perf(bunker): make NIP-46 publish non-blocking at app wiring level; resolve immediately and let responses drive timing/results

- Helps align our request shape with Amber's expected BunkerRequest format

.gitignore

@@ -8,6 +8,8 @@ dist
 *.log
 .DS_Store
 
-# Applesauce Reference
+# Reference Projects
 applesauce
+primal-web-app
+Amber
 

Amber.md

@@ -0,0 +1,77 @@
+## Boris ↔ Amber bunker: current findings
+
+- **Environment**
+  - Client: Boris (web) using `applesauce` stack (`NostrConnectSigner`, `RelayPool`).
+  - Bunker: Amber (mobile).
+  - We restored a `nostr-connect` account from localStorage and re-wired the signer to the app `RelayPool` before use.
+
+## What we changed client-side
+
+- **Signer wiring**
+  - Bound `NostrConnectSigner.subscriptionMethod/publishMethod` to the app `RelayPool` at startup.
+  - After deserialization, recreated the signer with pool context and merged its relays with app `RELAYS` (includes local relays).
+  - Opened the signer subscription and performed a guarded `connect()` with default permissions including `nip04_encrypt/decrypt` and `nip44_encrypt/decrypt`.
+
+- **Probes and timeouts**
+  - Initial probe tried `decrypt('invalid-ciphertext')` → timed out.
+  - Switched to roundtrip probes: `encrypt(self, ... )` then `decrypt(self, cipher)` for both nip-44 and nip-04.
+  - Increased probe timeout from 3s → 10s; increased bookmark decrypt timeout from 15s → 30s.
+
+- **Logging**
+  - Added logs for publish/subscribe and parsed the NIP-46 request content length.
+  - Confirmed NIP‑46 request events are kind `24133` with a single `p` tag (expected). The method is inside the encrypted content, so it prints as `method: undefined` (expected).
+
+## Evidence from logs (client)
+
+```
+[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription
+[bunker] 🔗 Signer relays merged with app RELAYS: (19) [...]
+[bunker] subscribe via signer: { relays: [...], filters: [...] }
+[bunker] ✅ Signer subscription opened
+[bunker] publish via signer: { relays: [...], kind: 24133, tags: [['p', <remote>]], contentLength: 260|304|54704 }
+[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
+[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
+bookmarkProcessing.ts: ❌ nip44.decrypt failed: Decrypt timeout after 30000ms
+bookmarkProcessing.ts: ❌ nip04.decrypt failed: Decrypt timeout after 30000ms
+```
+
+Notes:
+- Final signer status shows `listening: true`, `isConnected: true`, and requests are published to 19 relays (includes Amber’s).
+
+## Evidence from Amber (device)
+
+- Activity screen shows multiple entries for: “Encrypt data using nip 4” and “Encrypt data using nip 44” with green checkmarks.
+- No entries for “Decrypt data using nip 4” or “Decrypt data using nip 44”.
+
+## Interpretation
+
+- Transport and publish paths are working: Boris is publishing NIP‑46 requests (kind 24133) and Amber receives them (ENCRYPT activity visible).
+- The persistent failure is specific to DECRYPT handling: Amber does not show any DECRYPT activity and Boris receives no decrypt responses within 10–30s windows.
+- Client-side wiring is likely correct (subscription open, permissions requested, relays merged). The remaining issue appears provider-side in Amber’s NIP‑46 decrypt handling or permission gating.
+
+## Repro steps (quick)
+
+1) Revoke Boris in Amber.
+2) Reconnect with a fresh bunker URI; approve signing and both encrypt/decrypt scopes for nip‑04 and nip‑44.
+3) Keep Amber unlocked and foregrounded.
+4) Reload Boris; observe:
+   - Logs showing `publish via signer` for kind 24133.
+   - In Amber, activity should include “Decrypt data using nip 4/44”.
+
+If DECRYPT entries still don’t appear:
+
+- This points to Amber’s NIP‑46 provider not executing/authorizing `nip04_decrypt`/`nip44_decrypt` methods, or not publishing responses.
+
+## Suggestions for Amber-side debugging
+
+- Verify permission gating allows `nip04_decrypt` and `nip44_decrypt` (not just encrypt).
+- Confirm the provider recognizes NIP‑46 methods `nip04_decrypt` and `nip44_decrypt` in the decrypted payload and routes them to decrypt routines.
+- Ensure the response event is published back to the same relays and correctly addressed to the client (`p` tag set and content encrypted back to client pubkey).
+- Add activity logging for “Decrypt …” attempts and failures to surface denial/exception states.
+
+## Current conclusion
+
+- Client is configured and publishing requests correctly; encryption proves end‑to‑end path is alive.
+- The missing DECRYPT activity in Amber is the blocker. Fixing Amber’s NIP‑46 decrypt handling should resolve bookmark decryption in Boris without further client changes.
+
+

CHANGELOG.md

@@ -7,6 +7,393 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 
 ## [Unreleased]
 
+## [0.6.24] - 2025-01-16
+
+### Fixed
+
+- TypeScript global declarations for build-time defines
+  - Added proper type declarations for `__APP_VERSION__`, `__GIT_COMMIT__`, `__GIT_BRANCH__`, `__BUILD_TIME__`, and `__GIT_COMMIT_URL__`
+  - Resolved ESLint no-undef errors for build-time injected variables
+  - Added Node.js environment hint to Vite configuration
+
+## [0.6.23] - 2025-01-16
+
+### Fixed
+
+- Deep-link refresh redirect issue for nostr-native articles
+  - Limited `/a/:naddr` rewrite to bot user-agents only in Vercel configuration
+  - Real browsers now hit the SPA directly, preventing redirect to root path
+  - Bot crawlers still receive proper OpenGraph metadata for social sharing
+
+### Added
+
+- Version and git commit information in Settings footer
+  - Displays app version and short commit hash with link to GitHub
+  - Build-time metadata injection via Vite configuration
+  - Subtle footer styling with selectable text
+
+### Changed
+
+- Article OG handler now uses proper RelayPool.request() API
+  - Aligned with applesauce RelayPool interface
+  - Removed deprecated open/close methods
+  - Fixed TypeScript linting errors
+
+### Technical
+
+- Added debug logging for route state and article OG handler
+  - Gated by `?debug=1` query parameter for production testing
+  - Structured logging for troubleshooting deep-link issues
+  - Temporary debug components for validation
+
+## [0.6.22] - 2025-10-16
+
+### Added
+
+- Dynamic OpenGraph and Twitter Card meta tags for article deep-links
+  - Social media platforms display article title, author, cover image, and summary when sharing `/a/{naddr}` links
+  - Serverless endpoint fetches article metadata from Nostr relays (kind:30023) and author profiles (kind:0)
+  - User-agent detection serves appropriate content to crawlers vs browsers
+  - Falls back to default social preview image when articles have no cover image
+- Social preview image for homepage and article links
+  - Added `boris-social-1200.png` as default OpenGraph image (1200x630)
+  - Homepage now includes social preview image in meta tags
+
+### Changed
+
+- Article deep-links now properly preserve URL when loading in browser
+  - Uses `history.replaceState()` to maintain correct article path
+  - Browser navigation works correctly on refresh and new tab opens
+
+### Fixed
+
+- Vercel rewrite configuration for article routes
+  - Routes `/a/:naddr` to serverless OG endpoint for dynamic meta tags
+  - Regular SPA routing preserved for browser navigation
+
+## [0.6.21] - 2025-10-16
+
+### Added
+
+- Reading position sync across devices using Nostr Kind 30078 (NIP-78)
+  - Automatically saves and syncs reading position as you scroll
+  - Visual reading progress indicator on article cards
+  - Reading progress shown in Explore and Bookmarks sidebar
+  - Auto-scroll to last reading position setting (configurable in Settings)
+  - Reading position displayed as colored progress bar on cards
+- Reading progress filters for organizing articles
+  - Filter by reading state: Unopened, Started (0-10%), Reading (11-94%), Completed (95-100% or marked as read)
+  - Filter icons colored when active (blue for most, green for completed)
+  - URL routing support for reading progress filters
+  - Reading progress filters available in Archive tab and bookmarks sidebar
+- Reads and Links tabs on `/me` page
+  - Reads tab shows nostr-native articles with reading progress
+  - Links tab shows external URLs with reading progress
+  - Both tabs populate instantly from bookmarks for fast loading
+  - Lazy loading for improved performance
+- Auto-mark as read at 100% reading progress
+  - Articles automatically marked as read when scrolled to end
+  - Marked-as-read articles treated as 100% progress
+  - Fancy checkmark animation on Mark as Read button
+- Click-to-open article navigation on highlights
+  - Clicking highlights in Explore and Me pages opens the source article
+  - Automatically scrolls to highlighted text position
+
+### Changed
+
+- Renamed Archive to Reads with expanded functionality
+- Merged 'Completed' and 'Marked as Read' filters into one unified filter
+- Simplified filter icon colors to blue (except green for completed)
+- Started reading progress state (0-10%) uses neutral text color
+- Replace spinners with skeleton placeholders during refresh in Archive/Reads/Links tabs
+- Removed unused IEventStore import in ContentPanel
+
+### Fixed
+
+- Reading position calculation now accurately reaches 100%
+- Reading position filters work correctly in bookmarks sidebar
+- Filter out reads without timestamps or 'Untitled' items
+- Show skeleton placeholders correctly during initial tab load
+- External URLs in Reads tab only shown if they have reading progress
+- Reading progress merges even when timestamp is older than bookmark
+- Resolved all linter errors and TypeScript type issues
+
+### Refactored
+
+- Renamed ArchiveFilters component to ReadingProgressFilters
+- Extracted shared utilities from readsFromBookmarks for DRY code
+- Use setState callback pattern for background enrichment
+- Use naddr format for article IDs to match reading positions
+- Extract article titles, images, summaries from bookmark tags using applesauce helpers
+
+## [0.6.20] - 2025-10-15
+
+### Added
+
+- Bookmark filter buttons by content type (articles, videos, images, web links)
+  - Filter bookmarks by their content type on bookmarks sidebar
+  - Filters also available on `/me` page bookmarks tab
+  - Separate filter for external articles with link icon
+  - Multiple filters can be active simultaneously
+- Private Bookmarks section for encrypted legacy bookmarks
+  - Encrypted legacy bookmarks now grouped in separate section
+  - Better organization and clarity for different bookmark types
+
+### Changed
+
+- Bookmark section labels improved for clarity
+  - More descriptive section headings throughout
+  - Better categorization of bookmark types
+- Bookmark filter button styling refined
+  - Reduced whitespace around bookmark filters for cleaner layout
+  - Dramatically reduced whitespace on both sidebar and `/me` page
+- Lock icon removed from individual bookmarks
+  - Encryption status now indicated by section grouping
+  - Cleaner bookmark item appearance
+- External article icon changed to link icon (`faLink`)
+  - More intuitive icon for external content
+
+### Fixed
+
+- Highlight button positioning and visibility
+  - Fixed to viewport for consistent placement
+  - Sticky and always visible when needed
+  - Properly positioned inside reader pane
+
+## [0.6.19] - 2025-10-15
+
+### Fixed
+
+- Highlights disappearing on external URLs after a few seconds
+  - Fixed `useBookmarksData` from fetching general highlights when viewing external URLs
+  - External URL highlights now managed exclusively by `useExternalUrlLoader`
+  - Removed redundant `setHighlights` call that was overwriting streamed highlights
+  - Improved error handling in `fetchHighlightsForUrl` to prevent silent failures
+  - Isolated rebroadcast errors so they don't break highlight display
+  - Added logging to help diagnose highlight fetching issues
+
+## [0.6.18] - 2025-10-15
+
+### Changed
+
+- Zap split labels simplified and terminology updated
+  - Removed redundant "Weight: xy" label to save space
+  - Changed "Author(s) Share" to "Author's Share" (possessive singular)
+  - Changed "Support Boris" to "Boris' Share" for consistency
+  - Weight value now shown directly in label (e.g., "Your Share: 50")
+  - Share and percentage now displayed on same line for cleaner layout
+- Zap preset buttons on desktop now expand to match slider width
+  - Added `flex: 1` to buttons for equal width distribution
+  - Buttons still wrap properly on smaller screens
+- PWA install section now always visible in settings
+  - Section shows regardless of installation or device capability status
+  - Button adapts with proper disabled states and visual feedback
+  - "Installed" state shows checkmark icon and disabled button
+  - Non-installable state shows disabled button
+
+### Fixed
+
+- PWA install button now properly disabled when installation is not possible on device
+  - Button only enabled when browser fires `beforeinstallprompt` event
+  - Removed hardcoded testing state that always showed button as installable
+- App & Airplane Mode section now always visible regardless of PWA status
+  - Image cache and local relay settings always accessible
+  - Previously entire section was hidden if PWA not installable/installed
+  - Only PWA-specific install button is conditionally affected
+
+## [0.6.17] - 2025-10-15
+
+### Added
+
+- PWA settings illustration (`pwa.svg`) displayed on right side of section
+  - Responsive design: hidden on mobile, 30% width on desktop
+  - Visual enhancement for App & Airplane Mode section
+- Zaps illustration (`zaps.svg`) displayed on right side of Zap Splits section
+  - Matching responsive layout and styling as PWA illustration
+- Visual 50% indicators on zap split sliders
+  - Linear gradient background using highlight colors (yellow/orange) at 50% opacity
+  - Datalist tick marks at 50% for "Your Share" and "Author(s) Share" sliders
+  - Tick mark at 5 for "Support Boris" slider
+- Lightning bolt icons as slider thumbs for zap splits
+  - Replaces default circular slider handles
+  - White lightning bolt SVG embedded in slider thumb background
+  - 24px square thumb with 4px border radius
+- Offline-first description paragraph at beginning of App & Airplane Mode section
+  - Explains Boris's offline capabilities upfront
+- Settings page width constraint (900px max-width)
+  - Matches article view max-width for consistent reading experience
+  - Centered layout with proper margins
+
+### Changed
+
+- Settings section reorganization
+  - "PWA & Flight Mode" merged into single "App & Airplane Mode" section
+  - "Layout & Navigation" and "Startup & Behavior" merged into "Layout & Behavior"
+  - Section order: Theme → Reading & Display → Zap Splits → Layout & Behavior → App & Airplane Mode → Relays
+  - "Startup & Behavior" moved after "Zap Splits"
+  - "Layout & Navigation" moved below "Zap Splits"
+- PWA settings section restructure
+  - Checkboxes moved to top (image cache, local relays)
+  - Descriptive paragraphs in middle
+  - Install button at bottom
+  - Note about local relays moved before install paragraph
+- Zap split sliders styling
+  - Left side (0-50%): highlight color (yellow) at 50% opacity
+  - Right side (50-100%): friend-highlight color (orange) at 50% opacity
+  - Creates visual distinction tied to app's highlight color scheme
+- Zap split description text styling
+  - Now matches offline-first paragraph style with secondary color and smaller font size
+- Clear cache button styling
+  - Replaced `IconButton` with plain `FontAwesomeIcon` for subtler appearance
+  - No border or background, just icon with opacity
+- Font Size buttons alignment
+  - Now properly align to the right using `setting-control` wrapper
+  - Matches alignment of highlight color picker buttons
+- Default Highlight Visibility position
+  - Moved back to original position after "Paragraph Alignment"
+  - Grouped with other reading display controls
+- Spacing adjustments in App & Airplane Mode section
+  - Reduced gap between elements from 1rem → 0.5rem → 0.25rem for tighter layout
+
+### Fixed
+
+- PWA settings paragraph wrapping
+  - Moved offline-first paragraph inside flex container to prevent extending above image
+- Font Size buttons alignment issues
+  - Properly implemented `setting-control` wrapper for right alignment
+  - Previously attempted alignment didn't work correctly
+- Slider thumb icon centering
+  - Lightning bolt icons properly centered vertically on slider
+  - Added `position: relative`, `top: 0`, `margin-top: 0` for accurate positioning
+
+## [0.6.16] - 2025-10-15
+
+### Changed
+
+- Replaced delete dialog popup with inline confirmation UI
+  - Shows red "Confirm?" text with trash icon when delete is clicked
+  - Clicking the red trash icon confirms deletion
+  - No more modal overlay or backdrop
+  - Click outside or reopen menu to cancel
+- Reordered Reading & Display settings for better organization
+  - Highlight Style, Paragraph Alignment, and Default Highlight Visibility moved to top
+  - Followed by Reading Font, Font Size, and color pickers
+- Setting buttons now align vertically with fixed label width (220px)
+  - Creates consistent "tab stops" for cleaner visual alignment
+
+### Fixed
+
+- Removed unused `handleCancelDelete` function after dialog removal
+
+## [0.6.15] - 2025-10-15
+
+### Added
+
+- Paragraph alignment setting with left-aligned and justified text options
+  - Icon buttons in Reading & Display settings for switching alignment
+  - CSS variable system for applying alignment to reader content
+  - Real-time preview of alignment changes in settings
+  - Headings remain left-aligned for optimal readability
+
+### Changed
+
+- Default paragraph alignment changed to justified for improved reading experience
+  - Applies to paragraphs, list items, divs, and blockquotes
+  - Settings stored and synced via Nostr (NIP-78)
+
+## [0.6.14] - 2025-10-15
+
+### Added
+
+- Support for bookmark sets (NIP-51 kind:30003)
+  - Bookmark sets now display alongside regular bookmark lists
+  - Properly handles AddressPointer bookmarks for long-form articles
+- Content type icons for bookmarks
+  - Article, video, web, and image icons to indicate bookmark content type
+  - Camera icon for image bookmarks
+  - Sticky note icon for text-only bookmarks without URLs
+- Bookmark grouping and sections
+  - Grouped sections in sidebar and `/me` reading-list
+  - Web bookmarks, default bookmarks, and legacy bookmarks in separate sections
+  - Grouping and sorting helpers for organizing bookmark sections
+- Adaptive text color for publication date over hero images
+  - Automatically detects image brightness and adjusts text color
+  - Improved contrast for better readability
+
+### Changed
+
+- Renamed "Amethyst-style bookmarks" to "Old Bookmarks (Legacy)"
+- Hide cover images in compact view for cleaner layout
+- Support button improvements
+  - Moved to bottom-left of bookmarks bar
+  - Changed icon from lightning bolt to heart (orange color)
+  - Left-aligned support button, right-aligned view mode buttons
+- Section headings improved with better typography (removed counts)
+- Icon changed from book to file-lines for default bookmarks
+- Use regular (outlined) icon variants for lighter, more refined appearance
+- Add bookmark button moved to web bookmarks section
+- Empty state messages replaced with loading spinners
+- Section dividers made more subtle
+- Simplified bookmark filtering to only exclude empty content
+
+### Fixed
+
+- Removed borders from compact bookmark cards for cleaner look
+- Removed duplicate type indicator icons from bookmark cards
+- Reduced section heading bottom padding for better spacing
+- Aligned add bookmark button with section heading
+- Removed redundant loading spinner above tabs
+- Resolved linter and type errors
+- Include kind:30003 in default bookmark list detection
+- Removed text shadows from publication date for cleaner look
+- Improved shadow contrast without background overlay
+- Corrected async handling in adaptive color detection
+- Corrected FastAverageColor import to use named export
+- Section heading styles now properly override with `!important`
+- Removed unused articleImage prop from CompactView
+
+## [0.6.13] - 2025-10-15
+
+### Added
+
+- Support for `nprofile` identifiers on `/p/` profile pages (NIP-19)
+  - Profile pages now accept both `npub` and `nprofile` identifiers
+  - Extracts pubkey from nprofile data structure
+  - Users can share profiles with relay metadata included
+- Gradient placeholder images for articles without cover images
+  - Blog post cards show subtle diagonal gradient using theme colors
+  - Reader view displays gradient background with newspaper icon
+  - Placeholders adapt automatically to light/dark themes
+  - Large view bookmarks use matching gradient backgrounds
+
+### Changed
+
+- PWA install section styling in settings
+  - Heading now matches other section headings with proper styling
+  - Install button uses standard app button styling instead of custom gradient
+  - Consistent with app's design system and theme colors
+
+### Fixed
+
+- Mobile bookmark button visibility across all pages
+  - Now visible on `/p/` (profile), `/explore`, `/me`, and `/support` pages
+  - Only hidden on settings page or when scrolling down while reading
+  - Prevents users from getting stuck without navigation options
+- Mobile highlights button behavior at page top
+  - Hidden when scrolled to the very top of the page
+  - Appears when scrolling up from below
+  - Bookmark button remains visible at top (only hides on scroll down)
+  - Separate visibility logic for each button improves UX
+
+## [0.6.12] - 2025-10-15
+
+### Changed
+
+- Horizontal dividers (`<hr>`) in blog posts now display with more subtle styling
+  - Reduced visual weight with 69% opacity for better readability
+  - Added increased vertical padding (2.5rem) above and below dividers
+  - Improved visual separation without disrupting reading flow
+
 ## [0.6.11] - 2025-10-15
 
