import { KINDS } from '../config/kinds'
+import { getActiveRelayUrls } from '../services/relayManager'
 import AuthorCard from './AuthorCard'
 import BlogPostCard from './BlogPostCard'
 import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
@@ -57,6 +57,15 @@ const Profile: React.FC<ProfileProps> = ({
     [pubkey]
   )
 
+  // Sort writings by publication date, newest first
+  const sortedWritings = useMemo(() => {
+    return cachedWritings.slice().sort((a, b) => {
+      const timeA = a.published || a.event.created_at
+      const timeB = b.published || b.event.created_at
+      return timeB - timeA
+    })
+  }, [cachedWritings])
+
   // Update local state when prop changes
   useEffect(() => {
     if (propActiveTab) {
@@ -98,24 +107,14 @@ const Profile: React.FC<ProfileProps> = ({
   useEffect(() => {
     if (!pubkey || !relayPool || !eventStore) return
     
+    // Fetch all highlights and writings in background (no limits)
+    const relayUrls = getActiveRelayUrls(relayPool)
     
-    // Fetch highlights in background
     fetchHighlights(relayPool, pubkey, undefined, undefined, false, eventStore)
-      .then(() => {
-        // Highlights fetched
-      })
-      .catch(err => {
-        console.warn('⚠️ [Profile] Failed to fetch highlights:', err)
-      })
+      .catch(err => console.warn('⚠️ [Profile] Failed to fetch highlights:', err))
     
-    // Fetch writings in background (no limit for single user profile)
-    fetchBlogPostsFromAuthors(relayPool, [pubkey], RELAYS, undefined, null)
-      .then(writings => {
-        writings.forEach(w => eventStore.add(w.event))
-      })
-      .catch(err => {
-        console.warn('⚠️ [Profile] Failed to fetch writings:', err)
-      })
+    fetchBlogPostsFromAuthors(relayPool, [pubkey], relayUrls, undefined, null, eventStore)
+      .catch(err => console.warn('⚠️ [Profile] Failed to fetch writings:', err))
   }, [pubkey, relayPool, eventStore, refreshTrigger])
 
   // Pull-to-refresh
@@ -168,7 +167,7 @@ const Profile: React.FC<ProfileProps> = ({
   }
 
   const npub = nip19.npubEncode(pubkey)
-  const showSkeletons = cachedHighlights.length === 0 && cachedWritings.length === 0
+  const showSkeletons = cachedHighlights.length === 0 && sortedWritings.length === 0
 
   const renderTabContent = () => {
     switch (activeTab) {
@@ -209,13 +208,13 @@ const Profile: React.FC<ProfileProps> = ({
             </div>
           )
         }
-        return cachedWritings.length === 0 ? (
+        return sortedWritings.length === 0 ? (
           <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
             No articles written yet.
           </div>
         ) : (
           <div className="explore-grid">
-            {cachedWritings.map((post) => (
+            {sortedWritings.map((post) => (
               <BlogPostCard
                 key={post.event.id}
                 post={post}

src/components/RichContent.tsx

@@ -0,0 +1,77 @@
+import React from 'react'
+import NostrMentionLink from './NostrMentionLink'
+
+interface RichContentProps {
+  content: string
+  className?: string
+}
+
+/**
+ * Component to render text content with:
+ * - Clickable links
+ * - Resolved nostr mentions (npub, nprofile, note, nevent, naddr)
+ * - Plain text
+ * 
+ * Handles both nostr:npub1... and plain npub1... formats
+ */
+const RichContent: React.FC<RichContentProps> = ({ 
+  content, 
+  className = 'bookmark-content' 
+}) => {
+  // Pattern to match:
+  // 1. nostr: URIs (nostr:npub1..., nostr:note1..., etc.)
+  // 2. Plain nostr identifiers (npub1..., nprofile1..., note1..., etc.)
+  // 3. http(s) URLs
+  const pattern = /(nostr:[a-z0-9]+|npub1[a-z0-9]+|nprofile1[a-z0-9]+|note1[a-z0-9]+|nevent1[a-z0-9]+|naddr1[a-z0-9]+|https?:\/\/[^\s]+)/gi
+  
+  const parts = content.split(pattern)
+  
+  return (
+    <div className={className}>
+      {parts.map((part, index) => {
+        // Handle nostr: URIs
+        if (part.startsWith('nostr:')) {
+          return (
+            <NostrMentionLink
+              key={index}
+              nostrUri={part}
+            />
+          )
+        }
+        
+        // Handle plain nostr identifiers (add nostr: prefix)
+        if (
+          part.match(/^(npub1|nprofile1|note1|nevent1|naddr1)[a-z0-9]+$/i)
+        ) {
+          return (
+            <NostrMentionLink
+              key={index}
+              nostrUri={`nostr:${part}`}
+            />
+          )
+        }
+        
+        // Handle http(s) URLs
+        if (part.match(/^https?:\/\//)) {
+          return (
+            <a
+              key={index}
+              href={part}
+              className="nostr-link"
+              target="_blank"
+              rel="noopener noreferrer"
+            >
+              {part}
+            </a>
+          )
+        }
+        
+        // Plain text
+        return <React.Fragment key={index}>{part}</React.Fragment>
+      })}
+    </div>
+  )
+}
+
+export default RichContent
+

src/components/Settings.tsx

@@ -6,11 +6,13 @@ import IconButton from './IconButton'
 import { loadFont } from '../utils/fontLoader'
 import ThemeSettings from './Settings/ThemeSettings'
 import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
+import MediaDisplaySettings from './Settings/MediaDisplaySettings'
 import ExploreSettings from './Settings/ExploreSettings'
 import LayoutBehaviorSettings from './Settings/LayoutBehaviorSettings'
 import ZapSettings from './Settings/ZapSettings'
 import RelaySettings from './Settings/RelaySettings'
 import PWASettings from './Settings/PWASettings'
+import TTSSettings from './Settings/TTSSettings'
 import { useRelayStatus } from '../hooks/useRelayStatus'
 import VersionFooter from './VersionFooter'
 
@@ -39,9 +41,15 @@ const DEFAULT_SETTINGS: UserSettings = {
   useLocalRelayAsCache: true,
   rebroadcastToAllRelays: false,
   paragraphAlignment: 'justify',
+  fullWidthImages: true,
+  renderVideoLinksAsEmbeds: true,
   syncReadingPosition: true,
   autoMarkAsReadOnCompletion: false,
   hideBookmarksWithoutCreationDate: true,
+  ttsUseSystemLanguage: false,
+  ttsDetectContentLanguage: true,
+  ttsLanguageMode: 'content',
+  ttsDefaultSpeed: 2.1,
 }
 
 interface SettingsProps {
@@ -169,8 +177,10 @@ const Settings: React.FC<SettingsProps> = ({ settings, onSave, onClose, relayPoo
       <div className="settings-content">
         <ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
         <ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
+        <MediaDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
         <ExploreSettings settings={localSettings} onUpdate={handleUpdate} />
         <ZapSettings settings={localSettings} onUpdate={handleUpdate} />
+        <TTSSettings settings={localSettings} onUpdate={handleUpdate} />
         <LayoutBehaviorSettings settings={localSettings} onUpdate={handleUpdate} />
         <PWASettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
         <RelaySettings relayStatuses={relayStatuses} onClose={onClose} />

src/components/Settings/ExploreSettings.tsx

@@ -51,6 +51,19 @@ const ExploreSettings: React.FC<ExploreSettingsProps> = ({ settings, onUpdate })
           />
         </div>
       </div>
+
+      <div className="setting-group">
+        <label htmlFor="hideBotArticlesByName" className="checkbox-label">
+          <input
+            id="hideBotArticlesByName"
+            type="checkbox"
+            checked={settings.hideBotArticlesByName !== false}
+            onChange={(e) => onUpdate({ hideBotArticlesByName: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Hide content posted by bots</span>
+        </label>
+      </div>
     </div>
   )
 }

src/components/Settings/MediaDisplaySettings.tsx

@@ -0,0 +1,43 @@
+import React from 'react'
+import { UserSettings } from '../../services/settingsService'
+
+interface MediaDisplaySettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+}
+
+const MediaDisplaySettings: React.FC<MediaDisplaySettingsProps> = ({ settings, onUpdate }) => {
+  return (
+    <div className="settings-section">
+      <h3 className="section-title">Media Display</h3>
+      
+      <div className="setting-group">
+        <label htmlFor="fullWidthImages" className="checkbox-label">
+          <input
+            id="fullWidthImages"
+            type="checkbox"
+            checked={settings.fullWidthImages === true}
+            onChange={(e) => onUpdate({ fullWidthImages: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Full-width images in articles</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="renderVideoLinksAsEmbeds" className="checkbox-label">
+          <input
+            id="renderVideoLinksAsEmbeds"
+            type="checkbox"
+            checked={settings.renderVideoLinksAsEmbeds === true}
+            onChange={(e) => onUpdate({ renderVideoLinksAsEmbeds: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Render video links as embeds</span>
+        </label>
+      </div>
+    </div>
+  )
+}
+
+export default MediaDisplaySettings

src/components/Settings/ReadingDisplaySettings.tsx

@@ -59,6 +59,7 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
         </div>
       </div>
 
+
       <div className="setting-group setting-inline">
         <label>Default Highlight Visibility</label>
         <div className="highlight-level-toggles">

src/components/Settings/TTSSettings.tsx

@@ -0,0 +1,86 @@
+import React from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faGauge } from '@fortawesome/free-solid-svg-icons'
+import { UserSettings } from '../../services/settingsService'
+import TTSControls from '../TTSControls'
+
+interface TTSSettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+}
+
+const SPEED_OPTIONS = [0.8, 1, 1.2, 1.4, 1.6, 1.8, 2, 2.1, 2.4, 2.8, 3]
+const EXAMPLE_TEXT = "Boris aims to be a calm reader app with clean typography, beautiful design, and a focus on readability. Boris does not and will never have ads, trackers, paywalls, subscriptions, or any other distractions."
+
+const TTSSettings: React.FC<TTSSettingsProps> = ({ settings, onUpdate }) => {
+  const currentSpeed = settings.ttsDefaultSpeed || 2.1
+
+  const handleCycleSpeed = () => {
+    const currentIndex = SPEED_OPTIONS.indexOf(currentSpeed)
+    const nextIndex = (currentIndex + 1) % SPEED_OPTIONS.length
+    onUpdate({ ttsDefaultSpeed: SPEED_OPTIONS[nextIndex] })
+  }
+
+  return (
+    <div className="settings-section">
+      <h3 className="section-title">Text-to-Speech</h3>
+      
+      <div className="setting-group setting-inline">
+        <label>Default Playback Speed</label>
+        <div className="setting-buttons">
+          <button
+            type="button"
+            className="article-menu-btn"
+            onClick={handleCycleSpeed}
+            title="Cycle speed"
+          >
+            <FontAwesomeIcon icon={faGauge} />
+            <span>{currentSpeed}x</span>
+          </button>
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label>Speaker language</label>
+        <div className="setting-control">
+          <select
+            value={settings.ttsLanguageMode || 'content'}
+            onChange={e => {
+              const value = e.target.value
+              onUpdate({ 
+                ttsLanguageMode: value,
+                ttsUseSystemLanguage: value === 'system',
+                ttsDetectContentLanguage: value === 'content'
+              })
+            }}
+            className="setting-select"
+          >
+            <option value="system">System Language</option>
+            <option value="content">Content (auto-detect)</option>
+            <option disabled>────────────</option>
+            <option value="en-US">English (American)</option>
+            <option value="en-GB">English (British)</option>
+            <option value="zh">Mandarin Chinese</option>
+            <option value="es">Spanish</option>
+            <option value="hi">Hindi</option>
+            <option value="ar">Arabic</option>
+            <option value="fr">French</option>
+            <option value="pt">Portuguese</option>
+            <option value="de">German</option>
+            <option value="ja">Japanese</option>
+            <option value="ru">Russian</option>
+          </select>
+        </div>
+      </div>
+
+      <div className="setting-group">
+        <div style={{ padding: '0.75rem', backgroundColor: 'var(--color-bg)', borderRadius: '4px', marginBottom: '0.75rem', fontSize: '0.95rem', lineHeight: '1.5' }}>
+          {EXAMPLE_TEXT}
+        </div>
+        <TTSControls text={EXAMPLE_TEXT} settings={settings} />
+      </div>
+    </div>
+  )
+}
+
+export default TTSSettings

src/components/ShareTargetHandler.tsx

@@ -0,0 +1,99 @@
+import { useEffect, useState } from 'react'
+import { useNavigate, useLocation } from 'react-router-dom'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faSpinner } from '@fortawesome/free-solid-svg-icons'
+import { Hooks } from 'applesauce-react'
+import { RelayPool } from 'applesauce-relay'
+import { createWebBookmark } from '../services/webBookmarkService'
+import { getActiveRelayUrls } from '../services/relayManager'
+import { useToast } from '../hooks/useToast'
+
+interface ShareTargetHandlerProps {
+  relayPool: RelayPool
+}
+
+/**
+ * Handles incoming shared URLs from the Web Share Target API.
+ * Auto-saves the shared URL as a web bookmark (NIP-B0).
+ */
+export default function ShareTargetHandler({ relayPool }: ShareTargetHandlerProps) {
+  const navigate = useNavigate()
+  const location = useLocation()
+  const activeAccount = Hooks.useActiveAccount()
+  const { showToast } = useToast()
+  const [processing, setProcessing] = useState(false)
+  const [waitingForLogin, setWaitingForLogin] = useState(false)
+
+  useEffect(() => {
+    const handleSharedContent = async () => {
+      // Parse query parameters
+      const params = new URLSearchParams(location.search)
+      const link = params.get('link')
+      const title = params.get('title')
+      const text = params.get('text')
+
+      // Validate we have a URL
+      if (!link) {
+        showToast('No URL to save')
+        navigate('/')
+        return
+      }
+
+      // If no active account, wait for login
+      if (!activeAccount) {
+        setWaitingForLogin(true)
+        showToast('Please log in to save this bookmark')
+        return
+      }
+
+      // We have account and URL, proceed with saving
+      if (!processing) {
+        setProcessing(true)
+        try {
+          await createWebBookmark(
+            link,
+            title || undefined,
+            text || undefined,
+            undefined,
+            activeAccount,
+            relayPool,
+            getActiveRelayUrls(relayPool)
+          )
+          showToast('Bookmark saved!')
+          navigate('/me/links')
+        } catch (err) {
+          console.error('Failed to save shared bookmark:', err)
+          showToast('Failed to save bookmark')
+          navigate('/')
+        } finally {
+          setProcessing(false)
+        }
+      }
+    }
+
+    handleSharedContent()
+  }, [activeAccount, location.search, navigate, relayPool, showToast, processing])
+
+  // Show waiting for login state
+  if (waitingForLogin && !activeAccount) {
+    return (
+      <div className="flex items-center justify-center h-screen">
+        <div className="text-center">
+          <FontAwesomeIcon icon={faSpinner} spin className="text-4xl mb-4" />
+          <p className="text-lg">Waiting for login...</p>
+        </div>
+      </div>
+    )
+  }
+
+  // Show processing state
+  return (
+    <div className="flex items-center justify-center h-screen">
+      <div className="text-center">
+        <FontAwesomeIcon icon={faSpinner} spin className="text-4xl mb-4" />
+        <p className="text-lg">Saving bookmark...</p>
+      </div>
+    </div>
+  )
+}
+

