mirror of
https://github.com/dergigi/boris.git
synced 2026-02-23 07:54:59 +01:00
Compare commits
452 Commits
v0.6.9
...
bunker-enc
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
2c3aff0407 | ||
|
|
aad35d41db | ||
|
|
cc6189a5d9 | ||
|
|
18bf8f9a2c | ||
|
|
37f3a32a1c | ||
|
|
c9678564a5 | ||
|
|
721c18c509 | ||
|
|
9e30fe683b | ||
|
|
7fff50c146 | ||
|
|
fc1c845b67 | ||
|
|
c2ec1f3677 | ||
|
|
0cbd357856 | ||
|
|
26ea9ed547 | ||
|
|
9cbbecb32c | ||
|
|
db12c89731 | ||
|
|
6f413deb90 | ||
|
|
0127e2dc86 | ||
|
|
7743928702 | ||
|
|
bf76150fc1 | ||
|
|
c62107172b | ||
|
|
a253587dfa | ||
|
|
1938533d53 | ||
|
|
28943c55bd | ||
|
|
791bbb68b6 | ||
|
|
ec8adcc794 | ||
|
|
68058e7661 | ||
|
|
416c62369c | ||
|
|
a19dd53423 | ||
|
|
79ec33b79a | ||
|
|
be881b957c | ||
|
|
244872e9f2 | ||
|
|
1397f7f0f4 | ||
|
|
96424dd65c | ||
|
|
9efc5459fb | ||
|
|
7e02168e54 | ||
|
|
f8e6b3e828 | ||
|
|
c06176bfc9 | ||
|
|
e2a1701000 | ||
|
|
d7703ceef4 | ||
|
|
93daabc673 | ||
|
|
9264245944 | ||
|
|
f56423040b | ||
|
|
4b91504a50 | ||
|
|
1f0f7fef5e | ||
|
|
6aced653fb | ||
|
|
0899482869 | ||
|
|
1bdfa1e6e1 | ||
|
|
f22a8f15c0 | ||
|
|
bf6394fc7d | ||
|
|
6f08586e8f | ||
|
|
d60a4a24ad | ||
|
|
51069f3623 | ||
|
|
1407af22e3 | ||
|
|
ea6220277d | ||
|
|
fbffa03dad | ||
|
|
a74760d804 | ||
|
|
c4b0a712d2 | ||
|
|
1fecf9c7f4 | ||
|
|
7be21203d9 | ||
|
|
f65f2c6597 | ||
|
|
227def4328 | ||
|
|
b506624f57 | ||
|
|
fbb6a0a153 | ||
|
|
528de32689 | ||
|
|
230e5380ca | ||
|
|
349237d097 | ||
|
|
d4df9f0424 | ||
|
|
2f68e84002 | ||
|
|
b18dcc29cd | ||
|
|
680169e312 | ||
|
|
11753c4515 | ||
|
|
bd29dfd65f | ||
|
|
4b1ae838e5 | ||
|
|
85599d3103 | ||
|
|
4603c5a258 | ||
|
|
ec45fbc5e8 | ||
|
|
53400334b2 | ||
|
|
af4ff7081a | ||
|
|
7f21b8ed76 | ||
|
|
55e44dcc9c | ||
|
|
59dac947ab | ||
|
|
7d33c3c024 | ||
|
|
38a014ef84 | ||
|
|
f451348430 | ||
|
|
685aaf43b0 | ||
|
|
d6a20b5272 | ||
|
|
d8d7a19fa1 | ||
|
|
63626fae3a | ||
|
|
de09ef2935 | ||
|
|
bcb28a63a7 | ||
|
|
a479903ce3 | ||
|
|
567d105261 | ||
|
|
83743c5a9f | ||
|
|
0b8f88ea1d | ||
|
|
fadc755930 | ||
|
|
f67f171e64 | ||
|
|
449c59015e | ||
|
|
4d697e6a79 | ||
|
|
04ae70873a | ||
|
|
2f8a64826a | ||
|
|
11cb3542ee | ||
|
|
905296621c | ||
|
|
769484bc0d | ||
|
|
27ff4cef22 | ||
|
|
a352e2616e | ||
|
|
77cbb9394f | ||
|
|
39c8b3dfe4 | ||
|
|
7bd11e695e | ||
|
|
a76b703d36 | ||
|
|
df51173405 | ||
|
|
a79d7f9eaf | ||
|
|
1032a46456 | ||
|
|
ae997758ab | ||
|
|
91a827324d | ||
|
|
bf849c9faa | ||
|
|
118ab46ac0 | ||
|
|
d2f2b689f9 | ||
|
|
5229e45566 | ||
|
|
b17043e85d | ||
|
|
19ca909ef5 | ||
|
|
f7ff309b6e | ||
|
|
ea5a8486b9 | ||
|
|
58897b3436 | ||
|
|
6a59ecfa47 | ||
|
|
272066c6e0 | ||
|
|
0426c9d3b0 | ||
|
|
c22419ba0e | ||
|
|
8278fed2fb | ||
|
|
b24a65b490 | ||
|
|
fb509fabd8 | ||
|
|
d21285123f | ||
|
|
1029b6be0c | ||
|
|
3fff9455a1 | ||
|
|
8c6232e029 | ||
|
|
f6c562e9be | ||
|
|
a92b14e877 | ||
|
|
b69a956247 | ||
|
|
82a8dcf6eb | ||
|
|
8e19e22289 | ||
|
|
e167b57810 | ||
|
|
ba3b82e6b5 | ||
|
|
b5edfbb2c9 | ||
|
|
48048f877a | ||
|
|
bd1afc54c3 | ||
|
|
a2c4bed0f5 | ||
|
|
9bad49fe5f | ||
|
|
2aa6536496 | ||
|
|
bd6d8a0342 | ||
|
|
dc8e86bc57 | ||
|
|
32b843908e | ||
|
|
5a71480459 | ||
|
|
17455aa47b | ||
|
|
4cc32c27de | ||
|
|
99bfe209a5 | ||
|
|
0a28bfbd50 | ||
|
|
ba9fb109f6 | ||
|
|
ec9d2fcb49 | ||
|
|
f841043e03 | ||
|
|
94dc95e1f0 | ||
|
|
32a5145d8f | ||
|
|
a856e8ca26 | ||
|
|
d54306cf92 | ||
|
|
9fdb96b64e | ||
|
|
c50aa3a243 | ||
|
|
adef1a922c | ||
|
|
99df4d6761 | ||
|
|
5f6a414953 | ||
|
|
ed17a68986 | ||
|
|
bedf3daed1 | ||
|
|
2c913cf7e8 | ||
|
|
aff5bff03b | ||
|
|
e90f902f0b | ||
|
|
d763aa5f15 | ||
|
|
9d6b1f6f84 | ||
|
|
9eb2f35dbf | ||
|
|
5f33ad3ba0 | ||
|
|
3db4855532 | ||
|
|
3305be1da5 | ||
|
|
fe55e87496 | ||
|
|
f78f1a3460 | ||
|
|
e73d89739b | ||
|
|
7e2b4b46c9 | ||
|
|
fddf79e0c6 | ||
|
|
cf2098a723 | ||
|
|
5568437663 | ||
|
|
7bfd7fdf6c | ||
|
|
e6876d141f | ||
|
|
5bb81b3c22 | ||
|
|
1e8e58fa05 | ||
|
|
f44e36e4bf | ||
|
|
11c7564f8c | ||
|
|
a064376bd8 | ||
|
|
292e8e9bda | ||
|
|
951a3699ca | ||
|
|
860ec70b1c | ||
|
|
2b69c72939 | ||
|
|
b98d774cbf | ||
|
|
8972571a18 | ||
|
|
ab5d5dca58 | ||
|
|
e383356af1 | ||
|
|
165d10c49b | ||
|
|
e0869c436b | ||
|
|
95432fc276 | ||
|
|
1982d25fa8 | ||
|
|
2fc64b6028 | ||
|
|
6e8686a49d | ||
|
|
fd5ce80a06 | ||
|
|
ac4185e2cc | ||
|
|
9217077283 | ||
|
|
b7c14b5c7c | ||
|
|
9b3cc41770 | ||
|
|
4c4bd2214c | ||
|
|
93c31650f4 | ||
|
|
7f0d99fc29 | ||
|
|
eb6dbe1644 | ||
|
|
474da25f77 | ||
|
|
02eaa1c8f8 | ||
|
|
8800791723 | ||
|
|
6758b9678b | ||
|
|
63f58e010f | ||
|
|
85649ae283 | ||
|
|
d0b814e39d | ||
|
|
f4a227e40a | ||
|
|
6ef0a6dd71 | ||
|
|
5502d71ac4 | ||
|
|
5e1146b015 | ||
|
|
8f89165711 | ||
|
|
674634326f | ||
|
|
30eaec5770 | ||
|
|
0ff3c864a9 | ||
|
|
ab2ca1f5e7 | ||
|
|
cf2d227f61 | ||
|
|
2c9e6cc54e | ||
|
|
8da0a06711 | ||
|
|
be8d857223 | ||
|
|
d50bcd700e | ||
|
|
820ab1d902 | ||
|
|
f5e9e5bf61 | ||
|
|
40b43532e8 | ||
|
|
51a3008730 | ||
|
|
e30cbc72c3 | ||
|
|
6f913262f4 | ||
|
|
0f0462e6ac | ||
|
|
e353f0e2d6 | ||
|
|
ee1365d3ca | ||
|
|
a215d0b026 | ||
|
|
b8d76c0bd8 | ||
|
|
233169b082 | ||
|
|
72b9a04cd2 | ||
|
|
432715efb6 | ||
|
|
8b2b954dde | ||
|
|
c2d2bd8106 | ||
|
|
a5c3085c59 | ||
|
|
c0332f08d6 | ||
|
|
38a1d6caec | ||
|
|
39dd607e7b | ||
|
|
9dc0db3e06 | ||
|
|
b1eb58a385 | ||
|
|
f3c6404f76 | ||
|
|
1a42a6422d | ||
|
|
2e2de4ccda | ||
|
|
4325d3a519 | ||
|
|
51115c5f68 | ||
|
|
2aa6fe860b | ||
|
|
86f39eacf8 | ||
|
|
d15daef3ea | ||
|
|
281c70cdea | ||
|
|
d6d6087543 | ||
|
|
d06e38bc19 | ||
|
|
cfc8eb0bbc | ||
|
|
b85f9b79c3 | ||
|
|
1b0045c737 | ||
|
|
3dc8d7d440 | ||
|
|
bf9ca48d64 | ||
|
|
70441f3d59 | ||
|
|
431f28e861 | ||
|
|
3b1fc095c4 | ||
|
|
9a6c7a29d0 | ||
|
|
c1d173f40e | ||
|
|
f03ec5df8c | ||
|
|
6c74a12636 | ||
|
|
39797803d3 | ||
|
|
c66c1e928d | ||
|
|
f934b641bb | ||
|
|
1128a11603 | ||
|
|
9f90718918 | ||
|
|
067a07fc00 | ||
|
|
1811cf045e | ||
|
|
270b4f429f | ||
|
|
380acbb55f | ||
|
|
c384f0b4fb | ||
|
|
27cf393a03 | ||
|
|
8831726913 | ||
|
|
2f4327874c | ||
|
|
483845962e | ||
|
|
c44b1d6349 | ||
|
|
79f28a142d | ||
|
|
02dd537cd9 | ||
|
|
5af1f14a0b | ||
|
|
664f59a9cc | ||
|
|
7d3641aab7 | ||
|
|
7924df4c67 | ||
|
|
68a8eed4af | ||
|
|
887db84ce7 | ||
|
|
05348fbfeb | ||
|
|
38eb6716f8 | ||
|
|
d7f9cd30eb | ||
|
|
922d041e0e | ||
|
|
76f4588c85 | ||
|
|
e163b92a7e | ||
|
|
11925a42b0 | ||
|
|
acf45530ca | ||
|
|
3792ad6abf | ||
|
|
bf98b307e8 | ||
|
|
d15392f41e | ||
|
|
f26a024255 | ||
|
|
bf9f894c0d | ||
|
|
53a7b7d1c5 | ||
|
|
a12a883cc6 | ||
|
|
0cf076b010 | ||
|
|
e2c712033f | ||
|
|
e38237ca8e | ||
|
|
1fff44fc6c | ||
|
|
4e50073e07 | ||
|
|
0ce64fe83f | ||
|
|
ef848aa93e | ||
|
|
67b287d75d | ||
|
|
b795dfd2c6 | ||
|
|
c68d855983 | ||
|
|
fb1c19e64b | ||
|
|
384c16e29d | ||
|
|
789982bd76 | ||
|
|
8bccc9de48 | ||
|
|
ec8584b4d2 | ||
|
|
54bd59fa2d | ||
|
|
b19f5f55f7 | ||
|
|
0964f25f97 | ||
|
|
5f3e6335c1 | ||
|
|
f30c894c87 | ||
|
|
bec769ac1b | ||
|
|
cb3748e06f | ||
|
|
d5a24f0a46 | ||
|
|
401a8241bd | ||
|
|
2193a7a863 | ||
|
|
e6bc4d7fda | ||
|
|
aee9f73316 | ||
|
|
aef7b4cea4 | ||
|
|
c9a8a3b91e | ||
|
|
0c7b11bdf8 | ||
|
|
8c151a5855 | ||
|
|
9b54fa9c14 | ||
|
|
99d7705404 | ||
|
|
eaa590b8e2 | ||
|
|
715fd8cf10 | ||
|
|
99a9709605 | ||
|
|
65d330d5ed | ||
|
|
1d1d389a03 | ||
|
|
0392389355 | ||
|
|
cf2a500a07 | ||
|
|
7d3748202e | ||
|
|
d7f90faea9 | ||
|
|
cb0066aac9 | ||
|
|
b48397b7a6 | ||
|
|
82ab8419e3 | ||
|
|
142a2414d3 | ||
|
|
081bd95f60 | ||
|
|
300aed0589 | ||
|
|
b2b23c66cf | ||
|
|
838bb6aa3d | ||
|
|
f14ecc5acb | ||
|
|
d533e23dc0 | ||
|
|
eefcf99364 | ||
|
|
1c0790bfb6 | ||
|
|
29e351ba78 | ||
|
|
7592c5c327 | ||
|
|
f5018204ab | ||
|
|
7ae74268fd | ||
|
|
52e959a7f5 | ||
|
|
4f03a2c276 | ||
|
|
bc4c96ee35 | ||
|
|
a866040fc1 | ||
|
|
c90fad268a | ||
|
|
8ef1f775f9 | ||
|
|
90af87339c | ||
|
|
9007b1ca71 | ||
|
|
0b7e6145de | ||
|
|
bf1b608d96 | ||
|
|
7db0f2a05c | ||
|
|
165b4d4b9f | ||
|
|
a7106138c4 | ||
|
|
a498bfab38 | ||
|
|
3dd2980283 | ||
|
|
2e2a1a2c9d | ||
|
|
b9666bf037 | ||
|
|
ab1e964d3a | ||
|
|
1500744a96 | ||
|
|
394311622d | ||
|
|
c7f3991ddd | ||
|
|
e05efaa4f6 | ||
|
|
c96347a331 | ||
|
|
d721e84e42 | ||
|
|
dcbe4bd23e | ||
|
|
e11184426e | ||
|
|
ebea872c72 | ||
|
|
8e57d3d491 | ||
|
|
ca339ac0b2 | ||
|
|
abb6819c40 | ||
|
|
de314894ff | ||
|
|
2939747ebf | ||
|
|
a4548306e7 | ||
|
|
f16c1720a6 | ||
|
|
5b2ee94062 | ||
|
|
3091ad7fd4 | ||
|
|
5b7488295c | ||
|
|
bea62ddc4b | ||
|
|
44d6b1fb2a | ||
|
|
02ec8dd936 | ||
|
|
765ce0ac5e | ||
|
|
a1f7c3e34a | ||
|
|
2e5eb08b54 | ||
|
|
46a6d4fe0c | ||
|
|
84ea0df550 | ||
|
|
0f58b166ce | ||
|
|
f65d39023c | ||
|
|
0b3c7efbc1 | ||
|
|
ecb462562f | ||
|
|
c5a3d00371 | ||
|
|
d3b7a8ddde | ||
|
|
0eee203a9b | ||
|
|
cd5a95dea3 | ||
|
|
f348ddaf73 | ||
|
|
9f09093c80 | ||
|
|
490c6c9bdc | ||
|
|
4eb0ede76b | ||
|
|
02c1b6b783 | ||
|
|
9eed448da6 | ||
|
|
f8d621bcdc | ||
|
|
5cbe2246d3 | ||
|
|
f29a180cbd | ||
|
|
0ca3771906 | ||
|
|
6dab126f88 | ||
|
|
6c74d04984 | ||
|
|
1e00ff5e35 | ||
|
|
71fa334f61 | ||
|
|
d3ee995221 | ||
|
|
6812584b8c | ||
|
|
47ddf8ebe1 | ||
|
|
36897e7f15 | ||
|
|
f18315be02 | ||
|
|
38d77b02f5 | ||
|
|
5b77a93bba | ||
|
|
e1c11a7450 |
@@ -4,3 +4,5 @@ alwaysApply: false
|
|||||||
---
|
---
|
||||||
|
|
||||||
This is a mobile-first application. All UI elements should be designed with that in mind. The application should work well on small screens, including older smartphones. The UX should be immaculate on mobile, even when in flight mode. (We use local caches and local relays, so that app works offline too.)
|
This is a mobile-first application. All UI elements should be designed with that in mind. The application should work well on small screens, including older smartphones. The UX should be immaculate on mobile, even when in flight mode. (We use local caches and local relays, so that app works offline too.)
|
||||||
|
|
||||||
|
Let's not show too many error messages, and more importantly: let's not make them red. Nothing is ever this tragic.
|
||||||
|
|||||||
4
.gitignore
vendored
4
.gitignore
vendored
@@ -8,6 +8,8 @@ dist
|
|||||||
*.log
|
*.log
|
||||||
.DS_Store
|
.DS_Store
|
||||||
|
|
||||||
# Applesauce Reference
|
# Reference Projects
|
||||||
applesauce
|
applesauce
|
||||||
|
primal-web-app
|
||||||
|
Amber
|
||||||
|
|
||||||
|
|||||||
77
Amber.md
Normal file
77
Amber.md
Normal file
@@ -0,0 +1,77 @@
|
|||||||
|
## Boris ↔ Amber bunker: current findings
|
||||||
|
|
||||||
|
- **Environment**
|
||||||
|
- Client: Boris (web) using `applesauce` stack (`NostrConnectSigner`, `RelayPool`).
|
||||||
|
- Bunker: Amber (mobile).
|
||||||
|
- We restored a `nostr-connect` account from localStorage and re-wired the signer to the app `RelayPool` before use.
|
||||||
|
|
||||||
|
## What we changed client-side
|
||||||
|
|
||||||
|
- **Signer wiring**
|
||||||
|
- Bound `NostrConnectSigner.subscriptionMethod/publishMethod` to the app `RelayPool` at startup.
|
||||||
|
- After deserialization, recreated the signer with pool context and merged its relays with app `RELAYS` (includes local relays).
|
||||||
|
- Opened the signer subscription and performed a guarded `connect()` with default permissions including `nip04_encrypt/decrypt` and `nip44_encrypt/decrypt`.
|
||||||
|
|
||||||
|
- **Probes and timeouts**
|
||||||
|
- Initial probe tried `decrypt('invalid-ciphertext')` → timed out.
|
||||||
|
- Switched to roundtrip probes: `encrypt(self, ... )` then `decrypt(self, cipher)` for both nip-44 and nip-04.
|
||||||
|
- Increased probe timeout from 3s → 10s; increased bookmark decrypt timeout from 15s → 30s.
|
||||||
|
|
||||||
|
- **Logging**
|
||||||
|
- Added logs for publish/subscribe and parsed the NIP-46 request content length.
|
||||||
|
- Confirmed NIP‑46 request events are kind `24133` with a single `p` tag (expected). The method is inside the encrypted content, so it prints as `method: undefined` (expected).
|
||||||
|
|
||||||
|
## Evidence from logs (client)
|
||||||
|
|
||||||
|
```
|
||||||
|
[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription
|
||||||
|
[bunker] 🔗 Signer relays merged with app RELAYS: (19) [...]
|
||||||
|
[bunker] subscribe via signer: { relays: [...], filters: [...] }
|
||||||
|
[bunker] ✅ Signer subscription opened
|
||||||
|
[bunker] publish via signer: { relays: [...], kind: 24133, tags: [['p', <remote>]], contentLength: 260|304|54704 }
|
||||||
|
[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
|
||||||
|
[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
|
||||||
|
bookmarkProcessing.ts: ❌ nip44.decrypt failed: Decrypt timeout after 30000ms
|
||||||
|
bookmarkProcessing.ts: ❌ nip04.decrypt failed: Decrypt timeout after 30000ms
|
||||||
|
```
|
||||||
|
|
||||||
|
Notes:
|
||||||
|
- Final signer status shows `listening: true`, `isConnected: true`, and requests are published to 19 relays (includes Amber’s).
|
||||||
|
|
||||||
|
## Evidence from Amber (device)
|
||||||
|
|
||||||
|
- Activity screen shows multiple entries for: “Encrypt data using nip 4” and “Encrypt data using nip 44” with green checkmarks.
|
||||||
|
- No entries for “Decrypt data using nip 4” or “Decrypt data using nip 44”.
|
||||||
|
|
||||||
|
## Interpretation
|
||||||
|
|
||||||
|
- Transport and publish paths are working: Boris is publishing NIP‑46 requests (kind 24133) and Amber receives them (ENCRYPT activity visible).
|
||||||
|
- The persistent failure is specific to DECRYPT handling: Amber does not show any DECRYPT activity and Boris receives no decrypt responses within 10–30s windows.
|
||||||
|
- Client-side wiring is likely correct (subscription open, permissions requested, relays merged). The remaining issue appears provider-side in Amber’s NIP‑46 decrypt handling or permission gating.
|
||||||
|
|
||||||
|
## Repro steps (quick)
|
||||||
|
|
||||||
|
1) Revoke Boris in Amber.
|
||||||
|
2) Reconnect with a fresh bunker URI; approve signing and both encrypt/decrypt scopes for nip‑04 and nip‑44.
|
||||||
|
3) Keep Amber unlocked and foregrounded.
|
||||||
|
4) Reload Boris; observe:
|
||||||
|
- Logs showing `publish via signer` for kind 24133.
|
||||||
|
- In Amber, activity should include “Decrypt data using nip 4/44”.
|
||||||
|
|
||||||
|
If DECRYPT entries still don’t appear:
|
||||||
|
|
||||||
|
- This points to Amber’s NIP‑46 provider not executing/authorizing `nip04_decrypt`/`nip44_decrypt` methods, or not publishing responses.
|
||||||
|
|
||||||
|
## Suggestions for Amber-side debugging
|
||||||
|
|
||||||
|
- Verify permission gating allows `nip04_decrypt` and `nip44_decrypt` (not just encrypt).
|
||||||
|
- Confirm the provider recognizes NIP‑46 methods `nip04_decrypt` and `nip44_decrypt` in the decrypted payload and routes them to decrypt routines.
|
||||||
|
- Ensure the response event is published back to the same relays and correctly addressed to the client (`p` tag set and content encrypted back to client pubkey).
|
||||||
|
- Add activity logging for “Decrypt …” attempts and failures to surface denial/exception states.
|
||||||
|
|
||||||
|
## Current conclusion
|
||||||
|
|
||||||
|
- Client is configured and publishing requests correctly; encryption proves end‑to‑end path is alive.
|
||||||
|
- The missing DECRYPT activity in Amber is the blocker. Fixing Amber’s NIP‑46 decrypt handling should resolve bookmark decryption in Boris without further client changes.
|
||||||
|
|
||||||
|
|
||||||
484
CHANGELOG.md
484
CHANGELOG.md
@@ -7,6 +7,473 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
## [Unreleased]
|
## [Unreleased]
|
||||||
|
|
||||||
|
## [0.6.24] - 2025-01-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- TypeScript global declarations for build-time defines
|
||||||
|
- Added proper type declarations for `__APP_VERSION__`, `__GIT_COMMIT__`, `__GIT_BRANCH__`, `__BUILD_TIME__`, and `__GIT_COMMIT_URL__`
|
||||||
|
- Resolved ESLint no-undef errors for build-time injected variables
|
||||||
|
- Added Node.js environment hint to Vite configuration
|
||||||
|
|
||||||
|
## [0.6.23] - 2025-01-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Deep-link refresh redirect issue for nostr-native articles
|
||||||
|
- Limited `/a/:naddr` rewrite to bot user-agents only in Vercel configuration
|
||||||
|
- Real browsers now hit the SPA directly, preventing redirect to root path
|
||||||
|
- Bot crawlers still receive proper OpenGraph metadata for social sharing
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Version and git commit information in Settings footer
|
||||||
|
- Displays app version and short commit hash with link to GitHub
|
||||||
|
- Build-time metadata injection via Vite configuration
|
||||||
|
- Subtle footer styling with selectable text
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Article OG handler now uses proper RelayPool.request() API
|
||||||
|
- Aligned with applesauce RelayPool interface
|
||||||
|
- Removed deprecated open/close methods
|
||||||
|
- Fixed TypeScript linting errors
|
||||||
|
|
||||||
|
### Technical
|
||||||
|
|
||||||
|
- Added debug logging for route state and article OG handler
|
||||||
|
- Gated by `?debug=1` query parameter for production testing
|
||||||
|
- Structured logging for troubleshooting deep-link issues
|
||||||
|
- Temporary debug components for validation
|
||||||
|
|
||||||
|
## [0.6.22] - 2025-10-16
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Dynamic OpenGraph and Twitter Card meta tags for article deep-links
|
||||||
|
- Social media platforms display article title, author, cover image, and summary when sharing `/a/{naddr}` links
|
||||||
|
- Serverless endpoint fetches article metadata from Nostr relays (kind:30023) and author profiles (kind:0)
|
||||||
|
- User-agent detection serves appropriate content to crawlers vs browsers
|
||||||
|
- Falls back to default social preview image when articles have no cover image
|
||||||
|
- Social preview image for homepage and article links
|
||||||
|
- Added `boris-social-1200.png` as default OpenGraph image (1200x630)
|
||||||
|
- Homepage now includes social preview image in meta tags
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Article deep-links now properly preserve URL when loading in browser
|
||||||
|
- Uses `history.replaceState()` to maintain correct article path
|
||||||
|
- Browser navigation works correctly on refresh and new tab opens
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Vercel rewrite configuration for article routes
|
||||||
|
- Routes `/a/:naddr` to serverless OG endpoint for dynamic meta tags
|
||||||
|
- Regular SPA routing preserved for browser navigation
|
||||||
|
|
||||||
|
## [0.6.21] - 2025-10-16
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Reading position sync across devices using Nostr Kind 30078 (NIP-78)
|
||||||
|
- Automatically saves and syncs reading position as you scroll
|
||||||
|
- Visual reading progress indicator on article cards
|
||||||
|
- Reading progress shown in Explore and Bookmarks sidebar
|
||||||
|
- Auto-scroll to last reading position setting (configurable in Settings)
|
||||||
|
- Reading position displayed as colored progress bar on cards
|
||||||
|
- Reading progress filters for organizing articles
|
||||||
|
- Filter by reading state: Unopened, Started (0-10%), Reading (11-94%), Completed (95-100% or marked as read)
|
||||||
|
- Filter icons colored when active (blue for most, green for completed)
|
||||||
|
- URL routing support for reading progress filters
|
||||||
|
- Reading progress filters available in Archive tab and bookmarks sidebar
|
||||||
|
- Reads and Links tabs on `/me` page
|
||||||
|
- Reads tab shows nostr-native articles with reading progress
|
||||||
|
- Links tab shows external URLs with reading progress
|
||||||
|
- Both tabs populate instantly from bookmarks for fast loading
|
||||||
|
- Lazy loading for improved performance
|
||||||
|
- Auto-mark as read at 100% reading progress
|
||||||
|
- Articles automatically marked as read when scrolled to end
|
||||||
|
- Marked-as-read articles treated as 100% progress
|
||||||
|
- Fancy checkmark animation on Mark as Read button
|
||||||
|
- Click-to-open article navigation on highlights
|
||||||
|
- Clicking highlights in Explore and Me pages opens the source article
|
||||||
|
- Automatically scrolls to highlighted text position
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Renamed Archive to Reads with expanded functionality
|
||||||
|
- Merged 'Completed' and 'Marked as Read' filters into one unified filter
|
||||||
|
- Simplified filter icon colors to blue (except green for completed)
|
||||||
|
- Started reading progress state (0-10%) uses neutral text color
|
||||||
|
- Replace spinners with skeleton placeholders during refresh in Archive/Reads/Links tabs
|
||||||
|
- Removed unused IEventStore import in ContentPanel
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Reading position calculation now accurately reaches 100%
|
||||||
|
- Reading position filters work correctly in bookmarks sidebar
|
||||||
|
- Filter out reads without timestamps or 'Untitled' items
|
||||||
|
- Show skeleton placeholders correctly during initial tab load
|
||||||
|
- External URLs in Reads tab only shown if they have reading progress
|
||||||
|
- Reading progress merges even when timestamp is older than bookmark
|
||||||
|
- Resolved all linter errors and TypeScript type issues
|
||||||
|
|
||||||
|
### Refactored
|
||||||
|
|
||||||
|
- Renamed ArchiveFilters component to ReadingProgressFilters
|
||||||
|
- Extracted shared utilities from readsFromBookmarks for DRY code
|
||||||
|
- Use setState callback pattern for background enrichment
|
||||||
|
- Use naddr format for article IDs to match reading positions
|
||||||
|
- Extract article titles, images, summaries from bookmark tags using applesauce helpers
|
||||||
|
|
||||||
|
## [0.6.20] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Bookmark filter buttons by content type (articles, videos, images, web links)
|
||||||
|
- Filter bookmarks by their content type on bookmarks sidebar
|
||||||
|
- Filters also available on `/me` page bookmarks tab
|
||||||
|
- Separate filter for external articles with link icon
|
||||||
|
- Multiple filters can be active simultaneously
|
||||||
|
- Private Bookmarks section for encrypted legacy bookmarks
|
||||||
|
- Encrypted legacy bookmarks now grouped in separate section
|
||||||
|
- Better organization and clarity for different bookmark types
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Bookmark section labels improved for clarity
|
||||||
|
- More descriptive section headings throughout
|
||||||
|
- Better categorization of bookmark types
|
||||||
|
- Bookmark filter button styling refined
|
||||||
|
- Reduced whitespace around bookmark filters for cleaner layout
|
||||||
|
- Dramatically reduced whitespace on both sidebar and `/me` page
|
||||||
|
- Lock icon removed from individual bookmarks
|
||||||
|
- Encryption status now indicated by section grouping
|
||||||
|
- Cleaner bookmark item appearance
|
||||||
|
- External article icon changed to link icon (`faLink`)
|
||||||
|
- More intuitive icon for external content
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Highlight button positioning and visibility
|
||||||
|
- Fixed to viewport for consistent placement
|
||||||
|
- Sticky and always visible when needed
|
||||||
|
- Properly positioned inside reader pane
|
||||||
|
|
||||||
|
## [0.6.19] - 2025-10-15
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Highlights disappearing on external URLs after a few seconds
|
||||||
|
- Fixed `useBookmarksData` from fetching general highlights when viewing external URLs
|
||||||
|
- External URL highlights now managed exclusively by `useExternalUrlLoader`
|
||||||
|
- Removed redundant `setHighlights` call that was overwriting streamed highlights
|
||||||
|
- Improved error handling in `fetchHighlightsForUrl` to prevent silent failures
|
||||||
|
- Isolated rebroadcast errors so they don't break highlight display
|
||||||
|
- Added logging to help diagnose highlight fetching issues
|
||||||
|
|
||||||
|
## [0.6.18] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Zap split labels simplified and terminology updated
|
||||||
|
- Removed redundant "Weight: xy" label to save space
|
||||||
|
- Changed "Author(s) Share" to "Author's Share" (possessive singular)
|
||||||
|
- Changed "Support Boris" to "Boris' Share" for consistency
|
||||||
|
- Weight value now shown directly in label (e.g., "Your Share: 50")
|
||||||
|
- Share and percentage now displayed on same line for cleaner layout
|
||||||
|
- Zap preset buttons on desktop now expand to match slider width
|
||||||
|
- Added `flex: 1` to buttons for equal width distribution
|
||||||
|
- Buttons still wrap properly on smaller screens
|
||||||
|
- PWA install section now always visible in settings
|
||||||
|
- Section shows regardless of installation or device capability status
|
||||||
|
- Button adapts with proper disabled states and visual feedback
|
||||||
|
- "Installed" state shows checkmark icon and disabled button
|
||||||
|
- Non-installable state shows disabled button
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- PWA install button now properly disabled when installation is not possible on device
|
||||||
|
- Button only enabled when browser fires `beforeinstallprompt` event
|
||||||
|
- Removed hardcoded testing state that always showed button as installable
|
||||||
|
- App & Airplane Mode section now always visible regardless of PWA status
|
||||||
|
- Image cache and local relay settings always accessible
|
||||||
|
- Previously entire section was hidden if PWA not installable/installed
|
||||||
|
- Only PWA-specific install button is conditionally affected
|
||||||
|
|
||||||
|
## [0.6.17] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- PWA settings illustration (`pwa.svg`) displayed on right side of section
|
||||||
|
- Responsive design: hidden on mobile, 30% width on desktop
|
||||||
|
- Visual enhancement for App & Airplane Mode section
|
||||||
|
- Zaps illustration (`zaps.svg`) displayed on right side of Zap Splits section
|
||||||
|
- Matching responsive layout and styling as PWA illustration
|
||||||
|
- Visual 50% indicators on zap split sliders
|
||||||
|
- Linear gradient background using highlight colors (yellow/orange) at 50% opacity
|
||||||
|
- Datalist tick marks at 50% for "Your Share" and "Author(s) Share" sliders
|
||||||
|
- Tick mark at 5 for "Support Boris" slider
|
||||||
|
- Lightning bolt icons as slider thumbs for zap splits
|
||||||
|
- Replaces default circular slider handles
|
||||||
|
- White lightning bolt SVG embedded in slider thumb background
|
||||||
|
- 24px square thumb with 4px border radius
|
||||||
|
- Offline-first description paragraph at beginning of App & Airplane Mode section
|
||||||
|
- Explains Boris's offline capabilities upfront
|
||||||
|
- Settings page width constraint (900px max-width)
|
||||||
|
- Matches article view max-width for consistent reading experience
|
||||||
|
- Centered layout with proper margins
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Settings section reorganization
|
||||||
|
- "PWA & Flight Mode" merged into single "App & Airplane Mode" section
|
||||||
|
- "Layout & Navigation" and "Startup & Behavior" merged into "Layout & Behavior"
|
||||||
|
- Section order: Theme → Reading & Display → Zap Splits → Layout & Behavior → App & Airplane Mode → Relays
|
||||||
|
- "Startup & Behavior" moved after "Zap Splits"
|
||||||
|
- "Layout & Navigation" moved below "Zap Splits"
|
||||||
|
- PWA settings section restructure
|
||||||
|
- Checkboxes moved to top (image cache, local relays)
|
||||||
|
- Descriptive paragraphs in middle
|
||||||
|
- Install button at bottom
|
||||||
|
- Note about local relays moved before install paragraph
|
||||||
|
- Zap split sliders styling
|
||||||
|
- Left side (0-50%): highlight color (yellow) at 50% opacity
|
||||||
|
- Right side (50-100%): friend-highlight color (orange) at 50% opacity
|
||||||
|
- Creates visual distinction tied to app's highlight color scheme
|
||||||
|
- Zap split description text styling
|
||||||
|
- Now matches offline-first paragraph style with secondary color and smaller font size
|
||||||
|
- Clear cache button styling
|
||||||
|
- Replaced `IconButton` with plain `FontAwesomeIcon` for subtler appearance
|
||||||
|
- No border or background, just icon with opacity
|
||||||
|
- Font Size buttons alignment
|
||||||
|
- Now properly align to the right using `setting-control` wrapper
|
||||||
|
- Matches alignment of highlight color picker buttons
|
||||||
|
- Default Highlight Visibility position
|
||||||
|
- Moved back to original position after "Paragraph Alignment"
|
||||||
|
- Grouped with other reading display controls
|
||||||
|
- Spacing adjustments in App & Airplane Mode section
|
||||||
|
- Reduced gap between elements from 1rem → 0.5rem → 0.25rem for tighter layout
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- PWA settings paragraph wrapping
|
||||||
|
- Moved offline-first paragraph inside flex container to prevent extending above image
|
||||||
|
- Font Size buttons alignment issues
|
||||||
|
- Properly implemented `setting-control` wrapper for right alignment
|
||||||
|
- Previously attempted alignment didn't work correctly
|
||||||
|
- Slider thumb icon centering
|
||||||
|
- Lightning bolt icons properly centered vertically on slider
|
||||||
|
- Added `position: relative`, `top: 0`, `margin-top: 0` for accurate positioning
|
||||||
|
|
||||||
|
## [0.6.16] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Replaced delete dialog popup with inline confirmation UI
|
||||||
|
- Shows red "Confirm?" text with trash icon when delete is clicked
|
||||||
|
- Clicking the red trash icon confirms deletion
|
||||||
|
- No more modal overlay or backdrop
|
||||||
|
- Click outside or reopen menu to cancel
|
||||||
|
- Reordered Reading & Display settings for better organization
|
||||||
|
- Highlight Style, Paragraph Alignment, and Default Highlight Visibility moved to top
|
||||||
|
- Followed by Reading Font, Font Size, and color pickers
|
||||||
|
- Setting buttons now align vertically with fixed label width (220px)
|
||||||
|
- Creates consistent "tab stops" for cleaner visual alignment
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Removed unused `handleCancelDelete` function after dialog removal
|
||||||
|
|
||||||
|
## [0.6.15] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Paragraph alignment setting with left-aligned and justified text options
|
||||||
|
- Icon buttons in Reading & Display settings for switching alignment
|
||||||
|
- CSS variable system for applying alignment to reader content
|
||||||
|
- Real-time preview of alignment changes in settings
|
||||||
|
- Headings remain left-aligned for optimal readability
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Default paragraph alignment changed to justified for improved reading experience
|
||||||
|
- Applies to paragraphs, list items, divs, and blockquotes
|
||||||
|
- Settings stored and synced via Nostr (NIP-78)
|
||||||
|
|
||||||
|
## [0.6.14] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for bookmark sets (NIP-51 kind:30003)
|
||||||
|
- Bookmark sets now display alongside regular bookmark lists
|
||||||
|
- Properly handles AddressPointer bookmarks for long-form articles
|
||||||
|
- Content type icons for bookmarks
|
||||||
|
- Article, video, web, and image icons to indicate bookmark content type
|
||||||
|
- Camera icon for image bookmarks
|
||||||
|
- Sticky note icon for text-only bookmarks without URLs
|
||||||
|
- Bookmark grouping and sections
|
||||||
|
- Grouped sections in sidebar and `/me` reading-list
|
||||||
|
- Web bookmarks, default bookmarks, and legacy bookmarks in separate sections
|
||||||
|
- Grouping and sorting helpers for organizing bookmark sections
|
||||||
|
- Adaptive text color for publication date over hero images
|
||||||
|
- Automatically detects image brightness and adjusts text color
|
||||||
|
- Improved contrast for better readability
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Renamed "Amethyst-style bookmarks" to "Old Bookmarks (Legacy)"
|
||||||
|
- Hide cover images in compact view for cleaner layout
|
||||||
|
- Support button improvements
|
||||||
|
- Moved to bottom-left of bookmarks bar
|
||||||
|
- Changed icon from lightning bolt to heart (orange color)
|
||||||
|
- Left-aligned support button, right-aligned view mode buttons
|
||||||
|
- Section headings improved with better typography (removed counts)
|
||||||
|
- Icon changed from book to file-lines for default bookmarks
|
||||||
|
- Use regular (outlined) icon variants for lighter, more refined appearance
|
||||||
|
- Add bookmark button moved to web bookmarks section
|
||||||
|
- Empty state messages replaced with loading spinners
|
||||||
|
- Section dividers made more subtle
|
||||||
|
- Simplified bookmark filtering to only exclude empty content
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Removed borders from compact bookmark cards for cleaner look
|
||||||
|
- Removed duplicate type indicator icons from bookmark cards
|
||||||
|
- Reduced section heading bottom padding for better spacing
|
||||||
|
- Aligned add bookmark button with section heading
|
||||||
|
- Removed redundant loading spinner above tabs
|
||||||
|
- Resolved linter and type errors
|
||||||
|
- Include kind:30003 in default bookmark list detection
|
||||||
|
- Removed text shadows from publication date for cleaner look
|
||||||
|
- Improved shadow contrast without background overlay
|
||||||
|
- Corrected async handling in adaptive color detection
|
||||||
|
- Corrected FastAverageColor import to use named export
|
||||||
|
- Section heading styles now properly override with `!important`
|
||||||
|
- Removed unused articleImage prop from CompactView
|
||||||
|
|
||||||
|
## [0.6.13] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for `nprofile` identifiers on `/p/` profile pages (NIP-19)
|
||||||
|
- Profile pages now accept both `npub` and `nprofile` identifiers
|
||||||
|
- Extracts pubkey from nprofile data structure
|
||||||
|
- Users can share profiles with relay metadata included
|
||||||
|
- Gradient placeholder images for articles without cover images
|
||||||
|
- Blog post cards show subtle diagonal gradient using theme colors
|
||||||
|
- Reader view displays gradient background with newspaper icon
|
||||||
|
- Placeholders adapt automatically to light/dark themes
|
||||||
|
- Large view bookmarks use matching gradient backgrounds
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- PWA install section styling in settings
|
||||||
|
- Heading now matches other section headings with proper styling
|
||||||
|
- Install button uses standard app button styling instead of custom gradient
|
||||||
|
- Consistent with app's design system and theme colors
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Mobile bookmark button visibility across all pages
|
||||||
|
- Now visible on `/p/` (profile), `/explore`, `/me`, and `/support` pages
|
||||||
|
- Only hidden on settings page or when scrolling down while reading
|
||||||
|
- Prevents users from getting stuck without navigation options
|
||||||
|
- Mobile highlights button behavior at page top
|
||||||
|
- Hidden when scrolled to the very top of the page
|
||||||
|
- Appears when scrolling up from below
|
||||||
|
- Bookmark button remains visible at top (only hides on scroll down)
|
||||||
|
- Separate visibility logic for each button improves UX
|
||||||
|
|
||||||
|
## [0.6.12] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Horizontal dividers (`<hr>`) in blog posts now display with more subtle styling
|
||||||
|
- Reduced visual weight with 69% opacity for better readability
|
||||||
|
- Added increased vertical padding (2.5rem) above and below dividers
|
||||||
|
- Improved visual separation without disrupting reading flow
|
||||||
|
|
||||||
|
## [0.6.11] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Colored borders to blog post and highlight cards based on relationship
|
||||||
|
- Mine: yellow border
|
||||||
|
- Friends: orange border
|
||||||
|
- Nostrverse: purple border
|
||||||
|
- Visual distinction helps identify content source at a glance
|
||||||
|
- Mobile sidebar toggle buttons on explore page
|
||||||
|
- Bookmark and highlights buttons now visible on explore page
|
||||||
|
- Improves mobile navigation UX
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Mobile bookmarks sidebar opening and closing immediately
|
||||||
|
- Memoized `toggleSidebar` function to prevent unnecessary re-renders
|
||||||
|
- Updated route-change effect to only close sidebar on actual pathname changes
|
||||||
|
- Sidebar now stays open when opened on mobile PWA
|
||||||
|
|
||||||
|
## [0.6.10] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support page (`/support`) displaying zappers with avatar grid
|
||||||
|
- Shows "Absolute Legends" (69420+ sats) and regular supporters (2100+ sats)
|
||||||
|
- Clickable supporter avatars link to profiles
|
||||||
|
- Bolt icon button in sidebar navigation
|
||||||
|
- Thank-you illustration and call-to-action
|
||||||
|
- Links to pricing page and Boris profile
|
||||||
|
- Refresh button to explore page
|
||||||
|
- Positioned next to filter buttons
|
||||||
|
- Spinning animation during loading and pull-to-refresh
|
||||||
|
- Unified event publishing and querying services
|
||||||
|
- `publishEvent` service for highlights and settings
|
||||||
|
- `queryEvents` helper with local-first fetching
|
||||||
|
- Centralized relay timeouts configuration
|
||||||
|
- FEATURES.md documentation file
|
||||||
|
- MIT License
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Explore page improvements
|
||||||
|
- Filter defaults to friends only (instead of all)
|
||||||
|
- Tabs moved below filter buttons
|
||||||
|
- Filter buttons positioned on the right
|
||||||
|
- Writings tab now uses newspaper icon
|
||||||
|
- Subtitle removed for cleaner layout
|
||||||
|
- Pull-to-refresh library
|
||||||
|
- Replaced custom implementation with `use-pull-to-refresh`
|
||||||
|
- Updated HighlightsPanel to use new library
|
||||||
|
- Loading states now show progressive loading with skeletons instead of blocking error screens
|
||||||
|
- All event fetching services migrated to unified `queryEvents` helper
|
||||||
|
- `nostrverseService`, `bookmarkService`, `libraryService`
|
||||||
|
- `exploreService`, `fetchHighlightsFromAuthors`
|
||||||
|
- Contact streaming with extended timeout and partial results
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- All ESLint and TypeScript linting errors
|
||||||
|
- Removed all `eslint-disable` statements
|
||||||
|
- Fixed `react-hooks/exhaustive-deps` warnings
|
||||||
|
- Resolved all type errors
|
||||||
|
- Explore page refresh loop and false empty-follows error
|
||||||
|
- Zap receipt scanning with applesauce helpers and more relays
|
||||||
|
- Support page theme colors for proper readability
|
||||||
|
|
||||||
|
### Refactored
|
||||||
|
|
||||||
|
- Event publishing to use unified `publishEvent` service
|
||||||
|
- Event fetching to use unified `queryEvents` helper
|
||||||
|
- Image cache and bookmark components (removed unused settings parameter)
|
||||||
|
- Support page spacing and visual hierarchy
|
||||||
|
|
||||||
|
## [0.6.9] - 2025-10-14
|
||||||
|
|
||||||
|
### Documentation
|
||||||
|
|
||||||
|
- Minor changelog formatting updates
|
||||||
|
|
||||||
## [0.6.8] - 2025-10-14
|
## [0.6.8] - 2025-10-14
|
||||||
|
|
||||||
### Changed
|
### Changed
|
||||||
@@ -1293,7 +1760,22 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
- Optimize relay usage following applesauce-relay best practices
|
- Optimize relay usage following applesauce-relay best practices
|
||||||
- Use applesauce-react event models for better profile handling
|
- Use applesauce-react event models for better profile handling
|
||||||
|
|
||||||
[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.8...HEAD
|
[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.24...HEAD
|
||||||
|
[0.6.24]: https://github.com/dergigi/boris/compare/v0.6.23...v0.6.24
|
||||||
|
[0.6.23]: https://github.com/dergigi/boris/compare/v0.6.22...v0.6.23
|
||||||
|
[0.6.21]: https://github.com/dergigi/boris/compare/v0.6.20...v0.6.21
|
||||||
|
[0.6.20]: https://github.com/dergigi/boris/compare/v0.6.19...v0.6.20
|
||||||
|
[0.6.19]: https://github.com/dergigi/boris/compare/v0.6.18...v0.6.19
|
||||||
|
[0.6.18]: https://github.com/dergigi/boris/compare/v0.6.17...v0.6.18
|
||||||
|
[0.6.17]: https://github.com/dergigi/boris/compare/v0.6.16...v0.6.17
|
||||||
|
[0.6.16]: https://github.com/dergigi/boris/compare/v0.6.15...v0.6.16
|
||||||
|
[0.6.15]: https://github.com/dergigi/boris/compare/v0.6.14...v0.6.15
|
||||||
|
[0.6.14]: https://github.com/dergigi/boris/compare/v0.6.13...v0.6.14
|
||||||
|
[0.6.13]: https://github.com/dergigi/boris/compare/v0.6.12...v0.6.13
|
||||||
|
[0.6.12]: https://github.com/dergigi/boris/compare/v0.6.11...v0.6.12
|
||||||
|
[0.6.11]: https://github.com/dergigi/boris/compare/v0.6.10...v0.6.11
|
||||||
|
[0.6.10]: https://github.com/dergigi/boris/compare/v0.6.9...v0.6.10
|
||||||
|
[0.6.9]: https://github.com/dergigi/boris/compare/v0.6.8...v0.6.9
|
||||||
[0.6.8]: https://github.com/dergigi/boris/compare/v0.6.7...v0.6.8
|
[0.6.8]: https://github.com/dergigi/boris/compare/v0.6.7...v0.6.8
|
||||||
[0.6.7]: https://github.com/dergigi/boris/compare/v0.6.6...v0.6.7
|
[0.6.7]: https://github.com/dergigi/boris/compare/v0.6.6...v0.6.7
|
||||||
[0.6.6]: https://github.com/dergigi/boris/compare/v0.6.5...v0.6.6
|
[0.6.6]: https://github.com/dergigi/boris/compare/v0.6.5...v0.6.6
|
||||||
|
|||||||
89
FEATURES.md
Normal file
89
FEATURES.md
Normal file
@@ -0,0 +1,89 @@
|
|||||||
|
# Boris Features
|
||||||
|
## Overview
|
||||||
|
|
||||||
|
- **Purpose**: A calm, fast, Nostr‑first reader that turns your bookmarks into a focused reading app.
|
||||||
|
- **Layout**: Three‑pane interface — bookmarks (left), reader (center), highlights (right). Collapsible sidebars.
|
||||||
|
- **Content**: Renders both Nostr long‑form posts (kind:30023) and regular web URLs.
|
||||||
|
- **Social layer**: Highlights shown by level — mine, friends, nostrverse — each with its own color and visibility toggle.
|
||||||
|
|
||||||
|
## Reader Experience
|
||||||
|
|
||||||
|
- **Distraction‑free view**: Clean typography, optional hero image, summary, and published date.
|
||||||
|
- **Reading time**: Displays estimated reading time for text or duration for supported videos.
|
||||||
|
- **Progress**: Reading progress indicator with completion state.
|
||||||
|
- **Menus**: Quick actions to open, share, or copy links (for both Nostr and web content).
|
||||||
|
- **Performance**: Lightweight fetching and caching for speed; skeleton loaders to avoid empty flashes.
|
||||||
|
|
||||||
|
## Highlights (NIP‑84)
|
||||||
|
|
||||||
|
- **Levels**: Mine, friends, nostrverse; toggle per level; colors configurable in settings.
|
||||||
|
- **Interactions**: Click a highlight to scroll to its position; count indicator in the header.
|
||||||
|
- **Creation**: Select text and use the floating highlighter button to publish a highlight.
|
||||||
|
- **Attribution**: Automatically tags article authors for Nostr posts so they can see highlights.
|
||||||
|
|
||||||
|
## Zap Splits (NIP‑57)
|
||||||
|
|
||||||
|
- **Configurable splits**: Weight‑based sliders for highlighter, author(s), and Boris (defaults 50/50/2.1).
|
||||||
|
- **Presets**: Quick buttons for common split configurations.
|
||||||
|
- **Respect source**: If the source article has zap tags, author weights are proportionally preserved.
|
||||||
|
|
||||||
|
## Bookmarks & Reading List (NIP‑51 + Web)
|
||||||
|
|
||||||
|
- **Ingestion**: Collects list bookmarks and items from kinds 10003/30003/30001.
|
||||||
|
- **Web bookmarks**: Supports NIP‑B0 (kind:39701) for standalone URL bookmarks.
|
||||||
|
- **Add Bookmark**: Modal with auto title/description extraction and keywords/tags suggestion (adds “boris” when helpful).
|
||||||
|
- **Views**: Reading list in compact, cards, or large preview modes; quick toggles to switch.
|
||||||
|
- **Archive**: “Read” items appear in your archive; can mark articles/web pages as read.
|
||||||
|
|
||||||
|
## Explore & Profiles
|
||||||
|
|
||||||
|
- **Explore**: Discover friends' highlights and writings, plus a "nostrverse" feed.
|
||||||
|
- **Filters**: Visibility toggles (mine, friends, nostrverse) apply to Explore highlights.
|
||||||
|
- **Profiles**: View your own (`/me`) or other users (`/p/:npub`) with tabs for Highlights, Bookmarks, Archive, and Writings.
|
||||||
|
|
||||||
|
## Support
|
||||||
|
|
||||||
|
- **Supporter page**: Displays avatars of users who zapped Boris (kind:9735 receipts).
|
||||||
|
- **Thresholds**: Shows supporters who sent ≥ 2100 sats; whales (≥ 69420 sats) get special styling with a bolt badge.
|
||||||
|
- **Profile integration**: Fetches and displays profile pictures and names for all supporters.
|
||||||
|
- **Stats**: Total supporter count and zap count displayed at the bottom.
|
||||||
|
|
||||||
|
## Video
|
||||||
|
|
||||||
|
- **Embedded player**: Plays supported videos (e.g., YouTube) inline with duration display.
|
||||||
|
- **Metadata**: Fetches YouTube title/description/transcript when available.
|
||||||
|
- **Deep links**: Open in native apps via platform‑specific URL schemes.
|
||||||
|
|
||||||
|
## Settings (NIP‑78 Application Data)
|
||||||
|
|
||||||
|
- **Theme**: System/light/dark with color variants (dark: black/midnight/charcoal; light: paper‑white/sepia/ivory).
|
||||||
|
- **Reading**: Font family (preloaded), font size, highlight style (marker/underline), per‑level colors.
|
||||||
|
- **Layout & startup**: Default view modes, auto‑collapse preferences, show/hide highlights.
|
||||||
|
- **Zap Splits**: Weight sliders and presets for NIP‑57 splits.
|
||||||
|
- **Offline/Flight Mode**: Local image cache with size limit and clear controls; “use local relay as cache”; rebroadcast preferences.
|
||||||
|
- **Relays**: Relay overview and status in Settings; educational links.
|
||||||
|
- **PWA**: Install prompt when available.
|
||||||
|
|
||||||
|
## Offline, PWA, and Sync
|
||||||
|
|
||||||
|
- **PWA**: Installable; service worker registered; periodic update checks with in‑app toast.
|
||||||
|
- **Flight Mode**: Operates with local relays only; highlights created offline are stored locally and synced later.
|
||||||
|
- **Relay indicator**: Floating status indicator shows Connecting/Offline/Flight Mode and connected counts.
|
||||||
|
|
||||||
|
## Relays & Accounts
|
||||||
|
|
||||||
|
- **Applesauce stack**: Accounts, event store, relay pool, and blueprints power Nostr interactions.
|
||||||
|
- **Multi‑relay**: Grouped connections with keep‑alive subscription; local+remote partitioning for fast queries.
|
||||||
|
- **Persistence**: Accounts restored from local storage; settings saved to NIP‑78 and watched for updates.
|
||||||
|
|
||||||
|
## Privacy
|
||||||
|
|
||||||
|
- **Identity**: No email or new account; uses your existing Nostr signer/identity.
|
||||||
|
- **Data**: Bookmarks and highlights live on Nostr; reading/rendering happens locally in your browser.
|
||||||
|
|
||||||
|
## Conveniences
|
||||||
|
|
||||||
|
- **Share/copy**: One‑click copy or share for articles and videos.
|
||||||
|
- **Open on Nostr**: Deep links to portals and `nostr:` schemes for long‑form articles.
|
||||||
|
- **Mobile UX**: Floating open buttons for Bookmarks/Highlights, focus trapping, and backdrop controls.
|
||||||
|
|
||||||
22
LICENSE
Normal file
22
LICENSE
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
MIT License
|
||||||
|
|
||||||
|
Copyright (c) 2025 Gigi
|
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
|
in the Software without restriction, including without limitation the rights
|
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
copies of the Software, and to permit persons to whom the Software is
|
||||||
|
furnished to do so, subject to the following conditions:
|
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all
|
||||||
|
copies or substantial portions of the Software.
|
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||||
|
SOFTWARE.
|
||||||
|
|
||||||
304
api/article-og.ts
Normal file
304
api/article-og.ts
Normal file
@@ -0,0 +1,304 @@
|
|||||||
|
import type { VercelRequest, VercelResponse } from '@vercel/node'
|
||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
import { AddressPointer } from 'nostr-tools/nip19'
|
||||||
|
import { NostrEvent, Filter } from 'nostr-tools'
|
||||||
|
import { Helpers } from 'applesauce-core'
|
||||||
|
|
||||||
|
const { getArticleTitle, getArticleImage, getArticleSummary } = Helpers
|
||||||
|
|
||||||
|
// Relay configuration (from src/config/relays.ts)
|
||||||
|
const RELAYS = [
|
||||||
|
'wss://relay.damus.io',
|
||||||
|
'wss://nos.lol',
|
||||||
|
'wss://relay.nostr.band',
|
||||||
|
'wss://relay.dergigi.com',
|
||||||
|
'wss://wot.dergigi.com',
|
||||||
|
'wss://relay.snort.social',
|
||||||
|
'wss://relay.current.fyi',
|
||||||
|
'wss://nostr-pub.wellorder.net',
|
||||||
|
'wss://purplepag.es',
|
||||||
|
'wss://relay.primal.net'
|
||||||
|
]
|
||||||
|
|
||||||
|
type CacheEntry = {
|
||||||
|
html: string
|
||||||
|
expires: number
|
||||||
|
}
|
||||||
|
|
||||||
|
const WEEK_MS = 7 * 24 * 60 * 60 * 1000
|
||||||
|
const memoryCache = new Map<string, CacheEntry>()
|
||||||
|
|
||||||
|
function escapeHtml(text: string): string {
|
||||||
|
return text
|
||||||
|
.replace(/&/g, '&')
|
||||||
|
.replace(/</g, '<')
|
||||||
|
.replace(/>/g, '>')
|
||||||
|
.replace(/"/g, '"')
|
||||||
|
.replace(/'/g, ''')
|
||||||
|
}
|
||||||
|
|
||||||
|
function setCacheHeaders(res: VercelResponse, maxAge: number = 86400): void {
|
||||||
|
res.setHeader('Cache-Control', `public, max-age=${maxAge}, s-maxage=604800`)
|
||||||
|
res.setHeader('Content-Type', 'text/html; charset=utf-8')
|
||||||
|
}
|
||||||
|
|
||||||
|
interface ArticleMetadata {
|
||||||
|
title: string
|
||||||
|
summary: string
|
||||||
|
image: string
|
||||||
|
author: string
|
||||||
|
published?: number
|
||||||
|
}
|
||||||
|
|
||||||
|
async function fetchEventsFromRelays(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
relayUrls: string[],
|
||||||
|
filter: Filter,
|
||||||
|
timeoutMs: number
|
||||||
|
): Promise<NostrEvent[]> {
|
||||||
|
const events: NostrEvent[] = []
|
||||||
|
|
||||||
|
await new Promise<void>((resolve) => {
|
||||||
|
const timeout = setTimeout(() => resolve(), timeoutMs)
|
||||||
|
|
||||||
|
// `request` emits NostrEvent objects directly
|
||||||
|
relayPool.request(relayUrls, filter).subscribe({
|
||||||
|
next: (event) => {
|
||||||
|
events.push(event)
|
||||||
|
},
|
||||||
|
error: () => resolve(),
|
||||||
|
complete: () => {
|
||||||
|
clearTimeout(timeout)
|
||||||
|
resolve()
|
||||||
|
}
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
|
// Sort by created_at and return most recent first
|
||||||
|
return events.sort((a, b) => b.created_at - a.created_at)
|
||||||
|
}
|
||||||
|
|
||||||
|
async function fetchArticleMetadata(naddr: string): Promise<ArticleMetadata | null> {
|
||||||
|
const relayPool = new RelayPool()
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Decode naddr
|
||||||
|
const decoded = nip19.decode(naddr)
|
||||||
|
if (decoded.type !== 'naddr') {
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const pointer = decoded.data as AddressPointer
|
||||||
|
|
||||||
|
// Determine relay URLs
|
||||||
|
const relayUrls = pointer.relays && pointer.relays.length > 0 ? pointer.relays : RELAYS
|
||||||
|
|
||||||
|
// Fetch article and profile in parallel
|
||||||
|
const [articleEvents, profileEvents] = await Promise.all([
|
||||||
|
fetchEventsFromRelays(relayPool, relayUrls, {
|
||||||
|
kinds: [pointer.kind],
|
||||||
|
authors: [pointer.pubkey],
|
||||||
|
'#d': [pointer.identifier || '']
|
||||||
|
}, 5000),
|
||||||
|
fetchEventsFromRelays(relayPool, relayUrls, {
|
||||||
|
kinds: [0],
|
||||||
|
authors: [pointer.pubkey]
|
||||||
|
}, 3000)
|
||||||
|
])
|
||||||
|
|
||||||
|
if (articleEvents.length === 0) {
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const article = articleEvents[0]
|
||||||
|
|
||||||
|
// Extract article metadata
|
||||||
|
const title = getArticleTitle(article) || 'Untitled Article'
|
||||||
|
const summary = getArticleSummary(article) || 'Read this article on Boris'
|
||||||
|
const image = getArticleImage(article) || '/boris-social-1200.png'
|
||||||
|
|
||||||
|
// Extract author name from profile
|
||||||
|
let authorName = pointer.pubkey.slice(0, 8) + '...'
|
||||||
|
if (profileEvents.length > 0) {
|
||||||
|
try {
|
||||||
|
const profileData = JSON.parse(profileEvents[0].content)
|
||||||
|
authorName = profileData.display_name || profileData.name || authorName
|
||||||
|
} catch {
|
||||||
|
// Use fallback
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
title,
|
||||||
|
summary,
|
||||||
|
image,
|
||||||
|
author: authorName,
|
||||||
|
published: article.created_at
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to fetch article metadata:', err)
|
||||||
|
return null
|
||||||
|
} finally {
|
||||||
|
// No explicit close needed; pool manages connections internally
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
function generateHtml(naddr: string, meta: ArticleMetadata | null): string {
|
||||||
|
const baseUrl = 'https://read.withboris.com'
|
||||||
|
const articleUrl = `${baseUrl}/a/${naddr}`
|
||||||
|
|
||||||
|
const title = meta?.title || 'Boris – Nostr Bookmarks'
|
||||||
|
const description = meta?.summary || 'Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights.'