 ### Added
@@ -1373,7 +1760,19 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
 - Optimize relay usage following applesauce-relay best practices
 - Use applesauce-react event models for better profile handling
 
-[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.11...HEAD
+[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.24...HEAD
+[0.6.24]: https://github.com/dergigi/boris/compare/v0.6.23...v0.6.24
+[0.6.23]: https://github.com/dergigi/boris/compare/v0.6.22...v0.6.23
+[0.6.21]: https://github.com/dergigi/boris/compare/v0.6.20...v0.6.21
+[0.6.20]: https://github.com/dergigi/boris/compare/v0.6.19...v0.6.20
+[0.6.19]: https://github.com/dergigi/boris/compare/v0.6.18...v0.6.19
+[0.6.18]: https://github.com/dergigi/boris/compare/v0.6.17...v0.6.18
+[0.6.17]: https://github.com/dergigi/boris/compare/v0.6.16...v0.6.17
+[0.6.16]: https://github.com/dergigi/boris/compare/v0.6.15...v0.6.16
+[0.6.15]: https://github.com/dergigi/boris/compare/v0.6.14...v0.6.15
+[0.6.14]: https://github.com/dergigi/boris/compare/v0.6.13...v0.6.14
+[0.6.13]: https://github.com/dergigi/boris/compare/v0.6.12...v0.6.13
+[0.6.12]: https://github.com/dergigi/boris/compare/v0.6.11...v0.6.12
 [0.6.11]: https://github.com/dergigi/boris/compare/v0.6.10...v0.6.11
 [0.6.10]: https://github.com/dergigi/boris/compare/v0.6.9...v0.6.10
 [0.6.9]: https://github.com/dergigi/boris/compare/v0.6.8...v0.6.9

api/article-og.ts

@@ -0,0 +1,304 @@
+import type { VercelRequest, VercelResponse } from '@vercel/node'
+import { RelayPool } from 'applesauce-relay'
+import { nip19 } from 'nostr-tools'
+import { AddressPointer } from 'nostr-tools/nip19'
+import { NostrEvent, Filter } from 'nostr-tools'
+import { Helpers } from 'applesauce-core'
+
+const { getArticleTitle, getArticleImage, getArticleSummary } = Helpers
+
+// Relay configuration (from src/config/relays.ts)
+const RELAYS = [
+  'wss://relay.damus.io',
+  'wss://nos.lol',
+  'wss://relay.nostr.band',
+  'wss://relay.dergigi.com',
+  'wss://wot.dergigi.com',
+  'wss://relay.snort.social',
+  'wss://relay.current.fyi',
+  'wss://nostr-pub.wellorder.net',
+  'wss://purplepag.es',
+  'wss://relay.primal.net'
+]
+
+type CacheEntry = {
+  html: string
+  expires: number
+}
+
+const WEEK_MS = 7 * 24 * 60 * 60 * 1000
+const memoryCache = new Map<string, CacheEntry>()
+
+function escapeHtml(text: string): string {
+  return text
+    .replace(/&/g, '&amp;')
+    .replace(/</g, '&lt;')
+    .replace(/>/g, '&gt;')
+    .replace(/"/g, '&quot;')
+    .replace(/'/g, '&#039;')
+}
+
+function setCacheHeaders(res: VercelResponse, maxAge: number = 86400): void {
+  res.setHeader('Cache-Control', `public, max-age=${maxAge}, s-maxage=604800`)
+  res.setHeader('Content-Type', 'text/html; charset=utf-8')
+}
+
+interface ArticleMetadata {
+  title: string
+  summary: string
+  image: string
+  author: string
+  published?: number
+}
+
+async function fetchEventsFromRelays(
+  relayPool: RelayPool,
+  relayUrls: string[],
+  filter: Filter,
+  timeoutMs: number
+): Promise<NostrEvent[]> {
+  const events: NostrEvent[] = []
+
+  await new Promise<void>((resolve) => {
+    const timeout = setTimeout(() => resolve(), timeoutMs)
+
+    // `request` emits NostrEvent objects directly
+    relayPool.request(relayUrls, filter).subscribe({
+      next: (event) => {
+        events.push(event)
+      },
+      error: () => resolve(),
+      complete: () => {
+        clearTimeout(timeout)
+        resolve()
+      }
+    })
+  })
+
+  // Sort by created_at and return most recent first
+  return events.sort((a, b) => b.created_at - a.created_at)
+}
+
+async function fetchArticleMetadata(naddr: string): Promise<ArticleMetadata | null> {
+  const relayPool = new RelayPool()
+  
+  try {
+    // Decode naddr
+    const decoded = nip19.decode(naddr)
+    if (decoded.type !== 'naddr') {
+      return null
+    }
+
+    const pointer = decoded.data as AddressPointer
+
+    // Determine relay URLs
+    const relayUrls = pointer.relays && pointer.relays.length > 0 ? pointer.relays : RELAYS
+
+    // Fetch article and profile in parallel
+    const [articleEvents, profileEvents] = await Promise.all([
+      fetchEventsFromRelays(relayPool, relayUrls, {
+        kinds: [pointer.kind],
+        authors: [pointer.pubkey],
+        '#d': [pointer.identifier || '']
+      }, 5000),
+      fetchEventsFromRelays(relayPool, relayUrls, {
+        kinds: [0],
+        authors: [pointer.pubkey]
+      }, 3000)
+    ])
+
+    if (articleEvents.length === 0) {
+      return null
+    }
+
+    const article = articleEvents[0]
+
+    // Extract article metadata
+    const title = getArticleTitle(article) || 'Untitled Article'
+    const summary = getArticleSummary(article) || 'Read this article on Boris'
+    const image = getArticleImage(article) || '/boris-social-1200.png'
+
+    // Extract author name from profile
+    let authorName = pointer.pubkey.slice(0, 8) + '...'
+    if (profileEvents.length > 0) {
+      try {
+        const profileData = JSON.parse(profileEvents[0].content)
+        authorName = profileData.display_name || profileData.name || authorName
+      } catch {
+        // Use fallback
+      }
+    }
+
+    return {
+      title,
+      summary,
+      image,
+      author: authorName,
+      published: article.created_at
+    }
+  } catch (err) {
+    console.error('Failed to fetch article metadata:', err)
+    return null
+  } finally {
+    // No explicit close needed; pool manages connections internally
+  }
+}
+
+function generateHtml(naddr: string, meta: ArticleMetadata | null): string {
+  const baseUrl = 'https://read.withboris.com'
+  const articleUrl = `${baseUrl}/a/${naddr}`
+  
+  const title = meta?.title || 'Boris – Nostr Bookmarks'
+  const description = meta?.summary || 'Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights.'
+  const image = meta?.image?.startsWith('http') ? meta.image : `${baseUrl}${meta?.image || '/boris-social-1200.png'}`
+  const author = meta?.author || 'Boris'
+
+  return `<!doctype html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" type="image/x-icon" href="/favicon.ico" />
+    <link rel="icon" type="image/png" sizes="32x32" href="/favicon-32x32.png" />
+    <link rel="icon" type="image/png" sizes="16x16" href="/favicon-16x16.png" />
+    <link rel="apple-touch-icon" sizes="180x180" href="/apple-touch-icon.png" />
+    <meta name="viewport" content="width=device-width, initial-scale=1, viewport-fit=cover" />
+    <meta name="theme-color" content="#0f172a" />
+    <link rel="manifest" href="/manifest.webmanifest" />
+    <title>${escapeHtml(title)}</title>
+    <meta name="description" content="${escapeHtml(description)}" />
+    <link rel="canonical" href="${articleUrl}" />
+    
+    <!-- Open Graph / Social Media -->
+    <meta property="og:type" content="article" />
+    <meta property="og:url" content="${articleUrl}" />
+    <meta property="og:title" content="${escapeHtml(title)}" />
+    <meta property="og:description" content="${escapeHtml(description)}" />
+    <meta property="og:image" content="${escapeHtml(image)}" />
+    <meta property="og:site_name" content="Boris" />
+    ${meta?.published ? `<meta property="article:published_time" content="${new Date(meta.published * 1000).toISOString()}" />` : ''}
+    <meta property="article:author" content="${escapeHtml(author)}" />
+    
+    <!-- Twitter Card -->
+    <meta name="twitter:card" content="summary_large_image" />
+    <meta name="twitter:url" content="${articleUrl}" />
+    <meta name="twitter:title" content="${escapeHtml(title)}" />
+    <meta name="twitter:description" content="${escapeHtml(description)}" />
+    <meta name="twitter:image" content="${escapeHtml(image)}" />
+  </head>
+  <body>
+    <noscript>
+      <p>Redirecting to <a href="/">Boris</a>...</p>
+    </noscript>
+  </body>
+</html>`
+}
+
+function isCrawler(userAgent: string | undefined): boolean {
+  if (!userAgent) return false
+  const crawlers = [
+    'bot', 'crawl', 'spider', 'slurp', 'facebook', 'twitter', 'linkedin',
+    'whatsapp', 'telegram', 'slack', 'discord', 'preview'
+  ]
+  const ua = userAgent.toLowerCase()
+  return crawlers.some(crawler => ua.includes(crawler))
+}
+
+export default async function handler(req: VercelRequest, res: VercelResponse) {
+  const naddr = (req.query.naddr as string | undefined)?.trim()
+  
+  if (!naddr) {
+    return res.status(400).json({ error: 'Missing naddr parameter' })
+  }
+
+  const userAgent = req.headers['user-agent'] as string | undefined
+  const isCrawlerRequest = isCrawler(userAgent)
+
+  const debugEnabled = req.query.debug === '1' || req.headers['x-boris-debug'] === '1'
+  if (debugEnabled) {
+    console.log('[article-og] request', JSON.stringify({
+      naddr,
+      ua: userAgent || null,
+      isCrawlerRequest,
+      path: req.url || null
+    }))
+    res.setHeader('X-Boris-Debug', '1')
+  }
+
+  // If it's a regular browser (not a bot), serve HTML that loads SPA
+  // Use history.replaceState to set the URL before the SPA boots
+  if (!isCrawlerRequest) {
+    const articlePath = `/a/${naddr}`
+    // Serve a minimal HTML that sets up the URL and loads the SPA
+    const html = `<!DOCTYPE html>
+<html lang="en">
+<head>
+  <meta charset="UTF-8">
+  <link rel="icon" type="image/x-icon" href="/favicon.ico">
+  <meta name="viewport" content="width=device-width, initial-scale=1">
+  <title>Boris - Loading Article...</title>
+  <script>
+    // Set the URL to the article path before SPA loads
+    if (window.location.pathname !== '${articlePath}') {
+      history.replaceState(null, '', '${articlePath}');
+    }
+  </script>
+  ${debugEnabled ? `<script>console.debug('article-og', { mode: 'browser', naddr: '${naddr}', path: location.pathname, referrer: document.referrer });</script>` : ''}
+  <script>
+    // Redirect to index.html which will load the SPA
+    // The history state is already set, so SPA will see the correct URL
+    window.location.replace('/');
+  </script>
+</head>
+<body>
+  <div id="root"></div>
+</body>
+</html>`
+    
+    res.setHeader('Content-Type', 'text/html; charset=utf-8')
+    res.setHeader('Cache-Control', 'no-cache, no-store, must-revalidate')
+    if (debugEnabled) {
+      console.log('[article-og] response', JSON.stringify({ mode: 'browser', naddr }))
+    }
+    return res.status(200).send(html)
+  }
+
+  // Check cache for bots/crawlers
+  const now = Date.now()
+  const cached = memoryCache.get(naddr)
+  if (cached && cached.expires > now) {
+    setCacheHeaders(res)
+    if (debugEnabled) {
+      console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: true }))
+    }
+    return res.status(200).send(cached.html)
+  }
+
+  try {
+    // Fetch metadata
+    const meta = await fetchArticleMetadata(naddr)
+    
+    // Generate HTML
+    const html = generateHtml(naddr, meta)
+    
+    // Cache the result
+    memoryCache.set(naddr, { html, expires: now + WEEK_MS })
+    
+    // Send response
+    setCacheHeaders(res)
+    if (debugEnabled) {
+      console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: false }))
+    }
+    return res.status(200).send(html)
+  } catch (err) {
+    console.error('Error generating article OG HTML:', err)
+    
+    // Fallback to basic HTML with SPA boot
+    const html = generateHtml(naddr, null)
+    setCacheHeaders(res, 3600)
+    if (debugEnabled) {
+      console.log('[article-og] response', JSON.stringify({ mode: 'bot-fallback', naddr }))
+    }
+    return res.status(200).send(html)
+  }
+}
+