src/components/Support.tsx

@@ -2,7 +2,7 @@ import React, { useEffect, useState } from 'react'
 import { RelayPool } from 'applesauce-relay'
 import { IEventStore } from 'applesauce-core'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faHeart, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
+import { faHeart, faUserCircle } from '@fortawesome/free-solid-svg-icons'
 import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
 import { fetchProfiles } from '../services/profileService'
 import { UserSettings } from '../services/settingsService'
@@ -21,7 +21,7 @@ type SupporterProfile = ZapSender
 
 const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) => {
   const [supporters, setSupporters] = useState<SupporterProfile[]>([])
-  const [loading, setLoading] = useState(true)
+  const [loading, setLoading] = useState(false)
 
   useEffect(() => {
     const loadSupporters = async () => {
@@ -31,7 +31,8 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
         
         if (zappers.length > 0) {
           const pubkeys = zappers.map(z => z.pubkey)
-          await fetchProfiles(relayPool, eventStore, pubkeys, settings)
+          // Fetch profiles in background without blocking
+          fetchProfiles(relayPool, eventStore, pubkeys, settings).catch(() => {})
         }
         
         setSupporters(zappers)
@@ -45,14 +46,6 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
     loadSupporters()
   }, [relayPool, eventStore, settings])
 
-  if (loading) {
-    return (
-      <div className="flex items-center justify-center min-h-screen p-4">
-        <FontAwesomeIcon icon={faSpinner} spin size="2x" className="text-zinc-400" />
-      </div>
-    )
-  }
-
   return (
     <div className="min-h-screen" style={{ backgroundColor: 'var(--color-bg)', color: 'var(--color-text)' }}>
       <div className="max-w-5xl mx-auto px-4 py-12 md:py-16">
@@ -82,7 +75,32 @@ const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) =>
           </p>
         </div>
 
-        {supporters.length === 0 ? (
+        {loading ? (
+          <>
+            {/* Loading Skeletons */}
+            <div className="mb-16 md:mb-20">
+              <h2 className="text-2xl md:text-3xl font-semibold mb-8 md:mb-10 text-center" style={{ color: 'var(--color-text)' }}>
+                Legends
+              </h2>
+              <div className="grid grid-cols-2 sm:grid-cols-3 md:grid-cols-4 lg:grid-cols-5 gap-8 md:gap-10">
+                {Array.from({ length: 3 }).map((_, i) => (
+                  <SupporterSkeleton key={`whale-${i}`} isWhale={true} />
+                ))}
+              </div>
+            </div>
+
+            <div className="mb-12">
+              <h2 className="text-xl md:text-2xl font-semibold mb-8 text-center" style={{ color: 'var(--color-text)' }}>
+                Supporters
+              </h2>
+              <div className="grid grid-cols-4 sm:grid-cols-6 md:grid-cols-8 lg:grid-cols-10 gap-4 md:gap-5">
+                {Array.from({ length: 12 }).map((_, i) => (
+                  <SupporterSkeleton key={`supporter-${i}`} isWhale={false} />
+                ))}
+              </div>
+            </div>
+          </>
+        ) : supporters.length === 0 ? (
           <div className="text-center py-12" style={{ color: 'var(--color-text-muted)' }}>
             <p>No supporters yet. Be the first to zap Boris!</p>
           </div>
@@ -231,5 +249,55 @@ const SupporterCard: React.FC<SupporterCardProps> = ({ supporter, isWhale }) =>
   )
 }
 
+interface SupporterSkeletonProps {
+  isWhale: boolean
+}
+
+const SupporterSkeleton: React.FC<SupporterSkeletonProps> = ({ isWhale }) => {
+  return (
+    <div className="flex flex-col items-center">
+      <div className="relative">
+        {/* Avatar Skeleton */}
+        <div
+          className={`rounded-full overflow-hidden flex items-center justify-center animate-pulse
+            ${isWhale ? 'w-24 h-24 md:w-28 md:h-28' : 'w-10 h-10 md:w-12 md:h-12'}
+          `}
+          style={{ 
+            backgroundColor: 'var(--color-bg-elevated)'
+          }}
+        >
+          <div 
+            className={`rounded-full ${isWhale ? 'w-20 h-20 md:w-24 md:h-24' : 'w-8 h-8 md:w-10 md:h-10'}`}
+            style={{ backgroundColor: 'var(--color-border)' }}
+          />
+        </div>
+
+        {/* Whale Badge Skeleton */}
+        {isWhale && (
+          <div 
+            className="absolute -bottom-1 -right-1 w-8 h-8 rounded-full animate-pulse border-2"
+            style={{ 
+              backgroundColor: 'var(--color-border)',
+              borderColor: 'var(--color-bg)' 
+            }}
+          />
+        )}
+      </div>
+
+      {/* Name and Total Skeleton */}
+      <div className="mt-2 text-center space-y-1">
+        <div 
+          className={`rounded animate-pulse ${isWhale ? 'h-4 w-16' : 'h-3 w-12'}`}
+          style={{ backgroundColor: 'var(--color-border)' }}
+        />
+        <div 
+          className={`rounded animate-pulse ${isWhale ? 'h-3 w-12' : 'h-2 w-10'}`}
+          style={{ backgroundColor: 'var(--color-border)' }}
+        />
+      </div>
+    </div>
+  )
+}
+
 export default Support
 

src/components/TTSControls.tsx

@@ -0,0 +1,114 @@
+import React, { useMemo } from 'react'
+import { useTextToSpeech } from '../hooks/useTextToSpeech'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faPlay, faPause, faGauge } from '@fortawesome/free-solid-svg-icons'
+import { UserSettings } from '../services/settingsService'
+import { detect } from 'tinyld'
+
+interface Props {
+  text: string
+  defaultLang?: string
+  className?: string
+  settings?: UserSettings
+}
+
+const SPEED_OPTIONS = [0.8, 1, 1.2, 1.4, 1.6, 1.8, 2, 2.1, 2.4, 2.8, 3]
+
+const TTSControls: React.FC<Props> = ({ text, defaultLang, className, settings }) => {
+  const {
+    supported, speaking, paused,
+    speak, pause, resume,
+    rate, setRate
+  } = useTextToSpeech({ defaultLang, defaultRate: settings?.ttsDefaultSpeed })
+
+  const canPlay = supported && text?.trim().length > 0
+
+  const resolvedSystemLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    if ((mode ? mode === 'system' : settings?.ttsUseSystemLanguage) === true) {
+      return navigator?.language?.split('-')[0]
+    }
+    return undefined
+  }, [settings?.ttsLanguageMode, settings?.ttsUseSystemLanguage])
+
+  const detectContentLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    if (mode) return mode === 'content'
+    return settings?.ttsDetectContentLanguage !== false
+  }, [settings?.ttsLanguageMode, settings?.ttsDetectContentLanguage])
+
+  const specificLang = useMemo(() => {
+    const mode = settings?.ttsLanguageMode
+    // If mode is not 'system' or 'content', it's a specific language code
+    if (mode && mode !== 'system' && mode !== 'content') {
+      return mode
+    }
+    return undefined
+  }, [settings?.ttsLanguageMode])
+
+  const handlePlayPause = () => {
+    if (!canPlay) return
+
+    if (!speaking) {
+      let langOverride: string | undefined
+      
+      // Priority: specific language > content detection > system language
+      if (specificLang) {
+        langOverride = specificLang
+      } else if (detectContentLang && text) {
+        try {
+          const lang = detect(text)
+          if (typeof lang === 'string' && lang.length >= 2) langOverride = lang.slice(0, 2)
+        } catch (err) {
+          console.debug('[tts][detect] failed', err)
+        }
+      }
+      if (!langOverride && resolvedSystemLang) {
+        langOverride = resolvedSystemLang
+      }
+      speak(text, langOverride)
+    } else if (paused) {
+      resume()
+    } else {
+      pause()
+    }
+  }
+
+  const handleCycleSpeed = () => {
+    const currentIndex = SPEED_OPTIONS.indexOf(rate)
+    const nextIndex = (currentIndex + 1) % SPEED_OPTIONS.length
+    const next = SPEED_OPTIONS[nextIndex]
+    console.debug('[tts][ui] cycle speed', { from: rate, to: next, speaking, paused })
+    setRate(next)
+  }
+
+  const playLabel = !speaking ? 'Listen' : (paused ? 'Resume' : 'Pause')
+
+  if (!supported) return null
+
+  return (
+    <div className={className || 'tts-controls'} style={{ display: 'flex', gap: '0.5rem', alignItems: 'center', flexWrap: 'wrap', justifyContent: 'flex-end' }}>
+      <button
+        type="button"
+        className="article-menu-btn"
+        onClick={handlePlayPause}
+        title={playLabel}
+        disabled={!canPlay}
+      >
+        <FontAwesomeIcon icon={!speaking ? faPlay : (paused ? faPlay : faPause)} />
+      </button>
+      <button
+        type="button"
+        className="article-menu-btn"
+        onClick={handleCycleSpeed}
+        title="Cycle speed"
+      >
+        <FontAwesomeIcon icon={faGauge} />
+        <span>{rate}x</span>
+      </button>
+    </div>
+  )
+}
+
+export default TTSControls
+

src/components/VideoEmbedProcessor.tsx

@@ -0,0 +1,212 @@
+import React, { useMemo, forwardRef } from 'react'
+import ReactPlayer from 'react-player'
+import { classifyUrl } from '../utils/helpers'
+
+interface VideoEmbedProcessorProps {
+  html: string
+  renderVideoLinksAsEmbeds: boolean
+  className?: string
+  onMouseUp?: (e: React.MouseEvent) => void
+  onTouchEnd?: (e: React.TouchEvent) => void
+}
+
+/**
+ * Component that processes HTML content and optionally embeds video links
+ * as ReactPlayer components when renderVideoLinksAsEmbeds is enabled
+ */
+const VideoEmbedProcessor = forwardRef<HTMLDivElement, VideoEmbedProcessorProps>(({
+  html,
+  renderVideoLinksAsEmbeds,
+  className,
+  onMouseUp,
+  onTouchEnd
+}, ref) => {
+  const processedHtml = useMemo(() => {
+    if (!renderVideoLinksAsEmbeds || !html) {
+      return html
+    }
+
+    // Process HTML in stages: <video> blocks, <img> tags with video src, and bare video URLs
+    let result = html
+
+    const collectedUrls: string[] = []
+    let placeholderIndex = 0
+
+    // 1) Replace entire <video>...</video> blocks when they reference a video URL
+    const videoBlockPattern = /<video[^>]*>[\s\S]*?<\/video>/gi
+    const videoBlocks = result.match(videoBlockPattern) || []
+    videoBlocks.forEach((block) => {
+      // Try src on <video>
+      let url: string | null = null
+      const videoSrcMatch = block.match(/<video[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+      if (videoSrcMatch && videoSrcMatch[1]) {
+        url = videoSrcMatch[1]
+      } else {
+        // Try nested <source>
+        const sourceSrcMatch = block.match(/<source[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+        if (sourceSrcMatch && sourceSrcMatch[1]) {
+          url = sourceSrcMatch[1]
+        }
+      }
+      if (url) {
+        collectedUrls.push(url)
+        const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+        const escaped = block.replace(/[.*+?^${}()|[\]\\]/g, '\\$&')
+        result = result.replace(new RegExp(escaped, 'g'), placeholder)
+        placeholderIndex++
+      }
+    })
+
+    // 2) Replace entire <img ...> tags if their src points to a video
+    const imgTagPattern = /<img[^>]*>/gi
+    const allImgTags = result.match(imgTagPattern) || []
+    allImgTags.forEach((imgTag) => {
+      const srcMatch = imgTag.match(/src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?/i)
+      if (srcMatch && srcMatch[1]) {
+        const videoUrl = srcMatch[1]
+        collectedUrls.push(videoUrl)
+        const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+        const escapedTag = imgTag.replace(/[.*+?^${}()|[\]\\]/g, '\\$&')
+        result = result.replace(new RegExp(escapedTag, 'g'), placeholder)
+        placeholderIndex++
+      }
+    })
+
+    // 3) Replace remaining bare video URLs (direct files or recognized video platforms)
+    const fileVideoPattern = /https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)(?:\?[^\s<>"']*)?/gi
+    const fileVideoUrls: string[] = result.match(fileVideoPattern) || []
+
+    const allUrlPattern = /https?:\/\/[^\s<>"']+(?=\s|>|"|'|$)/gi
+    const allUrls: string[] = result.match(allUrlPattern) || []
+    const platformVideoUrls = allUrls.filter(url => {
+      // include URLs classified as video and not already collected
+      const classification = classifyUrl(url)
+      return classification.type === 'video' && !collectedUrls.includes(url)
+    })
+
+    const remainingUrls = [...fileVideoUrls, ...platformVideoUrls].filter(url => !collectedUrls.includes(url))
+
+    let processedHtml = result
+    remainingUrls.forEach((url) => {
+      const placeholder = `__VIDEO_EMBED_${placeholderIndex}__`
+      processedHtml = processedHtml.replace(new RegExp(url.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'), 'g'), placeholder)
+      collectedUrls.push(url)
+      placeholderIndex++
+    })
+
+    // If nothing collected, return original html
+    if (collectedUrls.length === 0) {
+      return html
+    }
+
+    return processedHtml
+  }, [html, renderVideoLinksAsEmbeds])
+
+  const videoUrls = useMemo(() => {
+    if (!renderVideoLinksAsEmbeds || !html) {
+      return []
+    }
+
+    const urls: string[] = []
+
+    // 1) Extract from <video> blocks first (video src or nested source src)
+    const videoBlockPattern = /<video[^>]*>[\s\S]*?<\/video>/gi
+    const videoBlocks = html.match(videoBlockPattern) || []
+    videoBlocks.forEach((block) => {
+      let url: string | null = null
+      const videoSrcMatch = block.match(/<video[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+      if (videoSrcMatch && videoSrcMatch[1]) {
+        url = videoSrcMatch[1]
+      } else {
+        const sourceSrcMatch = block.match(/<source[^>]*\s+src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?[^>]*>/i)
+        if (sourceSrcMatch && sourceSrcMatch[1]) {
+          url = sourceSrcMatch[1]
+        }
+      }
+      if (url && !urls.includes(url)) urls.push(url)
+    })
+
+    // 2) Extract from <img> tags with video src
+    const imgTagPattern = /<img[^>]*>/gi
+    const allImgTags = html.match(imgTagPattern) || []
+    allImgTags.forEach((imgTag) => {
+      const srcMatch = imgTag.match(/src=["']?(https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)[^\s<>"']*)["']?/i)
+      if (srcMatch && srcMatch[1] && !urls.includes(srcMatch[1])) {
+        urls.push(srcMatch[1])
+      }
+    })
+
+    // 3) Extract remaining direct file URLs and platform-classified video URLs
+    const fileVideoPattern = /https?:\/\/[^\s<>"']+\.(mp4|webm|ogg|mov|avi|mkv|m4v)(?:\?[^\s<>"']*)?/gi
+    const fileVideoUrls: string[] = html.match(fileVideoPattern) || []
+    fileVideoUrls.forEach(u => { if (!urls.includes(u)) urls.push(u) })
+
+    const allUrlPattern = /https?:\/\/[^\s<>"']+(?=\s|>|"|'|$)/gi
+    const allUrls: string[] = html.match(allUrlPattern) || []
+    allUrls.forEach(u => {
+      const classification = classifyUrl(u)
+      if (classification.type === 'video' && !urls.includes(u)) {
+        urls.push(u)
+      }
+    })
+
+    return urls
+  }, [html, renderVideoLinksAsEmbeds])
+
+  // If no video embedding is enabled, just render the HTML normally
+  if (!renderVideoLinksAsEmbeds || videoUrls.length === 0) {
+    return (
+      <div 
+        ref={ref}
+        className={className}
+        dangerouslySetInnerHTML={{ __html: processedHtml }}
+        onMouseUp={onMouseUp}
+        onTouchEnd={onTouchEnd}
+      />
+    )
+  }
+
+  // Split the HTML by video placeholders and render with embedded players
+  const parts = processedHtml.split(/(__VIDEO_EMBED_\d+__)/)
+  
+  return (
+    <div ref={ref} className={className} onMouseUp={onMouseUp} onTouchEnd={onTouchEnd}>
+      {parts.map((part, index) => {
+        const videoMatch = part.match(/^__VIDEO_EMBED_(\d+)__$/)
+        if (videoMatch) {
+          const videoIndex = parseInt(videoMatch[1])
+          const videoUrl = videoUrls[videoIndex]
+          if (videoUrl) {
+            return (
+              <div key={index} className="reader-video" style={{ margin: '1rem 0' }}>
+                <ReactPlayer 
+                  url={videoUrl}
+                  controls 
+                  width="100%"
+                  height="auto"
+                  style={{ 
+                    width: '100%', 
+                    height: 'auto', 
+                    aspectRatio: '16/9' 
+                  }}
+                />
+              </div>
+            )
+          }
+        }
+        
+        // Regular HTML content
+        return (
+          <div 
+            key={index}
+            dangerouslySetInnerHTML={{ __html: part }}
+          />
+        )
+      })}
+    </div>
+  )
+})
+
+VideoEmbedProcessor.displayName = 'VideoEmbedProcessor'
+
+export default VideoEmbedProcessor