|
||||||
|
const image = meta?.image?.startsWith('http') ? meta.image : `${baseUrl}${meta?.image || '/boris-social-1200.png'}`
|
||||||
|
const author = meta?.author || 'Boris'
|
||||||
|
|
||||||
|
return `<!doctype html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="UTF-8" />
|
||||||
|
<link rel="icon" type="image/x-icon" href="/favicon.ico" />
|
||||||
|
<link rel="icon" type="image/png" sizes="32x32" href="/favicon-32x32.png" />
|
||||||
|
<link rel="icon" type="image/png" sizes="16x16" href="/favicon-16x16.png" />
|
||||||
|
<link rel="apple-touch-icon" sizes="180x180" href="/apple-touch-icon.png" />
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1, viewport-fit=cover" />
|
||||||
|
<meta name="theme-color" content="#0f172a" />
|
||||||
|
<link rel="manifest" href="/manifest.webmanifest" />
|
||||||
|
<title>${escapeHtml(title)}</title>
|
||||||
|
<meta name="description" content="${escapeHtml(description)}" />
|
||||||
|
<link rel="canonical" href="${articleUrl}" />
|
||||||
|
|
||||||
|
<!-- Open Graph / Social Media -->
|
||||||
|
<meta property="og:type" content="article" />
|
||||||
|
<meta property="og:url" content="${articleUrl}" />
|
||||||
|
<meta property="og:title" content="${escapeHtml(title)}" />
|
||||||
|
<meta property="og:description" content="${escapeHtml(description)}" />
|
||||||
|
<meta property="og:image" content="${escapeHtml(image)}" />
|
||||||
|
<meta property="og:site_name" content="Boris" />
|
||||||
|
${meta?.published ? `<meta property="article:published_time" content="${new Date(meta.published * 1000).toISOString()}" />` : ''}
|
||||||
|
<meta property="article:author" content="${escapeHtml(author)}" />
|
||||||
|
|
||||||
|
<!-- Twitter Card -->
|
||||||
|
<meta name="twitter:card" content="summary_large_image" />
|
||||||
|
<meta name="twitter:url" content="${articleUrl}" />
|
||||||
|
<meta name="twitter:title" content="${escapeHtml(title)}" />
|
||||||
|
<meta name="twitter:description" content="${escapeHtml(description)}" />
|
||||||
|
<meta name="twitter:image" content="${escapeHtml(image)}" />
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<noscript>
|
||||||
|
<p>Redirecting to <a href="/">Boris</a>...</p>
|
||||||
|
</noscript>
|
||||||
|
</body>
|
||||||
|
</html>`
|
||||||
|
}
|
||||||
|
|
||||||
|
function isCrawler(userAgent: string | undefined): boolean {
|
||||||
|
if (!userAgent) return false
|
||||||
|
const crawlers = [
|
||||||
|
'bot', 'crawl', 'spider', 'slurp', 'facebook', 'twitter', 'linkedin',
|
||||||
|
'whatsapp', 'telegram', 'slack', 'discord', 'preview'
|
||||||
|
]
|
||||||
|
const ua = userAgent.toLowerCase()
|
||||||
|
return crawlers.some(crawler => ua.includes(crawler))
|
||||||
|
}
|
||||||
|
|
||||||
|
export default async function handler(req: VercelRequest, res: VercelResponse) {
|
||||||
|
const naddr = (req.query.naddr as string | undefined)?.trim()
|
||||||
|
|
||||||
|
if (!naddr) {
|
||||||
|
return res.status(400).json({ error: 'Missing naddr parameter' })
|
||||||
|
}
|
||||||
|
|
||||||
|
const userAgent = req.headers['user-agent'] as string | undefined
|
||||||
|
const isCrawlerRequest = isCrawler(userAgent)
|
||||||
|
|
||||||
|
const debugEnabled = req.query.debug === '1' || req.headers['x-boris-debug'] === '1'
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] request', JSON.stringify({
|
||||||
|
naddr,
|
||||||
|
ua: userAgent || null,
|
||||||
|
isCrawlerRequest,
|
||||||
|
path: req.url || null
|
||||||
|
}))
|
||||||
|
res.setHeader('X-Boris-Debug', '1')
|
||||||
|
}
|
||||||
|
|
||||||
|
// If it's a regular browser (not a bot), serve HTML that loads SPA
|
||||||
|
// Use history.replaceState to set the URL before the SPA boots
|
||||||
|
if (!isCrawlerRequest) {
|
||||||
|
const articlePath = `/a/${naddr}`
|
||||||
|
// Serve a minimal HTML that sets up the URL and loads the SPA
|
||||||
|
const html = `<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="UTF-8">
|
||||||
|
<link rel="icon" type="image/x-icon" href="/favicon.ico">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
<title>Boris - Loading Article...</title>
|
||||||
|
<script>
|
||||||
|
// Set the URL to the article path before SPA loads
|
||||||
|
if (window.location.pathname !== '${articlePath}') {
|
||||||
|
history.replaceState(null, '', '${articlePath}');
|
||||||
|
}
|
||||||
|
</script>
|
||||||
|
${debugEnabled ? `<script>console.debug('article-og', { mode: 'browser', naddr: '${naddr}', path: location.pathname, referrer: document.referrer });</script>` : ''}
|
||||||
|
<script>
|
||||||
|
// Redirect to index.html which will load the SPA
|
||||||
|
// The history state is already set, so SPA will see the correct URL
|
||||||
|
window.location.replace('/');
|
||||||
|
</script>
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div id="root"></div>
|
||||||
|
</body>
|
||||||
|
</html>`
|
||||||
|
|
||||||
|
res.setHeader('Content-Type', 'text/html; charset=utf-8')
|
||||||
|
res.setHeader('Cache-Control', 'no-cache, no-store, must-revalidate')
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'browser', naddr }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check cache for bots/crawlers
|
||||||
|
const now = Date.now()
|
||||||
|
const cached = memoryCache.get(naddr)
|
||||||
|
if (cached && cached.expires > now) {
|
||||||
|
setCacheHeaders(res)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: true }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(cached.html)
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch metadata
|
||||||
|
const meta = await fetchArticleMetadata(naddr)
|
||||||
|
|
||||||
|
// Generate HTML
|
||||||
|
const html = generateHtml(naddr, meta)
|
||||||
|
|
||||||
|
// Cache the result
|
||||||
|
memoryCache.set(naddr, { html, expires: now + WEEK_MS })
|
||||||
|
|
||||||
|
// Send response
|
||||||
|
setCacheHeaders(res)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: false }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Error generating article OG HTML:', err)
|
||||||
|
|
||||||
|
// Fallback to basic HTML with SPA boot
|
||||||
|
const html = generateHtml(naddr, null)
|
||||||
|
setCacheHeaders(res, 3600)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot-fallback', naddr }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@@ -18,6 +18,7 @@
|
|||||||
<meta property="og:url" content="https://read.withboris.com/" />
|
<meta property="og:url" content="https://read.withboris.com/" />
|
||||||
<meta property="og:title" content="Boris - Nostr Bookmarks" />
|
<meta property="og:title" content="Boris - Nostr Bookmarks" />
|
||||||
<meta property="og:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
<meta property="og:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
||||||
|
<meta property="og:image" content="https://read.withboris.com/boris-social-1200.png" />
|
||||||
<meta property="og:site_name" content="Boris" />
|
<meta property="og:site_name" content="Boris" />
|
||||||
|
|
||||||
<!-- Twitter Card -->
|
<!-- Twitter Card -->
|
||||||
@@ -25,6 +26,7 @@
|
|||||||
<meta name="twitter:url" content="https://read.withboris.com/" />
|
<meta name="twitter:url" content="https://read.withboris.com/" />
|
||||||
<meta name="twitter:title" content="Boris - Nostr Bookmarks" />
|
<meta name="twitter:title" content="Boris - Nostr Bookmarks" />
|
||||||
<meta name="twitter:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
<meta name="twitter:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
||||||
|
<meta name="twitter:image" content="https://read.withboris.com/boris-social-1200.png" />
|
||||||
|
|
||||||
<!-- Default to system theme until settings load from Nostr -->
|
<!-- Default to system theme until settings load from Nostr -->
|
||||||
<script>
|
<script>
|
||||||
|
|||||||
26
package-lock.json
generated
26
package-lock.json
generated
@@ -1,12 +1,12 @@
|
|||||||
{
|
{
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.6",
|
"version": "0.6.13",
|
||||||
"lockfileVersion": 3,
|
"lockfileVersion": 3,
|
||||||
"requires": true,
|
"requires": true,
|
||||||
"packages": {
|
"packages": {
|
||||||
"": {
|
"": {
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.6",
|
"version": "0.6.13",
|
||||||
"dependencies": {
|
"dependencies": {
|
||||||
"@fortawesome/fontawesome-svg-core": "^7.1.0",
|
"@fortawesome/fontawesome-svg-core": "^7.1.0",
|
||||||
"@fortawesome/free-regular-svg-icons": "^7.1.0",
|
"@fortawesome/free-regular-svg-icons": "^7.1.0",
|
||||||
@@ -22,6 +22,7 @@
|
|||||||
"applesauce-react": "^4.0.0",
|
"applesauce-react": "^4.0.0",
|
||||||
"applesauce-relay": "^4.0.0",
|
"applesauce-relay": "^4.0.0",
|
||||||
"date-fns": "^4.1.0",
|
"date-fns": "^4.1.0",
|
||||||
|
"fast-average-color": "^9.5.0",
|
||||||
"nostr-tools": "^2.4.0",
|
"nostr-tools": "^2.4.0",
|
||||||
"prismjs": "^1.30.0",
|
"prismjs": "^1.30.0",
|
||||||
"react": "^18.2.0",
|
"react": "^18.2.0",
|
||||||
@@ -33,7 +34,8 @@
|
|||||||
"reading-time-estimator": "^1.14.0",
|
"reading-time-estimator": "^1.14.0",
|
||||||
"rehype-prism-plus": "^2.0.1",
|
"rehype-prism-plus": "^2.0.1",
|
||||||
"rehype-raw": "^7.0.0",
|
"rehype-raw": "^7.0.0",
|
||||||
"remark-gfm": "^4.0.1"
|
"remark-gfm": "^4.0.1",
|
||||||
|
"use-pull-to-refresh": "^2.4.1"
|
||||||
},
|
},
|
||||||
"devDependencies": {
|
"devDependencies": {
|
||||||
"@tailwindcss/postcss": "^4.1.14",
|
"@tailwindcss/postcss": "^4.1.14",
|
||||||
@@ -6085,6 +6087,15 @@
|
|||||||
"integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
|
"integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
|
||||||
"license": "MIT"
|
"license": "MIT"
|
||||||
},
|
},
|
||||||
|
"node_modules/fast-average-color": {
|
||||||
|
"version": "9.5.0",
|
||||||
|
"resolved": "https://registry.npmjs.org/fast-average-color/-/fast-average-color-9.5.0.tgz",
|
||||||
|
"integrity": "sha512-nC6x2YIlJ9xxgkMFMd1BNoM1ctMjNoRKfRliPmiEWW3S6rLTHiQcy9g3pt/xiKv/D0NAAkhb9VyV+WJFvTqMGg==",
|
||||||
|
"license": "MIT",
|
||||||
|
"engines": {
|
||||||
|
"node": ">= 12"
|
||||||
|
}
|
||||||
|
},
|
||||||
"node_modules/fast-deep-equal": {
|
"node_modules/fast-deep-equal": {
|
||||||
"version": "3.1.3",
|
"version": "3.1.3",
|
||||||
"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
|
"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
|
||||||
@@ -11695,6 +11706,15 @@
|
|||||||
"punycode": "^2.1.0"
|
"punycode": "^2.1.0"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
"node_modules/use-pull-to-refresh": {
|
||||||
|
"version": "2.4.1",
|
||||||
|
"resolved": "https://registry.npmjs.org/use-pull-to-refresh/-/use-pull-to-refresh-2.4.1.tgz",
|
||||||
|
"integrity": "sha512-mI3utetwSPT3ovZHUJ4LBW29EtmkrzpK/O38msP5WnI8ocFmM5boy3QZALosgeQwqwdmtQgC+8xnJIYHXeABew==",
|
||||||
|
"license": "MIT",
|
||||||
|
"peerDependencies": {
|
||||||
|
"react": "18.x || 19.x"
|
||||||
|
}
|
||||||
|
},
|
||||||
"node_modules/v8-compile-cache-lib": {
|
"node_modules/v8-compile-cache-lib": {
|
||||||
"version": "3.0.1",
|
"version": "3.0.1",
|
||||||
"resolved": "https://registry.npmjs.org/v8-compile-cache-lib/-/v8-compile-cache-lib-3.0.1.tgz",
|
"resolved": "https://registry.npmjs.org/v8-compile-cache-lib/-/v8-compile-cache-lib-3.0.1.tgz",
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
{
|
{
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.9",
|
"version": "0.6.24",
|
||||||
"description": "A minimal nostr client for bookmark management",
|
"description": "A minimal nostr client for bookmark management",
|
||||||
"homepage": "https://read.withboris.com/",
|
"homepage": "https://read.withboris.com/",
|
||||||
"type": "module",
|
"type": "module",
|
||||||
@@ -25,6 +25,7 @@
|
|||||||
"applesauce-react": "^4.0.0",
|
"applesauce-react": "^4.0.0",
|
||||||
"applesauce-relay": "^4.0.0",
|
"applesauce-relay": "^4.0.0",
|
||||||
"date-fns": "^4.1.0",
|
"date-fns": "^4.1.0",
|
||||||
|
"fast-average-color": "^9.5.0",
|
||||||
"nostr-tools": "^2.4.0",
|
"nostr-tools": "^2.4.0",
|
||||||
"prismjs": "^1.30.0",
|
"prismjs": "^1.30.0",
|
||||||
"react": "^18.2.0",
|
"react": "^18.2.0",
|
||||||
@@ -36,7 +37,8 @@
|
|||||||
"reading-time-estimator": "^1.14.0",
|
"reading-time-estimator": "^1.14.0",
|
||||||
"rehype-prism-plus": "^2.0.1",
|
"rehype-prism-plus": "^2.0.1",
|
||||||
"rehype-raw": "^7.0.0",
|
"rehype-raw": "^7.0.0",
|
||||||
"remark-gfm": "^4.0.1"
|
"remark-gfm": "^4.0.1",
|
||||||
|
"use-pull-to-refresh": "^2.4.1"
|
||||||
},
|
},
|
||||||
"devDependencies": {
|
"devDependencies": {
|
||||||
"@tailwindcss/postcss": "^4.1.14",
|
"@tailwindcss/postcss": "^4.1.14",
|
||||||
|
|||||||
BIN
public/boris-social-1200.png
Normal file
BIN
public/boris-social-1200.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 819 KiB |
215
public/pwa.svg
Normal file
215
public/pwa.svg
Normal file
@@ -0,0 +1,215 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
|
||||||
|
<svg
|
||||||
|
width="649.67538"
|
||||||
|
height="568.22024"
|
||||||
|
viewBox="0 0 649.67538 568.22024"
|
||||||
|
role="img"
|
||||||
|
artist="Katerina Limpitsouni"
|
||||||
|
source="https://undraw.co/"
|
||||||
|
version="1.1"
|
||||||
|
id="svg31"
|
||||||
|
sodipodi:docname="pwa.svg"
|
||||||
|
inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
|
||||||
|
xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
|
||||||
|
xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
|
||||||
|
xmlns="http://www.w3.org/2000/svg"
|
||||||
|
xmlns:svg="http://www.w3.org/2000/svg">
|
||||||
|
<defs
|
||||||
|
id="defs31" />
|
||||||
|
<sodipodi:namedview
|
||||||
|
id="namedview31"
|
||||||
|
pagecolor="#ffffff"
|
||||||
|
bordercolor="#000000"
|
||||||
|
borderopacity="0.25"
|
||||||
|
inkscape:showpageshadow="2"
|
||||||
|
inkscape:pageopacity="0.0"
|
||||||
|
inkscape:pagecheckerboard="0"
|
||||||
|
inkscape:deskcolor="#d1d1d1"
|
||||||
|
inkscape:zoom="1.6866359"
|
||||||
|
inkscape:cx="303.56285"
|
||||||
|
inkscape:cy="531.82789"
|
||||||
|
inkscape:window-width="3840"
|
||||||
|
inkscape:window-height="1027"
|
||||||
|
inkscape:window-x="0"
|
||||||
|
inkscape:window-y="25"
|
||||||
|
inkscape:window-maximized="0"
|
||||||
|
inkscape:current-layer="svg31" />
|
||||||
|
<path
|
||||||
|
d="M397.23858,566.04035,390.539,618.81819l-9.85909-59.95407c-47.3817-18.18194-102.78179-21.713-102.78179-21.713s-12.22552,114.50728,28.139,162.38683,82.92182,40.60129,118.03379,11.00042c35.1114-29.60039,49.48123-70.31412,9.11675-118.19368C424.20327,581.68766,411.521,573.04476,397.23858,566.04035Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path1" />
|
||||||
|
<path
|
||||||
|
d="M384.1004,626.79762l1.98958,2.36c22.98681,27.551,36.40476,52.8555,40.0327,75.5803.05864.33032.09573.65881.15431.98919l-1.53846.23773-1.48187.20991c-3.64942-24.76543-19.47993-50.77428-39.52347-74.8103-.63842-.781-1.28663-1.57364-1.95824-2.34655-8.57477-10.1-17.832-19.82437-27.217-28.9415-.72021-.712-1.46191-1.42587-2.20361-2.13968-12.44963-11.96994-25.01434-22.84351-36.237-32.03036-.7903-.653-1.59224-1.296-2.38439-1.92739-19.05943-15.4717-33.9044-25.802-37.21424-28.06849-.39875-.28343-.62465-.43273-.67573-.46958l.844-1.25121.00183-.02155.85568-1.26106c.05113.03692.81117.53546,2.18233,1.49814,5.15056,3.57268,18.987,13.39417,36.1433,27.27236.77059.62957,1.57259,1.27267,2.36284,1.92555,9.11521,7.44575,19.072,15.96086,29.1037,25.25221q3.78542,3.49455,7.37706,6.9724c.75332.704,1.495,1.41783,2.21523,2.12988Q372.14864,612.73905,384.1004,626.79762Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path2" />
|
||||||
|
<path
|
||||||
|
d="M315.8701,561.67759c-.6941.76509-1.39989,1.54-2.13716,2.30139a84.299,84.299,0,0,1-6.3038,5.89408,82.00518,82.00518,0,0,1-32.26683,16.72907c.03131,1.03285.06269,2.06578.09217,3.12018a85.04164,85.04164,0,0,0,34.14459-17.51256,87.22471,87.22471,0,0,0,6.71826-6.30338c.72551-.75156,1.43131-1.52651,2.11561-2.30323a84.3256,84.3256,0,0,0,13.87772-21.35332q-1.56615-.32858-3.06776-.65165A81.72351,81.72351,0,0,1,315.8701,561.67759Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path3" />
|
||||||
|
<path
|
||||||
|
d="M354.7137,595.82775q-1.15019,1.08949-2.35939,2.109c-.23552.21856-.49252.43522-.7379.64208a82.4401,82.4401,0,0,1-74.51659,16.59042c.1138,1.08323.22759,2.1666.36294,3.25167a85.5013,85.5013,0,0,0,76.12358-17.5054c.32717-.27581.65427-.55157.97158-.83909.80793-.70112,1.59437-1.40414,2.371-2.11878a85.04917,85.04917,0,0,0,24.39782-41.355c-.955-.37409-1.91-.74825-2.87668-1.11248A81.874,81.874,0,0,1,354.7137,595.82775Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path4" />
|
||||||
|
<path
|
||||||
|
d="M384.1004,626.79762c-.75869.75952-1.53717,1.49572-2.32545,2.22029-.84674.77374-1.70328,1.53585-2.57954,2.27457a82.66307,82.66307,0,0,1-98.92522,5.60818c.27211,1.38968.5343,2.76759.82973,4.13747a85.69022,85.69022,0,0,0,100.06542-7.409c.87626-.73872,1.74266-1.48914,2.56785-2.26471.80983-.72274,1.58831-1.45893,2.35679-2.20683a85.43958,85.43958,0,0,0,25.37276-57.38712c-.97424-.6577-1.97364-1.27419-2.98289-1.90237A82.39644,82.39644,0,0,1,384.1004,626.79762Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path5" />
|
||||||
|
<path
|
||||||
|
d="M648.03621,300.20693V215.13007a49.24034,49.24034,0,0,0-49.24-49.24019H418.54942a49.24029,49.24029,0,0,0-49.2406,49.24V271.632h-3.16709v19.90855h3.16709V312.7763h-3.16709v30.52644h3.16709V356.5751h-3.16709v30.52643h3.16709v294.7669a49.23993,49.23993,0,0,0,49.23995,49.24019H598.79561a49.24028,49.24028,0,0,0,49.2406-49.24V360.76613h3.10552v-60.5592Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path6" />
|
||||||
|
<path
|
||||||
|
d="M600.78268,178.70047H577.2545a17.47031,17.47031,0,0,1-16.17511,24.06836H457.81825a17.4703,17.4703,0,0,1-16.17512-24.06839H419.66775a36.772,36.772,0,0,0-36.772,36.772V681.526a36.772,36.772,0,0,0,36.772,36.77205h181.115a36.772,36.772,0,0,0,36.772-36.772h0V215.47244A36.772,36.772,0,0,0,600.78268,178.70047Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path7" />
|
||||||
|
<path
|
||||||
|
d="M605.33827,340.8917H415.11207a5.0058,5.0058,0,0,1-5-5V258.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V335.8917A5.00573,5.00573,0,0,1,605.33827,340.8917Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path8" />
|
||||||
|
<path
|
||||||
|
d="M587.22522,377.41807h-154a5.5,5.5,0,0,1,0-11h154a5.5,5.5,0,0,1,0,11Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path9" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,405.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path10" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,432.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path11" />
|
||||||
|
<path
|
||||||
|
d="M605.33827,571.8917H415.11207a5.0058,5.0058,0,0,1-5-5V489.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V566.8917A5.00573,5.00573,0,0,1,605.33827,571.8917Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path12" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,608.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path13" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,636.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path14" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,663.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path15" />
|
||||||
|
<path
|
||||||
|
d="M760.06605,312.22721c-1.93457-14.18963-4.36084-29.42431-14.3689-39.66754a33.65518,33.65518,0,0,0-48.62622.5033c-7.28515,7.77185-10.50244,18.68475-10.79687,29.33325s2.07714,21.17865,4.708,31.50122a97.0913,97.0913,0,0,0,40.52124-7.97583,65.28916,65.28916,0,0,1,9.71558-3.81427c3.376-.85925,5.78247,1.303,8.92285,2.81073l1.72388-3.30078c1.41113,2.62616,5.78076,1.84772,7.36572-.67737C760.81605,318.41483,760.46888,315.18107,760.06605,312.22721Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path16" />
|
||||||
|
<polygon
|
||||||
|
points="612.434 535.007 602.208 541.77 571.257 505.545 586.349 495.564 612.434 535.007"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="polygon16" />
|
||||||
|
<path
|
||||||
|
d="M896.7595,709.08432,863.787,730.89015l-.27582-.417a15.38729,15.38729,0,0,1,4.34573-21.32122l.00081-.00054,20.13853-13.31819Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path17" />
|
||||||
|
<polygon
|
||||||
|
points="480.429 553.116 468.169 553.116 462.337 505.828 480.431 505.829 480.429 553.116"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="polygon17" />
|
||||||
|
<path
|
||||||
|
d="M758.71777,730.89015l-39.53076-.00146v-.5a15.3873,15.3873,0,0,1,15.38647-15.38623h.001l24.144.001Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path18" />
|
||||||
|
<path
|
||||||
|
d="M668.3639,394.03709l-46.28906-33.06561a8.99743,8.99743,0,1,0-10.80762,7.74816c5.78613,4.85816,48.04785,46.88825,54.09888,44.67127,6.1416-2.25012,32.99341-6.32324,32.99341-6.32324l.74755-25.4953Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="path19" />
|
||||||
|
<path
|
||||||
|
d="M704.73272,454.19782l.437,58.1781s10.01741,86.201,13.712,100.76318,18.69148,81.94564,18.69148,81.94564l24.3788-3.93292-15.69975-88.09791,4.74535-73.017,27.36445,73.178L847.847,675.848l17.61024-14.2095-60.48051-88.88116-18.47283-72.811s2.29785-37.66031-18.40081-52.16322Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path20" />
|
||||||
|
<circle
|
||||||
|
cx="443.5739"
|
||||||
|
cy="133.65539"
|
||||||
|
r="26.72083"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="circle20" />
|
||||||
|
<rect
|
||||||
|
x="722.98731"
|
||||||
|
y="465.33587"
|
||||||
|
width="24.29166"
|
||||||
|
height="31.57916"
|
||||||
|
transform="translate(-279.66359 789.41207) rotate(-65.86746)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="rect20" />
|
||||||
|
<path
|
||||||
|
d="M593.23271,362.65743"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path21" />
|
||||||
|
<path
|
||||||
|
d="M761.53382,350.95884c-3.14892-6.267-4.67895-14.009-11.39209-16.04077-4.5332-1.372-22.86841.68408-27,3-6.87231,3.85236-.64453,11.07111-4.699,17.82642q-6.61121,11.01552-13.22241,22.031c-3.03,5.04852-6.0918,10.16889-7.73023,15.82434-1.63818,5.65546-1.717,12.00305,1.074,17.18756,2.4978,4.64045,7.02294,7.93158,9.53515,12.56433,2.61231,4.81806-2.07715,26.33136-4.50854,31.24341l1.167.539a263.08934,263.08934,0,0,0,48.448-1.63024c3.9873-.50489,8.12744-1.16449,11.41308-3.47895,4.83985-3.40918,6.75318-9.5954,7.949-15.39337A129.67713,129.67713,0,0,0,761.53382,350.95884Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path22" />
|
||||||
|
<path
|
||||||
|
d="M706.84845,411.65133c7.23924-7.1146,14.51542-14.27181,20.47486-22.48827s10.5936-17.62115,11.88744-27.68835a20.50914,20.50914,0,0,0-.64136-9.62007c-1.11054-3.049-3.56912-5.755-6.73861-6.45068-5.07194-1.11355-9.6829,2.93435-13.30226,6.6577q-16.00732,16.46812-32.01478,32.936,10.19649,13.42191,20.393,26.84353Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path23" />
|
||||||
|
<path
|
||||||
|
d="M785.75257,417.13127c-2.25-6.14148-6.32324-32.99323-6.32324-32.99323l-25.49512-.74756,12.4646,30.7431-34.01367,47.61615s.063.10462.17749.2912a8.99538,8.99538,0,1,0,7.54468,9.55927.62106.62106,0,0,0,.77978-.13385C744.67176,466.7169,788.00257,423.27281,785.75257,417.13127Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="path24" />
|
||||||
|
<path
|
||||||
|
d="M788.34461,400.17338c-2.34008-9.87665-4.69751-19.807-8.64282-29.15894s-9.59326-18.18512-17.53711-24.50317a20.50909,20.50909,0,0,0-8.563-4.43085c-3.18359-.62805-6.77148.07483-9.00732,2.42658-3.57813,3.76318-2.50147,9.80365-1.18921,14.8277q5.80444,22.2203,11.60864,44.44061,16.76184-1.77667,33.52344-3.55347Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path25" />
|
||||||
|
<path
|
||||||
|
d="M752.14124,301.6237c-.83545-6.464-1.708-12.98224-3.67065-19.06879-1.96265-6.08661-5.12622-11.78747-9.66431-15.23547-7.1853-5.459-16.488-4.40613-24.54394-1.266-6.23,2.42846-12.31153,6.1195-16.70484,12.05346-4.39355,5.934-6.86108,14.40119-5.2268,22.1601q12.88989-3.58722,25.77954-7.1745l-.94068.783c5.57642,3.14221,9.81153,9.64361,11.07691,17.00482a28.7171,28.7171,0,0,1-4.53662,21.03778q8.79089-3.67337,17.58178-7.34662c3.61744-1.51153,7.489-3.25317,9.634-7.13025C753.41273,312.94608,752.83485,306.98814,752.14124,301.6237Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path26" />
|
||||||
|
<path
|
||||||
|
d="M625.98113,343.51431,608.792,369.31226a4.46863,4.46863,0,0,1-3.75549,2.00125,4.47943,4.47943,0,0,1-4.13509-2.75491,4.12763,4.12763,0,0,1-.2689-.85745,4.51165,4.51165,0,0,1,.66976-3.37929l17.18913-25.79794a4.5,4.5,0,1,1,7.48973,4.99039Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path27" />
|
||||||
|
<path
|
||||||
|
d="M610.17821,367.23178l-3.47923,5.19091-6.15652,5.42689a2.45095,2.45095,0,0,1-3.94221-2.627l2.69471-7.8881,3.39353-5.09311Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path28" />
|
||||||
|
<path
|
||||||
|
d="M626.74053,329.98545l-8.6142,7.59289a2.45233,2.45233,0,0,0,.26168,3.88081l1.62984,1.086-4.71315,7.07363a1,1,0,0,0,1.66439,1.109l4.71314-7.07362,1.62985,1.086a2.45552,2.45552,0,0,0,3.39872-.675,2.46816,2.46816,0,0,0,.28357-.57793l3.69013-10.8738a2.45251,2.45251,0,0,0-3.944-2.62786Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path29" />
|
||||||
|
<path
|
||||||
|
d="M516.97522,187.41807h-27a2,2,0,0,1,0-4h27a2,2,0,0,1,0,4Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path31" />
|
||||||
|
<circle
|
||||||
|
cx="255.31291"
|
||||||
|
cy="19.52819"
|
||||||
|
r="2"
|
||||||
|
fill="#fff"
|
||||||
|
id="circle31" />
|
||||||
|
</svg>
|
||||||
|
After Width: | Height: | Size: 12 KiB |
1
public/thank-you.svg
Normal file
1
public/thank-you.svg
Normal file
File diff suppressed because one or more lines are too long
|
After Width: | Height: | Size: 17 KiB |
235
public/zaps.svg
Normal file
235
public/zaps.svg
Normal file
@@ -0,0 +1,235 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
|
||||||
|
<svg
|
||||||
|
width="720.44"
|
||||||
|
height="718.635"
|
||||||
|
viewBox="0 0 720.44 718.635"
|
||||||
|
role="img"
|
||||||
|
artist="Katerina Limpitsouni"
|
||||||
|
source="https://undraw.co/"
|
||||||
|
version="1.1"
|
||||||
|
id="svg30"
|
||||||
|
sodipodi:docname="zaps.svg"
|
||||||
|
xml:space="preserve"
|
||||||
|
inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
|
||||||
|
xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
|
||||||
|
xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
|
||||||
|
xmlns="http://www.w3.org/2000/svg"
|
||||||
|
xmlns:svg="http://www.w3.org/2000/svg"><defs
|
||||||
|
id="defs30" /><sodipodi:namedview
|
||||||
|
id="namedview30"
|
||||||
|
pagecolor="#ffffff"
|
||||||
|
bordercolor="#000000"
|
||||||
|
borderopacity="0.25"
|
||||||
|
inkscape:showpageshadow="2"
|
||||||
|
inkscape:pageopacity="0.0"
|
||||||
|
inkscape:pagecheckerboard="0"
|
||||||
|
inkscape:deskcolor="#d1d1d1"
|
||||||
|
inkscape:zoom="2.6746164"
|
||||||
|
inkscape:cx="38.510195"
|
||||||
|
inkscape:cy="485.67712"
|
||||||
|
inkscape:window-width="3840"
|
||||||
|
inkscape:window-height="1027"
|
||||||
|
inkscape:window-x="0"
|
||||||
|
inkscape:window-y="25"
|
||||||
|
inkscape:window-maximized="0"
|
||||||
|
inkscape:current-layer="g27" /><g
|
||||||
|
transform="translate(-600 -181)"
|
||||||
|
id="g30"><g
|
||||||
|
transform="translate(783.85 181)"
|
||||||
|
id="g2"><path
|
||||||
|
d="M624.7,249.968h-3.952V141.8a62.6,62.6,0,0,0-62.6-62.6H328.97a62.6,62.6,0,0,0-62.6,62.6V735.225a62.6,62.6,0,0,0,62.6,62.6H558.143a62.6,62.6,0,0,0,62.6-62.6V326.965H624.7Z"
|
||||||
|
transform="translate(-266.365 -79.193)"
|
||||||
|
fill="#090814"
|
||||||
|
id="path1" /><path
|
||||||
|
d="M560.888,95.686H530.974a22.212,22.212,0,0,1-20.565,30.6h-131.3a22.212,22.212,0,0,1-20.566-30.6H330.607a46.752,46.752,0,0,0-46.752,46.752V735a46.752,46.752,0,0,0,46.752,46.752H560.879A46.752,46.752,0,0,0,607.63,735V142.439a46.752,46.752,0,0,0-46.744-46.752Z"
|
||||||
|
transform="translate(-266.577 -79.397)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path2" /></g><path
|
||||||
|
d="M8,0H256a8,8,0,0,1,8,8V72a8,8,0,0,1-8,8H8a8,8,0,0,1-8-8V8A8,8,0,0,1,8,0Z"
|
||||||
|
transform="translate(828 265)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path3" /><path
|
||||||
|
d="M8,0H256a8.065,8.065,0,0,1,8,8.128V475.474a8.065,8.065,0,0,1-8,8.128H8a8.065,8.065,0,0,1-8-8.128V8.128A8.065,8.065,0,0,1,8,0Z"
|
||||||
|
transform="translate(828 358.398)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path4" /><g
|
||||||
|
transform="translate(623.104 296.398)"
|
||||||
|
id="g9"><rect
|
||||||
|
width="278.304"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect4" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect5" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-53.047 -325.676)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path5" /><g
|
||||||
|
transform="translate(17.038 13.546)"
|
||||||
|
id="g7"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path6" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.7844991 20.830193,9.2808662 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(72.886 17.036)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path8" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(72.886 37.98)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path9" /></g><g
|
||||||
|
transform="translate(1003.278 402.469)"
|
||||||
|
id="g14"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect9" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect10" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.751 -325.287)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path10" /><g
|
||||||
|
transform="translate(17.334 13.936)"
|
||||||
|
id="g12"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path11" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-7"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.181 17.426)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path13" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.181 38.369)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path14" /></g><g
|
||||||
|
transform="translate(663.012 510.639)"
|
||||||
|
id="g19"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect14" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect15" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.814 -325.25)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path15" /><g
|
||||||
|
transform="translate(17.272 13.972)"
|
||||||
|
id="g17"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path16" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-0"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.119 17.463)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path18" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.119 38.406)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path19" /></g><g
|
||||||
|
transform="translate(1041.086 616.711)"
|
||||||
|
id="g24"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="70.364"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect19" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(4.201 4.201)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect20" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.163 -324.86)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path20" /><g
|
||||||
|
transform="translate(17.922 14.362)"
|
||||||
|
id="g22"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path21" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-9"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.77 17.853)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path23" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.77 38.796)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path24" /></g><g
|
||||||
|
transform="translate(600 723.832)"
|
||||||
|
id="g29"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect24" /><rect
|
||||||
|
width="273.053"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect25" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.631 -325.518)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path25" /><g
|
||||||
|
transform="translate(17.454 13.704)"
|
||||||
|
id="g27"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path26" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-98"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.301 17.194)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path28" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.301 38.138)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path29" /></g></g></svg>
|
||||||
|
After Width: | Height: | Size: 17 KiB |
295
src/App.tsx
295
src/App.tsx
@@ -4,16 +4,21 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
|||||||
import { faSpinner } from '@fortawesome/free-solid-svg-icons'
|
import { faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { EventStoreProvider, AccountsProvider, Hooks } from 'applesauce-react'
|
import { EventStoreProvider, AccountsProvider, Hooks } from 'applesauce-react'
|
||||||
import { EventStore } from 'applesauce-core'
|
import { EventStore } from 'applesauce-core'
|
||||||
import { AccountManager } from 'applesauce-accounts'
|
import { AccountManager, Accounts } from 'applesauce-accounts'
|
||||||
import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
|
import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from './services/nostrConnect'
|
||||||
import { createAddressLoader } from 'applesauce-loaders/loaders'
|
import { createAddressLoader } from 'applesauce-loaders/loaders'
|
||||||
|
import Debug from './components/Debug'
|
||||||
import Bookmarks from './components/Bookmarks'
|
import Bookmarks from './components/Bookmarks'
|
||||||
|
import RouteDebug from './components/RouteDebug'
|
||||||
import Toast from './components/Toast'
|
import Toast from './components/Toast'
|
||||||
import { useToast } from './hooks/useToast'
|
import { useToast } from './hooks/useToast'
|
||||||
import { useOnlineStatus } from './hooks/useOnlineStatus'
|
import { useOnlineStatus } from './hooks/useOnlineStatus'
|
||||||
import { RELAYS } from './config/relays'
|
import { RELAYS } from './config/relays'
|
||||||
import { SkeletonThemeProvider } from './components/Skeletons'
|
import { SkeletonThemeProvider } from './components/Skeletons'
|
||||||
|
import { DebugBus } from './utils/debugBus'
|
||||||
|
|
||||||
const DEFAULT_ARTICLE = import.meta.env.VITE_DEFAULT_ARTICLE_NADDR ||
|
const DEFAULT_ARTICLE = import.meta.env.VITE_DEFAULT_ARTICLE_NADDR ||
|
||||||
'naddr1qvzqqqr4gupzqmjxss3dld622uu8q25gywum9qtg4w4cv4064jmg20xsac2aam5nqqxnzd3cxqmrzv3exgmr2wfesgsmew'
|
'naddr1qvzqqqr4gupzqmjxss3dld622uu8q25gywum9qtg4w4cv4064jmg20xsac2aam5nqqxnzd3cxqmrzv3exgmr2wfesgsmew'
|
||||||
@@ -62,6 +67,15 @@ function AppRoutes({
|
|||||||
/>
|
/>
|
||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
|
<Route
|
||||||
|
path="/support"
|
||||||
|
element={
|
||||||
|
<Bookmarks
|
||||||
|
relayPool={relayPool}
|
||||||
|
onLogout={handleLogout}
|
||||||
|
/>
|
||||||
|
}
|
||||||
|
/>
|
||||||
<Route
|
<Route
|
||||||
path="/explore"
|
path="/explore"
|
||||||
element={
|
element={
|
||||||
@@ -103,7 +117,25 @@ function AppRoutes({
|
|||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
<Route
|
<Route
|
||||||
path="/me/archive"
|
path="/me/reads"
|
||||||
|
element={
|
||||||
|
<Bookmarks
|
||||||
|
relayPool={relayPool}
|
||||||
|
onLogout={handleLogout}
|
||||||
|
/>
|
||||||
|
}
|
||||||
|
/>
|
||||||
|
<Route
|
||||||
|
path="/me/reads/:filter"
|
||||||
|
element={
|
||||||
|
<Bookmarks
|
||||||
|
relayPool={relayPool}
|
||||||
|
onLogout={handleLogout}
|
||||||
|
/>
|
||||||
|
}
|
||||||
|
/>
|
||||||
|
<Route
|
||||||
|
path="/me/links"
|
||||||
element={
|
element={
|
||||||
<Bookmarks
|
<Bookmarks
|
||||||
relayPool={relayPool}
|
relayPool={relayPool}
|
||||||
@@ -138,6 +170,7 @@ function AppRoutes({
|
|||||||
/>
|
/>
|
||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
|
<Route path="/debug" element={<Debug />} />
|
||||||
<Route path="/" element={<Navigate to={`/a/${DEFAULT_ARTICLE}`} replace />} />
|
<Route path="/" element={<Navigate to={`/a/${DEFAULT_ARTICLE}`} replace />} />
|
||||||
</Routes>
|
</Routes>
|
||||||
)
|
)
|
||||||
@@ -159,20 +192,57 @@ function App() {
|
|||||||
// Register common account types (needed for deserialization)
|
// Register common account types (needed for deserialization)
|
||||||
registerCommonAccountTypes(accounts)
|
registerCommonAccountTypes(accounts)
|
||||||
|
|
||||||
|
// Create relay pool and set it up BEFORE loading accounts
|
||||||
|
// NostrConnectAccount.fromJSON needs this to restore the signer
|
||||||
|
const pool = new RelayPool()
|
||||||
|
// Wire the signer to use this pool; make publish non-blocking so callers don't
|
||||||
|
// wait for every relay send to finish. Responses still resolve the pending request.
|
||||||
|
NostrConnectSigner.subscriptionMethod = pool.subscription.bind(pool)
|
||||||
|
NostrConnectSigner.publishMethod = (relays: string[], event: unknown) => {
|
||||||
|
const result: any = pool.publish(relays, event as any)
|
||||||
|
if (result && typeof (result as any).subscribe === 'function') {
|
||||||
|
try { (result as any).subscribe({ complete: () => {}, error: () => {} }) } catch {}
|
||||||
|
}
|
||||||
|
// Return an already-resolved promise so upstream await finishes immediately
|
||||||
|
return Promise.resolve()
|
||||||
|
}
|
||||||
|
console.log('[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription (before account load)')
|
||||||
|
|
||||||
|
// Create a relay group for better event deduplication and management
|
||||||
|
pool.group(RELAYS)
|
||||||
|
console.log('[bunker] Created relay group with', RELAYS.length, 'relays (including local)')
|
||||||
|
|
||||||
// Load persisted accounts from localStorage
|
// Load persisted accounts from localStorage
|
||||||
try {
|
try {
|
||||||
const json = JSON.parse(localStorage.getItem('accounts') || '[]')
|
const accountsJson = localStorage.getItem('accounts')
|
||||||
|
console.log('[bunker] Raw accounts from localStorage:', accountsJson)
|
||||||
|
|
||||||
|
const json = JSON.parse(accountsJson || '[]')
|
||||||
|
console.log('[bunker] Parsed accounts:', json.length, 'accounts')
|
||||||
|
|
||||||
await accounts.fromJSON(json)
|
await accounts.fromJSON(json)
|
||||||
console.log('Loaded', accounts.accounts.length, 'accounts from storage')
|
console.log('[bunker] Loaded', accounts.accounts.length, 'accounts from storage')
|
||||||
|
console.log('[bunker] Account types:', accounts.accounts.map(a => ({ id: a.id, type: a.type })))
|
||||||
|
|
||||||
// Load active account from storage
|
// Load active account from storage
|
||||||
const activeId = localStorage.getItem('active')
|
const activeId = localStorage.getItem('active')
|
||||||
if (activeId && accounts.getAccount(activeId)) {
|
console.log('[bunker] Active ID from localStorage:', activeId)
|
||||||
accounts.setActive(activeId)
|
|
||||||
console.log('Restored active account:', activeId)
|
if (activeId) {
|
||||||
|
const account = accounts.getAccount(activeId)
|
||||||
|
console.log('[bunker] Found account for ID?', !!account, account?.type)
|
||||||
|
|
||||||
|
if (account) {
|
||||||
|
accounts.setActive(activeId)
|
||||||
|
console.log('[bunker] ✅ Restored active account:', activeId, 'type:', account.type)
|
||||||
|
} else {
|
||||||
|
console.warn('[bunker] ⚠️ Active ID found but account not in list')
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] No active account ID in localStorage')
|
||||||
}
|
}
|
||||||
} catch (err) {
|
} catch (err) {
|
||||||
console.error('Failed to load accounts from storage:', err)
|
console.error('[bunker] ❌ Failed to load accounts from storage:', err)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Subscribe to accounts changes and persist to localStorage
|
// Subscribe to accounts changes and persist to localStorage
|
||||||
@@ -189,12 +259,197 @@ function App() {
|
|||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
const pool = new RelayPool()
|
// Reconnect bunker signers when active account changes
|
||||||
|
// Keep track of which accounts we've already reconnected to avoid double-connecting
|
||||||
|
const reconnectedAccounts = new Set<string>()
|
||||||
|
|
||||||
// Create a relay group for better event deduplication and management
|
const bunkerReconnectSub = accounts.active$.subscribe(async (account) => {
|
||||||
pool.group(RELAYS)
|
console.log('[bunker] Active account changed:', {
|
||||||
console.log('Created relay group with', RELAYS.length, 'relays (including local)')
|
hasAccount: !!account,
|
||||||
console.log('Relay URLs:', RELAYS)
|
type: account?.type,
|
||||||
|
id: account?.id
|
||||||
|
})
|
||||||
|
|
||||||
|
if (account && account.type === 'nostr-connect') {
|
||||||
|
const nostrConnectAccount = account as Accounts.NostrConnectAccount<unknown>
|
||||||
|
// Disable applesauce account queueing so decrypt requests aren't serialized behind earlier ops
|
||||||
|
try {
|
||||||
|
if (!(nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue) {
|
||||||
|
(nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue = true
|
||||||
|
console.log('[bunker] ⚙️ Disabled account request queueing for nostr-connect')
|
||||||
|
}
|
||||||
|
} catch (err) { console.warn('[bunker] failed to disable queue', err) }
|
||||||
|
// Note: for Amber bunker, the remote signer pubkey is the user's pubkey. This is expected.
|
||||||
|
|
||||||
|
// Skip if we've already reconnected this account
|
||||||
|
if (reconnectedAccounts.has(account.id)) {
|
||||||
|
console.log('[bunker] ⏭️ Already reconnected this account, skipping')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('[bunker] Account detected. Status:', {
|
||||||
|
listening: nostrConnectAccount.signer.listening,
|
||||||
|
isConnected: nostrConnectAccount.signer.isConnected,
|
||||||
|
hasRemote: !!nostrConnectAccount.signer.remote,
|
||||||
|
bunkerRelays: nostrConnectAccount.signer.relays
|
||||||
|
})
|
||||||
|
|
||||||
|
try {
|
||||||
|
// For restored signers, ensure they have the pool's subscription methods
|
||||||
|
// The signer was created in fromJSON without pool context, so we need to recreate it
|
||||||
|
const signerData = nostrConnectAccount.toJSON().signer
|
||||||
|
|
||||||
|
// Add bunker's relays to the pool BEFORE recreating the signer
|
||||||
|
// This ensures the pool has all relays when the signer sets up its methods
|
||||||
|
const bunkerRelays = signerData.relays || []
|
||||||
|
const existingRelayUrls = new Set(Array.from(pool.relays.keys()))
|
||||||
|
const newBunkerRelays = bunkerRelays.filter(url => !existingRelayUrls.has(url))
|
||||||
|
|
||||||
|
if (newBunkerRelays.length > 0) {
|
||||||
|
console.log('[bunker] Adding bunker relays to pool BEFORE signer recreation:', newBunkerRelays)
|
||||||
|
pool.group(newBunkerRelays)
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] Bunker relays already in pool')
|
||||||
|
}
|
||||||
|
|
||||||
|
const recreatedSigner = new NostrConnectSigner({
|
||||||
|
relays: signerData.relays,
|
||||||
|
pubkey: nostrConnectAccount.pubkey,
|
||||||
|
remote: signerData.remote,
|
||||||
|
signer: nostrConnectAccount.signer.signer, // Use the existing SimpleSigner
|
||||||
|
pool: pool
|
||||||
|
})
|
||||||
|
// Ensure local relays are included for NIP-46 request/response traffic (e.g., Amber bunker)
|
||||||
|
try {
|
||||||
|
const mergedRelays = Array.from(new Set([...(signerData.relays || []), ...RELAYS]))
|
||||||
|
recreatedSigner.relays = mergedRelays
|
||||||
|
console.log('[bunker] 🔗 Signer relays merged with app RELAYS:', mergedRelays)
|
||||||
|
} catch (err) { console.warn('[bunker] failed to merge signer relays', err) }
|
||||||
|
|
||||||
|
// Replace the signer on the account
|
||||||
|
nostrConnectAccount.signer = recreatedSigner
|
||||||
|
console.log('[bunker] ✅ Signer recreated with pool context')
|
||||||
|
|
||||||
|
// Debug: log publish/subscription calls made by signer (decrypt/sign requests)
|
||||||
|
// IMPORTANT: bind originals to preserve `this` context used internally by the signer
|
||||||
|
const originalPublish = (recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod.bind(recreatedSigner)
|
||||||
|
;(recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod = (relays: string[], event: unknown) => {
|
||||||
|
try {
|
||||||
|
let method: string | undefined
|
||||||
|
const content = (event as { content?: unknown })?.content
|
||||||
|
if (typeof content === 'string') {
|
||||||
|
try {
|
||||||
|
const parsed = JSON.parse(content) as { method?: string; id?: unknown }
|
||||||
|
method = parsed?.method
|
||||||
|
} catch (err) { console.warn('[bunker] failed to parse event content', err) }
|
||||||
|
}
|
||||||
|
const summary = {
|
||||||
|
relays,
|
||||||
|
kind: (event as { kind?: number })?.kind,
|
||||||
|
method,
|
||||||
|
// include tags array for debugging (NIP-46 expects method tag)
|
||||||
|
tags: (event as { tags?: unknown })?.tags,
|
||||||
|
contentLength: typeof content === 'string' ? content.length : undefined
|
||||||
|
}
|
||||||
|
console.log('[bunker] publish via signer:', summary)
|
||||||
|
try { DebugBus.info('bunker', 'publish', summary) } catch (err) { console.warn('[bunker] failed to log to DebugBus', err) }
|
||||||
|
} catch (err) { console.warn('[bunker] failed to log publish summary', err) }
|
||||||
|
// Fire-and-forget publish: trigger the publish but do not return the
|
||||||
|
// Observable/Promise to upstream to avoid their awaiting of completion.
|
||||||
|
const result = originalPublish(relays, event)
|
||||||
|
if (result && typeof (result as { subscribe?: unknown }).subscribe === 'function') {
|
||||||
|
try { (result as { subscribe: (h: { complete?: () => void; error?: (e: unknown) => void }) => unknown }).subscribe({ complete: () => {}, error: () => {} }) } catch {}
|
||||||
|
}
|
||||||
|
// If it's a Promise, simply ignore it (no await) so it resolves in the background.
|
||||||
|
// Return a benign object so callers that probe for a "subscribe" property
|
||||||
|
// (e.g., applesauce makeRequest) won't throw on `"subscribe" in result`.
|
||||||
|
return {} as unknown as never
|
||||||
|
}
|
||||||
|
const originalSubscribe = (recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod.bind(recreatedSigner)
|
||||||
|
;(recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod = (relays: string[], filters: unknown[]) => {
|
||||||
|
try {
|
||||||
|
console.log('[bunker] subscribe via signer:', { relays, filters })
|
||||||
|
try { DebugBus.info('bunker', 'subscribe', { relays, filters }) } catch (err) { console.warn('[bunker] failed to log subscribe to DebugBus', err) }
|
||||||
|
} catch (err) { console.warn('[bunker] failed to log subscribe summary', err) }
|
||||||
|
return originalSubscribe(relays, filters)
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// Just ensure the signer is listening for responses - don't call connect() again
|
||||||
|
// The fromBunkerURI already connected with permissions during login
|
||||||
|
if (!nostrConnectAccount.signer.listening) {
|
||||||
|
console.log('[bunker] Opening signer subscription...')