index.html

@@ -18,6 +18,7 @@
     <meta property="og:url" content="https://read.withboris.com/" />
     <meta property="og:title" content="Boris - Nostr Bookmarks" />
     <meta property="og:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
+    <meta property="og:image" content="https://read.withboris.com/boris-social-1200.png" />
     <meta property="og:site_name" content="Boris" />
     
     <!-- Twitter Card -->
@@ -25,6 +26,7 @@
     <meta name="twitter:url" content="https://read.withboris.com/" />
     <meta name="twitter:title" content="Boris - Nostr Bookmarks" />
     <meta name="twitter:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
+    <meta name="twitter:image" content="https://read.withboris.com/boris-social-1200.png" />
     
     <!-- Default to system theme until settings load from Nostr -->
     <script>

package-lock.json

@@ -1,12 +1,12 @@
 {
   "name": "boris",
-  "version": "0.6.9",
+  "version": "0.6.13",
   "lockfileVersion": 3,
   "requires": true,
   "packages": {
     "": {
       "name": "boris",
-      "version": "0.6.9",
+      "version": "0.6.13",
       "dependencies": {
         "@fortawesome/fontawesome-svg-core": "^7.1.0",
         "@fortawesome/free-regular-svg-icons": "^7.1.0",
@@ -22,6 +22,7 @@
         "applesauce-react": "^4.0.0",
         "applesauce-relay": "^4.0.0",
         "date-fns": "^4.1.0",
+        "fast-average-color": "^9.5.0",
         "nostr-tools": "^2.4.0",
         "prismjs": "^1.30.0",
         "react": "^18.2.0",
@@ -6086,6 +6087,15 @@
       "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
       "license": "MIT"
     },
+    "node_modules/fast-average-color": {
+      "version": "9.5.0",
+      "resolved": "https://registry.npmjs.org/fast-average-color/-/fast-average-color-9.5.0.tgz",
+      "integrity": "sha512-nC6x2YIlJ9xxgkMFMd1BNoM1ctMjNoRKfRliPmiEWW3S6rLTHiQcy9g3pt/xiKv/D0NAAkhb9VyV+WJFvTqMGg==",
+      "license": "MIT",
+      "engines": {
+        "node": ">= 12"
+      }
+    },
     "node_modules/fast-deep-equal": {
       "version": "3.1.3",
       "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",

package.json

@@ -1,6 +1,6 @@
 {
   "name": "boris",
-  "version": "0.6.12",
+  "version": "0.6.24",
   "description": "A minimal nostr client for bookmark management",
   "homepage": "https://read.withboris.com/",
   "type": "module",
@@ -25,6 +25,7 @@
     "applesauce-react": "^4.0.0",
     "applesauce-relay": "^4.0.0",
     "date-fns": "^4.1.0",
+    "fast-average-color": "^9.5.0",
     "nostr-tools": "^2.4.0",
     "prismjs": "^1.30.0",
     "react": "^18.2.0",

public/pwa.svg

@@ -0,0 +1,215 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<svg
+   width="649.67538"
+   height="568.22024"
+   viewBox="0 0 649.67538 568.22024"
+   role="img"
+   artist="Katerina Limpitsouni"
+   source="https://undraw.co/"
+   version="1.1"
+   id="svg31"
+   sodipodi:docname="pwa.svg"
+   inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
+   xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+   xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+   xmlns="http://www.w3.org/2000/svg"
+   xmlns:svg="http://www.w3.org/2000/svg">
+  <defs
+     id="defs31" />
+  <sodipodi:namedview
+     id="namedview31"
+     pagecolor="#ffffff"
+     bordercolor="#000000"
+     borderopacity="0.25"
+     inkscape:showpageshadow="2"
+     inkscape:pageopacity="0.0"
+     inkscape:pagecheckerboard="0"
+     inkscape:deskcolor="#d1d1d1"
+     inkscape:zoom="1.6866359"
+     inkscape:cx="303.56285"
+     inkscape:cy="531.82789"
+     inkscape:window-width="3840"
+     inkscape:window-height="1027"
+     inkscape:window-x="0"
+     inkscape:window-y="25"
+     inkscape:window-maximized="0"
+     inkscape:current-layer="svg31" />
+  <path
+     d="M397.23858,566.04035,390.539,618.81819l-9.85909-59.95407c-47.3817-18.18194-102.78179-21.713-102.78179-21.713s-12.22552,114.50728,28.139,162.38683,82.92182,40.60129,118.03379,11.00042c35.1114-29.60039,49.48123-70.31412,9.11675-118.19368C424.20327,581.68766,411.521,573.04476,397.23858,566.04035Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#f2f2f2"
+     id="path1" />
+  <path
+     d="M384.1004,626.79762l1.98958,2.36c22.98681,27.551,36.40476,52.8555,40.0327,75.5803.05864.33032.09573.65881.15431.98919l-1.53846.23773-1.48187.20991c-3.64942-24.76543-19.47993-50.77428-39.52347-74.8103-.63842-.781-1.28663-1.57364-1.95824-2.34655-8.57477-10.1-17.832-19.82437-27.217-28.9415-.72021-.712-1.46191-1.42587-2.20361-2.13968-12.44963-11.96994-25.01434-22.84351-36.237-32.03036-.7903-.653-1.59224-1.296-2.38439-1.92739-19.05943-15.4717-33.9044-25.802-37.21424-28.06849-.39875-.28343-.62465-.43273-.67573-.46958l.844-1.25121.00183-.02155.85568-1.26106c.05113.03692.81117.53546,2.18233,1.49814,5.15056,3.57268,18.987,13.39417,36.1433,27.27236.77059.62957,1.57259,1.27267,2.36284,1.92555,9.11521,7.44575,19.072,15.96086,29.1037,25.25221q3.78542,3.49455,7.37706,6.9724c.75332.704,1.495,1.41783,2.21523,2.12988Q372.14864,612.73905,384.1004,626.79762Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path2" />
+  <path
+     d="M315.8701,561.67759c-.6941.76509-1.39989,1.54-2.13716,2.30139a84.299,84.299,0,0,1-6.3038,5.89408,82.00518,82.00518,0,0,1-32.26683,16.72907c.03131,1.03285.06269,2.06578.09217,3.12018a85.04164,85.04164,0,0,0,34.14459-17.51256,87.22471,87.22471,0,0,0,6.71826-6.30338c.72551-.75156,1.43131-1.52651,2.11561-2.30323a84.3256,84.3256,0,0,0,13.87772-21.35332q-1.56615-.32858-3.06776-.65165A81.72351,81.72351,0,0,1,315.8701,561.67759Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path3" />
+  <path
+     d="M354.7137,595.82775q-1.15019,1.08949-2.35939,2.109c-.23552.21856-.49252.43522-.7379.64208a82.4401,82.4401,0,0,1-74.51659,16.59042c.1138,1.08323.22759,2.1666.36294,3.25167a85.5013,85.5013,0,0,0,76.12358-17.5054c.32717-.27581.65427-.55157.97158-.83909.80793-.70112,1.59437-1.40414,2.371-2.11878a85.04917,85.04917,0,0,0,24.39782-41.355c-.955-.37409-1.91-.74825-2.87668-1.11248A81.874,81.874,0,0,1,354.7137,595.82775Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path4" />
+  <path
+     d="M384.1004,626.79762c-.75869.75952-1.53717,1.49572-2.32545,2.22029-.84674.77374-1.70328,1.53585-2.57954,2.27457a82.66307,82.66307,0,0,1-98.92522,5.60818c.27211,1.38968.5343,2.76759.82973,4.13747a85.69022,85.69022,0,0,0,100.06542-7.409c.87626-.73872,1.74266-1.48914,2.56785-2.26471.80983-.72274,1.58831-1.45893,2.35679-2.20683a85.43958,85.43958,0,0,0,25.37276-57.38712c-.97424-.6577-1.97364-1.27419-2.98289-1.90237A82.39644,82.39644,0,0,1,384.1004,626.79762Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path5" />
+  <path
+     d="M648.03621,300.20693V215.13007a49.24034,49.24034,0,0,0-49.24-49.24019H418.54942a49.24029,49.24029,0,0,0-49.2406,49.24V271.632h-3.16709v19.90855h3.16709V312.7763h-3.16709v30.52644h3.16709V356.5751h-3.16709v30.52643h3.16709v294.7669a49.23993,49.23993,0,0,0,49.23995,49.24019H598.79561a49.24028,49.24028,0,0,0,49.2406-49.24V360.76613h3.10552v-60.5592Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#3f3d56"
+     id="path6" />
+  <path
+     d="M600.78268,178.70047H577.2545a17.47031,17.47031,0,0,1-16.17511,24.06836H457.81825a17.4703,17.4703,0,0,1-16.17512-24.06839H419.66775a36.772,36.772,0,0,0-36.772,36.772V681.526a36.772,36.772,0,0,0,36.772,36.77205h181.115a36.772,36.772,0,0,0,36.772-36.772h0V215.47244A36.772,36.772,0,0,0,600.78268,178.70047Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path7" />
+  <path
+     d="M605.33827,340.8917H415.11207a5.0058,5.0058,0,0,1-5-5V258.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V335.8917A5.00573,5.00573,0,0,1,605.33827,340.8917Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#6c63ff"
+     id="path8" />
+  <path
+     d="M587.22522,377.41807h-154a5.5,5.5,0,0,1,0-11h154a5.5,5.5,0,0,1,0,11Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#6c63ff"
+     id="path9" />
+  <path
+     d="M587.22523,405.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path10" />
+  <path
+     d="M587.22523,432.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path11" />
+  <path
+     d="M605.33827,571.8917H415.11207a5.0058,5.0058,0,0,1-5-5V489.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V566.8917A5.00573,5.00573,0,0,1,605.33827,571.8917Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path12" />
+  <path
+     d="M587.22523,608.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path13" />
+  <path
+     d="M587.22523,636.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path14" />
+  <path
+     d="M587.22523,663.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path15" />
+  <path
+     d="M760.06605,312.22721c-1.93457-14.18963-4.36084-29.42431-14.3689-39.66754a33.65518,33.65518,0,0,0-48.62622.5033c-7.28515,7.77185-10.50244,18.68475-10.79687,29.33325s2.07714,21.17865,4.708,31.50122a97.0913,97.0913,0,0,0,40.52124-7.97583,65.28916,65.28916,0,0,1,9.71558-3.81427c3.376-.85925,5.78247,1.303,8.92285,2.81073l1.72388-3.30078c1.41113,2.62616,5.78076,1.84772,7.36572-.67737C760.81605,318.41483,760.46888,315.18107,760.06605,312.22721Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#2f2e41"
+     id="path16" />
+  <polygon
+     points="612.434 535.007 602.208 541.77 571.257 505.545 586.349 495.564 612.434 535.007"
+     fill="#9e616a"
+     id="polygon16" />
+  <path
+     d="M896.7595,709.08432,863.787,730.89015l-.27582-.417a15.38729,15.38729,0,0,1,4.34573-21.32122l.00081-.00054,20.13853-13.31819Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#2f2e41"
+     id="path17" />
+  <polygon
+     points="480.429 553.116 468.169 553.116 462.337 505.828 480.431 505.829 480.429 553.116"
+     fill="#9e616a"
+     id="polygon17" />
+  <path
+     d="M758.71777,730.89015l-39.53076-.00146v-.5a15.3873,15.3873,0,0,1,15.38647-15.38623h.001l24.144.001Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#2f2e41"
+     id="path18" />
+  <path
+     d="M668.3639,394.03709l-46.28906-33.06561a8.99743,8.99743,0,1,0-10.80762,7.74816c5.78613,4.85816,48.04785,46.88825,54.09888,44.67127,6.1416-2.25012,32.99341-6.32324,32.99341-6.32324l.74755-25.4953Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#9e616a"
+     id="path19" />
+  <path
+     d="M704.73272,454.19782l.437,58.1781s10.01741,86.201,13.712,100.76318,18.69148,81.94564,18.69148,81.94564l24.3788-3.93292-15.69975-88.09791,4.74535-73.017,27.36445,73.178L847.847,675.848l17.61024-14.2095-60.48051-88.88116-18.47283-72.811s2.29785-37.66031-18.40081-52.16322Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#2f2e41"
+     id="path20" />
+  <circle
+     cx="443.5739"
+     cy="133.65539"
+     r="26.72083"
+     fill="#9e616a"
+     id="circle20" />
+  <rect
+     x="722.98731"
+     y="465.33587"
+     width="24.29166"
+     height="31.57916"
+     transform="translate(-279.66359 789.41207) rotate(-65.86746)"
+     fill="#2f2e41"
+     id="rect20" />
+  <path
+     d="M593.23271,362.65743"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#6c63ff"
+     id="path21" />
+  <path
+     d="M761.53382,350.95884c-3.14892-6.267-4.67895-14.009-11.39209-16.04077-4.5332-1.372-22.86841.68408-27,3-6.87231,3.85236-.64453,11.07111-4.699,17.82642q-6.61121,11.01552-13.22241,22.031c-3.03,5.04852-6.0918,10.16889-7.73023,15.82434-1.63818,5.65546-1.717,12.00305,1.074,17.18756,2.4978,4.64045,7.02294,7.93158,9.53515,12.56433,2.61231,4.81806-2.07715,26.33136-4.50854,31.24341l1.167.539a263.08934,263.08934,0,0,0,48.448-1.63024c3.9873-.50489,8.12744-1.16449,11.41308-3.47895,4.83985-3.40918,6.75318-9.5954,7.949-15.39337A129.67713,129.67713,0,0,0,761.53382,350.95884Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path22" />
+  <path
+     d="M706.84845,411.65133c7.23924-7.1146,14.51542-14.27181,20.47486-22.48827s10.5936-17.62115,11.88744-27.68835a20.50914,20.50914,0,0,0-.64136-9.62007c-1.11054-3.049-3.56912-5.755-6.73861-6.45068-5.07194-1.11355-9.6829,2.93435-13.30226,6.6577q-16.00732,16.46812-32.01478,32.936,10.19649,13.42191,20.393,26.84353Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path23" />
+  <path
+     d="M785.75257,417.13127c-2.25-6.14148-6.32324-32.99323-6.32324-32.99323l-25.49512-.74756,12.4646,30.7431-34.01367,47.61615s.063.10462.17749.2912a8.99538,8.99538,0,1,0,7.54468,9.55927.62106.62106,0,0,0,.77978-.13385C744.67176,466.7169,788.00257,423.27281,785.75257,417.13127Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#9e616a"
+     id="path24" />
+  <path
+     d="M788.34461,400.17338c-2.34008-9.87665-4.69751-19.807-8.64282-29.15894s-9.59326-18.18512-17.53711-24.50317a20.50909,20.50909,0,0,0-8.563-4.43085c-3.18359-.62805-6.77148.07483-9.00732,2.42658-3.57813,3.76318-2.50147,9.80365-1.18921,14.8277q5.80444,22.2203,11.60864,44.44061,16.76184-1.77667,33.52344-3.55347Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#e4e4e4"
+     id="path25" />
+  <path
+     d="M752.14124,301.6237c-.83545-6.464-1.708-12.98224-3.67065-19.06879-1.96265-6.08661-5.12622-11.78747-9.66431-15.23547-7.1853-5.459-16.488-4.40613-24.54394-1.266-6.23,2.42846-12.31153,6.1195-16.70484,12.05346-4.39355,5.934-6.86108,14.40119-5.2268,22.1601q12.88989-3.58722,25.77954-7.1745l-.94068.783c5.57642,3.14221,9.81153,9.64361,11.07691,17.00482a28.7171,28.7171,0,0,1-4.53662,21.03778q8.79089-3.67337,17.58178-7.34662c3.61744-1.51153,7.489-3.25317,9.634-7.13025C753.41273,312.94608,752.83485,306.98814,752.14124,301.6237Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#2f2e41"
+     id="path26" />
+  <path
+     d="M625.98113,343.51431,608.792,369.31226a4.46863,4.46863,0,0,1-3.75549,2.00125,4.47943,4.47943,0,0,1-4.13509-2.75491,4.12763,4.12763,0,0,1-.2689-.85745,4.51165,4.51165,0,0,1,.66976-3.37929l17.18913-25.79794a4.5,4.5,0,1,1,7.48973,4.99039Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#6c63ff"
+     id="path27" />
+  <path
+     d="M610.17821,367.23178l-3.47923,5.19091-6.15652,5.42689a2.45095,2.45095,0,0,1-3.94221-2.627l2.69471-7.8881,3.39353-5.09311Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#3f3d56"
+     id="path28" />
+  <path
+     d="M626.74053,329.98545l-8.6142,7.59289a2.45233,2.45233,0,0,0,.26168,3.88081l1.62984,1.086-4.71315,7.07363a1,1,0,0,0,1.66439,1.109l4.71314-7.07362,1.62985,1.086a2.45552,2.45552,0,0,0,3.39872-.675,2.46816,2.46816,0,0,0,.28357-.57793l3.69013-10.8738a2.45251,2.45251,0,0,0-3.944-2.62786Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#3f3d56"
+     id="path29" />
+  <path
+     d="M516.97522,187.41807h-27a2,2,0,0,1,0-4h27a2,2,0,0,1,0,4Z"
+     transform="translate(-275.16231 -165.88988)"
+     fill="#fff"
+     id="path31" />
+  <circle
+     cx="255.31291"
+     cy="19.52819"
+     r="2"
+     fill="#fff"
+     id="circle31" />
+</svg>