src/config/bots.ts

@@ -0,0 +1,17 @@
+import { nip19 } from 'nostr-tools'
+
+/**
+ * Hardcoded list of bot pubkeys (hex format) to hide articles from
+ * These are accounts known to be bots or automated services
+ */
+export const BOT_PUBKEYS = new Set([
+  // Step Counter Bot (npub14l5xklll5vxzrf6hfkv8m6n2gqevythn5pqc6ezluespah0e8ars4279ss)
+  nip19.decode('npub14l5xklll5vxzrf6hfkv8m6n2gqevythn5pqc6ezluespah0e8ars4279ss').data as string,
+])
+
+/**
+ * Check if a pubkey corresponds to a known bot
+ */
+export function isKnownBot(pubkey: string): boolean {
+  return BOT_PUBKEYS.has(pubkey)
+}

src/config/relays.ts

@@ -11,12 +11,11 @@ export const RELAYS = [
   'wss://relay.damus.io',
   'wss://nos.lol',
   'wss://relay.nostr.band',
-  'wss://relay.dergigi.com',
   'wss://wot.dergigi.com',
   'wss://relay.snort.social',
   'wss://nostr-pub.wellorder.net',
   'wss://purplepag.es',
   'wss://relay.primal.net',
-  'wss://proxy.nostr-relay.app/5d0d38afc49c4b84ca0da951a336affa18438efed302aeedfa92eb8b0d3fcb87'
+  'wss://proxy.nostr-relay.app/5d0d38afc49c4b84ca0da951a336affa18438efed302aeedfa92eb8b0d3fcb87',
 ]
 

src/hooks/useArticleLoader.ts

@@ -1,4 +1,4 @@
-import { useEffect, Dispatch, SetStateAction } from 'react'
+import { useEffect, useRef, Dispatch, SetStateAction } from 'react'
 import { RelayPool } from 'applesauce-relay'
 import { fetchArticleByNaddr } from '../services/articleService'
 import { fetchHighlightsForArticle } from '../services/highlightService'
@@ -36,18 +36,26 @@ export function useArticleLoader({
   setCurrentArticle,
   settings
 }: UseArticleLoaderProps) {
+  const mountedRef = useRef(true)
+  
   useEffect(() => {
+    mountedRef.current = true
+    
     if (!relayPool || !naddr) return
     
     const loadArticle = async () => {
+      if (!mountedRef.current) return
+      
       setReaderLoading(true)
       setReaderContent(undefined)
       setSelectedUrl(`nostr:${naddr}`)
       setIsCollapsed(true)
-      // Keep highlights panel collapsed by default - only open on user interaction
       
       try {
         const article = await fetchArticleByNaddr(relayPool, naddr, false, settings)
+        
+        if (!mountedRef.current) return
+        
         setReaderContent({
           title: article.title,
           markdown: article.markdown,
@@ -63,24 +71,22 @@ export function useArticleLoader({
         setCurrentArticleCoordinate(articleCoordinate)
         setCurrentArticleEventId(article.event.id)
         setCurrentArticle?.(article.event)
-        
-        
-        // Set reader loading to false immediately after article content is ready
-        // Don't wait for highlights to finish loading
         setReaderLoading(false)
         
         // Fetch highlights asynchronously without blocking article display
-        // Stream them as they arrive for instant rendering
         try {
+          if (!mountedRef.current) return
+          
           setHighlightsLoading(true)
-          setHighlights([]) // Clear old highlights
+          setHighlights([])
           
           await fetchHighlightsForArticle(
             relayPool, 
             articleCoordinate, 
             article.event.id,
             (highlight) => {
-              // Merge streaming results with existing UI state to preserve locally created highlights
+              if (!mountedRef.current) return
+              
               setHighlights((prev: Highlight[]) => {
                 if (prev.some((h: Highlight) => h.id === highlight.id)) return prev
                 const next = [highlight, ...prev]
@@ -92,19 +98,40 @@ export function useArticleLoader({
         } catch (err) {
           console.error('Failed to fetch highlights:', err)
         } finally {
-          setHighlightsLoading(false)
+          if (mountedRef.current) {
+            setHighlightsLoading(false)
+          }
         }
       } catch (err) {
         console.error('Failed to load article:', err)
-        setReaderContent({
-          title: 'Error Loading Article',
-          html: `<p>Failed to load article: ${err instanceof Error ? err.message : 'Unknown error'}</p>`,
-          url: `nostr:${naddr}`
-        })
-        setReaderLoading(false)
+        if (mountedRef.current) {
+          setReaderContent({
+            title: 'Error Loading Article',
+            html: `<p>Failed to load article: ${err instanceof Error ? err.message : 'Unknown error'}</p>`,
+            url: `nostr:${naddr}`
+          })
+          setReaderLoading(false)
+        }
       }
     }
     
     loadArticle()
-  }, [naddr, relayPool, setSelectedUrl, setReaderContent, setReaderLoading, setIsCollapsed, setHighlights, setHighlightsLoading, setCurrentArticleCoordinate, setCurrentArticleEventId, setCurrentArticle, settings])
+    
+    return () => {
+      mountedRef.current = false
+    }
+  }, [
+    naddr,
+    relayPool,
+    settings,
+    setSelectedUrl,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed,
+    setHighlights,
+    setHighlightsLoading,
+    setCurrentArticleCoordinate,
+    setCurrentArticleEventId,
+    setCurrentArticle
+  ])
 }

src/hooks/useEventLoader.ts

@@ -0,0 +1,132 @@
+import { useEffect, useCallback } from 'react'
+import { RelayPool } from 'applesauce-relay'
+import { IEventStore } from 'applesauce-core'
+import { NostrEvent } from 'nostr-tools'
+import { ReadableContent } from '../services/readerService'
+import { eventManager } from '../services/eventManager'
+import { fetchProfiles } from '../services/profileService'
+
+interface UseEventLoaderProps {
+  eventId?: string
+  relayPool?: RelayPool | null
+  eventStore?: IEventStore | null
+  setSelectedUrl: (url: string) => void
+  setReaderContent: (content: ReadableContent | undefined) => void
+  setReaderLoading: (loading: boolean) => void
+  setIsCollapsed: (collapsed: boolean) => void
+}
+
+export function useEventLoader({
+  eventId,
+  relayPool,
+  eventStore,
+  setSelectedUrl,
+  setReaderContent,
+  setReaderLoading,
+  setIsCollapsed
+}: UseEventLoaderProps) {
+  const displayEvent = useCallback((event: NostrEvent) => {
+    // Escape HTML in content and convert newlines to breaks for plain text display
+    const escapedContent = event.content
+      .replace(/&/g, '&')
+      .replace(/</g, '&lt;')
+      .replace(/>/g, '&gt;')
+      .replace(/\n/g, '<br />')
+
+    // Initial title
+    let title = `Note (${event.kind})`
+    if (event.kind === 1) {
+      title = `Note by @${event.pubkey.slice(0, 8)}...`
+    }
+
+    // Emit immediately
+    const baseContent: ReadableContent = {
+      url: '',
+      html: `<div style="white-space: pre-wrap; word-break: break-word;">${escapedContent}</div>`,
+      title,
+      published: event.created_at
+    }
+    setReaderContent(baseContent)
+
+    // Background: resolve author profile for kind:1 and update title
+    if (event.kind === 1 && eventStore) {
+      (async () => {
+        try {
+          let resolved = ''
+
+          // First, try to get from event store cache
+          const storedProfile = eventStore.getEvent(event.pubkey + ':0')
+          if (storedProfile) {
+            try {
+              const obj = JSON.parse(storedProfile.content || '{}') as { name?: string; display_name?: string; nip05?: string }
+              resolved = obj.display_name || obj.name || obj.nip05 || ''
+            } catch {
+              // ignore parse errors
+            }
+          }
+
+          // If not found in event store, fetch from relays
+          if (!resolved && relayPool) {
+            const profiles = await fetchProfiles(relayPool, eventStore as unknown as IEventStore, [event.pubkey])
+            if (profiles && profiles.length > 0) {
+              const latest = profiles.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))[0]
+              try {
+                const obj = JSON.parse(latest.content || '{}') as { name?: string; display_name?: string; nip05?: string }
+                resolved = obj.display_name || obj.name || obj.nip05 || ''
+              } catch {
+                // ignore parse errors
+              }
+            }
+          }
+
+          if (resolved) {
+            setReaderContent({ ...baseContent, title: `Note by @${resolved}` })
+          }
+        } catch {
+          // ignore profile failures; keep fallback title
+        }
+      })()
+    }
+  }, [setReaderContent, relayPool, eventStore])
+
+  // Initialize event manager with services
+  useEffect(() => {
+    eventManager.setServices(eventStore || null, relayPool || null)
+  }, [eventStore, relayPool])
+
+  useEffect(() => {
+    if (!eventId) return
+
+    setReaderLoading(true)
+    setReaderContent(undefined)
+    setSelectedUrl(`nostr-event:${eventId}`) // sentinel: truthy selection, not treated as article
+    setIsCollapsed(false)
+
+    // Fetch using event manager (handles cache, deduplication, and retry)
+    let cancelled = false
+
+    eventManager.fetchEvent(eventId).then(
+      (event) => {
+        if (!cancelled) {
+          displayEvent(event)
+          setReaderLoading(false)
+        }
+      },
+      (err) => {
+        if (!cancelled) {
+          const errorContent: ReadableContent = {
+            url: '',
+            html: `<div style="padding: 1rem; color: var(--color-error, red);">Failed to load event: ${err instanceof Error ? err.message : 'Unknown error'}</div>`,
+            title: 'Error'
+          }
+          setReaderContent(errorContent)
+          setReaderLoading(false)
+        }
+      }
+    )
+
+    return () => {
+      cancelled = true
+    }
+  }, [eventId, displayEvent, setReaderLoading, setSelectedUrl, setIsCollapsed, setReaderContent])
+}

src/hooks/useExternalUrlLoader.ts

@@ -1,4 +1,4 @@
-import { useEffect, useMemo } from 'react'
+import { useEffect, useRef, useMemo } from 'react'
 import { RelayPool } from 'applesauce-relay'
 import { IEventStore } from 'applesauce-core'
 import { fetchReadableContent, ReadableContent } from '../services/readerService'
@@ -48,6 +48,8 @@ export function useExternalUrlLoader({
   setCurrentArticleCoordinate,
   setCurrentArticleEventId
 }: UseExternalUrlLoaderProps) {
+  const mountedRef = useRef(true)
+  
   // Load cached URL-specific highlights from event store
   const urlFilter = useMemo(() => {
     if (!url) return null
@@ -63,33 +65,37 @@ export function useExternalUrlLoader({
   