|
||||||
|
await nostrConnectAccount.signer.open()
|
||||||
|
console.log('[bunker] ✅ Signer subscription opened')
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] ✅ Signer already listening')
|
||||||
|
}
|
||||||
|
|
||||||
|
// Attempt a guarded reconnect to ensure Amber authorizes decrypt operations
|
||||||
|
try {
|
||||||
|
if (nostrConnectAccount.signer.remote && !reconnectedAccounts.has(account.id)) {
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
console.log('[bunker] Attempting guarded connect() with permissions to ensure decrypt perms', { count: permissions.length })
|
||||||
|
await nostrConnectAccount.signer.connect(undefined, permissions)
|
||||||
|
console.log('[bunker] ✅ Guarded connect() succeeded with permissions')
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('[bunker] ⚠️ Guarded connect() failed:', e)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Give the subscription a moment to fully establish before allowing decrypt operations
|
||||||
|
// This ensures the signer is ready to handle and receive responses
|
||||||
|
await new Promise(resolve => setTimeout(resolve, 100))
|
||||||
|
console.log("[bunker] Subscription ready after startup delay")
|
||||||
|
// Fire-and-forget: probe decrypt path to verify Amber responds to NIP-46 decrypt
|
||||||
|
try {
|
||||||
|
const withTimeout = async <T,>(p: Promise<T>, ms = 10000): Promise<T> => {
|
||||||
|
return await Promise.race([
|
||||||
|
p,
|
||||||
|
new Promise<T>((_, rej) => setTimeout(() => rej(new Error(`probe timeout after ${ms}ms`)), ms)),
|
||||||
|
])
|
||||||
|
}
|
||||||
|
setTimeout(async () => {
|
||||||
|
const self = nostrConnectAccount.pubkey
|
||||||
|
// Try a roundtrip so the bunker can respond successfully
|
||||||
|
try {
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)…')
|
||||||
|
const cipher44 = await withTimeout(nostrConnectAccount.signer.nip44!.encrypt(self, 'probe-nip44'))
|
||||||
|
const plain44 = await withTimeout(nostrConnectAccount.signer.nip44!.decrypt(self, cipher44))
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 responded:', typeof plain44 === 'string' ? plain44 : typeof plain44)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 result:', err instanceof Error ? err.message : err)
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)…')
|
||||||
|
const cipher04 = await withTimeout(nostrConnectAccount.signer.nip04!.encrypt(self, 'probe-nip04'))
|
||||||
|
const plain04 = await withTimeout(nostrConnectAccount.signer.nip04!.decrypt(self, cipher04))
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 responded:', typeof plain04 === 'string' ? plain04 : typeof plain04)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 result:', err instanceof Error ? err.message : err)
|
||||||
|
}
|
||||||
|
}, 0)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe setup failed:', err)
|
||||||
|
}
|
||||||
|
// The bunker remembers the permissions from the initial connection
|
||||||
|
nostrConnectAccount.signer.isConnected = true
|
||||||
|
|
||||||
|
console.log('[bunker] Final signer status:', {
|
||||||
|
listening: nostrConnectAccount.signer.listening,
|
||||||
|
isConnected: nostrConnectAccount.signer.isConnected,
|
||||||
|
remote: nostrConnectAccount.signer.remote,
|
||||||
|
relays: nostrConnectAccount.signer.relays
|
||||||
|
})
|
||||||
|
|
||||||
|
// Mark this account as reconnected
|
||||||
|
reconnectedAccounts.add(account.id)
|
||||||
|
console.log('[bunker] 🎉 Signer ready for signing')
|
||||||
|
} catch (error) {
|
||||||
|
console.error('[bunker] ❌ Failed to open signer:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
// Keep all relay connections alive indefinitely by creating a persistent subscription
|
// Keep all relay connections alive indefinitely by creating a persistent subscription
|
||||||
// This prevents disconnection when no other subscriptions are active
|
// This prevents disconnection when no other subscriptions are active
|
||||||
@@ -206,8 +461,7 @@ function App() {
|
|||||||
console.log('🔗 Created keep-alive subscription for', RELAYS.length, 'relay(s)')
|
console.log('🔗 Created keep-alive subscription for', RELAYS.length, 'relay(s)')
|
||||||
|
|
||||||
// Store subscription for cleanup
|
// Store subscription for cleanup
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
;(pool as unknown as { _keepAliveSubscription: typeof keepAliveSub })._keepAliveSubscription = keepAliveSub
|
||||||
;(pool as any)._keepAliveSubscription = keepAliveSub
|
|
||||||
|
|
||||||
// Attach address/replaceable loaders so ProfileModel can fetch profiles
|
// Attach address/replaceable loaders so ProfileModel can fetch profiles
|
||||||
const addressLoader = createAddressLoader(pool, {
|
const addressLoader = createAddressLoader(pool, {
|
||||||
@@ -225,11 +479,11 @@ function App() {
|
|||||||
return () => {
|
return () => {
|
||||||
accountsSub.unsubscribe()
|
accountsSub.unsubscribe()
|
||||||
activeSub.unsubscribe()
|
activeSub.unsubscribe()
|
||||||
|
bunkerReconnectSub.unsubscribe()
|
||||||
// Clean up keep-alive subscription if it exists
|
// Clean up keep-alive subscription if it exists
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
|
||||||
if ((pool as any)._keepAliveSubscription) {
|
if (poolWithSub._keepAliveSubscription) {
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
poolWithSub._keepAliveSubscription.unsubscribe()
|
||||||
(pool as any)._keepAliveSubscription.unsubscribe()
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -242,7 +496,7 @@ function App() {
|
|||||||
return () => {
|
return () => {
|
||||||
if (cleanup) cleanup()
|
if (cleanup) cleanup()
|
||||||
}
|
}
|
||||||
}, [])
|
}, [isOnline, showToast])
|
||||||
|
|
||||||
// Monitor online/offline status
|
// Monitor online/offline status
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -278,6 +532,7 @@ function App() {
|
|||||||
<BrowserRouter>
|
<BrowserRouter>
|
||||||
<div className="min-h-screen p-0 max-w-none m-0 relative">
|
<div className="min-h-screen p-0 max-w-none m-0 relative">
|
||||||
<AppRoutes relayPool={relayPool} showToast={showToast} />
|
<AppRoutes relayPool={relayPool} showToast={showToast} />
|
||||||
|
<RouteDebug />
|
||||||
</div>
|
</div>
|
||||||
</BrowserRouter>
|
</BrowserRouter>
|
||||||
{toastMessage && (
|
{toastMessage && (
|
||||||
|
|||||||
@@ -140,8 +140,7 @@ const AddBookmarkModal: React.FC<AddBookmarkModalProps> = ({ onClose, onSave })
|
|||||||
clearTimeout(fetchTimeoutRef.current)
|
clearTimeout(fetchTimeoutRef.current)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// eslint-disable-next-line react-hooks/exhaustive-deps
|
}, [url, title, description, tagsInput])
|
||||||
}, [url]) // Only depend on url - title, description, tagsInput are intentionally checked but not dependencies
|
|
||||||
|
|
||||||
const handleSubmit = async (e: React.FormEvent) => {
|
const handleSubmit = async (e: React.FormEvent) => {
|
||||||
e.preventDefault()
|
e.preventDefault()
|
||||||
|
|||||||
47
src/components/ArchiveFilters.tsx
Normal file
47
src/components/ArchiveFilters.tsx
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faBookOpen, faBookmark, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { faBooks } from '../icons/customIcons'
|
||||||
|
|
||||||
|
export type ArchiveFilterType = 'all' | 'to-read' | 'reading' | 'completed' | 'marked'
|
||||||
|
|
||||||
|
interface ArchiveFiltersProps {
|
||||||
|
selectedFilter: ArchiveFilterType
|
||||||
|
onFilterChange: (filter: ArchiveFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const ArchiveFilters: React.FC<ArchiveFiltersProps> = ({ selectedFilter, onFilterChange }) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'to-read' as const, icon: faBookmark, label: 'To Read' },
|
||||||
|
{ type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
|
||||||
|
{ type: 'completed' as const, icon: faCheckCircle, label: 'Completed' },
|
||||||
|
{ type: 'marked' as const, icon: faBooks, label: 'Marked as Read' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => {
|
||||||
|
const isActive = selectedFilter === filter.type
|
||||||
|
// Only "completed" gets green color, everything else uses default blue
|
||||||
|
const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
|
||||||
|
|
||||||
|
return (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${isActive ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
style={activeStyle}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
)
|
||||||
|
})}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default ArchiveFilters
|
||||||
|
|
||||||
@@ -10,9 +10,11 @@ import { Models } from 'applesauce-core'
|
|||||||
interface BlogPostCardProps {
|
interface BlogPostCardProps {
|
||||||
post: BlogPostPreview
|
post: BlogPostPreview
|
||||||
href: string
|
href: string
|
||||||
|
level?: 'mine' | 'friends' | 'nostrverse'
|
||||||
|
readingProgress?: number // 0-1 reading progress (optional)
|
||||||
}
|
}
|
||||||
|
|
||||||
const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href }) => {
|
const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress }) => {
|
||||||
const profile = useEventModel(Models.ProfileModel, [post.author])
|
const profile = useEventModel(Models.ProfileModel, [post.author])
|
||||||
const displayName = profile?.name || profile?.display_name ||
|
const displayName = profile?.name || profile?.display_name ||
|
||||||
`${post.author.slice(0, 8)}...${post.author.slice(-4)}`
|
`${post.author.slice(0, 8)}...${post.author.slice(-4)}`
|
||||||
@@ -22,10 +24,20 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href }) => {
|
|||||||
addSuffix: true
|
addSuffix: true
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Calculate progress percentage and determine color (matching readingProgressUtils.ts logic)
|
||||||
|
const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
|
||||||
|
let progressColor = '#6366f1' // Default blue (reading)
|
||||||
|
|
||||||
|
if (readingProgress && readingProgress >= 0.95) {
|
||||||
|
progressColor = '#10b981' // Green (completed)
|
||||||
|
} else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
|
||||||
|
progressColor = 'var(--color-text)' // Neutral text color (started)
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<Link
|
<Link
|
||||||
to={href}
|
to={href}
|
||||||
className="blog-post-card"
|
className={`blog-post-card ${level ? `level-${level}` : ''}`}
|
||||||
style={{ textDecoration: 'none', color: 'inherit' }}
|
style={{ textDecoration: 'none', color: 'inherit' }}
|
||||||
>
|
>
|
||||||
<div className="blog-post-card-image">
|
<div className="blog-post-card-image">
|
||||||
@@ -46,7 +58,37 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href }) => {
|
|||||||
{post.summary && (
|
{post.summary && (
|
||||||
<p className="blog-post-card-summary">{post.summary}</p>
|
<p className="blog-post-card-summary">{post.summary}</p>
|
||||||
)}
|
)}
|
||||||
<div className="blog-post-card-meta">
|
|
||||||
|
{/* Reading progress indicator - replaces the dividing line */}
|
||||||
|
{readingProgress !== undefined && readingProgress > 0 ? (
|
||||||
|
<div
|
||||||
|
className="blog-post-reading-progress"
|
||||||
|
style={{
|
||||||
|
height: '3px',
|
||||||
|
width: '100%',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
overflow: 'hidden',
|
||||||
|
marginTop: '1rem'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '100%',
|
||||||
|
width: `${progressPercent}%`,
|
||||||
|
background: progressColor,
|
||||||
|
transition: 'width 0.3s ease, background 0.3s ease'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div style={{
|
||||||
|
height: '1px',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
marginTop: '1rem'
|
||||||
|
}} />
|
||||||
|
)}
|
||||||
|
|
||||||
|
<div className="blog-post-card-meta" style={{ borderTop: 'none', paddingTop: '0.75rem' }}>
|
||||||
<span className="blog-post-card-author">
|
<span className="blog-post-card-author">
|
||||||
<FontAwesomeIcon icon={faUser} />
|
<FontAwesomeIcon icon={faUser} />
|
||||||
{displayName}
|
{displayName}
|
||||||
|
|||||||
44
src/components/BookmarkFilters.tsx
Normal file
44
src/components/BookmarkFilters.tsx
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faNewspaper, faStickyNote, faCirclePlay } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
import { faGlobe, faAsterisk, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
|
||||||
|
export type BookmarkFilterType = 'all' | 'article' | 'external' | 'video' | 'note' | 'web'
|
||||||
|
|
||||||
|
interface BookmarkFiltersProps {
|
||||||
|
selectedFilter: BookmarkFilterType
|
||||||
|
onFilterChange: (filter: BookmarkFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const BookmarkFilters: React.FC<BookmarkFiltersProps> = ({
|
||||||
|
selectedFilter,
|
||||||
|
onFilterChange
|
||||||
|
}) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'article' as const, icon: faNewspaper, label: 'Articles' },
|
||||||
|
{ type: 'external' as const, icon: faLink, label: 'External Articles' },
|
||||||
|
{ type: 'video' as const, icon: faCirclePlay, label: 'Videos' },
|
||||||
|
{ type: 'note' as const, icon: faStickyNote, label: 'Notes' },
|
||||||
|
{ type: 'web' as const, icon: faGlobe, label: 'Web' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${selectedFilter === filter.type ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default BookmarkFilters
|
||||||
|
|
||||||
@@ -1,5 +1,7 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { faBookOpen, faPlay, faEye } from '@fortawesome/free-solid-svg-icons'
|
import { faNewspaper, faStickyNote, faCirclePlay, faCamera, faFileLines } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
import { faGlobe, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { useEventModel } from 'applesauce-react/hooks'
|
import { useEventModel } from 'applesauce-react/hooks'
|
||||||
import { Models } from 'applesauce-core'
|
import { Models } from 'applesauce-core'
|
||||||
import { npubEncode, neventEncode } from 'nostr-tools/nip19'
|
import { npubEncode, neventEncode } from 'nostr-tools/nip19'
|
||||||
@@ -11,17 +13,15 @@ import { getPreviewImage, fetchOgImage } from '../utils/imagePreview'
|
|||||||
import { CompactView } from './BookmarkViews/CompactView'
|
import { CompactView } from './BookmarkViews/CompactView'
|
||||||
import { LargeView } from './BookmarkViews/LargeView'
|
import { LargeView } from './BookmarkViews/LargeView'
|
||||||
import { CardView } from './BookmarkViews/CardView'
|
import { CardView } from './BookmarkViews/CardView'
|
||||||
import { UserSettings } from '../services/settingsService'
|
|
||||||
|
|
||||||
interface BookmarkItemProps {
|
interface BookmarkItemProps {
|
||||||
bookmark: IndividualBookmark
|
bookmark: IndividualBookmark
|
||||||
index: number
|
index: number
|
||||||
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
||||||
viewMode?: ViewMode
|
viewMode?: ViewMode
|
||||||
settings?: UserSettings
|
|
||||||
}
|
}
|
||||||
|
|
||||||
export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onSelectUrl, viewMode = 'cards', settings }) => {
|
export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onSelectUrl, viewMode = 'cards' }) => {
|
||||||
const [ogImage, setOgImage] = useState<string | null>(null)
|
const [ogImage, setOgImage] = useState<string | null>(null)
|
||||||
|
|
||||||
const short = (v: string) => `${v.slice(0, 8)}...${v.slice(-8)}`
|
const short = (v: string) => `${v.slice(0, 8)}...${v.slice(-8)}`
|
||||||
@@ -68,18 +68,41 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
return short(bookmark.pubkey) // fallback to short pubkey
|
return short(bookmark.pubkey) // fallback to short pubkey
|
||||||
}
|
}
|
||||||
|
|
||||||
// use helper from kindIcon.ts
|
// Get content type icon based on bookmark kind and URL classification
|
||||||
|
const getContentTypeIcon = (): IconDefinition => {
|
||||||
|
if (isArticle) return faNewspaper // Nostr-native article
|
||||||
|
|
||||||
|
// For web bookmarks, classify the URL to determine icon
|
||||||
|
if (isWebBookmark && firstUrlClassification) {
|
||||||
|
switch (firstUrlClassification.type) {
|
||||||
|
case 'youtube':
|
||||||
|
case 'video':
|
||||||
|
return faCirclePlay
|
||||||
|
case 'image':
|
||||||
|
return faCamera
|
||||||
|
case 'article':
|
||||||
|
return faLink // External article
|
||||||
|
default:
|
||||||
|
return faGlobe
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!hasUrls) return faStickyNote // Just a text note
|
||||||
|
if (firstUrlClassification?.type === 'youtube' || firstUrlClassification?.type === 'video') return faCirclePlay
|
||||||
|
if (firstUrlClassification?.type === 'article') return faLink // External article
|
||||||
|
return faFileLines
|
||||||
|
}
|
||||||
|
|
||||||
const getIconForUrlType = (url: string) => {
|
const getIconForUrlType = (url: string) => {
|
||||||
const classification = classifyUrl(url)
|
const classification = classifyUrl(url)
|
||||||
switch (classification.type) {
|
switch (classification.type) {
|
||||||
case 'youtube':
|
case 'youtube':
|
||||||
case 'video':
|
case 'video':
|
||||||
return faPlay
|
return faCirclePlay
|
||||||
case 'image':
|
case 'image':
|
||||||
return faEye
|
return faCamera
|
||||||
default:
|
default:
|
||||||
return faBookOpen
|
return faFileLines
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -116,11 +139,13 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleImage,
|
articleImage,
|
||||||
articleSummary,
|
articleSummary,
|
||||||
settings
|
contentTypeIcon: getContentTypeIcon()
|
||||||
}
|
}
|
||||||
|
|
||||||
if (viewMode === 'compact') {
|
if (viewMode === 'compact') {
|
||||||
return <CompactView {...sharedProps} />
|
// eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
|
||||||
|
const { articleImage, ...compactProps } = sharedProps
|
||||||
|
return <CompactView {...compactProps} />
|
||||||
}
|
}
|
||||||
|
|
||||||
if (viewMode === 'large') {
|
if (viewMode === 'large') {
|
||||||
@@ -128,5 +153,5 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
return <LargeView {...sharedProps} getIconForUrlType={getIconForUrlType} previewImage={previewImage} />
|
return <LargeView {...sharedProps} getIconForUrlType={getIconForUrlType} previewImage={previewImage} />
|
||||||
}
|
}
|
||||||
|
|
||||||
return <CardView {...sharedProps} getIconForUrlType={getIconForUrlType} articleImage={articleImage} />
|
return <CardView {...sharedProps} articleImage={articleImage} />
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,18 +1,27 @@
|
|||||||
import React, { useRef } from 'react'
|
import React, { useRef, useState } from 'react'
|
||||||
|
import { useNavigate } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate, faHeart, faPlus } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { formatDistanceToNow } from 'date-fns'
|
import { formatDistanceToNow } from 'date-fns'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
||||||
import { BookmarkItem } from './BookmarkItem'
|
import { BookmarkItem } from './BookmarkItem'
|
||||||
import SidebarHeader from './SidebarHeader'
|
import SidebarHeader from './SidebarHeader'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
|
import CompactButton from './CompactButton'
|
||||||
import { ViewMode } from './Bookmarks'
|
import { ViewMode } from './Bookmarks'
|
||||||
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
import { usePullToRefresh } from '../hooks/usePullToRefresh'
|
|
||||||
import PullToRefreshIndicator from './PullToRefreshIndicator'
|
|
||||||
import { BookmarkSkeleton } from './Skeletons'
|
import { BookmarkSkeleton } from './Skeletons'
|
||||||
|
import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWithoutSet } from '../utils/bookmarkUtils'
|
||||||
|
import { UserSettings } from '../services/settingsService'
|
||||||
|
import AddBookmarkModal from './AddBookmarkModal'
|
||||||
|
import { createWebBookmark } from '../services/webBookmarkService'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
|
||||||
|
import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import LoginOptions from './LoginOptions'
|
||||||
|
|
||||||
interface BookmarkListProps {
|
interface BookmarkListProps {
|
||||||
bookmarks: Bookmark[]
|
bookmarks: Bookmark[]
|
||||||
@@ -29,8 +38,8 @@ interface BookmarkListProps {
|
|||||||
lastFetchTime?: number | null
|
lastFetchTime?: number | null
|
||||||
loading?: boolean
|
loading?: boolean
|
||||||
relayPool: RelayPool | null
|
relayPool: RelayPool | null
|
||||||
settings?: UserSettings
|
|
||||||
isMobile?: boolean
|
isMobile?: boolean
|
||||||
|
settings?: UserSettings
|
||||||
}
|
}
|
||||||
|
|
||||||
export const BookmarkList: React.FC<BookmarkListProps> = ({
|
export const BookmarkList: React.FC<BookmarkListProps> = ({
|
||||||
@@ -48,52 +57,64 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
lastFetchTime,
|
lastFetchTime,
|
||||||
loading = false,
|
loading = false,
|
||||||
relayPool,
|
relayPool,
|
||||||
settings,
|
isMobile = false,
|
||||||
isMobile = false
|
settings
|
||||||
}) => {
|
}) => {
|
||||||
|
const navigate = useNavigate()
|
||||||
const bookmarksListRef = useRef<HTMLDivElement>(null)
|
const bookmarksListRef = useRef<HTMLDivElement>(null)
|
||||||
|
const friendsColor = settings?.highlightColorFriends || '#f97316'
|
||||||
|
const [showAddModal, setShowAddModal] = useState(false)
|
||||||
|
const [selectedFilter, setSelectedFilter] = useState<BookmarkFilterType>('all')
|
||||||
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
|
||||||
|
const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
|
||||||
|
if (!activeAccount || !relayPool) {
|
||||||
|
throw new Error('Please login to create bookmarks')
|
||||||
|
}
|
||||||
|
|
||||||
|
await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
|
||||||
|
}
|
||||||
|
|
||||||
// Pull-to-refresh for bookmarks
|
// Pull-to-refresh for bookmarks
|
||||||
const pullToRefreshState = usePullToRefresh(bookmarksListRef, {
|
const { isRefreshing: isPulling, pullPosition } = usePullToRefresh({
|
||||||
onRefresh: () => {
|
onRefresh: () => {
|
||||||
if (onRefresh) {
|
if (onRefresh) {
|
||||||
onRefresh()
|
onRefresh()
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
isRefreshing: isRefreshing || false,
|
maximumPullLength: 240,
|
||||||
disabled: !onRefresh
|
refreshThreshold: 80,
|
||||||
|
isDisabled: !onRefresh
|
||||||
})
|
})
|
||||||
|
|
||||||
// Helper to check if a bookmark has either content or a URL
|
|
||||||
const hasContentOrUrl = (ib: IndividualBookmark) => {
|
|
||||||
// Check if has content (text)
|
|
||||||
const hasContent = ib.content && ib.content.trim().length > 0
|
|
||||||
|
|
||||||
// Check if has URL
|
|
||||||
let hasUrl = false
|
|
||||||
|
|
||||||
// For web bookmarks (kind:39701), URL is in the 'd' tag
|
|
||||||
if (ib.kind === 39701) {
|
|
||||||
const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
|
|
||||||
hasUrl = !!dTag && dTag.trim().length > 0
|
|
||||||
} else {
|
|
||||||
// For other bookmarks, extract URLs from content
|
|
||||||
const urls = extractUrlsFromContent(ib.content || '')
|
|
||||||
hasUrl = urls.length > 0
|
|
||||||
}
|
|
||||||
|
|
||||||
// Always show articles (kind:30023) as they have special handling
|
|
||||||
if (ib.kind === 30023) return true
|
|
||||||
|
|
||||||
// Otherwise, must have either content or URL
|
|
||||||
return hasContent || hasUrl
|
|
||||||
}
|
|
||||||
|
|
||||||
// Merge and flatten all individual bookmarks from all lists
|
// Merge and flatten all individual bookmarks from all lists
|
||||||
// Re-sort after flattening to ensure newest first across all lists
|
|
||||||
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
.filter(hasContentOrUrl)
|
.filter(hasContent)
|
||||||
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
|
||||||
|
// Apply filter
|
||||||
|
const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, selectedFilter)
|
||||||
|
|
||||||
|
// Separate bookmarks with setName (kind 30003) from regular bookmarks
|
||||||
|
const bookmarksWithoutSet = getBookmarksWithoutSet(filteredBookmarks)
|
||||||
|
const bookmarkSets = getBookmarkSets(filteredBookmarks)
|
||||||
|
|
||||||
|
// Group non-set bookmarks as before
|
||||||
|
const groups = groupIndividualBookmarks(bookmarksWithoutSet)
|
||||||
|
const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
|
||||||
|
{ key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
|
||||||
|
{ key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
|
||||||
|
{ key: 'web', title: 'Web Bookmarks', items: groups.web },
|
||||||
|
{ key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
|
||||||
|
]
|
||||||
|
|
||||||
|
// Add bookmark sets as additional sections
|
||||||
|
bookmarkSets.forEach(set => {
|
||||||
|
sections.push({
|
||||||
|
key: `set-${set.name}`,
|
||||||
|
title: set.title || set.name,
|
||||||
|
items: set.bookmarks
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
if (isCollapsed) {
|
if (isCollapsed) {
|
||||||
// Check if the selected URL is in bookmarks
|
// Check if the selected URL is in bookmarks
|
||||||
@@ -123,11 +144,23 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
onToggleCollapse={onToggleCollapse}
|
onToggleCollapse={onToggleCollapse}
|
||||||
onLogout={onLogout}
|
onLogout={onLogout}
|
||||||
onOpenSettings={onOpenSettings}
|
onOpenSettings={onOpenSettings}
|
||||||
relayPool={relayPool}
|
|
||||||
isMobile={isMobile}
|
isMobile={isMobile}
|
||||||
/>
|
/>
|
||||||
|
|
||||||
{allIndividualBookmarks.length === 0 ? (
|
{allIndividualBookmarks.length > 0 && (
|
||||||
|
<BookmarkFilters
|
||||||
|
selectedFilter={selectedFilter}
|
||||||
|
onFilterChange={setSelectedFilter}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
|
|
||||||
|
{!activeAccount ? (
|
||||||
|
<LoginOptions />
|
||||||
|
) : filteredBookmarks.length === 0 && allIndividualBookmarks.length > 0 ? (
|
||||||
|
<div className="empty-state">
|
||||||
|
<p>No bookmarks match this filter.</p>
|
||||||
|
</div>
|
||||||
|
) : allIndividualBookmarks.length === 0 ? (
|
||||||
loading ? (
|
loading ? (
|
||||||
<div className={`bookmarks-list ${viewMode}`} aria-busy="true">
|
<div className={`bookmarks-list ${viewMode}`} aria-busy="true">
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
@@ -140,68 +173,98 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
<div className="empty-state">
|
<div className="empty-state">
|
||||||
<p>No bookmarks found.</p>
|
<p>No bookmarks found.</p>
|
||||||
<p>Add bookmarks using your nostr client to see them here.</p>
|
<p>Add bookmarks using your nostr client to see them here.</p>
|
||||||
<p>If you aren't on nostr yet, start here: <a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">nstart.me</a></p>
|
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
) : (
|
) : (
|
||||||
<div
|
<div
|
||||||
ref={bookmarksListRef}
|
ref={bookmarksListRef}
|
||||||
className={`bookmarks-list pull-to-refresh-container ${pullToRefreshState.isPulling ? 'is-pulling' : ''}`}
|
className="bookmarks-list"
|
||||||
>
|
>
|
||||||
<PullToRefreshIndicator
|
<RefreshIndicator
|
||||||
isPulling={pullToRefreshState.isPulling}
|
isRefreshing={isPulling || isRefreshing || false}
|
||||||
pullDistance={pullToRefreshState.pullDistance}
|
pullPosition={pullPosition}
|
||||||
canRefresh={pullToRefreshState.canRefresh}
|
|
||||||
isRefreshing={isRefreshing || false}
|
|
||||||
/>
|
/>
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
{sections.filter(s => s.items.length > 0).map(section => (
|
||||||
{allIndividualBookmarks.map((individualBookmark, index) =>
|
<div key={section.key} className="bookmarks-section">
|
||||||
<BookmarkItem
|
<div style={{ display: 'flex', alignItems: 'center', justifyContent: 'space-between' }}>
|
||||||
key={`${individualBookmark.id}-${index}`}
|
<h3 className="bookmarks-section-title" style={{ margin: 0, padding: '1.5rem 0.5rem 0.375rem', flex: 1 }}>{section.title}</h3>
|
||||||
bookmark={individualBookmark}
|
{section.key === 'web' && activeAccount && (
|
||||||
index={index}
|
<CompactButton
|
||||||
onSelectUrl={onSelectUrl}
|
icon={faPlus}
|
||||||
viewMode={viewMode}
|
onClick={() => setShowAddModal(true)}
|
||||||
settings={settings}
|
title="Add web bookmark"
|
||||||
/>
|
ariaLabel="Add web bookmark"
|
||||||
)}
|
className="bookmark-section-action"
|
||||||
</div>
|
/>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
|
{section.items.map((individualBookmark, index) => (
|
||||||
|
<BookmarkItem
|
||||||
|
key={`${section.key}-${individualBookmark.id}-${index}`}
|
||||||
|
bookmark={individualBookmark}
|
||||||
|
index={index}
|
||||||
|
onSelectUrl={onSelectUrl}
|
||||||
|
viewMode={viewMode}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
))}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
<div className="view-mode-controls">
|
<div className="view-mode-controls">
|
||||||
{onRefresh && (
|
<div className="view-mode-left">
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faRotate}
|
icon={faHeart}
|
||||||
onClick={onRefresh}
|
onClick={() => navigate('/support')}
|
||||||
title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
|
title="Support Boris"
|
||||||
ariaLabel="Refresh bookmarks"
|
ariaLabel="Support"
|
||||||
variant="ghost"
|
variant="ghost"
|
||||||
disabled={isRefreshing}
|
style={{ color: friendsColor }}
|
||||||
spin={isRefreshing}
|
|
||||||
/>
|
/>
|
||||||
)}
|
</div>
|
||||||
<IconButton
|
<div className="view-mode-right">
|
||||||
icon={faList}
|
{onRefresh && (
|
||||||
onClick={() => onViewModeChange('compact')}
|
<IconButton
|
||||||
title="Compact list view"
|
icon={faRotate}
|
||||||
ariaLabel="Compact list view"
|
onClick={onRefresh}
|
||||||
variant={viewMode === 'compact' ? 'primary' : 'ghost'}
|
title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
|
||||||
/>
|
ariaLabel="Refresh bookmarks"
|
||||||
<IconButton
|
variant="ghost"
|
||||||
icon={faThLarge}
|
disabled={isRefreshing}
|
||||||
onClick={() => onViewModeChange('cards')}
|
spin={isRefreshing}
|
||||||
title="Cards view"
|
/>
|
||||||
ariaLabel="Cards view"
|
)}
|
||||||
variant={viewMode === 'cards' ? 'primary' : 'ghost'}
|
<IconButton
|
||||||
/>
|
icon={faList}
|
||||||
<IconButton
|
onClick={() => onViewModeChange('compact')}
|
||||||
icon={faImage}
|
title="Compact list view"
|
||||||
onClick={() => onViewModeChange('large')}
|
ariaLabel="Compact list view"
|
||||||
title="Large preview view"
|
variant={viewMode === 'compact' ? 'primary' : 'ghost'}
|
||||||
ariaLabel="Large preview view"
|
/>
|
||||||
variant={viewMode === 'large' ? 'primary' : 'ghost'}
|
<IconButton
|
||||||
/>
|
icon={faThLarge}
|
||||||
|
onClick={() => onViewModeChange('cards')}
|
||||||
|
title="Cards view"
|
||||||
|
ariaLabel="Cards view"
|
||||||
|
variant={viewMode === 'cards' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faImage}
|
||||||
|
onClick={() => onViewModeChange('large')}
|
||||||
|
title="Large preview view"
|
||||||
|
ariaLabel="Large preview view"
|
||||||
|
variant={viewMode === 'large' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
{showAddModal && (
|
||||||
|
<AddBookmarkModal
|
||||||
|
onClose={() => setShowAddModal(false)}
|
||||||
|
onSave={handleSaveBookmark}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,16 +1,14 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { Link } from 'react-router-dom'
|
import { Link } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faUserLock, faChevronDown, faChevronUp, faGlobe } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronDown, faChevronUp } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
|
import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
import IconButton from '../IconButton'
|
|
||||||
import { classifyUrl } from '../../utils/helpers'
|
import { classifyUrl } from '../../utils/helpers'
|
||||||
import { IconGetter } from './shared'
|
|
||||||
import { useImageCache } from '../../hooks/useImageCache'
|
import { useImageCache } from '../../hooks/useImageCache'
|
||||||
import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
|
import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
import { getEventUrl } from '../../config/nostrGateways'
|
import { getEventUrl } from '../../config/nostrGateways'
|
||||||
|
|
||||||
interface CardViewProps {
|
interface CardViewProps {
|
||||||
@@ -19,14 +17,13 @@ interface CardViewProps {
|
|||||||
hasUrls: boolean
|
hasUrls: boolean
|
||||||
extractedUrls: string[]
|
extractedUrls: string[]
|
||||||
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
||||||
getIconForUrlType: IconGetter
|
|
||||||
authorNpub: string
|
authorNpub: string
|
||||||
eventNevent?: string
|
eventNevent?: string
|
||||||
getAuthorDisplayName: () => string
|
getAuthorDisplayName: () => string
|
||||||
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
||||||
articleImage?: string
|
articleImage?: string
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
settings?: UserSettings
|
contentTypeIcon: IconDefinition
|
||||||
}
|
}
|
||||||
|
|
||||||
export const CardView: React.FC<CardViewProps> = ({
|
export const CardView: React.FC<CardViewProps> = ({
|
||||||
@@ -35,14 +32,13 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
hasUrls,
|
hasUrls,
|
||||||
extractedUrls,
|
extractedUrls,
|
||||||
onSelectUrl,
|
onSelectUrl,
|
||||||
getIconForUrlType,
|
|
||||||
authorNpub,
|
authorNpub,
|
||||||
eventNevent,
|
eventNevent,
|
||||||
getAuthorDisplayName,
|
getAuthorDisplayName,
|
||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleImage,
|
articleImage,
|
||||||
articleSummary,
|
articleSummary,
|
||||||
settings
|
contentTypeIcon
|
||||||
}) => {
|
}) => {
|
||||||
const firstUrl = hasUrls ? extractedUrls[0] : null
|
const firstUrl = hasUrls ? extractedUrls[0] : null
|
||||||
const firstUrlClassificationType = firstUrl ? classifyUrl(firstUrl)?.type : null
|
const firstUrlClassificationType = firstUrl ? classifyUrl(firstUrl)?.type : null
|
||||||
@@ -55,11 +51,10 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
const contentLength = (bookmark.content || '').length
|
const contentLength = (bookmark.content || '').length
|
||||||
const shouldTruncate = !expanded && contentLength > 210
|
const shouldTruncate = !expanded && contentLength > 210
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
const isWebBookmark = bookmark.kind === 39701
|
|
||||||
|
|
||||||
// Determine which image to use (article image, instant preview, or OG image)
|
// Determine which image to use (article image, instant preview, or OG image)
|
||||||
const previewImage = articleImage || instantPreview || ogImage
|
const previewImage = articleImage || instantPreview || ogImage
|
||||||
const cachedImage = useImageCache(previewImage || undefined, settings)
|
const cachedImage = useImageCache(previewImage || undefined)
|
||||||
|
|
||||||
// Fetch OG image if we don't have any other image
|
// Fetch OG image if we don't have any other image
|
||||||
React.useEffect(() => {
|
React.useEffect(() => {
|
||||||
@@ -95,19 +90,7 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
)}
|
)}
|
||||||
<div className="bookmark-header">
|
<div className="bookmark-header">
|
||||||
<span className="bookmark-type">
|
<span className="bookmark-type">
|
||||||
{isWebBookmark ? (
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
<span className="fa-layers fa-fw">
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
|
|
||||||
</span>
|
|
||||||
) : bookmark.isPrivate ? (
|
|
||||||
<>
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
|
|
||||||
</>
|
|
||||||
) : (
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
)}
|
|
||||||
</span>
|
</span>
|
||||||
|
|
||||||
{eventNevent ? (
|
{eventNevent ? (
|
||||||
@@ -130,23 +113,14 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
<div className="bookmark-urls">
|
<div className="bookmark-urls">
|
||||||
{(urlsExpanded ? extractedUrls : extractedUrls.slice(0, 1)).map((url, urlIndex) => {
|
{(urlsExpanded ? extractedUrls : extractedUrls.slice(0, 1)).map((url, urlIndex) => {
|
||||||
return (
|
return (
|
||||||
<div key={urlIndex} className="url-row">
|
<button
|
||||||
<button
|
key={urlIndex}
|
||||||
className="bookmark-url"
|
className="bookmark-url"
|
||||||
onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
|
onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
|
||||||
title="Open in reader"
|
title="Open in reader"
|
||||||
>
|
>
|
||||||
{url}
|
{url}
|
||||||
</button>
|
</button>
|
||||||
<IconButton
|
|
||||||
icon={getIconForUrlType(url)}
|
|
||||||
ariaLabel="Open"
|
|
||||||
title="Open"
|
|
||||||
variant="success"
|
|
||||||
size={32}
|
|
||||||
onClick={(e) => { e.preventDefault(); e.stopPropagation(); onSelectUrl?.(url) }}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
)
|
)
|
||||||
})}
|
})}
|
||||||
{extractedUrls.length > 1 && (
|
{extractedUrls.length > 1 && (
|
||||||
|
|||||||
@@ -1,11 +1,9 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faUserLock, faGlobe } from '@fortawesome/free-solid-svg-icons'
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDateCompact } from '../../utils/bookmarkUtils'
|
import { formatDateCompact } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
import { useImageCache } from '../../hooks/useImageCache'
|
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
|
|
||||||
interface CompactViewProps {
|
interface CompactViewProps {
|
||||||
bookmark: IndividualBookmark
|
bookmark: IndividualBookmark
|
||||||
@@ -13,9 +11,8 @@ interface CompactViewProps {
|
|||||||
hasUrls: boolean
|
hasUrls: boolean
|
||||||
extractedUrls: string[]
|
extractedUrls: string[]
|
||||||
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
||||||
articleImage?: string
|
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
settings?: UserSettings
|
contentTypeIcon: IconDefinition
|
||||||
}
|
}
|
||||||
|
|
||||||
export const CompactView: React.FC<CompactViewProps> = ({
|
export const CompactView: React.FC<CompactViewProps> = ({
|
||||||
@@ -24,17 +21,13 @@ export const CompactView: React.FC<CompactViewProps> = ({
|
|||||||
hasUrls,
|
hasUrls,
|
||||||
extractedUrls,
|
extractedUrls,
|
||||||
onSelectUrl,
|
onSelectUrl,
|
||||||
articleImage,
|
|
||||||
articleSummary,
|
articleSummary,
|
||||||
settings
|
contentTypeIcon
|
||||||
}) => {
|
}) => {
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
const isWebBookmark = bookmark.kind === 39701
|
const isWebBookmark = bookmark.kind === 39701
|
||||||
const isClickable = hasUrls || isArticle || isWebBookmark
|
const isClickable = hasUrls || isArticle || isWebBookmark
|
||||||
|
|
||||||
// Get cached image for thumbnail
|
|
||||||
const cachedImage = useImageCache(articleImage || undefined, settings)
|
|
||||||
|
|
||||||
const handleCompactClick = () => {
|
const handleCompactClick = () => {
|
||||||
if (!onSelectUrl) return
|
if (!onSelectUrl) return
|
||||||
|
|
||||||
@@ -58,27 +51,8 @@ export const CompactView: React.FC<CompactViewProps> = ({
|
|||||||
role={isClickable ? 'button' : undefined}
|
role={isClickable ? 'button' : undefined}
|
||||||
tabIndex={isClickable ? 0 : undefined}
|
tabIndex={isClickable ? 0 : undefined}
|
||||||
>
|
>
|
||||||
{/* Thumbnail image */}
|
|
||||||
{cachedImage && (
|
|
||||||
<div className="compact-thumbnail">
|
|
||||||
<img src={cachedImage} alt="" />
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
|
|
||||||
<span className="bookmark-type-compact">
|
<span className="bookmark-type-compact">
|
||||||
{isWebBookmark ? (
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
<span className="fa-layers fa-fw">
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
|
|
||||||
</span>
|
|
||||||
) : bookmark.isPrivate ? (
|
|
||||||
<>
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
|
|
||||||
</>
|
|
||||||
) : (
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
)}
|
|
||||||
</span>
|
</span>
|
||||||
{displayText && (
|
{displayText && (
|
||||||
<div className="compact-text">
|
<div className="compact-text">
|
||||||
|
|||||||
@@ -1,12 +1,12 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { Link } from 'react-router-dom'
|
import { Link } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDate } from '../../utils/bookmarkUtils'
|
import { formatDate } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
import { IconGetter } from './shared'
|
import { IconGetter } from './shared'
|
||||||
import { useImageCache } from '../../hooks/useImageCache'
|
import { useImageCache } from '../../hooks/useImageCache'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
import { getEventUrl } from '../../config/nostrGateways'
|
import { getEventUrl } from '../../config/nostrGateways'
|
||||||
|
|
||||||
interface LargeViewProps {
|
interface LargeViewProps {
|
||||||
@@ -22,7 +22,8 @@ interface LargeViewProps {
|
|||||||
getAuthorDisplayName: () => string
|
getAuthorDisplayName: () => string
|
||||||
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
settings?: UserSettings
|
contentTypeIcon: IconDefinition
|
||||||
|
readingProgress?: number // 0-1 reading progress (optional)
|
||||||
}
|
}
|
||||||
|
|
||||||
export const LargeView: React.FC<LargeViewProps> = ({
|
export const LargeView: React.FC<LargeViewProps> = ({
|
||||||
@@ -38,11 +39,22 @@ export const LargeView: React.FC<LargeViewProps> = ({
|
|||||||
getAuthorDisplayName,
|
getAuthorDisplayName,
|
||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleSummary,
|
articleSummary,
|
||||||
settings
|
contentTypeIcon,
|
||||||
|
readingProgress
|
||||||
}) => {
|
}) => {
|
||||||
const cachedImage = useImageCache(previewImage || undefined, settings)
|
const cachedImage = useImageCache(previewImage || undefined)
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
|
|
||||||
|
// Calculate progress display (matching readingProgressUtils.ts logic)
|
||||||
|
const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
|
||||||
|
let progressColor = '#6366f1' // Default blue (reading)
|
||||||
|
|
||||||
|
if (readingProgress && readingProgress >= 0.95) {
|
||||||
|
progressColor = '#10b981' // Green (completed)
|
||||||
|
} else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
|
||||||
|
progressColor = 'var(--color-text)' // Neutral text color (started)
|
||||||
|
}
|
||||||
|
|
||||||
const triggerOpen = () => handleReadNow({ preventDefault: () => {} } as React.MouseEvent<HTMLButtonElement>)
|
const triggerOpen = () => handleReadNow({ preventDefault: () => {} } as React.MouseEvent<HTMLButtonElement>)
|
||||||
const handleKeyDown: React.KeyboardEventHandler<HTMLDivElement> = (e) => {
|
const handleKeyDown: React.KeyboardEventHandler<HTMLDivElement> = (e) => {
|
||||||
if (e.key === 'Enter' || e.key === ' ') {
|
if (e.key === 'Enter' || e.key === ' ') {
|
||||||
@@ -92,7 +104,32 @@ export const LargeView: React.FC<LargeViewProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
|
|
||||||
|
{/* Reading progress indicator for articles - shown only if there's progress */}
|
||||||
|
{isArticle && readingProgress !== undefined && readingProgress > 0 && (
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '3px',
|
||||||
|
width: '100%',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
overflow: 'hidden',
|
||||||
|
marginTop: '0.75rem'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '100%',
|
||||||
|
width: `${progressPercent}%`,
|
||||||
|
background: progressColor,
|
||||||
|
transition: 'width 0.3s ease, background 0.3s ease'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
|
||||||
<div className="large-footer">
|
<div className="large-footer">
|
||||||
|
<span className="bookmark-type-large">
|
||||||
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
|
</span>
|
||||||
<span className="large-author">
|
<span className="large-author">
|
||||||
<Link
|
<Link
|
||||||
to={`/p/${authorNpub}`}
|
to={`/p/${authorNpub}`}
|
||||||
|
|||||||
@@ -16,6 +16,7 @@ import { useOfflineSync } from '../hooks/useOfflineSync'
|
|||||||
import ThreePaneLayout from './ThreePaneLayout'
|
import ThreePaneLayout from './ThreePaneLayout'
|
||||||
import Explore from './Explore'
|
import Explore from './Explore'
|
||||||
import Me from './Me'
|
import Me from './Me'
|
||||||
|
import Support from './Support'
|
||||||
import { classifyHighlights } from '../utils/highlightClassification'
|
import { classifyHighlights } from '../utils/highlightClassification'
|
||||||
|
|
||||||
export type ViewMode = 'compact' | 'cards' | 'large'
|
export type ViewMode = 'compact' | 'cards' | 'large'
|
||||||
@@ -42,6 +43,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
const showExplore = location.pathname.startsWith('/explore')
|
const showExplore = location.pathname.startsWith('/explore')
|
||||||
const showMe = location.pathname.startsWith('/me')
|
const showMe = location.pathname.startsWith('/me')
|
||||||
const showProfile = location.pathname.startsWith('/p/')
|
const showProfile = location.pathname.startsWith('/p/')
|
||||||
|
const showSupport = location.pathname === '/support'
|
||||||
|
|
||||||
// Extract tab from explore routes
|
// Extract tab from explore routes
|
||||||
const exploreTab = location.pathname === '/explore/writings' ? 'writings' : 'highlights'
|
const exploreTab = location.pathname === '/explore/writings' ? 'writings' : 'highlights'
|
||||||
@@ -50,22 +52,25 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
const meTab = location.pathname === '/me' ? 'highlights' :
|
const meTab = location.pathname === '/me' ? 'highlights' :
|
||||||
location.pathname === '/me/highlights' ? 'highlights' :
|
location.pathname === '/me/highlights' ? 'highlights' :
|
||||||
location.pathname === '/me/reading-list' ? 'reading-list' :
|
location.pathname === '/me/reading-list' ? 'reading-list' :
|
||||||
location.pathname === '/me/archive' ? 'archive' :
|
location.pathname.startsWith('/me/reads') ? 'reads' :
|
||||||
|
location.pathname === '/me/links' ? 'links' :
|
||||||
location.pathname === '/me/writings' ? 'writings' : 'highlights'
|
location.pathname === '/me/writings' ? 'writings' : 'highlights'
|
||||||
|
|
||||||
// Extract tab from profile routes
|
// Extract tab from profile routes
|
||||||
const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
|
const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
|
||||||
|
|
||||||
// Decode npub to pubkey for profile view
|
// Decode npub or nprofile to pubkey for profile view
|
||||||
let profilePubkey: string | undefined
|
let profilePubkey: string | undefined
|
||||||
if (npub && showProfile) {
|
if (npub && showProfile) {
|
||||||
try {
|
try {
|
||||||
const decoded = nip19.decode(npub)
|
const decoded = nip19.decode(npub)
|
||||||
if (decoded.type === 'npub') {
|
if (decoded.type === 'npub') {
|
||||||
profilePubkey = decoded.data
|
profilePubkey = decoded.data
|
||||||
|
} else if (decoded.type === 'nprofile') {
|
||||||
|
profilePubkey = decoded.data.pubkey
|
||||||
}
|
}
|
||||||
} catch (err) {
|
} catch (err) {
|
||||||
console.error('Failed to decode npub:', err)
|
console.error('Failed to decode npub/nprofile:', err)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -124,12 +129,14 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
} = useBookmarksUI({ settings })
|
} = useBookmarksUI({ settings })
|
||||||
|
|
||||||
// Close sidebar on mobile when route changes (e.g., clicking on blog posts in Explore)
|
// Close sidebar on mobile when route changes (e.g., clicking on blog posts in Explore)
|
||||||
|
const prevPathnameRef = useRef<string>(location.pathname)
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
if (isMobile && isSidebarOpen) {
|
// Only close if pathname actually changed, not on initial render or other state changes
|
||||||
|
if (isMobile && isSidebarOpen && prevPathnameRef.current !== location.pathname) {
|
||||||
toggleSidebar()
|
toggleSidebar()
|
||||||
}
|
}
|
||||||
// eslint-disable-next-line react-hooks/exhaustive-deps
|
prevPathnameRef.current = location.pathname
|
||||||
}, [location.pathname])
|
}, [location.pathname, isMobile, isSidebarOpen, toggleSidebar])
|
||||||
|
|
||||||
// Handle highlight navigation from explore page
|
// Handle highlight navigation from explore page
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -161,6 +168,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
activeAccount,
|
activeAccount,
|
||||||
accountManager,
|
accountManager,
|
||||||
naddr,
|
naddr,
|
||||||
|
externalUrl,
|
||||||
currentArticleCoordinate,
|
currentArticleCoordinate,
|
||||||
currentArticleEventId,
|
currentArticleEventId,
|
||||||
settings
|
settings
|
||||||
@@ -250,6 +258,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
showExplore={showExplore}
|
showExplore={showExplore}
|
||||||
showMe={showMe}
|
showMe={showMe}
|
||||||
showProfile={showProfile}
|
showProfile={showProfile}
|
||||||
|
showSupport={showSupport}
|
||||||
bookmarks={bookmarks}
|
bookmarks={bookmarks}
|
||||||
bookmarksLoading={bookmarksLoading}
|
bookmarksLoading={bookmarksLoading}
|
||||||
viewMode={viewMode}
|
viewMode={viewMode}
|
||||||
@@ -313,6 +322,9 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
profile={showProfile && profilePubkey ? (
|
profile={showProfile && profilePubkey ? (
|
||||||
relayPool ? <Me relayPool={relayPool} activeTab={profileTab} pubkey={profilePubkey} /> : null
|
relayPool ? <Me relayPool={relayPool} activeTab={profileTab} pubkey={profilePubkey} /> : null
|
||||||
) : undefined}
|
) : undefined}
|
||||||
|
support={showSupport ? (
|
||||||
|
relayPool ? <Support relayPool={relayPool} eventStore={eventStore} settings={settings} /> : null
|
||||||
|
) : undefined}
|
||||||
toastMessage={toastMessage ?? undefined}
|
toastMessage={toastMessage ?? undefined}
|
||||||
toastType={toastType}
|
toastType={toastType}
|
||||||
onClearToast={clearToast}
|
onClearToast={clearToast}
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
import React, { useMemo, useState, useEffect, useRef } from 'react'
|
import React, { useMemo, useState, useEffect, useRef, useCallback } from 'react'
|
||||||
import ReactPlayer from 'react-player'
|
import ReactPlayer from 'react-player'
|
||||||
import ReactMarkdown from 'react-markdown'
|
import ReactMarkdown from 'react-markdown'
|
||||||
import remarkGfm from 'remark-gfm'
|
import remarkGfm from 'remark-gfm'
|
||||||
@@ -6,10 +6,10 @@ import rehypeRaw from 'rehype-raw'
|
|||||||
import rehypePrism from 'rehype-prism-plus'
|
import rehypePrism from 'rehype-prism-plus'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import 'prismjs/themes/prism-tomorrow.css'
|
import 'prismjs/themes/prism-tomorrow.css'
|
||||||
import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare } from '@fortawesome/free-solid-svg-icons'
|
import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare, faSearch } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { ContentSkeleton } from './Skeletons'
|
import { ContentSkeleton } from './Skeletons'
|
||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { getNostrUrl } from '../config/nostrGateways'
|
import { getNostrUrl, getSearchUrl } from '../config/nostrGateways'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { IAccount } from 'applesauce-accounts'
|
import { IAccount } from 'applesauce-accounts'
|
||||||
@@ -36,6 +36,13 @@ import { classifyUrl } from '../utils/helpers'
|
|||||||
import { buildNativeVideoUrl } from '../utils/videoHelpers'
|
import { buildNativeVideoUrl } from '../utils/videoHelpers'
|
||||||
import { useReadingPosition } from '../hooks/useReadingPosition'
|
import { useReadingPosition } from '../hooks/useReadingPosition'
|
||||||
import { ReadingProgressIndicator } from './ReadingProgressIndicator'
|
import { ReadingProgressIndicator } from './ReadingProgressIndicator'
|
||||||
|
import { EventFactory } from 'applesauce-factory'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import {
|
||||||
|
generateArticleIdentifier,
|
||||||
|
loadReadingPosition,
|
||||||
|
saveReadingPosition
|
||||||
|
} from '../services/readingPositionService'
|
||||||
|
|
||||||
interface ContentPanelProps {
|
interface ContentPanelProps {
|
||||||
loading: boolean
|
loading: boolean
|
||||||
@@ -100,6 +107,9 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
const [showArticleMenu, setShowArticleMenu] = useState(false)
|
const [showArticleMenu, setShowArticleMenu] = useState(false)
|
||||||
const [showVideoMenu, setShowVideoMenu] = useState(false)
|
const [showVideoMenu, setShowVideoMenu] = useState(false)
|
||||||
const [showExternalMenu, setShowExternalMenu] = useState(false)
|
const [showExternalMenu, setShowExternalMenu] = useState(false)
|
||||||
|
const [articleMenuOpenUpward, setArticleMenuOpenUpward] = useState(false)
|
||||||
|
const [videoMenuOpenUpward, setVideoMenuOpenUpward] = useState(false)
|
||||||
|
const [externalMenuOpenUpward, setExternalMenuOpenUpward] = useState(false)
|
||||||
const articleMenuRef = useRef<HTMLDivElement>(null)
|
const articleMenuRef = useRef<HTMLDivElement>(null)
|
||||||
const videoMenuRef = useRef<HTMLDivElement>(null)
|
const videoMenuRef = useRef<HTMLDivElement>(null)
|
||||||
const externalMenuRef = useRef<HTMLDivElement>(null)
|
const externalMenuRef = useRef<HTMLDivElement>(null)
|
||||||
@@ -126,10 +136,58 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
onClearSelection
|
onClearSelection
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Get event store for reading position service
|
||||||
|
const eventStore = Hooks.useEventStore()
|
||||||
|
|
||||||
// Reading position tracking - only for text content, not videos
|
// Reading position tracking - only for text content, not videos
|
||||||
const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
|
const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
|
||||||
const { isReadingComplete, progressPercentage } = useReadingPosition({
|
|
||||||
|
// Generate article identifier for saving/loading position
|
||||||
|
const articleIdentifier = useMemo(() => {
|
||||||
|
if (!selectedUrl) return null
|
||||||
|
return generateArticleIdentifier(selectedUrl)
|
||||||
|
}, [selectedUrl])
|
||||||
|
|
||||||
|
// Callback to save reading position
|
||||||
|
const handleSavePosition = useCallback(async (position: number) => {
|
||||||
|
if (!activeAccount || !relayPool || !eventStore || !articleIdentifier) {
|
||||||
|
console.log('⏭️ [ContentPanel] Skipping save - missing requirements:', {
|
||||||
|
hasAccount: !!activeAccount,
|
||||||
|
hasRelayPool: !!relayPool,
|
||||||
|
hasEventStore: !!eventStore,
|
||||||
|
hasIdentifier: !!articleIdentifier
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if (!settings?.syncReadingPosition) {
|
||||||
|
console.log('⏭️ [ContentPanel] Sync disabled in settings')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('💾 [ContentPanel] Saving position:', Math.round(position * 100) + '%', 'for article:', selectedUrl?.slice(0, 50))
|
||||||
|
|
||||||
|
try {
|
||||||
|
const factory = new EventFactory({ signer: activeAccount })
|
||||||
|
await saveReadingPosition(
|
||||||
|
relayPool,
|
||||||
|
eventStore,
|
||||||
|
factory,
|
||||||
|
articleIdentifier,
|
||||||
|
{
|
||||||
|
position,
|
||||||
|
timestamp: Math.floor(Date.now() / 1000),
|
||||||
|
scrollTop: window.pageYOffset || document.documentElement.scrollTop
|
||||||
|
}
|
||||||
|
)
|
||||||
|
} catch (error) {
|
||||||
|
console.error('❌ [ContentPanel] Failed to save reading position:', error)
|
||||||
|
}
|
||||||
|
}, [activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
|
||||||
|
|
||||||
|
const { isReadingComplete, progressPercentage, saveNow } = useReadingPosition({
|
||||||
enabled: isTextContent,
|
enabled: isTextContent,
|
||||||
|
syncEnabled: settings?.syncReadingPosition,
|
||||||
|
onSave: handleSavePosition,
|
||||||
onReadingComplete: () => {
|
onReadingComplete: () => {
|
||||||
// Optional: Auto-mark as read when reading is complete
|
// Optional: Auto-mark as read when reading is complete
|
||||||
if (activeAccount && !isMarkedAsRead) {
|
if (activeAccount && !isMarkedAsRead) {
|
||||||
@@ -138,6 +196,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Load saved reading position when article loads
|
||||||
|
useEffect(() => {
|
||||||
|
if (!isTextContent || !activeAccount || !relayPool || !eventStore || !articleIdentifier) {
|
||||||
|
console.log('⏭️ [ContentPanel] Skipping position restore - missing requirements:', {
|
||||||
|
isTextContent,
|
||||||
|
hasAccount: !!activeAccount,
|
||||||
|
hasRelayPool: !!relayPool,
|
||||||
|
hasEventStore: !!eventStore,
|
||||||
|
hasIdentifier: !!articleIdentifier
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if (!settings?.syncReadingPosition) {
|
||||||
|
console.log('⏭️ [ContentPanel] Sync disabled - not restoring position')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('📖 [ContentPanel] Loading position for article:', selectedUrl?.slice(0, 50))
|
||||||
|
|
||||||
|
const loadPosition = async () => {
|
||||||
|
try {
|
||||||
|
const savedPosition = await loadReadingPosition(
|
||||||
|
relayPool,
|
||||||
|
eventStore,
|
||||||
|
activeAccount.pubkey,
|
||||||
|
articleIdentifier
|
||||||
|
)
|
||||||
|
|
||||||
|
if (savedPosition && savedPosition.position > 0.05 && savedPosition.position < 1) {
|
||||||
|
console.log('🎯 [ContentPanel] Restoring position:', Math.round(savedPosition.position * 100) + '%')
|
||||||
|
// Wait for content to be fully rendered before scrolling
|
||||||
|
setTimeout(() => {
|
||||||
|
const documentHeight = document.documentElement.scrollHeight
|
||||||
|
const windowHeight = window.innerHeight
|
||||||
|
const scrollTop = savedPosition.position * (documentHeight - windowHeight)
|
||||||
|
|
||||||
|
window.scrollTo({
|
||||||
|
top: scrollTop,
|
||||||
|
behavior: 'smooth'
|
||||||
|
})
|
||||||
|
|
||||||
|
console.log('✅ [ContentPanel] Restored to position:', Math.round(savedPosition.position * 100) + '%', 'scrollTop:', scrollTop)
|
||||||
|
}, 500) // Give content time to render
|
||||||
|
} else if (savedPosition) {
|
||||||
|
if (savedPosition.position === 1) {
|
||||||
|
console.log('✅ [ContentPanel] Article completed (100%), starting from top')
|
||||||
|
} else {
|
||||||
|
console.log('⏭️ [ContentPanel] Position too early (<5%):', Math.round(savedPosition.position * 100) + '%')
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.error('❌ [ContentPanel] Failed to load reading position:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
loadPosition()
|
||||||
|
}, [isTextContent, activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
|
||||||
|
|
||||||
|
// Save position before unmounting or changing article
|
||||||
|
useEffect(() => {
|
||||||
|
return () => {
|
||||||
|
if (saveNow) {
|
||||||
|
saveNow()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}, [saveNow, selectedUrl])
|
||||||
|
|
||||||
// Close menu when clicking outside
|
// Close menu when clicking outside
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const handleClickOutside = (event: MouseEvent) => {
|
const handleClickOutside = (event: MouseEvent) => {
|
||||||
@@ -161,6 +286,35 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
||||||
|
|
||||||
|
// Check available space and position menu upward if needed
|
||||||
|
useEffect(() => {
|
||||||
|
const checkMenuPosition = (menuRef: React.RefObject<HTMLDivElement>, setOpenUpward: (value: boolean) => void) => {
|
||||||
|
if (!menuRef.current) return
|
||||||
|
|
||||||
|
const menuWrapper = menuRef.current
|
||||||
|
const menuElement = menuWrapper.querySelector('.article-menu') as HTMLElement
|
||||||
|
if (!menuElement) return
|
||||||
|
|
||||||
|
const rect = menuWrapper.getBoundingClientRect()
|
||||||
|
const viewportHeight = window.innerHeight
|
||||||
|
const spaceBelow = viewportHeight - rect.bottom
|
||||||
|
const menuHeight = menuElement.offsetHeight || 300 // estimate if not rendered yet
|
||||||
|
|
||||||
|
// Open upward if there's not enough space below (with 20px buffer)
|
||||||
|
setOpenUpward(spaceBelow < menuHeight + 20 && rect.top > menuHeight)
|
||||||
|
}
|
||||||
|
|
||||||
|
if (showArticleMenu) {
|
||||||
|
checkMenuPosition(articleMenuRef, setArticleMenuOpenUpward)
|
||||||
|
}
|
||||||
|
if (showVideoMenu) {
|
||||||
|
checkMenuPosition(videoMenuRef, setVideoMenuOpenUpward)
|
||||||
|
}
|
||||||
|
if (showExternalMenu) {
|
||||||
|
checkMenuPosition(externalMenuRef, setExternalMenuOpenUpward)
|
||||||
|
}
|
||||||
|
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
||||||
|
|
||||||
const readingStats = useMemo(() => {
|
const readingStats = useMemo(() => {
|
||||||
const content = markdown || html || ''
|
const content = markdown || html || ''
|
||||||
if (!content) return null
|
if (!content) return null
|
||||||
@@ -218,9 +372,15 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
relays: relayHints
|
relays: relayHints
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Check for source URL in 'r' tags
|
||||||
|
const sourceUrl = currentArticle.tags.find(t => t[0] === 'r')?.[1]
|
||||||
|
|
||||||
return {
|
return {
|
||||||
portal: getNostrUrl(naddr),
|
portal: getNostrUrl(naddr),
|
||||||
native: `nostr:${naddr}`
|
native: `nostr:${naddr}`,
|
||||||
|
naddr,
|
||||||
|
sourceUrl,
|
||||||
|
borisUrl: `${window.location.origin}/a/${naddr}`
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -245,6 +405,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
setShowArticleMenu(false)
|
setShowArticleMenu(false)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleShareBoris = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks) return
|
||||||
|
|
||||||
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: articleLinks.borisUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(articleLinks.borisUrl)
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Share failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleShareOriginal = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks?.sourceUrl) return
|
||||||
|
|
||||||
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: articleLinks.sourceUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(articleLinks.sourceUrl)
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Share failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleCopyBoris = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks) return
|
||||||
|
await navigator.clipboard.writeText(articleLinks.borisUrl)
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Copy failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleCopyOriginal = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks?.sourceUrl) return
|
||||||
|
await navigator.clipboard.writeText(articleLinks.sourceUrl)
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Copy failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleOpenSearch = () => {
|
||||||
|
if (articleLinks) {
|
||||||
|
window.open(getSearchUrl(articleLinks.naddr), '_blank', 'noopener,noreferrer')
|
||||||
|
}
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
|
||||||
// Video actions
|
// Video actions
|
||||||
const handleOpenVideoExternal = () => {
|
const handleOpenVideoExternal = () => {
|
||||||
@@ -307,10 +534,16 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
|
|
||||||
const handleShareExternalUrl = async () => {
|
const handleShareExternalUrl = async () => {
|
||||||
try {
|
try {
|
||||||
if (selectedUrl && (navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
if (!selectedUrl) return
|
||||||
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ title: title || 'Article', url: selectedUrl })
|
const borisUrl = `${window.location.origin}/r/${encodeURIComponent(selectedUrl)}`
|
||||||
} else if (selectedUrl) {
|
|
||||||
await navigator.clipboard.writeText(selectedUrl)
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: borisUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(borisUrl)
|
||||||
}
|
}
|
||||||
} catch (e) {
|
} catch (e) {
|
||||||
console.warn('Share failed', e)
|
console.warn('Share failed', e)
|
||||||
@@ -318,6 +551,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
setShowExternalMenu(false)
|
setShowExternalMenu(false)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleSearchExternalUrl = () => {
|
||||||
|
if (selectedUrl) {
|
||||||
|
window.open(getSearchUrl(selectedUrl), '_blank', 'noopener,noreferrer')
|
||||||
|
}
|
||||||
|
setShowExternalMenu(false)
|
||||||
|
}
|
||||||
|
|
||||||
// Check if article is already marked as read when URL/article changes
|
// Check if article is already marked as read when URL/article changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -501,7 +741,7 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
<FontAwesomeIcon icon={faEllipsisH} />
|
<FontAwesomeIcon icon={faEllipsisH} />
|
||||||
</button>
|
</button>
|
||||||
{showVideoMenu && (
|
{showVideoMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${videoMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
<button className="article-menu-item" onClick={handleOpenVideoExternal}>
|
<button className="article-menu-item" onClick={handleOpenVideoExternal}>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open Link</span>
|
<span>Open Link</span>
|
||||||
@@ -582,13 +822,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
|
|
||||||
{showExternalMenu && (
|
{showExternalMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${externalMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleOpenExternalUrl}
|
onClick={handleShareExternalUrl}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faShare} />
|
||||||
<span>Open Original URL</span>
|
<span>Share</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
@@ -599,10 +839,17 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleShareExternalUrl}
|
onClick={handleOpenExternalUrl}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faShare} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Share</span>
|
<span>Open Original</span>
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleSearchExternalUrl}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faSearch} />
|
||||||
|
<span>Search</span>
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
@@ -623,13 +870,52 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
|
|
||||||
{showArticleMenu && (
|
{showArticleMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${articleMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleShareBoris}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faShare} />
|
||||||
|
<span>Share</span>
|
||||||
|
</button>
|
||||||
|
{articleLinks.sourceUrl && (
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleShareOriginal}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faShare} />
|
||||||
|
<span>Share Original</span>
|
||||||
|
</button>
|
||||||
|
)}
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleCopyBoris}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faCopy} />
|
||||||
|
<span>Copy Link</span>
|
||||||
|
</button>
|
||||||
|
{articleLinks.sourceUrl && (
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleCopyOriginal}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faCopy} />
|
||||||
|
<span>Copy Original</span>
|
||||||
|
</button>
|
||||||
|
)}
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleOpenSearch}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faSearch} />
|
||||||
|
<span>Search</span>
|
||||||
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleOpenPortal}
|
onClick={handleOpenPortal}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open on Nostr</span>
|
<span>Open with njump</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
|
|||||||
395
src/components/Debug.tsx
Normal file
395
src/components/Debug.tsx
Normal file
@@ -0,0 +1,395 @@
|
|||||||
|
import React, { useEffect, useMemo, useState } from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faClock, faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import { Accounts } from 'applesauce-accounts'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from '../services/nostrConnect'
|
||||||
|
import { DebugBus, type DebugLogEntry } from '../utils/debugBus'
|
||||||
|
import VersionFooter from './VersionFooter'
|
||||||
|
|
||||||
|
const defaultPayload = 'The quick brown fox jumps over the lazy dog.'
|
||||||
|
|
||||||
|
const Debug: React.FC = () => {
|
||||||
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
const accountManager = Hooks.useAccountManager()
|
||||||
|
const [payload, setPayload] = useState<string>(defaultPayload)
|
||||||
|
const [cipher44, setCipher44] = useState<string>('')
|
||||||
|
const [cipher04, setCipher04] = useState<string>('')
|
||||||
|
const [plain44, setPlain44] = useState<string>('')
|
||||||
|
const [plain04, setPlain04] = useState<string>('')
|
||||||
|
const [tEncrypt44, setTEncrypt44] = useState<number | null>(null)
|
||||||
|
const [tEncrypt04, setTEncrypt04] = useState<number | null>(null)
|
||||||
|
const [tDecrypt44, setTDecrypt44] = useState<number | null>(null)
|
||||||
|
const [tDecrypt04, setTDecrypt04] = useState<number | null>(null)
|
||||||
|
const [logs, setLogs] = useState<DebugLogEntry[]>(DebugBus.snapshot())
|
||||||
|
const [debugEnabled, setDebugEnabled] = useState<boolean>(() => localStorage.getItem('debug') === '*')
|
||||||
|
|
||||||
|
// Bunker login state
|
||||||
|
const [bunkerUri, setBunkerUri] = useState<string>('')
|
||||||
|
const [isBunkerLoading, setIsBunkerLoading] = useState<boolean>(false)
|
||||||
|
const [bunkerError, setBunkerError] = useState<string | null>(null)
|
||||||
|
|
||||||
|
// Live timing state
|
||||||
|
const [liveTiming, setLiveTiming] = useState<{
|
||||||
|
nip44?: { type: 'encrypt' | 'decrypt'; startTime: number }
|
||||||
|
nip04?: { type: 'encrypt' | 'decrypt'; startTime: number }
|
||||||
|
}>({})
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
return DebugBus.subscribe((e) => setLogs(prev => [...prev, e].slice(-300)))
|
||||||
|
}, [])
|
||||||
|
|
||||||
|
// Live timer effect - triggers re-renders for live timing updates
|
||||||
|
useEffect(() => {
|
||||||
|
const interval = setInterval(() => {
|
||||||
|
// Force re-render to update live timing display
|
||||||
|
setLiveTiming(prev => prev)
|
||||||
|
}, 16) // ~60fps for smooth updates
|
||||||
|
return () => clearInterval(interval)
|
||||||
|
}, [])
|
||||||
|
|
||||||
|
const signer = useMemo(() => (activeAccount as unknown as { signer?: unknown })?.signer, [activeAccount])
|
||||||
|
const pubkey = (activeAccount as unknown as { pubkey?: string })?.pubkey
|
||||||
|
|
||||||
|
const hasNip04 = typeof (signer as { nip04?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip04?.encrypt === 'function'
|
||||||
|
const hasNip44 = typeof (signer as { nip44?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip44?.encrypt === 'function'
|
||||||
|
|
||||||
|
const doEncrypt = async (mode: 'nip44' | 'nip04') => {
|
||||||
|
if (!signer || !pubkey) return
|
||||||
|
try {
|
||||||
|
const api = (signer as { [key: string]: { encrypt: (pubkey: string, message: string) => Promise<string> } })[mode]
|
||||||
|
DebugBus.info('debug', `encrypt start ${mode}`, { pubkey, len: payload.length })
|
||||||
|
|
||||||
|
// Start live timing
|
||||||
|
const start = performance.now()
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: { type: 'encrypt', startTime: start } }))
|
||||||
|
|
||||||
|
const cipher = await api.encrypt(pubkey, payload)
|
||||||
|
const ms = Math.round(performance.now() - start)
|
||||||
|
|
||||||
|
// Stop live timing
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
|
||||||
|
DebugBus.info('debug', `encrypt done ${mode}`, { len: typeof cipher === 'string' ? cipher.length : -1, ms })
|
||||||
|
if (mode === 'nip44') setCipher44(cipher)
|
||||||
|
else setCipher04(cipher)
|
||||||
|
if (mode === 'nip44') setTEncrypt44(ms)
|
||||||
|
else setTEncrypt04(ms)
|
||||||
|
} catch (e) {
|
||||||
|
// Stop live timing on error
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
DebugBus.error('debug', `encrypt error ${mode}`, e instanceof Error ? e.message : String(e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const doDecrypt = async (mode: 'nip44' | 'nip04') => {
|
||||||
|
if (!signer || !pubkey) return
|
||||||
|
try {
|
||||||
|
const api = (signer as { [key: string]: { decrypt: (pubkey: string, ciphertext: string) => Promise<string> } })[mode]
|
||||||
|
const cipher = mode === 'nip44' ? cipher44 : cipher04
|
||||||
|
if (!cipher) {
|
||||||
|
DebugBus.warn('debug', `no cipher to decrypt for ${mode}`)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
DebugBus.info('debug', `decrypt start ${mode}`, { len: cipher.length })
|
||||||
|
|
||||||
|
// Start live timing
|
||||||
|
const start = performance.now()
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: { type: 'decrypt', startTime: start } }))
|
||||||
|
|
||||||
|
const plain = await api.decrypt(pubkey, cipher)
|
||||||
|
const ms = Math.round(performance.now() - start)
|
||||||
|
|
||||||
|
// Stop live timing
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
|
||||||
|
DebugBus.info('debug', `decrypt done ${mode}`, { len: typeof plain === 'string' ? plain.length : -1, ms })
|
||||||
|
if (mode === 'nip44') setPlain44(String(plain))
|
||||||
|
else setPlain04(String(plain))
|
||||||
|
if (mode === 'nip44') setTDecrypt44(ms)
|
||||||
|
else setTDecrypt04(ms)
|
||||||
|
} catch (e) {
|
||||||
|
// Stop live timing on error
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
DebugBus.error('debug', `decrypt error ${mode}`, e instanceof Error ? e.message : String(e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const toggleDebug = () => {
|
||||||
|
const next = !debugEnabled
|
||||||
|
setDebugEnabled(next)
|
||||||
|
if (next) localStorage.setItem('debug', '*')
|
||||||
|
else localStorage.removeItem('debug')
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleBunkerLogin = async () => {
|
||||||
|
if (!bunkerUri.trim()) {
|
||||||
|
setBunkerError('Please enter a bunker URI')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!bunkerUri.startsWith('bunker://')) {
|
||||||
|
setBunkerError('Invalid bunker URI. Must start with bunker://')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
setIsBunkerLoading(true)
|
||||||
|
setBunkerError(null)
|
||||||
|
|
||||||
|
// Create signer from bunker URI with default permissions
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
|
||||||
|
|
||||||
|
// Get pubkey from signer
|
||||||
|
const pubkey = await signer.getPublicKey()
|
||||||
|
|
||||||
|
// Create account from signer
|
||||||
|
const account = new Accounts.NostrConnectAccount(pubkey, signer)
|
||||||
|
|
||||||
|
// Add to account manager and set active
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
|
||||||
|
// Clear input on success
|
||||||
|
setBunkerUri('')
|
||||||
|
} catch (err) {
|
||||||
|
console.error('[bunker] Login failed:', err)
|
||||||
|
const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
|
||||||
|
|
||||||
|
// Check for permission-related errors
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
setBunkerError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
|
||||||
|
} else {
|
||||||
|
setBunkerError(errorMessage)
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
setIsBunkerLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const CodeBox = ({ value }: { value: string }) => (
|
||||||
|
<div className="h-20 overflow-y-auto font-mono text-xs leading-relaxed p-2 bg-gray-100 dark:bg-gray-800 rounded whitespace-pre-wrap break-all">
|
||||||
|
{value || '—'}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
|
||||||
|
const getLiveTiming = (mode: 'nip44' | 'nip04', type: 'encrypt' | 'decrypt') => {
|
||||||
|
const timing = liveTiming[mode]
|
||||||
|
if (timing && timing.type === type) {
|
||||||
|
const elapsed = Math.round(performance.now() - timing.startTime)
|
||||||
|
return elapsed
|
||||||
|
}
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const Stat = ({ label, value, mode, type }: {
|
||||||
|
label: string;
|
||||||
|
value?: string | number | null;
|
||||||
|
mode?: 'nip44' | 'nip04';
|
||||||
|
type?: 'encrypt' | 'decrypt';
|
||||||
|
}) => {
|
||||||
|
const liveValue = mode && type ? getLiveTiming(mode, type) : null
|
||||||
|
const isLive = !!liveValue
|
||||||
|
|
||||||
|
let displayValue: string
|
||||||
|
if (isLive) {
|
||||||
|
displayValue = ''
|
||||||
|
} else if (value !== null && value !== undefined) {
|
||||||
|
displayValue = `${value}ms`
|
||||||
|
} else {
|
||||||
|
displayValue = '—'
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<span className="badge" style={{ marginRight: 8 }}>
|
||||||
|
<FontAwesomeIcon icon={faClock} style={{ marginRight: 4, fontSize: '0.8em' }} />
|
||||||
|
{label}: {isLive ? (
|
||||||
|
<FontAwesomeIcon icon={faSpinner} className="animate-spin" style={{ fontSize: '0.8em' }} />
|
||||||
|
) : (
|
||||||
|
displayValue
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="settings-view">
|
||||||
|
<div className="settings-header">
|
||||||
|
<h2>Debug</h2>
|
||||||
|
<div className="settings-header-actions">
|
||||||
|
<span className="opacity-70">Active pubkey:</span> <code className="text-sm">{pubkey || 'none'}</code>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="settings-content">
|
||||||
|
|
||||||
|
{/* Bunker Login Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Bunker Connection</h3>
|
||||||
|
{!activeAccount ? (
|
||||||
|
<div>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Connect to your bunker (Nostr Connect signer) to enable encryption/decryption testing</div>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<input
|
||||||
|
type="text"
|
||||||
|
className="input flex-1"
|
||||||
|
placeholder="bunker://..."