public/zaps.svg

@@ -0,0 +1,235 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<svg
+   width="720.44"
+   height="718.635"
+   viewBox="0 0 720.44 718.635"
+   role="img"
+   artist="Katerina Limpitsouni"
+   source="https://undraw.co/"
+   version="1.1"
+   id="svg30"
+   sodipodi:docname="zaps.svg"
+   xml:space="preserve"
+   inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
+   xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+   xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+   xmlns="http://www.w3.org/2000/svg"
+   xmlns:svg="http://www.w3.org/2000/svg"><defs
+     id="defs30" /><sodipodi:namedview
+     id="namedview30"
+     pagecolor="#ffffff"
+     bordercolor="#000000"
+     borderopacity="0.25"
+     inkscape:showpageshadow="2"
+     inkscape:pageopacity="0.0"
+     inkscape:pagecheckerboard="0"
+     inkscape:deskcolor="#d1d1d1"
+     inkscape:zoom="2.6746164"
+     inkscape:cx="38.510195"
+     inkscape:cy="485.67712"
+     inkscape:window-width="3840"
+     inkscape:window-height="1027"
+     inkscape:window-x="0"
+     inkscape:window-y="25"
+     inkscape:window-maximized="0"
+     inkscape:current-layer="g27" /><g
+     transform="translate(-600 -181)"
+     id="g30"><g
+       transform="translate(783.85 181)"
+       id="g2"><path
+         d="M624.7,249.968h-3.952V141.8a62.6,62.6,0,0,0-62.6-62.6H328.97a62.6,62.6,0,0,0-62.6,62.6V735.225a62.6,62.6,0,0,0,62.6,62.6H558.143a62.6,62.6,0,0,0,62.6-62.6V326.965H624.7Z"
+         transform="translate(-266.365 -79.193)"
+         fill="#090814"
+         id="path1" /><path
+         d="M560.888,95.686H530.974a22.212,22.212,0,0,1-20.565,30.6h-131.3a22.212,22.212,0,0,1-20.566-30.6H330.607a46.752,46.752,0,0,0-46.752,46.752V735a46.752,46.752,0,0,0,46.752,46.752H560.879A46.752,46.752,0,0,0,607.63,735V142.439a46.752,46.752,0,0,0-46.744-46.752Z"
+         transform="translate(-266.577 -79.397)"
+         fill="#fff"
+         id="path2" /></g><path
+       d="M8,0H256a8,8,0,0,1,8,8V72a8,8,0,0,1-8,8H8a8,8,0,0,1-8-8V8A8,8,0,0,1,8,0Z"
+       transform="translate(828 265)"
+       fill="#f2f2f2"
+       id="path3" /><path
+       d="M8,0H256a8.065,8.065,0,0,1,8,8.128V475.474a8.065,8.065,0,0,1-8,8.128H8a8.065,8.065,0,0,1-8-8.128V8.128A8.065,8.065,0,0,1,8,0Z"
+       transform="translate(828 358.398)"
+       fill="#f2f2f2"
+       id="path4" /><g
+       transform="translate(623.104 296.398)"
+       id="g9"><rect
+         width="278.304"
+         height="69.313"
+         rx="16"
+         transform="translate(0 0)"
+         fill="#090814"
+         id="rect4" /><rect
+         width="272.003"
+         height="63.012"
+         rx="15"
+         transform="translate(3.151 3.151)"
+         fill="#fff"
+         id="rect5" /><path
+         d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
+         transform="translate(-53.047 -325.676)"
+         fill="#6c63ff"
+         id="path5" /><g
+         transform="translate(17.038 13.546)"
+         id="g7"><path
+           d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
+           transform="translate(0 0)"
+           fill="#6c63ff"
+           id="path6" /><path
+           fill="#ffffff"
+           d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.7844991 20.830193,9.2808662 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
+           id="path2-8-2"
+           style="stroke-width:0.575581" /></g><path
+         d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(72.886 17.036)"
+         fill="#e6e6e6"
+         id="path8" /><path
+         d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(72.886 37.98)"
+         fill="#e6e6e6"
+         id="path9" /></g><g
+       transform="translate(1003.278 402.469)"
+       id="g14"><rect
+         width="279.354"
+         height="69.313"
+         rx="16"
+         transform="translate(0 0)"
+         fill="#090814"
+         id="rect9" /><rect
+         width="272.003"
+         height="63.012"
+         rx="15"
+         transform="translate(3.151 3.151)"
+         fill="#fff"
+         id="rect10" /><path
+         d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
+         transform="translate(-52.751 -325.287)"
+         fill="#6c63ff"
+         id="path10" /><g
+         transform="translate(17.334 13.936)"
+         id="g12"><path
+           d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
+           transform="translate(0 0)"
+           fill="#6c63ff"
+           id="path11" /><path
+           fill="#ffffff"
+           d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
+           id="path2-8-2-7"
+           style="stroke-width:0.575581" /></g><path
+         d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.181 17.426)"
+         fill="#e6e6e6"
+         id="path13" /><path
+         d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.181 38.369)"
+         fill="#e6e6e6"
+         id="path14" /></g><g
+       transform="translate(663.012 510.639)"
+       id="g19"><rect
+         width="279.354"
+         height="69.313"
+         rx="16"
+         transform="translate(0 0)"
+         fill="#090814"
+         id="rect14" /><rect
+         width="272.003"
+         height="63.012"
+         rx="15"
+         transform="translate(3.151 3.151)"
+         fill="#fff"
+         id="rect15" /><path
+         d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
+         transform="translate(-52.814 -325.25)"
+         fill="#6c63ff"
+         id="path15" /><g
+         transform="translate(17.272 13.972)"
+         id="g17"><path
+           d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
+           transform="translate(0 0)"
+           fill="#6c63ff"
+           id="path16" /><path
+           fill="#ffffff"
+           d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
+           id="path2-8-2-0"
+           style="stroke-width:0.575581" /></g><path
+         d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.119 17.463)"
+         fill="#e6e6e6"
+         id="path18" /><path
+         d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.119 38.406)"
+         fill="#e6e6e6"
+         id="path19" /></g><g
+       transform="translate(1041.086 616.711)"
+       id="g24"><rect
+         width="279.354"
+         height="70.364"
+         rx="16"
+         transform="translate(0 0)"
+         fill="#090814"
+         id="rect19" /><rect
+         width="272.003"
+         height="63.012"
+         rx="15"
+         transform="translate(4.201 4.201)"
+         fill="#fff"
+         id="rect20" /><path
+         d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
+         transform="translate(-52.163 -324.86)"
+         fill="#6c63ff"
+         id="path20" /><g
+         transform="translate(17.922 14.362)"
+         id="g22"><path
+           d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
+           transform="translate(0 0)"
+           fill="#6c63ff"
+           id="path21" /><path
+           fill="#ffffff"
+           d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
+           id="path2-8-2-9"
+           style="stroke-width:0.575581" /></g><path
+         d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.77 17.853)"
+         fill="#e6e6e6"
+         id="path23" /><path
+         d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.77 38.796)"
+         fill="#e6e6e6"
+         id="path24" /></g><g
+       transform="translate(600 723.832)"
+       id="g29"><rect
+         width="279.354"
+         height="69.313"
+         rx="16"
+         transform="translate(0 0)"
+         fill="#090814"
+         id="rect24" /><rect
+         width="273.053"
+         height="63.012"
+         rx="15"
+         transform="translate(3.151 3.151)"
+         fill="#fff"
+         id="rect25" /><path
+         d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
+         transform="translate(-52.631 -325.518)"
+         fill="#6c63ff"
+         id="path25" /><g
+         transform="translate(17.454 13.704)"
+         id="g27"><path
+           d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
+           transform="translate(0 0)"
+           fill="#6c63ff"
+           id="path26" /><path
+           fill="#ffffff"
+           d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
+           id="path2-8-2-98"
+           style="stroke-width:0.575581" /></g><path
+         d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.301 17.194)"
+         fill="#e6e6e6"
+         id="path28" /><path
+         d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
+         transform="translate(73.301 38.138)"
+         fill="#e6e6e6"
+         id="path29" /></g></g></svg>

src/App.tsx

@@ -4,16 +4,21 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faSpinner } from '@fortawesome/free-solid-svg-icons'
 import { EventStoreProvider, AccountsProvider, Hooks } from 'applesauce-react'
 import { EventStore } from 'applesauce-core'
-import { AccountManager } from 'applesauce-accounts'
+import { AccountManager, Accounts } from 'applesauce-accounts'
 import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
 import { RelayPool } from 'applesauce-relay'
+import { NostrConnectSigner } from 'applesauce-signers'
+import { getDefaultBunkerPermissions } from './services/nostrConnect'
 import { createAddressLoader } from 'applesauce-loaders/loaders'
+import Debug from './components/Debug'
 import Bookmarks from './components/Bookmarks'
+import RouteDebug from './components/RouteDebug'
 import Toast from './components/Toast'
 import { useToast } from './hooks/useToast'
 import { useOnlineStatus } from './hooks/useOnlineStatus'
 import { RELAYS } from './config/relays'
 import { SkeletonThemeProvider } from './components/Skeletons'
+import { DebugBus } from './utils/debugBus'
 
 const DEFAULT_ARTICLE = import.meta.env.VITE_DEFAULT_ARTICLE_NADDR || 
   'naddr1qvzqqqr4gupzqmjxss3dld622uu8q25gywum9qtg4w4cv4064jmg20xsac2aam5nqqxnzd3cxqmrzv3exgmr2wfesgsmew'
@@ -112,7 +117,25 @@ function AppRoutes({
         } 
       />
       <Route 
-        path="/me/archive" 
+        path="/me/reads" 
+        element={
+          <Bookmarks 
+            relayPool={relayPool}
+            onLogout={handleLogout}
+          />
+        } 
+      />
+      <Route 
+        path="/me/reads/:filter" 
+        element={
+          <Bookmarks 
+            relayPool={relayPool}
+            onLogout={handleLogout}
+          />
+        } 
+      />
+      <Route 
+        path="/me/links" 
         element={
           <Bookmarks 
             relayPool={relayPool}
@@ -147,6 +170,7 @@ function AppRoutes({
           />
         } 
       />
+      <Route path="/debug" element={<Debug />} />
       <Route path="/" element={<Navigate to={`/a/${DEFAULT_ARTICLE}`} replace />} />
     </Routes>
   )
@@ -168,20 +192,57 @@ function App() {
       // Register common account types (needed for deserialization)
       registerCommonAccountTypes(accounts)
       