   // Load content and start streaming highlights when URL changes
   useEffect(() => {
+    mountedRef.current = true
+    
     if (!relayPool || !url) return
     
     const loadExternalUrl = async () => {
+      if (!mountedRef.current) return
+      
       setReaderLoading(true)
       setReaderContent(undefined)
       setSelectedUrl(url)
       setIsCollapsed(true)
-      // Clear article-specific state
       setCurrentArticleCoordinate(undefined)
       setCurrentArticleEventId(undefined)
       
       try {
         const content = await fetchReadableContent(url)
+        
+        if (!mountedRef.current) return
+        
         setReaderContent(content)
-        
-        
-        // Set reader loading to false immediately after content is ready
         setReaderLoading(false)
         
         // Fetch highlights for this URL asynchronously
         try {
+          if (!mountedRef.current) return
+          
           setHighlightsLoading(true)
           
           // Seed with cached highlights first
           if (cachedUrlHighlights.length > 0) {
             setHighlights((prev) => {
-              // Seed with cache but keep any locally created highlights already in state
               const seen = new Set<string>(cachedUrlHighlights.map(h => h.id))
               const localOnly = prev.filter(h => !seen.has(h.id))
               const next = [...cachedUrlHighlights, ...localOnly]
@@ -99,16 +105,16 @@ export function useExternalUrlLoader({
             setHighlights([])
           }
           
-          // Check if fetchHighlightsForUrl exists, otherwise skip
           if (typeof fetchHighlightsForUrl === 'function') {
             const seen = new Set<string>()
-            // Seed with cached IDs
             cachedUrlHighlights.forEach(h => seen.add(h.id))
             
             await fetchHighlightsForUrl(
               relayPool,
               url,
               (highlight) => {
+                if (!mountedRef.current) return
+                
                 if (seen.has(highlight.id)) return
                 seen.add(highlight.id)
                 setHighlights((prev) => {
@@ -117,32 +123,51 @@ export function useExternalUrlLoader({
                   return next.sort((a, b) => b.created_at - a.created_at)
                 })
               },
-              undefined, // settings
-              false, // force
+              undefined,
+              false,
               eventStore || undefined
             )
           }
         } catch (err) {
           console.error('Failed to fetch highlights:', err)
         } finally {
-          setHighlightsLoading(false)
+          if (mountedRef.current) {
+            setHighlightsLoading(false)
+          }
         }
       } catch (err) {
         console.error('Failed to load external URL:', err)
-        // For videos and other media files, use the filename as the title
-        const filename = getFilenameFromUrl(url)
-        setReaderContent({
-          title: filename,
-          html: `<p>Failed to load content: ${err instanceof Error ? err.message : 'Unknown error'}</p>`,
-          url
-        })
-        setReaderLoading(false)
+        if (mountedRef.current) {
+          const filename = getFilenameFromUrl(url)
+          setReaderContent({
+            title: filename,
+            html: `<p>Failed to load content: ${err instanceof Error ? err.message : 'Unknown error'}</p>`,
+            url
+          })
+          setReaderLoading(false)
+        }
       }
     }
     
     loadExternalUrl()
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [url, relayPool, eventStore, setSelectedUrl, setReaderContent, setReaderLoading, setIsCollapsed, setHighlights, setHighlightsLoading, setCurrentArticleCoordinate, setCurrentArticleEventId])
+    
+    return () => {
+      mountedRef.current = false
+    }
+  }, [
+    url,
+    relayPool,
+    eventStore,
+    cachedUrlHighlights,
+    setReaderContent,
+    setReaderLoading,
+    setIsCollapsed,
+    setSelectedUrl,
+    setHighlights,
+    setCurrentArticleCoordinate,
+    setCurrentArticleEventId,
+    setHighlightsLoading
+  ])
 
   // Keep UI highlights synced with cached store updates without reloading content
   useEffect(() => {

src/hooks/useMountedState.ts

@@ -0,0 +1,28 @@
+import { useRef, useEffect, useCallback } from 'react'
+
+/**
+ * Hook to track if component is mounted and prevent state updates after unmount.
+ * Returns a function to check if still mounted.
+ * 
+ * @example
+ * const isMounted = useMountedState()
+ * 
+ * async function loadData() {
+ *   const data = await fetch(...)
+ *   if (isMounted()) {
+ *     setState(data)
+ *   }
+ * }
+ */
+export function useMountedState(): () => boolean {
+  const mountedRef = useRef(true)
+  
+  useEffect(() => {
+    return () => {
+      mountedRef.current = false
+    }
+  }, [])
+  
+  return useCallback(() => mountedRef.current, [])
+}
+

src/hooks/useReadingPosition.ts

@@ -29,6 +29,7 @@ export const useReadingPosition = ({
   const saveTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
   const hasSavedOnce = useRef(false)
   const completionTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
+  const lastSavedAtRef = useRef<number>(0)
 
   // Debounced save function
   const scheduleSave = useCallback((currentPosition: number) => {
@@ -36,14 +37,49 @@ export const useReadingPosition = ({
       return
     }
 
-    // Don't save if position hasn't changed significantly (less than 1%)
-    // But always save if we've reached 100% (completion)
-    const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= 0.01
-    const hasReachedCompletion = currentPosition === 1 && lastSavedPosition.current < 1
-    const isInitialSave = !hasSavedOnce.current
-    
-    if (!hasSignificantChange && !hasReachedCompletion && !isInitialSave) {
-      // Not significant enough to save
+    // Always save instantly when we reach completion (1.0)
+    if (currentPosition === 1 && lastSavedPosition.current < 1) {
+      if (saveTimerRef.current) {
+        clearTimeout(saveTimerRef.current)
+        saveTimerRef.current = null
+      }
+      lastSavedPosition.current = 1
+      hasSavedOnce.current = true
+      lastSavedAtRef.current = Date.now()
+      onSave(1)
+      return
+    }
+
+    // Require at least 5% progress change to consider saving
+    const MIN_DELTA = 0.05
+    const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= MIN_DELTA
+
+    // Enforce a minimum interval between saves (15s) to avoid spamming
+    const MIN_INTERVAL_MS = 15000
+    const nowMs = Date.now()
+    const enoughTimeElapsed = nowMs - lastSavedAtRef.current >= MIN_INTERVAL_MS
+
+    // Allow the very first meaningful save (when crossing 5%) regardless of interval
+    const isFirstMeaningful = !hasSavedOnce.current && currentPosition >= MIN_DELTA
+
+    if (!hasSignificantChange && !isFirstMeaningful) {
+      return
+    }
+
+    // If interval hasn't elapsed yet, delay until autoSaveInterval but still cap frequency
+    if (!enoughTimeElapsed && !isFirstMeaningful) {
+      // Clear and reschedule within the remaining window, but not sooner than MIN_INTERVAL_MS
+      if (saveTimerRef.current) {
+        clearTimeout(saveTimerRef.current)
+      }
+      const remaining = Math.max(0, MIN_INTERVAL_MS - (nowMs - lastSavedAtRef.current))
+      const delay = Math.max(autoSaveInterval, remaining)
+      saveTimerRef.current = setTimeout(() => {
+        lastSavedPosition.current = currentPosition
+        hasSavedOnce.current = true
+        lastSavedAtRef.current = Date.now()
+        onSave(currentPosition)
+      }, delay)
       return
     }
 
@@ -52,27 +88,26 @@ export const useReadingPosition = ({
       clearTimeout(saveTimerRef.current)
     }
 
-    // Schedule new save
+    // Schedule new save using the larger of autoSaveInterval and MIN_INTERVAL_MS
+    const delay = Math.max(autoSaveInterval, MIN_INTERVAL_MS)
     saveTimerRef.current = setTimeout(() => {
       lastSavedPosition.current = currentPosition
       hasSavedOnce.current = true
+      lastSavedAtRef.current = Date.now()
       onSave(currentPosition)
-    }, autoSaveInterval)
+    }, delay)
   }, [syncEnabled, onSave, autoSaveInterval])
 
   // Immediate save function
   const saveNow = useCallback(() => {
     if (!syncEnabled || !onSave) return
-    
-    // Cancel any pending saves
     if (saveTimerRef.current) {
       clearTimeout(saveTimerRef.current)
       saveTimerRef.current = null
     }
-
-    // Always allow immediate save (including 0%)
     lastSavedPosition.current = position
     hasSavedOnce.current = true
+    lastSavedAtRef.current = Date.now()
     onSave(position)
   }, [syncEnabled, onSave, position])
 
@@ -97,13 +132,6 @@ export const useReadingPosition = ({
       const isAtBottom = scrollTop + windowHeight >= documentHeight - 5
       const clampedProgress = isAtBottom ? 1 : Math.max(0, Math.min(1, scrollProgress))
       
-      // Only log on significant changes (every 5%) to avoid flooding console
-      const prevPercent = Math.floor(position * 20) // Groups by 5%
-      const newPercent = Math.floor(clampedProgress * 20)
-      if (prevPercent !== newPercent) {
-        // Position threshold crossed
-      }
-      
       setPosition(clampedProgress)
       positionRef.current = clampedProgress
       onPositionChange?.(clampedProgress)
@@ -160,9 +188,7 @@ export const useReadingPosition = ({
         clearTimeout(completionTimerRef.current)
       }
     }
-    // position is intentionally not in deps - it's computed from scroll and would cause infinite re-renders
-    // eslint-disable-next-line react-hooks/exhaustive-deps
-  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave])
+  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave, completionHoldMs])
 
   // Reset reading complete state when enabled changes
   useEffect(() => {

src/hooks/useSettings.ts

@@ -16,7 +16,7 @@ interface UseSettingsParams {
 }
 
 export function useSettings({ relayPool, eventStore, pubkey, accountManager }: UseSettingsParams) {
-  const [settings, setSettings] = useState<UserSettings>({})
+  const [settings, setSettings] = useState<UserSettings>({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true })
   const [toastMessage, setToastMessage] = useState<string | null>(null)
   const [toastType, setToastType] = useState<'success' | 'error'>('success')
 
@@ -27,7 +27,7 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
     const loadAndWatch = async () => {
       try {
         const loadedSettings = await loadSettings(relayPool, eventStore, pubkey, RELAYS)
-        if (loadedSettings) setSettings(loadedSettings)
+        if (loadedSettings) setSettings({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true, ...loadedSettings })
       } catch (err) {
         console.error('Failed to load settings:', err)
       }
@@ -36,7 +36,7 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
     loadAndWatch()
 
     const subscription = watchSettings(eventStore, pubkey, (loadedSettings) => {
-      if (loadedSettings) setSettings(loadedSettings)
+      if (loadedSettings) setSettings({ renderVideoLinksAsEmbeds: true, hideBotArticlesByName: true, ...loadedSettings })
     })
 
     return () => subscription.unsubscribe()
@@ -73,6 +73,9 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
       // Set paragraph alignment
       root.setProperty('--paragraph-alignment', settings.paragraphAlignment || 'justify')
       
+      // Set image max-width based on full-width setting
+      root.setProperty('--image-max-width', settings.fullWidthImages ? 'none' : '100%')
+      
     }
     
     applyStyles()