|
||||||
|
value={bunkerUri}
|
||||||
|
onChange={(e) => setBunkerUri(e.target.value)}
|
||||||
|
disabled={isBunkerLoading}
|
||||||
|
/>
|
||||||
|
<button
|
||||||
|
className="btn btn-primary"
|
||||||
|
onClick={handleBunkerLogin}
|
||||||
|
disabled={isBunkerLoading || !bunkerUri.trim()}
|
||||||
|
>
|
||||||
|
{isBunkerLoading ? 'Connecting...' : 'Connect'}
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
{bunkerError && (
|
||||||
|
<div className="text-sm text-red-600 dark:text-red-400 mb-2">{bunkerError}</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="flex items-center justify-between">
|
||||||
|
<div>
|
||||||
|
<div className="text-sm opacity-70">Connected to bunker</div>
|
||||||
|
<div className="text-sm font-mono">{pubkey}</div>
|
||||||
|
</div>
|
||||||
|
<button
|
||||||
|
className="btn"
|
||||||
|
style={{
|
||||||
|
background: 'rgb(220 38 38)',
|
||||||
|
color: 'white',
|
||||||
|
border: '1px solid rgb(220 38 38)',
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
borderRadius: '6px',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: 'pointer',
|
||||||
|
transition: 'background-color 0.2s'
|
||||||
|
}}
|
||||||
|
onMouseEnter={(e) => e.currentTarget.style.background = 'rgb(185 28 28)'}
|
||||||
|
onMouseLeave={(e) => e.currentTarget.style.background = 'rgb(220 38 38)'}
|
||||||
|
onClick={() => accountManager.removeAccount(activeAccount)}
|
||||||
|
>
|
||||||
|
Disconnect
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Encryption Tools Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Encryption Tools</h3>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">Payload</label>
|
||||||
|
<textarea
|
||||||
|
className="textarea w-full bg-gray-50 dark:bg-gray-900 border border-gray-200 dark:border-gray-700"
|
||||||
|
value={payload}
|
||||||
|
onChange={e => setPayload(e.target.value)}
|
||||||
|
rows={3}
|
||||||
|
/>
|
||||||
|
<div className="flex gap-2 mt-3 justify-end">
|
||||||
|
<button className="btn btn-secondary" onClick={() => setPayload(defaultPayload)}>Reset</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => { setCipher44(''); setCipher04(''); setPlain44(''); setPlain04(''); setTEncrypt44(null); setTEncrypt04(null); setTDecrypt44(null); setTDecrypt04(null) }}>Clear</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-44</label>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<button className="btn btn-primary" onClick={() => doEncrypt('nip44')} disabled={!hasNip44}>Encrypt</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => doDecrypt('nip44')} disabled={!cipher44}>Decrypt</button>
|
||||||
|
</div>
|
||||||
|
<label className="block text-sm opacity-70 mb-2">Encrypted:</label>
|
||||||
|
<CodeBox value={cipher44} />
|
||||||
|
<div className="mt-3">
|
||||||
|
<span className="text-sm opacity-70">Plain:</span>
|
||||||
|
<CodeBox value={plain44} />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-04</label>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<button className="btn btn-primary" onClick={() => doEncrypt('nip04')} disabled={!hasNip04}>Encrypt</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => doDecrypt('nip04')} disabled={!cipher04}>Decrypt</button>
|
||||||
|
</div>
|
||||||
|
<label className="block text-sm opacity-70 mb-2">Encrypted:</label>
|
||||||
|
<CodeBox value={cipher04} />
|
||||||
|
<div className="mt-3">
|
||||||
|
<span className="text-sm opacity-70">Plain:</span>
|
||||||
|
<CodeBox value={plain04} />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Performance Timing Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Performance Timing</h3>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Encryption and decryption operation durations</div>
|
||||||
|
<div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-44</label>
|
||||||
|
<div className="flex flex-wrap items-center gap-2">
|
||||||
|
<Stat label="enc" value={tEncrypt44} mode="nip44" type="encrypt" />
|
||||||
|
<Stat label="dec" value={tDecrypt44} mode="nip44" type="decrypt" />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-04</label>
|
||||||
|
<div className="flex flex-wrap items-center gap-2">
|
||||||
|
<Stat label="enc" value={tEncrypt04} mode="nip04" type="encrypt" />
|
||||||
|
<Stat label="dec" value={tDecrypt04} mode="nip04" type="decrypt" />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Debug Logs Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Debug Logs</h3>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Recent bunker logs:</div>
|
||||||
|
<div className="max-h-192 overflow-y-auto font-mono text-xs leading-relaxed">
|
||||||
|
{logs.length === 0 ? (
|
||||||
|
<div className="text-sm opacity-50 italic">No logs yet</div>
|
||||||
|
) : (
|
||||||
|
logs.slice(-200).map((l, i) => (
|
||||||
|
<div key={i} className="mb-1 p-2 bg-gray-100 dark:bg-gray-800 rounded">
|
||||||
|
<span className="opacity-70">[{new Date(l.ts).toLocaleTimeString()}]</span> <span className="font-semibold">{l.level.toUpperCase()}</span> {l.source}: {l.message}
|
||||||
|
{l.data !== undefined && (
|
||||||
|
<span className="opacity-70"> — {typeof l.data === 'string' ? l.data : JSON.stringify(l.data)}</span>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
))
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
<div className="mt-3">
|
||||||
|
<div className="flex justify-end mb-2">
|
||||||
|
<label className="flex items-center gap-2 cursor-pointer">
|
||||||
|
<input
|
||||||
|
type="checkbox"
|
||||||
|
checked={debugEnabled}
|
||||||
|
onChange={toggleDebug}
|
||||||
|
className="checkbox"
|
||||||
|
/>
|
||||||
|
<span className="text-sm">Show all applesauce debug logs</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
<div className="flex justify-end">
|
||||||
|
<button className="btn btn-secondary" onClick={() => setLogs([])}>Clear logs</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<VersionFooter />
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default Debug
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
import React, { useState, useEffect, useRef, useMemo } from 'react'
|
import React, { useState, useEffect, useMemo } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faExclamationCircle, faNewspaper, faPenToSquare, faHighlighter, faUser, faUserGroup, faNetworkWired } from '@fortawesome/free-solid-svg-icons'
|
import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate, faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
|
import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
@@ -18,8 +18,8 @@ import { UserSettings } from '../services/settingsService'
|
|||||||
import BlogPostCard from './BlogPostCard'
|
import BlogPostCard from './BlogPostCard'
|
||||||
import { HighlightItem } from './HighlightItem'
|
import { HighlightItem } from './HighlightItem'
|
||||||
import { getCachedPosts, upsertCachedPost, setCachedPosts, getCachedHighlights, upsertCachedHighlight, setCachedHighlights } from '../services/exploreCache'
|
import { getCachedPosts, upsertCachedPost, setCachedPosts, getCachedHighlights, upsertCachedHighlight, setCachedHighlights } from '../services/exploreCache'
|
||||||
import { usePullToRefresh } from '../hooks/usePullToRefresh'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import PullToRefreshIndicator from './PullToRefreshIndicator'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
import { classifyHighlights } from '../utils/highlightClassification'
|
import { classifyHighlights } from '../utils/highlightClassification'
|
||||||
import { HighlightVisibility } from './HighlightsPanel'
|
import { HighlightVisibility } from './HighlightsPanel'
|
||||||
|
|
||||||
@@ -40,15 +40,13 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
const [highlights, setHighlights] = useState<Highlight[]>([])
|
const [highlights, setHighlights] = useState<Highlight[]>([])
|
||||||
const [followedPubkeys, setFollowedPubkeys] = useState<Set<string>>(new Set())
|
const [followedPubkeys, setFollowedPubkeys] = useState<Set<string>>(new Set())
|
||||||
const [loading, setLoading] = useState(true)
|
const [loading, setLoading] = useState(true)
|
||||||
const [error, setError] = useState<string | null>(null)
|
|
||||||
const exploreContainerRef = useRef<HTMLDivElement>(null)
|
|
||||||
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
||||||
|
|
||||||
// Visibility filters (defaults from settings)
|
// Visibility filters (defaults from settings, or friends only)
|
||||||
const [visibility, setVisibility] = useState<HighlightVisibility>({
|
const [visibility, setVisibility] = useState<HighlightVisibility>({
|
||||||
nostrverse: settings?.defaultHighlightVisibilityNostrverse !== false,
|
nostrverse: settings?.defaultHighlightVisibilityNostrverse ?? false,
|
||||||
friends: settings?.defaultHighlightVisibilityFriends !== false,
|
friends: settings?.defaultHighlightVisibilityFriends ?? true,
|
||||||
mine: settings?.defaultHighlightVisibilityMine !== false
|
mine: settings?.defaultHighlightVisibilityMine ?? false
|
||||||
})
|
})
|
||||||
|
|
||||||
// Update local state when prop changes
|
// Update local state when prop changes
|
||||||
@@ -61,7 +59,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const loadData = async () => {
|
const loadData = async () => {
|
||||||
if (!activeAccount) {
|
if (!activeAccount) {
|
||||||
setError('Please log in to explore content from your friends')
|
|
||||||
setLoading(false)
|
setLoading(false)
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
@@ -69,16 +66,16 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
try {
|
try {
|
||||||
// show spinner but keep existing data
|
// show spinner but keep existing data
|
||||||
setLoading(true)
|
setLoading(true)
|
||||||
setError(null)
|
|
||||||
|
|
||||||
// Seed from in-memory cache if available to avoid empty flash
|
// Seed from in-memory cache if available to avoid empty flash
|
||||||
|
// Use functional update to check current state without creating dependency
|
||||||
const cachedPosts = getCachedPosts(activeAccount.pubkey)
|
const cachedPosts = getCachedPosts(activeAccount.pubkey)
|
||||||
if (cachedPosts && cachedPosts.length > 0 && blogPosts.length === 0) {
|
if (cachedPosts && cachedPosts.length > 0) {
|
||||||
setBlogPosts(cachedPosts)
|
setBlogPosts(prev => prev.length === 0 ? cachedPosts : prev)
|
||||||
}
|
}
|
||||||
const cachedHighlights = getCachedHighlights(activeAccount.pubkey)
|
const cachedHighlights = getCachedHighlights(activeAccount.pubkey)
|
||||||
if (cachedHighlights && cachedHighlights.length > 0 && highlights.length === 0) {
|
if (cachedHighlights && cachedHighlights.length > 0) {
|
||||||
setHighlights(cachedHighlights)
|
setHighlights(prev => prev.length === 0 ? cachedHighlights : prev)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Fetch the user's contacts (friends)
|
// Fetch the user's contacts (friends)
|
||||||
@@ -151,11 +148,8 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
}
|
}
|
||||||
)
|
)
|
||||||
|
|
||||||
if (contacts.size === 0) {
|
// Always proceed to load nostrverse content even if no contacts
|
||||||
setError('You are not following anyone yet. Follow some people to see their content!')
|
// (removed blocking error for empty contacts)
|
||||||
setLoading(false)
|
|
||||||
return
|
|
||||||
}
|
|
||||||
|
|
||||||
// Store final followed pubkeys
|
// Store final followed pubkeys
|
||||||
setFollowedPubkeys(contacts)
|
setFollowedPubkeys(contacts)
|
||||||
@@ -202,10 +196,7 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
if (uniquePosts.length === 0 && uniqueHighlights.length === 0) {
|
// No blocking errors - let empty states handle messaging
|
||||||
setError('No content found yet')
|
|
||||||
}
|
|
||||||
|
|
||||||
setBlogPosts(uniquePosts)
|
setBlogPosts(uniquePosts)
|
||||||
setCachedPosts(activeAccount.pubkey, uniquePosts)
|
setCachedPosts(activeAccount.pubkey, uniquePosts)
|
||||||
|
|
||||||
@@ -213,21 +204,23 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
setCachedHighlights(activeAccount.pubkey, uniqueHighlights)
|
setCachedHighlights(activeAccount.pubkey, uniqueHighlights)
|
||||||
} catch (err) {
|
} catch (err) {
|
||||||
console.error('Failed to load data:', err)
|
console.error('Failed to load data:', err)
|
||||||
setError('Failed to load content. Please try again.')
|
// No blocking error - user can pull-to-refresh
|
||||||
} finally {
|
} finally {
|
||||||
setLoading(false)
|
setLoading(false)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
loadData()
|
loadData()
|
||||||
}, [relayPool, activeAccount, blogPosts.length, highlights.length, refreshTrigger, eventStore, settings])
|
}, [relayPool, activeAccount, refreshTrigger, eventStore, settings])
|
||||||
|
|
||||||
// Pull-to-refresh
|
// Pull-to-refresh
|
||||||
const pullToRefreshState = usePullToRefresh(exploreContainerRef, {
|
const { isRefreshing, pullPosition } = usePullToRefresh({
|
||||||
onRefresh: () => {
|
onRefresh: () => {
|
||||||
setRefreshTrigger(prev => prev + 1)
|
setRefreshTrigger(prev => prev + 1)
|
||||||
},
|
},
|
||||||
isRefreshing: loading
|
maximumPullLength: 240,
|
||||||
|
refreshThreshold: 80,
|
||||||
|
isDisabled: !activeAccount
|
||||||
})
|
})
|
||||||
|
|
||||||
const getPostUrl = (post: BlogPostPreview) => {
|
const getPostUrl = (post: BlogPostPreview) => {
|
||||||
@@ -244,35 +237,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
return `/a/${naddr}`
|
return `/a/${naddr}`
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleHighlightClick = (highlightId: string) => {
|
|
||||||
const highlight = highlights.find(h => h.id === highlightId)
|
|
||||||
if (!highlight) return
|
|
||||||
|
|
||||||
// For nostr-native articles
|
|
||||||
if (highlight.eventReference) {
|
|
||||||
// Convert eventReference to naddr
|
|
||||||
if (highlight.eventReference.includes(':')) {
|
|
||||||
const parts = highlight.eventReference.split(':')
|
|
||||||
const kind = parseInt(parts[0])
|
|
||||||
const pubkey = parts[1]
|
|
||||||
const identifier = parts[2] || ''
|
|
||||||
|
|
||||||
const naddr = nip19.naddrEncode({
|
|
||||||
kind,
|
|
||||||
pubkey,
|
|
||||||
identifier
|
|
||||||
})
|
|
||||||
navigate(`/a/${naddr}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
} else {
|
|
||||||
// Already an naddr
|
|
||||||
navigate(`/a/${highlight.eventReference}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
}
|
|
||||||
}
|
|
||||||
// For web URLs
|
|
||||||
else if (highlight.urlReference) {
|
|
||||||
navigate(`/r/${encodeURIComponent(highlight.urlReference)}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Classify highlights with levels based on user context and apply visibility filters
|
// Classify highlights with levels based on user context and apply visibility filters
|
||||||
const classifiedHighlights = useMemo(() => {
|
const classifiedHighlights = useMemo(() => {
|
||||||
@@ -285,33 +249,50 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
})
|
})
|
||||||
}, [highlights, activeAccount?.pubkey, followedPubkeys, visibility])
|
}, [highlights, activeAccount?.pubkey, followedPubkeys, visibility])
|
||||||
|
|
||||||
// Filter blog posts by future dates and visibility
|
// Filter blog posts by future dates and visibility, and add level classification
|
||||||
const filteredBlogPosts = useMemo(() => {
|
const filteredBlogPosts = useMemo(() => {
|
||||||
const maxFutureTime = Date.now() / 1000 + (24 * 60 * 60) // 1 day from now
|
const maxFutureTime = Date.now() / 1000 + (24 * 60 * 60) // 1 day from now
|
||||||
return blogPosts.filter(post => {
|
return blogPosts
|
||||||
// Filter out future dates
|
.filter(post => {
|
||||||
const publishedTime = post.published || post.event.created_at
|
// Filter out future dates
|
||||||
if (publishedTime > maxFutureTime) return false
|
const publishedTime = post.published || post.event.created_at
|
||||||
|
if (publishedTime > maxFutureTime) return false
|
||||||
// Apply visibility filters
|
|
||||||
const isMine = activeAccount && post.author === activeAccount.pubkey
|
// Apply visibility filters
|
||||||
const isFriend = followedPubkeys.has(post.author)
|
const isMine = activeAccount && post.author === activeAccount.pubkey
|
||||||
const isNostrverse = !isMine && !isFriend
|
const isFriend = followedPubkeys.has(post.author)
|
||||||
|
const isNostrverse = !isMine && !isFriend
|
||||||
if (isMine && !visibility.mine) return false
|
|
||||||
if (isFriend && !visibility.friends) return false
|
if (isMine && !visibility.mine) return false
|
||||||
if (isNostrverse && !visibility.nostrverse) return false
|
if (isFriend && !visibility.friends) return false
|
||||||
|
if (isNostrverse && !visibility.nostrverse) return false
|
||||||
return true
|
|
||||||
})
|
return true
|
||||||
|
})
|
||||||
|
.map(post => {
|
||||||
|
// Add level classification
|
||||||
|
const isMine = activeAccount && post.author === activeAccount.pubkey
|
||||||
|
const isFriend = followedPubkeys.has(post.author)
|
||||||
|
const level: 'mine' | 'friends' | 'nostrverse' = isMine ? 'mine' : isFriend ? 'friends' : 'nostrverse'
|
||||||
|
return { ...post, level }
|
||||||
|
})
|
||||||
}, [blogPosts, activeAccount, followedPubkeys, visibility])
|
}, [blogPosts, activeAccount, followedPubkeys, visibility])
|
||||||
|
|
||||||
const renderTabContent = () => {
|
const renderTabContent = () => {
|
||||||
switch (activeTab) {
|
switch (activeTab) {
|
||||||
case 'writings':
|
case 'writings':
|
||||||
|
if (showSkeletons) {
|
||||||
|
return (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
|
<BlogPostSkeleton key={i} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
return filteredBlogPosts.length === 0 ? (
|
return filteredBlogPosts.length === 0 ? (
|
||||||
<div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
<div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>No blog posts found yet.</p>
|
<FontAwesomeIcon icon={faSpinner} spin size="2x" />
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -320,15 +301,25 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
key={`${post.author}:${post.event.tags.find(t => t[0] === 'd')?.[1]}`}
|
key={`${post.author}:${post.event.tags.find(t => t[0] === 'd')?.[1]}`}
|
||||||
post={post}
|
post={post}
|
||||||
href={getPostUrl(post)}
|
href={getPostUrl(post)}
|
||||||
|
level={post.level}
|
||||||
/>
|
/>
|
||||||
))}
|
))}
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|
||||||
case 'highlights':
|
case 'highlights':
|
||||||
|
if (showSkeletons) {
|
||||||
|
return (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{Array.from({ length: 8 }).map((_, i) => (
|
||||||
|
<HighlightSkeleton key={i} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
return classifiedHighlights.length === 0 ? (
|
return classifiedHighlights.length === 0 ? (
|
||||||
<div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
<div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>No highlights yet. Your friends should start highlighting content!</p>
|
<FontAwesomeIcon icon={faSpinner} spin size="2x" />
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -337,7 +328,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
key={highlight.id}
|
key={highlight.id}
|
||||||
highlight={highlight}
|
highlight={highlight}
|
||||||
relayPool={relayPool}
|
relayPool={relayPool}
|
||||||
onHighlightClick={handleHighlightClick}
|
|
||||||
/>
|
/>
|
||||||
))}
|
))}
|
||||||
</div>
|
</div>
|
||||||
@@ -348,85 +338,33 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Only show full loading screen if we don't have any data yet
|
// Show content progressively - no blocking error screens
|
||||||
const hasData = highlights.length > 0 || blogPosts.length > 0
|
const hasData = highlights.length > 0 || blogPosts.length > 0
|
||||||
|
const showSkeletons = loading && !hasData
|
||||||
if (loading && !hasData) {
|
|
||||||
return (
|
|
||||||
<div className="explore-container" aria-busy="true">
|
|
||||||
<div className="explore-header">
|
|
||||||
<h1>
|
|
||||||
<FontAwesomeIcon icon={faNewspaper} />
|
|
||||||
Explore
|
|
||||||
</h1>
|
|
||||||
</div>
|
|
||||||
<div className="explore-grid">
|
|
||||||
{activeTab === 'writings' ? (
|
|
||||||
Array.from({ length: 6 }).map((_, i) => (
|
|
||||||
<BlogPostSkeleton key={i} />
|
|
||||||
))
|
|
||||||
) : (
|
|
||||||
Array.from({ length: 8 }).map((_, i) => (
|
|
||||||
<HighlightSkeleton key={i} />
|
|
||||||
))
|
|
||||||
)}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
if (error) {
|
|
||||||
return (
|
|
||||||
<div className="explore-container">
|
|
||||||
<div className="explore-error">
|
|
||||||
<FontAwesomeIcon icon={faExclamationCircle} size="2x" />
|
|
||||||
<p>{error}</p>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div
|
<div className="explore-container">
|
||||||
ref={exploreContainerRef}
|
<RefreshIndicator
|
||||||
className={`explore-container pull-to-refresh-container ${pullToRefreshState.isPulling ? 'is-pulling' : ''}`}
|
isRefreshing={isRefreshing}
|
||||||
>
|
pullPosition={pullPosition}
|
||||||
<PullToRefreshIndicator
|
|
||||||
isPulling={pullToRefreshState.isPulling}
|
|
||||||
pullDistance={pullToRefreshState.pullDistance}
|
|
||||||
canRefresh={pullToRefreshState.canRefresh}
|
|
||||||
isRefreshing={loading && pullToRefreshState.canRefresh}
|
|
||||||
/>
|
/>
|
||||||
<div className="explore-header">
|
<div className="explore-header">
|
||||||
<h1>
|
<h1>
|
||||||
<FontAwesomeIcon icon={faNewspaper} />
|
<FontAwesomeIcon icon={faNewspaper} />
|
||||||
Explore
|
Explore
|
||||||
</h1>
|
</h1>
|
||||||
<p className="explore-subtitle">
|
|
||||||
Discover highlights and blog posts from your friends and others
|
|
||||||
</p>
|
|
||||||
|
|
||||||
<div className="me-tabs">
|
|
||||||
<button
|
|
||||||
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
|
||||||
data-tab="highlights"
|
|
||||||
onClick={() => navigate('/explore')}
|
|
||||||
>
|
|
||||||
<FontAwesomeIcon icon={faHighlighter} />
|
|
||||||
<span className="tab-label">Highlights</span>
|
|
||||||
</button>
|
|
||||||
<button
|
|
||||||
className={`me-tab ${activeTab === 'writings' ? 'active' : ''}`}
|
|
||||||
data-tab="writings"
|
|
||||||
onClick={() => navigate('/explore/writings')}
|
|
||||||
>
|
|
||||||
<FontAwesomeIcon icon={faPenToSquare} />
|
|
||||||
<span className="tab-label">Writings</span>
|
|
||||||
</button>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
{/* Visibility filters */}
|
{/* Visibility filters */}
|
||||||
<div className="highlight-level-toggles" style={{ marginTop: '1rem', display: 'flex', gap: '0.5rem' }}>
|
<div className="highlight-level-toggles" style={{ marginTop: '1rem', display: 'flex', gap: '0.5rem', justifyContent: 'flex-end' }}>
|
||||||
|
<IconButton
|
||||||
|
icon={faArrowsRotate}
|
||||||
|
onClick={() => setRefreshTrigger(prev => prev + 1)}
|
||||||
|
title="Refresh content"
|
||||||
|
ariaLabel="Refresh content"
|
||||||
|
variant="ghost"
|
||||||
|
spin={loading || isRefreshing}
|
||||||
|
disabled={loading || isRefreshing}
|
||||||
|
/>
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faNetworkWired}
|
icon={faNetworkWired}
|
||||||
onClick={() => setVisibility({ ...visibility, nostrverse: !visibility.nostrverse })}
|
onClick={() => setVisibility({ ...visibility, nostrverse: !visibility.nostrverse })}
|
||||||
@@ -463,6 +401,25 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
}}
|
}}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div className="me-tabs">
|
||||||
|
<button
|
||||||
|
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
||||||
|
data-tab="highlights"
|
||||||
|
onClick={() => navigate('/explore')}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faHighlighter} />
|
||||||
|
<span className="tab-label">Highlights</span>
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
className={`me-tab ${activeTab === 'writings' ? 'active' : ''}`}
|
||||||
|
data-tab="writings"
|
||||||
|
onClick={() => navigate('/explore/writings')}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faNewspaper} />
|
||||||
|
<span className="tab-label">Writings</span>
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
{renderTabContent()}
|
{renderTabContent()}
|
||||||
|
|||||||
@@ -13,10 +13,10 @@ import { areAllRelaysLocal } from '../utils/helpers'
|
|||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { formatDateCompact } from '../utils/bookmarkUtils'
|
import { formatDateCompact } from '../utils/bookmarkUtils'
|
||||||
import { createDeletionRequest } from '../services/deletionService'
|
import { createDeletionRequest } from '../services/deletionService'
|
||||||
import ConfirmDialog from './ConfirmDialog'
|
|
||||||
import { getNostrUrl } from '../config/nostrGateways'
|
import { getNostrUrl } from '../config/nostrGateways'
|
||||||
import CompactButton from './CompactButton'
|
import CompactButton from './CompactButton'
|
||||||
import { HighlightCitation } from './HighlightCitation'
|
import { HighlightCitation } from './HighlightCitation'
|
||||||
|
import { useNavigate } from 'react-router-dom'
|
||||||
|
|
||||||
// Helper to detect if a URL is an image
|
// Helper to detect if a URL is an image
|
||||||
const isImageUrl = (url: string): boolean => {
|
const isImageUrl = (url: string): boolean => {
|
||||||
@@ -207,6 +207,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
const [showMenu, setShowMenu] = useState(false)
|
const [showMenu, setShowMenu] = useState(false)
|
||||||
|
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
const navigate = useNavigate()
|
||||||
|
|
||||||
// Resolve the profile of the user who made the highlight
|
// Resolve the profile of the user who made the highlight
|
||||||
const profile = useEventModel(Models.ProfileModel, [highlight.pubkey])
|
const profile = useEventModel(Models.ProfileModel, [highlight.pubkey])
|
||||||
@@ -257,25 +258,52 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
}
|
}
|
||||||
}, [isSelected])
|
}, [isSelected])
|
||||||
|
|
||||||
// Close menu when clicking outside
|
// Close menu and reset delete confirm when clicking outside
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const handleClickOutside = (event: MouseEvent) => {
|
const handleClickOutside = (event: MouseEvent) => {
|
||||||
if (menuRef.current && !menuRef.current.contains(event.target as Node)) {
|
if (menuRef.current && !menuRef.current.contains(event.target as Node)) {
|
||||||
setShowMenu(false)
|
setShowMenu(false)
|
||||||
|
setShowDeleteConfirm(false)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (showMenu) {
|
if (showMenu || showDeleteConfirm) {
|
||||||
document.addEventListener('mousedown', handleClickOutside)
|
document.addEventListener('mousedown', handleClickOutside)
|
||||||
return () => {
|
return () => {
|
||||||
document.removeEventListener('mousedown', handleClickOutside)
|
document.removeEventListener('mousedown', handleClickOutside)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}, [showMenu])
|
}, [showMenu, showDeleteConfirm])
|
||||||
|
|
||||||
const handleItemClick = () => {
|
const handleItemClick = () => {
|
||||||
|
// If onHighlightClick is provided, use it (legacy behavior)
|
||||||
if (onHighlightClick) {
|
if (onHighlightClick) {
|
||||||
onHighlightClick(highlight.id)
|
onHighlightClick(highlight.id)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// Otherwise, navigate to the article that this highlight references
|
||||||
|
if (highlight.eventReference) {
|
||||||
|
// Parse the event reference - it can be an event ID or article coordinate (kind:pubkey:identifier)
|
||||||
|
const parts = highlight.eventReference.split(':')
|
||||||
|
|
||||||
|
// If it's an article coordinate (3 parts) and kind is 30023, navigate to it
|
||||||
|
if (parts.length === 3) {
|
||||||
|
const [kind, pubkey, identifier] = parts
|
||||||
|
|
||||||
|
if (kind === '30023') {
|
||||||
|
// Encode as naddr and navigate
|
||||||
|
const naddr = nip19.naddrEncode({
|
||||||
|
kind: 30023,
|
||||||
|
pubkey,
|
||||||
|
identifier
|
||||||
|
})
|
||||||
|
navigate(`/a/${naddr}`)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else if (highlight.urlReference) {
|
||||||
|
// Navigate to external URL
|
||||||
|
navigate(`/r/${encodeURIComponent(highlight.urlReference)}`)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -434,12 +462,12 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleCancelDelete = () => {
|
|
||||||
setShowDeleteConfirm(false)
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleMenuToggle = (e: React.MouseEvent) => {
|
const handleMenuToggle = (e: React.MouseEvent) => {
|
||||||
e.stopPropagation()
|
e.stopPropagation()
|
||||||
|
// Reset delete confirm state when opening/closing menu
|
||||||
|
if (!showMenu) {
|
||||||
|
setShowDeleteConfirm(false)
|
||||||
|
}
|
||||||
setShowMenu(!showMenu)
|
setShowMenu(!showMenu)
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -461,6 +489,11 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
setShowDeleteConfirm(true)
|
setShowDeleteConfirm(true)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleConfirmDeleteClick = (e: React.MouseEvent) => {
|
||||||
|
e.stopPropagation()
|
||||||
|
handleConfirmDelete()
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
<div
|
<div
|
||||||
@@ -468,7 +501,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
className={`highlight-item ${isSelected ? 'selected' : ''} ${highlight.level ? `level-${highlight.level}` : ''}`}
|
className={`highlight-item ${isSelected ? 'selected' : ''} ${highlight.level ? `level-${highlight.level}` : ''}`}
|
||||||
data-highlight-id={highlight.id}
|
data-highlight-id={highlight.id}
|
||||||
onClick={handleItemClick}
|
onClick={handleItemClick}
|
||||||
style={{ cursor: onHighlightClick ? 'pointer' : 'default' }}
|
style={{ cursor: (onHighlightClick || highlight.eventReference || highlight.urlReference) ? 'pointer' : 'default' }}
|
||||||
>
|
>
|
||||||
<div className="highlight-header">
|
<div className="highlight-header">
|
||||||
<CompactButton
|
<CompactButton
|
||||||
@@ -533,6 +566,33 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div className="highlight-menu-wrapper" ref={menuRef}>
|
<div className="highlight-menu-wrapper" ref={menuRef}>
|
||||||
|
{showDeleteConfirm && canDelete && (
|
||||||
|
<div style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', marginRight: '0.5rem' }}>
|
||||||
|
<span style={{ fontSize: '0.875rem', color: 'rgb(220 38 38)', fontWeight: 500 }}>Confirm?</span>
|
||||||
|
<button
|
||||||
|
onClick={handleConfirmDeleteClick}
|
||||||
|
disabled={isDeleting}
|
||||||
|
title="Confirm deletion"
|
||||||
|
style={{
|
||||||
|
color: 'rgb(220 38 38)',
|
||||||
|
background: 'rgba(220, 38, 38, 0.1)',
|
||||||
|
border: '1px solid rgb(220 38 38)',
|
||||||
|
borderRadius: '4px',
|
||||||
|
padding: '0.375rem',
|
||||||
|
cursor: isDeleting ? 'not-allowed' : 'pointer',
|
||||||
|
display: 'flex',
|
||||||
|
alignItems: 'center',
|
||||||
|
justifyContent: 'center',
|
||||||
|
minWidth: '33px',
|
||||||
|
minHeight: '33px',
|
||||||
|
transition: 'all 0.2s'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={isDeleting ? faSpinner : faTrash} spin={isDeleting} />
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
|
||||||
<CompactButton
|
<CompactButton
|
||||||
icon={faEllipsisH}
|
icon={faEllipsisH}
|
||||||
onClick={handleMenuToggle}
|
onClick={handleMenuToggle}
|
||||||
@@ -546,7 +606,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
onClick={handleOpenPortal}
|
onClick={handleOpenPortal}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open on Nostr</span>
|
<span>Open with njump</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="highlight-menu-item"
|
className="highlight-menu-item"
|
||||||
@@ -571,17 +631,6 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<ConfirmDialog
|
|
||||||
isOpen={showDeleteConfirm}
|
|
||||||
title="Delete Highlight?"
|
|
||||||
message="This will request deletion of your highlight. It may still be visible on some relays that don't honor deletion requests."
|
|
||||||
confirmText="Delete"
|
|
||||||
cancelText="Cancel"
|
|
||||||
variant="danger"
|
|
||||||
onConfirm={handleConfirmDelete}
|
|
||||||
onCancel={handleCancelDelete}
|
|
||||||
/>
|
|
||||||
</>
|
</>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,13 +1,13 @@
|
|||||||
import React, { useState, useRef } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { HighlightItem } from './HighlightItem'
|
import { HighlightItem } from './HighlightItem'
|
||||||
import { useFilteredHighlights } from '../hooks/useFilteredHighlights'
|
import { useFilteredHighlights } from '../hooks/useFilteredHighlights'
|
||||||
import { usePullToRefresh } from '../hooks/usePullToRefresh'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import HighlightsPanelCollapsed from './HighlightsPanel/HighlightsPanelCollapsed'
|
import HighlightsPanelCollapsed from './HighlightsPanel/HighlightsPanelCollapsed'
|
||||||
import HighlightsPanelHeader from './HighlightsPanel/HighlightsPanelHeader'
|
import HighlightsPanelHeader from './HighlightsPanel/HighlightsPanelHeader'
|
||||||
import PullToRefreshIndicator from './PullToRefreshIndicator'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { IEventStore } from 'applesauce-core'
|
import { IEventStore } from 'applesauce-core'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
@@ -60,7 +60,6 @@ export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
|
|||||||
}) => {
|
}) => {
|
||||||
const [showHighlights, setShowHighlights] = useState(true)
|
const [showHighlights, setShowHighlights] = useState(true)
|
||||||
const [localHighlights, setLocalHighlights] = useState(highlights)
|
const [localHighlights, setLocalHighlights] = useState(highlights)
|
||||||
const highlightsListRef = useRef<HTMLDivElement>(null)
|
|
||||||
|
|
||||||
const handleToggleHighlights = () => {
|
const handleToggleHighlights = () => {
|
||||||
const newValue = !showHighlights
|
const newValue = !showHighlights
|
||||||
@@ -69,14 +68,15 @@ export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Pull-to-refresh for highlights
|
// Pull-to-refresh for highlights
|
||||||
const pullToRefreshState = usePullToRefresh(highlightsListRef, {
|
const { isRefreshing, pullPosition } = usePullToRefresh({
|
||||||
onRefresh: () => {
|
onRefresh: () => {
|
||||||
if (onRefresh) {
|
if (onRefresh) {
|
||||||
onRefresh()
|
onRefresh()
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
isRefreshing: loading,
|
maximumPullLength: 240,
|
||||||
disabled: !onRefresh
|
refreshThreshold: 80,
|
||||||
|
isDisabled: !onRefresh
|
||||||
})
|
})
|
||||||
|
|
||||||
// Keep track of highlight updates
|
// Keep track of highlight updates
|
||||||
@@ -144,15 +144,10 @@ export const HighlightsPanel: React.FC<HighlightsPanelProps> = ({
|
|||||||
</p>
|
</p>
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div
|
<div className="highlights-list">
|
||||||
ref={highlightsListRef}
|
<RefreshIndicator
|
||||||
className={`highlights-list pull-to-refresh-container ${pullToRefreshState.isPulling ? 'is-pulling' : ''}`}
|
isRefreshing={isRefreshing}
|
||||||
>
|
pullPosition={pullPosition}
|
||||||
<PullToRefreshIndicator
|
|
||||||
isPulling={pullToRefreshState.isPulling}
|
|
||||||
pullDistance={pullToRefreshState.pullDistance}
|
|
||||||
canRefresh={pullToRefreshState.canRefresh}
|
|
||||||
isRefreshing={loading}
|
|
||||||
/>
|
/>
|
||||||
{filteredHighlights.map((highlight) => (
|
{filteredHighlights.map((highlight) => (
|
||||||
<HighlightItem
|
<HighlightItem
|
||||||
|
|||||||
179
src/components/LoginOptions.tsx
Normal file
179
src/components/LoginOptions.tsx
Normal file
@@ -0,0 +1,179 @@
|
|||||||
|
import React, { useState } from 'react'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import { Accounts } from 'applesauce-accounts'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from '../services/nostrConnect'
|
||||||
|
|
||||||
|
const LoginOptions: React.FC = () => {
|
||||||
|
const accountManager = Hooks.useAccountManager()
|
||||||
|
const [showBunkerInput, setShowBunkerInput] = useState(false)
|
||||||
|
const [bunkerUri, setBunkerUri] = useState('')
|
||||||
|
const [isLoading, setIsLoading] = useState(false)
|
||||||
|
const [error, setError] = useState<string | null>(null)
|
||||||
|
|
||||||
|
const handleExtensionLogin = async () => {
|
||||||
|
try {
|
||||||
|
setIsLoading(true)
|
||||||
|
setError(null)
|
||||||
|
const account = await Accounts.ExtensionAccount.fromExtension()
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Extension login failed:', err)
|
||||||
|
setError('Login failed. Please install a nostr browser extension and try again.')
|
||||||
|
} finally {
|
||||||
|
setIsLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleBunkerLogin = async () => {
|
||||||
|
if (!bunkerUri.trim()) {
|
||||||
|
setError('Please enter a bunker URI')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!bunkerUri.startsWith('bunker://')) {
|
||||||
|
setError('Invalid bunker URI. Must start with bunker://')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
setIsLoading(true)
|
||||||
|
setError(null)
|
||||||
|
|
||||||
|
// Create signer from bunker URI with default permissions
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
|
||||||
|
|
||||||
|
// Get pubkey from signer
|
||||||
|
const pubkey = await signer.getPublicKey()
|
||||||
|
|
||||||
|
// Create account from signer
|
||||||
|
const account = new Accounts.NostrConnectAccount(pubkey, signer)
|
||||||
|
|
||||||
|
// Add to account manager and set active
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
|
||||||
|
// Clear input on success
|
||||||
|
setBunkerUri('')
|
||||||
|
setShowBunkerInput(false)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('[bunker] Login failed:', err)
|
||||||
|
const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
|
||||||
|
|
||||||
|
// Check for permission-related errors
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
setError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
|
||||||
|
} else {
|
||||||
|
setError(errorMessage)
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
setIsLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="empty-state">
|
||||||
|
<p style={{ marginBottom: '1rem' }}>Login with:</p>
|
||||||
|
|
||||||
|
<div style={{ display: 'flex', flexDirection: 'column', gap: '0.75rem', maxWidth: '300px', margin: '0 auto' }}>
|
||||||
|
<button
|
||||||
|
onClick={handleExtensionLogin}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: isLoading ? 'wait' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
{isLoading && !showBunkerInput ? 'Connecting...' : 'Extension'}
|
||||||
|
</button>
|
||||||
|
|
||||||
|
{!showBunkerInput ? (
|
||||||
|
<button
|
||||||
|
onClick={() => setShowBunkerInput(true)}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: isLoading ? 'wait' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
Bunker
|
||||||
|
</button>
|
||||||
|
) : (
|
||||||
|
<div style={{ display: 'flex', flexDirection: 'column', gap: '0.5rem' }}>
|
||||||
|
<input
|
||||||
|
type="text"
|
||||||
|
placeholder="bunker://..."
|
||||||
|
value={bunkerUri}
|
||||||
|
onChange={(e) => setBunkerUri(e.target.value)}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
width: '100%',
|
||||||
|
boxSizing: 'border-box'
|
||||||
|
}}
|
||||||
|
onKeyDown={(e) => {
|
||||||
|
if (e.key === 'Enter') {
|
||||||
|
handleBunkerLogin()
|
||||||
|
}
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
<div style={{ display: 'flex', gap: '0.5rem' }}>
|
||||||
|
<button
|
||||||
|
onClick={handleBunkerLogin}
|
||||||
|
disabled={isLoading || !bunkerUri.trim()}
|
||||||
|
style={{
|
||||||
|
padding: '0.5rem 1rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
flex: 1,
|
||||||
|
cursor: isLoading || !bunkerUri.trim() ? 'not-allowed' : 'pointer',
|
||||||
|
opacity: isLoading || !bunkerUri.trim() ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
{isLoading && showBunkerInput ? 'Connecting...' : 'Connect'}
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
onClick={() => {
|
||||||
|
setShowBunkerInput(false)
|
||||||
|
setBunkerUri('')
|
||||||
|
setError(null)
|
||||||
|
}}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.5rem 1rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
cursor: isLoading ? 'not-allowed' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
Cancel
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{error && (
|
||||||
|
<p style={{ color: 'var(--color-error, #ef4444)', marginTop: '1rem', fontSize: '0.9rem' }}>
|
||||||
|
{error}
|
||||||
|
</p>
|
||||||
|
)}
|
||||||
|
|
||||||
|
<p style={{ marginTop: '1.5rem', fontSize: '0.9rem' }}>
|
||||||
|
If you aren't on nostr yet, start here:{' '}
|
||||||
|
<a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">
|
||||||
|
nstart.me
|
||||||
|
</a>
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default LoginOptions
|
||||||
|
|
||||||
@@ -1,16 +1,17 @@
|
|||||||
import React, { useState, useEffect, useRef } from 'react'
|
import React, { useState, useEffect } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faSpinner, faExclamationCircle, faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
|
import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { useNavigate } from 'react-router-dom'
|
import { useNavigate, useParams } from 'react-router-dom'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { HighlightItem } from './HighlightItem'
|
import { HighlightItem } from './HighlightItem'
|
||||||
import { fetchHighlights } from '../services/highlightService'
|
import { fetchHighlights } from '../services/highlightService'
|
||||||
import { fetchBookmarks } from '../services/bookmarkService'
|
import { fetchBookmarks } from '../services/bookmarkService'
|
||||||
import { fetchReadArticlesWithData } from '../services/libraryService'
|
import { fetchAllReads, ReadItem } from '../services/readsService'
|
||||||
|
import { fetchLinks } from '../services/linksService'
|
||||||
import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
|
import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
||||||
@@ -19,12 +20,18 @@ import BlogPostCard from './BlogPostCard'
|
|||||||
import { BookmarkItem } from './BookmarkItem'
|
import { BookmarkItem } from './BookmarkItem'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import { ViewMode } from './Bookmarks'
|
import { ViewMode } from './Bookmarks'
|
||||||
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
import { getCachedMeData, updateCachedHighlights } from '../services/meCache'
|
||||||
import { getCachedMeData, setCachedMeData, updateCachedHighlights } from '../services/meCache'
|
|
||||||
import { faBooks } from '../icons/customIcons'
|
import { faBooks } from '../icons/customIcons'
|
||||||
import { usePullToRefresh } from '../hooks/usePullToRefresh'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import PullToRefreshIndicator from './PullToRefreshIndicator'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
import { getProfileUrl } from '../config/nostrGateways'
|
import { groupIndividualBookmarks, hasContent } from '../utils/bookmarkUtils'
|
||||||
|
import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
|
||||||
|
import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import ReadingProgressFilters, { ReadingProgressFilterType } from './ReadingProgressFilters'
|
||||||
|
import { filterByReadingProgress } from '../utils/readingProgressUtils'
|
||||||
|
import { deriveReadsFromBookmarks } from '../utils/readsFromBookmarks'
|
||||||
|
import { deriveLinksFromBookmarks } from '../utils/linksFromBookmarks'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
interface MeProps {
|
interface MeProps {
|
||||||
relayPool: RelayPool
|
relayPool: RelayPool
|
||||||
@@ -32,11 +39,15 @@ interface MeProps {
|
|||||||
pubkey?: string // Optional pubkey for viewing other users' profiles
|
pubkey?: string // Optional pubkey for viewing other users' profiles
|
||||||
}
|
}
|
||||||
|
|
||||||
type TabType = 'highlights' | 'reading-list' | 'archive' | 'writings'
|
type TabType = 'highlights' | 'reading-list' | 'reads' | 'links' | 'writings'
|
||||||
|
|
||||||
|
// Valid reading progress filters
|
||||||
|
const VALID_FILTERS: ReadingProgressFilterType[] = ['all', 'unopened', 'started', 'reading', 'completed']
|
||||||
|
|
||||||
const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: propPubkey }) => {
|
const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: propPubkey }) => {
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
const navigate = useNavigate()
|
const navigate = useNavigate()
|
||||||
|
const { filter: urlFilter } = useParams<{ filter?: string }>()
|
||||||
const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
|
const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
|
||||||
|
|
||||||
// Use provided pubkey or fall back to active account
|
// Use provided pubkey or fall back to active account
|
||||||
@@ -44,13 +55,22 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
const isOwnProfile = !propPubkey || (activeAccount?.pubkey === propPubkey)
|
const isOwnProfile = !propPubkey || (activeAccount?.pubkey === propPubkey)
|
||||||
const [highlights, setHighlights] = useState<Highlight[]>([])
|
const [highlights, setHighlights] = useState<Highlight[]>([])
|
||||||
const [bookmarks, setBookmarks] = useState<Bookmark[]>([])
|
const [bookmarks, setBookmarks] = useState<Bookmark[]>([])
|
||||||
const [readArticles, setReadArticles] = useState<BlogPostPreview[]>([])
|
const [reads, setReads] = useState<ReadItem[]>([])
|
||||||
|
const [, setReadsMap] = useState<Map<string, ReadItem>>(new Map())
|
||||||
|
const [links, setLinks] = useState<ReadItem[]>([])
|
||||||
|
const [, setLinksMap] = useState<Map<string, ReadItem>>(new Map())
|
||||||
const [writings, setWritings] = useState<BlogPostPreview[]>([])
|
const [writings, setWritings] = useState<BlogPostPreview[]>([])
|
||||||
const [loading, setLoading] = useState(true)
|
const [loading, setLoading] = useState(true)
|
||||||
const [error, setError] = useState<string | null>(null)
|
const [loadedTabs, setLoadedTabs] = useState<Set<TabType>>(new Set())
|
||||||
const [viewMode, setViewMode] = useState<ViewMode>('cards')
|
const [viewMode, setViewMode] = useState<ViewMode>('cards')
|
||||||
const meContainerRef = useRef<HTMLDivElement>(null)
|
|
||||||
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
||||||
|
const [bookmarkFilter, setBookmarkFilter] = useState<BookmarkFilterType>('all')
|
||||||
|
|
||||||
|
// Initialize reading progress filter from URL param
|
||||||
|
const initialFilter = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType)
|
||||||
|
? (urlFilter as ReadingProgressFilterType)
|
||||||
|
: 'all'
|
||||||
|
const [readingProgressFilter, setReadingProgressFilter] = useState<ReadingProgressFilterType>(initialFilter)
|
||||||
|
|
||||||
// Update local state when prop changes
|
// Update local state when prop changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -59,77 +79,251 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
}
|
}
|
||||||
}, [propActiveTab])
|
}, [propActiveTab])
|
||||||
|
|
||||||
|
// Sync filter state with URL changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const loadData = async () => {
|
const filterFromUrl = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType)
|
||||||
if (!viewingPubkey) {
|
? (urlFilter as ReadingProgressFilterType)
|
||||||
setError(isOwnProfile ? 'Please log in to view your data' : 'Invalid profile')
|
: 'all'
|
||||||
setLoading(false)
|
setReadingProgressFilter(filterFromUrl)
|
||||||
return
|
}, [urlFilter])
|
||||||
|
|
||||||
|
// Handler to change reading progress filter and update URL
|
||||||
|
const handleReadingProgressFilterChange = (filter: ReadingProgressFilterType) => {
|
||||||
|
setReadingProgressFilter(filter)
|
||||||
|
if (activeTab === 'reads') {
|
||||||
|
if (filter === 'all') {
|
||||||
|
navigate('/me/reads', { replace: true })
|
||||||
|
} else {
|
||||||
|
navigate(`/me/reads/${filter}`, { replace: true })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Tab-specific loading functions
|
||||||
|
const loadHighlightsTab = async () => {
|
||||||
|
if (!viewingPubkey) return
|
||||||
|
|
||||||
|
// Only show loading skeleton if tab hasn't been loaded yet
|
||||||
|
const hasBeenLoaded = loadedTabs.has('highlights')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
const userHighlights = await fetchHighlights(relayPool, viewingPubkey)
|
||||||
|
setHighlights(userHighlights)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('highlights'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load highlights:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadWritingsTab = async () => {
|
||||||
|
if (!viewingPubkey) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('writings')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
const userWritings = await fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
|
||||||
|
setWritings(userWritings)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('writings'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load writings:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadReadingListTab = async () => {
|
||||||
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('reading-list')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
setBookmarks([])
|
||||||
|
}
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('reading-list'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load reading list:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadReadsTab = async () => {
|
||||||
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('reads')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
|
||||||
|
// Ensure bookmarks are loaded
|
||||||
|
let fetchedBookmarks: Bookmark[] = bookmarks
|
||||||
|
if (bookmarks.length === 0) {
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
fetchedBookmarks = newBookmarks
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
fetchedBookmarks = []
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
try {
|
// Derive reads from bookmarks immediately
|
||||||
setLoading(true)
|
const initialReads = deriveReadsFromBookmarks(fetchedBookmarks)
|
||||||
setError(null)
|
const initialMap = new Map(initialReads.map(item => [item.id, item]))
|
||||||
|
setReadsMap(initialMap)
|
||||||
// Seed from cache if available to avoid empty flash (own profile only)
|
setReads(initialReads)
|
||||||
if (isOwnProfile) {
|
setLoadedTabs(prev => new Set(prev).add('reads'))
|
||||||
const cached = getCachedMeData(viewingPubkey)
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
if (cached) {
|
|
||||||
setHighlights(cached.highlights)
|
// Background enrichment: merge reading progress and mark-as-read
|
||||||
setBookmarks(cached.bookmarks)
|
// Only update items that are already in our map
|
||||||
setReadArticles(cached.readArticles)
|
fetchAllReads(relayPool, viewingPubkey, fetchedBookmarks, (item) => {
|
||||||
|
console.log('📈 [Reads] Enrichment item received:', {
|
||||||
|
id: item.id.slice(0, 20) + '...',
|
||||||
|
progress: item.readingProgress,
|
||||||
|
hasProgress: item.readingProgress !== undefined && item.readingProgress > 0
|
||||||
|
})
|
||||||
|
|
||||||
|
setReadsMap(prevMap => {
|
||||||
|
// Only update if item exists in our current map
|
||||||
|
if (!prevMap.has(item.id)) {
|
||||||
|
console.log('⚠️ [Reads] Item not in map, skipping:', item.id.slice(0, 20) + '...')
|
||||||
|
return prevMap
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
const newMap = new Map(prevMap)
|
||||||
// Fetch highlights and writings (public data)
|
const merged = mergeReadItem(newMap, item)
|
||||||
const [userHighlights, userWritings] = await Promise.all([
|
if (merged) {
|
||||||
fetchHighlights(relayPool, viewingPubkey),
|
console.log('✅ [Reads] Merged progress:', item.id.slice(0, 20) + '...', item.readingProgress)
|
||||||
fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
|
// Update reads array after map is updated
|
||||||
])
|
setReads(Array.from(newMap.values()))
|
||||||
|
return newMap
|
||||||
setHighlights(userHighlights)
|
|
||||||
setWritings(userWritings)
|
|
||||||
|
|
||||||
// Only fetch private data for own profile
|
|
||||||
if (isOwnProfile && activeAccount) {
|
|
||||||
const userReadArticles = await fetchReadArticlesWithData(relayPool, viewingPubkey)
|
|
||||||
setReadArticles(userReadArticles)
|
|
||||||
|
|
||||||
// Fetch bookmarks using callback pattern
|
|
||||||
let fetchedBookmarks: Bookmark[] = []
|
|
||||||
try {
|
|
||||||
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
|
||||||
fetchedBookmarks = newBookmarks
|
|
||||||
setBookmarks(newBookmarks)
|
|
||||||
})
|
|
||||||
} catch (err) {
|
|
||||||
console.warn('Failed to load bookmarks:', err)
|
|
||||||
setBookmarks([])
|
|
||||||
}
|
}
|
||||||
|
return prevMap
|
||||||
|
})
|
||||||
|
}).catch(err => console.warn('Failed to enrich reads:', err))
|
||||||
|
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load reads:', err)
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// Update cache with all fetched data
|
const loadLinksTab = async () => {
|
||||||
setCachedMeData(viewingPubkey, userHighlights, fetchedBookmarks, userReadArticles)
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
} else {
|
|
||||||
setBookmarks([])
|
const hasBeenLoaded = loadedTabs.has('links')
|
||||||
setReadArticles([])
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
|
||||||
|
// Ensure bookmarks are loaded
|
||||||
|
let fetchedBookmarks: Bookmark[] = bookmarks
|
||||||
|
if (bookmarks.length === 0) {
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
fetchedBookmarks = newBookmarks
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
fetchedBookmarks = []
|
||||||
}
|
}
|
||||||
} catch (err) {
|
}
|
||||||
console.error('Failed to load data:', err)
|
|
||||||
setError('Failed to load data. Please try again.')
|
// Derive links from bookmarks immediately
|
||||||
} finally {
|
const initialLinks = deriveLinksFromBookmarks(fetchedBookmarks)
|
||||||
setLoading(false)
|
const initialMap = new Map(initialLinks.map(item => [item.id, item]))
|
||||||
|
setLinksMap(initialMap)
|
||||||
|
setLinks(initialLinks)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('links'))
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
|
||||||
|
// Background enrichment: merge reading progress and mark-as-read
|
||||||
|
// Only update items that are already in our map
|
||||||
|
fetchLinks(relayPool, viewingPubkey, (item) => {
|
||||||
|
setLinksMap(prevMap => {
|
||||||
|
// Only update if item exists in our current map
|
||||||
|
if (!prevMap.has(item.id)) return prevMap
|
||||||
|
|
||||||
|
const newMap = new Map(prevMap)
|
||||||
|
if (mergeReadItem(newMap, item)) {
|
||||||
|
// Update links array after map is updated
|
||||||
|
setLinks(Array.from(newMap.values()))
|
||||||
|
return newMap
|
||||||
|
}
|
||||||
|
return prevMap
|
||||||
|
})
|
||||||
|
}).catch(err => console.warn('Failed to enrich links:', err))
|
||||||
|
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load links:', err)
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Load active tab data
|
||||||
|
useEffect(() => {
|
||||||
|
if (!viewingPubkey || !activeTab) {
|
||||||
|
setLoading(false)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// Load cached data immediately if available
|
||||||
|
if (isOwnProfile) {
|
||||||
|
const cached = getCachedMeData(viewingPubkey)
|
||||||
|
if (cached) {
|
||||||
|
setHighlights(cached.highlights)
|
||||||
|
setBookmarks(cached.bookmarks)
|
||||||
|
setReads(cached.reads || [])
|
||||||
|
setLinks(cached.links || [])
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
loadData()
|
// Load data for active tab (refresh in background if already loaded)
|
||||||
}, [relayPool, viewingPubkey, isOwnProfile, activeAccount, refreshTrigger])
|
switch (activeTab) {
|
||||||
|
case 'highlights':
|
||||||
|
loadHighlightsTab()
|
||||||
|
break
|
||||||
|
case 'writings':
|
||||||
|
loadWritingsTab()
|
||||||
|
break
|
||||||
|
case 'reading-list':
|
||||||
|
loadReadingListTab()
|
||||||
|
break
|
||||||
|
case 'reads':
|
||||||
|
loadReadsTab()
|
||||||
|
break
|
||||||
|
case 'links':
|
||||||
|
loadLinksTab()
|
||||||
|
break
|
||||||
|
}
|
||||||
|
// eslint-disable-next-line react-hooks/exhaustive-deps
|
||||||
|
}, [activeTab, viewingPubkey, refreshTrigger])
|
||||||
|
|
||||||
// Pull-to-refresh
|
|
||||||
const pullToRefreshState = usePullToRefresh(meContainerRef, {
|
// Pull-to-refresh - reload active tab without clearing state
|
||||||
|
const { isRefreshing, pullPosition } = usePullToRefresh({
|
||||||
onRefresh: () => {
|
onRefresh: () => {
|
||||||
|
// Just trigger refresh - loaders will merge new data
|
||||||
setRefreshTrigger(prev => prev + 1)
|
setRefreshTrigger(prev => prev + 1)
|
||||||
},
|
},
|
||||||
isRefreshing: loading
|
maximumPullLength: 240,
|
||||||
|
refreshThreshold: 80,
|
||||||
|
isDisabled: !viewingPubkey
|
||||||
})
|
})
|
||||||
|
|
||||||
const handleHighlightDelete = (highlightId: string) => {
|
const handleHighlightDelete = (highlightId: string) => {
|
||||||
@@ -153,21 +347,47 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
return `/a/${naddr}`
|
return `/a/${naddr}`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Helper to check if a bookmark has either content or a URL (same logic as BookmarkList)
|
const getReadItemUrl = (item: ReadItem) => {
|
||||||
const hasContentOrUrl = (ib: IndividualBookmark) => {
|
if (item.type === 'article') {
|
||||||
const hasContent = ib.content && ib.content.trim().length > 0
|
// ID is already in naddr format
|
||||||
|
return `/a/${item.id}`
|
||||||
let hasUrl = false
|
} else if (item.url) {
|
||||||
if (ib.kind === 39701) {
|
return `/r/${encodeURIComponent(item.url)}`
|
||||||
const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
|
}
|
||||||
hasUrl = !!dTag && dTag.trim().length > 0
|
return '#'
|
||||||
} else {
|
}
|
||||||
const urls = extractUrlsFromContent(ib.content || '')
|
|
||||||
hasUrl = urls.length > 0
|
const convertReadItemToBlogPostPreview = (item: ReadItem): BlogPostPreview => {
|
||||||
|
if (item.event) {
|
||||||
|
return {
|
||||||
|
event: item.event,
|
||||||
|
title: item.title || 'Untitled',
|
||||||
|
summary: item.summary,
|
||||||
|
image: item.image,
|
||||||
|
published: item.published,
|
||||||
|
author: item.author || item.event.pubkey
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (ib.kind === 30023) return true
|
// Create a mock event for external URLs
|
||||||
return hasContent || hasUrl
|
const mockEvent = {
|
||||||
|
id: item.id,
|
||||||
|
pubkey: item.author || '',
|
||||||
|
created_at: item.readingTimestamp || Math.floor(Date.now() / 1000),
|
||||||
|
kind: 1,
|
||||||
|
tags: [] as string[][],
|
||||||
|
content: item.title || item.url || 'Untitled',
|
||||||
|
sig: ''
|
||||||
|
} as const
|
||||||
|
|
||||||
|
return {
|
||||||
|
event: mockEvent as unknown as import('nostr-tools').NostrEvent,
|
||||||
|
title: item.title || item.url || 'Untitled',
|
||||||
|
summary: item.summary,
|
||||||
|
image: item.image,
|
||||||
|
published: item.published,
|
||||||
|
author: item.author || ''
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleSelectUrl = (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => {
|
const handleSelectUrl = (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => {
|
||||||
@@ -189,62 +409,44 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Merge and flatten all individual bookmarks (same logic as BookmarkList)
|
// Merge and flatten all individual bookmarks
|
||||||
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
.filter(hasContentOrUrl)
|
.filter(hasContent)
|
||||||
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
|
||||||
|
|
||||||
// Only show full loading screen if we don't have any data yet
|
|
||||||
const hasData = highlights.length > 0 || bookmarks.length > 0 || readArticles.length > 0 || writings.length > 0
|
|
||||||
|
|
||||||
if (loading && !hasData) {
|
// Apply bookmark filter
|
||||||
return (
|
const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, bookmarkFilter)
|
||||||
<div className="explore-container" aria-busy="true">
|
|
||||||
{viewingPubkey && (
|
const groups = groupIndividualBookmarks(filteredBookmarks)
|
||||||
<div className="explore-header">
|
|
||||||
<AuthorCard authorPubkey={viewingPubkey} />
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
<div className="explore-grid">
|
|
||||||
{activeTab === 'writings' ? (
|
|
||||||
Array.from({ length: 6 }).map((_, i) => (
|
|
||||||
<BlogPostSkeleton key={i} />
|
|
||||||
))
|
|
||||||
) : activeTab === 'highlights' ? (
|
|
||||||
Array.from({ length: 8 }).map((_, i) => (
|
|
||||||
<HighlightSkeleton key={i} />
|
|
||||||
))
|
|
||||||
) : (
|
|
||||||
Array.from({ length: 6 }).map((_, i) => (
|
|
||||||
<BookmarkSkeleton key={i} viewMode={viewMode} />
|
|
||||||
))
|
|
||||||
)}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
if (error) {
|
// Apply reading progress filter
|
||||||
return (
|
const filteredReads = filterByReadingProgress(reads, readingProgressFilter)
|
||||||
<div className="explore-container">
|
const filteredLinks = filterByReadingProgress(links, readingProgressFilter)
|
||||||
<div className="explore-error">
|
const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
|
||||||
<FontAwesomeIcon icon={faExclamationCircle} size="2x" />
|
{ key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
|
||||||
<p>{error}</p>
|
{ key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
|
||||||
</div>
|
{ key: 'web', title: 'Web Bookmarks', items: groups.web },
|
||||||
</div>
|
{ key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
|
||||||
)
|
]
|
||||||
}
|
|
||||||
|
// Show content progressively - no blocking error screens
|
||||||
|
const hasData = highlights.length > 0 || bookmarks.length > 0 || reads.length > 0 || links.length > 0 || writings.length > 0
|
||||||
|
const showSkeletons = loading && !hasData
|
||||||
|
|
||||||
const renderTabContent = () => {
|
const renderTabContent = () => {
|
||||||
switch (activeTab) {
|
switch (activeTab) {
|
||||||
case 'highlights':
|
case 'highlights':
|
||||||
return highlights.length === 0 ? (
|
if (showSkeletons) {
|
||||||
<div className="explore-empty">
|
return (
|
||||||
<p>
|
<div className="explore-grid">
|
||||||
{isOwnProfile
|
{Array.from({ length: 8 }).map((_, i) => (
|
||||||
? 'No highlights yet. Start highlighting content to see them here!'
|
<HighlightSkeleton key={i} />
|
||||||
: 'No highlights yet. You should shame them on nostr!'}
|
))}
|
||||||
</p>
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
return highlights.length === 0 && !loading ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No highlights yet.