+      // Create relay pool and set it up BEFORE loading accounts
+      // NostrConnectAccount.fromJSON needs this to restore the signer
+      const pool = new RelayPool()
+      // Wire the signer to use this pool; make publish non-blocking so callers don't
+      // wait for every relay send to finish. Responses still resolve the pending request.
+      NostrConnectSigner.subscriptionMethod = pool.subscription.bind(pool)
+      NostrConnectSigner.publishMethod = (relays: string[], event: unknown) => {
+        const result: any = pool.publish(relays, event as any)
+        if (result && typeof (result as any).subscribe === 'function') {
+          try { (result as any).subscribe({ complete: () => {}, error: () => {} }) } catch {}
+        }
+        // Return an already-resolved promise so upstream await finishes immediately
+        return Promise.resolve()
+      }
+      console.log('[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription (before account load)')
+      
+      // Create a relay group for better event deduplication and management
+      pool.group(RELAYS)
+      console.log('[bunker] Created relay group with', RELAYS.length, 'relays (including local)')
+      
       // Load persisted accounts from localStorage
       try {
-        const json = JSON.parse(localStorage.getItem('accounts') || '[]')
+        const accountsJson = localStorage.getItem('accounts')
+        console.log('[bunker] Raw accounts from localStorage:', accountsJson)
+        
+        const json = JSON.parse(accountsJson || '[]')
+        console.log('[bunker] Parsed accounts:', json.length, 'accounts')
+        
         await accounts.fromJSON(json)
-        console.log('Loaded', accounts.accounts.length, 'accounts from storage')
+        console.log('[bunker] Loaded', accounts.accounts.length, 'accounts from storage')
+        console.log('[bunker] Account types:', accounts.accounts.map(a => ({ id: a.id, type: a.type })))
         
         // Load active account from storage
         const activeId = localStorage.getItem('active')
-        if (activeId && accounts.getAccount(activeId)) {
-          accounts.setActive(activeId)
-          console.log('Restored active account:', activeId)
+        console.log('[bunker] Active ID from localStorage:', activeId)
+        
+        if (activeId) {
+          const account = accounts.getAccount(activeId)
+          console.log('[bunker] Found account for ID?', !!account, account?.type)
+          
+          if (account) {
+            accounts.setActive(activeId)
+            console.log('[bunker] ✅ Restored active account:', activeId, 'type:', account.type)
+          } else {
+            console.warn('[bunker] ⚠️  Active ID found but account not in list')
+          }
+        } else {
+          console.log('[bunker] No active account ID in localStorage')
         }
       } catch (err) {
-        console.error('Failed to load accounts from storage:', err)
+        console.error('[bunker] ❌ Failed to load accounts from storage:', err)
       }
       
       // Subscribe to accounts changes and persist to localStorage
@@ -198,12 +259,197 @@ function App() {
         }
       })
       
-      const pool = new RelayPool()
+      // Reconnect bunker signers when active account changes
+      // Keep track of which accounts we've already reconnected to avoid double-connecting
+      const reconnectedAccounts = new Set<string>()
       
-      // Create a relay group for better event deduplication and management
-      pool.group(RELAYS)
-      console.log('Created relay group with', RELAYS.length, 'relays (including local)')
-      console.log('Relay URLs:', RELAYS)
+            const bunkerReconnectSub = accounts.active$.subscribe(async (account) => {
+              console.log('[bunker] Active account changed:', { 
+                hasAccount: !!account, 
+                type: account?.type,
+                id: account?.id 
+              })
+              
+              if (account && account.type === 'nostr-connect') {
+                const nostrConnectAccount = account as Accounts.NostrConnectAccount<unknown>
+                // Disable applesauce account queueing so decrypt requests aren't serialized behind earlier ops
+                try {
+                  if (!(nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue) {
+                    (nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue = true
+                    console.log('[bunker] ⚙️  Disabled account request queueing for nostr-connect')
+                  }
+                } catch (err) { console.warn('[bunker] failed to disable queue', err) }
+                // Note: for Amber bunker, the remote signer pubkey is the user's pubkey. This is expected.
+                
+                // Skip if we've already reconnected this account
+                if (reconnectedAccounts.has(account.id)) {
+                  console.log('[bunker] ⏭️  Already reconnected this account, skipping')
+                  return
+                }
+                
+                console.log('[bunker] Account detected. Status:', {
+                  listening: nostrConnectAccount.signer.listening,
+                  isConnected: nostrConnectAccount.signer.isConnected,
+                  hasRemote: !!nostrConnectAccount.signer.remote,
+                  bunkerRelays: nostrConnectAccount.signer.relays
+                })
+                
+                try {
+                  // For restored signers, ensure they have the pool's subscription methods
+                  // The signer was created in fromJSON without pool context, so we need to recreate it
+                  const signerData = nostrConnectAccount.toJSON().signer
+                  
+                  // Add bunker's relays to the pool BEFORE recreating the signer
+                  // This ensures the pool has all relays when the signer sets up its methods
+                  const bunkerRelays = signerData.relays || []
+                  const existingRelayUrls = new Set(Array.from(pool.relays.keys()))
+                  const newBunkerRelays = bunkerRelays.filter(url => !existingRelayUrls.has(url))
+                  
+                  if (newBunkerRelays.length > 0) {
+                    console.log('[bunker] Adding bunker relays to pool BEFORE signer recreation:', newBunkerRelays)
+                    pool.group(newBunkerRelays)
+                  } else {
+                    console.log('[bunker] Bunker relays already in pool')
+                  }
+                  
+                  const recreatedSigner = new NostrConnectSigner({
+                    relays: signerData.relays,
+                    pubkey: nostrConnectAccount.pubkey,
+                    remote: signerData.remote,
+                    signer: nostrConnectAccount.signer.signer, // Use the existing SimpleSigner
+                    pool: pool
+                  })
+                  // Ensure local relays are included for NIP-46 request/response traffic (e.g., Amber bunker)
+                  try {
+                    const mergedRelays = Array.from(new Set([...(signerData.relays || []), ...RELAYS]))
+                    recreatedSigner.relays = mergedRelays
+                    console.log('[bunker] 🔗 Signer relays merged with app RELAYS:', mergedRelays)
+                  } catch (err) { console.warn('[bunker] failed to merge signer relays', err) }
+                  
+                  // Replace the signer on the account
+                  nostrConnectAccount.signer = recreatedSigner
+                  console.log('[bunker] ✅ Signer recreated with pool context')
+
+                  // Debug: log publish/subscription calls made by signer (decrypt/sign requests)
+                  // IMPORTANT: bind originals to preserve `this` context used internally by the signer
+                  const originalPublish = (recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod.bind(recreatedSigner)
+                  ;(recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod = (relays: string[], event: unknown) => {
+                    try {
+                      let method: string | undefined
+                      const content = (event as { content?: unknown })?.content
+                      if (typeof content === 'string') {
+                        try {
+                          const parsed = JSON.parse(content) as { method?: string; id?: unknown }
+                          method = parsed?.method
+                        } catch (err) { console.warn('[bunker] failed to parse event content', err) }
+                      }
+                      const summary = {
+                        relays,
+                        kind: (event as { kind?: number })?.kind,
+                        method,
+                        // include tags array for debugging (NIP-46 expects method tag)
+                        tags: (event as { tags?: unknown })?.tags,
+                        contentLength: typeof content === 'string' ? content.length : undefined
+                      }
+                      console.log('[bunker] publish via signer:', summary)
+                      try { DebugBus.info('bunker', 'publish', summary) } catch (err) { console.warn('[bunker] failed to log to DebugBus', err) }
+                    } catch (err) { console.warn('[bunker] failed to log publish summary', err) }
+                    // Fire-and-forget publish: trigger the publish but do not return the
+                    // Observable/Promise to upstream to avoid their awaiting of completion.
+                    const result = originalPublish(relays, event)
+                    if (result && typeof (result as { subscribe?: unknown }).subscribe === 'function') {
+                      try { (result as { subscribe: (h: { complete?: () => void; error?: (e: unknown) => void }) => unknown }).subscribe({ complete: () => {}, error: () => {} }) } catch {}
+                    }
+                    // If it's a Promise, simply ignore it (no await) so it resolves in the background.
+                    // Return a benign object so callers that probe for a "subscribe" property
+                    // (e.g., applesauce makeRequest) won't throw on `"subscribe" in result`.
+                    return {} as unknown as never
+                  }
+                  const originalSubscribe = (recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod.bind(recreatedSigner)
+                  ;(recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod = (relays: string[], filters: unknown[]) => {
+                    try {
+                      console.log('[bunker] subscribe via signer:', { relays, filters })
+                      try { DebugBus.info('bunker', 'subscribe', { relays, filters }) } catch (err) { console.warn('[bunker] failed to log subscribe to DebugBus', err) }
+                    } catch (err) { console.warn('[bunker] failed to log subscribe summary', err) }
+                    return originalSubscribe(relays, filters)
+                  }
+
+                  
+                  // Just ensure the signer is listening for responses - don't call connect() again
+                  // The fromBunkerURI already connected with permissions during login
+                  if (!nostrConnectAccount.signer.listening) {
+                    console.log('[bunker] Opening signer subscription...')
+                    await nostrConnectAccount.signer.open()
+                    console.log('[bunker] ✅ Signer subscription opened')
+                  } else {
+                    console.log('[bunker] ✅ Signer already listening')
+                  }
+                  
+                  // Attempt a guarded reconnect to ensure Amber authorizes decrypt operations
+                  try {
+                    if (nostrConnectAccount.signer.remote && !reconnectedAccounts.has(account.id)) {
+                      const permissions = getDefaultBunkerPermissions()
+                      console.log('[bunker] Attempting guarded connect() with permissions to ensure decrypt perms', { count: permissions.length })
+                      await nostrConnectAccount.signer.connect(undefined, permissions)
+                      console.log('[bunker] ✅ Guarded connect() succeeded with permissions')
+                    }
+                  } catch (e) {
+                    console.warn('[bunker] ⚠️ Guarded connect() failed:', e)
+                  }
+                  
+                  // Give the subscription a moment to fully establish before allowing decrypt operations
+                  // This ensures the signer is ready to handle and receive responses
+                  await new Promise(resolve => setTimeout(resolve, 100))
+                  console.log("[bunker] Subscription ready after startup delay")
+                  // Fire-and-forget: probe decrypt path to verify Amber responds to NIP-46 decrypt
+                  try {
+                    const withTimeout = async <T,>(p: Promise<T>, ms = 10000): Promise<T> => {
+                      return await Promise.race([
+                        p,
+                        new Promise<T>((_, rej) => setTimeout(() => rej(new Error(`probe timeout after ${ms}ms`)), ms)),
+                      ])
+                    }
+                    setTimeout(async () => {
+                      const self = nostrConnectAccount.pubkey
+                      // Try a roundtrip so the bunker can respond successfully
+                      try {
+                        console.log('[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)…')
+                        const cipher44 = await withTimeout(nostrConnectAccount.signer.nip44!.encrypt(self, 'probe-nip44'))
+                        const plain44 = await withTimeout(nostrConnectAccount.signer.nip44!.decrypt(self, cipher44))
+                        console.log('[bunker] 🔎 Probe nip44 responded:', typeof plain44 === 'string' ? plain44 : typeof plain44)
+                      } catch (err) {
+                        console.log('[bunker] 🔎 Probe nip44 result:', err instanceof Error ? err.message : err)
+                      }
+                      try {
+                        console.log('[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)…')
+                        const cipher04 = await withTimeout(nostrConnectAccount.signer.nip04!.encrypt(self, 'probe-nip04'))
+                        const plain04 = await withTimeout(nostrConnectAccount.signer.nip04!.decrypt(self, cipher04))
+                        console.log('[bunker] 🔎 Probe nip04 responded:', typeof plain04 === 'string' ? plain04 : typeof plain04)
+                      } catch (err) {
+                        console.log('[bunker] 🔎 Probe nip04 result:', err instanceof Error ? err.message : err)
+                      }
+                    }, 0)
+                  } catch (err) {
+                    console.log('[bunker] 🔎 Probe setup failed:', err)
+                  }
+                  // The bunker remembers the permissions from the initial connection
+                  nostrConnectAccount.signer.isConnected = true
+                  
+                  console.log('[bunker] Final signer status:', {
+                    listening: nostrConnectAccount.signer.listening,
+                    isConnected: nostrConnectAccount.signer.isConnected,
+                    remote: nostrConnectAccount.signer.remote,
+                    relays: nostrConnectAccount.signer.relays
+                  })
+                  
+                  // Mark this account as reconnected
+                  reconnectedAccounts.add(account.id)
+                  console.log('[bunker] 🎉 Signer ready for signing')
+                } catch (error) {
+                  console.error('[bunker] ❌ Failed to open signer:', error)
+                }
+              }
+            })
       
       // Keep all relay connections alive indefinitely by creating a persistent subscription
       // This prevents disconnection when no other subscriptions are active
@@ -233,6 +479,7 @@ function App() {
       return () => {
         accountsSub.unsubscribe()
         activeSub.unsubscribe()
+        bunkerReconnectSub.unsubscribe()
         // Clean up keep-alive subscription if it exists
         const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
         if (poolWithSub._keepAliveSubscription) {
@@ -249,7 +496,7 @@ function App() {
     return () => {
       if (cleanup) cleanup()
     }
-  }, [])
+  }, [isOnline, showToast])
 