src/hooks/useTextToSpeech.ts

@@ -0,0 +1,306 @@
+import { useCallback, useEffect, useMemo, useRef, useState } from 'react'
+
+// Web Speech API types
+type SpeechSynthesisVoice = {
+  name: string
+  voiceURI: string
+  lang: string
+  localService: boolean
+  default: boolean
+}
+
+export interface UseTTSOptions {
+  defaultLang?: string
+  defaultRate?: number
+  defaultPitch?: number
+  defaultVolume?: number
+}
+
+export interface UseTTS {
+  supported: boolean
+  speaking: boolean
+  paused: boolean
+  voices: SpeechSynthesisVoice[]
+  voice: SpeechSynthesisVoice | null
+  rate: number
+  pitch: number
+  volume: number
+  setVoice: (v: SpeechSynthesisVoice | null) => void
+  setRate: (r: number) => void
+  setPitch: (p: number) => void
+  setVolume: (v: number) => void
+  speak: (text: string, langOverride?: string) => void
+  pause: () => void
+  resume: () => void
+  stop: () => void
+}
+
+export function useTextToSpeech(options: UseTTSOptions = {}): UseTTS {
+  const synth = typeof window !== 'undefined' ? window.speechSynthesis : undefined
+  const supported = !!synth
+  const [voices, setVoices] = useState<SpeechSynthesisVoice[]>([])
+  const [voice, setVoice] = useState<SpeechSynthesisVoice | null>(null)
+  const [speaking, setSpeaking] = useState(false)
+  const [paused, setPaused] = useState(false)
+  const [rate, setRate] = useState(options.defaultRate ?? 2.1)
+  const [pitch, setPitch] = useState(options.defaultPitch ?? 1)
+  const [volume, setVolume] = useState(options.defaultVolume ?? 1)
+  const defaultLang = options.defaultLang || (typeof navigator !== 'undefined' ? navigator.language : 'en')
+
+  const utteranceRef = useRef<SpeechSynthesisUtterance | null>(null)
+  const spokenTextRef = useRef<string>('')
+  const charIndexRef = useRef<number>(0)
+  // Chunking state to reliably speak long texts from web URLs
+  const chunksRef = useRef<string[]>([])
+  const chunkIndexRef = useRef<number>(0)
+  const globalOffsetRef = useRef<number>(0)
+  const langRef = useRef<string | undefined>(undefined)
+
+  // Update rate when defaultRate option changes
+  useEffect(() => {
+    if (options.defaultRate !== undefined) {
+      console.debug('[tts] defaultRate changed ->', options.defaultRate)
+      setRate(options.defaultRate)
+    }
+  }, [options.defaultRate])
+
+  // Load voices (async in many browsers)
+  useEffect(() => {
+    if (!supported) return
+    const load = () => {
+      const v = synth!.getVoices()
+      setVoices(v)
+      if (!voice && v.length) {
+        const byLang = v.find(x => x.lang?.toLowerCase().startsWith(defaultLang.toLowerCase()))
+        setVoice(byLang || v[0] || null)
+        console.debug('[tts] voices loaded', { total: v.length, picked: (byLang || v[0] || null)?.lang })
+      }
+    }
+    load()
+    const handleVoicesChanged = () => load()
+    synth!.addEventListener('voiceschanged', handleVoicesChanged)
+    return () => {
+      synth!.removeEventListener('voiceschanged', handleVoicesChanged)
+    }
+  }, [supported, defaultLang, voice, synth])
+
+  const createUtterance = useCallback((text: string, langOverride?: string): SpeechSynthesisUtterance => {
+    const SpeechSynthesisUtteranceConstructor = (window as Window & typeof globalThis).SpeechSynthesisUtterance
+    const u = new SpeechSynthesisUtteranceConstructor(text) as SpeechSynthesisUtterance
+    const resolvedLang = langOverride || voice?.lang || defaultLang
+    u.lang = resolvedLang
+    if (langOverride) {
+      const match = voices.find(v => v.lang?.toLowerCase().startsWith(langOverride.toLowerCase()))
+      if (match) {
+        u.voice = match
+      } else if (voice) {
+        u.voice = voice
+      }
+    } else if (voice) {
+      u.voice = voice
+    }
+    u.rate = rate
+    u.pitch = pitch
+    u.volume = volume
+
+    const self = u
+
+    u.onstart = () => {
+      if (utteranceRef.current !== self) return
+      console.debug('[tts] onstart')
+      setSpeaking(true)
+      setPaused(false)
+    }
+    u.onpause = () => {
+      if (utteranceRef.current !== self) return
+      console.debug('[tts] onpause')
+      setPaused(true)
+    }
+    u.onresume = () => {
+      if (utteranceRef.current !== self) return
+      console.debug('[tts] onresume')
+      setPaused(false)
+    }
+    u.onend = () => {
+      if (utteranceRef.current !== self) return
+      console.debug('[tts] onend')
+      // Continue with next chunk if available
+      const hasMore = chunkIndexRef.current < (chunksRef.current.length - 1)
+      if (hasMore) {
+        chunkIndexRef.current += 1
+        globalOffsetRef.current += self.text.length
+        const next = chunksRef.current[chunkIndexRef.current] || ''
+        const nextUtterance = createUtterance(next, langRef.current)
+        utteranceRef.current = nextUtterance
+        synth!.speak(nextUtterance)
+        return
+      }
+      setSpeaking(false)
+      setPaused(false)
+      utteranceRef.current = null
+    }
+    u.onerror = () => {
+      if (utteranceRef.current !== self) return
+      console.debug('[tts] onerror')
+      setSpeaking(false)
+      setPaused(false)
+      utteranceRef.current = null
+    }
+    u.onboundary = (ev: SpeechSynthesisEvent) => {
+      if (utteranceRef.current !== self) return
+      if (typeof ev.charIndex === 'number') {
+        const newIndex = globalOffsetRef.current + ev.charIndex
+        if (newIndex > charIndexRef.current) {
+          charIndexRef.current = newIndex
+        }
+      }
+    }
+
+    return u
+  }, [voice, defaultLang, rate, pitch, volume, voices, synth])
+
+  const splitIntoChunks = useCallback((text: string, maxLen = 2400): string[] => {
+    const normalized = text.replace(/\s+/g, ' ').trim()
+    if (normalized.length <= maxLen) return [normalized]
+    const sentences = normalized.split(/(?<=[.!?])\s+/)
+    const chunks: string[] = []
+    let current = ''
+    for (const s of sentences) {
+      if ((current + (current ? ' ' : '') + s).length > maxLen) {
+        if (current) chunks.push(current)
+        if (s.length > maxLen) {
+          // Hard split very long sentence
+          for (let i = 0; i < s.length; i += maxLen) {
+            chunks.push(s.slice(i, i + maxLen))
+          }
+          current = ''
+        } else {
+          current = s
+        }
+      } else {
+        current = current ? `${current} ${s}` : s
+      }
+    }
+    if (current) chunks.push(current)
+    return chunks
+  }, [])
+
+  const startSpeakingChunks = useCallback((text: string) => {
+    chunksRef.current = splitIntoChunks(text)
+    chunkIndexRef.current = 0
+    globalOffsetRef.current = 0
+    const first = chunksRef.current[0] || ''
+    const u = createUtterance(first, langRef.current)
+    utteranceRef.current = u
+    synth!.speak(u)
+  }, [createUtterance, splitIntoChunks, synth])
+
+  const stop = useCallback(() => {
+    if (!supported) return
+    console.debug('[tts] stop')
+    synth!.cancel()
+    setSpeaking(false)
+    setPaused(false)
+    utteranceRef.current = null
+    charIndexRef.current = 0
+    spokenTextRef.current = ''
+    chunksRef.current = []
+    chunkIndexRef.current = 0
+    globalOffsetRef.current = 0
+  }, [supported, synth])
+
+  const speak = useCallback((text: string, langOverride?: string) => {
+    if (!supported || !text?.trim()) return
+    console.debug('[tts] speak', { len: text.length, rate })
+    synth!.cancel()
+    spokenTextRef.current = text
+    charIndexRef.current = 0
+    langRef.current = langOverride
+    startSpeakingChunks(text)
+  }, [supported, synth, startSpeakingChunks, rate])
+
+  const pause = useCallback(() => {
+    if (!supported) return
+    if (synth!.speaking && !synth!.paused) {
+      console.debug('[tts] pause')
+      synth!.pause()
+      setPaused(true)
+    }
+  }, [supported, synth])
+
+  const resume = useCallback(() => {
+    if (!supported) return
+    if (synth!.speaking && synth!.paused) {
+      console.debug('[tts] resume')
+      synth!.resume()
+      setPaused(false)
+    }
+  }, [supported, synth])
+
+  // Update rate in real-time: while speaking, restart from last boundary with new rate.
+  useEffect(() => {
+    if (!supported) return
+    if (!utteranceRef.current) return
+
+    console.debug('[tts] rate change', { rate, speaking: synth!.speaking, paused: synth!.paused, charIndex: charIndexRef.current })
+
+    if (synth!.speaking && !synth!.paused) {
+      const fullText = spokenTextRef.current
+      const startIndex = Math.max(0, Math.min(charIndexRef.current, fullText.length))
+      const remainingText = fullText.slice(startIndex)
+
+      console.debug('[tts] restart at new rate', { startIndex, remainingLen: remainingText.length })
+      synth!.cancel()
+      // restart chunked from current global index
+      spokenTextRef.current = remainingText
+      charIndexRef.current = 0
+      // keep current language selection; no change needed here
+      startSpeakingChunks(remainingText)
+      return
+    }
+
+    if (utteranceRef.current) {
+      utteranceRef.current.rate = rate
+    }
+  }, [rate, supported, synth, startSpeakingChunks])
+
+  const updateRate = useCallback((newRate: number) => {
+    setRate(newRate)
+    if (!supported) return
+    if (!utteranceRef.current) return
+
+    if (synth!.speaking && !synth!.paused) {
+      const fullText = spokenTextRef.current
+      const startIndex = Math.max(0, Math.min(charIndexRef.current, fullText.length - 1))
+      const remainingText = fullText.slice(startIndex)
+      console.debug('[tts] updateRate -> restart', { newRate, startIndex, remainingLen: remainingText.length })
+      synth!.cancel()
+      const u = createUtterance(remainingText)
+      // ensure the new rate is applied immediately on the new utterance
+      u.rate = newRate
+      utteranceRef.current = u
+      synth!.speak(u)
+    } else if (utteranceRef.current) {
+      console.debug('[tts] updateRate -> set on utterance', { newRate })
+      utteranceRef.current.rate = newRate
+    }
+  }, [supported, synth, createUtterance])
+
+  // stop TTS when unmounting
+  useEffect(() => stop, [stop])
+
+  return useMemo(() => ({
+    supported,
+    speaking,
+    paused,
+    voices,
+    voice,
+    rate,
+    setRate: updateRate,
+    pitch, setPitch,
+    volume, setVolume,
+    setVoice,
+    speak, pause, resume, stop
+  }), [supported, speaking, paused, voices, voice, rate, updateRate, pitch, volume, setVoice, speak, pause, resume, stop])
+}
+

src/services/archiveController.ts

@@ -3,7 +3,6 @@ import { IEventStore } from 'applesauce-core'
 import { NostrEvent } from 'nostr-tools'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
-import { RELAYS } from '../config/relays'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { nip19 } from 'nostr-tools'
 
@@ -35,14 +34,12 @@ class ArchiveController {
     if (!this.markedIds.has(id)) {
       this.markedIds.add(id)
       this.emit()
-      console.log('[archive] mark() added', id.slice(0, 48))
     }
   }
 
   unmark(id: string): void {
     if (this.markedIds.delete(id)) {
       this.emit()
-      console.log('[archive] unmark() removed', id.slice(0, 48))
     }
   }
 
@@ -61,7 +58,7 @@ class ArchiveController {
   reset(): void {
     this.generation++
       if (this.timelineSubscription) {
-        try { this.timelineSubscription.unsubscribe() } catch (e) { console.warn('[archive] timeline unsub error', e) }
+        try { this.timelineSubscription.unsubscribe() } catch { /* ignore */ }
         this.timelineSubscription = null
       }
     this.markedIds = new Set()
@@ -80,13 +77,11 @@ class ArchiveController {
     const startGen = this.generation
 
     if (!force && this.isLoadedFor(pubkey)) {
-      console.log('[archive] start() skipped - already loaded for pubkey')
       return
     }
 
     // Mark as loaded immediately (fetch runs non-blocking)
     this.lastLoadedPubkey = pubkey
-    console.log('[archive] start() begin for pubkey:', pubkey.slice(0, 12), '...')
 
     // Handlers for streaming queries
     const handleUrlReaction = (evt: NostrEvent) => {
@@ -95,7 +90,6 @@ class ArchiveController {
       if (!rTag) return
       this.markedIds.add(rTag)
       this.emit()
-      console.log('[archive] mark url:', rTag)
     }
 
     const handleEventReaction = (evt: NostrEvent) => {
@@ -110,7 +104,6 @@ class ArchiveController {
             const naddr = nip19.naddrEncode({ kind, pubkey, identifier })
             this.markedIds.add(naddr)
             this.emit()
-            console.log('[archive] mark naddr via a-tag:', naddr.slice(0, 24), '...')
             return
           }
         } catch { /* ignore malformed a-tag */ }
@@ -118,14 +111,13 @@ class ArchiveController {
       const eTag = evt.tags.find(t => t[0] === 'e')?.[1]
       if (!eTag) return
       this.pendingEventIds.add(eTag)
-      console.log('[archive] pending event id:', eTag)
     }
 
     try {
       // Stream kind:17 and kind:7 in parallel
       const [kind17, kind7] = await Promise.all([
-        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleUrlReaction }),
-        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleEventReaction })
+        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { onEvent: handleUrlReaction }),
+        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { onEvent: handleEventReaction })
       ])
 
       if (startGen !== this.generation) return
@@ -133,27 +125,23 @@ class ArchiveController {
       // Include EOSE events
       kind17.forEach(handleUrlReaction)
       kind7.forEach(handleEventReaction)
-      console.log('[archive] EOSE sizes kind17:', kind17.length, 'kind7:', kind7.length, 'pendingEventIds:', this.pendingEventIds.size)
 
       if (this.pendingEventIds.size > 0) {
         // Fetch referenced articles (kind:30023) and map event IDs to naddr
         const ids = Array.from(this.pendingEventIds)
-        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids }, { relayUrls: RELAYS })
-        console.log('[archive] fetched articles for mapping:', articleEvents.length)
+        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids })
         for (const article of articleEvents) {
           const dTag = article.tags.find(t => t[0] === 'd')?.[1]
           if (!dTag) continue
           try {
             const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: article.pubkey, identifier: dTag })
             this.markedIds.add(naddr)
-            console.log('[archive] mark naddr:', naddr.slice(0, 24), '...')
           } catch {
             // skip invalid
           }
         }
         this.emit()
       }
-      console.log('[archive] total marked ids:', this.markedIds.size)
 
       // Try immediate mapping via eventStore for any still-pending e-ids
       if (this.pendingEventIds.size > 0) {
@@ -167,7 +155,6 @@ class ArchiveController {
               if (dTag) {
                 const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: evt.pubkey, identifier: dTag })
                 this.markedIds.add(naddr)
-                console.log('[archive] map via eventStore naddr:', naddr.slice(0, 24), '...')
               }
             } else {
               stillPending.add(eId)
@@ -178,7 +165,7 @@ class ArchiveController {
         if (stillPending.size > 0) {
           // Subscribe to future 30023 arrivals to finalize mapping
           if (this.timelineSubscription) {
-            try { this.timelineSubscription.unsubscribe() } catch (e) { console.warn('[archive] timeline unsub error', e) }
+            try { this.timelineSubscription.unsubscribe() } catch { /* ignore */ }
             this.timelineSubscription = null
           }
           const sub$ = eventStore.timeline({ kinds: [KINDS.BlogPost] })
@@ -193,16 +180,14 @@ class ArchiveController {
                 const naddr = nip19.naddrEncode({ kind: KINDS.BlogPost, pubkey: evt.pubkey, identifier: dTag })
                 this.markedIds.add(naddr)
                 this.pendingEventIds.delete(evt.id)
-                console.log('[archive] map via timeline naddr:', naddr.slice(0, 24), '...')
                 this.emit()
-              } catch (e) { console.warn('[archive] map via timeline encode error', e) }
+              } catch { /* ignore */ }
             }
           })
         }
       }
     } catch (err) {
       // Non-blocking fetch; ignore errors here
-      console.warn('[archive] start() error:', err)
     }
   }
 }

src/services/bookmarkController.ts

@@ -3,7 +3,8 @@ import { Helpers, EventStore } from 'applesauce-core'
 import { createEventLoader, createAddressLoader } from 'applesauce-loaders/loaders'
 import { NostrEvent } from 'nostr-tools'
 import { EventPointer } from 'nostr-tools/nip19'
-import { merge } from 'rxjs'
+import { from } from 'rxjs'
+import { mergeMap } from 'rxjs/operators'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
 import { RELAYS } from '../config/relays'
@@ -69,6 +70,7 @@ class BookmarkController {
   private eventStore = new EventStore()
   private eventLoader: ReturnType<typeof createEventLoader> | null = null
   private addressLoader: ReturnType<typeof createAddressLoader> | null = null
+  private externalEventStore: EventStore | null = null
 
   onRawEvent(cb: RawEventCallback): () => void {
     this.rawEventListeners.push(cb)
@@ -138,8 +140,11 @@ class BookmarkController {
     // Convert IDs to EventPointers
     const pointers: EventPointer[] = unique.map(id => ({ id }))
     