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="highlights-list me-highlights-list">
|
<div className="highlights-list me-highlights-list">
|
||||||
@@ -260,23 +462,50 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
)
|
)
|
||||||
|
|
||||||
case 'reading-list':
|
case 'reading-list':
|
||||||
return allIndividualBookmarks.length === 0 ? (
|
if (showSkeletons) {
|
||||||
<div className="explore-empty">
|
return (
|
||||||
<p>No bookmarks yet. Bookmark articles to see them here!</p>
|
<div className="bookmarks-list">
|
||||||
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
|
<BookmarkSkeleton key={i} viewMode={viewMode} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
return allIndividualBookmarks.length === 0 && !loading ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No bookmarks yet.
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="bookmarks-list">
|
<div className="bookmarks-list">
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
{allIndividualBookmarks.length > 0 && (
|
||||||
{allIndividualBookmarks.map((individualBookmark, index) => (
|
<BookmarkFilters
|
||||||
<BookmarkItem
|
selectedFilter={bookmarkFilter}
|
||||||
key={`${individualBookmark.id}-${index}`}
|
onFilterChange={setBookmarkFilter}
|
||||||
bookmark={individualBookmark}
|
/>
|
||||||
index={index}
|
)}
|
||||||
viewMode={viewMode}
|
{filteredBookmarks.length === 0 ? (
|
||||||
onSelectUrl={handleSelectUrl}
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
/>
|
No bookmarks match this filter.
|
||||||
))}
|
</div>
|
||||||
</div>
|
) : (
|
||||||
|
sections.filter(s => s.items.length > 0).map(section => (
|
||||||
|
<div key={section.key} className="bookmarks-section">
|
||||||
|
<h3 className="bookmarks-section-title">{section.title}</h3>
|
||||||
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
|
{section.items.map((individualBookmark, index) => (
|
||||||
|
<BookmarkItem
|
||||||
|
key={`${section.key}-${individualBookmark.id}-${index}`}
|
||||||
|
bookmark={individualBookmark}
|
||||||
|
index={index}
|
||||||
|
viewMode={viewMode}
|
||||||
|
onSelectUrl={handleSelectUrl}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)))}
|
||||||
<div className="view-mode-controls" style={{
|
<div className="view-mode-controls" style={{
|
||||||
display: 'flex',
|
display: 'flex',
|
||||||
justifyContent: 'center',
|
justifyContent: 'center',
|
||||||
@@ -310,44 +539,113 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|
||||||
case 'archive':
|
case 'reads':
|
||||||
return readArticles.length === 0 ? (
|
// Show loading skeletons only while initially loading
|
||||||
<div className="explore-empty">
|
if (loading && !loadedTabs.has('reads')) {
|
||||||
<p>No read articles yet. Mark articles as read to see them here!</p>
|
return (
|
||||||
</div>
|
<div className="explore-grid">
|
||||||
) : (
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
<div className="explore-grid">
|
<BlogPostSkeleton key={i} />
|
||||||
{readArticles.map((post) => (
|
))}
|
||||||
<BlogPostCard
|
</div>
|
||||||
key={post.event.id}
|
)
|
||||||
post={post}
|
}
|
||||||
href={getPostUrl(post)}
|
|
||||||
/>
|
// Show empty state if loaded but no reads
|
||||||
))}
|
if (reads.length === 0 && loadedTabs.has('reads')) {
|
||||||
</div>
|
return (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No articles read yet.
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show reads with filters
|
||||||
|
return (
|
||||||
|
<>
|
||||||
|
<ReadingProgressFilters
|
||||||
|
selectedFilter={readingProgressFilter}
|
||||||
|
onFilterChange={handleReadingProgressFilterChange}
|
||||||
|
/>
|
||||||
|
{filteredReads.length === 0 ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No articles match this filter.
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{filteredReads.map((item) => (
|
||||||
|
<BlogPostCard
|
||||||
|
key={item.id}
|
||||||
|
post={convertReadItemToBlogPostPreview(item)}
|
||||||
|
href={getReadItemUrl(item)}
|
||||||
|
readingProgress={item.readingProgress}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</>
|
||||||
|
)
|
||||||
|
|
||||||
|
case 'links':
|
||||||
|
// Show loading skeletons only while initially loading
|
||||||
|
if (loading && !loadedTabs.has('links')) {
|
||||||
|
return (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
|
<BlogPostSkeleton key={i} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show empty state if loaded but no links
|
||||||
|
if (links.length === 0 && loadedTabs.has('links')) {
|
||||||
|
return (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No links with reading progress yet.
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show links with filters
|
||||||
|
return (
|
||||||
|
<>
|
||||||
|
<ReadingProgressFilters
|
||||||
|
selectedFilter={readingProgressFilter}
|
||||||
|
onFilterChange={handleReadingProgressFilterChange}
|
||||||
|
/>
|
||||||
|
{filteredLinks.length === 0 ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No links match this filter.
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{filteredLinks.map((item) => (
|
||||||
|
<BlogPostCard
|
||||||
|
key={item.id}
|
||||||
|
post={convertReadItemToBlogPostPreview(item)}
|
||||||
|
href={getReadItemUrl(item)}
|
||||||
|
readingProgress={item.readingProgress}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</>
|
||||||
)
|
)
|
||||||
|
|
||||||
case 'writings':
|
case 'writings':
|
||||||
return writings.length === 0 ? (
|
if (showSkeletons) {
|
||||||
<div className="explore-empty">
|
return (
|
||||||
<p>
|
<div className="explore-grid">
|
||||||
{isOwnProfile
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
? 'No articles written yet. Publish your first article to see it here!'
|
<BlogPostSkeleton key={i} />
|
||||||
: (
|
))}
|
||||||
<>
|
</div>
|
||||||
No articles written. You can find other stuff from this user using{' '}
|
)
|
||||||
<a
|
}
|
||||||
href={viewingPubkey ? getProfileUrl(nip19.npubEncode(viewingPubkey)) : '#'}
|
return writings.length === 0 && !loading ? (
|
||||||
target="_blank"
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
rel="noopener noreferrer"
|
No articles written yet.
|
||||||
style={{ color: 'rgb(99 102 241)', textDecoration: 'underline' }}
|
|
||||||
>
|
|
||||||
ants
|
|
||||||
</a>
|
|
||||||
.
|
|
||||||
</>
|
|
||||||
)}
|
|
||||||
</p>
|
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -367,25 +665,14 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div
|
<div className="explore-container">
|
||||||
ref={meContainerRef}
|
<RefreshIndicator
|
||||||
className={`explore-container pull-to-refresh-container ${pullToRefreshState.isPulling ? 'is-pulling' : ''}`}
|
isRefreshing={isRefreshing}
|
||||||
>
|
pullPosition={pullPosition}
|
||||||
<PullToRefreshIndicator
|
|
||||||
isPulling={pullToRefreshState.isPulling}
|
|
||||||
pullDistance={pullToRefreshState.pullDistance}
|
|
||||||
canRefresh={pullToRefreshState.canRefresh}
|
|
||||||
isRefreshing={loading && pullToRefreshState.canRefresh}
|
|
||||||
/>
|
/>
|
||||||
<div className="explore-header">
|
<div className="explore-header">
|
||||||
{viewingPubkey && <AuthorCard authorPubkey={viewingPubkey} clickable={false} />}
|
{viewingPubkey && <AuthorCard authorPubkey={viewingPubkey} clickable={false} />}
|
||||||
|
|
||||||
{loading && hasData && (
|
|
||||||
<div className="explore-loading" style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', padding: '0.5rem 0' }}>
|
|
||||||
<FontAwesomeIcon icon={faSpinner} spin />
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
|
|
||||||
<div className="me-tabs">
|
<div className="me-tabs">
|
||||||
<button
|
<button
|
||||||
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
||||||
@@ -406,12 +693,20 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
<span className="tab-label">Bookmarks</span>
|
<span className="tab-label">Bookmarks</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className={`me-tab ${activeTab === 'archive' ? 'active' : ''}`}
|
className={`me-tab ${activeTab === 'reads' ? 'active' : ''}`}
|
||||||
data-tab="archive"
|
data-tab="reads"
|
||||||
onClick={() => navigate('/me/archive')}
|
onClick={() => navigate('/me/reads')}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faBooks} />
|
<FontAwesomeIcon icon={faBooks} />
|
||||||
<span className="tab-label">Archive</span>
|
<span className="tab-label">Reads</span>
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
className={`me-tab ${activeTab === 'links' ? 'active' : ''}`}
|
||||||
|
data-tab="links"
|
||||||
|
onClick={() => navigate('/me/links')}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faLink} />
|
||||||
|
<span className="tab-label">Links</span>
|
||||||
</button>
|
</button>
|
||||||
</>
|
</>
|
||||||
)}
|
)}
|
||||||
|
|||||||
@@ -1,52 +0,0 @@
|
|||||||
import React from 'react'
|
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
|
||||||
import { faArrowDown } from '@fortawesome/free-solid-svg-icons'
|
|
||||||
|
|
||||||
interface PullToRefreshIndicatorProps {
|
|
||||||
isPulling: boolean
|
|
||||||
pullDistance: number
|
|
||||||
canRefresh: boolean
|
|
||||||
isRefreshing: boolean
|
|
||||||
threshold?: number
|
|
||||||
}
|
|
||||||
|
|
||||||
const PullToRefreshIndicator: React.FC<PullToRefreshIndicatorProps> = ({
|
|
||||||
isPulling,
|
|
||||||
pullDistance,
|
|
||||||
canRefresh,
|
|
||||||
threshold = 80
|
|
||||||
}) => {
|
|
||||||
// Only show when actively pulling, not when refreshing
|
|
||||||
if (!isPulling) return null
|
|
||||||
|
|
||||||
const opacity = Math.min(pullDistance / threshold, 1)
|
|
||||||
const rotation = (pullDistance / threshold) * 180
|
|
||||||
|
|
||||||
return (
|
|
||||||
<div
|
|
||||||
className="pull-to-refresh-indicator"
|
|
||||||
style={{
|
|
||||||
opacity,
|
|
||||||
transform: `translateY(${-20 + pullDistance / 2}px)`
|
|
||||||
}}
|
|
||||||
>
|
|
||||||
<div
|
|
||||||
className="pull-to-refresh-icon"
|
|
||||||
style={{
|
|
||||||
transform: `rotate(${rotation}deg)`
|
|
||||||
}}
|
|
||||||
>
|
|
||||||
<FontAwesomeIcon
|
|
||||||
icon={faArrowDown}
|
|
||||||
style={{ color: canRefresh ? 'var(--accent-color, #3b82f6)' : 'var(--text-secondary)' }}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
<div className="pull-to-refresh-text">
|
|
||||||
{canRefresh ? 'Release to refresh' : 'Pull to refresh'}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
export default PullToRefreshIndicator
|
|
||||||
|
|
||||||
@@ -1,8 +1,9 @@
|
|||||||
import React, { useMemo } from 'react'
|
import React, { useMemo } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faHighlighter, faClock } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faClock, faNewspaper } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { format } from 'date-fns'
|
import { format } from 'date-fns'
|
||||||
import { useImageCache } from '../hooks/useImageCache'
|
import { useImageCache } from '../hooks/useImageCache'
|
||||||
|
import { useAdaptiveTextColor } from '../hooks/useAdaptiveTextColor'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
import { Highlight, HighlightLevel } from '../types/highlights'
|
import { Highlight, HighlightLevel } from '../types/highlights'
|
||||||
import { HighlightVisibility } from './HighlightsPanel'
|
import { HighlightVisibility } from './HighlightsPanel'
|
||||||
@@ -33,7 +34,8 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
highlights = [],
|
highlights = [],
|
||||||
highlightVisibility = { nostrverse: true, friends: true, mine: true }
|
highlightVisibility = { nostrverse: true, friends: true, mine: true }
|
||||||
}) => {
|
}) => {
|
||||||
const cachedImage = useImageCache(image, settings)
|
const cachedImage = useImageCache(image)
|
||||||
|
const { textColor } = useAdaptiveTextColor(cachedImage)
|
||||||
const formattedDate = published ? format(new Date(published * 1000), 'MMM d, yyyy') : null
|
const formattedDate = published ? format(new Date(published * 1000), 'MMM d, yyyy') : null
|
||||||
const isLongSummary = summary && summary.length > 150
|
const isLongSummary = summary && summary.length > 150
|
||||||
|
|
||||||
@@ -70,13 +72,25 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
}
|
}
|
||||||
}, [highlights, highlightVisibility, settings])
|
}, [highlights, highlightVisibility, settings])
|
||||||
|
|
||||||
if (cachedImage) {
|
// Show hero section if we have an image OR a title
|
||||||
|
if (cachedImage || title) {
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
<div className="reader-hero-image">
|
<div className="reader-hero-image">
|
||||||
<img src={cachedImage} alt={title || 'Article image'} />
|
{cachedImage ? (
|
||||||
|
<img src={cachedImage} alt={title || 'Article image'} />
|
||||||
|
) : (
|
||||||
|
<div className="reader-hero-placeholder">
|
||||||
|
<FontAwesomeIcon icon={faNewspaper} />
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
{formattedDate && (
|
{formattedDate && (
|
||||||
<div className="publish-date-topright">
|
<div
|
||||||
|
className="publish-date-topright"
|
||||||
|
style={{
|
||||||
|
color: textColor
|
||||||
|
}}
|
||||||
|
>
|
||||||
{formattedDate}
|
{formattedDate}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
@@ -118,7 +132,12 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
{title && (
|
{title && (
|
||||||
<div className="reader-header">
|
<div className="reader-header">
|
||||||
{formattedDate && (
|
{formattedDate && (
|
||||||
<div className="publish-date-topright">
|
<div
|
||||||
|
className="publish-date-topright"
|
||||||
|
style={{
|
||||||
|
color: textColor
|
||||||
|
}}
|
||||||
|
>
|
||||||
{formattedDate}
|
{formattedDate}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
|
|||||||
47
src/components/ReadingProgressFilters.tsx
Normal file
47
src/components/ReadingProgressFilters.tsx
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faBookOpen, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { faEnvelope, faEnvelopeOpen } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
|
||||||
|
export type ReadingProgressFilterType = 'all' | 'unopened' | 'started' | 'reading' | 'completed'
|
||||||
|
|
||||||
|
interface ReadingProgressFiltersProps {
|
||||||
|
selectedFilter: ReadingProgressFilterType
|
||||||
|
onFilterChange: (filter: ReadingProgressFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const ReadingProgressFilters: React.FC<ReadingProgressFiltersProps> = ({ selectedFilter, onFilterChange }) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'unopened' as const, icon: faEnvelope, label: 'Unopened' },
|
||||||
|
{ type: 'started' as const, icon: faEnvelopeOpen, label: 'Started' },
|
||||||
|
{ type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
|
||||||
|
{ type: 'completed' as const, icon: faCheckCircle, label: 'Completed' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => {
|
||||||
|
const isActive = selectedFilter === filter.type
|
||||||
|
// Only "completed" gets green color, everything else uses default blue
|
||||||
|
const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
|
||||||
|
|
||||||
|
return (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${isActive ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
style={activeStyle}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
)
|
||||||
|
})}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default ReadingProgressFilters
|
||||||
|
|
||||||
@@ -19,6 +19,21 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
}) => {
|
}) => {
|
||||||
const clampedProgress = Math.min(100, Math.max(0, progress))
|
const clampedProgress = Math.min(100, Math.max(0, progress))
|
||||||
|
|
||||||
|
// Determine reading state based on progress (matching readingProgressUtils.ts logic)
|
||||||
|
const progressDecimal = clampedProgress / 100
|
||||||
|
const isStarted = progressDecimal > 0 && progressDecimal <= 0.10
|
||||||
|
|
||||||
|
// Determine bar color based on state
|
||||||
|
let barColorClass = ''
|
||||||
|
let barColorStyle: string | undefined = 'var(--color-primary)' // Default blue
|
||||||
|
|
||||||
|
if (isComplete) {
|
||||||
|
barColorClass = 'bg-green-500'
|
||||||
|
barColorStyle = undefined
|
||||||
|
} else if (isStarted) {
|
||||||
|
barColorStyle = 'var(--color-text)' // Neutral text color (matches card titles)
|
||||||
|
}
|
||||||
|
|
||||||
// Calculate left and right offsets based on sidebar states (desktop only)
|
// Calculate left and right offsets based on sidebar states (desktop only)
|
||||||
const leftOffset = isSidebarCollapsed
|
const leftOffset = isSidebarCollapsed
|
||||||
? 'var(--sidebar-collapsed-width)'
|
? 'var(--sidebar-collapsed-width)'
|
||||||
@@ -42,14 +57,10 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
style={{ backgroundColor: 'var(--color-border)' }}
|
style={{ backgroundColor: 'var(--color-border)' }}
|
||||||
>
|
>
|
||||||
<div
|
<div
|
||||||
className={`h-full rounded-full transition-all duration-300 relative ${
|
className={`h-full rounded-full transition-all duration-300 relative ${barColorClass}`}
|
||||||
isComplete
|
|
||||||
? 'bg-green-500'
|
|
||||||
: ''
|
|
||||||
}`}
|
|
||||||
style={{
|
style={{
|
||||||
width: `${clampedProgress}%`,
|
width: `${clampedProgress}%`,
|
||||||
backgroundColor: isComplete ? undefined : 'var(--color-primary)'
|
backgroundColor: barColorStyle
|
||||||
}}
|
}}
|
||||||
>
|
>
|
||||||
<div className="absolute inset-0 bg-gradient-to-r from-transparent via-white/30 to-transparent animate-[shimmer_2s_infinite]" />
|
<div className="absolute inset-0 bg-gradient-to-r from-transparent via-white/30 to-transparent animate-[shimmer_2s_infinite]" />
|
||||||
@@ -60,7 +71,9 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
className={`text-[0.625rem] font-normal min-w-[32px] text-right tabular-nums ${
|
className={`text-[0.625rem] font-normal min-w-[32px] text-right tabular-nums ${
|
||||||
isComplete ? 'text-green-500' : ''
|
isComplete ? 'text-green-500' : ''
|
||||||
}`}
|
}`}
|
||||||
style={{ color: isComplete ? undefined : 'var(--color-text-muted)' }}
|
style={{
|
||||||
|
color: isComplete ? undefined : isStarted ? 'var(--color-text)' : 'var(--color-text-muted)'
|
||||||
|
}}
|
||||||
>
|
>
|
||||||
{isComplete ? '✓' : `${clampedProgress}%`}
|
{isComplete ? '✓' : `${clampedProgress}%`}
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
63
src/components/RefreshIndicator.tsx
Normal file
63
src/components/RefreshIndicator.tsx
Normal file
@@ -0,0 +1,63 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faArrowRotateRight } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
|
||||||
|
interface RefreshIndicatorProps {
|
||||||
|
isRefreshing: boolean
|
||||||
|
pullPosition: number
|
||||||
|
}
|
||||||
|
|
||||||
|
const THRESHOLD = 80
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Simple pull-to-refresh visual indicator
|
||||||
|
*/
|
||||||
|
const RefreshIndicator: React.FC<RefreshIndicatorProps> = ({
|
||||||
|
isRefreshing,
|
||||||
|
pullPosition
|
||||||
|
}) => {
|
||||||
|
const isVisible = isRefreshing || pullPosition > 0
|
||||||
|
if (!isVisible) return null
|
||||||
|
|
||||||
|
const opacity = Math.min(pullPosition / THRESHOLD, 1)
|
||||||
|
const translateY = isRefreshing ? THRESHOLD / 3 : pullPosition / 3
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
position: 'fixed',
|
||||||
|
top: `${translateY}px`,
|
||||||
|
left: '50%',
|
||||||
|
transform: 'translateX(-50%)',
|
||||||
|
zIndex: 30,
|
||||||
|
opacity,
|
||||||
|
transition: isRefreshing ? 'opacity 0.2s' : 'none'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
width: '32px',
|
||||||
|
height: '32px',
|
||||||
|
borderRadius: '50%',
|
||||||
|
backgroundColor: 'var(--surface-secondary, #ffffff)',
|
||||||
|
boxShadow: '0 2px 8px rgba(0, 0, 0, 0.1)',
|
||||||
|
display: 'flex',
|
||||||
|
alignItems: 'center',
|
||||||
|
justifyContent: 'center'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon
|
||||||
|
icon={faArrowRotateRight}
|
||||||
|
style={{
|
||||||
|
transform: isRefreshing ? 'none' : `rotate(${pullPosition}deg)`,
|
||||||
|
color: 'var(--accent-color, #3b82f6)'
|
||||||
|
}}
|
||||||
|
className={isRefreshing ? 'fa-spin' : ''}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default RefreshIndicator
|
||||||
|
|
||||||
30
src/components/RouteDebug.tsx
Normal file
30
src/components/RouteDebug.tsx
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
import { useEffect } from 'react'
|
||||||
|
import { useLocation, useMatch } from 'react-router-dom'
|
||||||
|
|
||||||
|
export default function RouteDebug() {
|
||||||
|
const location = useLocation()
|
||||||
|
const matchArticle = useMatch('/a/:naddr')
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
const params = new URLSearchParams(location.search)
|
||||||
|
if (params.get('debug') !== '1') return
|
||||||
|
|
||||||
|
const info: Record<string, unknown> = {
|
||||||
|
pathname: location.pathname,
|
||||||
|
search: location.search || null,
|
||||||
|
matchedArticleRoute: Boolean(matchArticle),
|
||||||
|
referrer: document.referrer || null
|
||||||
|
}
|
||||||
|
|
||||||
|
if (location.pathname === '/') {
|
||||||
|
// Unexpected during deep-link refresh tests
|
||||||
|
console.warn('[RouteDebug] unexpected root redirect', info)
|
||||||
|
} else {
|
||||||
|
console.debug('[RouteDebug]', info)
|
||||||
|
}
|
||||||
|
}, [location, matchArticle])
|
||||||
|
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -6,13 +6,12 @@ import IconButton from './IconButton'
|
|||||||
import { loadFont } from '../utils/fontLoader'
|
import { loadFont } from '../utils/fontLoader'
|
||||||
import ThemeSettings from './Settings/ThemeSettings'
|
import ThemeSettings from './Settings/ThemeSettings'
|
||||||
import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
|
import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
|
||||||
import LayoutNavigationSettings from './Settings/LayoutNavigationSettings'
|
import LayoutBehaviorSettings from './Settings/LayoutBehaviorSettings'
|
||||||
import StartupPreferencesSettings from './Settings/StartupPreferencesSettings'
|
|
||||||
import ZapSettings from './Settings/ZapSettings'
|
import ZapSettings from './Settings/ZapSettings'
|
||||||
import OfflineModeSettings from './Settings/OfflineModeSettings'
|
|
||||||
import RelaySettings from './Settings/RelaySettings'
|
import RelaySettings from './Settings/RelaySettings'
|
||||||
import PWASettings from './Settings/PWASettings'
|
import PWASettings from './Settings/PWASettings'
|
||||||
import { useRelayStatus } from '../hooks/useRelayStatus'
|
import { useRelayStatus } from '../hooks/useRelayStatus'
|
||||||
|
import VersionFooter from './VersionFooter'
|
||||||
|
|
||||||
const DEFAULT_SETTINGS: UserSettings = {
|
const DEFAULT_SETTINGS: UserSettings = {
|
||||||
collapseOnArticleOpen: true,
|
collapseOnArticleOpen: true,
|
||||||
@@ -35,6 +34,8 @@ const DEFAULT_SETTINGS: UserSettings = {
|
|||||||
zapSplitAuthorWeight: 50,
|
zapSplitAuthorWeight: 50,
|
||||||
useLocalRelayAsCache: true,
|
useLocalRelayAsCache: true,
|
||||||
rebroadcastToAllRelays: false,
|
rebroadcastToAllRelays: false,
|
||||||
|
paragraphAlignment: 'justify',
|
||||||
|
syncReadingPosition: false,
|
||||||
}
|
}
|
||||||
|
|
||||||
interface SettingsProps {
|
interface SettingsProps {
|
||||||
@@ -162,13 +163,12 @@ const Settings: React.FC<SettingsProps> = ({ settings, onSave, onClose, relayPoo
|
|||||||
<div className="settings-content">
|
<div className="settings-content">
|
||||||
<ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
|
<ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
|
<ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<LayoutNavigationSettings settings={localSettings} onUpdate={handleUpdate} />
|
|
||||||
<StartupPreferencesSettings settings={localSettings} onUpdate={handleUpdate} />
|
|
||||||
<ZapSettings settings={localSettings} onUpdate={handleUpdate} />
|
<ZapSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<OfflineModeSettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
|
<LayoutBehaviorSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
|
<PWASettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
|
||||||
<RelaySettings relayStatuses={relayStatuses} onClose={onClose} />
|
<RelaySettings relayStatuses={relayStatuses} onClose={onClose} />
|
||||||
<PWASettings />
|
|
||||||
</div>
|
</div>
|
||||||
|
<VersionFooter />
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
125
src/components/Settings/LayoutBehaviorSettings.tsx
Normal file
125
src/components/Settings/LayoutBehaviorSettings.tsx
Normal file
@@ -0,0 +1,125 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import IconButton from '../IconButton'
|
||||||
|
|
||||||
|
interface LayoutBehaviorSettingsProps {
|
||||||
|
settings: UserSettings
|
||||||
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
|
return (
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Layout & Behavior</h3>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label>Default Bookmark View</label>
|
||||||
|
<div className="setting-buttons">
|
||||||
|
<IconButton
|
||||||
|
icon={faList}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'compact' })}
|
||||||
|
title="Compact list view"
|
||||||
|
ariaLabel="Compact list view"
|
||||||
|
variant={(settings.defaultViewMode || 'compact') === 'compact' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faThLarge}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'cards' })}
|
||||||
|
title="Cards view"
|
||||||
|
ariaLabel="Cards view"
|
||||||
|
variant={settings.defaultViewMode === 'cards' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faImage}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'large' })}
|
||||||
|
title="Large preview view"
|
||||||
|
ariaLabel="Large preview view"
|
||||||
|
variant={settings.defaultViewMode === 'large' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="collapseOnArticleOpen" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="collapseOnArticleOpen"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.collapseOnArticleOpen !== false}
|
||||||
|
onChange={(e) => onUpdate({ collapseOnArticleOpen: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Collapse bookmark bar when opening an article</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="sidebarCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.sidebarCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with bookmarks sidebar collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="highlightsCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.highlightsCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with highlights panel collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="rebroadcastToAllRelays"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.rebroadcastToAllRelays ?? false}
|
||||||
|
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Rebroadcast events while browsing</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="autoCollapseSidebarOnMobile"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.autoCollapseSidebarOnMobile !== false}
|
||||||
|
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Auto-collapse sidebar on small screens</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="syncReadingPosition" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="syncReadingPosition"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.syncReadingPosition ?? false}
|
||||||
|
onChange={(e) => onUpdate({ syncReadingPosition: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Sync reading position across devices</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default LayoutBehaviorSettings
|
||||||
|
|
||||||
@@ -3,15 +3,15 @@ import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
|
|||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
import IconButton from '../IconButton'
|
import IconButton from '../IconButton'
|
||||||
|
|
||||||
interface LayoutNavigationSettingsProps {
|
interface LayoutBehaviorSettingsProps {
|
||||||
settings: UserSettings
|
settings: UserSettings
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
}
|
}
|
||||||
|
|
||||||
const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ settings, onUpdate }) => {
|
const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
return (
|
return (
|
||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Layout & Navigation</h3>
|
<h3 className="section-title">Layout & Behavior</h3>
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label>Default Bookmark View</label>
|
<label>Default Bookmark View</label>
|
||||||
@@ -52,9 +52,61 @@ const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ set
|
|||||||
<span>Collapse bookmark bar when opening an article</span>
|
<span>Collapse bookmark bar when opening an article</span>
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="sidebarCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.sidebarCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with bookmarks sidebar collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="highlightsCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.highlightsCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with highlights panel collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="rebroadcastToAllRelays"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.rebroadcastToAllRelays ?? false}
|
||||||
|
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Rebroadcast events while browsing</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="autoCollapseSidebarOnMobile"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.autoCollapseSidebarOnMobile !== false}
|
||||||
|
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Auto-collapse sidebar on small screens</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
export default LayoutNavigationSettings
|
export default LayoutBehaviorSettings
|
||||||
|
|
||||||
|
|||||||
@@ -1,173 +0,0 @@
|
|||||||
import React, { useState, useEffect } from 'react'
|
|
||||||
import { useNavigate } from 'react-router-dom'
|
|
||||||
import { faTrash } from '@fortawesome/free-solid-svg-icons'
|
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
|
|
||||||
import IconButton from '../IconButton'
|
|
||||||
|
|
||||||
interface OfflineModeSettingsProps {
|
|
||||||
settings: UserSettings
|
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
|
||||||
onClose?: () => void
|
|
||||||
}
|
|
||||||
|
|
||||||
const OfflineModeSettings: React.FC<OfflineModeSettingsProps> = ({ settings, onUpdate, onClose }) => {
|
|
||||||
const navigate = useNavigate()
|
|
||||||
const [cacheStats, setCacheStats] = useState<{
|
|
||||||
totalSizeMB: number
|
|
||||||
itemCount: number
|
|
||||||
items: Array<{ url: string, sizeMB: number }>
|
|
||||||
}>({ totalSizeMB: 0, itemCount: 0, items: [] })
|
|
||||||
|
|
||||||
const handleLinkClick = (url: string) => {
|
|
||||||
if (onClose) onClose()
|
|
||||||
navigate(`/r/${encodeURIComponent(url)}`)
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleClearCache = async () => {
|
|
||||||
if (confirm('Are you sure you want to clear all cached images?')) {
|
|
||||||
await clearImageCache()
|
|
||||||
const stats = await getImageCacheStatsAsync()
|
|
||||||
setCacheStats(stats)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Update cache stats periodically
|
|
||||||
useEffect(() => {
|
|
||||||
const updateStats = async () => {
|
|
||||||
const stats = await getImageCacheStatsAsync()
|
|
||||||
setCacheStats(stats)
|
|
||||||
}
|
|
||||||
|
|
||||||
updateStats() // Initial load
|
|
||||||
const interval = setInterval(updateStats, 3000) // Update every 3 seconds
|
|
||||||
return () => clearInterval(interval)
|
|
||||||
}, [])
|
|
||||||
|
|
||||||
return (
|
|
||||||
<div className="settings-section">
|
|
||||||
<h3 className="section-title">Flight Mode</h3>
|
|
||||||
|
|
||||||
<div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
|
|
||||||
<label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
|
|
||||||
<input
|
|
||||||
id="enableImageCache"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.enableImageCache ?? true}
|
|
||||||
onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Use local image cache</span>
|
|
||||||
</label>
|
|
||||||
|
|
||||||
{(settings.enableImageCache ?? true) && (
|
|
||||||
<div style={{
|
|
||||||
fontSize: '0.85rem',
|
|
||||||
color: 'var(--text-secondary)',
|
|
||||||
display: 'flex',
|
|
||||||
alignItems: 'center',
|
|
||||||
gap: '0.5rem'
|
|
||||||
}}>
|
|
||||||
<span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
|
|
||||||
( {cacheStats.totalSizeMB.toFixed(1)} MB /
|
|
||||||
<input
|
|
||||||
id="imageCacheSizeMB"
|
|
||||||
type="number"
|
|
||||||
min="10"
|
|
||||||
max="500"
|
|
||||||
value={settings.imageCacheSizeMB ?? 210}
|
|
||||||
onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
|
|
||||||
style={{
|
|
||||||
width: '50px',
|
|
||||||
padding: '0.15rem 0.35rem',
|
|
||||||
background: 'var(--surface-secondary)',
|
|
||||||
border: '1px solid var(--border-color, #333)',
|
|
||||||
borderRadius: '4px',
|
|
||||||
color: 'inherit',
|
|
||||||
fontSize: 'inherit',
|
|
||||||
fontFamily: 'inherit',
|
|
||||||
textAlign: 'center'
|
|
||||||
}}
|
|
||||||
/>
|
|
||||||
MB used )
|
|
||||||
</span>
|
|
||||||
<IconButton
|
|
||||||
icon={faTrash}
|
|
||||||
onClick={handleClearCache}
|
|
||||||
title="Clear cache"
|
|
||||||
variant="ghost"
|
|
||||||
size={28}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="useLocalRelayAsCache" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="useLocalRelayAsCache"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.useLocalRelayAsCache ?? true}
|
|
||||||
onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Use local relays as cache</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div style={{
|
|
||||||
marginTop: '1.5rem',
|
|
||||||
padding: '1rem',
|
|
||||||
background: 'var(--surface-secondary)',
|
|
||||||
borderRadius: '6px',
|
|
||||||
fontSize: '0.9rem',
|
|
||||||
lineHeight: '1.6'
|
|
||||||
}}>
|
|
||||||
<p style={{ margin: 0, color: 'var(--text-secondary)' }}>
|
|
||||||
Boris works best with a local relay. Consider running{' '}
|
|
||||||
<a
|
|
||||||
href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download"
|
|
||||||
target="_blank"
|
|
||||||
rel="noopener noreferrer"
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)' }}
|
|
||||||
>
|
|
||||||
Citrine
|
|
||||||
</a>
|
|
||||||
{' or '}
|
|
||||||
<a
|
|
||||||
href="https://github.com/CodyTseng/nostr-relay-tray/releases"
|
|
||||||
target="_blank"
|
|
||||||
rel="noopener noreferrer"
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)' }}
|
|
||||||
>
|
|
||||||
nostr-relay-tray
|
|
||||||
</a>
|
|
||||||
. Don't know what relays are? Learn more{' '}
|
|
||||||
<a
|
|
||||||
onClick={(e) => {
|
|
||||||
e.preventDefault()
|
|
||||||
handleLinkClick('https://nostr.how/en/relays')
|
|
||||||
}}
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
|
||||||
>
|
|
||||||
here
|
|
||||||
</a>
|
|
||||||
{' and '}
|
|
||||||
<a
|
|
||||||
onClick={(e) => {
|
|
||||||
e.preventDefault()
|
|
||||||
handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
|
|
||||||
}}
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
|
||||||
>
|
|
||||||
here
|
|
||||||
</a>
|
|
||||||
.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
export default OfflineModeSettings
|
|
||||||
|
|
||||||
@@ -1,80 +1,206 @@
|
|||||||
import React from 'react'
|
import React, { useState, useEffect } from 'react'
|
||||||
import { faDownload, faCheckCircle, faMobileAlt } from '@fortawesome/free-solid-svg-icons'
|
import { useNavigate } from 'react-router-dom'
|
||||||
|
import { faDownload, faCheckCircle, faTrash } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { usePWAInstall } from '../../hooks/usePWAInstall'
|
import { usePWAInstall } from '../../hooks/usePWAInstall'
|
||||||
|
import { useIsMobile } from '../../hooks/useMediaQuery'
|
||||||
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
|
||||||
|
|
||||||
const PWASettings: React.FC = () => {
|
interface PWASettingsProps {
|
||||||
|
settings: UserSettings
|
||||||
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
|
onClose?: () => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }) => {
|
||||||
|
const navigate = useNavigate()
|
||||||
|
const isMobile = useIsMobile()
|
||||||
const { isInstallable, isInstalled, installApp } = usePWAInstall()
|
const { isInstallable, isInstalled, installApp } = usePWAInstall()
|
||||||
|
const [cacheStats, setCacheStats] = useState<{
|
||||||
|
totalSizeMB: number
|
||||||
|
itemCount: number
|
||||||
|
items: Array<{ url: string, sizeMB: number }>
|
||||||
|
}>({ totalSizeMB: 0, itemCount: 0, items: [] })
|
||||||
|
|
||||||
const handleInstall = async () => {
|
const handleInstall = async () => {
|
||||||
|
if (isInstalled) return
|
||||||
const success = await installApp()
|
const success = await installApp()
|
||||||
if (success) {
|
if (success) {
|
||||||
console.log('App installed successfully')
|
console.log('App installed successfully')
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (isInstalled) {
|
const handleLinkClick = (url: string) => {
|
||||||
return (
|
if (onClose) onClose()
|
||||||
<div className="settings-section">
|
navigate(`/r/${encodeURIComponent(url)}`)
|
||||||
<h3>Progressive Web App</h3>
|
|
||||||
<div className="setting-item">
|
|
||||||
<div className="setting-info">
|
|
||||||
<FontAwesomeIcon icon={faCheckCircle} style={{ color: '#22c55e', marginRight: '8px' }} />
|
|
||||||
<span>Boris is installed as an app</span>
|
|
||||||
</div>
|
|
||||||
<p className="setting-description">
|
|
||||||
You can launch Boris from your home screen or app drawer.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!isInstallable) {
|
const handleClearCache = async () => {
|
||||||
return null
|
if (confirm('Are you sure you want to clear all cached images?')) {
|
||||||
|
await clearImageCache()
|
||||||
|
const stats = await getImageCacheStatsAsync()
|
||||||
|
setCacheStats(stats)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Update cache stats periodically
|
||||||
|
useEffect(() => {
|
||||||
|
const updateStats = async () => {
|
||||||
|
const stats = await getImageCacheStatsAsync()
|
||||||
|
setCacheStats(stats)
|
||||||
|
}
|
||||||
|
|
||||||
|
updateStats() // Initial load
|
||||||
|
const interval = setInterval(updateStats, 3000) // Update every 3 seconds
|
||||||
|
return () => clearInterval(interval)
|
||||||
|
}, [])
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3>Progressive Web App</h3>
|
<h3 className="section-title">App & Airplane Mode</h3>
|
||||||
<div className="setting-item">
|
|
||||||
<div className="setting-info">
|
<div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
|
||||||
<FontAwesomeIcon icon={faMobileAlt} style={{ marginRight: '8px' }} />
|
<div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
|
||||||
<span>Install Boris as an app</span>
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Boris is offline‑first by design. You can read, create highlights, and browse your library without being connected to the internet. Boris will store changes locally and sync later.
|
||||||
|
</p>
|
||||||
|
|
||||||
|
{/* Flight Mode Section - Checkboxes First */}
|
||||||
|
<div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
|
||||||
|
<label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
|
||||||
|
<input
|
||||||
|
id="enableImageCache"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.enableImageCache ?? true}
|
||||||
|
onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Use local image cache</span>
|
||||||
|
</label>
|
||||||
|
|
||||||
|
{(settings.enableImageCache ?? true) && (
|
||||||
|
<div style={{
|
||||||
|
fontSize: '0.85rem',
|
||||||
|
color: 'var(--text-secondary)',
|
||||||
|
display: 'flex',
|
||||||
|
alignItems: 'center',
|
||||||
|
gap: '0.5rem'
|
||||||
|
}}>
|
||||||
|
<span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
|
||||||
|
( {cacheStats.totalSizeMB.toFixed(1)} MB /
|
||||||
|
<input
|
||||||
|
id="imageCacheSizeMB"
|
||||||
|
type="number"
|
||||||
|
min="10"
|
||||||
|
max="500"
|
||||||
|
value={settings.imageCacheSizeMB ?? 210}
|
||||||
|
onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
|
||||||
|
style={{
|
||||||
|
width: '50px',
|
||||||
|
padding: '0.15rem 0.35rem',
|
||||||
|
background: 'var(--surface-secondary)',
|
||||||
|
border: '1px solid var(--border-color, #333)',
|
||||||
|
borderRadius: '4px',
|
||||||
|
color: 'inherit',
|
||||||
|
fontSize: 'inherit',
|
||||||
|
fontFamily: 'inherit',
|
||||||
|
textAlign: 'center'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
MB used )
|
||||||
|
</span>
|
||||||
|
<FontAwesomeIcon
|
||||||
|
icon={faTrash}
|
||||||
|
onClick={handleClearCache}
|
||||||
|
title="Clear cache"
|
||||||
|
style={{ cursor: 'pointer', fontSize: '0.85rem', opacity: 0.7 }}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* PWA Install Section - Paragraphs */}
|
||||||
|
<div className="setting-group">
|
||||||
|
<p className="setting-description" style={{ marginTop: '0.5rem', marginBottom: '0.75rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
<strong>Note:</strong> Boris works best with a local relay. Consider running{' '}
|
||||||
|
<a
|
||||||
|
href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)' }}
|
||||||
|
>
|
||||||
|
Citrine
|
||||||
|
</a>
|
||||||
|
{' or '}
|
||||||
|
<a
|
||||||
|
href="https://github.com/CodyTseng/nostr-relay-tray/releases"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)' }}
|
||||||
|
>
|
||||||
|
nostr-relay-tray
|
||||||
|
</a>
|
||||||
|
{' '}to bring full offline functionality to Boris. Don't know what relays are? Learn more{' '}
|
||||||
|
<a
|
||||||
|
onClick={(e) => {
|
||||||
|
e.preventDefault()
|
||||||
|
handleLinkClick('https://nostr.how/en/relays')
|
||||||
|
}}
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
||||||
|
>
|
||||||
|
here
|
||||||
|
</a>
|
||||||
|
{' and '}
|
||||||
|
<a
|
||||||
|
onClick={(e) => {
|
||||||
|
e.preventDefault()
|
||||||
|
handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
|
||||||
|
}}
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
||||||
|
>
|
||||||
|
here
|
||||||
|
</a>
|
||||||
|
.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="useLocalRelayAsCache" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="useLocalRelayAsCache"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.useLocalRelayAsCache ?? true}
|
||||||
|
onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Use local relays as cache</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Install Boris on your device for a native app experience.
|
||||||
|
</p>
|
||||||
|
<button
|
||||||
|
onClick={handleInstall}
|
||||||
|
className="zap-preset-btn"
|
||||||
|
style={{ display: 'flex', alignItems: 'center', gap: '0.5rem' }}
|
||||||
|
disabled={isInstalled || !isInstallable}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={isInstalled ? faCheckCircle : faDownload} />
|
||||||
|
{isInstalled ? 'Installed' : 'Install App'}
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<p className="setting-description">
|
|
||||||
Install Boris on your device for a native app experience with offline support.
|
{!isMobile && (
|
||||||
</p>
|
<img
|
||||||
<button
|
src="/pwa.svg"
|
||||||
onClick={handleInstall}
|
alt="Progressive Web App"
|
||||||
className="install-button"
|
style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
|
||||||
style={{
|
/>
|
||||||
marginTop: '12px',
|
)}
|
||||||
padding: '8px 16px',
|
|
||||||
background: 'linear-gradient(135deg, #3b82f6 0%, #1e40af 100%)',
|
|
||||||
color: 'white',
|
|
||||||
border: 'none',
|
|
||||||
borderRadius: '8px',
|
|
||||||
cursor: 'pointer',
|
|
||||||
display: 'flex',
|
|
||||||
alignItems: 'center',
|
|
||||||
gap: '8px',
|
|
||||||
fontSize: '14px',
|
|
||||||
fontWeight: '500',
|
|
||||||
transition: 'transform 0.2s, box-shadow 0.2s',
|
|
||||||
}}
|
|
||||||
onMouseEnter={(e) => {
|
|
||||||
e.currentTarget.style.transform = 'translateY(-2px)'
|
|
||||||
e.currentTarget.style.boxShadow = '0 4px 12px rgba(59, 130, 246, 0.3)'
|
|
||||||
}}
|
|
||||||
onMouseLeave={(e) => {
|
|
||||||
e.currentTarget.style.transform = 'translateY(0)'
|
|
||||||
e.currentTarget.style.boxShadow = 'none'
|
|
||||||
}}
|
|
||||||
>
|
|
||||||
<FontAwesomeIcon icon={faDownload} />
|
|
||||||
Install App
|
|
||||||
</button>
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -1,5 +1,5 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser, faAlignLeft, faAlignJustify } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
import IconButton from '../IconButton'
|
import IconButton from '../IconButton'
|
||||||
import ColorPicker from '../ColorPicker'
|
import ColorPicker from '../ColorPicker'
|
||||||
@@ -19,35 +19,6 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Reading & Display</h3>
|
<h3 className="section-title">Reading & Display</h3>
|
||||||
|
|
||||||
<div style={{ display: 'flex', gap: '1rem', flexWrap: 'wrap' }}>
|
|
||||||
<div className="setting-group setting-inline" style={{ flex: '1 1 auto', minWidth: '200px' }}>
|
|
||||||
<label htmlFor="readingFont">Reading Font</label>
|
|
||||||
<div className="setting-control">
|
|
||||||
<FontSelector
|
|
||||||
value={settings.readingFont || 'source-serif-4'}
|
|
||||||
onChange={(font) => onUpdate({ readingFont: font })}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline" style={{ flex: '0 1 auto' }}>
|
|
||||||
<label>Font Size</label>
|
|
||||||
<div className="setting-buttons">
|
|
||||||
{[16, 18, 21, 24, 28, 32].map(size => (
|
|
||||||
<button
|
|
||||||
key={size}
|
|
||||||
onClick={() => onUpdate({ fontSize: size })}
|
|
||||||
className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
|
|
||||||
title={`${size}px`}
|
|
||||||
style={{ fontSize: `${size - 2}px` }}
|
|
||||||
>
|
|
||||||
A
|
|
||||||
</button>
|
|
||||||
))}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label>Highlight Style</label>
|
<label>Highlight Style</label>
|
||||||
<div className="setting-buttons">
|
<div className="setting-buttons">
|
||||||
@@ -69,31 +40,21 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label className="setting-label">My Highlights</label>
|
<label>Paragraph Alignment</label>
|
||||||
<div className="setting-control">
|
<div className="setting-buttons">
|
||||||
<ColorPicker
|
<IconButton
|
||||||
selectedColor={settings.highlightColorMine || '#fde047'}
|
icon={faAlignLeft}
|
||||||
onColorChange={(color) => onUpdate({ highlightColorMine: color })}
|
onClick={() => onUpdate({ paragraphAlignment: 'left' })}
|
||||||
|
title="Left aligned"
|
||||||
|
ariaLabel="Left aligned"
|
||||||
|
variant={settings.paragraphAlignment === 'left' ? 'primary' : 'ghost'}
|
||||||
/>
|
/>
|
||||||
</div>
|
<IconButton
|
||||||
</div>
|
icon={faAlignJustify}
|
||||||
|
onClick={() => onUpdate({ paragraphAlignment: 'justify' })}
|
||||||
<div className="setting-group setting-inline">
|
title="Justified"
|
||||||
<label className="setting-label">Friends Highlights</label>
|
ariaLabel="Justified"
|
||||||
<div className="setting-control">
|
variant={(settings.paragraphAlignment || 'justify') === 'justify' ? 'primary' : 'ghost'}
|
||||||
<ColorPicker
|
|
||||||
selectedColor={settings.highlightColorFriends || '#f97316'}
|
|
||||||
onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
|
||||||
<label className="setting-label">Nostrverse Highlights</label>
|
|
||||||
<div className="setting-control">
|
|
||||||
<ColorPicker
|
|
||||||
selectedColor={settings.highlightColorNostrverse || '#9333ea'}
|
|
||||||
onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
|
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
@@ -137,6 +98,65 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label htmlFor="readingFont">Reading Font</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<FontSelector
|
||||||
|
value={settings.readingFont || 'source-serif-4'}
|
||||||
|
onChange={(font) => onUpdate({ readingFont: font })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Font Size</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<div className="setting-buttons">
|
||||||
|
{[16, 18, 21, 24, 28, 32].map(size => (
|
||||||
|
<button
|
||||||
|
key={size}
|
||||||
|
onClick={() => onUpdate({ fontSize: size })}
|
||||||
|
className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
|
||||||
|
title={`${size}px`}
|
||||||
|
style={{ fontSize: `${size - 2}px` }}
|
||||||
|
>
|
||||||
|
A
|
||||||
|
</button>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">My Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorMine || '#fde047'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorMine: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Friends Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorFriends || '#f97316'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Nostrverse Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorNostrverse || '#9333ea'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
<div className="setting-group">
|
<div className="setting-group">
|
||||||
<label htmlFor="showHighlights" className="checkbox-label">
|
<label htmlFor="showHighlights" className="checkbox-label">
|
||||||
<input
|
<input
|
||||||
@@ -157,7 +177,8 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
style={{
|
style={{
|
||||||
fontFamily: previewFontFamily,
|
fontFamily: previewFontFamily,
|
||||||
fontSize: `${settings.fontSize || 21}px`,
|
fontSize: `${settings.fontSize || 21}px`,
|
||||||
'--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00')
|
'--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00'),
|
||||||
|
'--paragraph-alignment': settings.paragraphAlignment || 'justify'
|
||||||
} as React.CSSProperties}
|
} as React.CSSProperties}
|
||||||
>
|
>
|
||||||
<h3>The Quick Brown Fox</h3>
|
<h3>The Quick Brown Fox</h3>
|
||||||
|
|||||||
@@ -1,70 +0,0 @@
|
|||||||
import React from 'react'
|
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
|
|
||||||
interface StartupPreferencesSettingsProps {
|
|
||||||
settings: UserSettings
|
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
|
||||||
}
|
|
||||||
|
|
||||||
const StartupPreferencesSettings: React.FC<StartupPreferencesSettingsProps> = ({ settings, onUpdate }) => {
|
|
||||||
return (
|
|
||||||
<div className="settings-section">
|
|
||||||
<h3 className="section-title">Startup & Behavior</h3>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="sidebarCollapsed"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.sidebarCollapsed !== false}
|
|
||||||
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Start with bookmarks sidebar collapsed</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="highlightsCollapsed"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.highlightsCollapsed !== false}
|
|
||||||
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Start with highlights panel collapsed</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="rebroadcastToAllRelays"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.rebroadcastToAllRelays ?? false}
|
|
||||||
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Rebroadcast events while browsing</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="autoCollapseSidebarOnMobile"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.autoCollapseSidebarOnMobile !== false}
|
|
||||||
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Auto-collapse sidebar on small screens</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
export default StartupPreferencesSettings
|
|
||||||
|
|
||||||
@@ -1,5 +1,6 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import { useIsMobile } from '../../hooks/useMediaQuery'
|
||||||
|
|
||||||
interface ZapSettingsProps {
|
interface ZapSettingsProps {
|
||||||
settings: UserSettings
|
settings: UserSettings
|
||||||
@@ -7,6 +8,7 @@ interface ZapSettingsProps {
|
|||||||
}
|
}
|
||||||
|
|
||||||
const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
|
const isMobile = useIsMobile()
|
||||||
const highlighterWeight = settings.zapSplitHighlighterWeight ?? 50
|
const highlighterWeight = settings.zapSplitHighlighterWeight ?? 50
|
||||||
const borisWeight = settings.zapSplitBorisWeight ?? 2.1
|
const borisWeight = settings.zapSplitBorisWeight ?? 2.1
|
||||||
const authorWeight = settings.zapSplitAuthorWeight ?? 50
|
const authorWeight = settings.zapSplitAuthorWeight ?? 50
|
||||||
@@ -42,98 +44,119 @@ const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
|||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Zap Splits</h3>
|
<h3 className="section-title">Zap Splits</h3>
|
||||||
|
|
||||||
<div className="setting-group">
|
<div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
|
||||||
<label className="setting-label">Presets</label>
|
<div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
|
||||||
<div className="zap-preset-buttons">
|
<div className="setting-group">
|
||||||
<button
|
<label className="setting-label">Presets</label>
|
||||||
onClick={() => applyPreset(presets.default)}
|
<div className="zap-preset-buttons">
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 49%, Author: 49%, Boris: 2%"
|
onClick={() => applyPreset(presets.default)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
|
||||||
Default
|
title="You: 49%, Author: 49%, Boris: 2%"
|
||||||
</button>
|
>
|
||||||
<button
|
Default
|
||||||
onClick={() => applyPreset(presets.generous)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 6%, Author: 83%, Boris: 11%"
|
onClick={() => applyPreset(presets.generous)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
|
||||||
Generous
|
title="You: 6%, Author: 83%, Boris: 11%"
|
||||||
</button>
|
>
|
||||||
<button
|
Generous
|
||||||
onClick={() => applyPreset(presets.selfless)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 1%, Author: 80%, Boris: 19%"
|
onClick={() => applyPreset(presets.selfless)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
|
||||||
Selfless
|
title="You: 1%, Author: 80%, Boris: 19%"
|
||||||
</button>
|
>
|
||||||
<button
|
Selfless
|
||||||
onClick={() => applyPreset(presets.boris)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 10%, Author: 10%, Boris: 80%"
|
onClick={() => applyPreset(presets.boris)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
|
||||||
Boris 🧡
|
title="You: 10%, Author: 10%, Boris: 80%"
|
||||||
</button>
|
>
|
||||||
</div>
|
Boris 🧡
|
||||||
</div>
|
</button>
|
||||||
|
</div>
|
||||||
<div className="setting-group">
|
|
||||||
<label className="setting-label">Your Share</label>
|
|
||||||
<div className="zap-split-container">
|
|
||||||
<div className="zap-split-labels">
|
|
||||||
<span className="zap-split-label">Weight: {highlighterWeight}</span>
|
|
||||||
<span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
|
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
<div className="setting-group">
|
||||||
min="0"
|
<div className="zap-split-container">
|
||||||
max="100"
|
<div className="zap-split-labels">
|
||||||
value={highlighterWeight}
|
<span className="zap-split-label">Your Share: {highlighterWeight}</span>
|
||||||
onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
|
<span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
|
||||||
className="zap-split-slider"
|
</div>
|
||||||
/>
|
<input
|
||||||
</div>
|
type="range"
|
||||||
</div>
|
min="0"
|
||||||
|
max="100"
|
||||||
<div className="setting-group">
|
value={highlighterWeight}
|
||||||
<label className="setting-label">Author(s) Share</label>
|
onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
|
||||||
<div className="zap-split-container">
|
className="zap-split-slider"
|
||||||
<div className="zap-split-labels">
|
list="highlighter-ticks"
|
||||||
<span className="zap-split-label">Weight: {authorWeight}</span>
|
/>
|
||||||
<span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
|
<datalist id="highlighter-ticks">
|
||||||
|
<option value="50" label="50%"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
|
||||||
min="0"
|
|
||||||
max="100"
|
|
||||||
value={authorWeight}
|
|
||||||
onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
|
|
||||||
className="zap-split-slider"
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
<div className="setting-group">
|
||||||
<label className="setting-label">Support Boris</label>
|
<div className="zap-split-container">
|
||||||
<div className="zap-split-container">
|
<div className="zap-split-labels">
|
||||||
<div className="zap-split-labels">
|
<span className="zap-split-label">Author's Share: {authorWeight}</span>
|
||||||
<span className="zap-split-label">Weight: {borisWeight.toFixed(1)}</span>
|
<span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
|
||||||
<span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
|
</div>
|
||||||
|
<input
|
||||||
|
type="range"
|
||||||
|
min="0"
|
||||||
|
max="100"
|
||||||
|
value={authorWeight}
|
||||||
|
onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
|
||||||
|
className="zap-split-slider"
|
||||||
|
list="author-ticks"
|
||||||
|
/>
|
||||||
|
<datalist id="author-ticks">
|
||||||
|
<option value="50" label="50%"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
|
||||||
min="0"
|
|
||||||
max="10"
|
|
||||||
step="0.1"
|
|
||||||
value={borisWeight}
|
|
||||||
onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
|
|
||||||
className="zap-split-slider"
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="zap-split-description">
|
<div className="setting-group">
|
||||||
Weights determine zap splits when highlighting nostr-native content.
|
<div className="zap-split-container">
|
||||||
If the content has multiple authors, their share is divided proportionally.
|
<div className="zap-split-labels">
|
||||||
|
<span className="zap-split-label">Boris' Share: {borisWeight.toFixed(1)}</span>
|
||||||
|
<span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
|
||||||
|
</div>
|
||||||
|
<input
|
||||||
|
type="range"
|
||||||
|
min="0"
|
||||||
|
max="10"
|
||||||
|
step="0.1"
|
||||||
|
value={borisWeight}
|
||||||
|
onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
|
||||||
|
className="zap-split-slider"
|
||||||
|
list="boris-ticks"
|
||||||
|
/>
|
||||||
|
<datalist id="boris-ticks">
|
||||||
|
<option value="5" label="5"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Weights determine zap splits when highlighting nostr-native content.
|
||||||
|
If the content has multiple authors, their share is divided proportionally.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{!isMobile && (
|
||||||
|
<img
|
||||||
|
src="/zaps.svg"
|
||||||
|
alt="Zap Splits"
|
||||||
|
style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -1,28 +1,22 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { useNavigate } from 'react-router-dom'
|
import { useNavigate } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faPlus, faNewspaper, faTimes } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faNewspaper, faTimes } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
import { useEventModel } from 'applesauce-react/hooks'
|
import { useEventModel } from 'applesauce-react/hooks'
|
||||||
import { Models } from 'applesauce-core'
|
import { Models } from 'applesauce-core'
|
||||||
import { Accounts } from 'applesauce-accounts'
|
import { Accounts } from 'applesauce-accounts'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import AddBookmarkModal from './AddBookmarkModal'
|
|
||||||
import { createWebBookmark } from '../services/webBookmarkService'
|
|
||||||
import { RELAYS } from '../config/relays'
|
|
||||||
|
|
||||||
interface SidebarHeaderProps {
|
interface SidebarHeaderProps {
|
||||||
onToggleCollapse: () => void
|
onToggleCollapse: () => void
|
||||||
onLogout: () => void
|
onLogout: () => void
|
||||||
onOpenSettings: () => void
|
onOpenSettings: () => void
|
||||||
relayPool: RelayPool | null
|
|
||||||
isMobile?: boolean
|
isMobile?: boolean
|
||||||
}
|
}
|
||||||
|
|
||||||
const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, relayPool, isMobile = false }) => {
|
const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, isMobile = false }) => {
|
||||||
const [isConnecting, setIsConnecting] = useState(false)
|
const [isConnecting, setIsConnecting] = useState(false)
|
||||||
const [showAddModal, setShowAddModal] = useState(false)
|
|
||||||
const navigate = useNavigate()
|
const navigate = useNavigate()
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
const accountManager = Hooks.useAccountManager()
|
const accountManager = Hooks.useAccountManager()
|
||||||
@@ -54,14 +48,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
return `${activeAccount.pubkey.slice(0, 8)}...${activeAccount.pubkey.slice(-8)}`
|
return `${activeAccount.pubkey.slice(0, 8)}...${activeAccount.pubkey.slice(-8)}`
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
|
|
||||||
if (!activeAccount || !relayPool) {
|
|
||||||
throw new Error('Please login to create bookmarks')
|
|
||||||
}
|
|
||||||
|
|
||||||
await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
|
|
||||||
}
|
|
||||||
|
|
||||||
const profileImage = getProfileImage()
|
const profileImage = getProfileImage()
|
||||||
|
|
||||||
return (
|
return (
|
||||||
@@ -124,15 +110,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
ariaLabel="Settings"
|
ariaLabel="Settings"
|
||||||
variant="ghost"
|
variant="ghost"
|
||||||
/>
|
/>
|
||||||
{activeAccount && (
|
|
||||||
<IconButton
|
|
||||||
icon={faPlus}
|
|
||||||
onClick={() => setShowAddModal(true)}
|
|
||||||
title="Add bookmark"
|
|
||||||
ariaLabel="Add bookmark"
|
|
||||||
variant="ghost"
|
|
||||||
/>
|
|
||||||
)}
|
|
||||||
{activeAccount ? (
|
{activeAccount ? (
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faRightFromBracket}
|
icon={faRightFromBracket}
|
||||||
@@ -152,12 +129,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
)}
|
)}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
{showAddModal && (
|
|
||||||
<AddBookmarkModal
|
|
||||||
onClose={() => setShowAddModal(false)}
|
|
||||||
onSave={handleSaveBookmark}
|
|
||||||
/>
|
|
||||||
)}
|
|
||||||
</>
|
</>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
235
src/components/Support.tsx
Normal file
235
src/components/Support.tsx
Normal file
@@ -0,0 +1,235 @@
|
|||||||
|
import React, { useEffect, useState } from 'react'
|
||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { IEventStore } from 'applesauce-core'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faHeart, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
|
||||||
|
import { fetchProfiles } from '../services/profileService'
|
||||||
|
import { UserSettings } from '../services/settingsService'
|
||||||
|
import { Models } from 'applesauce-core'
|
||||||
|
import { useEventModel } from 'applesauce-react/hooks'
|
||||||
|
import { useNavigate } from 'react-router-dom'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
|
||||||
|
interface SupportProps {
|
||||||
|
relayPool: RelayPool
|
||||||
|
eventStore: IEventStore
|
||||||
|
settings: UserSettings
|
||||||
|
}
|
||||||
|
|
||||||
|
type SupporterProfile = ZapSender
|
||||||
|
|
||||||
|
const Support: React.FC<SupportProps> = ({ relayPool, eventStore, settings }) => {
|
||||||
|
const [supporters, setSupporters] = useState<SupporterProfile[]>([])
|
||||||
|
const [loading, setLoading] = useState(true)
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
const loadSupporters = async () => {
|
||||||
|
setLoading(true)
|
||||||
|
try {
|
||||||
|
const zappers = await fetchBorisZappers(relayPool)
|
||||||
|
|
||||||
|
if (zappers.length > 0) {
|
||||||
|
const pubkeys = zappers.map(z => z.pubkey)
|
||||||
|
await fetchProfiles(relayPool, eventStore, pubkeys, settings)
|
||||||
|
}
|
||||||
|
|
||||||
|
setSupporters(zappers)
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to load supporters:', error)
|
||||||
|
} finally {
|
||||||
|
setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
loadSupporters()
|
||||||
|
}, [relayPool, eventStore, settings])
|
||||||
|
|
||||||
|
if (loading) {
|
||||||
|
return (
|
||||||
|
<div className="flex items-center justify-center min-h-screen p-4">
|
||||||
|
<FontAwesomeIcon icon={faSpinner} spin size="2x" className="text-zinc-400" />
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="min-h-screen" style={{ backgroundColor: 'var(--color-bg)', color: 'var(--color-text)' }}>
|
||||||
|
<div className="max-w-5xl mx-auto px-4 py-12 md:py-16">
|
||||||
|
<div className="text-center mb-16 md:mb-20">
|
||||||
|
<div className="flex justify-center mb-8">
|
||||||
|
<img
|
||||||
|
src="/thank-you.svg"
|
||||||
|
alt="Thank you"
|
||||||
|
className="w-56 h-56 md:w-72 md:h-72 opacity-90"
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
<h1 className="text-4xl md:text-5xl font-bold mb-4" style={{ color: 'var(--color-text)' }}>
|
||||||
|
Thank You!