   // Monitor online/offline status
   useEffect(() => {
@@ -285,6 +532,7 @@ function App() {
           <BrowserRouter>
             <div className="min-h-screen p-0 max-w-none m-0 relative">
               <AppRoutes relayPool={relayPool} showToast={showToast} />
+              <RouteDebug />
             </div>
           </BrowserRouter>
           {toastMessage && (

src/components/ArchiveFilters.tsx

@@ -0,0 +1,47 @@
+import React from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faBookOpen, faBookmark, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
+import { faBooks } from '../icons/customIcons'
+
+export type ArchiveFilterType = 'all' | 'to-read' | 'reading' | 'completed' | 'marked'
+
+interface ArchiveFiltersProps {
+  selectedFilter: ArchiveFilterType
+  onFilterChange: (filter: ArchiveFilterType) => void
+}
+
+const ArchiveFilters: React.FC<ArchiveFiltersProps> = ({ selectedFilter, onFilterChange }) => {
+  const filters = [
+    { type: 'all' as const, icon: faAsterisk, label: 'All' },
+    { type: 'to-read' as const, icon: faBookmark, label: 'To Read' },
+    { type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
+    { type: 'completed' as const, icon: faCheckCircle, label: 'Completed' },
+    { type: 'marked' as const, icon: faBooks, label: 'Marked as Read' }
+  ]
+
+  return (
+    <div className="bookmark-filters">
+      {filters.map(filter => {
+        const isActive = selectedFilter === filter.type
+        // Only "completed" gets green color, everything else uses default blue
+        const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
+        
+        return (
+          <button
+            key={filter.type}
+            onClick={() => onFilterChange(filter.type)}
+            className={`filter-btn ${isActive ? 'active' : ''}`}
+            title={filter.label}
+            aria-label={`Filter by ${filter.label}`}
+            style={activeStyle}
+          >
+            <FontAwesomeIcon icon={filter.icon} />
+          </button>
+        )
+      })}
+    </div>
+  )
+}
+
+export default ArchiveFilters
+

src/components/BlogPostCard.tsx

@@ -11,9 +11,10 @@ interface BlogPostCardProps {
   post: BlogPostPreview
   href: string
   level?: 'mine' | 'friends' | 'nostrverse'
+  readingProgress?: number // 0-1 reading progress (optional)
 }
 
-const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
+const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress }) => {
   const profile = useEventModel(Models.ProfileModel, [post.author])
   const displayName = profile?.name || profile?.display_name || 
     `${post.author.slice(0, 8)}...${post.author.slice(-4)}`
@@ -23,6 +24,16 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
     addSuffix: true 
   })
 
+  // Calculate progress percentage and determine color (matching readingProgressUtils.ts logic)
+  const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
+  let progressColor = '#6366f1' // Default blue (reading)
+  
+  if (readingProgress && readingProgress >= 0.95) {
+    progressColor = '#10b981' // Green (completed)
+  } else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
+    progressColor = 'var(--color-text)' // Neutral text color (started)
+  }
+
   return (
     <Link 
       to={href}
@@ -47,7 +58,37 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
         {post.summary && (
           <p className="blog-post-card-summary">{post.summary}</p>
         )}
-        <div className="blog-post-card-meta">
+        
+        {/* Reading progress indicator - replaces the dividing line */}
+        {readingProgress !== undefined && readingProgress > 0 ? (
+          <div 
+            className="blog-post-reading-progress"
+            style={{
+              height: '3px',
+              width: '100%',
+              background: 'var(--color-border)',
+              overflow: 'hidden',
+              marginTop: '1rem'
+            }}
+          >
+            <div
+              style={{
+                height: '100%',
+                width: `${progressPercent}%`,
+                background: progressColor,
+                transition: 'width 0.3s ease, background 0.3s ease'
+              }}
+            />
+          </div>
+        ) : (
+          <div style={{ 
+            height: '1px', 
+            background: 'var(--color-border)', 
+            marginTop: '1rem' 
+          }} />
+        )}
+        
+        <div className="blog-post-card-meta" style={{ borderTop: 'none', paddingTop: '0.75rem' }}>
           <span className="blog-post-card-author">
             <FontAwesomeIcon icon={faUser} />
             {displayName}

src/components/BookmarkFilters.tsx

@@ -0,0 +1,44 @@
+import React from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faNewspaper, faStickyNote, faCirclePlay } from '@fortawesome/free-regular-svg-icons'
+import { faGlobe, faAsterisk, faLink } from '@fortawesome/free-solid-svg-icons'
+
+export type BookmarkFilterType = 'all' | 'article' | 'external' | 'video' | 'note' | 'web'
+
+interface BookmarkFiltersProps {
+  selectedFilter: BookmarkFilterType
+  onFilterChange: (filter: BookmarkFilterType) => void
+}
+
+const BookmarkFilters: React.FC<BookmarkFiltersProps> = ({
+  selectedFilter,
+  onFilterChange
+}) => {
+  const filters = [
+    { type: 'all' as const, icon: faAsterisk, label: 'All' },
+    { type: 'article' as const, icon: faNewspaper, label: 'Articles' },
+    { type: 'external' as const, icon: faLink, label: 'External Articles' },
+    { type: 'video' as const, icon: faCirclePlay, label: 'Videos' },
+    { type: 'note' as const, icon: faStickyNote, label: 'Notes' },
+    { type: 'web' as const, icon: faGlobe, label: 'Web' }
+  ]
+
+  return (
+    <div className="bookmark-filters">
+      {filters.map(filter => (
+        <button
+          key={filter.type}
+          onClick={() => onFilterChange(filter.type)}
+          className={`filter-btn ${selectedFilter === filter.type ? 'active' : ''}`}
+          title={filter.label}
+          aria-label={`Filter by ${filter.label}`}
+        >
+          <FontAwesomeIcon icon={filter.icon} />
+        </button>
+      ))}
+    </div>
+  )
+}
+
+export default BookmarkFilters
+

src/components/BookmarkItem.tsx

@@ -1,5 +1,7 @@
 import React, { useState } from 'react'
-import { faBookOpen, faPlay, faEye } from '@fortawesome/free-solid-svg-icons'
+import { faNewspaper, faStickyNote, faCirclePlay, faCamera, faFileLines } from '@fortawesome/free-regular-svg-icons'
+import { faGlobe, faLink } from '@fortawesome/free-solid-svg-icons'
+import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
 import { npubEncode, neventEncode } from 'nostr-tools/nip19'
@@ -66,18 +68,41 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
     return short(bookmark.pubkey) // fallback to short pubkey
   }
 
-  // use helper from kindIcon.ts
+  // Get content type icon based on bookmark kind and URL classification
+  const getContentTypeIcon = (): IconDefinition => {
+    if (isArticle) return faNewspaper // Nostr-native article
+    
+    // For web bookmarks, classify the URL to determine icon
+    if (isWebBookmark && firstUrlClassification) {
+      switch (firstUrlClassification.type) {
+        case 'youtube':
+        case 'video':
+          return faCirclePlay
+        case 'image':
+          return faCamera
+        case 'article':
+          return faLink // External article
+        default:
+          return faGlobe
+      }
+    }
+    
+    if (!hasUrls) return faStickyNote // Just a text note
+    if (firstUrlClassification?.type === 'youtube' || firstUrlClassification?.type === 'video') return faCirclePlay
+    if (firstUrlClassification?.type === 'article') return faLink // External article
+    return faFileLines
+  }
 
   const getIconForUrlType = (url: string) => {
     const classification = classifyUrl(url)
     switch (classification.type) {
       case 'youtube':
       case 'video':
-        return faPlay
+        return faCirclePlay
       case 'image':
-        return faEye
+        return faCamera
       default:
-        return faBookOpen
+        return faFileLines
     }
   }
 
@@ -113,11 +138,14 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
     getAuthorDisplayName,
     handleReadNow,
     articleImage,
-    articleSummary
+    articleSummary,
+    contentTypeIcon: getContentTypeIcon()
   }
 
   if (viewMode === 'compact') {
-    return <CompactView {...sharedProps} />
+    // eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
+    const { articleImage, ...compactProps } = sharedProps
+    return <CompactView {...compactProps} />
   }
 
   if (viewMode === 'large') {
@@ -125,5 +153,5 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
     return <LargeView {...sharedProps} getIconForUrlType={getIconForUrlType} previewImage={previewImage} />
   }
 
-  return <CardView {...sharedProps} getIconForUrlType={getIconForUrlType} articleImage={articleImage} />
+  return <CardView {...sharedProps} articleImage={articleImage} />
 }

src/components/BookmarkList.tsx

@@ -1,17 +1,27 @@
-import React, { useRef } from 'react'
+import React, { useRef, useState } from 'react'
+import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate } from '@fortawesome/free-solid-svg-icons'
+import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate, faHeart, faPlus } from '@fortawesome/free-solid-svg-icons'
 import { formatDistanceToNow } from 'date-fns'
 import { RelayPool } from 'applesauce-relay'
 import { Bookmark, IndividualBookmark } from '../types/bookmarks'
 import { BookmarkItem } from './BookmarkItem'
 import SidebarHeader from './SidebarHeader'
 import IconButton from './IconButton'
+import CompactButton from './CompactButton'
 import { ViewMode } from './Bookmarks'
-import { extractUrlsFromContent } from '../services/bookmarkHelpers'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
 import { BookmarkSkeleton } from './Skeletons'
+import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWithoutSet } from '../utils/bookmarkUtils'
+import { UserSettings } from '../services/settingsService'
+import AddBookmarkModal from './AddBookmarkModal'
+import { createWebBookmark } from '../services/webBookmarkService'
+import { RELAYS } from '../config/relays'
+import { Hooks } from 'applesauce-react'
+import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
+import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
+import LoginOptions from './LoginOptions'
 
 interface BookmarkListProps {
   bookmarks: Bookmark[]
@@ -29,6 +39,7 @@ interface BookmarkListProps {
   loading?: boolean
   relayPool: RelayPool | null
   isMobile?: boolean
+  settings?: UserSettings
 }
 
 export const BookmarkList: React.FC<BookmarkListProps> = ({
@@ -46,9 +57,23 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
   lastFetchTime,
   loading = false,
   relayPool,
-  isMobile = false
+  isMobile = false,
+  settings
 }) => {
+  const navigate = useNavigate()
   const bookmarksListRef = useRef<HTMLDivElement>(null)
+  const friendsColor = settings?.highlightColorFriends || '#f97316'
+  const [showAddModal, setShowAddModal] = useState(false)
+  const [selectedFilter, setSelectedFilter] = useState<BookmarkFilterType>('all')
+  const activeAccount = Hooks.useActiveAccount()
+
+  const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
+    if (!activeAccount || !relayPool) {
+      throw new Error('Please login to create bookmarks')
+    }
+
+    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
+  }
 
   // Pull-to-refresh for bookmarks
   const { isRefreshing: isPulling, pullPosition } = usePullToRefresh({
@@ -62,36 +87,34 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
     isDisabled: !onRefresh
   })
 
-  // Helper to check if a bookmark has either content or a URL
-  const hasContentOrUrl = (ib: IndividualBookmark) => {
-    // Check if has content (text)
-    const hasContent = ib.content && ib.content.trim().length > 0
-    
-    // Check if has URL
-    let hasUrl = false
-    
-    // For web bookmarks (kind:39701), URL is in the 'd' tag
-    if (ib.kind === 39701) {
-      const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
-      hasUrl = !!dTag && dTag.trim().length > 0
-    } else {
-      // For other bookmarks, extract URLs from content
-      const urls = extractUrlsFromContent(ib.content || '')
-      hasUrl = urls.length > 0
-    }
-    
-    // Always show articles (kind:30023) as they have special handling
-    if (ib.kind === 30023) return true
-    
-    // Otherwise, must have either content or URL
-    return hasContent || hasUrl
-  }
-  
   // Merge and flatten all individual bookmarks from all lists
-  // Re-sort after flattening to ensure newest first across all lists
   const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
-    .filter(hasContentOrUrl)
-    .sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
+    .filter(hasContent)
+  
+  // Apply filter
+  const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, selectedFilter)
+  
+  // Separate bookmarks with setName (kind 30003) from regular bookmarks
+  const bookmarksWithoutSet = getBookmarksWithoutSet(filteredBookmarks)
+  const bookmarkSets = getBookmarkSets(filteredBookmarks)
+  
+  // Group non-set bookmarks as before
+  const groups = groupIndividualBookmarks(bookmarksWithoutSet)
+  const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
+    { key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
+    { key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
+    { key: 'web', title: 'Web Bookmarks', items: groups.web },
+    { key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
+  ]
+  
+  // Add bookmark sets as additional sections
+  bookmarkSets.forEach(set => {
+    sections.push({
+      key: `set-${set.name}`,
+      title: set.title || set.name,
+      items: set.bookmarks
+    })
+  })
   
   if (isCollapsed) {
     // Check if the selected URL is in bookmarks
@@ -121,11 +144,23 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
         onToggleCollapse={onToggleCollapse} 
         onLogout={onLogout}
         onOpenSettings={onOpenSettings}
-        relayPool={relayPool}
         isMobile={isMobile}
       />
       