-    // Use EventLoader - it auto-batches and streams results
-    merge(...pointers.map(this.eventLoader)).subscribe({
+    // Use mergeMap with concurrency limit instead of merge to properly batch requests
+    // This prevents overwhelming relays with 96+ simultaneous requests
+    from(pointers).pipe(
+      mergeMap(pointer => this.eventLoader!(pointer), 5)
+    ).subscribe({
       next: (event) => {
         // Check if hydration was cancelled
         if (this.hydrationGeneration !== generation) return
@@ -153,6 +158,11 @@ class BookmarkController {
           idToEvent.set(coordinate, event)
         }
         
+        // Add to external event store if available
+        if (this.externalEventStore) {
+          this.externalEventStore.add(event)
+        }
+        
         onProgress()
       },
       error: () => {
@@ -183,8 +193,10 @@ class BookmarkController {
       identifier: c.identifier
     }))
 
-    // Use AddressLoader - it auto-batches and streams results
-    merge(...pointers.map(this.addressLoader)).subscribe({
+    // Use mergeMap with concurrency limit instead of merge to properly batch requests
+    from(pointers).pipe(
+      mergeMap(pointer => this.addressLoader!(pointer), 5)
+    ).subscribe({
       next: (event) => {
         // Check if hydration was cancelled
         if (this.hydrationGeneration !== generation) return
@@ -194,6 +206,11 @@ class BookmarkController {
         idToEvent.set(coordinate, event)
         idToEvent.set(event.id, event)
         
+        // Add to external event store if available
+        if (this.externalEventStore) {
+          this.externalEventStore.add(event)
+        }
+        
         onProgress()
       },
       error: () => {
@@ -244,30 +261,42 @@ class BookmarkController {
       })
 
       const allItems = [...publicItemsAll, ...privateItemsAll]
+      const deduped = dedupeBookmarksById(allItems)
       
-      // Separate hex IDs from coordinates
+      // Separate hex IDs from coordinates for fetching
       const noteIds: string[] = []
       const coordinates: string[] = []
       
-      allItems.forEach(i => {
-        if (/^[0-9a-f]{64}$/i.test(i.id)) {
-          noteIds.push(i.id)
-        } else if (i.id.includes(':')) {
-          coordinates.push(i.id)
+      // Request hydration for all items that don't have content yet
+      deduped.forEach(i => {
+        // If item has no content, we need to fetch it
+        if (!i.content || i.content.length === 0) {
+          if (/^[0-9a-f]{64}$/i.test(i.id)) {
+            noteIds.push(i.id)
+          } else if (i.id.includes(':')) {
+            coordinates.push(i.id)
+          }
         }
       })
       
+      console.log(`📋 Requesting hydration for: ${noteIds.length} note IDs, ${coordinates.length} coordinates`)
+      
       // Helper to build and emit bookmarks
       const emitBookmarks = (idToEvent: Map<string, NostrEvent>) => {
-        const allBookmarks = dedupeBookmarksById([
+        // Now hydrate the ORIGINAL items (which may have duplicates), using the deduplicated results
+        // This preserves the original public/private split while still getting all the content
+        const allBookmarks = [
           ...hydrateItems(publicItemsAll, idToEvent),
           ...hydrateItems(privateItemsAll, idToEvent)
-        ])
-
+        ]
+        
         const enriched = allBookmarks.map(b => ({
           ...b,
           tags: b.tags || [],
-          content: b.content || ''
+          // Prefer hydrated content; fallback to any cached event content in external store
+          content: b.content && b.content.length > 0
+            ? b.content
+            : (this.externalEventStore?.getEvent(b.id)?.content || '')
         }))
         
         const sortedBookmarks = enriched
@@ -324,8 +353,12 @@ class BookmarkController {
     relayPool: RelayPool
     activeAccount: unknown
     accountManager: { getActive: () => unknown }
+    eventStore?: EventStore
   }): Promise<void> {
-    const { relayPool, activeAccount, accountManager } = options
+    const { relayPool, activeAccount, accountManager, eventStore } = options
+    
+    // Store the external event store reference for adding hydrated events
+    this.externalEventStore = eventStore || null
 
     if (!activeAccount || typeof (activeAccount as { pubkey?: string }).pubkey !== 'string') {
       return

src/services/bookmarkHelpers.ts

@@ -62,7 +62,8 @@ export { dedupeNip51Events } from './bookmarkEvents'
 export const processApplesauceBookmarks = (
   bookmarks: unknown,
   activeAccount: ActiveAccount,
-  isPrivate: boolean
+  isPrivate: boolean,
+  parentCreatedAt?: number
 ): IndividualBookmark[] => {
   if (!bookmarks) return []
 
@@ -76,14 +77,14 @@ export const processApplesauceBookmarks = (
         allItems.push({
           id: note.id,
           content: '',
-          created_at: Math.floor(Date.now() / 1000),
+          created_at: parentCreatedAt || 0,
           pubkey: note.author || activeAccount.pubkey,
           kind: 1, // Short note kind
           tags: [],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: Math.floor(Date.now() / 1000)
+          added_at: parentCreatedAt || 0
         })
       })
     }
@@ -96,14 +97,14 @@ export const processApplesauceBookmarks = (
         allItems.push({
           id: coordinate,
           content: '',
-          created_at: Math.floor(Date.now() / 1000),
+          created_at: parentCreatedAt || 0,
           pubkey: article.pubkey,
           kind: article.kind, // Usually 30023 for long-form articles
           tags: [],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: Math.floor(Date.now() / 1000)
+          added_at: parentCreatedAt || 0
         })
       })
     }
@@ -114,14 +115,14 @@ export const processApplesauceBookmarks = (
         allItems.push({
           id: `hashtag-${hashtag}`,
           content: `#${hashtag}`,
-          created_at: Math.floor(Date.now() / 1000),
+          created_at: parentCreatedAt || 0,
           pubkey: activeAccount.pubkey,
           kind: 1,
           tags: [['t', hashtag]],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: Math.floor(Date.now() / 1000)
+          added_at: parentCreatedAt || 0
         })
       })
     }
@@ -132,14 +133,14 @@ export const processApplesauceBookmarks = (
         allItems.push({
           id: `url-${url}`,
           content: url,
-          created_at: Math.floor(Date.now() / 1000),
+          created_at: parentCreatedAt || 0,
           pubkey: activeAccount.pubkey,
           kind: 1,
           tags: [['r', url]],
           parsedContent: undefined,
           type: 'event' as const,
           isPrivate,
-          added_at: Math.floor(Date.now() / 1000)
+          added_at: parentCreatedAt || 0
         })
       })
     }
@@ -153,14 +154,14 @@ export const processApplesauceBookmarks = (
     .map((bookmark: BookmarkData) => ({
       id: bookmark.id!,
       content: bookmark.content || '',
-      created_at: bookmark.created_at || Math.floor(Date.now() / 1000),
+      created_at: bookmark.created_at || parentCreatedAt || 0,
       pubkey: activeAccount.pubkey,
       kind: bookmark.kind || 30001,
       tags: bookmark.tags || [],
       parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
       type: 'event' as const,
       isPrivate,
-      added_at: bookmark.created_at || Math.floor(Date.now() / 1000)
+      added_at: bookmark.created_at || parentCreatedAt || 0
     }))
 }
 
@@ -169,29 +170,38 @@ export function hydrateItems(
   items: IndividualBookmark[],
   idToEvent: Map<string, NostrEvent>
 ): IndividualBookmark[] {
-  return items.map(item => {
-    const ev = idToEvent.get(item.id)
-    if (!ev) return item
-    
-    // For long-form articles (kind:30023), use the article title as content
-    let content = ev.content || item.content || ''
-    if (ev.kind === 30023) {
-      const articleTitle = getArticleTitle(ev)
-      if (articleTitle) {
-        content = articleTitle
+  return items
+    .map(item => {
+      const ev = idToEvent.get(item.id)
+      if (!ev) return item
+      
+      // For long-form articles (kind:30023), use the article title as content
+      let content = ev.content || item.content || ''
+      if (ev.kind === 30023) {
+        const articleTitle = getArticleTitle(ev)
+        if (articleTitle) {
+          content = articleTitle
+        }
       }
-    }
-    
-    return {
-      ...item,
-      pubkey: ev.pubkey || item.pubkey,
-      content,
-      created_at: ev.created_at || item.created_at,
-      kind: ev.kind || item.kind,
-      tags: ev.tags || item.tags,
-      parsedContent: ev.content ? (getParsedContent(content) as ParsedContent) : item.parsedContent
-    }
-  })
+      
+      // Ensure all events with content get parsed content for proper rendering
+      const parsedContent = content ? (getParsedContent(content) as ParsedContent) : undefined
+      
+      return {
+        ...item,
+        pubkey: ev.pubkey || item.pubkey,
+        content,
+        created_at: ev.created_at || item.created_at,
+        kind: ev.kind || item.kind,
+        tags: ev.tags || item.tags,
+        parsedContent: parsedContent || item.parsedContent
+      }
+    })
+    .filter(item => {
+      // Filter out bookmark list events (they're containers, not content)
+      const isBookmarkListEvent = item.kind === 10003 || item.kind === 30003 || item.kind === 30001
+      return !isBookmarkListEvent
+    })
 }
 
 // Note: event decryption/collection lives in `bookmarkProcessing.ts`

src/services/bookmarkProcessing.ts

@@ -64,7 +64,7 @@ async function decryptEvent(
           const hiddenTags = JSON.parse(decryptedContent) as string[][]
           const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
           privateItems.push(
-            ...processApplesauceBookmarks(manualPrivate, activeAccount, true).map(i => ({
+            ...processApplesauceBookmarks(manualPrivate, activeAccount, true, evt.created_at).map(i => ({
               ...i,
               sourceKind: evt.kind,
               setName: dTag,
@@ -84,7 +84,7 @@ async function decryptEvent(
     const priv = Helpers.getHiddenBookmarks(evt)
     if (priv) {
       privateItems.push(
-        ...processApplesauceBookmarks(priv, activeAccount, true).map(i => ({
+        ...processApplesauceBookmarks(priv, activeAccount, true, evt.created_at).map(i => ({
           ...i,
           sourceKind: evt.kind,
           setName: dTag,
@@ -155,7 +155,7 @@ export async function collectBookmarksFromEvents(
 
     const pub = Helpers.getPublicBookmarks(evt)
     publicItemsAll.push(
-      ...processApplesauceBookmarks(pub, activeAccount, false).map(i => ({
+      ...processApplesauceBookmarks(pub, activeAccount, false, evt.created_at).map(i => ({
         ...i,
         sourceKind: evt.kind,
         setName: dTag,
@@ -181,7 +181,7 @@ export async function collectBookmarksFromEvents(
       const priv = Helpers.getHiddenBookmarks(evt)
       if (priv) {
         publicItemsAll.push(
-          ...processApplesauceBookmarks(priv, activeAccount, true).map(i => ({
+          ...processApplesauceBookmarks(priv, activeAccount, true, evt.created_at).map(i => ({
             ...i,
             sourceKind: evt.kind,
             setName: dTag,

src/services/eventManager.ts

@@ -0,0 +1,148 @@
+import { RelayPool } from 'applesauce-relay'
+import { IEventStore } from 'applesauce-core'
+import { createEventLoader } from 'applesauce-loaders/loaders'
+import { NostrEvent } from 'nostr-tools'
+
+type PendingRequest = {
+  resolve: (event: NostrEvent) => void
+  reject: (error: Error) => void
+}
+
+/**
+ * Centralized event manager for event fetching and caching
+ * Handles deduplication of concurrent requests and coordinate with relay pool
+ */
+class EventManager {
+  private eventStore: IEventStore | null = null
+  private relayPool: RelayPool | null = null
+  private eventLoader: ReturnType<typeof createEventLoader> | null = null
+  
+  // Track pending requests to deduplicate and resolve all at once
+  private pendingRequests = new Map<string, PendingRequest[]>()
+  
+  // Safety timeout for event fetches (ms)
+  private fetchTimeoutMs = 12000
+  
+  /**
+   * Initialize the event manager with event store and relay pool
+   */
+  setServices(eventStore: IEventStore | null, relayPool: RelayPool | null): void {
+    this.eventStore = eventStore
+    this.relayPool = relayPool
+    
+    // Recreate loader when services change
+    if (relayPool) {
+      this.eventLoader = createEventLoader(relayPool, {
+        eventStore: eventStore || undefined
+      })
+      
+      // Retry any pending requests now that we have a loader
+      this.retryAllPending()
+    }
+  }
+  
+  /**
+   * Get cached event from event store
+   */
+  getCachedEvent(eventId: string): NostrEvent | null {
+    if (!this.eventStore) return null
+    return this.eventStore.getEvent(eventId) || null
+  }
+  
+  /**
+   * Fetch an event by ID, returning a promise
+   * Automatically deduplicates concurrent requests for the same event
+   */
+  fetchEvent(eventId: string): Promise<NostrEvent> {
+    // Check cache first
+    const cached = this.getCachedEvent(eventId)
+    if (cached) {
+      return Promise.resolve(cached)
+    }
+    
+    return new Promise<NostrEvent>((resolve, reject) => {
+      // Check if we're already fetching this event
+      if (this.pendingRequests.has(eventId)) {
+        // Add to existing request queue
+        this.pendingRequests.get(eventId)!.push({ resolve, reject })
+        return
+      }
+      
+      // Start a new fetch request
+      this.pendingRequests.set(eventId, [{ resolve, reject }])
+      this.fetchFromRelay(eventId)
+    })
+  }
+  
+  private resolvePending(eventId: string, event: NostrEvent): void {
+    const requests = this.pendingRequests.get(eventId) || []
+    this.pendingRequests.delete(eventId)
+    requests.forEach(req => req.resolve(event))
+  }
+  
+  private rejectPending(eventId: string, error: Error): void {
+    const requests = this.pendingRequests.get(eventId) || []
+    this.pendingRequests.delete(eventId)
+    requests.forEach(req => req.reject(error))
+  }
+  
+  /**
+   * Actually fetch the event from relay
+   */
+  private fetchFromRelay(eventId: string): void {
+    // If no loader yet, schedule retry
+    if (!this.relayPool || !this.eventLoader) {
+      setTimeout(() => {
+        if (this.eventLoader && this.pendingRequests.has(eventId)) {
+          this.fetchFromRelay(eventId)
+        }
+      }, 500)
+      return
+    }
+    
+    let delivered = false
+    const subscription = this.eventLoader({ id: eventId }).subscribe({
+      next: (event: NostrEvent) => {
+        delivered = true
+        clearTimeout(timeoutId)
+        this.resolvePending(eventId, event)
+        subscription.unsubscribe()
+      },
+      error: (err: unknown) => {
+        clearTimeout(timeoutId)
+        const error = err instanceof Error ? err : new Error(String(err))
+        this.rejectPending(eventId, error)
+        subscription.unsubscribe()
+      },
+      complete: () => {
+        // Completed without next - consider not found
+        if (!delivered) {
+          clearTimeout(timeoutId)
+          this.rejectPending(eventId, new Error('Event not found'))
+        }
+        subscription.unsubscribe()
+      }
+    })
+    
+    // Safety timeout
+    const timeoutId = setTimeout(() => {
+      if (!delivered) {
+        this.rejectPending(eventId, new Error('Timed out fetching event'))
+        subscription.unsubscribe()
+      }
+    }, this.fetchTimeoutMs)
+  }
+  
+  /**
+   * Retry all pending requests after relay pool becomes available
+   */
+  private retryAllPending(): void {
+    const pendingIds = Array.from(this.pendingRequests.keys())
+    pendingIds.forEach(eventId => {
+      this.fetchFromRelay(eventId)
+    })
+  }
+}
+
+// Singleton instance
+export const eventManager = new EventManager()

src/services/exploreService.ts

@@ -1,6 +1,6 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
-import { Helpers } from 'applesauce-core'
+import { Helpers, IEventStore } from 'applesauce-core'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
 