|
||||||
|
</h1>
|
||||||
|
<p className="text-lg md:text-xl max-w-2xl mx-auto leading-relaxed" style={{ color: 'var(--color-text-secondary)' }}>
|
||||||
|
Your{' '}
|
||||||
|
<a
|
||||||
|
href="https://www.readwithboris.com/#pricing"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
className="underline hover:no-underline"
|
||||||
|
style={{ color: 'var(--color-primary)' }}
|
||||||
|
>
|
||||||
|
zaps
|
||||||
|
</a>
|
||||||
|
{' '}help keep this project alive.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{supporters.length === 0 ? (
|
||||||
|
<div className="text-center py-12" style={{ color: 'var(--color-text-muted)' }}>
|
||||||
|
<p>No supporters yet. Be the first to zap Boris!</p>
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<>
|
||||||
|
{/* Whales Section */}
|
||||||
|
{supporters.filter(s => s.isWhale).length > 0 && (
|
||||||
|
<div className="mb-16 md:mb-20">
|
||||||
|
<h2 className="text-2xl md:text-3xl font-semibold mb-8 md:mb-10 text-center" style={{ color: 'var(--color-text)' }}>
|
||||||
|
Legends
|
||||||
|
</h2>
|
||||||
|
<div className="grid grid-cols-2 sm:grid-cols-3 md:grid-cols-4 lg:grid-cols-5 gap-8 md:gap-10">
|
||||||
|
{supporters.filter(s => s.isWhale).map(supporter => (
|
||||||
|
<SupporterCard key={supporter.pubkey} supporter={supporter} isWhale={true} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
|
||||||
|
{/* Regular Supporters Section */}
|
||||||
|
{supporters.filter(s => !s.isWhale).length > 0 && (
|
||||||
|
<div className="mb-12">
|
||||||
|
<h2 className="text-xl md:text-2xl font-semibold mb-8 text-center" style={{ color: 'var(--color-text)' }}>
|
||||||
|
Supporters
|
||||||
|
</h2>
|
||||||
|
<div className="grid grid-cols-4 sm:grid-cols-6 md:grid-cols-8 lg:grid-cols-10 gap-4 md:gap-5">
|
||||||
|
{supporters.filter(s => !s.isWhale).map(supporter => (
|
||||||
|
<SupporterCard key={supporter.pubkey} supporter={supporter} isWhale={false} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</>
|
||||||
|
)}
|
||||||
|
|
||||||
|
<div className="mt-16 md:mt-20 pt-8 border-t" style={{ borderColor: 'var(--color-border-subtle)' }}>
|
||||||
|
<div className="text-center space-y-4">
|
||||||
|
<p className="text-base" style={{ color: 'var(--color-text-secondary)' }}>
|
||||||
|
Zap{' '}
|
||||||
|
<a
|
||||||
|
href="https://njump.me/npub19802see0gnk3vjlus0dnmfdagusqrtmsxpl5yfmkwn9uvnfnqylqduhr0x"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
className="underline hover:no-underline"
|
||||||
|
style={{ color: 'var(--color-primary)' }}
|
||||||
|
>
|
||||||
|
Boris
|
||||||
|
</a>
|
||||||
|
{' '}a{' '}
|
||||||
|
<a
|
||||||
|
href="https://www.readwithboris.com/#pricing"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
className="underline hover:no-underline"
|
||||||
|
style={{ color: 'var(--color-primary)' }}
|
||||||
|
>
|
||||||
|
meaningful amount of sats
|
||||||
|
</a>
|
||||||
|
{' '}and your avatar will show above.
|
||||||
|
</p>
|
||||||
|
<p className="text-xs" style={{ color: 'var(--color-text-muted)' }}>
|
||||||
|
Total supporters: {supporters.length} •
|
||||||
|
Total zaps: {supporters.reduce((sum, s) => sum + s.zapCount, 0)}
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
interface SupporterCardProps {
|
||||||
|
supporter: SupporterProfile
|
||||||
|
isWhale: boolean
|
||||||
|
}
|
||||||
|
|
||||||
|
const SupporterCard: React.FC<SupporterCardProps> = ({ supporter, isWhale }) => {
|
||||||
|
const navigate = useNavigate()
|
||||||
|
const profile = useEventModel(Models.ProfileModel, [supporter.pubkey])
|
||||||
|
|
||||||
|
const picture = profile?.picture
|
||||||
|
const name = profile?.name || profile?.display_name || `${supporter.pubkey.slice(0, 8)}...`
|
||||||
|
|
||||||
|
const handleClick = () => {
|
||||||
|
const npub = nip19.npubEncode(supporter.pubkey)
|
||||||
|
navigate(`/p/${npub}`)
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="flex flex-col items-center">
|
||||||
|
<div className="relative">
|
||||||
|
{/* Avatar */}
|
||||||
|
<div
|
||||||
|
className={`rounded-full overflow-hidden flex items-center justify-center cursor-pointer transition-transform hover:scale-105
|
||||||
|
${isWhale ? 'w-24 h-24 md:w-28 md:h-28 ring-4 ring-yellow-400' : 'w-10 h-10 md:w-12 md:h-12'}
|
||||||
|
`}
|
||||||
|
style={{
|
||||||
|
backgroundColor: 'var(--color-bg-elevated)'
|
||||||
|
}}
|
||||||
|
title={`${name} • ${supporter.totalSats.toLocaleString()} sats`}
|
||||||
|
onClick={handleClick}
|
||||||
|
>
|
||||||
|
{picture ? (
|
||||||
|
<img
|
||||||
|
src={picture}
|
||||||
|
alt={name}
|
||||||
|
className="w-full h-full object-cover"
|
||||||
|
loading="lazy"
|
||||||
|
/>
|
||||||
|
) : (
|
||||||
|
<FontAwesomeIcon
|
||||||
|
icon={faUserCircle}
|
||||||
|
className={isWhale ? 'text-5xl' : 'text-3xl'}
|
||||||
|
style={{ color: 'var(--color-border)' }}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Whale Badge */}
|
||||||
|
{isWhale && (
|
||||||
|
<div
|
||||||
|
className="absolute -bottom-1 -right-1 w-8 h-8 bg-yellow-400 rounded-full flex items-center justify-center border-2"
|
||||||
|
style={{ borderColor: 'var(--color-bg)' }}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faHeart} className="text-zinc-900 text-sm" />
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Name and Total */}
|
||||||
|
<div className="mt-2 text-center">
|
||||||
|
<p
|
||||||
|
className={`font-medium truncate max-w-full ${isWhale ? 'text-sm' : 'text-xs'}`}
|
||||||
|
style={{ color: 'var(--color-text)' }}
|
||||||
|
>
|
||||||
|
{name}
|
||||||
|
</p>
|
||||||
|
<p
|
||||||
|
className={isWhale ? 'text-xs' : 'text-[10px]'}
|
||||||
|
style={{ color: 'var(--color-text-muted)' }}
|
||||||
|
>
|
||||||
|
{supporter.totalSats.toLocaleString()} sats
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default Support
|
||||||
|
|
||||||
@@ -1,4 +1,4 @@
|
|||||||
import React, { useEffect, useRef } from 'react'
|
import React, { useEffect, useRef, useState } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
import { faBookmark, faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
@@ -32,6 +32,7 @@ interface ThreePaneLayoutProps {
|
|||||||
showExplore?: boolean
|
showExplore?: boolean
|
||||||
showMe?: boolean
|
showMe?: boolean
|
||||||
showProfile?: boolean
|
showProfile?: boolean
|
||||||
|
showSupport?: boolean
|
||||||
|
|
||||||
// Bookmarks pane
|
// Bookmarks pane
|
||||||
bookmarks: Bookmark[]
|
bookmarks: Bookmark[]
|
||||||
@@ -93,6 +94,9 @@ interface ThreePaneLayoutProps {
|
|||||||
|
|
||||||
// Optional Profile content
|
// Optional Profile content
|
||||||
profile?: React.ReactNode
|
profile?: React.ReactNode
|
||||||
|
|
||||||
|
// Optional Support content
|
||||||
|
support?: React.ReactNode
|
||||||
}
|
}
|
||||||
|
|
||||||
const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
||||||
@@ -101,13 +105,33 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
const highlightsRef = useRef<HTMLDivElement>(null)
|
const highlightsRef = useRef<HTMLDivElement>(null)
|
||||||
const mainPaneRef = useRef<HTMLDivElement>(null)
|
const mainPaneRef = useRef<HTMLDivElement>(null)
|
||||||
|
|
||||||
// Detect scroll direction to hide/show mobile buttons
|
// Detect scroll direction and position to hide/show mobile buttons
|
||||||
// Now using window scroll (document scroll) instead of pane scroll
|
// Only hide on scroll down when viewing article content
|
||||||
|
const isViewingArticle = !!(props.selectedUrl)
|
||||||
const scrollDirection = useScrollDirection({
|
const scrollDirection = useScrollDirection({
|
||||||
threshold: 10,
|
threshold: 10,
|
||||||
enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed
|
enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && isViewingArticle
|
||||||
})
|
})
|
||||||
const showMobileButtons = scrollDirection !== 'down'
|
|
||||||
|
// Track if we're at the top of the page
|
||||||
|
const [isAtTop, setIsAtTop] = useState(true)
|
||||||
|
useEffect(() => {
|
||||||
|
if (!isMobile || !isViewingArticle) return
|
||||||
|
|
||||||
|
const handleScroll = () => {
|
||||||
|
setIsAtTop(window.scrollY <= 10)
|
||||||
|
}
|
||||||
|
|
||||||
|
handleScroll() // Check initial position
|
||||||
|
window.addEventListener('scroll', handleScroll, { passive: true })
|
||||||
|
|
||||||
|
return () => window.removeEventListener('scroll', handleScroll)
|
||||||
|
}, [isMobile, isViewingArticle])
|
||||||
|
|
||||||
|
// Bookmark button: hide only when scrolling down
|
||||||
|
const showBookmarkButton = scrollDirection !== 'down'
|
||||||
|
// Highlights button: hide when scrolling down OR at the top
|
||||||
|
const showHighlightsButton = scrollDirection !== 'down' && !isAtTop
|
||||||
|
|
||||||
// Lock body scroll when mobile sidebar or highlights is open
|
// Lock body scroll when mobile sidebar or highlights is open
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -225,11 +249,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
|
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
{/* Mobile bookmark button - only show when viewing article (not on settings/explore/me/profile) */}
|
{/* Mobile bookmark button - always show except on settings page */}
|
||||||
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showExplore && !props.showMe && !props.showProfile && (
|
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && (
|
||||||
<button
|
<button
|
||||||
className={`fixed z-[900] bg-zinc-800/70 border border-zinc-600/40 rounded-lg text-zinc-200 flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
className={`fixed z-[900] bg-zinc-800/70 border border-zinc-600/40 rounded-lg text-zinc-200 flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
||||||
showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
showBookmarkButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
||||||
}`}
|
}`}
|
||||||
style={{
|
style={{
|
||||||
top: 'calc(1rem + env(safe-area-inset-top))',
|
top: 'calc(1rem + env(safe-area-inset-top))',
|
||||||
@@ -245,11 +269,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
</button>
|
</button>
|
||||||
)}
|
)}
|
||||||
|
|
||||||
{/* Mobile highlights button - only show when viewing article (not on settings/explore/me/profile) */}
|
{/* Mobile highlights button - only show when viewing article content */}
|
||||||
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showExplore && !props.showMe && !props.showProfile && (
|
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && isViewingArticle && (
|
||||||
<button
|
<button
|
||||||
className={`fixed z-[900] border border-zinc-600/40 rounded-lg flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
className={`fixed z-[900] border border-zinc-600/40 rounded-lg flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
||||||
showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
showHighlightsButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
||||||
}`}
|
}`}
|
||||||
style={{
|
style={{
|
||||||
top: 'calc(1rem + env(safe-area-inset-top))',
|
top: 'calc(1rem + env(safe-area-inset-top))',
|
||||||
@@ -299,8 +323,8 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
lastFetchTime={props.lastFetchTime}
|
lastFetchTime={props.lastFetchTime}
|
||||||
loading={props.bookmarksLoading}
|
loading={props.bookmarksLoading}
|
||||||
relayPool={props.relayPool}
|
relayPool={props.relayPool}
|
||||||
settings={props.settings}
|
|
||||||
isMobile={isMobile}
|
isMobile={isMobile}
|
||||||
|
settings={props.settings}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
<div
|
<div
|
||||||
@@ -329,6 +353,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
<>
|
<>
|
||||||
{props.profile}
|
{props.profile}
|
||||||
</>
|
</>
|
||||||
|
) : props.showSupport && props.support ? (
|
||||||
|
// Render Support inside the main pane to keep side panels
|
||||||
|
<>
|
||||||
|
{props.support}
|
||||||
|
</>
|
||||||
) : (
|
) : (
|
||||||
<ContentPanel
|
<ContentPanel
|
||||||
loading={props.readerLoading}
|
loading={props.readerLoading}
|
||||||
@@ -394,7 +423,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
)}
|
)}
|
||||||
<RelayStatusIndicator
|
<RelayStatusIndicator
|
||||||
relayPool={props.relayPool}
|
relayPool={props.relayPool}
|
||||||
showOnMobile={showMobileButtons}
|
showOnMobile={showBookmarkButton}
|
||||||
/>
|
/>
|
||||||
{props.toastMessage && (
|
{props.toastMessage && (
|
||||||
<Toast
|
<Toast
|
||||||
|
|||||||
32
src/components/VersionFooter.tsx
Normal file
32
src/components/VersionFooter.tsx
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
/* global __APP_VERSION__, __GIT_COMMIT__, __GIT_COMMIT_URL__, __RELEASE_URL__ */
|
||||||
|
import React from 'react'
|
||||||
|
|
||||||
|
const VersionFooter: React.FC = () => {
|
||||||
|
return (
|
||||||
|
<div className="text-xs opacity-60 mt-4 px-4 pb-3 select-text">
|
||||||
|
<span>
|
||||||
|
{typeof __RELEASE_URL__ !== 'undefined' && __RELEASE_URL__ ? (
|
||||||
|
<a href={__RELEASE_URL__} target="_blank" rel="noopener noreferrer">
|
||||||
|
Version {typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}
|
||||||
|
</a>
|
||||||
|
) : (
|
||||||
|
`Version ${typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}`
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
{typeof __GIT_COMMIT__ !== 'undefined' && __GIT_COMMIT__ ? (
|
||||||
|
<span>
|
||||||
|
{' '}·{' '}
|
||||||
|
{typeof __GIT_COMMIT_URL__ !== 'undefined' && __GIT_COMMIT_URL__ ? (
|
||||||
|
<a href={__GIT_COMMIT_URL__} target="_blank" rel="noopener noreferrer">
|
||||||
|
<code>{__GIT_COMMIT__.slice(0, 7)}</code>
|
||||||
|
</a>
|
||||||
|
) : (
|
||||||
|
<code>{__GIT_COMMIT__.slice(0, 7)}</code>
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
) : null}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default VersionFooter
|
||||||
15
src/config/kinds.ts
Normal file
15
src/config/kinds.ts
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
// Nostr event kinds used throughout the application
|
||||||
|
export const KINDS = {
|
||||||
|
Highlights: 9802, // NIP-?? user highlights
|
||||||
|
BlogPost: 30023, // NIP-23 long-form article
|
||||||
|
AppData: 30078, // NIP-78 application data (reading positions)
|
||||||
|
List: 30001, // NIP-51 list (addressable)
|
||||||
|
ListReplaceable: 30003, // NIP-51 replaceable list
|
||||||
|
ListSimple: 10003, // NIP-51 simple list
|
||||||
|
WebBookmark: 39701, // NIP-B0 web bookmark
|
||||||
|
ReactionToEvent: 7, // emoji reaction to event (used for mark-as-read)
|
||||||
|
ReactionToUrl: 17 // emoji reaction to URL (used for mark-as-read)
|
||||||
|
} as const
|
||||||
|
|
||||||
|
export type KindValue = typeof KINDS[keyof typeof KINDS]
|
||||||
|
|
||||||
12
src/config/network.ts
Normal file
12
src/config/network.ts
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
// Centralized network configuration for relay queries
|
||||||
|
// Keep timeouts modest for local-first, longer for remote; tweak per use-case
|
||||||
|
|
||||||
|
export const LOCAL_TIMEOUT_MS = 1200
|
||||||
|
export const REMOTE_TIMEOUT_MS = 6000
|
||||||
|
|
||||||
|
// Contacts often need a bit more time on mobile networks
|
||||||
|
export const CONTACTS_REMOTE_TIMEOUT_MS = 9000
|
||||||
|
|
||||||
|
// Future knobs could live here (e.g., max limits per kind)
|
||||||
|
|
||||||
|
|
||||||
@@ -2,20 +2,21 @@
|
|||||||
* Nostr gateway URLs for viewing events and profiles on the web
|
* Nostr gateway URLs for viewing events and profiles on the web
|
||||||
*/
|
*/
|
||||||
|
|
||||||
export const NOSTR_GATEWAY = 'https://ants.sh' as const
|
export const NOSTR_GATEWAY = 'https://nostr.at' as const
|
||||||
|
export const SEARCH_PORTAL = 'https://ants.sh' as const
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get a profile URL on the gateway
|
* Get a profile URL on the gateway
|
||||||
*/
|
*/
|
||||||
export function getProfileUrl(npub: string): string {
|
export function getProfileUrl(npub: string): string {
|
||||||
return `${NOSTR_GATEWAY}/p/${npub}`
|
return `${NOSTR_GATEWAY}/${npub}`
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get an event URL on the gateway
|
* Get an event URL on the gateway
|
||||||
*/
|
*/
|
||||||
export function getEventUrl(nevent: string): string {
|
export function getEventUrl(nevent: string): string {
|
||||||
return `${NOSTR_GATEWAY}/e/${nevent}`
|
return `${NOSTR_GATEWAY}/${nevent}`
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -23,12 +24,14 @@ export function getEventUrl(nevent: string): string {
|
|||||||
* Automatically detects if it's a profile (npub/nprofile) or event (note/nevent/naddr)
|
* Automatically detects if it's a profile (npub/nprofile) or event (note/nevent/naddr)
|
||||||
*/
|
*/
|
||||||
export function getNostrUrl(identifier: string): string {
|
export function getNostrUrl(identifier: string): string {
|
||||||
// Check the prefix to determine if it's a profile or event
|
// nostr.at uses simple /{identifier} format for all types
|
||||||
if (identifier.startsWith('npub') || identifier.startsWith('nprofile')) {
|
return `${NOSTR_GATEWAY}/${identifier}`
|
||||||
return `${NOSTR_GATEWAY}/p/${identifier}`
|
}
|
||||||
}
|
|
||||||
|
/**
|
||||||
// Everything else (note, nevent, naddr) goes to /e/
|
* Get a search portal URL with a query
|
||||||
return `${NOSTR_GATEWAY}/e/${identifier}`
|
*/
|
||||||
|
export function getSearchUrl(query: string): string {
|
||||||
|
return `${SEARCH_PORTAL}/?q=${encodeURIComponent(query)}`
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -7,6 +7,7 @@
|
|||||||
export const RELAYS = [
|
export const RELAYS = [
|
||||||
'ws://localhost:10547',
|
'ws://localhost:10547',
|
||||||
'ws://localhost:4869',
|
'ws://localhost:4869',
|
||||||
|
'wss://relay.nsec.app',
|
||||||
'wss://relay.damus.io',
|
'wss://relay.damus.io',
|
||||||
'wss://nos.lol',
|
'wss://nos.lol',
|
||||||
'wss://relay.nostr.band',
|
'wss://relay.nostr.band',
|
||||||
|
|||||||
90
src/hooks/useAdaptiveTextColor.ts
Normal file
90
src/hooks/useAdaptiveTextColor.ts
Normal file
@@ -0,0 +1,90 @@
|
|||||||
|
import { useEffect, useState } from 'react'
|
||||||
|
import { FastAverageColor } from 'fast-average-color'
|
||||||
|
|
||||||
|
interface AdaptiveTextColor {
|
||||||
|
textColor: string
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hook to determine optimal text color based on image background
|
||||||
|
* Samples the top-right corner of the image to ensure publication date is readable
|
||||||
|
*
|
||||||
|
* @param imageUrl - The URL of the image to analyze
|
||||||
|
* @returns Object containing textColor for optimal contrast
|
||||||
|
*/
|
||||||
|
export function useAdaptiveTextColor(imageUrl: string | undefined): AdaptiveTextColor {
|
||||||
|
const [colors, setColors] = useState<AdaptiveTextColor>({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
if (!imageUrl) {
|
||||||
|
// No image, use default white text
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
const fac = new FastAverageColor()
|
||||||
|
const img = new Image()
|
||||||
|
img.crossOrigin = 'anonymous'
|
||||||
|
|
||||||
|
img.onload = () => {
|
||||||
|
try {
|
||||||
|
const width = img.naturalWidth
|
||||||
|
const height = img.naturalHeight
|
||||||
|
|
||||||
|
// Sample top-right corner (last 25% width, first 25% height)
|
||||||
|
const color = fac.getColor(img, {
|
||||||
|
left: Math.floor(width * 0.75),
|
||||||
|
top: 0,
|
||||||
|
width: Math.floor(width * 0.25),
|
||||||
|
height: Math.floor(height * 0.25)
|
||||||
|
})
|
||||||
|
|
||||||
|
console.log('Adaptive color detected:', {
|
||||||
|
hex: color.hex,
|
||||||
|
rgb: color.rgb,
|
||||||
|
isLight: color.isLight,
|
||||||
|
isDark: color.isDark
|
||||||
|
})
|
||||||
|
|
||||||
|
// Use library's built-in isLight check for optimal contrast
|
||||||
|
if (color.isLight) {
|
||||||
|
console.log('Light background detected, using black text')
|
||||||
|
setColors({
|
||||||
|
textColor: '#000000'
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
console.log('Dark background detected, using white text')
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
// Fallback to default on error
|
||||||
|
console.error('Error analyzing image color:', error)
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
img.onerror = () => {
|
||||||
|
// Fallback to default if image fails to load
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
img.src = imageUrl
|
||||||
|
|
||||||
|
return () => {
|
||||||
|
fac.destroy()
|
||||||
|
}
|
||||||
|
}, [imageUrl])
|
||||||
|
|
||||||
|
return colors
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,5 +1,6 @@
|
|||||||
import { useState, useEffect, useCallback } from 'react'
|
import { useState, useEffect, useCallback } from 'react'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { IAccount, AccountManager } from 'applesauce-accounts'
|
||||||
import { Bookmark } from '../types/bookmarks'
|
import { Bookmark } from '../types/bookmarks'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { fetchBookmarks } from '../services/bookmarkService'
|
import { fetchBookmarks } from '../services/bookmarkService'
|
||||||
@@ -9,11 +10,10 @@ import { UserSettings } from '../services/settingsService'
|
|||||||
|
|
||||||
interface UseBookmarksDataParams {
|
interface UseBookmarksDataParams {
|
||||||
relayPool: RelayPool | null
|
relayPool: RelayPool | null
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
activeAccount: IAccount | undefined
|
||||||
activeAccount: any
|
accountManager: AccountManager
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
|
||||||
accountManager: any
|
|
||||||
naddr?: string
|
naddr?: string
|
||||||
|
externalUrl?: string
|
||||||
currentArticleCoordinate?: string
|
currentArticleCoordinate?: string
|
||||||
currentArticleEventId?: string
|
currentArticleEventId?: string
|
||||||
settings?: UserSettings
|
settings?: UserSettings
|
||||||
@@ -24,6 +24,7 @@ export const useBookmarksData = ({
|
|||||||
activeAccount,
|
activeAccount,
|
||||||
accountManager,
|
accountManager,
|
||||||
naddr,
|
naddr,
|
||||||
|
externalUrl,
|
||||||
currentArticleCoordinate,
|
currentArticleCoordinate,
|
||||||
currentArticleEventId,
|
currentArticleEventId,
|
||||||
settings
|
settings
|
||||||
@@ -116,11 +117,13 @@ export const useBookmarksData = ({
|
|||||||
// Fetch highlights/contacts independently to avoid disturbing bookmarks
|
// Fetch highlights/contacts independently to avoid disturbing bookmarks
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
if (!relayPool || !activeAccount) return
|
if (!relayPool || !activeAccount) return
|
||||||
if (!naddr) {
|
// Only fetch general highlights when not viewing an article (naddr) or external URL
|
||||||
|
// External URLs have their highlights fetched by useExternalUrlLoader
|
||||||
|
if (!naddr && !externalUrl) {
|
||||||
handleFetchHighlights()
|
handleFetchHighlights()
|
||||||
}
|
}
|
||||||
handleFetchContacts()
|
handleFetchContacts()
|
||||||
}, [relayPool, activeAccount, naddr, handleFetchHighlights, handleFetchContacts])
|
}, [relayPool, activeAccount, naddr, externalUrl, handleFetchHighlights, handleFetchContacts])
|
||||||
|
|
||||||
return {
|
return {
|
||||||
bookmarks,
|
bookmarks,
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
import { useState, useEffect } from 'react'
|
import { useState, useEffect, useCallback } from 'react'
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { HighlightVisibility } from '../components/HighlightsPanel'
|
import { HighlightVisibility } from '../components/HighlightsPanel'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
@@ -47,9 +47,9 @@ export const useBookmarksUI = ({ settings }: UseBookmarksUIParams) => {
|
|||||||
})
|
})
|
||||||
}, [settings])
|
}, [settings])
|
||||||
|
|
||||||
const toggleSidebar = () => {
|
const toggleSidebar = useCallback(() => {
|
||||||
setIsSidebarOpen(prev => !prev)
|
setIsSidebarOpen(prev => !prev)
|
||||||
}
|
}, [])
|
||||||
|
|
||||||
return {
|
return {
|
||||||
isMobile,
|
isMobile,
|
||||||
|
|||||||
@@ -71,7 +71,7 @@ export function useExternalUrlLoader({
|
|||||||
// Check if fetchHighlightsForUrl exists, otherwise skip
|
// Check if fetchHighlightsForUrl exists, otherwise skip
|
||||||
if (typeof fetchHighlightsForUrl === 'function') {
|
if (typeof fetchHighlightsForUrl === 'function') {
|
||||||
const seen = new Set<string>()
|
const seen = new Set<string>()
|
||||||
const highlightsList = await fetchHighlightsForUrl(
|
await fetchHighlightsForUrl(
|
||||||
relayPool,
|
relayPool,
|
||||||
url,
|
url,
|
||||||
(highlight) => {
|
(highlight) => {
|
||||||
@@ -84,9 +84,9 @@ export function useExternalUrlLoader({
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
// Ensure final list is sorted and contains all items
|
// Highlights are already set via the streaming callback
|
||||||
setHighlights(highlightsList.sort((a, b) => b.created_at - a.created_at))
|
// No need to set them again as that could cause a flash/disappearance
|
||||||
console.log(`📌 Found ${highlightsList.length} highlights for URL`)
|
console.log(`📌 Finished fetching highlights for URL`)
|
||||||
} else {
|
} else {
|
||||||
console.log('📌 Highlight fetching for URLs not yet implemented')
|
console.log('📌 Highlight fetching for URLs not yet implemented')
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -3,15 +3,16 @@ import { flushSync } from 'react-dom'
|
|||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { IEventStore } from 'applesauce-core'
|
import { IEventStore } from 'applesauce-core'
|
||||||
|
import { IAccount } from 'applesauce-accounts'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { ReadableContent } from '../services/readerService'
|
import { ReadableContent } from '../services/readerService'
|
||||||
import { createHighlight } from '../services/highlightCreationService'
|
import { createHighlight } from '../services/highlightCreationService'
|
||||||
import { HighlightButtonRef } from '../components/HighlightButton'
|
import { HighlightButtonRef } from '../components/HighlightButton'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
|
import { useToast } from './useToast'
|
||||||
|
|
||||||
interface UseHighlightCreationParams {
|
interface UseHighlightCreationParams {
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
activeAccount: IAccount | undefined
|
||||||
activeAccount: any
|
|
||||||
relayPool: RelayPool | null
|
relayPool: RelayPool | null
|
||||||
eventStore: IEventStore | null
|
eventStore: IEventStore | null
|
||||||
currentArticle: NostrEvent | undefined
|
currentArticle: NostrEvent | undefined
|
||||||
@@ -32,6 +33,7 @@ export const useHighlightCreation = ({
|
|||||||
settings
|
settings
|
||||||
}: UseHighlightCreationParams) => {
|
}: UseHighlightCreationParams) => {
|
||||||
const highlightButtonRef = useRef<HighlightButtonRef>(null)
|
const highlightButtonRef = useRef<HighlightButtonRef>(null)
|
||||||
|
const { showToast } = useToast()
|
||||||
|
|
||||||
const handleTextSelection = useCallback((text: string) => {
|
const handleTextSelection = useCallback((text: string) => {
|
||||||
highlightButtonRef.current?.updateSelection(text)
|
highlightButtonRef.current?.updateSelection(text)
|
||||||
@@ -92,10 +94,19 @@ export const useHighlightCreation = ({
|
|||||||
})
|
})
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('❌ Failed to create highlight:', error)
|
console.error('❌ Failed to create highlight:', error)
|
||||||
|
|
||||||
|
// Show user-friendly error messages
|
||||||
|
const errorMessage = error instanceof Error ? error.message : 'Failed to create highlight'
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
showToast('Reconnect bunker and approve signing permissions to create highlights')
|
||||||
|
} else {
|
||||||
|
showToast(`Failed to create highlight: ${errorMessage}`)
|
||||||
|
}
|
||||||
|
|
||||||
// Re-throw to allow parent to handle
|
// Re-throw to allow parent to handle
|
||||||
throw error
|
throw error
|
||||||
}
|
}
|
||||||
}, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings])
|
}, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings, showToast])
|
||||||
|
|
||||||
return {
|
return {
|
||||||
highlightButtonRef,
|
highlightButtonRef,
|
||||||
|
|||||||
@@ -1,5 +1,3 @@
|
|||||||
import { UserSettings } from '../services/settingsService'
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Hook to return image URL for display
|
* Hook to return image URL for display
|
||||||
* Service Worker handles all caching transparently
|
* Service Worker handles all caching transparently
|
||||||
@@ -9,9 +7,7 @@ import { UserSettings } from '../services/settingsService'
|
|||||||
* @returns The image URL (Service Worker handles caching)
|
* @returns The image URL (Service Worker handles caching)
|
||||||
*/
|
*/
|
||||||
export function useImageCache(
|
export function useImageCache(
|
||||||
imageUrl: string | undefined,
|
imageUrl: string | undefined
|
||||||
// eslint-disable-next-line no-unused-vars
|
|
||||||
_settings?: UserSettings
|
|
||||||
): string | undefined {
|
): string | undefined {
|
||||||
// Service Worker handles everything - just return the URL as-is
|
// Service Worker handles everything - just return the URL as-is
|
||||||
return imageUrl
|
return imageUrl
|
||||||
@@ -22,9 +18,7 @@ export function useImageCache(
|
|||||||
* Triggers a fetch so the SW can cache it even if not visible yet
|
* Triggers a fetch so the SW can cache it even if not visible yet
|
||||||
*/
|
*/
|
||||||
export function useCacheImageOnLoad(
|
export function useCacheImageOnLoad(
|
||||||
imageUrl: string | undefined,
|
imageUrl: string | undefined
|
||||||
// eslint-disable-next-line no-unused-vars
|
|
||||||
_settings?: UserSettings
|
|
||||||
): void {
|
): void {
|
||||||
// Service Worker will cache on first fetch
|
// Service Worker will cache on first fetch
|
||||||
// This hook is now a no-op, kept for API compatibility
|
// This hook is now a no-op, kept for API compatibility
|
||||||
|
|||||||
@@ -1,153 +0,0 @@
|
|||||||
import { useEffect, useRef, useState, RefObject } from 'react'
|
|
||||||
import { useIsCoarsePointer } from './useMediaQuery'
|
|
||||||
|
|
||||||
interface UsePullToRefreshOptions {
|
|
||||||
onRefresh: () => void | Promise<void>
|
|
||||||
isRefreshing?: boolean
|
|
||||||
disabled?: boolean
|
|
||||||
threshold?: number // Distance in pixels to trigger refresh
|
|
||||||
resistance?: number // Resistance factor (higher = harder to pull)
|
|
||||||
}
|
|
||||||
|
|
||||||
interface PullToRefreshState {
|
|
||||||
isPulling: boolean
|
|
||||||
pullDistance: number
|
|
||||||
canRefresh: boolean
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Hook to enable pull-to-refresh gesture on touch devices
|
|
||||||
* @param containerRef - Ref to the scrollable container element
|
|
||||||
* @param options - Configuration options
|
|
||||||
* @returns State of the pull gesture
|
|
||||||
*/
|
|
||||||
export function usePullToRefresh(
|
|
||||||
containerRef: RefObject<HTMLElement>,
|
|
||||||
options: UsePullToRefreshOptions
|
|
||||||
): PullToRefreshState {
|
|
||||||
const {
|
|
||||||
onRefresh,
|
|
||||||
isRefreshing = false,
|
|
||||||
disabled = false,
|
|
||||||
threshold = 80,
|
|
||||||
resistance = 2.5
|
|
||||||
} = options
|
|
||||||
|
|
||||||
const isTouch = useIsCoarsePointer()
|
|
||||||
const [pullState, setPullState] = useState<PullToRefreshState>({
|
|
||||||
isPulling: false,
|
|
||||||
pullDistance: 0,
|
|
||||||
canRefresh: false
|
|
||||||
})
|
|
||||||
|
|
||||||
const touchStartY = useRef<number>(0)
|
|
||||||
const startScrollTop = useRef<number>(0)
|
|
||||||
const isDragging = useRef<boolean>(false)
|
|
||||||
|
|
||||||
useEffect(() => {
|
|
||||||
const container = containerRef.current
|
|
||||||
if (!container || !isTouch || disabled || isRefreshing) return
|
|
||||||
|
|
||||||
const handleTouchStart = (e: TouchEvent) => {
|
|
||||||
// Only start if scrolled to top
|
|
||||||
const scrollTop = container.scrollTop
|
|
||||||
if (scrollTop <= 0) {
|
|
||||||
touchStartY.current = e.touches[0].clientY
|
|
||||||
startScrollTop.current = scrollTop
|
|
||||||
isDragging.current = true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleTouchMove = (e: TouchEvent) => {
|
|
||||||
if (!isDragging.current) return
|
|
||||||
|
|
||||||
const currentY = e.touches[0].clientY
|
|
||||||
const deltaY = currentY - touchStartY.current
|
|
||||||
const scrollTop = container.scrollTop
|
|
||||||
|
|
||||||
// Only pull down when at top and pulling down
|
|
||||||
if (scrollTop <= 0 && deltaY > 0) {
|
|
||||||
// Prevent default scroll behavior
|
|
||||||
e.preventDefault()
|
|
||||||
|
|
||||||
// Apply resistance to make pulling feel natural
|
|
||||||
const distance = Math.min(deltaY / resistance, threshold * 1.5)
|
|
||||||
const canRefresh = distance >= threshold
|
|
||||||
|
|
||||||
setPullState({
|
|
||||||
isPulling: true,
|
|
||||||
pullDistance: distance,
|
|
||||||
canRefresh
|
|
||||||
})
|
|
||||||
} else {
|
|
||||||
// Reset if scrolled or pulling up
|
|
||||||
isDragging.current = false
|
|
||||||
setPullState({
|
|
||||||
isPulling: false,
|
|
||||||
pullDistance: 0,
|
|
||||||
canRefresh: false
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleTouchEnd = async () => {
|
|
||||||
if (!isDragging.current) return
|
|
||||||
|
|
||||||
isDragging.current = false
|
|
||||||
|
|
||||||
if (pullState.canRefresh && !isRefreshing) {
|
|
||||||
// Keep the indicator visible while refreshing
|
|
||||||
setPullState(prev => ({
|
|
||||||
...prev,
|
|
||||||
isPulling: false
|
|
||||||
}))
|
|
||||||
|
|
||||||
// Trigger refresh
|
|
||||||
await onRefresh()
|
|
||||||
}
|
|
||||||
|
|
||||||
// Reset state
|
|
||||||
setPullState({
|
|
||||||
isPulling: false,
|
|
||||||
pullDistance: 0,
|
|
||||||
canRefresh: false
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleTouchCancel = () => {
|
|
||||||
isDragging.current = false
|
|
||||||
setPullState({
|
|
||||||
isPulling: false,
|
|
||||||
pullDistance: 0,
|
|
||||||
canRefresh: false
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
// Add event listeners with passive: false to allow preventDefault
|
|
||||||
container.addEventListener('touchstart', handleTouchStart, { passive: true })
|
|
||||||
container.addEventListener('touchmove', handleTouchMove, { passive: false })
|
|
||||||
container.addEventListener('touchend', handleTouchEnd, { passive: true })
|
|
||||||
container.addEventListener('touchcancel', handleTouchCancel, { passive: true })
|
|
||||||
|
|
||||||
return () => {
|
|
||||||
container.removeEventListener('touchstart', handleTouchStart)
|
|
||||||
container.removeEventListener('touchmove', handleTouchMove)
|
|
||||||
container.removeEventListener('touchend', handleTouchEnd)
|
|
||||||
container.removeEventListener('touchcancel', handleTouchCancel)
|
|
||||||
}
|
|
||||||
}, [containerRef, isTouch, disabled, isRefreshing, threshold, resistance, onRefresh, pullState.canRefresh])
|
|
||||||
|
|
||||||
// Reset pull state when refresh completes
|
|
||||||
useEffect(() => {
|
|
||||||
if (!isRefreshing && pullState.isPulling) {
|
|
||||||
setPullState({
|
|
||||||
isPulling: false,
|
|
||||||
pullDistance: 0,
|
|
||||||
canRefresh: false
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}, [isRefreshing, pullState.isPulling])
|
|
||||||
|
|
||||||
return pullState
|
|
||||||
}
|
|
||||||
|
|
||||||
@@ -1,21 +1,72 @@
|
|||||||
import { useEffect, useRef, useState } from 'react'
|
import { useEffect, useRef, useState, useCallback } from 'react'
|
||||||
|
|
||||||
interface UseReadingPositionOptions {
|
interface UseReadingPositionOptions {
|
||||||
enabled?: boolean
|
enabled?: boolean
|
||||||
onPositionChange?: (position: number) => void
|
onPositionChange?: (position: number) => void
|
||||||
onReadingComplete?: () => void
|
onReadingComplete?: () => void
|
||||||
readingCompleteThreshold?: number // Default 0.9 (90%)
|
readingCompleteThreshold?: number // Default 0.9 (90%)
|
||||||
|
syncEnabled?: boolean // Whether to sync positions to Nostr
|
||||||
|
onSave?: (position: number) => void // Callback for saving position
|
||||||
|
autoSaveInterval?: number // Auto-save interval in ms (default 5000)
|
||||||
}
|
}
|
||||||
|
|
||||||
export const useReadingPosition = ({
|
export const useReadingPosition = ({
|
||||||
enabled = true,
|
enabled = true,
|
||||||
onPositionChange,
|
onPositionChange,
|
||||||
onReadingComplete,
|
onReadingComplete,
|
||||||
readingCompleteThreshold = 0.9
|
readingCompleteThreshold = 0.9,
|
||||||
|
syncEnabled = false,
|
||||||
|
onSave,
|
||||||
|
autoSaveInterval = 5000
|
||||||
}: UseReadingPositionOptions = {}) => {
|
}: UseReadingPositionOptions = {}) => {
|
||||||
const [position, setPosition] = useState(0)
|
const [position, setPosition] = useState(0)
|
||||||
const [isReadingComplete, setIsReadingComplete] = useState(false)
|
const [isReadingComplete, setIsReadingComplete] = useState(false)
|
||||||
const hasTriggeredComplete = useRef(false)
|
const hasTriggeredComplete = useRef(false)
|
||||||
|
const lastSavedPosition = useRef(0)
|
||||||
|
const saveTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
|
||||||
|
|
||||||
|
// Debounced save function
|
||||||
|
const scheduleSave = useCallback((currentPosition: number) => {
|
||||||
|
if (!syncEnabled || !onSave) return
|
||||||
|
|
||||||
|
// Don't save if position is too low (< 5%)
|
||||||
|
if (currentPosition < 0.05) return
|
||||||
|
|
||||||
|
// Don't save if position hasn't changed significantly (less than 1%)
|
||||||
|
// But always save if we've reached 100% (completion)
|
||||||
|
const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= 0.01
|
||||||
|
const hasReachedCompletion = currentPosition === 1 && lastSavedPosition.current < 1
|
||||||
|
|
||||||
|
if (!hasSignificantChange && !hasReachedCompletion) return
|
||||||
|
|
||||||
|
// Clear existing timer
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Schedule new save
|
||||||
|
saveTimerRef.current = setTimeout(() => {
|
||||||
|
lastSavedPosition.current = currentPosition
|
||||||
|
onSave(currentPosition)
|
||||||
|
}, autoSaveInterval)
|
||||||
|
}, [syncEnabled, onSave, autoSaveInterval])
|
||||||
|
|
||||||
|
// Immediate save function
|
||||||
|
const saveNow = useCallback(() => {
|
||||||
|
if (!syncEnabled || !onSave) return
|
||||||
|
|
||||||
|
// Cancel any pending saves
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
saveTimerRef.current = null
|
||||||
|
}
|
||||||
|
|
||||||
|
// Save if position is meaningful (>= 5%)
|
||||||
|
if (position >= 0.05) {
|
||||||
|
lastSavedPosition.current = position
|
||||||
|
onSave(position)
|
||||||
|
}
|
||||||
|
}, [syncEnabled, onSave, position])
|
||||||
|
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
if (!enabled) return
|
if (!enabled) return
|
||||||
@@ -30,12 +81,20 @@ export const useReadingPosition = ({
|
|||||||
const documentHeight = document.documentElement.scrollHeight
|
const documentHeight = document.documentElement.scrollHeight
|
||||||
|
|
||||||
// Calculate position based on how much of the content has been scrolled through
|
// Calculate position based on how much of the content has been scrolled through
|
||||||
const scrollProgress = Math.min(scrollTop / (documentHeight - windowHeight), 1)
|
// Add a small threshold (5px) to account for rounding and make it easier to reach 100%
|
||||||
const clampedProgress = Math.max(0, Math.min(1, scrollProgress))
|
const maxScroll = documentHeight - windowHeight
|
||||||
|
const scrollProgress = maxScroll > 0 ? scrollTop / maxScroll : 0
|
||||||
|
|
||||||
|
// If we're within 5px of the bottom, consider it 100%
|
||||||
|
const isAtBottom = scrollTop + windowHeight >= documentHeight - 5
|
||||||
|
const clampedProgress = isAtBottom ? 1 : Math.max(0, Math.min(1, scrollProgress))
|
||||||
|
|
||||||
setPosition(clampedProgress)
|
setPosition(clampedProgress)
|
||||||
onPositionChange?.(clampedProgress)
|
onPositionChange?.(clampedProgress)
|
||||||
|
|
||||||
|
// Schedule auto-save if sync is enabled
|
||||||
|
scheduleSave(clampedProgress)
|
||||||
|
|
||||||
// Check if reading is complete
|
// Check if reading is complete
|
||||||
if (clampedProgress >= readingCompleteThreshold && !hasTriggeredComplete.current) {
|
if (clampedProgress >= readingCompleteThreshold && !hasTriggeredComplete.current) {
|
||||||
setIsReadingComplete(true)
|
setIsReadingComplete(true)
|
||||||
@@ -54,8 +113,13 @@ export const useReadingPosition = ({
|
|||||||
return () => {
|
return () => {
|
||||||
window.removeEventListener('scroll', handleScroll)
|
window.removeEventListener('scroll', handleScroll)
|
||||||
window.removeEventListener('resize', handleScroll)
|
window.removeEventListener('resize', handleScroll)
|
||||||
|
|
||||||
|
// Clear save timer on unmount
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold])
|
}, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave])
|
||||||
|
|
||||||
// Reset reading complete state when enabled changes
|
// Reset reading complete state when enabled changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -68,6 +132,7 @@ export const useReadingPosition = ({
|
|||||||
return {
|
return {
|
||||||
position,
|
position,
|
||||||
isReadingComplete,
|
isReadingComplete,
|
||||||
progressPercentage: Math.round(position * 100)
|
progressPercentage: Math.round(position * 100),
|
||||||
|
saveNow
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -73,6 +73,9 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
|
|||||||
root.setProperty('--highlight-color-friends', settings.highlightColorFriends || '#f97316')
|
root.setProperty('--highlight-color-friends', settings.highlightColorFriends || '#f97316')
|
||||||
root.setProperty('--highlight-color-nostrverse', settings.highlightColorNostrverse || '#9333ea')
|
root.setProperty('--highlight-color-nostrverse', settings.highlightColorNostrverse || '#9333ea')
|
||||||
|
|
||||||
|
// Set paragraph alignment
|
||||||
|
root.setProperty('--paragraph-alignment', settings.paragraphAlignment || 'justify')
|
||||||
|
|
||||||
console.log('✅ All styles applied')
|
console.log('✅ All styles applied')
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -85,7 +88,7 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
|
|||||||
const fullAccount = accountManager.getActive()
|
const fullAccount = accountManager.getActive()
|
||||||
if (!fullAccount) throw new Error('No active account')
|
if (!fullAccount) throw new Error('No active account')
|
||||||
const factory = new EventFactory({ signer: fullAccount })
|
const factory = new EventFactory({ signer: fullAccount })
|
||||||
await saveSettings(relayPool, eventStore, factory, newSettings, RELAYS)
|
await saveSettings(relayPool, eventStore, factory, newSettings)
|
||||||
setSettings(newSettings)
|
setSettings(newSettings)
|
||||||
setToastType('success')
|
setToastType('success')
|
||||||
setToastMessage('Settings saved')
|
setToastMessage('Settings saved')
|
||||||
|
|||||||
@@ -19,7 +19,7 @@ export function dedupeNip51Events(events: NostrEvent[]): NostrEvent[] {
|
|||||||
const webBookmarks = unique.filter(e => e.kind === 39701)
|
const webBookmarks = unique.filter(e => e.kind === 39701)
|
||||||
|
|
||||||
const bookmarkLists = unique
|
const bookmarkLists = unique
|
||||||
.filter(e => e.kind === 10003 || e.kind === 30001)
|
.filter(e => e.kind === 10003 || e.kind === 30003 || e.kind === 30001)
|
||||||
.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
|
.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
|
||||||
const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
|
const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
|
||||||
|
|
||||||
|
|||||||
@@ -16,11 +16,24 @@ export interface BookmarkData {
|
|||||||
tags?: string[][]
|
tags?: string[][]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
export interface AddressPointer {
|
||||||
|
kind: number
|
||||||
|
pubkey: string
|
||||||
|
identifier: string
|
||||||
|
relays?: string[]
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface EventPointer {
|
||||||
|
id: string
|
||||||
|
relays?: string[]
|
||||||
|
author?: string
|
||||||
|
}
|
||||||
|
|
||||||
export interface ApplesauceBookmarks {
|
export interface ApplesauceBookmarks {
|
||||||
notes?: BookmarkData[]
|
notes?: EventPointer[]
|
||||||
articles?: BookmarkData[]
|
articles?: AddressPointer[]
|
||||||
hashtags?: BookmarkData[]
|
hashtags?: string[]
|
||||||
urls?: BookmarkData[]
|
urls?: string[]
|
||||||
}
|
}
|
||||||
|
|
||||||
export interface AccountWithExtension {
|
export interface AccountWithExtension {
|
||||||
@@ -55,25 +68,83 @@ export const processApplesauceBookmarks = (
|
|||||||
|
|
||||||
if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
|
if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
|
||||||
const applesauceBookmarks = bookmarks as ApplesauceBookmarks
|
const applesauceBookmarks = bookmarks as ApplesauceBookmarks
|
||||||
const allItems: BookmarkData[] = []
|
const allItems: IndividualBookmark[] = []
|
||||||
if (applesauceBookmarks.notes) allItems.push(...applesauceBookmarks.notes)
|
|
||||||
if (applesauceBookmarks.articles) allItems.push(...applesauceBookmarks.articles)
|
// Process notes (EventPointer[])
|
||||||
if (applesauceBookmarks.hashtags) allItems.push(...applesauceBookmarks.hashtags)
|
if (applesauceBookmarks.notes) {
|
||||||
if (applesauceBookmarks.urls) allItems.push(...applesauceBookmarks.urls)
|
applesauceBookmarks.notes.forEach((note: EventPointer) => {
|
||||||
|
allItems.push({
|
||||||
|
id: note.id,
|
||||||
|
content: '',
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: note.author || activeAccount.pubkey,
|
||||||
|
kind: 1, // Short note kind
|
||||||
|
tags: [],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process articles (AddressPointer[])
|
||||||
|
if (applesauceBookmarks.articles) {
|
||||||
|
applesauceBookmarks.articles.forEach((article: AddressPointer) => {
|
||||||
|
// Convert AddressPointer to coordinate format: kind:pubkey:identifier
|
||||||
|
const coordinate = `${article.kind}:${article.pubkey}:${article.identifier || ''}`
|
||||||
|
allItems.push({
|
||||||
|
id: coordinate,
|
||||||
|
content: '',
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: article.pubkey,
|
||||||
|
kind: article.kind, // Usually 30023 for long-form articles
|
||||||
|
tags: [],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process hashtags (string[])
|
||||||
|
if (applesauceBookmarks.hashtags) {
|
||||||
|
applesauceBookmarks.hashtags.forEach((hashtag: string) => {
|
||||||
|
allItems.push({
|
||||||
|
id: `hashtag-${hashtag}`,
|
||||||
|
content: `#${hashtag}`,
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: activeAccount.pubkey,
|
||||||
|
kind: 1,
|
||||||
|
tags: [['t', hashtag]],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process URLs (string[])
|
||||||
|
if (applesauceBookmarks.urls) {
|
||||||
|
applesauceBookmarks.urls.forEach((url: string) => {
|
||||||
|
allItems.push({
|
||||||
|
id: `url-${url}`,
|
||||||
|
content: url,
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: activeAccount.pubkey,
|
||||||
|
kind: 1,
|
||||||
|
tags: [['r', url]],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
return allItems
|
return allItems
|
||||||
.filter((bookmark: BookmarkData) => bookmark.id) // Skip bookmarks without valid IDs
|
|
||||||
.map((bookmark: BookmarkData) => ({
|
|
||||||
id: bookmark.id!,
|
|
||||||
content: bookmark.content || '',
|
|
||||||
created_at: bookmark.created_at || Math.floor(Date.now() / 1000),
|
|
||||||
pubkey: activeAccount.pubkey,
|
|
||||||
kind: bookmark.kind || 30001,
|
|
||||||
tags: bookmark.tags || [],
|
|
||||||
parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
|
|
||||||
type: 'event' as const,
|
|
||||||
isPrivate,
|
|
||||||
added_at: bookmark.created_at || Math.floor(Date.now() / 1000)
|
|
||||||
}))
|
|
||||||
}
|
}
|
||||||
|
|
||||||
const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]
|
const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]
|
||||||
|
|||||||
@@ -11,6 +11,18 @@ type UnlockHiddenTagsFn = typeof Helpers.unlockHiddenTags
|
|||||||
type HiddenContentSigner = Parameters<UnlockHiddenTagsFn>[1]
|
type HiddenContentSigner = Parameters<UnlockHiddenTagsFn>[1]
|
||||||
type UnlockMode = Parameters<UnlockHiddenTagsFn>[2]
|
type UnlockMode = Parameters<UnlockHiddenTagsFn>[2]
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrap a decrypt promise with a timeout to prevent hanging (using 30s timeout for bunker)
|
||||||
|
*/
|
||||||
|
function withDecryptTimeout<T>(promise: Promise<T>, timeoutMs = 30000): Promise<T> {
|
||||||
|
return Promise.race([
|
||||||
|
promise,
|
||||||
|
new Promise<T>((_, reject) =>
|
||||||
|
setTimeout(() => reject(new Error(`Decrypt timeout after ${timeoutMs}ms`)), timeoutMs)
|
||||||
|
)
|
||||||
|
])
|
||||||
|
}
|
||||||
|
|
||||||
export async function collectBookmarksFromEvents(
|
export async function collectBookmarksFromEvents(
|
||||||
bookmarkListEvents: NostrEvent[],
|
bookmarkListEvents: NostrEvent[],
|
||||||
activeAccount: ActiveAccount,
|
activeAccount: ActiveAccount,
|
||||||
@@ -33,6 +45,12 @@ export async function collectBookmarksFromEvents(
|
|||||||
if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
|
if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
|
||||||
if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
|
if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
|
||||||
|
|
||||||
|
// Extract the 'd' tag and metadata for bookmark sets (kind 30003)
|
||||||
|
const dTag = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] : undefined
|
||||||
|
const setTitle = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'title')?.[1] : undefined
|
||||||
|
const setDescription = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'description')?.[1] : undefined
|
||||||
|
const setImage = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'image')?.[1] : undefined
|
||||||
|
|
||||||
// Handle web bookmarks (kind:39701) as individual bookmarks
|
// Handle web bookmarks (kind:39701) as individual bookmarks
|
||||||
if (evt.kind === 39701) {
|
if (evt.kind === 39701) {
|
||||||
publicItemsAll.push({
|
publicItemsAll.push({
|
||||||
@@ -45,13 +63,27 @@ export async function collectBookmarksFromEvents(
|
|||||||
parsedContent: undefined,
|
parsedContent: undefined,
|
||||||
type: 'web' as const,
|
type: 'web' as const,
|
||||||
isPrivate: false,
|
isPrivate: false,
|
||||||
added_at: evt.created_at || Math.floor(Date.now() / 1000)
|
added_at: evt.created_at || Math.floor(Date.now() / 1000),
|
||||||
|
sourceKind: 39701,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
})
|
})
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
const pub = Helpers.getPublicBookmarks(evt)
|
const pub = Helpers.getPublicBookmarks(evt)
|
||||||
publicItemsAll.push(...processApplesauceBookmarks(pub, activeAccount, false))
|
publicItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(pub, activeAccount, false).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
|
|
||||||
try {
|
try {
|
||||||
if (Helpers.hasHiddenTags(evt) && !Helpers.isHiddenTagsUnlocked(evt) && signerCandidate) {
|
if (Helpers.hasHiddenTags(evt) && !Helpers.isHiddenTagsUnlocked(evt) && signerCandidate) {
|
||||||
@@ -60,7 +92,8 @@ export async function collectBookmarksFromEvents(
|
|||||||
} catch {
|
} catch {
|
||||||
try {
|
try {
|
||||||
await Helpers.unlockHiddenTags(evt, signerCandidate as HiddenContentSigner, 'nip44' as UnlockMode)
|
await Helpers.unlockHiddenTags(evt, signerCandidate as HiddenContentSigner, 'nip44' as UnlockMode)
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -68,24 +101,26 @@ export async function collectBookmarksFromEvents(
|
|||||||
let decryptedContent: string | undefined
|
let decryptedContent: string | undefined
|
||||||
try {
|
try {
|
||||||
if (hasNip44Decrypt(signerCandidate)) {
|
if (hasNip44Decrypt(signerCandidate)) {
|
||||||
decryptedContent = await (signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
|
decryptedContent = await withDecryptTimeout((signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
|
||||||
evt.pubkey,
|
evt.pubkey,
|
||||||
evt.content
|
evt.content
|
||||||
)
|
))
|
||||||
}
|
}
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!decryptedContent) {
|
if (!decryptedContent) {
|
||||||
try {
|
try {
|
||||||
if (hasNip04Decrypt(signerCandidate)) {
|
if (hasNip04Decrypt(signerCandidate)) {
|
||||||
decryptedContent = await (signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
|
decryptedContent = await withDecryptTimeout((signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
|
||||||
evt.pubkey,
|
evt.pubkey,
|
||||||
evt.content
|
evt.content
|
||||||
)
|
))
|
||||||
}
|
}
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip04.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -94,11 +129,20 @@ export async function collectBookmarksFromEvents(
|
|||||||
try {
|
try {
|
||||||
const hiddenTags = JSON.parse(decryptedContent) as string[][]
|
const hiddenTags = JSON.parse(decryptedContent) as string[][]
|
||||||
const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
|
const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
|
||||||
privateItemsAll.push(...processApplesauceBookmarks(manualPrivate, activeAccount, true))
|
privateItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(manualPrivate, activeAccount, true).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
Reflect.set(evt, BookmarkHiddenSymbol, manualPrivate)
|
Reflect.set(evt, BookmarkHiddenSymbol, manualPrivate)
|
||||||
Reflect.set(evt, 'EncryptedContentSymbol', decryptedContent)
|
Reflect.set(evt, 'EncryptedContentSymbol', decryptedContent)
|
||||||
// Don't set latestContent to decrypted JSON - it's not user-facing content
|
// Don't set latestContent to decrypted JSON - it's not user-facing content
|
||||||
} catch {
|
} catch (err) {
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -106,7 +150,16 @@ export async function collectBookmarksFromEvents(
|
|||||||
|
|
||||||
const priv = Helpers.getHiddenBookmarks(evt)
|
const priv = Helpers.getHiddenBookmarks(evt)
|
||||||
if (priv) {
|
if (priv) {
|
||||||
privateItemsAll.push(...processApplesauceBookmarks(priv, activeAccount, true))
|
privateItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(priv, activeAccount, true).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
}
|
}
|
||||||
} catch {
|
} catch {
|
||||||
// ignore individual event failures
|
// ignore individual event failures
|
||||||
|
|||||||
@@ -1,12 +1,10 @@
|
|||||||
import { RelayPool, completeOnEose } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
|
||||||
import {
|
import {
|
||||||
AccountWithExtension,
|
AccountWithExtension,
|
||||||
NostrEvent,
|
NostrEvent,
|
||||||
dedupeNip51Events,
|
dedupeNip51Events,
|
||||||
hydrateItems,
|
hydrateItems,
|
||||||
isAccountWithExtension,
|
isAccountWithExtension,
|
||||||
isHexId,
|
|
||||||
hasNip04Decrypt,
|
hasNip04Decrypt,
|
||||||
hasNip44Decrypt,
|
hasNip44Decrypt,
|
||||||
dedupeBookmarksById,
|
dedupeBookmarksById,
|
||||||
@@ -16,7 +14,8 @@ import { Bookmark } from '../types/bookmarks'
|
|||||||
import { collectBookmarksFromEvents } from './bookmarkProcessing.ts'
|
import { collectBookmarksFromEvents } from './bookmarkProcessing.ts'
|
||||||
import { UserSettings } from './settingsService'
|
import { UserSettings } from './settingsService'
|
||||||
import { rebroadcastEvents } from './rebroadcastService'
|
import { rebroadcastEvents } from './rebroadcastService'
|
||||||
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -31,23 +30,14 @@ export const fetchBookmarks = async (
|
|||||||
if (!isAccountWithExtension(activeAccount)) {
|
if (!isAccountWithExtension(activeAccount)) {
|
||||||
throw new Error('Invalid account object provided')
|
throw new Error('Invalid account object provided')
|
||||||
}
|
}
|
||||||
// Get relay URLs from the pool
|
|
||||||
const relayUrls = prioritizeLocalRelays(Array.from(relayPool.relays.values()).map(relay => relay.url))
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(relayUrls)
|
|
||||||
// Fetch bookmark events - NIP-51 standards, legacy formats, and web bookmarks (NIP-B0)
|
// Fetch bookmark events - NIP-51 standards, legacy formats, and web bookmarks (NIP-B0)
|
||||||
console.log('🔍 Fetching bookmark events from relays:', relayUrls)
|
console.log('🔍 Fetching bookmark events')
|
||||||
// Try local-first quickly, then full set fallback
|
|
||||||
const local$ = localRelays.length > 0
|
const rawEvents = await queryEvents(
|
||||||
? relayPool
|
relayPool,
|
||||||
.req(localRelays, { kinds: [10003, 30003, 30001, 39701], authors: [activeAccount.pubkey] })
|
{ kinds: [KINDS.ListSimple, KINDS.ListReplaceable, KINDS.List, KINDS.WebBookmark], authors: [activeAccount.pubkey] },
|
||||||
.pipe(completeOnEose(), takeUntil(timer(1200)))
|
{}
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
)
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [10003, 30003, 30001, 39701], authors: [activeAccount.pubkey] })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(6000)))
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
const rawEvents = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
|
||||||
console.log('📊 Raw events fetched:', rawEvents.length, 'events')
|
console.log('📊 Raw events fetched:', rawEvents.length, 'events')
|
||||||
|
|
||||||
// Rebroadcast bookmark events to local/all relays based on settings
|
// Rebroadcast bookmark events to local/all relays based on settings
|
||||||
@@ -67,18 +57,35 @@ export const fetchBookmarks = async (
|
|||||||
rawEvents.forEach((evt, i) => {
|
rawEvents.forEach((evt, i) => {
|
||||||
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
||||||
const contentPreview = evt.content ? evt.content.slice(0, 50) + (evt.content.length > 50 ? '...' : '') : 'empty'
|
const contentPreview = evt.content ? evt.content.slice(0, 50) + (evt.content.length > 50 ? '...' : '') : 'empty'
|
||||||
console.log(` Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, contentPreview=${contentPreview}`)
|
const eTags = evt.tags?.filter((t: string[]) => t[0] === 'e').length || 0
|
||||||
|
const aTags = evt.tags?.filter((t: string[]) => t[0] === 'a').length || 0
|
||||||
|
console.log(` Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, eTags=${eTags}, aTags=${aTags}, contentPreview=${contentPreview}`)
|
||||||
})
|
})
|
||||||
|
|
||||||
const bookmarkListEvents = dedupeNip51Events(rawEvents)
|
const bookmarkListEvents = dedupeNip51Events(rawEvents)
|
||||||
console.log('📋 After deduplication:', bookmarkListEvents.length, 'bookmark events')
|
console.log('📋 After deduplication:', bookmarkListEvents.length, 'bookmark events')
|
||||||
|
|
||||||
|
// Log which events made it through deduplication
|
||||||
|
bookmarkListEvents.forEach((evt, i) => {
|
||||||
|
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
||||||
|
console.log(` Dedupe ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag="${dTag}"`)
|
||||||
|
})
|
||||||
|
|
||||||
|
// Check specifically for Primal's "reads" list
|
||||||
|
const primalReads = rawEvents.find(e => e.kind === KINDS.ListSimple && e.tags?.find((t: string[]) => t[0] === 'd' && t[1] === 'reads'))
|
||||||
|
if (primalReads) {
|
||||||
|
console.log('✅ Found Primal reads list:', primalReads.id.slice(0, 8))
|
||||||
|
} else {
|
||||||
|
console.log('❌ No Primal reads list found (kind:10003 with d="reads")')
|
||||||
|
}
|
||||||
|
|
||||||
if (bookmarkListEvents.length === 0) {
|
if (bookmarkListEvents.length === 0) {
|
||||||
// Keep existing bookmarks visible; do not clear list if nothing new found
|
// Keep existing bookmarks visible; do not clear list if nothing new found
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
// Aggregate across events
|
// Aggregate across events
|
||||||
const maybeAccount = activeAccount as AccountWithExtension
|
const maybeAccount = activeAccount as AccountWithExtension
|
||||||
console.log('🔐 Account object:', {
|
console.log('[bunker] 🔐 Account object:', {
|
||||||
hasSignEvent: typeof maybeAccount?.signEvent === 'function',
|
hasSignEvent: typeof maybeAccount?.signEvent === 'function',
|
||||||
hasSigner: !!maybeAccount?.signer,
|
hasSigner: !!maybeAccount?.signer,
|
||||||
accountType: typeof maybeAccount,
|
accountType: typeof maybeAccount,
|
||||||
@@ -95,35 +102,107 @@ export const fetchBookmarks = async (
|
|||||||
signerCandidate = maybeAccount.signer
|
signerCandidate = maybeAccount.signer
|
||||||
}
|
}
|
||||||
|
|
||||||
console.log('🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
|
console.log('[bunker] 🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
|
||||||
if (signerCandidate) {
|
if (signerCandidate) {
|
||||||
console.log('🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
|
console.log('[bunker] 🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
|
||||||
console.log('🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
|
console.log('[bunker] 🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
|
||||||
}
|
}
|
||||||
const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
|
|
||||||
|
// Debug relay connectivity for bunker relays
|
||||||
|
try {
|
||||||
|
const urls = Array.from(relayPool.relays.values()).map(r => ({ url: r.url, connected: (r as unknown as { connected?: boolean }).connected }))
|
||||||
|
console.log('[bunker] Relay connections:', urls)
|
||||||
|
} catch (err) { console.warn('[bunker] Failed to read relay connections', err) }
|
||||||
|
|
||||||
|
const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
|
||||||
bookmarkListEvents,
|
bookmarkListEvents,
|
||||||
activeAccount,
|
activeAccount,
|
||||||
signerCandidate
|
signerCandidate
|
||||||
)
|
)
|
||||||
|
|
||||||
const allItems = [...publicItemsAll, ...privateItemsAll]
|
const allItems = [...publicItemsAll, ...privateItemsAll]
|
||||||
const noteIds = Array.from(new Set(allItems.map(i => i.id).filter(isHexId)))
|
|
||||||
let idToEvent: Map<string, NostrEvent> = new Map()
|
// Separate hex IDs (regular events) from coordinates (addressable events)
|
||||||
|
const noteIds: string[] = []
|
||||||
|
const coordinates: string[] = []
|
||||||
|
|
||||||
|
allItems.forEach(i => {
|
||||||
|
// Check if it's a hex ID (64 character hex string)
|
||||||
|
if (/^[0-9a-f]{64}$/i.test(i.id)) {
|
||||||
|
noteIds.push(i.id)
|
||||||
|
} else if (i.id.includes(':')) {
|
||||||
|
// Coordinate format: kind:pubkey:identifier
|
||||||
|
coordinates.push(i.id)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
const idToEvent: Map<string, NostrEvent> = new Map()
|
||||||
|
|
||||||
|
// Fetch regular events by ID
|
||||||
if (noteIds.length > 0) {
|
if (noteIds.length > 0) {
|
||||||
try {
|
try {
|
||||||
const { local: localHydrate, remote: remoteHydrate } = partitionRelays(relayUrls)
|
const events = await queryEvents(
|
||||||
const localHydrate$ = localHydrate.length > 0
|
relayPool,
|
||||||
? relayPool.req(localHydrate, { ids: noteIds }).pipe(completeOnEose(), takeUntil(timer(800)))
|
{ ids: Array.from(new Set(noteIds)) },
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
{ localTimeoutMs: 800, remoteTimeoutMs: 2500 }
|
||||||
const remoteHydrate$ = remoteHydrate.length > 0
|
)
|
||||||
? relayPool.req(remoteHydrate, { ids: noteIds }).pipe(completeOnEose(), takeUntil(timer(2500)))
|
events.forEach((e: NostrEvent) => {
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
idToEvent.set(e.id, e)
|
||||||
const events: NostrEvent[] = await lastValueFrom(merge(localHydrate$, remoteHydrate$).pipe(toArray()))
|
// Also store by coordinate if it's an addressable event
|
||||||
idToEvent = new Map(events.map((e: NostrEvent) => [e.id, e]))
|
if (e.kind && e.kind >= 30000 && e.kind < 40000) {
|
||||||
|
const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
|
||||||
|
idToEvent.set(coordinate, e)
|
||||||
|
}
|
||||||
|
})
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.warn('Failed to fetch events for hydration:', error)
|
console.warn('Failed to fetch events by ID:', error)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Fetch addressable events by coordinates
|
||||||
|
if (coordinates.length > 0) {
|
||||||
|
try {
|
||||||
|
// Group by kind for more efficient querying
|
||||||
|
const byKind = new Map<number, Array<{ pubkey: string; identifier: string }>>()
|
||||||
|
|
||||||
|
coordinates.forEach(coord => {
|
||||||
|
const parts = coord.split(':')
|
||||||
|
const kind = parseInt(parts[0])
|
||||||
|
const pubkey = parts[1]
|
||||||
|
const identifier = parts[2] || ''
|
||||||
|
|
||||||
|
if (!byKind.has(kind)) {
|
||||||
|
byKind.set(kind, [])
|
||||||
|
}
|
||||||
|
byKind.get(kind)!.push({ pubkey, identifier })
|
||||||
|
})
|
||||||
|
|
||||||
|
// Query each kind group
|
||||||
|
for (const [kind, items] of byKind.entries()) {
|
||||||
|
const authors = Array.from(new Set(items.map(i => i.pubkey)))
|
||||||
|
const identifiers = Array.from(new Set(items.map(i => i.identifier)))
|
||||||
|
|
||||||
|
const events = await queryEvents(
|
||||||
|
relayPool,
|
||||||
|
{ kinds: [kind], authors, '#d': identifiers },
|
||||||
|
{ localTimeoutMs: 800, remoteTimeoutMs: 2500 }
|
||||||
|
)
|
||||||
|
|
||||||
|
events.forEach((e: NostrEvent) => {
|
||||||
|
const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
|
||||||
|
idToEvent.set(coordinate, e)
|
||||||
|
// Also store by event ID
|
||||||
|
idToEvent.set(e.id, e)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.warn('Failed to fetch addressable events:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`📦 Hydration: fetched ${idToEvent.size} events for ${allItems.length} bookmarks (${noteIds.length} notes, ${coordinates.length} articles)`)
|
||||||
const allBookmarks = dedupeBookmarksById([
|
const allBookmarks = dedupeBookmarksById([
|
||||||
...hydrateItems(publicItemsAll, idToEvent),
|
...hydrateItems(publicItemsAll, idToEvent),
|
||||||
...hydrateItems(privateItemsAll, idToEvent)
|
...hydrateItems(privateItemsAll, idToEvent)
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
import { RelayPool, completeOnEose } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
|
||||||
import { prioritizeLocalRelays } from '../utils/helpers'
|
import { prioritizeLocalRelays } from '../utils/helpers'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { CONTACTS_REMOTE_TIMEOUT_MS } from '../config/network'
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Fetches the contact list (follows) for a specific user
|
* Fetches the contact list (follows) for a specific user
|
||||||
@@ -15,24 +16,27 @@ export const fetchContacts = async (
|
|||||||
): Promise<Set<string>> => {
|
): Promise<Set<string>> => {
|
||||||
try {
|
try {
|
||||||
const relayUrls = prioritizeLocalRelays(Array.from(relayPool.relays.values()).map(relay => relay.url))
|
const relayUrls = prioritizeLocalRelays(Array.from(relayPool.relays.values()).map(relay => relay.url))
|
||||||
|
|
||||||
console.log('🔍 Fetching contacts (kind 3) for user:', pubkey)
|
console.log('🔍 Fetching contacts (kind 3) for user:', pubkey)
|
||||||
|
|
||||||
// Local-first quick attempt
|
const partialFollowed = new Set<string>()
|
||||||
const localRelays = relayUrls.filter(url => url.includes('localhost') || url.includes('127.0.0.1'))
|
const events = await queryEvents(
|
||||||
const remoteRelays = relayUrls.filter(url => !url.includes('localhost') && !url.includes('127.0.0.1'))
|
relayPool,
|
||||||
const local$ = localRelays.length > 0
|
{ kinds: [3], authors: [pubkey] },
|
||||||
? relayPool
|
{
|
||||||
.req(localRelays, { kinds: [3], authors: [pubkey] })
|
relayUrls,
|
||||||
.pipe(completeOnEose(), takeUntil(timer(1200)))
|
remoteTimeoutMs: CONTACTS_REMOTE_TIMEOUT_MS,
|
||||||
: new Observable<{ created_at: number; tags: string[][] }>((sub) => sub.complete())
|
onEvent: (event: { created_at: number; tags: string[][] }) => {
|
||||||
const remote$ = remoteRelays.length > 0
|
// Stream partials as we see any contact list
|
||||||
? relayPool
|
for (const tag of event.tags) {
|
||||||
.req(remoteRelays, { kinds: [3], authors: [pubkey] })
|
if (tag[0] === 'p' && tag[1]) {
|
||||||
.pipe(completeOnEose(), takeUntil(timer(6000)))
|
partialFollowed.add(tag[1])
|
||||||
: new Observable<{ created_at: number; tags: string[][] }>((sub) => sub.complete())
|
}
|
||||||
const events = await lastValueFrom(
|
}
|
||||||
merge(local$, remote$).pipe(toArray())
|
if (onPartial && partialFollowed.size > 0) {
|
||||||
|
onPartial(new Set(partialFollowed))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
)
|
)
|
||||||
const followed = new Set<string>()
|
const followed = new Set<string>()
|
||||||
if (events.length > 0) {
|
if (events.length > 0) {
|
||||||
|
|||||||
70
src/services/dataFetch.ts
Normal file
70
src/services/dataFetch.ts
Normal file
@@ -0,0 +1,70 @@
|
|||||||
|
import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
|
||||||
|
import { Observable, merge, takeUntil, timer, toArray, tap, lastValueFrom } from 'rxjs'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { Filter } from 'nostr-tools/filter'
|
||||||
|
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
||||||
|
import { LOCAL_TIMEOUT_MS, REMOTE_TIMEOUT_MS } from '../config/network'
|
||||||
|
|
||||||
|
export interface QueryOptions {
|
||||||
|
relayUrls?: string[]
|
||||||
|
localTimeoutMs?: number
|
||||||
|
remoteTimeoutMs?: number
|
||||||
|
onEvent?: (event: NostrEvent) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unified local-first query helper with optional streaming callback.