-      {allIndividualBookmarks.length === 0 ? (
+      {allIndividualBookmarks.length > 0 && (
+        <BookmarkFilters
+          selectedFilter={selectedFilter}
+          onFilterChange={setSelectedFilter}
+        />
+      )}
+      
+      {!activeAccount ? (
+        <LoginOptions />
+      ) : filteredBookmarks.length === 0 && allIndividualBookmarks.length > 0 ? (
+        <div className="empty-state">
+          <p>No bookmarks match this filter.</p>
+        </div>
+      ) : allIndividualBookmarks.length === 0 ? (
         loading ? (
           <div className={`bookmarks-list ${viewMode}`} aria-busy="true">
             <div className={`bookmarks-grid bookmarks-${viewMode}`}>
@@ -138,7 +173,6 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
           <div className="empty-state">
             <p>No bookmarks found.</p>
             <p>Add bookmarks using your nostr client to see them here.</p>
-            <p>If you aren't on nostr yet, start here: <a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">nstart.me</a></p>
           </div>
         )
       ) : (
@@ -150,53 +184,87 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
             isRefreshing={isPulling || isRefreshing || false}
             pullPosition={pullPosition}
           />
-          <div className={`bookmarks-grid bookmarks-${viewMode}`}>
-            {allIndividualBookmarks.map((individualBookmark, index) => 
-              <BookmarkItem 
-                key={`${individualBookmark.id}-${index}`}
-                bookmark={individualBookmark} 
-                index={index} 
-                onSelectUrl={onSelectUrl}
-                viewMode={viewMode}
-              />
-            )}
-          </div>
+          {sections.filter(s => s.items.length > 0).map(section => (
+            <div key={section.key} className="bookmarks-section">
+              <div style={{ display: 'flex', alignItems: 'center', justifyContent: 'space-between' }}>
+                <h3 className="bookmarks-section-title" style={{ margin: 0, padding: '1.5rem 0.5rem 0.375rem', flex: 1 }}>{section.title}</h3>
+                {section.key === 'web' && activeAccount && (
+                  <CompactButton
+                    icon={faPlus}
+                    onClick={() => setShowAddModal(true)}
+                    title="Add web bookmark"
+                    ariaLabel="Add web bookmark"
+                    className="bookmark-section-action"
+                  />
+                )}
+              </div>
+              <div className={`bookmarks-grid bookmarks-${viewMode}`}>
+                {section.items.map((individualBookmark, index) => (
+                  <BookmarkItem 
+                    key={`${section.key}-${individualBookmark.id}-${index}`}
+                    bookmark={individualBookmark} 
+                    index={index} 
+                    onSelectUrl={onSelectUrl}
+                    viewMode={viewMode}
+                  />
+                ))}
+              </div>
+            </div>
+          ))}
         </div>
       )}
       <div className="view-mode-controls">
-        {onRefresh && (
+        <div className="view-mode-left">
           <IconButton
-            icon={faRotate}
-            onClick={onRefresh}
-            title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
-            ariaLabel="Refresh bookmarks"
+            icon={faHeart}
+            onClick={() => navigate('/support')}
+            title="Support Boris"
+            ariaLabel="Support"
             variant="ghost"
-            disabled={isRefreshing}
-            spin={isRefreshing}
+            style={{ color: friendsColor }}
           />
-        )}
-        <IconButton
-          icon={faList}
-          onClick={() => onViewModeChange('compact')}
-          title="Compact list view"
-          ariaLabel="Compact list view"
-          variant={viewMode === 'compact' ? 'primary' : 'ghost'}
-        />
-        <IconButton
-          icon={faThLarge}
-          onClick={() => onViewModeChange('cards')}
-          title="Cards view"
-          ariaLabel="Cards view"
-          variant={viewMode === 'cards' ? 'primary' : 'ghost'}
-        />
-        <IconButton
-          icon={faImage}
-          onClick={() => onViewModeChange('large')}
-          title="Large preview view"
-          ariaLabel="Large preview view"
-          variant={viewMode === 'large' ? 'primary' : 'ghost'}
-        />
+        </div>
+        <div className="view-mode-right">
+          {onRefresh && (
+            <IconButton
+              icon={faRotate}
+              onClick={onRefresh}
+              title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
+              ariaLabel="Refresh bookmarks"
+              variant="ghost"
+              disabled={isRefreshing}
+              spin={isRefreshing}
+            />
+          )}
+          <IconButton
+            icon={faList}
+            onClick={() => onViewModeChange('compact')}
+            title="Compact list view"
+            ariaLabel="Compact list view"
+            variant={viewMode === 'compact' ? 'primary' : 'ghost'}
+          />
+          <IconButton
+            icon={faThLarge}
+            onClick={() => onViewModeChange('cards')}
+            title="Cards view"
+            ariaLabel="Cards view"
+            variant={viewMode === 'cards' ? 'primary' : 'ghost'}
+          />
+          <IconButton
+            icon={faImage}
+            onClick={() => onViewModeChange('large')}
+            title="Large preview view"
+            ariaLabel="Large preview view"
+            variant={viewMode === 'large' ? 'primary' : 'ghost'}
+          />
+        </div>
       </div>
+      {showAddModal && (
+        <AddBookmarkModal
+          onClose={() => setShowAddModal(false)}
+          onSave={handleSaveBookmark}
+        />
+      )}
     </div>
   )
 }

src/components/BookmarkViews/CardView.tsx

@@ -1,13 +1,12 @@
 import React, { useState } from 'react'
 import { Link } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faBookmark, faUserLock, faChevronDown, faChevronUp, faGlobe } from '@fortawesome/free-solid-svg-icons'
+import { faChevronDown, faChevronUp } from '@fortawesome/free-solid-svg-icons'
+import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
 import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
-import IconButton from '../IconButton'
 import { classifyUrl } from '../../utils/helpers'
-import { IconGetter } from './shared'
 import { useImageCache } from '../../hooks/useImageCache'
 import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
 import { getEventUrl } from '../../config/nostrGateways'
@@ -18,13 +17,13 @@ interface CardViewProps {
   hasUrls: boolean
   extractedUrls: string[]
   onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
-  getIconForUrlType: IconGetter
   authorNpub: string
   eventNevent?: string
   getAuthorDisplayName: () => string
   handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
   articleImage?: string
   articleSummary?: string
+  contentTypeIcon: IconDefinition
 }
 
 export const CardView: React.FC<CardViewProps> = ({
@@ -33,13 +32,13 @@ export const CardView: React.FC<CardViewProps> = ({
   hasUrls,
   extractedUrls,
   onSelectUrl,
-  getIconForUrlType,
   authorNpub,
   eventNevent,
   getAuthorDisplayName,
   handleReadNow,
   articleImage,
-  articleSummary
+  articleSummary,
+  contentTypeIcon
 }) => {
   const firstUrl = hasUrls ? extractedUrls[0] : null
   const firstUrlClassificationType = firstUrl ? classifyUrl(firstUrl)?.type : null
@@ -52,7 +51,6 @@ export const CardView: React.FC<CardViewProps> = ({
   const contentLength = (bookmark.content || '').length
   const shouldTruncate = !expanded && contentLength > 210
   const isArticle = bookmark.kind === 30023
-  const isWebBookmark = bookmark.kind === 39701
   
   // Determine which image to use (article image, instant preview, or OG image)
   const previewImage = articleImage || instantPreview || ogImage
@@ -92,19 +90,7 @@ export const CardView: React.FC<CardViewProps> = ({
       )}
       <div className="bookmark-header">
         <span className="bookmark-type">
-          {isWebBookmark ? (
-            <span className="fa-layers fa-fw">
-              <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-              <FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
-            </span>
-          ) : bookmark.isPrivate ? (
-            <>
-              <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-              <FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
-            </>
-          ) : (
-            <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-          )}
+          <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
         </span>
         
         {eventNevent ? (
@@ -127,23 +113,14 @@ export const CardView: React.FC<CardViewProps> = ({
         <div className="bookmark-urls">
           {(urlsExpanded ? extractedUrls : extractedUrls.slice(0, 1)).map((url, urlIndex) => {
             return (
-              <div key={urlIndex} className="url-row">
-                <button
-                  className="bookmark-url"
-                  onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
-                  title="Open in reader"
-                >
-                  {url}
-                </button>
-                <IconButton
-                  icon={getIconForUrlType(url)}
-                  ariaLabel="Open"
-                  title="Open"
-                  variant="success"
-                  size={32}
-                  onClick={(e) => { e.preventDefault(); e.stopPropagation(); onSelectUrl?.(url) }}
-                />
-              </div>
+              <button
+                key={urlIndex}
+                className="bookmark-url"
+                onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
+                title="Open in reader"
+              >
+                {url}
+              </button>
             )
           })}
           {extractedUrls.length > 1 && (

src/components/BookmarkViews/CompactView.tsx

@@ -1,10 +1,9 @@
 import React from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faBookmark, faUserLock, faGlobe } from '@fortawesome/free-solid-svg-icons'
+import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDateCompact } from '../../utils/bookmarkUtils'
 import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
-import { useImageCache } from '../../hooks/useImageCache'
 
 interface CompactViewProps {
   bookmark: IndividualBookmark
@@ -12,8 +11,8 @@ interface CompactViewProps {
   hasUrls: boolean
   extractedUrls: string[]
   onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
-  articleImage?: string
   articleSummary?: string
+  contentTypeIcon: IconDefinition
 }
 
 export const CompactView: React.FC<CompactViewProps> = ({
@@ -22,16 +21,13 @@ export const CompactView: React.FC<CompactViewProps> = ({
   hasUrls,
   extractedUrls,
   onSelectUrl,
-  articleImage,
-  articleSummary
+  articleSummary,
+  contentTypeIcon
 }) => {
   const isArticle = bookmark.kind === 30023
   const isWebBookmark = bookmark.kind === 39701
   const isClickable = hasUrls || isArticle || isWebBookmark
   
-  // Get cached image for thumbnail
-  const cachedImage = useImageCache(articleImage || undefined)
-  
   const handleCompactClick = () => {
     if (!onSelectUrl) return
     
@@ -55,27 +51,8 @@ export const CompactView: React.FC<CompactViewProps> = ({
         role={isClickable ? 'button' : undefined}
         tabIndex={isClickable ? 0 : undefined}
       >
-        {/* Thumbnail image */}
-        {cachedImage && (
-          <div className="compact-thumbnail">
-            <img src={cachedImage} alt="" />
-          </div>
-        )}
-        
         <span className="bookmark-type-compact">
-          {isWebBookmark ? (
-            <span className="fa-layers fa-fw">
-              <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-              <FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
-            </span>
-          ) : bookmark.isPrivate ? (
-            <>
-              <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-              <FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
-            </>
-          ) : (
-            <FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
-          )}
+          <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
         </span>
         {displayText && (
           <div className="compact-text">

src/components/BookmarkViews/LargeView.tsx

@@ -1,6 +1,7 @@
 import React from 'react'
 import { Link } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
 import { IndividualBookmark } from '../../types/bookmarks'
 import { formatDate } from '../../utils/bookmarkUtils'
 import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
@@ -21,6 +22,8 @@ interface LargeViewProps {
   getAuthorDisplayName: () => string
   handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
   articleSummary?: string
+  contentTypeIcon: IconDefinition
+  readingProgress?: number // 0-1 reading progress (optional)
 }
 
 export const LargeView: React.FC<LargeViewProps> = ({
@@ -35,11 +38,23 @@ export const LargeView: React.FC<LargeViewProps> = ({
   eventNevent,
   getAuthorDisplayName,
   handleReadNow,
-  articleSummary
+  articleSummary,
+  contentTypeIcon,
+  readingProgress
 }) => {
   const cachedImage = useImageCache(previewImage || undefined)
   const isArticle = bookmark.kind === 30023
   
+  // Calculate progress display (matching readingProgressUtils.ts logic)
+  const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
+  let progressColor = '#6366f1' // Default blue (reading)
+  
+  if (readingProgress && readingProgress >= 0.95) {
+    progressColor = '#10b981' // Green (completed)
+  } else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
+    progressColor = 'var(--color-text)' // Neutral text color (started)
+  }
+  
   const triggerOpen = () => handleReadNow({ preventDefault: () => {} } as React.MouseEvent<HTMLButtonElement>)
   const handleKeyDown: React.KeyboardEventHandler<HTMLDivElement> = (e) => {
     if (e.key === 'Enter' || e.key === ' ') {
@@ -89,7 +104,32 @@ export const LargeView: React.FC<LargeViewProps> = ({
           </div>
         )}
         
+        {/* Reading progress indicator for articles - shown only if there's progress */}
+        {isArticle && readingProgress !== undefined && readingProgress > 0 && (
+          <div 
+            style={{
+              height: '3px',
+              width: '100%',
+              background: 'var(--color-border)',
+              overflow: 'hidden',
+              marginTop: '0.75rem'
+            }}
+          >
+            <div
+              style={{
+                height: '100%',
+                width: `${progressPercent}%`,
+                background: progressColor,
+                transition: 'width 0.3s ease, background 0.3s ease'
+              }}
+            />
+          </div>
+        )}
+        
         <div className="large-footer">
+          <span className="bookmark-type-large">
+            <FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
+          </span>
           <span className="large-author">
             <Link
               to={`/p/${authorNpub}`}

src/components/Bookmarks.tsx

@@ -52,22 +52,25 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
   const meTab = location.pathname === '/me' ? 'highlights' : 
                 location.pathname === '/me/highlights' ? 'highlights' :
                 location.pathname === '/me/reading-list' ? 'reading-list' :
-                location.pathname === '/me/archive' ? 'archive' :
+                location.pathname.startsWith('/me/reads') ? 'reads' :
+                location.pathname === '/me/links' ? 'links' :
                 location.pathname === '/me/writings' ? 'writings' : 'highlights'
   
   // Extract tab from profile routes
   const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
   
-  // Decode npub to pubkey for profile view
+  // Decode npub or nprofile to pubkey for profile view
   let profilePubkey: string | undefined
   if (npub && showProfile) {
     try {
       const decoded = nip19.decode(npub)
       if (decoded.type === 'npub') {
         profilePubkey = decoded.data
+      } else if (decoded.type === 'nprofile') {
+        profilePubkey = decoded.data.pubkey
       }
     } catch (err) {
-      console.error('Failed to decode npub:', err)
+      console.error('Failed to decode npub/nprofile:', err)
     }
   }
   
@@ -165,6 +168,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
     activeAccount,
     accountManager,
     naddr,
+    externalUrl,
     currentArticleCoordinate,
     currentArticleEventId,
     settings

src/components/ContentPanel.tsx

@@ -1,4 +1,4 @@
-import React, { useMemo, useState, useEffect, useRef } from 'react'
+import React, { useMemo, useState, useEffect, useRef, useCallback } from 'react'
 import ReactPlayer from 'react-player'
 import ReactMarkdown from 'react-markdown'
 import remarkGfm from 'remark-gfm'
@@ -6,10 +6,10 @@ import rehypeRaw from 'rehype-raw'
 import rehypePrism from 'rehype-prism-plus'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import 'prismjs/themes/prism-tomorrow.css'
-import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare } from '@fortawesome/free-solid-svg-icons'
+import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare, faSearch } from '@fortawesome/free-solid-svg-icons'
 import { ContentSkeleton } from './Skeletons'
 import { nip19 } from 'nostr-tools'
-import { getNostrUrl } from '../config/nostrGateways'
+import { getNostrUrl, getSearchUrl } from '../config/nostrGateways'
 import { RELAYS } from '../config/relays'
 import { RelayPool } from 'applesauce-relay'
 import { IAccount } from 'applesauce-accounts'
@@ -36,6 +36,13 @@ import { classifyUrl } from '../utils/helpers'
 import { buildNativeVideoUrl } from '../utils/videoHelpers'
 import { useReadingPosition } from '../hooks/useReadingPosition'
 import { ReadingProgressIndicator } from './ReadingProgressIndicator'
+import { EventFactory } from 'applesauce-factory'
+import { Hooks } from 'applesauce-react'
+import { 
+  generateArticleIdentifier, 
+  loadReadingPosition, 
+  saveReadingPosition 
+} from '../services/readingPositionService'
 
 interface ContentPanelProps {
   loading: boolean
@@ -100,6 +107,9 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
   const [showArticleMenu, setShowArticleMenu] = useState(false)
   const [showVideoMenu, setShowVideoMenu] = useState(false)
   const [showExternalMenu, setShowExternalMenu] = useState(false)
+  const [articleMenuOpenUpward, setArticleMenuOpenUpward] = useState(false)
+  const [videoMenuOpenUpward, setVideoMenuOpenUpward] = useState(false)
+  const [externalMenuOpenUpward, setExternalMenuOpenUpward] = useState(false)
   const articleMenuRef = useRef<HTMLDivElement>(null)
   const videoMenuRef = useRef<HTMLDivElement>(null)
   const externalMenuRef = useRef<HTMLDivElement>(null)
@@ -126,10 +136,58 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     onClearSelection
   })
 