@@ -22,6 +22,7 @@ export interface BlogPostPreview {
  * @param relayUrls - Array of relay URLs to query
  * @param onPost - Optional callback for streaming posts
  * @param limit - Limit for number of events to fetch (default: 100, pass null for no limit)
+ * @param eventStore - Optional event store to persist fetched events
  * @returns Array of blog post previews
  */
 export const fetchBlogPostsFromAuthors = async (
@@ -29,7 +30,8 @@ export const fetchBlogPostsFromAuthors = async (
   pubkeys: string[],
   relayUrls: string[],
   onPost?: (post: BlogPostPreview) => void,
-  limit: number | null = 100
+  limit: number | null = 100,
+  eventStore?: IEventStore
 ): Promise<BlogPostPreview[]> => {
   try {
     if (pubkeys.length === 0) {
@@ -45,12 +47,17 @@ export const fetchBlogPostsFromAuthors = async (
       ? { kinds: [KINDS.BlogPost], authors: pubkeys, limit }
       : { kinds: [KINDS.BlogPost], authors: pubkeys }
 
-    await queryEvents(
+    const events = await queryEvents(
       relayPool,
       filter,
       {
         relayUrls,
         onEvent: (event: NostrEvent) => {
+          // Store in event store immediately if provided
+          if (eventStore) {
+            eventStore.add(event)
+          }
+
           const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
           const key = `${event.pubkey}:${dTag}`
           const existing = uniqueEvents.get(key)
@@ -73,6 +80,10 @@ export const fetchBlogPostsFromAuthors = async (
       }
     )
 
+    // Store all events in event store if provided (safety net for any missed during streaming)
+    if (eventStore) {
+      events.forEach(evt => eventStore.add(evt))
+    }
     
     // Convert to blog post previews and sort by published date (most recent first)
     const blogPosts: BlogPostPreview[] = Array.from(uniqueEvents.values())

src/services/libraryService.ts

@@ -1,7 +1,6 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { Helpers } from 'applesauce-core'
-import { RELAYS } from '../config/relays'
 import { KINDS } from '../config/kinds'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { BlogPostPreview } from './exploreService'
@@ -30,8 +29,8 @@ export async function fetchReadArticles(
   try {
     // Fetch kind:7 and kind:17 reactions in parallel
     const [kind7Events, kind17Events] = await Promise.all([
-      queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }, { relayUrls: RELAYS }),
-      queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] }, { relayUrls: RELAYS })
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }),
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] })
     ])
 
     const readArticles: ReadArticle[] = []
@@ -115,8 +114,7 @@ export async function fetchReadArticlesWithData(
     
     const articleEvents = await queryEvents(
       relayPool,
-      { kinds: [KINDS.BlogPost], ids: eventIds },
-      { relayUrls: RELAYS }
+      { kinds: [KINDS.BlogPost], ids: eventIds }
     )
 
     // Deduplicate article events by ID

src/services/reactionService.ts

@@ -2,8 +2,8 @@ import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
 import { IAccount } from 'applesauce-accounts'
 import { NostrEvent } from 'nostr-tools'
 import { lastValueFrom, takeUntil, timer, toArray } from 'rxjs'
-import { RELAYS } from '../config/relays'
 import { EventFactory } from 'applesauce-factory'
+import { getActiveRelayUrls } from './relayManager'
 
 const ARCHIVE_EMOJI = '📚'
 
@@ -35,7 +35,6 @@ export async function createEventReaction(
   ]
   if (options?.aCoord) {
     tags.push(['a', options.aCoord])
-    console.log('[archive] createEventReaction add a-tag:', options.aCoord)
   }
 
   const draft = await factory.create(async () => ({
@@ -49,7 +48,7 @@ export async function createEventReaction(
 
 
   // Publish to relays
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
 
 
   return signed
@@ -99,7 +98,7 @@ export async function createWebsiteReaction(
 
 
   // Publish to relays
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
 
 
   return signed
@@ -122,7 +121,7 @@ export async function deleteReaction(
     created_at: Math.floor(Date.now() / 1000)
   }))
   const signed = await factory.sign(draft)
-  await relayPool.publish(RELAYS, signed)
+  await relayPool.publish(getActiveRelayUrls(relayPool), signed)
   return signed
 }
 
@@ -146,7 +145,7 @@ export async function hasMarkedEventAsRead(
     }
 
     const events$ = relayPool
-      .req(RELAYS, filter)
+      .req(getActiveRelayUrls(relayPool), filter)
       .pipe(
         onlyEvents(),
         completeOnEose(),
@@ -199,7 +198,7 @@ export async function hasMarkedWebsiteAsRead(
     }
 
     const events$ = relayPool
-      .req(RELAYS, filter)
+      .req(getActiveRelayUrls(relayPool), filter)
       .pipe(
         onlyEvents(),
         completeOnEose(),

src/services/readingProgressController.ts

@@ -3,13 +3,11 @@ import { IEventStore } from 'applesauce-core'
 import { NostrEvent } from 'nostr-tools'
 import { queryEvents } from './dataFetch'
 import { KINDS } from '../config/kinds'
-import { RELAYS } from '../config/relays'
 import { processReadingProgress } from './readingDataProcessor'
 import { ReadItem } from './readsService'
 import { ARCHIVE_EMOJI } from './reactionService'
 import { nip19 } from 'nostr-tools'
 
-console.log('[readingProgress] Module loaded')
 
 type ProgressMapCallback = (progressMap: Map<string, number>) => void
 type LoadingCallback = (loading: boolean) => void
@@ -176,17 +174,14 @@ class ReadingProgressController {
     const { relayPool, eventStore, pubkey, force = false } = params
     const startGeneration = this.generation
 
-    console.log('[readingProgress] start() called for pubkey:', pubkey.slice(0, 16), '...', 'force:', force)
 
     // Skip if already loaded for this pubkey and not forcing
     if (!force && this.isLoadedFor(pubkey)) {
-      console.log('[readingProgress] Already loaded for pubkey, skipping')
       return
     }
 
     // Prevent concurrent starts
     if (this.isLoading) {
-      console.log('[readingProgress] Already loading, skipping concurrent start')
       return
     }
 
@@ -212,7 +207,6 @@ class ReadingProgressController {
         this.timelineSubscription = null
       }
 
-      console.log('[readingProgress] Setting up eventStore subscription...')
       const timeline$ = eventStore.timeline({
         kinds: [KINDS.ReadingProgress],
         authors: [pubkey]
@@ -223,20 +217,17 @@ class ReadingProgressController {
         if (!Array.isArray(localEvents) || localEvents.length === 0) return
         this.processEvents(localEvents)
       })
-      console.log('[readingProgress] EventStore subscription ready - updates streaming')
 
       // Mark as loaded immediately - queries run in background non-blocking
       this.lastLoadedPubkey = pubkey
 
       // Query reading progress from relays in background (non-blocking, fire-and-forget)
-      console.log('[readingProgress] Starting background relay query for reading progress...')
       queryEvents(relayPool, {
         kinds: [KINDS.ReadingProgress],
         authors: [pubkey]
-      }, { relayUrls: RELAYS })
+      })
         .then((relayEvents) => {
           if (startGeneration !== this.generation) return
-          console.log('[readingProgress] Got reading progress from relays:', relayEvents.length)
           if (relayEvents.length > 0) {
             relayEvents.forEach(e => eventStore.add(e))
             this.processEvents(relayEvents)
@@ -249,10 +240,8 @@ class ReadingProgressController {
         })
 
       // Load mark-as-read reactions in background (non-blocking, streaming)
-      console.log('[readingProgress] Starting background relay query for mark-as-read reactions...')
       this.loadMarkAsReadReactions(relayPool, eventStore, pubkey, startGeneration)
         .then(() => {
-          console.log('[readingProgress] Mark-as-read reactions loading complete')
         })
         .catch((err) => {
           console.warn('[readingProgress] Mark-as-read reactions loading failed:', err)
@@ -265,9 +254,6 @@ class ReadingProgressController {
         this.setLoading(false)
       }
       this.isLoading = false
-      console.log('[readingProgress] === LOADED ===')
-      console.log('[readingProgress] progressMap keys:', Array.from(this.currentProgressMap.keys()))
-      console.log('[readingProgress] markedAsReadIds:', Array.from(this.markedAsReadIds))
     }
   }
 
@@ -318,7 +304,6 @@ class ReadingProgressController {
   ): Promise<void> {
     try {
       // Stream kind:17 (URL reactions) and kind:7 (event reactions) in parallel
-      console.log('[readingProgress] Querying kind:17 and kind:7 reactions (streaming)...')
       const seenReactionIds = new Set<string>()
 
       const handleUrlReaction = (evt: NostrEvent) => {
@@ -343,8 +328,8 @@ class ReadingProgressController {
 
       // Fire queries with onEvent callbacks for streaming behavior
       const [kind17Events, kind7Events] = await Promise.all([
-        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleUrlReaction }),
-        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { relayUrls: RELAYS, onEvent: handleEventReaction })
+        queryEvents(relayPool, { kinds: [17], authors: [pubkey] }, { onEvent: handleUrlReaction }),
+        queryEvents(relayPool, { kinds: [7], authors: [pubkey] }, { onEvent: handleEventReaction })
       ])
 
       if (generation !== this.generation) return
@@ -356,7 +341,7 @@ class ReadingProgressController {
       if (pendingEventIds.size > 0) {
         // Fetch referenced 30023 events, streaming not required here
         const ids = Array.from(pendingEventIds)
-        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids }, { relayUrls: RELAYS })
+        const articleEvents = await queryEvents(relayPool, { kinds: [KINDS.BlogPost], ids })
         const eventIdToNaddr = new Map<string, string>()
         for (const article of articleEvents) {
           const dTag = article.tags.find(t => t[0] === 'd')?.[1]
@@ -379,7 +364,6 @@ class ReadingProgressController {
         this.emitMarkedAsReadChanged()
       }
 
-      console.log('[readingProgress] Mark-as-read reactions complete. Total:', Array.from(this.markedAsReadIds).length)
     } catch (err) {
       console.warn('[readingProgress] Failed to load mark-as-read reactions:', err)
     }

src/services/readsService.ts

@@ -3,7 +3,6 @@ import { Helpers } from 'applesauce-core'
 import { Bookmark } from '../types/bookmarks'
 import { fetchReadArticles } from './libraryService'
 import { queryEvents } from './dataFetch'
-import { RELAYS } from '../config/relays'
 import { KINDS } from '../config/kinds'
 import { classifyBookmarkType } from '../utils/bookmarkTypeClassifier'
 import { nip19 } from 'nostr-tools'
@@ -44,7 +43,7 @@ export async function fetchAllReads(
   try {
     // Fetch all data sources in parallel
     const [progressEvents, markedAsReadArticles] = await Promise.all([
-      queryEvents(relayPool, { kinds: [KINDS.ReadingProgress], authors: [userPubkey] }, { relayUrls: RELAYS }),
+      queryEvents(relayPool, { kinds: [KINDS.ReadingProgress], authors: [userPubkey] }),
       fetchReadArticles(relayPool, userPubkey)
     ])
 
@@ -130,8 +129,7 @@ export async function fetchAllReads(
         
         const events = await queryEvents(
           relayPool,
-          { kinds: [KINDS.BlogPost], authors, '#d': identifiers },
-          { relayUrls: RELAYS }
+          { kinds: [KINDS.BlogPost], authors, '#d': identifiers }
         )
 