|
||||||
|
* Returns all collected events (deduped by id) after both streams complete or time out.
|
||||||
|
*/
|
||||||
|
export async function queryEvents(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
filter: Filter,
|
||||||
|
options: QueryOptions = {}
|
||||||
|
): Promise<NostrEvent[]> {
|
||||||
|
const {
|
||||||
|
relayUrls,
|
||||||
|
localTimeoutMs = LOCAL_TIMEOUT_MS,
|
||||||
|
remoteTimeoutMs = REMOTE_TIMEOUT_MS,
|
||||||
|
onEvent
|
||||||
|
} = options
|
||||||
|
|
||||||
|
const urls = relayUrls && relayUrls.length > 0
|
||||||
|
? relayUrls
|
||||||
|
: Array.from(relayPool.relays.values()).map(r => r.url)
|
||||||
|
|
||||||
|
const ordered = prioritizeLocalRelays(urls)
|
||||||
|
const { local: localRelays, remote: remoteRelays } = partitionRelays(ordered)
|
||||||
|
|
||||||
|
const local$: Observable<NostrEvent> = localRelays.length > 0
|
||||||
|
? relayPool
|
||||||
|
.req(localRelays, filter)
|
||||||
|
.pipe(
|
||||||
|
onlyEvents(),
|
||||||
|
onEvent ? tap((e: NostrEvent) => onEvent(e)) : tap(() => {}),
|
||||||
|
completeOnEose(),
|
||||||
|
takeUntil(timer(localTimeoutMs))
|
||||||
|
) as unknown as Observable<NostrEvent>
|
||||||
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
|
|
||||||
|
const remote$: Observable<NostrEvent> = remoteRelays.length > 0
|
||||||
|
? relayPool
|
||||||
|
.req(remoteRelays, filter)
|
||||||
|
.pipe(
|
||||||
|
onlyEvents(),
|
||||||
|
onEvent ? tap((e: NostrEvent) => onEvent(e)) : tap(() => {}),
|
||||||
|
completeOnEose(),
|
||||||
|
takeUntil(timer(remoteTimeoutMs))
|
||||||
|
) as unknown as Observable<NostrEvent>
|
||||||
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
|
|
||||||
|
const events = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
||||||
|
|
||||||
|
// Deduplicate by id (callers can perform higher-level replaceable grouping if needed)
|
||||||
|
const byId = new Map<string, NostrEvent>()
|
||||||
|
for (const ev of events) {
|
||||||
|
if (!byId.has(ev.id)) byId.set(ev.id, ev)
|
||||||
|
}
|
||||||
|
return Array.from(byId.values())
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -1,8 +1,8 @@
|
|||||||
import { RelayPool, completeOnEose } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
|
||||||
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { Helpers } from 'applesauce-core'
|
import { Helpers } from 'applesauce-core'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
|
||||||
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
@@ -35,49 +35,38 @@ export const fetchBlogPostsFromAuthors = async (
|
|||||||
}
|
}
|
||||||
|
|
||||||
console.log('📚 Fetching blog posts (kind 30023) from', pubkeys.length, 'authors')
|
console.log('📚 Fetching blog posts (kind 30023) from', pubkeys.length, 'authors')
|
||||||
|
|
||||||
const prioritized = prioritizeLocalRelays(relayUrls)
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(prioritized)
|
|
||||||
|
|
||||||
// Deduplicate replaceable events by keeping the most recent version
|
// Deduplicate replaceable events by keeping the most recent version
|
||||||
// Group by author + d-tag identifier
|
// Group by author + d-tag identifier
|
||||||
const uniqueEvents = new Map<string, NostrEvent>()
|
const uniqueEvents = new Map<string, NostrEvent>()
|
||||||
|
|
||||||
const processEvents = (incoming: NostrEvent[]) => {
|
await queryEvents(
|
||||||
for (const event of incoming) {
|
relayPool,
|
||||||
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
{ kinds: [KINDS.BlogPost], authors: pubkeys, limit: 100 },
|
||||||
const key = `${event.pubkey}:${dTag}`
|
{
|
||||||
const existing = uniqueEvents.get(key)
|
relayUrls,
|
||||||
if (!existing || event.created_at > existing.created_at) {
|
onEvent: (event: NostrEvent) => {
|
||||||
uniqueEvents.set(key, event)
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
||||||
// Emit as we incorporate
|
const key = `${event.pubkey}:${dTag}`
|
||||||
if (onPost) {
|
const existing = uniqueEvents.get(key)
|
||||||
const post: BlogPostPreview = {
|
if (!existing || event.created_at > existing.created_at) {
|
||||||
event,
|
uniqueEvents.set(key, event)
|
||||||
title: getArticleTitle(event) || 'Untitled',
|
// Emit as we incorporate
|
||||||
summary: getArticleSummary(event),
|
if (onPost) {
|
||||||
image: getArticleImage(event),
|
const post: BlogPostPreview = {
|
||||||
published: getArticlePublished(event),
|
event,
|
||||||
author: event.pubkey
|
title: getArticleTitle(event) || 'Untitled',
|
||||||
|
summary: getArticleSummary(event),
|
||||||
|
image: getArticleImage(event),
|
||||||
|
published: getArticlePublished(event),
|
||||||
|
author: event.pubkey
|
||||||
|
}
|
||||||
|
onPost(post)
|
||||||
}
|
}
|
||||||
onPost(post)
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
)
|
||||||
|
|
||||||
const local$ = localRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(localRelays, { kinds: [30023], authors: pubkeys, limit: 100 })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(1200)))
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [30023], authors: pubkeys, limit: 100 })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(6000)))
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
const events = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
|
||||||
processEvents(events)
|
|
||||||
|
|
||||||
console.log('📊 Blog post events fetched (unique):', uniqueEvents.size)
|
console.log('📊 Blog post events fetched (unique):', uniqueEvents.size)
|
||||||
|
|
||||||
|
|||||||
@@ -7,12 +7,12 @@ import { Helpers, IEventStore } from 'applesauce-core'
|
|||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { UserSettings } from './settingsService'
|
import { UserSettings } from './settingsService'
|
||||||
import { areAllRelaysLocal } from '../utils/helpers'
|
import { isLocalRelay, areAllRelaysLocal } from '../utils/helpers'
|
||||||
import { markEventAsOfflineCreated } from './offlineSyncService'
|
import { publishEvent } from './writeService'
|
||||||
|
|
||||||
// Boris pubkey for zap splits
|
// Boris pubkey for zap splits
|
||||||
// npub19802see0gnk3vjlus0dnmfdagusqrtmsxpl5yfmkwn9uvnfnqylqduhr0x
|
// npub19802see0gnk3vjlus0dnmfdagusqrtmsxpl5yfmkwn9uvnfnqylqduhr0x
|
||||||
const BORIS_PUBKEY = '29dea8672f44ed164bfc83db3da5bd472001af70307f42277674cbc64d33013e'
|
export const BORIS_PUBKEY = '29dea8672f44ed164bfc83db3da5bd472001af70307f42277674cbc64d33013e'
|
||||||
|
|
||||||
const {
|
const {
|
||||||
getHighlightText,
|
getHighlightText,
|
||||||
@@ -46,7 +46,8 @@ export async function createHighlight(
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Create EventFactory with the account as signer
|
// Create EventFactory with the account as signer
|
||||||
const factory = new EventFactory({ signer: account })
|
console.log("[bunker] Creating EventFactory with signer:", { signerType: account.signer?.constructor?.name })
|
||||||
|
const factory = new EventFactory({ signer: account.signer })
|
||||||
|
|
||||||
let blueprintSource: NostrEvent | AddressPointer | string
|
let blueprintSource: NostrEvent | AddressPointer | string
|
||||||
let context: string | undefined
|
let context: string | undefined
|
||||||
@@ -116,61 +117,30 @@ export async function createHighlight(
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Sign the event
|
// Sign the event
|
||||||
|
console.log('[bunker] Signing highlight event...', { kind: highlightEvent.kind, tags: highlightEvent.tags.length })
|
||||||
const signedEvent = await factory.sign(highlightEvent)
|
const signedEvent = await factory.sign(highlightEvent)
|
||||||
|
console.log('[bunker] ✅ Highlight signed successfully!', { id: signedEvent.id.slice(0, 8) })
|
||||||
|
|
||||||
// Publish to all configured relays - let the relay pool handle connection state
|
// Use unified write service to store and publish
|
||||||
const targetRelays = RELAYS
|
await publishEvent(relayPool, eventStore, signedEvent)
|
||||||
|
|
||||||
// Store the event in the local EventStore FIRST for immediate UI display
|
// Check current connection status for UI feedback
|
||||||
eventStore.add(signedEvent)
|
|
||||||
console.log('💾 Stored highlight in EventStore:', signedEvent.id.slice(0, 8))
|
|
||||||
|
|
||||||
// Check current connection status - are we online or in flight mode?
|
|
||||||
const connectedRelays = Array.from(relayPool.relays.values())
|
const connectedRelays = Array.from(relayPool.relays.values())
|
||||||
.filter(relay => relay.connected)
|
.filter(relay => relay.connected)
|
||||||
.map(relay => relay.url)
|
.map(relay => relay.url)
|
||||||
|
|
||||||
const hasRemoteConnection = connectedRelays.some(url =>
|
const hasRemoteConnection = connectedRelays.some(url => !isLocalRelay(url))
|
||||||
!url.includes('localhost') && !url.includes('127.0.0.1')
|
const expectedSuccessRelays = hasRemoteConnection
|
||||||
)
|
? RELAYS
|
||||||
|
: RELAYS.filter(isLocalRelay)
|
||||||
// Determine which relays we expect to succeed
|
|
||||||
const expectedSuccessRelays = hasRemoteConnection
|
|
||||||
? RELAYS
|
|
||||||
: RELAYS.filter(r => r.includes('localhost') || r.includes('127.0.0.1'))
|
|
||||||
|
|
||||||
const isLocalOnly = areAllRelaysLocal(expectedSuccessRelays)
|
const isLocalOnly = areAllRelaysLocal(expectedSuccessRelays)
|
||||||
|
|
||||||
console.log('📍 Highlight relay status:', {
|
|
||||||
targetRelays: targetRelays.length,
|
|
||||||
expectedSuccessRelays,
|
|
||||||
isLocalOnly,
|
|
||||||
hasRemoteConnection,
|
|
||||||
eventId: signedEvent.id
|
|
||||||
})
|
|
||||||
|
|
||||||
// If we're in local-only mode, mark this event for later sync
|
|
||||||
if (isLocalOnly) {
|
|
||||||
markEventAsOfflineCreated(signedEvent.id)
|
|
||||||
}
|
|
||||||
|
|
||||||
// Convert to Highlight with relay tracking info and return IMMEDIATELY
|
// Convert to Highlight with relay tracking info and return IMMEDIATELY
|
||||||
const highlight = eventToHighlight(signedEvent)
|
const highlight = eventToHighlight(signedEvent)
|
||||||
highlight.publishedRelays = expectedSuccessRelays // Show only relays we expect to succeed
|
highlight.publishedRelays = expectedSuccessRelays
|
||||||
highlight.isLocalOnly = isLocalOnly
|
highlight.isLocalOnly = isLocalOnly
|
||||||
highlight.isOfflineCreated = isLocalOnly // Mark as created offline if local-only
|
highlight.isOfflineCreated = isLocalOnly
|
||||||
|
|
||||||
// Publish to relays in the background (non-blocking)
|
|
||||||
// This allows instant UI updates while publishing happens asynchronously
|
|
||||||
relayPool.publish(targetRelays, signedEvent)
|
|
||||||
.then(() => {
|
|
||||||
console.log('✅ Highlight published to', targetRelays.length, 'relay(s):', targetRelays)
|
|
||||||
})
|
|
||||||
.catch((error) => {
|
|
||||||
console.warn('⚠️ Failed to publish highlight to relays (event still saved locally):', error)
|
|
||||||
})
|
|
||||||
|
|
||||||
// Return the highlight immediately for instant UI updates
|
|
||||||
return highlight
|
return highlight
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -6,6 +6,7 @@ import { prioritizeLocalRelays, partitionRelays } from '../../utils/helpers'
|
|||||||
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
||||||
import { UserSettings } from '../settingsService'
|
import { UserSettings } from '../settingsService'
|
||||||
import { rebroadcastEvents } from '../rebroadcastService'
|
import { rebroadcastEvents } from '../rebroadcastService'
|
||||||
|
import { KINDS } from '../../config/kinds'
|
||||||
|
|
||||||
export const fetchHighlights = async (
|
export const fetchHighlights = async (
|
||||||
relayPool: RelayPool,
|
relayPool: RelayPool,
|
||||||
@@ -21,7 +22,7 @@ export const fetchHighlights = async (
|
|||||||
const seenIds = new Set<string>()
|
const seenIds = new Set<string>()
|
||||||
const local$ = localRelays.length > 0
|
const local$ = localRelays.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(localRelays, { kinds: [9802], authors: [pubkey] })
|
.req(localRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
|
||||||
.pipe(
|
.pipe(
|
||||||
onlyEvents(),
|
onlyEvents(),
|
||||||
tap((event: NostrEvent) => {
|
tap((event: NostrEvent) => {
|
||||||
@@ -36,7 +37,7 @@ export const fetchHighlights = async (
|
|||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
const remote$ = remoteRelays.length > 0
|
const remote$ = remoteRelays.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(remoteRelays, { kinds: [9802], authors: [pubkey] })
|
.req(remoteRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
|
||||||
.pipe(
|
.pipe(
|
||||||
onlyEvents(),
|
onlyEvents(),
|
||||||
tap((event: NostrEvent) => {
|
tap((event: NostrEvent) => {
|
||||||
|
|||||||
@@ -14,10 +14,11 @@ export const fetchHighlightsForUrl = async (
|
|||||||
onHighlight?: (highlight: Highlight) => void,
|
onHighlight?: (highlight: Highlight) => void,
|
||||||
settings?: UserSettings
|
settings?: UserSettings
|
||||||
): Promise<Highlight[]> => {
|
): Promise<Highlight[]> => {
|
||||||
|
const seenIds = new Set<string>()
|
||||||
|
const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
|
||||||
|
const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
|
||||||
|
|
||||||
try {
|
try {
|
||||||
const seenIds = new Set<string>()
|
|
||||||
const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
|
|
||||||
const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
|
|
||||||
const local$ = localRelaysUrl.length > 0
|
const local$ = localRelaysUrl.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(localRelaysUrl, { kinds: [9802], '#r': [url] })
|
.req(localRelaysUrl, { kinds: [9802], '#r': [url] })
|
||||||
@@ -45,11 +46,23 @@ export const fetchHighlightsForUrl = async (
|
|||||||
)
|
)
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
||||||
await rebroadcastEvents(rawEvents, relayPool, settings)
|
|
||||||
|
console.log(`📌 Fetched ${rawEvents.length} highlight events for URL:`, url)
|
||||||
|
|
||||||
|
// Rebroadcast events - but don't let errors here break the highlight display
|
||||||
|
try {
|
||||||
|
await rebroadcastEvents(rawEvents, relayPool, settings)
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to rebroadcast highlight events:', err)
|
||||||
|
}
|
||||||
|
|
||||||
const uniqueEvents = dedupeHighlights(rawEvents)
|
const uniqueEvents = dedupeHighlights(rawEvents)
|
||||||
const highlights: Highlight[] = uniqueEvents.map(eventToHighlight)
|
const highlights: Highlight[] = uniqueEvents.map(eventToHighlight)
|
||||||
return sortHighlights(highlights)
|
return sortHighlights(highlights)
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.error('Error fetching highlights for URL:', err)
|
||||||
|
// Return highlights that were already streamed via callback
|
||||||
|
// Don't return empty array as that would clear already-displayed highlights
|
||||||
return []
|
return []
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,9 +1,8 @@
|
|||||||
import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, tap, toArray } from 'rxjs'
|
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { Highlight } from '../../types/highlights'
|
import { Highlight } from '../../types/highlights'
|
||||||
import { prioritizeLocalRelays, partitionRelays } from '../../utils/helpers'
|
|
||||||
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
||||||
|
import { queryEvents } from '../dataFetch'
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Fetches highlights (kind:9802) from a list of pubkeys (friends)
|
* Fetches highlights (kind:9802) from a list of pubkeys (friends)
|
||||||
@@ -24,46 +23,20 @@ export const fetchHighlightsFromAuthors = async (
|
|||||||
}
|
}
|
||||||
|
|
||||||
console.log('💡 Fetching highlights (kind 9802) from', pubkeys.length, 'authors')
|
console.log('💡 Fetching highlights (kind 9802) from', pubkeys.length, 'authors')
|
||||||
|
|
||||||
const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
|
|
||||||
const prioritized = prioritizeLocalRelays(relayUrls)
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(prioritized)
|
|
||||||
|
|
||||||
const seenIds = new Set<string>()
|
const seenIds = new Set<string>()
|
||||||
|
const rawEvents = await queryEvents(
|
||||||
const local$ = localRelays.length > 0
|
relayPool,
|
||||||
? relayPool
|
{ kinds: [9802], authors: pubkeys, limit: 200 },
|
||||||
.req(localRelays, { kinds: [9802], authors: pubkeys, limit: 200 })
|
{
|
||||||
.pipe(
|
onEvent: (event: NostrEvent) => {
|
||||||
onlyEvents(),
|
if (!seenIds.has(event.id)) {
|
||||||
tap((event: NostrEvent) => {
|
seenIds.add(event.id)
|
||||||
if (!seenIds.has(event.id)) {
|
if (onHighlight) onHighlight(eventToHighlight(event))
|
||||||
seenIds.add(event.id)
|
}
|
||||||
if (onHighlight) onHighlight(eventToHighlight(event))
|
}
|
||||||
}
|
}
|
||||||
}),
|
)
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(1200))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [9802], authors: pubkeys, limit: 200 })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
tap((event: NostrEvent) => {
|
|
||||||
if (!seenIds.has(event.id)) {
|
|
||||||
seenIds.add(event.id)
|
|
||||||
if (onHighlight) onHighlight(eventToHighlight(event))
|
|
||||||
}
|
|
||||||
}),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(6000))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
|
||||||
|
|
||||||
const uniqueEvents = dedupeHighlights(rawEvents)
|
const uniqueEvents = dedupeHighlights(rawEvents)
|
||||||
const highlights = uniqueEvents.map(eventToHighlight)
|
const highlights = uniqueEvents.map(eventToHighlight)
|
||||||
|
|||||||
@@ -1,11 +1,11 @@
|
|||||||
import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { Helpers } from 'applesauce-core'
|
import { Helpers } from 'applesauce-core'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
import { KINDS } from '../config/kinds'
|
||||||
import { MARK_AS_READ_EMOJI } from './reactionService'
|
import { MARK_AS_READ_EMOJI } from './reactionService'
|
||||||
import { BlogPostPreview } from './exploreService'
|
import { BlogPostPreview } from './exploreService'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
|
||||||
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
@@ -28,58 +28,11 @@ export async function fetchReadArticles(
|
|||||||
userPubkey: string
|
userPubkey: string
|
||||||
): Promise<ReadArticle[]> {
|
): Promise<ReadArticle[]> {
|
||||||
try {
|
try {
|
||||||
const orderedRelays = prioritizeLocalRelays(RELAYS)
|
// Fetch kind:7 and kind:17 reactions in parallel
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(orderedRelays)
|
const [kind7Events, kind17Events] = await Promise.all([
|
||||||
|
queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
// Fetch kind:7 reactions (nostr-native articles)
|
queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] }, { relayUrls: RELAYS })
|
||||||
const kind7Local$ = localRelays.length > 0
|
])
|
||||||
? relayPool
|
|
||||||
.req(localRelays, { kinds: [7], authors: [userPubkey] })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(1200))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const kind7Remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [7], authors: [userPubkey] })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(6000))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const kind7Events: NostrEvent[] = await lastValueFrom(
|
|
||||||
merge(kind7Local$, kind7Remote$).pipe(toArray())
|
|
||||||
)
|
|
||||||
|
|
||||||
// Fetch kind:17 reactions (external URLs)
|
|
||||||
const kind17Local$ = localRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(localRelays, { kinds: [17], authors: [userPubkey] })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(1200))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const kind17Remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [17], authors: [userPubkey] })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(6000))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const kind17Events: NostrEvent[] = await lastValueFrom(
|
|
||||||
merge(kind17Local$, kind17Remote$).pipe(toArray())
|
|
||||||
)
|
|
||||||
|
|
||||||
const readArticles: ReadArticle[] = []
|
const readArticles: ReadArticle[] = []
|
||||||
|
|
||||||
@@ -150,41 +103,20 @@ export async function fetchReadArticlesWithData(
|
|||||||
|
|
||||||
// Filter to only nostr-native articles (kind 30023)
|
// Filter to only nostr-native articles (kind 30023)
|
||||||
const nostrArticles = readArticles.filter(
|
const nostrArticles = readArticles.filter(
|
||||||
article => article.eventKind === 30023 && article.eventId
|
article => article.eventKind === KINDS.BlogPost && article.eventId
|
||||||
)
|
)
|
||||||
|
|
||||||
if (nostrArticles.length === 0) {
|
if (nostrArticles.length === 0) {
|
||||||
return []
|
return []
|
||||||
}
|
}
|
||||||
|
|
||||||
const orderedRelays = prioritizeLocalRelays(RELAYS)
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(orderedRelays)
|
|
||||||
|
|
||||||
// Fetch the actual article events
|
// Fetch the actual article events
|
||||||
const eventIds = nostrArticles.map(a => a.eventId!).filter(Boolean)
|
const eventIds = nostrArticles.map(a => a.eventId!).filter(Boolean)
|
||||||
|
|
||||||
const local$ = localRelays.length > 0
|
const articleEvents = await queryEvents(
|
||||||
? relayPool
|
relayPool,
|
||||||
.req(localRelays, { kinds: [30023], ids: eventIds })
|
{ kinds: [KINDS.BlogPost], ids: eventIds },
|
||||||
.pipe(
|
{ relayUrls: RELAYS }
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(1200))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [30023], ids: eventIds })
|
|
||||||
.pipe(
|
|
||||||
onlyEvents(),
|
|
||||||
completeOnEose(),
|
|
||||||
takeUntil(timer(6000))
|
|
||||||
)
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const articleEvents: NostrEvent[] = await lastValueFrom(
|
|
||||||
merge(local$, remote$).pipe(toArray())
|
|
||||||
)
|
)
|
||||||
|
|
||||||
// Deduplicate article events by ID
|
// Deduplicate article events by ID
|
||||||
|
|||||||
90
src/services/linksService.ts
Normal file
90
src/services/linksService.ts
Normal file
@@ -0,0 +1,90 @@
|
|||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { fetchReadArticles } from './libraryService'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fetches external URL links with reading progress from:
|
||||||
|
* - URLs with reading progress (kind:30078)
|
||||||
|
* - Manually marked as read URLs (kind:7, kind:17)
|
||||||
|
*/
|
||||||
|
export async function fetchLinks(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
userPubkey: string,
|
||||||
|
onItem?: (item: ReadItem) => void
|
||||||
|
): Promise<ReadItem[]> {
|
||||||
|
console.log('🔗 [Links] Fetching external links for user:', userPubkey.slice(0, 8))
|
||||||
|
|
||||||
|
const linksMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
// Helper to emit items as they're added/updated
|
||||||
|
const emitItem = (item: ReadItem) => {
|
||||||
|
if (onItem && mergeReadItem(linksMap, item)) {
|
||||||
|
onItem(linksMap.get(item.id)!)
|
||||||
|
} else if (!onItem) {
|
||||||
|
linksMap.set(item.id, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch all data sources in parallel
|
||||||
|
const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
|
||||||
|
queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
|
fetchReadArticles(relayPool, userPubkey)
|
||||||
|
])
|
||||||
|
|
||||||
|
console.log('📊 [Links] Data fetched:', {
|
||||||
|
readingPositions: readingPositionEvents.length,
|
||||||
|
markedAsRead: markedAsReadArticles.length
|
||||||
|
})
|
||||||
|
|
||||||
|
// Process reading positions and emit external items
|
||||||
|
processReadingPositions(readingPositionEvents, linksMap)
|
||||||
|
if (onItem) {
|
||||||
|
linksMap.forEach(item => {
|
||||||
|
if (item.type === 'external') {
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
if (hasProgress) emitItem(item)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process marked-as-read and emit external items
|
||||||
|
processMarkedAsRead(markedAsReadArticles, linksMap)
|
||||||
|
if (onItem) {
|
||||||
|
linksMap.forEach(item => {
|
||||||
|
if (item.type === 'external') {
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
if (hasProgress) emitItem(item)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Filter for external URLs only with reading progress
|
||||||
|
const links = Array.from(linksMap.values())
|
||||||
|
.filter(item => {
|
||||||
|
// Only external URLs
|
||||||
|
if (item.type !== 'external') return false
|
||||||
|
|
||||||
|
// Only include if there's reading progress or marked as read
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
return hasProgress
|
||||||
|
})
|
||||||
|
|
||||||
|
// Apply common validation and sorting
|
||||||
|
const validLinks = filterValidItems(links)
|
||||||
|
const sortedLinks = sortByReadingActivity(validLinks)
|
||||||
|
|
||||||
|
console.log('✅ [Links] Processed', sortedLinks.length, 'total links')
|
||||||
|
return sortedLinks
|
||||||
|
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to fetch links:', error)
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { Bookmark } from '../types/bookmarks'
|
import { Bookmark } from '../types/bookmarks'
|
||||||
import { BlogPostPreview } from './exploreService'
|
import { BlogPostPreview } from './exploreService'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
|
||||||
export interface MeCache {
|
export interface MeCache {
|
||||||
highlights: Highlight[]
|
highlights: Highlight[]
|
||||||
bookmarks: Bookmark[]
|
bookmarks: Bookmark[]
|
||||||
readArticles: BlogPostPreview[]
|
readArticles: BlogPostPreview[]
|
||||||
|
reads?: ReadItem[]
|
||||||
|
links?: ReadItem[]
|
||||||
timestamp: number
|
timestamp: number
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
26
src/services/nostrConnect.ts
Normal file
26
src/services/nostrConnect.ts
Normal file
@@ -0,0 +1,26 @@
|
|||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get default NIP-46 permissions for bunker connections
|
||||||
|
* These permissions cover all event kinds and encryption/decryption operations Boris needs
|
||||||
|
*/
|
||||||
|
export function getDefaultBunkerPermissions(): string[] {
|
||||||
|
return [
|
||||||
|
// Signing permissions for event kinds we create
|
||||||
|
...NostrConnectSigner.buildSigningPermissions([
|
||||||
|
0, // Profile metadata
|
||||||
|
5, // Event deletion
|
||||||
|
7, // Reactions (nostr events)
|
||||||
|
17, // Reactions (websites)
|
||||||
|
9802, // Highlights
|
||||||
|
30078, // Settings & reading positions
|
||||||
|
39701, // Web bookmarks
|
||||||
|
]),
|
||||||
|
// Encryption/decryption for hidden content
|
||||||
|
'nip04_encrypt',
|
||||||
|
'nip04_decrypt',
|
||||||
|
'nip44_encrypt',
|
||||||
|
'nip44_decrypt',
|
||||||
|
]
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,11 +1,10 @@
|
|||||||
import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
|
||||||
import { Helpers } from 'applesauce-core'
|
import { Helpers } from 'applesauce-core'
|
||||||
import { BlogPostPreview } from './exploreService'
|
import { BlogPostPreview } from './exploreService'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { eventToHighlight, dedupeHighlights, sortHighlights } from './highlightEventProcessor'
|
import { eventToHighlight, dedupeHighlights, sortHighlights } from './highlightEventProcessor'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
|
||||||
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
@@ -23,36 +22,25 @@ export const fetchNostrverseBlogPosts = async (
|
|||||||
): Promise<BlogPostPreview[]> => {
|
): Promise<BlogPostPreview[]> => {
|
||||||
try {
|
try {
|
||||||
console.log('📚 Fetching nostrverse blog posts (kind 30023), limit:', limit)
|
console.log('📚 Fetching nostrverse blog posts (kind 30023), limit:', limit)
|
||||||
|
|
||||||
const prioritized = prioritizeLocalRelays(relayUrls)
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(prioritized)
|
|
||||||
|
|
||||||
// Deduplicate replaceable events by keeping the most recent version
|
// Deduplicate replaceable events by keeping the most recent version
|
||||||
const uniqueEvents = new Map<string, NostrEvent>()
|
const uniqueEvents = new Map<string, NostrEvent>()
|
||||||
|
|
||||||
const processEvents = (incoming: NostrEvent[]) => {
|
await queryEvents(
|
||||||
for (const event of incoming) {
|
relayPool,
|
||||||
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
{ kinds: [30023], limit },
|
||||||
const key = `${event.pubkey}:${dTag}`
|
{
|
||||||
const existing = uniqueEvents.get(key)
|
relayUrls,
|
||||||
if (!existing || event.created_at > existing.created_at) {
|
onEvent: (event: NostrEvent) => {
|
||||||
uniqueEvents.set(key, event)
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
||||||
|
const key = `${event.pubkey}:${dTag}`
|
||||||
|
const existing = uniqueEvents.get(key)
|
||||||
|
if (!existing || event.created_at > existing.created_at) {
|
||||||
|
uniqueEvents.set(key, event)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
)
|
||||||
|
|
||||||
const local$ = localRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(localRelays, { kinds: [30023], limit })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(1200)), onlyEvents())
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [30023], limit })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(6000)), onlyEvents())
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
const events = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
|
||||||
processEvents(events)
|
|
||||||
|
|
||||||
console.log('📊 Nostrverse blog post events fetched (unique):', uniqueEvents.size)
|
console.log('📊 Nostrverse blog post events fetched (unique):', uniqueEvents.size)
|
||||||
|
|
||||||
@@ -93,24 +81,12 @@ export const fetchNostrverseHighlights = async (
|
|||||||
): Promise<Highlight[]> => {
|
): Promise<Highlight[]> => {
|
||||||
try {
|
try {
|
||||||
console.log('💡 Fetching nostrverse highlights (kind 9802), limit:', limit)
|
console.log('💡 Fetching nostrverse highlights (kind 9802), limit:', limit)
|
||||||
|
|
||||||
const relayUrls = Array.from(relayPool.relays.values()).map(relay => relay.url)
|
|
||||||
const prioritized = prioritizeLocalRelays(relayUrls)
|
|
||||||
const { local: localRelays, remote: remoteRelays } = partitionRelays(prioritized)
|
|
||||||
|
|
||||||
const local$ = localRelays.length > 0
|
const rawEvents = await queryEvents(
|
||||||
? relayPool
|
relayPool,
|
||||||
.req(localRelays, { kinds: [9802], limit })
|
{ kinds: [9802], limit },
|
||||||
.pipe(completeOnEose(), takeUntil(timer(1200)), onlyEvents())
|
{}
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
)
|
||||||
|
|
||||||
const remote$ = remoteRelays.length > 0
|
|
||||||
? relayPool
|
|
||||||
.req(remoteRelays, { kinds: [9802], limit })
|
|
||||||
.pipe(completeOnEose(), takeUntil(timer(6000)), onlyEvents())
|
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
|
||||||
|
|
||||||
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
|
||||||
|
|
||||||
const uniqueEvents = dedupeHighlights(rawEvents)
|
const uniqueEvents = dedupeHighlights(rawEvents)
|
||||||
const highlights = uniqueEvents.map(eventToHighlight)
|
const highlights = uniqueEvents.map(eventToHighlight)
|
||||||
|
|||||||
147
src/services/readingDataProcessor.ts
Normal file
147
src/services/readingDataProcessor.ts
Normal file
@@ -0,0 +1,147 @@
|
|||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
import { fallbackTitleFromUrl } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
const READING_POSITION_PREFIX = 'boris:reading-position:'
|
||||||
|
|
||||||
|
interface ReadArticle {
|
||||||
|
id: string
|
||||||
|
url?: string
|
||||||
|
eventId?: string
|
||||||
|
eventKind?: number
|
||||||
|
markedAt: number
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Processes reading position events into ReadItems
|
||||||
|
*/
|
||||||
|
export function processReadingPositions(
|
||||||
|
events: NostrEvent[],
|
||||||
|
readsMap: Map<string, ReadItem>
|
||||||
|
): void {
|
||||||
|
for (const event of events) {
|
||||||
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1]
|
||||||
|
if (!dTag || !dTag.startsWith(READING_POSITION_PREFIX)) continue
|
||||||
|
|
||||||
|
const identifier = dTag.replace(READING_POSITION_PREFIX, '')
|
||||||
|
|
||||||
|
try {
|
||||||
|
const positionData = JSON.parse(event.content)
|
||||||
|
const position = positionData.position
|
||||||
|
const timestamp = positionData.timestamp
|
||||||
|
|
||||||
|
let itemId: string
|
||||||
|
let itemUrl: string | undefined
|
||||||
|
let itemType: 'article' | 'external' = 'external'
|
||||||
|
|
||||||
|
// Check if it's a nostr article (naddr format)
|
||||||
|
if (identifier.startsWith('naddr1')) {
|
||||||
|
itemId = identifier
|
||||||
|
itemType = 'article'
|
||||||
|
} else {
|
||||||
|
// It's a base64url-encoded URL
|
||||||
|
try {
|
||||||
|
itemUrl = atob(identifier.replace(/-/g, '+').replace(/_/g, '/'))
|
||||||
|
itemId = itemUrl
|
||||||
|
itemType = 'external'
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Failed to decode URL identifier:', identifier)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Add or update the item
|
||||||
|
const existing = readsMap.get(itemId)
|
||||||
|
if (!existing || !existing.readingTimestamp || timestamp > existing.readingTimestamp) {
|
||||||
|
readsMap.set(itemId, {
|
||||||
|
...existing,
|
||||||
|
id: itemId,
|
||||||
|
source: 'reading-progress',
|
||||||
|
type: itemType,
|
||||||
|
url: itemUrl,
|
||||||
|
readingProgress: position,
|
||||||
|
readingTimestamp: timestamp
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.warn('Failed to parse reading position:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Processes marked-as-read articles into ReadItems
|
||||||
|
*/
|
||||||
|
export function processMarkedAsRead(
|
||||||
|
articles: ReadArticle[],
|
||||||
|
readsMap: Map<string, ReadItem>
|
||||||
|
): void {
|
||||||
|
for (const article of articles) {
|
||||||
|
const existing = readsMap.get(article.id)
|
||||||
|
|
||||||
|
if (article.eventId && article.eventKind === 30023) {
|
||||||
|
// Nostr article
|
||||||
|
readsMap.set(article.id, {
|
||||||
|
...existing,
|
||||||
|
id: article.id,
|
||||||
|
source: 'marked-as-read',
|
||||||
|
type: 'article',
|
||||||
|
markedAsRead: true,
|
||||||
|
markedAt: article.markedAt,
|
||||||
|
readingTimestamp: existing?.readingTimestamp || article.markedAt
|
||||||
|
})
|
||||||
|
} else if (article.url) {
|
||||||
|
// External URL
|
||||||
|
readsMap.set(article.id, {
|
||||||
|
...existing,
|
||||||
|
id: article.id,
|
||||||
|
source: 'marked-as-read',
|
||||||
|
type: 'external',
|
||||||
|
url: article.url,
|
||||||
|
markedAsRead: true,
|
||||||
|
markedAt: article.markedAt,
|
||||||
|
readingTimestamp: existing?.readingTimestamp || article.markedAt
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sorts ReadItems by most recent reading activity
|
||||||
|
*/
|
||||||
|
export function sortByReadingActivity(items: ReadItem[]): ReadItem[] {
|
||||||
|
return items.sort((a, b) => {
|
||||||
|
const timeA = a.readingTimestamp || a.markedAt || 0
|
||||||
|
const timeB = b.readingTimestamp || b.markedAt || 0
|
||||||
|
return timeB - timeA
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters out items without timestamps and enriches external items with fallback titles
|
||||||
|
*/
|
||||||
|
export function filterValidItems(items: ReadItem[]): ReadItem[] {
|
||||||
|
return items
|
||||||
|
.filter(item => {
|
||||||
|
// Only include items that have a timestamp
|
||||||
|
const hasTimestamp = (item.readingTimestamp && item.readingTimestamp > 0) ||
|
||||||
|
(item.markedAt && item.markedAt > 0)
|
||||||
|
if (!hasTimestamp) return false
|
||||||
|
|
||||||
|
// For Nostr articles, we need the event to be valid
|
||||||
|
if (item.type === 'article' && !item.event) return false
|
||||||
|
|
||||||
|
// For external URLs, we need at least a URL
|
||||||
|
if (item.type === 'external' && !item.url) return false
|
||||||
|
|
||||||
|
return true
|
||||||
|
})
|
||||||
|
.map(item => {
|
||||||
|
// Add fallback title for external URLs without titles
|
||||||
|
if (item.type === 'external' && !item.title && item.url) {
|
||||||
|
return { ...item, title: fallbackTitleFromUrl(item.url) }
|
||||||
|
}
|
||||||
|
return item
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
196
src/services/readingPositionService.ts
Normal file
196
src/services/readingPositionService.ts
Normal file
@@ -0,0 +1,196 @@
|
|||||||
|
import { IEventStore, mapEventsToStore } from 'applesauce-core'
|
||||||
|
import { EventFactory } from 'applesauce-factory'
|
||||||
|
import { RelayPool, onlyEvents } from 'applesauce-relay'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { firstValueFrom } from 'rxjs'
|
||||||
|
import { publishEvent } from './writeService'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
|
||||||
|
const APP_DATA_KIND = 30078 // NIP-78 Application Data
|
||||||
|
const READING_POSITION_PREFIX = 'boris:reading-position:'
|
||||||
|
|
||||||
|
export interface ReadingPosition {
|
||||||
|
position: number // 0-1 scroll progress
|
||||||
|
timestamp: number // Unix timestamp
|
||||||
|
scrollTop?: number // Optional: pixel position
|
||||||
|
}
|
||||||
|
|
||||||
|
// Helper to extract and parse reading position from an event
|
||||||
|
function getReadingPositionContent(event: NostrEvent): ReadingPosition | undefined {
|
||||||
|
if (!event.content || event.content.length === 0) return undefined
|
||||||
|
try {
|
||||||
|
return JSON.parse(event.content) as ReadingPosition
|
||||||
|
} catch {
|
||||||
|
return undefined
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Generate a unique identifier for an article
|
||||||
|
* For Nostr articles: use the naddr directly
|
||||||
|
* For external URLs: use base64url encoding of the URL
|
||||||
|
*/
|
||||||
|
export function generateArticleIdentifier(naddrOrUrl: string): string {
|
||||||
|
// If it starts with "nostr:", extract the naddr
|
||||||
|
if (naddrOrUrl.startsWith('nostr:')) {
|
||||||
|
return naddrOrUrl.replace('nostr:', '')
|
||||||
|
}
|
||||||
|
// For URLs, use base64url encoding (URL-safe)
|
||||||
|
return btoa(naddrOrUrl)
|
||||||
|
.replace(/\+/g, '-')
|
||||||
|
.replace(/\//g, '_')
|
||||||
|
.replace(/=+$/, '')
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Save reading position to Nostr (Kind 30078)
|
||||||
|
*/
|
||||||
|
export async function saveReadingPosition(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
eventStore: IEventStore,
|
||||||
|
factory: EventFactory,
|
||||||
|
articleIdentifier: string,
|
||||||
|
position: ReadingPosition
|
||||||
|
): Promise<void> {
|
||||||
|
console.log('💾 [ReadingPosition] Saving position:', {
|
||||||
|
identifier: articleIdentifier.slice(0, 32) + '...',
|
||||||
|
position: position.position,
|
||||||
|
positionPercent: Math.round(position.position * 100) + '%',
|
||||||
|
timestamp: position.timestamp,
|
||||||
|
scrollTop: position.scrollTop
|
||||||
|
})
|
||||||
|
|
||||||
|
const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
|
||||||
|
|
||||||
|
const draft = await factory.create(async () => ({
|
||||||
|
kind: APP_DATA_KIND,
|
||||||
|
content: JSON.stringify(position),
|
||||||
|
tags: [
|
||||||
|
['d', dTag],
|
||||||
|
['client', 'boris']
|
||||||
|
],
|
||||||
|
created_at: Math.floor(Date.now() / 1000)
|
||||||
|
}))
|
||||||
|
|
||||||
|
const signed = await factory.sign(draft)
|
||||||
|
|
||||||
|
// Use unified write service
|
||||||
|
await publishEvent(relayPool, eventStore, signed)
|
||||||
|
|
||||||
|
console.log('✅ [ReadingPosition] Position saved successfully, event ID:', signed.id.slice(0, 8))
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Load reading position from Nostr
|
||||||
|
*/
|
||||||
|
export async function loadReadingPosition(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
eventStore: IEventStore,
|
||||||
|
pubkey: string,
|
||||||
|
articleIdentifier: string
|
||||||
|
): Promise<ReadingPosition | null> {
|
||||||
|
const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
|
||||||
|
|
||||||
|
console.log('📖 [ReadingPosition] Loading position:', {
|
||||||
|
pubkey: pubkey.slice(0, 8) + '...',
|
||||||
|
identifier: articleIdentifier.slice(0, 32) + '...',
|
||||||
|
dTag: dTag.slice(0, 50) + '...'
|
||||||
|
})
|
||||||
|
|
||||||
|
// First, check if we already have the position in the local event store
|
||||||
|
try {
|
||||||
|
const localEvent = await firstValueFrom(
|
||||||
|
eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
|
||||||
|
)
|
||||||
|
if (localEvent) {
|
||||||
|
const content = getReadingPositionContent(localEvent)
|
||||||
|
if (content) {
|
||||||
|
console.log('✅ [ReadingPosition] Loaded from local store:', {
|
||||||
|
position: content.position,
|
||||||
|
positionPercent: Math.round(content.position * 100) + '%',
|
||||||
|
timestamp: content.timestamp
|
||||||
|
})
|
||||||
|
|
||||||
|
// Still fetch from relays in the background to get any updates
|
||||||
|
relayPool
|
||||||
|
.subscription(RELAYS, {
|
||||||
|
kinds: [APP_DATA_KIND],
|
||||||
|
authors: [pubkey],
|
||||||
|
'#d': [dTag]
|
||||||
|
})
|
||||||
|
.pipe(onlyEvents(), mapEventsToStore(eventStore))
|
||||||
|
.subscribe()
|
||||||
|
|
||||||
|
return content
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.log('📭 No cached reading position found, fetching from relays...')
|
||||||
|
}
|
||||||
|
|
||||||
|
// If not in local store, fetch from relays
|
||||||
|
return new Promise((resolve) => {
|
||||||
|
let hasResolved = false
|
||||||
|
const timeout = setTimeout(() => {
|
||||||
|
if (!hasResolved) {
|
||||||
|
console.log('⏱️ Reading position load timeout - no position found')
|
||||||
|
hasResolved = true
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}, 3000) // Shorter timeout for reading positions
|
||||||
|
|
||||||
|
const sub = relayPool
|
||||||
|
.subscription(RELAYS, {
|
||||||
|
kinds: [APP_DATA_KIND],
|
||||||
|
authors: [pubkey],
|
||||||
|
'#d': [dTag]
|
||||||
|
})
|
||||||
|
.pipe(onlyEvents(), mapEventsToStore(eventStore))
|
||||||
|
.subscribe({
|
||||||
|
complete: async () => {
|
||||||
|
clearTimeout(timeout)
|
||||||
|
if (!hasResolved) {
|
||||||
|
hasResolved = true
|
||||||
|
try {
|
||||||
|
const event = await firstValueFrom(
|
||||||
|
eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
|
||||||
|
)
|
||||||
|
if (event) {
|
||||||
|
const content = getReadingPositionContent(event)
|
||||||
|
if (content) {
|
||||||
|
console.log('✅ [ReadingPosition] Loaded from relays:', {
|
||||||
|
position: content.position,
|
||||||
|
positionPercent: Math.round(content.position * 100) + '%',
|
||||||
|
timestamp: content.timestamp
|
||||||
|
})
|
||||||
|
resolve(content)
|
||||||
|
} else {
|
||||||
|
console.log('⚠️ [ReadingPosition] Event found but no valid content')
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
console.log('📭 [ReadingPosition] No position found on relays')
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.error('❌ Error loading reading position:', err)
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
},
|
||||||
|
error: (err) => {
|
||||||
|
console.error('❌ Reading position subscription error:', err)
|
||||||
|
clearTimeout(timeout)
|
||||||
|
if (!hasResolved) {
|
||||||
|
hasResolved = true
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
setTimeout(() => {
|
||||||
|
sub.unsubscribe()
|
||||||
|
}, 3000)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
197
src/services/readsService.ts
Normal file
197
src/services/readsService.ts
Normal file
@@ -0,0 +1,197 @@
|
|||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { Helpers } from 'applesauce-core'
|
||||||
|
import { Bookmark } from '../types/bookmarks'
|
||||||
|
import { fetchReadArticles } from './libraryService'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { classifyBookmarkType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
|
export interface ReadItem {
|
||||||
|
id: string // event ID or URL or coordinate
|
||||||
|
source: 'bookmark' | 'reading-progress' | 'marked-as-read'
|
||||||
|
type: 'article' | 'external' // article=kind:30023, external=URL
|
||||||
|
|
||||||
|
// Article data
|
||||||
|
event?: NostrEvent
|
||||||
|
url?: string
|
||||||
|
title?: string
|
||||||
|
summary?: string
|
||||||
|
image?: string
|
||||||
|
published?: number
|
||||||
|
author?: string
|
||||||
|
|
||||||
|
// Reading metadata
|
||||||
|
readingProgress?: number // 0-1
|
||||||
|
readingTimestamp?: number // Unix timestamp of last reading activity
|
||||||
|
markedAsRead?: boolean
|
||||||
|
markedAt?: number
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fetches all reads from multiple sources:
|
||||||
|
* - Bookmarked articles (kind:30023) and article/website URLs
|
||||||
|
* - Articles/URLs with reading progress (kind:30078)
|
||||||
|
* - Manually marked as read articles/URLs (kind:7, kind:17)
|
||||||
|
*/
|
||||||
|
export async function fetchAllReads(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
userPubkey: string,
|
||||||
|
bookmarks: Bookmark[],
|
||||||
|
onItem?: (item: ReadItem) => void
|
||||||
|
): Promise<ReadItem[]> {
|
||||||
|
console.log('📚 [Reads] Fetching all reads for user:', userPubkey.slice(0, 8))
|
||||||
|
|
||||||
|
const readsMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
// Helper to emit items as they're added/updated
|
||||||
|
const emitItem = (item: ReadItem) => {
|
||||||
|
if (onItem && mergeReadItem(readsMap, item)) {
|
||||||
|
onItem(readsMap.get(item.id)!)
|
||||||
|
} else if (!onItem) {
|
||||||
|
readsMap.set(item.id, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch all data sources in parallel
|
||||||
|
const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
|
||||||
|
queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
|
fetchReadArticles(relayPool, userPubkey)
|
||||||
|
])
|
||||||
|
|
||||||
|
console.log('📊 [Reads] Data fetched:', {
|
||||||
|
readingPositions: readingPositionEvents.length,
|
||||||
|
markedAsRead: markedAsReadArticles.length,
|
||||||
|
bookmarks: bookmarks.length
|
||||||
|
})
|
||||||
|
|
||||||
|
// Process reading positions and emit items
|
||||||
|
processReadingPositions(readingPositionEvents, readsMap)
|
||||||
|
if (onItem) {
|
||||||
|
readsMap.forEach(item => {
|
||||||
|
if (item.type === 'article') onItem(item)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process marked-as-read and emit items
|
||||||
|
processMarkedAsRead(markedAsReadArticles, readsMap)
|
||||||
|
if (onItem) {
|
||||||
|
readsMap.forEach(item => {
|
||||||
|
if (item.type === 'article') onItem(item)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// 3. Process bookmarked articles and article/website URLs
|
||||||
|
const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
|
|
||||||
|
for (const bookmark of allBookmarks) {
|
||||||
|
const bookmarkType = classifyBookmarkType(bookmark)
|
||||||
|
|
||||||
|
// Only include articles
|
||||||
|
if (bookmarkType === 'article') {
|
||||||
|
// Kind:30023 nostr article
|
||||||
|
const coordinate = bookmark.id // Already in coordinate format
|
||||||
|
const existing = readsMap.get(coordinate)
|
||||||
|
|
||||||
|
if (!existing) {
|
||||||
|
const item: ReadItem = {
|
||||||
|
id: coordinate,
|
||||||
|
source: 'bookmark',
|
||||||
|
type: 'article',
|
||||||
|
readingProgress: 0,
|
||||||
|
readingTimestamp: bookmark.added_at || bookmark.created_at
|
||||||
|
}
|
||||||
|
readsMap.set(coordinate, item)
|
||||||
|
if (onItem) emitItem(item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// 4. Fetch full event data for nostr articles
|
||||||
|
const articleCoordinates = Array.from(readsMap.values())
|
||||||
|
.filter(item => item.type === 'article' && !item.event)
|
||||||
|
.map(item => item.id)
|
||||||
|
|
||||||
|
if (articleCoordinates.length > 0) {
|
||||||
|
console.log('📖 [Reads] Fetching article events for', articleCoordinates.length, 'articles')
|
||||||
|
|
||||||
|
// Parse coordinates and fetch events
|
||||||
|
const articlesToFetch: Array<{ pubkey: string; identifier: string }> = []
|
||||||
|
|
||||||
|
for (const coord of articleCoordinates) {
|
||||||
|
try {
|
||||||
|
// Try to decode as naddr
|
||||||
|
if (coord.startsWith('naddr1')) {
|
||||||
|
const decoded = nip19.decode(coord)
|
||||||
|
if (decoded.type === 'naddr' && decoded.data.kind === KINDS.BlogPost) {
|
||||||
|
articlesToFetch.push({
|
||||||
|
pubkey: decoded.data.pubkey,
|
||||||
|
identifier: decoded.data.identifier || ''
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// Try coordinate format (kind:pubkey:identifier)
|
||||||
|
const parts = coord.split(':')
|
||||||
|
if (parts.length === 3 && parseInt(parts[0]) === KINDS.BlogPost) {
|
||||||
|
articlesToFetch.push({
|
||||||
|
pubkey: parts[1],
|
||||||
|
identifier: parts[2]
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Failed to decode article coordinate:', coord)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (articlesToFetch.length > 0) {
|
||||||
|
const authors = Array.from(new Set(articlesToFetch.map(a => a.pubkey)))
|
||||||
|
const identifiers = Array.from(new Set(articlesToFetch.map(a => a.identifier)))
|
||||||
|
|
||||||
|
const events = await queryEvents(
|
||||||
|
relayPool,
|
||||||
|
{ kinds: [KINDS.BlogPost], authors, '#d': identifiers },
|
||||||
|
{ relayUrls: RELAYS }
|
||||||
|
)
|
||||||
|
|
||||||
|
// Merge event data into ReadItems and emit
|
||||||
|
for (const event of events) {
|
||||||
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${KINDS.BlogPost}:${event.pubkey}:${dTag}`
|
||||||
|
|
||||||
|
const item = readsMap.get(coordinate) || readsMap.get(event.id)
|
||||||
|
if (item) {
|
||||||
|
item.event = event
|
||||||
|
item.title = getArticleTitle(event) || 'Untitled'
|
||||||
|
item.summary = getArticleSummary(event)
|
||||||
|
item.image = getArticleImage(event)
|
||||||
|
item.published = getArticlePublished(event)
|
||||||
|
item.author = event.pubkey
|
||||||
|
if (onItem) emitItem(item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// 5. Filter for Nostr articles only and apply common validation/sorting
|
||||||
|
const articles = Array.from(readsMap.values())
|
||||||
|
.filter(item => item.type === 'article')
|
||||||
|
|
||||||
|
const validArticles = filterValidItems(articles)
|
||||||
|
const sortedReads = sortByReadingActivity(validArticles)
|
||||||
|
|
||||||
|
console.log('✅ [Reads] Processed', sortedReads.length, 'total reads')
|
||||||
|
return sortedReads
|
||||||
|
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to fetch all reads:', error)
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -3,6 +3,7 @@ import { EventFactory } from 'applesauce-factory'
|
|||||||
import { RelayPool, onlyEvents } from 'applesauce-relay'
|
import { RelayPool, onlyEvents } from 'applesauce-relay'
|
||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { firstValueFrom } from 'rxjs'
|
import { firstValueFrom } from 'rxjs'
|
||||||
|
import { publishEvent } from './writeService'
|
||||||
|
|
||||||
const SETTINGS_IDENTIFIER = 'com.dergigi.boris.user-settings'
|
const SETTINGS_IDENTIFIER = 'com.dergigi.boris.user-settings'
|
||||||
const APP_DATA_KIND = 30078 // NIP-78 Application Data
|
const APP_DATA_KIND = 30078 // NIP-78 Application Data
|
||||||
@@ -51,6 +52,10 @@ export interface UserSettings {
|
|||||||
theme?: 'dark' | 'light' | 'system' // default: system
|
theme?: 'dark' | 'light' | 'system' // default: system
|
||||||
darkColorTheme?: 'black' | 'midnight' | 'charcoal' // default: midnight
|
darkColorTheme?: 'black' | 'midnight' | 'charcoal' // default: midnight
|
||||||
lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
|
lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
|
||||||
|
// Reading settings
|
||||||
|
paragraphAlignment?: 'left' | 'justify' // default: justify
|
||||||
|
// Reading position sync
|
||||||
|
syncReadingPosition?: boolean // default: false (opt-in)
|
||||||
}
|
}
|
||||||
|
|
||||||
export async function loadSettings(
|
export async function loadSettings(
|
||||||
@@ -147,11 +152,10 @@ export async function saveSettings(
|
|||||||
relayPool: RelayPool,
|
relayPool: RelayPool,
|
||||||
eventStore: IEventStore,
|
eventStore: IEventStore,
|
||||||
factory: EventFactory,
|
factory: EventFactory,
|
||||||
settings: UserSettings,
|
settings: UserSettings
|
||||||
relays: string[]
|
|
||||||
): Promise<void> {
|
): Promise<void> {
|
||||||
console.log('💾 Saving settings to nostr:', settings)
|
console.log('💾 Saving settings to nostr:', settings)
|
||||||
|
|
||||||
// Create NIP-78 application data event manually
|
// Create NIP-78 application data event manually
|
||||||
// Note: AppDataBlueprint is not available in the npm package
|
// Note: AppDataBlueprint is not available in the npm package
|
||||||
const draft = await factory.create(async () => ({
|
const draft = await factory.create(async () => ({
|
||||||
@@ -160,14 +164,12 @@ export async function saveSettings(
|
|||||||
tags: [['d', SETTINGS_IDENTIFIER]],
|
tags: [['d', SETTINGS_IDENTIFIER]],
|
||||||
created_at: Math.floor(Date.now() / 1000)
|
created_at: Math.floor(Date.now() / 1000)
|
||||||
}))
|
}))
|
||||||
|
|
||||||
const signed = await factory.sign(draft)
|
const signed = await factory.sign(draft)
|
||||||
|
|
||||||
console.log('📤 Publishing settings event:', signed.id, 'to', relays.length, 'relays')
|
// Use unified write service
|
||||||
|
await publishEvent(relayPool, eventStore, signed)
|
||||||
eventStore.add(signed)
|
|
||||||
await relayPool.publish(relays, signed)
|
|
||||||
|
|
||||||
console.log('✅ Settings published successfully')
|
console.log('✅ Settings published successfully')
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
62
src/services/writeService.ts
Normal file
62
src/services/writeService.ts
Normal file
@@ -0,0 +1,62 @@
|
|||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { IEventStore } from 'applesauce-core'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { isLocalRelay, areAllRelaysLocal } from '../utils/helpers'
|
||||||
|
import { markEventAsOfflineCreated } from './offlineSyncService'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unified write helper: add event to EventStore, detect connectivity,
|
||||||
|
* mark for offline sync if needed, and publish in background.
|
||||||
|
*/
|
||||||
|
export async function publishEvent(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
eventStore: IEventStore,
|
||||||
|
event: NostrEvent
|
||||||
|
): Promise<void> {
|
||||||
|
// Store the event in the local EventStore FIRST for immediate UI display
|
||||||
|
eventStore.add(event)
|
||||||
|
console.log('💾 Stored event in EventStore:', event.id.slice(0, 8), `(kind ${event.kind})`)
|
||||||
|
|
||||||
|
// Check current connection status - are we online or in flight mode?
|
||||||
|
const connectedRelays = Array.from(relayPool.relays.values())
|
||||||
|
.filter(relay => relay.connected)
|
||||||
|
.map(relay => relay.url)
|
||||||
|
|
||||||
|
const hasRemoteConnection = connectedRelays.some(url => !isLocalRelay(url))
|
||||||
|
|
||||||
|
// Determine which relays we expect to succeed
|
||||||
|
const expectedSuccessRelays = hasRemoteConnection
|
||||||
|
? RELAYS
|
||||||
|
: RELAYS.filter(isLocalRelay)
|
||||||
|
|
||||||
|
const isLocalOnly = areAllRelaysLocal(expectedSuccessRelays)
|
||||||
|
|
||||||
|
console.log('📍 Event relay status:', {
|
||||||
|
targetRelays: RELAYS.length,
|
||||||
|
expectedSuccessRelays: expectedSuccessRelays.length,
|
||||||
|
isLocalOnly,
|
||||||
|
hasRemoteConnection,
|
||||||
|
eventId: event.id.slice(0, 8)
|
||||||
|
})
|
||||||
|
|
||||||
|
// If we're in local-only mode, mark this event for later sync
|
||||||
|
if (isLocalOnly) {
|
||||||
|
markEventAsOfflineCreated(event.id)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Publish to all configured relays in the background (non-blocking)
|
||||||
|
relayPool.publish(RELAYS, event)
|
||||||
|
.then(() => {
|
||||||
|
console.log('✅ Event published to', RELAYS.length, 'relay(s):', event.id.slice(0, 8))
|
||||||
|
})
|
||||||
|
.catch((error) => {
|
||||||
|
console.warn('⚠️ Failed to publish event to relays (event still saved locally):', error)
|
||||||
|
|
||||||
|
// Surface common bunker signing errors for debugging
|
||||||
|
if (error instanceof Error && error.message.includes('permission')) {
|
||||||
|
console.warn('💡 Hint: This may be a bunker permission issue. Ensure your bunker connection has signing permissions.')