         // Merge event data into ReadItems and emit

src/services/relayListService.ts

@@ -0,0 +1,180 @@
+import { RelayPool } from 'applesauce-relay'
+import { NostrEvent } from 'nostr-tools'
+import { queryEvents } from './dataFetch'
+
+export interface UserRelayInfo {
+  url: string
+  mode?: 'read' | 'write' | 'both'
+}
+
+/**
+ * Loads user's relay list from kind 10002 (NIP-65)
+ */
+export async function loadUserRelayList(
+  relayPool: RelayPool,
+  pubkey: string,
+  options?: {
+    onUpdate?: (relays: UserRelayInfo[]) => void
+  }
+): Promise<UserRelayInfo[]> {
+  try {
+    
+    
+    // Try querying with streaming callback for faster results
+    const events: NostrEvent[] = []
+    const eventsMap = new Map<string, NostrEvent>()
+    
+    const result = await queryEvents(relayPool, {
+      kinds: [10002],
+      authors: [pubkey],
+      limit: 10
+    }, {
+      onEvent: (evt) => {
+        // Deduplicate by id and keep most recent
+        const existing = eventsMap.get(evt.id)
+        if (!existing || evt.created_at > existing.created_at) {
+          eventsMap.set(evt.id, evt)
+          // Update events array with deduplicated events
+          events.length = 0
+          events.push(...Array.from(eventsMap.values()))
+
+          // Stream immediate updates to caller using the newest event
+          if (options?.onUpdate) {
+            const tags = evt.tags || []
+            const relays: UserRelayInfo[] = []
+            for (const tag of tags) {
+              if (tag[0] === 'r' && tag[1]) {
+                const url = tag[1]
+                const mode = (tag[2] as 'read' | 'write' | undefined) || 'both'
+                relays.push({ url, mode })
+              }
+            }
+            if (relays.length > 0) {
+              options.onUpdate(relays)
+            }
+          }
+        }
+      }
+    })
+    
+    // Use the streaming results if we got any, otherwise fall back to the full result
+    const finalEvents = events.length > 0 ? events : result
+    
+    // Also try a broader query to see if we get any events at all
+    await queryEvents(relayPool, {
+      kinds: [10002],
+      limit: 5
+    })
+    
+    
+
+    if (finalEvents.length === 0) return []
+
+    // Get most recent event
+    const sortedEvents = finalEvents.sort((a, b) => b.created_at - a.created_at)
+    const relayListEvent = sortedEvents[0]
+
+    const relays: UserRelayInfo[] = []
+    for (const tag of relayListEvent.tags) {
+      if (tag[0] === 'r' && tag[1]) {
+        const url = tag[1]
+        const mode = tag[2] as 'read' | 'write' | undefined
+        relays.push({
+          url,
+          mode: mode || 'both'
+        })
+      }
+    }
+
+    return relays
+  } catch (error) {
+    console.error('Failed to load user relay list:', error)
+    return []
+  }
+}
+
+/**
+ * Loads blocked relays from kind 10006 (NIP-51 mute list)
+ */
+export async function loadBlockedRelays(
+  relayPool: RelayPool,
+  pubkey: string
+): Promise<string[]> {
+  try {
+    const events = await queryEvents(relayPool, {
+      kinds: [10006],
+      authors: [pubkey]
+    })
+
+    if (events.length === 0) return []
+
+    // Get most recent event
+    const sortedEvents = events.sort((a, b) => b.created_at - a.created_at)
+    const muteListEvent = sortedEvents[0]
+
+    const blocked: string[] = []
+    for (const tag of muteListEvent.tags) {
+      if (tag[0] === 'r' && tag[1]) {
+        blocked.push(tag[1])
+      }
+    }
+
+    return blocked
+  } catch (error) {
+    console.error('Failed to load blocked relays:', error)
+    return []
+  }
+}
+
+/**
+ * Computes final relay set by merging inputs and removing blocked relays
+ */
+export function computeRelaySet(params: {
+  hardcoded: string[]
+  bunker?: string[]
+  userList?: UserRelayInfo[]
+  blocked?: string[]
+  alwaysIncludeLocal: string[]
+}): string[] {
+  const {
+    hardcoded,
+    bunker = [],
+    userList = [],
+    blocked = [],
+    alwaysIncludeLocal
+  } = params
+
+  const relaySet = new Set<string>()
+  const blockedSet = new Set(blocked)
+
+  // Helper to check if relay should be included
+  const shouldInclude = (url: string): boolean => {
+    // Always include local relays
+    if (alwaysIncludeLocal.includes(url)) return true
+    // Otherwise check if blocked
+    return !blockedSet.has(url)
+  }
+
+  // Add hardcoded relays
+  for (const url of hardcoded) {
+    if (shouldInclude(url)) relaySet.add(url)
+  }
+
+  // Add bunker relays
+  for (const url of bunker) {
+    if (shouldInclude(url)) relaySet.add(url)
+  }
+
+  // Add user relays (treating 'both' and 'read' as applicable for queries)
+  for (const relay of userList) {
+    if (shouldInclude(relay.url)) relaySet.add(relay.url)
+  }
+
+  // Always ensure local relays are present
+  for (const url of alwaysIncludeLocal) {
+    relaySet.add(url)
+  }
+
+  return Array.from(relaySet)
+}
+

src/services/relayManager.ts

@@ -0,0 +1,91 @@
+import { RelayPool } from 'applesauce-relay'
+import { prioritizeLocalRelays } from '../utils/helpers'
+
+/**
+ * Local relays that are always included
+ */
+export const ALWAYS_LOCAL_RELAYS = [
+  'ws://localhost:10547',
+  'ws://localhost:4869'
+]
+
+/**
+ * Hardcoded relays that are always included
+ */
+export const HARDCODED_RELAYS = [
+  'wss://relay.nostr.band'
+]
+
+/**
+ * Gets active relay URLs from the relay pool
+ */
+export function getActiveRelayUrls(relayPool: RelayPool): string[] {
+  const urls = Array.from(relayPool.relays.keys())
+  return prioritizeLocalRelays(urls)
+}
+
+/**
+ * Normalizes a relay URL to match what applesauce-relay stores internally
+ * Adds trailing slash for URLs without a path
+ */
+function normalizeRelayUrl(url: string): string {
+  try {
+    const parsed = new URL(url)
+    // If the pathname is empty or just "/", ensure it ends with "/"
+    if (parsed.pathname === '' || parsed.pathname === '/') {
+      return url.endsWith('/') ? url : url + '/'
+    }
+    return url
+  } catch {
+    // If URL parsing fails, return as-is
+    return url
+  }
+}
+
+/**
+ * Applies a new relay set to the pool: adds missing relays, removes extras
+ */
+export function applyRelaySetToPool(
+  relayPool: RelayPool,
+  finalUrls: string[]
+): void {
+  // Normalize all URLs to match pool's internal format
+  const currentUrls = new Set(Array.from(relayPool.relays.keys()))
+  const normalizedTargetUrls = new Set(finalUrls.map(normalizeRelayUrl))
+
+  
+
+  // Add new relays (use original URLs for adding, not normalized)
+  const toAdd = finalUrls.filter(url => !currentUrls.has(normalizeRelayUrl(url)))
+  
+  if (toAdd.length > 0) {
+    relayPool.group(toAdd)
+  }
+
+  // Remove relays not in target (but always keep local relays)
+  const toRemove: string[] = []
+  for (const url of currentUrls) {
+    // Check if this normalized URL is in the target set
+    if (!normalizedTargetUrls.has(url)) {
+      // Also check if it's a local relay (check both normalized and original forms)
+      const isLocal = ALWAYS_LOCAL_RELAYS.some(localUrl => 
+        normalizeRelayUrl(localUrl) === url || localUrl === url
+      )
+      if (!isLocal) {
+        toRemove.push(url)
+      }
+    }
+  }
+  
+
+  for (const url of toRemove) {
+    const relay = relayPool.relays.get(url)
+    if (relay) {
+      relay.close()
+      relayPool.relays.delete(url)
+    }
+  }
+  
+  
+}
+

src/services/settingsService.ts

@@ -58,11 +58,21 @@ export interface UserSettings {
   lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
   // Reading settings
   paragraphAlignment?: 'left' | 'justify' // default: justify
+  fullWidthImages?: boolean // default: false
+  renderVideoLinksAsEmbeds?: boolean // default: false
   // Reading position sync
   syncReadingPosition?: boolean // default: false (opt-in)
   autoMarkAsReadOnCompletion?: boolean // default: false (opt-in)
   // Bookmark filtering
   hideBookmarksWithoutCreationDate?: boolean // default: false
+  // Content filtering
+  hideBotArticlesByName?: boolean // default: true - hide authors whose profile name includes "bot"
+  // TTS language selection
+  ttsUseSystemLanguage?: boolean // default: false
+  ttsDetectContentLanguage?: boolean // default: true
+  ttsLanguageMode?: 'system' | 'content' | string // default: 'content', can also be language code like 'en', 'es', etc.
+  // Text-to-Speech settings
+  ttsDefaultSpeed?: number // default: 2.1
 }
 
 export async function loadSettings(

src/services/writeService.ts

@@ -1,9 +1,9 @@
 import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { IEventStore } from 'applesauce-core'
-import { RELAYS } from '../config/relays'
 import { isLocalRelay, areAllRelaysLocal } from '../utils/helpers'
 import { markEventAsOfflineCreated } from './offlineSyncService'
+import { getActiveRelayUrls } from './relayManager'
 
 /**
  * Unified write helper: add event to EventStore, detect connectivity, 
@@ -27,10 +27,13 @@ export async function publishEvent(
 
   const hasRemoteConnection = connectedRelays.some(url => !isLocalRelay(url))
 
+  // Get active relay URLs from the pool
+  const activeRelays = getActiveRelayUrls(relayPool)
+
   // Determine which relays we expect to succeed
   const expectedSuccessRelays = hasRemoteConnection
-    ? RELAYS
-    : RELAYS.filter(isLocalRelay)
+    ? activeRelays
+    : activeRelays.filter(isLocalRelay)
 
   const isLocalOnly = areAllRelaysLocal(expectedSuccessRelays)
 
@@ -42,7 +45,7 @@ export async function publishEvent(
   }
 
   // Publish to all configured relays in the background (non-blocking)
-  relayPool.publish(RELAYS, event)
+  relayPool.publish(activeRelays, event)
     .then(() => {
     })
     .catch((error) => {

src/styles/components/forms.css

@@ -43,7 +43,7 @@
   word-wrap: break-word;
   text-align: var(--paragraph-alignment, justify);
 }
-.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
+.setting-select { width: 100%; padding: 0.5rem 1.75rem 0.5rem 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
 .setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
 .setting-select:focus { outline: none; border-color: var(--color-primary); }
 .font-select option { padding: 0.5rem; font-size: 1rem; }

src/styles/components/login.css

@@ -29,7 +29,7 @@
 
 .login-highlight {
   background-color: var(--highlight-color-mine, #fde047);
-  color: var(--color-text);
+  color: #000000;
   padding: 0.125rem 0.25rem;
   border-radius: 3px;
   font-weight: 500;

src/styles/components/reader.css

@@ -14,12 +14,12 @@
 /* Video container - responsive wrapper following react-player docs */
 .reader-video { 
   position: relative;
-  width: 80vw;  /* 80% of viewport width */
-  min-width: 400px;  /* Minimum width */
-  max-width: 1000px;   /* Maximum width */
+  width: 100%;
+  max-width: 100%;
   aspect-ratio: 16/9;
-  margin: 0 -0.75rem 1rem -0.75rem; /* Negative margins to counteract reader padding */
+  margin: 0 0 1rem 0; /* align with reader padding, no bleed */
   background: rgb(0 0 0); /* black */
+  overflow: hidden;
 }
 .reader.empty { color: var(--color-text-secondary); }
 .loading-spinner { display: flex; align-items: center; gap: 0.5rem; color: var(--color-text-secondary); }
@@ -54,7 +54,15 @@
 .reader .reader-html h1, .reader .reader-html h2, .reader .reader-html h3, .reader .reader-html h4, .reader .reader-html h5, .reader .reader-html h6,
 .reader .reader-markdown h1, .reader .reader-markdown h2, .reader .reader-markdown h3, .reader .reader-markdown h4, .reader .reader-markdown h5, .reader .reader-markdown h6 { text-align: left !important; }
 /* Tame images from external content */
-.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
+.reader .reader-html img, .reader .reader-markdown img { 
+  max-width: var(--image-max-width, 100%); 
+  max-height: 70vh; 
+  height: auto; 
+  width: auto; 
+  display: block; 
+  margin: 0.75rem auto; 
+  border-radius: 6px; 
+}
 /* Headlines with Tailwind typography */
 .reader-markdown h1, .reader-html h1 { 
   font-size: 2.25rem; /* text-4xl */

src/sw.ts

@@ -98,10 +98,42 @@ sw.addEventListener('message', (event: ExtendableMessageEvent) => {
   }
 })
 
-// Log fetch errors for debugging (doesn't affect functionality)
+// Handle Web Share Target POST requests
 sw.addEventListener('fetch', (event: FetchEvent) => {
   const url = new URL(event.request.url)
   
+  // Handle POST to /share-target (Web Share Target API)
+  if (event.request.method === 'POST' && url.pathname === '/share-target') {
+    event.respondWith((async () => {
+      const formData = await event.request.formData()
+      const title = (formData.get('title') || '').toString()
+      const text = (formData.get('text') || '').toString()
+      // Accept multiple possible field names just in case different casings are used
+      let link = (
+        formData.get('link') ||
+        formData.get('Link') ||
+        formData.get('url') ||
+        ''
+      ).toString()
+      
+      // Android often omits url param, extract from text
+      if (!link && text) {
+        const urlMatch = text.match(/https?:\/\/[^\s]+/)
+        if (urlMatch) {
+          link = urlMatch[0]
+        }
+      }
+      
+      const queryParams = new URLSearchParams()
+      if (link) queryParams.set('link', link)
+      if (title) queryParams.set('title', title)
+      if (text) queryParams.set('text', text)
+      
+      return Response.redirect(`/share-target?${queryParams.toString()}`, 303)
+    })())
+    return
+  }
+  
   // Don't interfere with WebSocket connections (relay traffic)
   if (url.protocol === 'ws:' || url.protocol === 'wss:') {
     return

src/utils/bookmarkUtils.tsx

@@ -2,7 +2,7 @@ import React from 'react'
 import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
 import { ParsedContent, ParsedNode, IndividualBookmark } from '../types/bookmarks'
 import ResolvedMention from '../components/ResolvedMention'
-// Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
+// Note: RichContent is imported by components directly to keep this file component-only for fast refresh
 
 export const formatDate = (timestamp: number) => {
   const date = new Date(timestamp * 1000)

vite.config.ts

@@ -114,6 +114,17 @@ export default defineConfig({
         background_color: '#0b1220',
         orientation: 'any',
         categories: ['productivity', 'social', 'utilities'],
+        // Web Share Target configuration so the installed PWA shows up in the system share sheet
+        share_target: {
+          action: '/share-target',
+          method: 'POST',
+          enctype: 'multipart/form-data',
+          params: {
+            title: 'title',
+            text: 'text',
+            url: 'link'
+          }
+        },
         icons: [
           { src: '/icon-192.png', sizes: '192x192', type: 'image/png' },
           { src: '/icon-512.png', sizes: '512x512', type: 'image/png' },