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
127
src/services/zapReceiptService.ts
Normal file
127
src/services/zapReceiptService.ts
Normal file
@@ -0,0 +1,127 @@
|
|||||||
|
import { RelayPool, completeOnEose, onlyEvents } from 'applesauce-relay'
|
||||||
|
import { lastValueFrom, merge, Observable, takeUntil, timer, toArray } from 'rxjs'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { isValidZap, getZapSender, getZapAmount } from 'applesauce-core/helpers'
|
||||||
|
import { prioritizeLocalRelays, partitionRelays } from '../utils/helpers'
|
||||||
|
import { BORIS_PUBKEY } from './highlightCreationService'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
|
||||||
|
export interface ZapSender {
|
||||||
|
pubkey: string
|
||||||
|
totalSats: number
|
||||||
|
zapCount: number
|
||||||
|
isWhale: boolean // >= 69420 sats
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fetches zap receipts (kind:9735) for Boris and aggregates by sender
|
||||||
|
* @param relayPool - The relay pool to query
|
||||||
|
* @returns Array of senders who zapped >= 2100 sats, sorted by total desc
|
||||||
|
*/
|
||||||
|
export async function fetchBorisZappers(
|
||||||
|
relayPool: RelayPool
|
||||||
|
): Promise<ZapSender[]> {
|
||||||
|
try {
|
||||||
|
console.log('⚡ Fetching zap receipts for Boris...', BORIS_PUBKEY)
|
||||||
|
|
||||||
|
// Use all configured relays plus specific zap-heavy relays
|
||||||
|
const zapRelays = [
|
||||||
|
...RELAYS,
|
||||||
|
'wss://nostr.mutinywallet.com', // Common zap relay
|
||||||
|
'wss://relay.getalby.com/v1', // Alby zap relay
|
||||||
|
]
|
||||||
|
const prioritized = prioritizeLocalRelays(zapRelays)
|
||||||
|
const { local: localRelays, remote: remoteRelays } = partitionRelays(prioritized)
|
||||||
|
|
||||||
|
// Fetch zap receipts with Boris as recipient
|
||||||
|
const filter = {
|
||||||
|
kinds: [9735],
|
||||||
|
'#p': [BORIS_PUBKEY]
|
||||||
|
}
|
||||||
|
|
||||||
|
const local$ = localRelays.length > 0
|
||||||
|
? relayPool
|
||||||
|
.req(localRelays, filter)
|
||||||
|
.pipe(
|
||||||
|
onlyEvents(),
|
||||||
|
completeOnEose(),
|
||||||
|
takeUntil(timer(1200))
|
||||||
|
)
|
||||||
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
|
|
||||||
|
const remote$ = remoteRelays.length > 0
|
||||||
|
? relayPool
|
||||||
|
.req(remoteRelays, filter)
|
||||||
|
.pipe(
|
||||||
|
onlyEvents(),
|
||||||
|
completeOnEose(),
|
||||||
|
takeUntil(timer(6000))
|
||||||
|
)
|
||||||
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
|
|
||||||
|
const zapReceipts = await lastValueFrom(
|
||||||
|
merge(local$, remote$).pipe(toArray())
|
||||||
|
)
|
||||||
|
|
||||||
|
console.log(`📊 Fetched ${zapReceipts.length} raw zap receipts`)
|
||||||
|
|
||||||
|
// Dedupe by event ID and validate
|
||||||
|
const uniqueReceipts = new Map<string, NostrEvent>()
|
||||||
|
let invalidCount = 0
|
||||||
|
|
||||||
|
zapReceipts.forEach(receipt => {
|
||||||
|
if (!uniqueReceipts.has(receipt.id)) {
|
||||||
|
if (isValidZap(receipt)) {
|
||||||
|
uniqueReceipts.set(receipt.id, receipt)
|
||||||
|
} else {
|
||||||
|
invalidCount++
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
console.log(`✅ ${uniqueReceipts.size} valid zap receipts (${invalidCount} invalid)`)
|
||||||
|
|
||||||
|
// Aggregate by sender using applesauce helpers
|
||||||
|
const senderTotals = new Map<string, { totalSats: number; zapCount: number }>()
|
||||||
|
|
||||||
|
for (const receipt of uniqueReceipts.values()) {
|
||||||
|
const senderPubkey = getZapSender(receipt)
|
||||||
|
const amountMsats = getZapAmount(receipt)
|
||||||
|
|
||||||
|
if (!senderPubkey || !amountMsats || amountMsats === 0) {
|
||||||
|
console.warn('Invalid zap receipt - missing sender or amount:', receipt.id)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
const amountSats = Math.floor(amountMsats / 1000)
|
||||||
|
|
||||||
|
const existing = senderTotals.get(senderPubkey) || { totalSats: 0, zapCount: 0 }
|
||||||
|
senderTotals.set(senderPubkey, {
|
||||||
|
totalSats: existing.totalSats + amountSats,
|
||||||
|
zapCount: existing.zapCount + 1
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`👥 Found ${senderTotals.size} unique senders`)
|
||||||
|
|
||||||
|
// Filter >= 2100 sats, mark whales >= 69420 sats, sort by total desc
|
||||||
|
const zappers: ZapSender[] = Array.from(senderTotals.entries())
|
||||||
|
.filter(([, data]) => data.totalSats >= 2100)
|
||||||
|
.map(([pubkey, data]) => ({
|
||||||
|
pubkey,
|
||||||
|
totalSats: data.totalSats,
|
||||||
|
zapCount: data.zapCount,
|
||||||
|
isWhale: data.totalSats >= 69420
|
||||||
|
}))
|
||||||
|
.sort((a, b) => b.totalSats - a.totalSats)
|
||||||
|
|
||||||
|
console.log(`✅ Found ${zappers.length} supporters (${zappers.filter(z => z.isWhale).length} whales)`)
|
||||||
|
|
||||||
|
return zappers
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to fetch zap receipts:', error)
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -7,6 +7,27 @@
|
|||||||
.bookmark-content { color: var(--color-text); margin: 0.5rem 0; line-height: 1.4; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; }
|
.bookmark-content { color: var(--color-text); margin: 0.5rem 0; line-height: 1.4; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; }
|
||||||
.bookmark-meta { color: var(--color-text-secondary); font-size: 0.9rem; margin-top: 0.5rem; }
|
.bookmark-meta { color: var(--color-text-secondary); font-size: 0.9rem; margin-top: 0.5rem; }
|
||||||
|
|
||||||
|
.bookmarks-section-title {
|
||||||
|
font-size: 0.75rem !important;
|
||||||
|
font-weight: 700 !important;
|
||||||
|
text-transform: uppercase !important;
|
||||||
|
letter-spacing: 0.05em !important;
|
||||||
|
color: var(--color-text-muted) !important;
|
||||||
|
padding: 1.5rem 0.5rem 0.375rem !important;
|
||||||
|
margin: 0 !important;
|
||||||
|
border-top: 1px solid rgba(255, 255, 255, 0.05);
|
||||||
|
}
|
||||||
|
.bookmarks-section:first-of-type .bookmarks-section-title {
|
||||||
|
border-top: none;
|
||||||
|
padding-top: 0.5rem !important;
|
||||||
|
}
|
||||||
|
.bookmark-section-action {
|
||||||
|
padding: 1.5rem 0.5rem 0.375rem;
|
||||||
|
}
|
||||||
|
.bookmarks-section:first-of-type .bookmark-section-action {
|
||||||
|
padding-top: 0.5rem;
|
||||||
|
}
|
||||||
|
|
||||||
.individual-bookmarks { margin: 1rem 0; }
|
.individual-bookmarks { margin: 1rem 0; }
|
||||||
.individual-bookmarks h4 { margin: 0 0 1rem 0; font-size: 1rem; color: var(--color-text); }
|
.individual-bookmarks h4 { margin: 0 0 1rem 0; font-size: 1rem; color: var(--color-text); }
|
||||||
|
|
||||||
@@ -23,8 +44,8 @@
|
|||||||
.individual-bookmark:hover { border-color: var(--color-border); background: var(--color-bg-elevated); }
|
.individual-bookmark:hover { border-color: var(--color-border); background: var(--color-bg-elevated); }
|
||||||
|
|
||||||
/* Compact view */
|
/* Compact view */
|
||||||
.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none; border-bottom: 1px solid var(--color-bg-elevated); border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
|
.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none !important; border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
|
||||||
.individual-bookmark.compact:hover { background: var(--color-bg-elevated); border-bottom-color: var(--color-border); transform: none; box-shadow: none; }
|
.individual-bookmark.compact:hover { background: var(--color-bg-elevated); transform: none; box-shadow: none; border: none !important; }
|
||||||
.compact-row { display: flex; align-items: center; gap: 0.5rem; height: 28px; width: 100%; min-width: 0; overflow: hidden; }
|
.compact-row { display: flex; align-items: center; gap: 0.5rem; height: 28px; width: 100%; min-width: 0; overflow: hidden; }
|
||||||
.compact-thumbnail { width: 24px; height: 24px; flex-shrink: 0; border-radius: 4px; overflow: hidden; background: var(--color-bg-elevated); display: flex; align-items: center; justify-content: center; }
|
.compact-thumbnail { width: 24px; height: 24px; flex-shrink: 0; border-radius: 4px; overflow: hidden; background: var(--color-bg-elevated); display: flex; align-items: center; justify-content: center; }
|
||||||
.compact-thumbnail img { width: 100%; height: 100%; object-fit: cover; }
|
.compact-thumbnail img { width: 100%; height: 100%; object-fit: cover; }
|
||||||
@@ -57,10 +78,10 @@
|
|||||||
|
|
||||||
/* Large preview view */
|
/* Large preview view */
|
||||||
.individual-bookmark.large { padding: 0; display: flex; flex-direction: column; overflow: hidden; border: 1px solid var(--color-bg-elevated); }
|
.individual-bookmark.large { padding: 0; display: flex; flex-direction: column; overflow: hidden; border: 1px solid var(--color-bg-elevated); }
|
||||||
.large-preview-image { width: 100%; height: 180px; background: var(--color-bg); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
|
.large-preview-image { width: 100%; height: 180px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
|
||||||
.large-preview-image:hover { opacity: 0.9; }
|
.large-preview-image:hover { opacity: 0.9; }
|
||||||
.large-preview-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.3) 100%); pointer-events: none; }
|
.large-preview-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.3) 100%); pointer-events: none; }
|
||||||
.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); }
|
.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; }
|
||||||
.large-content { padding: 1.25rem; }
|
.large-content { padding: 1.25rem; }
|
||||||
.large-text { color: var(--color-text); font-size: 0.95rem; line-height: 1.6; margin-bottom: 1rem; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
|
.large-text { color: var(--color-text); font-size: 0.95rem; line-height: 1.6; margin-bottom: 1rem; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
|
||||||
.large-footer { display: flex; align-items: center; gap: 1rem; flex-wrap: wrap; font-size: 0.8rem; color: var(--color-text-secondary); padding-top: 0.75rem; border-top: 1px solid var(--color-border); }
|
.large-footer { display: flex; align-items: center; gap: 1rem; flex-wrap: wrap; font-size: 0.8rem; color: var(--color-text-secondary); padding-top: 0.75rem; border-top: 1px solid var(--color-border); }
|
||||||
@@ -81,10 +102,13 @@
|
|||||||
.explore-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(320px, 1fr)); gap: 2rem; margin-top: 2rem; }
|
.explore-grid { display: grid; grid-template-columns: repeat(auto-fill, minmax(320px, 1fr)); gap: 2rem; margin-top: 2rem; }
|
||||||
.blog-post-card { background: var(--color-bg); border: 1px solid var(--color-border); border-radius: 12px; overflow: hidden; transition: all 0.3s ease; cursor: pointer; display: flex; flex-direction: column; height: 100%; }
|
.blog-post-card { background: var(--color-bg); border: 1px solid var(--color-border); border-radius: 12px; overflow: hidden; transition: all 0.3s ease; cursor: pointer; display: flex; flex-direction: column; height: 100%; }
|
||||||
.blog-post-card:hover { border-color: var(--color-primary); transform: translateY(-4px); box-shadow: 0 8px 24px rgba(99, 102, 241, 0.15); }
|
.blog-post-card:hover { border-color: var(--color-primary); transform: translateY(-4px); box-shadow: 0 8px 24px rgba(99, 102, 241, 0.15); }
|
||||||
.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: var(--color-bg-subtle); display: flex; align-items: center; justify-content: center; }
|
.blog-post-card.level-mine { border-color: color-mix(in srgb, var(--highlight-color-mine, #fde047) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-mine, #fde047) 25%, transparent); }
|
||||||
|
.blog-post-card.level-friends { border-color: color-mix(in srgb, var(--highlight-color-friends, #f97316) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-friends, #f97316) 25%, transparent); }
|
||||||
|
.blog-post-card.level-nostrverse { border-color: color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 25%, transparent); }
|
||||||
|
.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); display: flex; align-items: center; justify-content: center; position: relative; }
|
||||||
.blog-post-card-image img { width: 100%; height: 100%; object-fit: cover; transition: transform 0.3s ease; }
|
.blog-post-card-image img { width: 100%; height: 100%; object-fit: cover; transition: transform 0.3s ease; }
|
||||||
.blog-post-card:hover .blog-post-card-image img { transform: scale(1.05); }
|
.blog-post-card:hover .blog-post-card-image img { transform: scale(1.05); }
|
||||||
.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); display: flex; align-items: center; justify-content: center; }
|
.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; display: flex; align-items: center; justify-content: center; width: 100%; height: 100%; }
|
||||||
.blog-post-card-content { padding: 1.5rem; display: flex; flex-direction: column; gap: 1rem; flex: 1; }
|
.blog-post-card-content { padding: 1.5rem; display: flex; flex-direction: column; gap: 1rem; flex: 1; }
|
||||||
.blog-post-card-title { font-size: 1.25rem; font-weight: 600; margin: 0; color: var(--color-text); line-height: 1.4; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
|
.blog-post-card-title { font-size: 1.25rem; font-weight: 600; margin: 0; color: var(--color-text); line-height: 1.4; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
|
||||||
.blog-post-card-summary { font-size: 0.875rem; color: var(--color-text-secondary); margin: 0; line-height: 1.6; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; flex: 1; }
|
.blog-post-card-summary { font-size: 0.875rem; color: var(--color-text-secondary); margin: 0; line-height: 1.6; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; flex: 1; }
|
||||||
|
|||||||
@@ -3,7 +3,7 @@
|
|||||||
.setting-group.setting-inline { display: flex; align-items: center; gap: 1rem; }
|
.setting-group.setting-inline { display: flex; align-items: center; gap: 1rem; }
|
||||||
.setting-label { text-align: left; flex: 1; }
|
.setting-label { text-align: left; flex: 1; }
|
||||||
.setting-control { display: flex; justify-content: flex-end; align-items: center; }
|
.setting-control { display: flex; justify-content: flex-end; align-items: center; }
|
||||||
.setting-group.setting-inline label { margin-bottom: 0; }
|
.setting-group.setting-inline label { margin-bottom: 0; min-width: 220px; }
|
||||||
.setting-group label { display: block; margin-bottom: 0.5rem; color: var(--color-text); font-weight: 500; text-align: left; }
|
.setting-group label { display: block; margin-bottom: 0.5rem; color: var(--color-text); font-weight: 500; text-align: left; }
|
||||||
.setting-buttons { display: flex; align-items: center; gap: 0.5rem; }
|
.setting-buttons { display: flex; align-items: center; gap: 0.5rem; }
|
||||||
.color-picker { display: flex; align-items: center; gap: 0.5rem; }
|
.color-picker { display: flex; align-items: center; gap: 0.5rem; }
|
||||||
@@ -41,6 +41,7 @@
|
|||||||
.preview-content p {
|
.preview-content p {
|
||||||
margin: 0.75rem 0;
|
margin: 0.75rem 0;
|
||||||
word-wrap: break-word;
|
word-wrap: break-word;
|
||||||
|
text-align: var(--paragraph-alignment, justify);
|
||||||
}
|
}
|
||||||
.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
|
.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
|
||||||
.setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
|
.setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
|
||||||
@@ -58,6 +59,10 @@
|
|||||||
gap: 0.75rem;
|
gap: 0.75rem;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.setting-group.setting-inline label {
|
||||||
|
min-width: unset;
|
||||||
|
}
|
||||||
|
|
||||||
.setting-inline .setting-select {
|
.setting-inline .setting-select {
|
||||||
width: 100%;
|
width: 100%;
|
||||||
min-width: unset;
|
min-width: unset;
|
||||||
|
|||||||
@@ -67,6 +67,10 @@
|
|||||||
width: 100%;
|
width: 100%;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.me-tab-content:has(.bookmark-filters) {
|
||||||
|
padding-top: 0.25rem;
|
||||||
|
}
|
||||||
|
|
||||||
/* Align highlight list width with profile card width on /me */
|
/* Align highlight list width with profile card width on /me */
|
||||||
.me-highlights-list { padding-left: 0; padding-right: 0; }
|
.me-highlights-list { padding-left: 0; padding-right: 0; }
|
||||||
.explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
|
.explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
|
||||||
@@ -79,6 +83,15 @@
|
|||||||
text-align: left; /* Override center alignment from .app */
|
text-align: left; /* Override center alignment from .app */
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/* Bookmark filters in Me page */
|
||||||
|
.me-tab-content .bookmark-filters {
|
||||||
|
background: transparent;
|
||||||
|
border: none;
|
||||||
|
padding: 0;
|
||||||
|
justify-content: center;
|
||||||
|
margin-bottom: 0.25rem;
|
||||||
|
}
|
||||||
|
|
||||||
/* Ensure all reading list elements are left-aligned */
|
/* Ensure all reading list elements are left-aligned */
|
||||||
.bookmarks-list .individual-bookmark,
|
.bookmarks-list .individual-bookmark,
|
||||||
.bookmarks-list .individual-bookmark * {
|
.bookmarks-list .individual-bookmark * {
|
||||||
|
|||||||
@@ -25,3 +25,23 @@
|
|||||||
.btn-primary:hover:not(:disabled) { background: var(--color-primary-hover); }
|
.btn-primary:hover:not(:disabled) { background: var(--color-primary-hover); }
|
||||||
.btn-primary:disabled { opacity: 0.6; cursor: not-allowed; }
|
.btn-primary:disabled { opacity: 0.6; cursor: not-allowed; }
|
||||||
|
|
||||||
|
/* Confirm Dialog */
|
||||||
|
.confirm-dialog-overlay { position: fixed; inset: 0; background: rgba(0, 0, 0, 0.7); backdrop-filter: blur(4px); display: flex; align-items: center; justify-content: center; z-index: 10000; padding: 1rem; }
|
||||||
|
.confirm-dialog { background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 12px; max-width: 400px; width: 100%; padding: 1.5rem; box-shadow: 0 8px 32px rgba(0, 0, 0, 0.5); }
|
||||||
|
.confirm-dialog-icon { display: flex; align-items: center; justify-content: center; width: 48px; height: 48px; border-radius: 50%; margin: 0 auto 1rem; font-size: 1.5rem; }
|
||||||
|
.confirm-dialog-icon.danger { background: rgba(220, 38, 38, 0.1); color: rgb(220 38 38); }
|
||||||
|
.confirm-dialog-icon.warning { background: rgba(251, 191, 36, 0.1); color: rgb(251 191 36); }
|
||||||
|
.confirm-dialog-icon.info { background: rgba(59, 130, 246, 0.1); color: rgb(59 130 246); }
|
||||||
|
.confirm-dialog-title { margin: 0 0 0.5rem 0; font-size: 1.25rem; font-weight: 600; color: var(--color-text); text-align: center; }
|
||||||
|
.confirm-dialog-message { margin: 0 0 1.5rem 0; font-size: 0.9rem; color: var(--color-text-secondary); text-align: center; line-height: 1.5; }
|
||||||
|
.confirm-dialog-actions { display: flex; gap: 0.75rem; }
|
||||||
|
.confirm-dialog-btn { flex: 1; padding: 0.75rem 1rem; border: none; border-radius: 8px; font-size: 0.9rem; font-weight: 500; cursor: pointer; transition: all 0.2s; }
|
||||||
|
.confirm-dialog-btn.cancel { background: var(--color-bg); border: 1px solid var(--color-border); color: var(--color-text); }
|
||||||
|
.confirm-dialog-btn.cancel:hover { background: var(--color-border); }
|
||||||
|
.confirm-dialog-btn.confirm.danger { background: rgb(220 38 38); color: white; }
|
||||||
|
.confirm-dialog-btn.confirm.danger:hover { background: rgb(185 28 28); }
|
||||||
|
.confirm-dialog-btn.confirm.warning { background: rgb(251 191 36); color: rgb(17 24 39); }
|
||||||
|
.confirm-dialog-btn.confirm.warning:hover { background: rgb(245 158 11); }
|
||||||
|
.confirm-dialog-btn.confirm.info { background: rgb(59 130 246); color: white; }
|
||||||
|
.confirm-dialog-btn.confirm.info:hover { background: rgb(37 99 235); }
|
||||||
|
|
||||||
|
|||||||
@@ -30,16 +30,29 @@
|
|||||||
.reader-meta { display: flex; align-items: center; gap: 0.75rem; flex-wrap: wrap; }
|
.reader-meta { display: flex; align-items: center; gap: 0.75rem; flex-wrap: wrap; }
|
||||||
.publish-date { display: flex; align-items: center; gap: 0.4rem; font-size: 0.813rem; color: var(--color-text-muted); opacity: 0.85; }
|
.publish-date { display: flex; align-items: center; gap: 0.4rem; font-size: 0.813rem; color: var(--color-text-muted); opacity: 0.85; }
|
||||||
.publish-date svg { font-size: 0.75rem; opacity: 0.6; }
|
.publish-date svg { font-size: 0.75rem; opacity: 0.6; }
|
||||||
.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; text-shadow: 0 2px 4px rgba(0, 0, 0, 0.5); z-index: 10; }
|
.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; z-index: 10; }
|
||||||
.reading-time { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 6px; font-size: 0.875rem; color: var(--color-text-secondary); }
|
.reading-time { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 6px; font-size: 0.875rem; color: var(--color-text-secondary); }
|
||||||
.reading-time svg { font-size: 0.875rem; }
|
.reading-time svg { font-size: 0.875rem; }
|
||||||
.highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
|
.highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
|
||||||
.highlight-indicator svg { font-size: 0.875rem; }
|
.highlight-indicator svg { font-size: 0.875rem; }
|
||||||
.reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
.reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
||||||
.reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
.reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
||||||
/* Ensure content is left-aligned even if source markup uses center */
|
/* Ensure font inheritance */
|
||||||
.reader .reader-html *, .reader .reader-markdown * { text-align: left !important; font-family: inherit !important; }
|
.reader .reader-html *, .reader .reader-markdown * { font-family: inherit !important; }
|
||||||
.reader center, .reader [align="center"] { text-align: left !important; }
|
/* Apply paragraph alignment from settings */
|
||||||
|
.reader .reader-html p,
|
||||||
|
.reader .reader-markdown p,
|
||||||
|
.reader .reader-html div,
|
||||||
|
.reader .reader-markdown div,
|
||||||
|
.reader .reader-html li,
|
||||||
|
.reader .reader-markdown li,
|
||||||
|
.reader .reader-html blockquote,
|
||||||
|
.reader .reader-markdown blockquote { text-align: var(--paragraph-alignment, justify); }
|
||||||
|
/* Override centered content with user preference */
|
||||||
|
.reader center, .reader [align="center"] { text-align: var(--paragraph-alignment, justify) !important; }
|
||||||
|
/* Keep headings left-aligned */
|
||||||
|
.reader .reader-html h1, .reader .reader-html h2, .reader .reader-html h3, .reader .reader-html h4, .reader .reader-html h5, .reader .reader-html h6,
|
||||||
|
.reader .reader-markdown h1, .reader .reader-markdown h2, .reader .reader-markdown h3, .reader .reader-markdown h4, .reader .reader-markdown h5, .reader .reader-markdown h6 { text-align: left !important; }
|
||||||
/* Tame images from external content */
|
/* Tame images from external content */
|
||||||
.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
|
.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
|
||||||
/* Headlines with Tailwind typography */
|
/* Headlines with Tailwind typography */
|
||||||
@@ -128,6 +141,13 @@
|
|||||||
.reader-markdown blockquote p, .reader-html blockquote p { margin: 0.5rem 0; }
|
.reader-markdown blockquote p, .reader-html blockquote p { margin: 0.5rem 0; }
|
||||||
.reader-markdown blockquote p:first-child, .reader-html blockquote p:first-child { margin-top: 0; }
|
.reader-markdown blockquote p:first-child, .reader-html blockquote p:first-child { margin-top: 0; }
|
||||||
.reader-markdown blockquote p:last-child, .reader-html blockquote p:last-child { margin-bottom: 0; }
|
.reader-markdown blockquote p:last-child, .reader-html blockquote p:last-child { margin-bottom: 0; }
|
||||||
|
/* Horizontal rule - subtle divider */
|
||||||
|
.reader-markdown hr, .reader-html hr {
|
||||||
|
border: none;
|
||||||
|
border-top: 1px solid var(--color-border);
|
||||||
|
opacity: 0.69;
|
||||||
|
margin: 2.5rem 0;
|
||||||
|
}
|
||||||
.reader-markdown a { color: var(--color-primary); text-decoration: none; }
|
.reader-markdown a { color: var(--color-primary); text-decoration: none; }
|
||||||
.reader-markdown a:hover { text-decoration: underline; }
|
.reader-markdown a:hover { text-decoration: underline; }
|
||||||
.reader-markdown code { background: var(--color-bg-subtle); border: 1px solid var(--color-border); border-radius: 4px; padding: 0.15rem 0.4rem; font-size: 0.9em; font-family: 'Monaco', 'Menlo', 'Consolas', 'Courier New', monospace; }
|
.reader-markdown code { background: var(--color-bg-subtle); border: 1px solid var(--color-border); border-radius: 4px; padding: 0.15rem 0.4rem; font-size: 0.9em; font-family: 'Monaco', 'Menlo', 'Consolas', 'Courier New', monospace; }
|
||||||
@@ -185,6 +205,7 @@
|
|||||||
.article-menu-btn { background: none; border: none; color: var(--color-text-secondary); cursor: pointer; padding: 0.5rem 0.75rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.5rem; transition: all 0.2s ease; border-radius: 6px; }
|
.article-menu-btn { background: none; border: none; color: var(--color-text-secondary); cursor: pointer; padding: 0.5rem 0.75rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.5rem; transition: all 0.2s ease; border-radius: 6px; }
|
||||||
.article-menu-btn:hover { color: var(--color-primary); background: rgba(99, 102, 241, 0.1); }
|
.article-menu-btn:hover { color: var(--color-primary); background: rgba(99, 102, 241, 0.1); }
|
||||||
.article-menu { position: absolute; right: 0; top: calc(100% + 4px); background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 6px; box-shadow: 0 4px 12px rgba(0, 0, 0, 0.3); z-index: 1000; min-width: 180px; overflow: hidden; }
|
.article-menu { position: absolute; right: 0; top: calc(100% + 4px); background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 6px; box-shadow: 0 4px 12px rgba(0, 0, 0, 0.3); z-index: 1000; min-width: 180px; overflow: hidden; }
|
||||||
|
.article-menu.open-upward { top: auto; bottom: calc(100% + 4px); }
|
||||||
.article-menu-item { width: 100%; background: none; border: none; color: var(--color-text); padding: 0.75rem 1rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.75rem; cursor: pointer; transition: all 0.15s ease; text-align: left; white-space: nowrap; }
|
.article-menu-item { width: 100%; background: none; border: none; color: var(--color-text); padding: 0.75rem 1rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.75rem; cursor: pointer; transition: all 0.15s ease; text-align: left; white-space: nowrap; }
|
||||||
.article-menu-item:hover { background: rgba(99, 102, 241, 0.15); color: var(--color-text); }
|
.article-menu-item:hover { background: rgba(99, 102, 241, 0.15); color: var(--color-text); }
|
||||||
.article-menu-item svg { font-size: 0.875rem; flex-shrink: 0; }
|
.article-menu-item svg { font-size: 0.875rem; flex-shrink: 0; }
|
||||||
@@ -214,8 +235,9 @@
|
|||||||
.article-hero-image { width: 100%; height: 200px; background-size: cover; background-position: center; background-repeat: no-repeat; cursor: pointer; transition: all 0.2s ease; border-radius: 8px 8px 0 0; position: relative; }
|
.article-hero-image { width: 100%; height: 200px; background-size: cover; background-position: center; background-repeat: no-repeat; cursor: pointer; transition: all 0.2s ease; border-radius: 8px 8px 0 0; position: relative; }
|
||||||
.article-hero-image:hover { opacity: 0.9; }
|
.article-hero-image:hover { opacity: 0.9; }
|
||||||
.article-hero-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.4) 100%); pointer-events: none; border-radius: 8px 8px 0 0; }
|
.article-hero-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.4) 100%); pointer-events: none; border-radius: 8px 8px 0 0; }
|
||||||
.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; }
|
.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 25%, var(--color-bg-elevated) 50%, var(--color-bg-subtle) 75%, var(--color-bg-elevated) 100%); }
|
||||||
.reader-hero-image img { width: 100%; height: auto; max-height: 500px; object-fit: cover; display: block; }
|
.reader-hero-image img { width: 100%; height: auto; max-height: 500px; object-fit: cover; display: block; }
|
||||||
|
.reader-hero-placeholder { width: 100%; height: 300px; display: flex; align-items: center; justify-content: center; font-size: 4rem; color: var(--color-border-subtle); opacity: 0.3; }
|
||||||
.reader-header-overlay { position: absolute; bottom: 0; left: 0; right: 0; padding: 2rem 2rem 1.5rem; background: linear-gradient(to top, rgba(0, 0, 0, 0.85) 0%, rgba(0, 0, 0, 0.6) 60%, rgba(0, 0, 0, 0) 100%); }
|
.reader-header-overlay { position: absolute; bottom: 0; left: 0; right: 0; padding: 2rem 2rem 1.5rem; background: linear-gradient(to top, rgba(0, 0, 0, 0.85) 0%, rgba(0, 0, 0, 0.6) 60%, rgba(0, 0, 0, 0) 100%); }
|
||||||
.reader-header-overlay .reader-title { color: #fff; text-shadow: 0 2px 8px rgba(0, 0, 0, 0.5); margin-bottom: 0.75rem; font-size: 2.5rem; font-weight: 700; line-height: 1.2; }
|
.reader-header-overlay .reader-title { color: #fff; text-shadow: 0 2px 8px rgba(0, 0, 0, 0.5); margin-bottom: 0.75rem; font-size: 2.5rem; font-weight: 700; line-height: 1.2; }
|
||||||
.reader-header-overlay .reader-summary { color: rgba(255, 255, 255, 0.9); font-size: 1.2rem; line-height: 1.6; margin: 0 0 1rem 0; text-shadow: 0 1px 4px rgba(0, 0, 0, 0.4); font-family: var(--reading-font); }
|
.reader-header-overlay .reader-summary { color: rgba(255, 255, 255, 0.9); font-size: 1.2rem; line-height: 1.6; margin: 0 0 1rem 0; text-shadow: 0 1px 4px rgba(0, 0, 0, 0.4); font-family: var(--reading-font); }
|
||||||
|
|||||||
@@ -1,9 +1,9 @@
|
|||||||
/* Settings view containers */
|
/* Settings view containers */
|
||||||
.settings-view { display: flex; flex-direction: column; height: 100%; overflow: hidden; padding: 0.75rem 1rem; text-align: left; }
|
.settings-view { display: flex; flex-direction: column; height: 100%; overflow: hidden; padding: 0.75rem 1rem; text-align: left; }
|
||||||
.settings-header { display: flex; align-items: center; justify-content: space-between; margin-bottom: 1.5rem; padding: 0; }
|
.settings-header { display: flex; align-items: center; justify-content: space-between; padding: 0; max-width: 900px; margin: 0 auto 1.5rem auto; width: 100%; }
|
||||||
.settings-header h2 { margin: 0; font-size: 1.5rem; font-weight: 600; text-align: left; }
|
.settings-header h2 { margin: 0; font-size: 1.5rem; font-weight: 600; text-align: left; }
|
||||||
.settings-header-actions { display: flex; gap: 0.5rem; align-items: center; }
|
.settings-header-actions { display: flex; gap: 0.5rem; align-items: center; }
|
||||||
.settings-content { overflow-y: auto; flex: 1; margin-bottom: 1rem; text-align: left; padding: 0 0.25rem 2rem 0.25rem; }
|
.settings-content { overflow-y: auto; flex: 1; text-align: left; padding: 0 0.25rem 2rem 0.25rem; max-width: 900px; margin: 0 auto 1rem auto; width: 100%; }
|
||||||
.settings-section { margin-bottom: 2.5rem; }
|
.settings-section { margin-bottom: 2.5rem; }
|
||||||
.settings-section:last-child { margin-bottom: 0; }
|
.settings-section:last-child { margin-bottom: 0; }
|
||||||
.section-title { font-size: 1rem; font-weight: 600; color: var(--color-text); margin: 0 0 1rem 0; padding-bottom: 0.5rem; border-bottom: 1px solid var(--color-border); text-transform: uppercase; letter-spacing: 0.05em; }
|
.section-title { font-size: 1rem; font-weight: 600; color: var(--color-text); margin: 0 0 1rem 0; padding-bottom: 0.5rem; border-bottom: 1px solid var(--color-border); text-transform: uppercase; letter-spacing: 0.05em; }
|
||||||
@@ -19,6 +19,7 @@
|
|||||||
/* Zap splits preset buttons */
|
/* Zap splits preset buttons */
|
||||||
.zap-preset-buttons { display: flex; gap: 0.5rem; flex-wrap: wrap; }
|
.zap-preset-buttons { display: flex; gap: 0.5rem; flex-wrap: wrap; }
|
||||||
.zap-preset-btn {
|
.zap-preset-btn {
|
||||||
|
flex: 1;
|
||||||
padding: 0.625rem 1.25rem;
|
padding: 0.625rem 1.25rem;
|
||||||
background: var(--color-bg-elevated);
|
background: var(--color-bg-elevated);
|
||||||
border: 1px solid var(--color-border-subtle);
|
border: 1px solid var(--color-border-subtle);
|
||||||
@@ -54,35 +55,56 @@
|
|||||||
width: 100%;
|
width: 100%;
|
||||||
height: 8px;
|
height: 8px;
|
||||||
border-radius: 4px;
|
border-radius: 4px;
|
||||||
background: var(--color-bg-elevated);
|
background: linear-gradient(
|
||||||
|
to right,
|
||||||
|
color-mix(in srgb, var(--highlight-color) 50%, transparent) 0%,
|
||||||
|
color-mix(in srgb, var(--highlight-color) 50%, transparent) 50%,
|
||||||
|
color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 50%,
|
||||||
|
color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 100%
|
||||||
|
);
|
||||||
outline: none;
|
outline: none;
|
||||||
-webkit-appearance: none;
|
-webkit-appearance: none;
|
||||||
|
position: relative;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-webkit-slider-thumb {
|
.zap-split-slider::-webkit-slider-thumb {
|
||||||
-webkit-appearance: none;
|
-webkit-appearance: none;
|
||||||
appearance: none;
|
appearance: none;
|
||||||
width: 20px;
|
width: 24px;
|
||||||
height: 20px;
|
height: 24px;
|
||||||
border-radius: 50%;
|
border-radius: 4px;
|
||||||
background: var(--color-primary);
|
background-color: var(--color-primary);
|
||||||
|
background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
|
||||||
|
background-size: 14px 14px;
|
||||||
|
background-repeat: no-repeat;
|
||||||
|
background-position: center center;
|
||||||
cursor: pointer;
|
cursor: pointer;
|
||||||
transition: all 0.2s ease;
|
transition: all 0.2s ease;
|
||||||
|
position: relative;
|
||||||
|
top: 0;
|
||||||
|
margin-top: 0;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-webkit-slider-thumb:hover {
|
.zap-split-slider::-webkit-slider-thumb:hover {
|
||||||
background: var(--color-primary-hover);
|
background-color: var(--color-primary-hover);
|
||||||
transform: scale(1.1);
|
transform: scale(1.1);
|
||||||
}
|
}
|
||||||
.zap-split-slider::-moz-range-thumb {
|
.zap-split-slider::-moz-range-thumb {
|
||||||
width: 20px;
|
width: 24px;
|
||||||
height: 20px;
|
height: 24px;
|
||||||
border-radius: 50%;
|
border-radius: 4px;
|
||||||
background: var(--color-primary);
|
background-color: var(--color-primary);
|
||||||
|
background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
|
||||||
|
background-size: 14px 14px;
|
||||||
|
background-repeat: no-repeat;
|
||||||
|
background-position: center center;
|
||||||
cursor: pointer;
|
cursor: pointer;
|
||||||
border: none;
|
border: none;
|
||||||
transition: all 0.2s ease;
|
transition: all 0.2s ease;
|
||||||
|
position: relative;
|
||||||
|
top: 0;
|
||||||
|
margin-top: 0;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-moz-range-thumb:hover {
|
.zap-split-slider::-moz-range-thumb:hover {
|
||||||
background: var(--color-primary-hover);
|
background-color: var(--color-primary-hover);
|
||||||
transform: scale(1.1);
|
transform: scale(1.1);
|
||||||
}
|
}
|
||||||
.zap-split-description {
|
.zap-split-description {
|
||||||
|
|||||||
@@ -81,7 +81,14 @@
|
|||||||
.view-mode-controls {
|
.view-mode-controls {
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
justify-content: center;
|
justify-content: space-between;
|
||||||
|
gap: 0.5rem;
|
||||||
|
}
|
||||||
|
|
||||||
|
.view-mode-left,
|
||||||
|
.view-mode-right {
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
gap: 0.5rem;
|
gap: 0.5rem;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -169,3 +176,38 @@
|
|||||||
.read-inline-btn { background: rgb(34 197 94); /* green-500 */ color: white; border: none; padding: 0.25rem 0.5rem; border-radius: 4px; cursor: pointer; }
|
.read-inline-btn { background: rgb(34 197 94); /* green-500 */ color: white; border: none; padding: 0.25rem 0.5rem; border-radius: 4px; cursor: pointer; }
|
||||||
.read-inline-btn:hover { background: rgb(22 163 74); /* green-600 */ }
|
.read-inline-btn:hover { background: rgb(22 163 74); /* green-600 */ }
|
||||||
|
|
||||||
|
/* Bookmark filters */
|
||||||
|
.bookmark-filters {
|
||||||
|
display: flex;
|
||||||
|
gap: 0.5rem;
|
||||||
|
padding: 0.5rem 1rem;
|
||||||
|
border-bottom: 1px solid var(--color-border);
|
||||||
|
background: var(--color-bg);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn {
|
||||||
|
background: transparent;
|
||||||
|
color: var(--color-text-secondary);
|
||||||
|
border: none;
|
||||||
|
padding: 0.375rem;
|
||||||
|
border-radius: 4px;
|
||||||
|
cursor: pointer;
|
||||||
|
transition: all 0.15s ease;
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
|
justify-content: center;
|
||||||
|
font-size: 0.875rem;
|
||||||
|
min-width: 32px;
|
||||||
|
min-height: 32px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn:hover {
|
||||||
|
color: var(--color-text);
|
||||||
|
background: var(--color-bg-elevated);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn.active {
|
||||||
|
color: var(--color-primary);
|
||||||
|
background: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -42,6 +42,14 @@ export interface IndividualBookmark {
|
|||||||
encryptedContent?: string
|
encryptedContent?: string
|
||||||
// When the item was added to the bookmark list (synthetic, for sorting)
|
// When the item was added to the bookmark list (synthetic, for sorting)
|
||||||
added_at?: number
|
added_at?: number
|
||||||
|
// The kind of the source list/set that produced this bookmark (e.g., 10003, 30003, 30001, or 39701 for web)
|
||||||
|
sourceKind?: number
|
||||||
|
// The 'd' tag value from kind 30003 bookmark sets
|
||||||
|
setName?: string
|
||||||
|
// Metadata from the bookmark set event (kind 30003)
|
||||||
|
setTitle?: string
|
||||||
|
setDescription?: string
|
||||||
|
setImage?: string
|
||||||
}
|
}
|
||||||
|
|
||||||
export interface ActiveAccount {
|
export interface ActiveAccount {
|
||||||
|
|||||||
42
src/utils/bookmarkTypeClassifier.ts
Normal file
42
src/utils/bookmarkTypeClassifier.ts
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
import { IndividualBookmark } from '../types/bookmarks'
|
||||||
|
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
||||||
|
import { classifyUrl } from './helpers'
|
||||||
|
|
||||||
|
export type BookmarkType = 'article' | 'external' | 'video' | 'note' | 'web'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Classifies a bookmark into one of the content types
|
||||||
|
*/
|
||||||
|
export function classifyBookmarkType(bookmark: IndividualBookmark): BookmarkType {
|
||||||
|
// Kind 30023 is always a nostr-native article
|
||||||
|
if (bookmark.kind === 30023) return 'article'
|
||||||
|
|
||||||
|
const isWebBookmark = bookmark.kind === 39701
|
||||||
|
const webBookmarkUrl = isWebBookmark ? bookmark.tags.find(t => t[0] === 'd')?.[1] : null
|
||||||
|
|
||||||
|
const extractedUrls = webBookmarkUrl
|
||||||
|
? [webBookmarkUrl.startsWith('http') ? webBookmarkUrl : `https://${webBookmarkUrl}`]
|
||||||
|
: extractUrlsFromContent(bookmark.content)
|
||||||
|
|
||||||
|
const firstUrl = extractedUrls[0]
|
||||||
|
if (!firstUrl) return 'note'
|
||||||
|
|
||||||
|
const urlType = classifyUrl(firstUrl)?.type
|
||||||
|
|
||||||
|
if (urlType === 'youtube' || urlType === 'video') return 'video'
|
||||||
|
if (urlType === 'article') return 'external' // External article links
|
||||||
|
|
||||||
|
return 'web'
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters bookmarks by type
|
||||||
|
*/
|
||||||
|
export function filterBookmarksByType(
|
||||||
|
bookmarks: IndividualBookmark[],
|
||||||
|
filterType: 'all' | BookmarkType
|
||||||
|
): IndividualBookmark[] {
|
||||||
|
if (filterType === 'all') return bookmarks
|
||||||
|
return bookmarks.filter(bookmark => classifyBookmarkType(bookmark) === filterType)
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
|
import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
|
||||||
import { ParsedContent, ParsedNode } from '../types/bookmarks'
|
import { ParsedContent, ParsedNode, IndividualBookmark } from '../types/bookmarks'
|
||||||
import ResolvedMention from '../components/ResolvedMention'
|
import ResolvedMention from '../components/ResolvedMention'
|
||||||
// Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
|
// Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
|
||||||
|
|
||||||
@@ -82,3 +82,73 @@ export const renderParsedContent = (parsedContent: ParsedContent) => {
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Sorting and grouping for bookmarks
|
||||||
|
export const sortIndividualBookmarks = (items: IndividualBookmark[]) => {
|
||||||
|
return items
|
||||||
|
.slice()
|
||||||
|
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
||||||
|
}
|
||||||
|
|
||||||
|
export function groupIndividualBookmarks(items: IndividualBookmark[]) {
|
||||||
|
const sorted = sortIndividualBookmarks(items)
|
||||||
|
const web = sorted.filter(i => i.kind === 39701 || i.type === 'web')
|
||||||
|
// Only non-encrypted legacy bookmarks go to the amethyst section
|
||||||
|
const amethyst = sorted.filter(i => i.sourceKind === 30001 && !i.isPrivate)
|
||||||
|
const isIn = (list: IndividualBookmark[], x: IndividualBookmark) => list.some(i => i.id === x.id)
|
||||||
|
// Private items include encrypted legacy bookmarks
|
||||||
|
const privateItems = sorted.filter(i => i.isPrivate && !isIn(web, i))
|
||||||
|
const publicItems = sorted.filter(i => !i.isPrivate && !isIn(amethyst, i) && !isIn(web, i))
|
||||||
|
return { privateItems, publicItems, web, amethyst }
|
||||||
|
}
|
||||||
|
|
||||||
|
// Simple filter: only exclude bookmarks with empty/whitespace-only content
|
||||||
|
export function hasContent(bookmark: IndividualBookmark): boolean {
|
||||||
|
return !!(bookmark.content && bookmark.content.trim().length > 0)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Bookmark sets helpers (kind 30003)
|
||||||
|
export interface BookmarkSet {
|
||||||
|
name: string
|
||||||
|
title?: string
|
||||||
|
description?: string
|
||||||
|
image?: string
|
||||||
|
bookmarks: IndividualBookmark[]
|
||||||
|
}
|
||||||
|
|
||||||
|
export function getBookmarkSets(items: IndividualBookmark[]): BookmarkSet[] {
|
||||||
|
// Group bookmarks by setName
|
||||||
|
const setMap = new Map<string, IndividualBookmark[]>()
|
||||||
|
|
||||||
|
items.forEach(bookmark => {
|
||||||
|
if (bookmark.setName) {
|
||||||
|
const existing = setMap.get(bookmark.setName) || []
|
||||||
|
existing.push(bookmark)
|
||||||
|
setMap.set(bookmark.setName, existing)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
// Convert to array and extract metadata from the bookmarks
|
||||||
|
const sets: BookmarkSet[] = []
|
||||||
|
setMap.forEach((bookmarks, name) => {
|
||||||
|
// Get metadata from the first bookmark (all bookmarks in a set share the same metadata)
|
||||||
|
const firstBookmark = bookmarks[0]
|
||||||
|
const title = firstBookmark?.setTitle
|
||||||
|
const description = firstBookmark?.setDescription
|
||||||
|
const image = firstBookmark?.setImage
|
||||||
|
|
||||||
|
sets.push({
|
||||||
|
name,
|
||||||
|
title,
|
||||||
|
description,
|
||||||
|
image,
|
||||||
|
bookmarks: sortIndividualBookmarks(bookmarks)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
|
return sets.sort((a, b) => a.name.localeCompare(b.name))
|
||||||
|
}
|
||||||
|
|
||||||
|
export function getBookmarksWithoutSet(items: IndividualBookmark[]): IndividualBookmark[] {
|
||||||
|
return sortIndividualBookmarks(items.filter(b => !b.setName))
|
||||||
|
}
|
||||||
|
|||||||
36
src/utils/debugBus.ts
Normal file
36
src/utils/debugBus.ts
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
export type DebugLevel = 'info' | 'warn' | 'error'
|
||||||
|
|
||||||
|
export interface DebugLogEntry {
|
||||||
|
ts: number
|
||||||
|
level: DebugLevel
|
||||||
|
source: string
|
||||||
|
message: string
|
||||||
|
data?: unknown
|
||||||
|
}
|
||||||
|
|
||||||
|
type Listener = (entry: DebugLogEntry) => void
|
||||||
|
|
||||||
|
const listeners = new Set<Listener>()
|
||||||
|
const buffer: DebugLogEntry[] = []
|
||||||
|
const MAX_BUFFER = 300
|
||||||
|
|
||||||
|
export const DebugBus = {
|
||||||
|
log(level: DebugLevel, source: string, message: string, data?: unknown): void {
|
||||||
|
const entry: DebugLogEntry = { ts: Date.now(), level, source, message, data }
|
||||||
|
buffer.push(entry)
|
||||||
|
if (buffer.length > MAX_BUFFER) buffer.shift()
|
||||||
|
listeners.forEach(l => {
|
||||||
|
try { l(entry) } catch (err) { console.warn('[DebugBus] listener error:', err) }
|
||||||
|
})
|
||||||
|
},
|
||||||
|
info(source: string, message: string, data?: unknown): void { this.log('info', source, message, data) },
|
||||||
|
warn(source: string, message: string, data?: unknown): void { this.log('warn', source, message, data) },
|
||||||
|
error(source: string, message: string, data?: unknown): void { this.log('error', source, message, data) },
|
||||||
|
subscribe(listener: Listener): () => void {
|
||||||
|
listeners.add(listener)
|
||||||
|
return () => listeners.delete(listener)
|
||||||
|
},
|
||||||
|
snapshot(): DebugLogEntry[] { return buffer.slice() }
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -102,13 +102,13 @@ export const prioritizeLocalRelays = (relayUrls: string[]): string[] => {
|
|||||||
// Parallel request helper
|
// Parallel request helper
|
||||||
import { completeOnEose, onlyEvents, RelayPool } from 'applesauce-relay'
|
import { completeOnEose, onlyEvents, RelayPool } from 'applesauce-relay'
|
||||||
import { Observable, takeUntil, timer } from 'rxjs'
|
import { Observable, takeUntil, timer } from 'rxjs'
|
||||||
|
import { Filter } from 'nostr-tools/filter'
|
||||||
|
|
||||||
export function createParallelReqStreams(
|
export function createParallelReqStreams(
|
||||||
relayPool: RelayPool,
|
relayPool: RelayPool,
|
||||||
localRelays: string[],
|
localRelays: string[],
|
||||||
remoteRelays: string[],
|
remoteRelays: string[],
|
||||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
filter: Filter,
|
||||||
filter: any,
|
|
||||||
localTimeoutMs = 1200,
|
localTimeoutMs = 1200,
|
||||||
remoteTimeoutMs = 6000
|
remoteTimeoutMs = 6000
|
||||||
): { local$: Observable<unknown>; remote$: Observable<unknown> } {
|
): { local$: Observable<unknown>; remote$: Observable<unknown> } {
|
||||||
|
|||||||
69
src/utils/linksFromBookmarks.ts
Normal file
69
src/utils/linksFromBookmarks.ts
Normal file
@@ -0,0 +1,69 @@
|
|||||||
|
import { Bookmark } from '../types/bookmarks'
|
||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { fallbackTitleFromUrl } from './readItemMerge'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Derives ReadItems from bookmarks for external URLs:
|
||||||
|
* - Web bookmarks (kind:39701)
|
||||||
|
* - Any bookmark with http(s) URLs in content or urlReferences
|
||||||
|
*/
|
||||||
|
export function deriveLinksFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
|
||||||
|
const linksMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
|
|
||||||
|
for (const bookmark of allBookmarks) {
|
||||||
|
const urls: string[] = []
|
||||||
|
|
||||||
|
// Web bookmarks (kind:39701) - extract from 'd' tag
|
||||||
|
if (bookmark.kind === KINDS.WebBookmark) {
|
||||||
|
const dTag = bookmark.tags.find(t => t[0] === 'd')?.[1]
|
||||||
|
if (dTag) {
|
||||||
|
const url = dTag.startsWith('http') ? dTag : `https://${dTag}`
|
||||||
|
urls.push(url)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Extract URLs from content if not already captured
|
||||||
|
if (bookmark.content) {
|
||||||
|
const urlRegex = /(https?:\/\/[^\s]+)/g
|
||||||
|
const matches = bookmark.content.match(urlRegex)
|
||||||
|
if (matches) {
|
||||||
|
urls.push(...matches)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Extract metadata from tags (for web bookmarks and other types)
|
||||||
|
const title = bookmark.tags.find(t => t[0] === 'title')?.[1]
|
||||||
|
const summary = bookmark.tags.find(t => t[0] === 'summary')?.[1]
|
||||||
|
const image = bookmark.tags.find(t => t[0] === 'image')?.[1]
|
||||||
|
|
||||||
|
// Create ReadItem for each unique URL
|
||||||
|
for (const url of [...new Set(urls)]) {
|
||||||
|
if (!linksMap.has(url)) {
|
||||||
|
const item: ReadItem = {
|
||||||
|
id: url,
|
||||||
|
source: 'bookmark',
|
||||||
|
type: 'external',
|
||||||
|
url,
|
||||||
|
title: title || fallbackTitleFromUrl(url),
|
||||||
|
summary,
|
||||||
|
image,
|
||||||
|
readingProgress: 0,
|
||||||
|
readingTimestamp: bookmark.added_at || bookmark.created_at
|
||||||
|
}
|
||||||
|
|
||||||
|
linksMap.set(url, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sort by most recent bookmark activity
|
||||||
|
return Array.from(linksMap.values()).sort((a, b) => {
|
||||||
|
const timeA = a.readingTimestamp || 0
|
||||||
|
const timeB = b.readingTimestamp || 0
|
||||||
|
return timeB - timeA
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
83
src/utils/readItemMerge.ts
Normal file
83
src/utils/readItemMerge.ts
Normal file
@@ -0,0 +1,83 @@
|
|||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merges a ReadItem into a state map, returning whether the state changed.
|
||||||
|
* Uses most recent reading activity to determine precedence.
|
||||||
|
*/
|
||||||
|
export function mergeReadItem(
|
||||||
|
stateMap: Map<string, ReadItem>,
|
||||||
|
incoming: ReadItem
|
||||||
|
): boolean {
|
||||||
|
const existing = stateMap.get(incoming.id)
|
||||||
|
|
||||||
|
if (!existing) {
|
||||||
|
stateMap.set(incoming.id, incoming)
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
// Always merge if incoming has reading progress data
|
||||||
|
const hasNewProgress = incoming.readingProgress !== undefined &&
|
||||||
|
(existing.readingProgress === undefined || existing.readingProgress !== incoming.readingProgress)
|
||||||
|
|
||||||
|
const hasNewMarkedAsRead = incoming.markedAsRead !== undefined && existing.markedAsRead === undefined
|
||||||
|
|
||||||
|
// Merge by taking the most recent reading activity
|
||||||
|
const existingTime = existing.readingTimestamp || existing.markedAt || 0
|
||||||
|
const incomingTime = incoming.readingTimestamp || incoming.markedAt || 0
|
||||||
|
|
||||||
|
if (incomingTime > existingTime || hasNewProgress || hasNewMarkedAsRead) {
|
||||||
|
// Keep existing data, but update with newer reading metadata
|
||||||
|
stateMap.set(incoming.id, {
|
||||||
|
...existing,
|
||||||
|
...incoming,
|
||||||
|
// Preserve event data if incoming doesn't have it
|
||||||
|
event: incoming.event || existing.event,
|
||||||
|
title: incoming.title || existing.title,
|
||||||
|
summary: incoming.summary || existing.summary,
|
||||||
|
image: incoming.image || existing.image,
|
||||||
|
published: incoming.published || existing.published,
|
||||||
|
author: incoming.author || existing.author,
|
||||||
|
// Always take reading progress if available
|
||||||
|
readingProgress: incoming.readingProgress !== undefined ? incoming.readingProgress : existing.readingProgress,
|
||||||
|
readingTimestamp: incomingTime > existingTime ? incoming.readingTimestamp : existing.readingTimestamp
|
||||||
|
})
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
// If timestamps are equal but incoming has additional data, merge it
|
||||||
|
if (incomingTime === existingTime && (!existing.event && incoming.event || !existing.title && incoming.title)) {
|
||||||
|
stateMap.set(incoming.id, {
|
||||||
|
...existing,
|
||||||
|
...incoming,
|
||||||
|
event: incoming.event || existing.event,
|
||||||
|
title: incoming.title || existing.title,
|
||||||
|
summary: incoming.summary || existing.summary,
|
||||||
|
image: incoming.image || existing.image,
|
||||||
|
published: incoming.published || existing.published,
|
||||||
|
author: incoming.author || existing.author
|
||||||
|
})
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Extracts a readable title from a URL when no title is available.
|
||||||
|
* Removes protocol, www, and shows domain + path.
|
||||||
|
*/
|
||||||
|
export function fallbackTitleFromUrl(url: string): string {
|
||||||
|
try {
|
||||||
|
const parsed = new URL(url)
|
||||||
|
let title = parsed.hostname.replace(/^www\./, '')
|
||||||
|
if (parsed.pathname && parsed.pathname !== '/') {
|
||||||
|
const path = parsed.pathname.slice(0, 40)
|
||||||
|
title += path.length < parsed.pathname.length ? path + '...' : path
|
||||||
|
}
|
||||||
|
return title
|
||||||
|
} catch {
|
||||||
|
// If URL parsing fails, just return the URL truncated
|
||||||
|
return url.length > 50 ? url.slice(0, 47) + '...' : url
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
30
src/utils/readingProgressUtils.ts
Normal file
30
src/utils/readingProgressUtils.ts
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
import { ReadingProgressFilterType } from '../components/ReadingProgressFilters'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters ReadItems by reading progress
|
||||||
|
*/
|
||||||
|
export function filterByReadingProgress(
|
||||||
|
items: ReadItem[],
|
||||||
|
filter: ReadingProgressFilterType
|
||||||
|
): ReadItem[] {
|
||||||
|
return items.filter((item) => {
|
||||||
|
const progress = item.readingProgress || 0
|
||||||
|
const isMarked = item.markedAsRead || false
|
||||||
|
|
||||||
|
switch (filter) {
|
||||||
|
case 'unopened':
|
||||||
|
return progress === 0 && !isMarked
|
||||||
|
case 'started':
|
||||||
|
return progress > 0 && progress <= 0.10 && !isMarked
|
||||||
|
case 'reading':
|
||||||
|
return progress > 0.10 && progress <= 0.94 && !isMarked
|
||||||
|
case 'completed':
|
||||||
|
return progress >= 0.95 || isMarked
|
||||||
|
case 'all':
|
||||||
|
default:
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user