+  // Get event store for reading position service
+  const eventStore = Hooks.useEventStore()
+  
   // Reading position tracking - only for text content, not videos
   const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
-  const { isReadingComplete, progressPercentage } = useReadingPosition({
+  
+  // Generate article identifier for saving/loading position
+  const articleIdentifier = useMemo(() => {
+    if (!selectedUrl) return null
+    return generateArticleIdentifier(selectedUrl)
+  }, [selectedUrl])
+
+  // Callback to save reading position
+  const handleSavePosition = useCallback(async (position: number) => {
+    if (!activeAccount || !relayPool || !eventStore || !articleIdentifier) {
+      console.log('⏭️ [ContentPanel] Skipping save - missing requirements:', {
+        hasAccount: !!activeAccount,
+        hasRelayPool: !!relayPool,
+        hasEventStore: !!eventStore,
+        hasIdentifier: !!articleIdentifier
+      })
+      return
+    }
+    if (!settings?.syncReadingPosition) {
+      console.log('⏭️ [ContentPanel] Sync disabled in settings')
+      return
+    }
+
+    console.log('💾 [ContentPanel] Saving position:', Math.round(position * 100) + '%', 'for article:', selectedUrl?.slice(0, 50))
+
+    try {
+      const factory = new EventFactory({ signer: activeAccount })
+      await saveReadingPosition(
+        relayPool,
+        eventStore,
+        factory,
+        articleIdentifier,
+        {
+          position,
+          timestamp: Math.floor(Date.now() / 1000),
+          scrollTop: window.pageYOffset || document.documentElement.scrollTop
+        }
+      )
+    } catch (error) {
+      console.error('❌ [ContentPanel] Failed to save reading position:', error)
+    }
+  }, [activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
+
+  const { isReadingComplete, progressPercentage, saveNow } = useReadingPosition({
     enabled: isTextContent,
+    syncEnabled: settings?.syncReadingPosition,
+    onSave: handleSavePosition,
     onReadingComplete: () => {
       // Optional: Auto-mark as read when reading is complete
       if (activeAccount && !isMarkedAsRead) {
@@ -138,6 +196,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     }
   })
 
+  // Load saved reading position when article loads
+  useEffect(() => {
+    if (!isTextContent || !activeAccount || !relayPool || !eventStore || !articleIdentifier) {
+      console.log('⏭️ [ContentPanel] Skipping position restore - missing requirements:', {
+        isTextContent,
+        hasAccount: !!activeAccount,
+        hasRelayPool: !!relayPool,
+        hasEventStore: !!eventStore,
+        hasIdentifier: !!articleIdentifier
+      })
+      return
+    }
+    if (!settings?.syncReadingPosition) {
+      console.log('⏭️ [ContentPanel] Sync disabled - not restoring position')
+      return
+    }
+
+    console.log('📖 [ContentPanel] Loading position for article:', selectedUrl?.slice(0, 50))
+
+    const loadPosition = async () => {
+      try {
+        const savedPosition = await loadReadingPosition(
+          relayPool,
+          eventStore,
+          activeAccount.pubkey,
+          articleIdentifier
+        )
+
+        if (savedPosition && savedPosition.position > 0.05 && savedPosition.position < 1) {
+          console.log('🎯 [ContentPanel] Restoring position:', Math.round(savedPosition.position * 100) + '%')
+          // Wait for content to be fully rendered before scrolling
+          setTimeout(() => {
+            const documentHeight = document.documentElement.scrollHeight
+            const windowHeight = window.innerHeight
+            const scrollTop = savedPosition.position * (documentHeight - windowHeight)
+            
+            window.scrollTo({
+              top: scrollTop,
+              behavior: 'smooth'
+            })
+            
+            console.log('✅ [ContentPanel] Restored to position:', Math.round(savedPosition.position * 100) + '%', 'scrollTop:', scrollTop)
+          }, 500) // Give content time to render
+        } else if (savedPosition) {
+          if (savedPosition.position === 1) {
+            console.log('✅ [ContentPanel] Article completed (100%), starting from top')
+          } else {
+            console.log('⏭️ [ContentPanel] Position too early (<5%):', Math.round(savedPosition.position * 100) + '%')
+          }
+        }
+      } catch (error) {
+        console.error('❌ [ContentPanel] Failed to load reading position:', error)
+      }
+    }
+
+    loadPosition()
+  }, [isTextContent, activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
+
+  // Save position before unmounting or changing article
+  useEffect(() => {
+    return () => {
+      if (saveNow) {
+        saveNow()
+      }
+    }
+  }, [saveNow, selectedUrl])
+
   // Close menu when clicking outside
   useEffect(() => {
     const handleClickOutside = (event: MouseEvent) => {
@@ -161,6 +286,35 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     }
   }, [showArticleMenu, showVideoMenu, showExternalMenu])
 
+  // Check available space and position menu upward if needed
+  useEffect(() => {
+    const checkMenuPosition = (menuRef: React.RefObject<HTMLDivElement>, setOpenUpward: (value: boolean) => void) => {
+      if (!menuRef.current) return
+
+      const menuWrapper = menuRef.current
+      const menuElement = menuWrapper.querySelector('.article-menu') as HTMLElement
+      if (!menuElement) return
+
+      const rect = menuWrapper.getBoundingClientRect()
+      const viewportHeight = window.innerHeight
+      const spaceBelow = viewportHeight - rect.bottom
+      const menuHeight = menuElement.offsetHeight || 300 // estimate if not rendered yet
+
+      // Open upward if there's not enough space below (with 20px buffer)
+      setOpenUpward(spaceBelow < menuHeight + 20 && rect.top > menuHeight)
+    }
+
+    if (showArticleMenu) {
+      checkMenuPosition(articleMenuRef, setArticleMenuOpenUpward)
+    }
+    if (showVideoMenu) {
+      checkMenuPosition(videoMenuRef, setVideoMenuOpenUpward)
+    }
+    if (showExternalMenu) {
+      checkMenuPosition(externalMenuRef, setExternalMenuOpenUpward)
+    }
+  }, [showArticleMenu, showVideoMenu, showExternalMenu])
+
   const readingStats = useMemo(() => {
     const content = markdown || html || ''
     if (!content) return null
@@ -218,9 +372,15 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
       relays: relayHints
     })
 
+    // Check for source URL in 'r' tags
+    const sourceUrl = currentArticle.tags.find(t => t[0] === 'r')?.[1]
+
     return {
       portal: getNostrUrl(naddr),
-      native: `nostr:${naddr}`
+      native: `nostr:${naddr}`,
+      naddr,
+      sourceUrl,
+      borisUrl: `${window.location.origin}/a/${naddr}`
     }
   }
 
@@ -245,6 +405,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
     }
     setShowArticleMenu(false)
   }
+
+  const handleShareBoris = async () => {
+    try {
+      if (!articleLinks) return
+      
+      if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
+        await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ 
+          title: title || 'Article', 
+          url: articleLinks.borisUrl 
+        })
+      } else {
+        await navigator.clipboard.writeText(articleLinks.borisUrl)
+      }
+    } catch (e) {
+      console.warn('Share failed', e)
+    } finally {
+      setShowArticleMenu(false)
+    }
+  }
+
+  const handleShareOriginal = async () => {
+    try {
+      if (!articleLinks?.sourceUrl) return
+      
+      if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
+        await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ 
+          title: title || 'Article', 
+          url: articleLinks.sourceUrl 
+        })
+      } else {
+        await navigator.clipboard.writeText(articleLinks.sourceUrl)
+      }
+    } catch (e) {
+      console.warn('Share failed', e)
+    } finally {
+      setShowArticleMenu(false)
+    }
+  }
+
+  const handleCopyBoris = async () => {
+    try {
+      if (!articleLinks) return
+      await navigator.clipboard.writeText(articleLinks.borisUrl)
+    } catch (e) {
+      console.warn('Copy failed', e)
+    } finally {
+      setShowArticleMenu(false)
+    }
+  }
+
+  const handleCopyOriginal = async () => {
+    try {
+      if (!articleLinks?.sourceUrl) return
+      await navigator.clipboard.writeText(articleLinks.sourceUrl)
+    } catch (e) {
+      console.warn('Copy failed', e)
+    } finally {
+      setShowArticleMenu(false)
+    }
+  }
+
+  const handleOpenSearch = () => {
+    if (articleLinks) {
+      window.open(getSearchUrl(articleLinks.naddr), '_blank', 'noopener,noreferrer')
+    }
+    setShowArticleMenu(false)
+  }
   
   // Video actions
   const handleOpenVideoExternal = () => {
@@ -307,10 +534,16 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
 
   const handleShareExternalUrl = async () => {
     try {
-      if (selectedUrl && (navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
-        await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ title: title || 'Article', url: selectedUrl })
-      } else if (selectedUrl) {
-        await navigator.clipboard.writeText(selectedUrl)
+      if (!selectedUrl) return
+      const borisUrl = `${window.location.origin}/r/${encodeURIComponent(selectedUrl)}`
+      
+      if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
+        await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ 
+          title: title || 'Article', 
+          url: borisUrl 
+        })
+      } else {
+        await navigator.clipboard.writeText(borisUrl)
       }
     } catch (e) {
       console.warn('Share failed', e)
@@ -318,6 +551,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
       setShowExternalMenu(false)
     }
   }
+
+  const handleSearchExternalUrl = () => {
+    if (selectedUrl) {
+      window.open(getSearchUrl(selectedUrl), '_blank', 'noopener,noreferrer')
+    }
+    setShowExternalMenu(false)
+  }
   
   // Check if article is already marked as read when URL/article changes
   useEffect(() => {
@@ -501,7 +741,7 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
                 <FontAwesomeIcon icon={faEllipsisH} />
               </button>
               {showVideoMenu && (
-                <div className="article-menu">
+                <div className={`article-menu ${videoMenuOpenUpward ? 'open-upward' : ''}`}>
                   <button className="article-menu-item" onClick={handleOpenVideoExternal}>
                     <FontAwesomeIcon icon={faExternalLinkAlt} />
                     <span>Open Link</span>
@@ -582,13 +822,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
                 </button>
                 
                 {showExternalMenu && (
-                  <div className="article-menu">
+                  <div className={`article-menu ${externalMenuOpenUpward ? 'open-upward' : ''}`}>
                     <button
                       className="article-menu-item"
-                      onClick={handleOpenExternalUrl}
+                      onClick={handleShareExternalUrl}
                     >
-                      <FontAwesomeIcon icon={faExternalLinkAlt} />
-                      <span>Open Original URL</span>
+                      <FontAwesomeIcon icon={faShare} />
+                      <span>Share</span>
                     </button>
                     <button
                       className="article-menu-item"
@@ -599,10 +839,17 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
                     </button>
                     <button
                       className="article-menu-item"
-                      onClick={handleShareExternalUrl}
+                      onClick={handleOpenExternalUrl}
                     >
-                      <FontAwesomeIcon icon={faShare} />
-                      <span>Share</span>
+                      <FontAwesomeIcon icon={faExternalLinkAlt} />
+                      <span>Open Original</span>
+                    </button>
+                    <button
+                      className="article-menu-item"
+                      onClick={handleSearchExternalUrl}
+                    >
+                      <FontAwesomeIcon icon={faSearch} />
+                      <span>Search</span>
                     </button>
                   </div>
                 )}
@@ -623,13 +870,52 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
                 </button>
                 
                 {showArticleMenu && (
-                  <div className="article-menu">
+                  <div className={`article-menu ${articleMenuOpenUpward ? 'open-upward' : ''}`}>
+                    <button
+                      className="article-menu-item"
+                      onClick={handleShareBoris}
+                    >
+                      <FontAwesomeIcon icon={faShare} />
+                      <span>Share</span>
+                    </button>
+                    {articleLinks.sourceUrl && (
+                      <button
+                        className="article-menu-item"
+                        onClick={handleShareOriginal}
+                      >
+                        <FontAwesomeIcon icon={faShare} />
+                        <span>Share Original</span>
+                      </button>
+                    )}
+                    <button
+                      className="article-menu-item"
+                      onClick={handleCopyBoris}
+                    >
+                      <FontAwesomeIcon icon={faCopy} />
+                      <span>Copy Link</span>
+                    </button>
+                    {articleLinks.sourceUrl && (
+                      <button
+                        className="article-menu-item"
+                        onClick={handleCopyOriginal}
+                      >
+                        <FontAwesomeIcon icon={faCopy} />
+                        <span>Copy Original</span>
+                      </button>
+                    )}
+                    <button
+                      className="article-menu-item"
+                      onClick={handleOpenSearch}
+                    >
+                      <FontAwesomeIcon icon={faSearch} />
+                      <span>Search</span>
+                    </button>
                     <button
                       className="article-menu-item"
                       onClick={handleOpenPortal}
                     >
                       <FontAwesomeIcon icon={faExternalLinkAlt} />
-                      <span>Open on Nostr</span>
+                      <span>Open with njump</span>
                     </button>
                     <button
                       className="article-menu-item"

src/components/Debug.tsx

@@ -0,0 +1,395 @@
+import React, { useEffect, useMemo, useState } from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faClock, faSpinner } from '@fortawesome/free-solid-svg-icons'
+import { Hooks } from 'applesauce-react'
+import { Accounts } from 'applesauce-accounts'
+import { NostrConnectSigner } from 'applesauce-signers'
+import { getDefaultBunkerPermissions } from '../services/nostrConnect'
+import { DebugBus, type DebugLogEntry } from '../utils/debugBus'
+import VersionFooter from './VersionFooter'
+
+const defaultPayload = 'The quick brown fox jumps over the lazy dog.'
+
+const Debug: React.FC = () => {
+  const activeAccount = Hooks.useActiveAccount()
+  const accountManager = Hooks.useAccountManager()
+  const [payload, setPayload] = useState<string>(defaultPayload)
+  const [cipher44, setCipher44] = useState<string>('')
+  const [cipher04, setCipher04] = useState<string>('')
+  const [plain44, setPlain44] = useState<string>('')
+  const [plain04, setPlain04] = useState<string>('')
+  const [tEncrypt44, setTEncrypt44] = useState<number | null>(null)
+  const [tEncrypt04, setTEncrypt04] = useState<number | null>(null)
+  const [tDecrypt44, setTDecrypt44] = useState<number | null>(null)
+  const [tDecrypt04, setTDecrypt04] = useState<number | null>(null)
+  const [logs, setLogs] = useState<DebugLogEntry[]>(DebugBus.snapshot())
+  const [debugEnabled, setDebugEnabled] = useState<boolean>(() => localStorage.getItem('debug') === '*')
+  
+  // Bunker login state
+  const [bunkerUri, setBunkerUri] = useState<string>('')
+  const [isBunkerLoading, setIsBunkerLoading] = useState<boolean>(false)
+  const [bunkerError, setBunkerError] = useState<string | null>(null)
+  
+  // Live timing state
+  const [liveTiming, setLiveTiming] = useState<{
+    nip44?: { type: 'encrypt' | 'decrypt'; startTime: number }
+    nip04?: { type: 'encrypt' | 'decrypt'; startTime: number }
+  }>({})
+
+  useEffect(() => {
+    return DebugBus.subscribe((e) => setLogs(prev => [...prev, e].slice(-300)))
+  }, [])
+
+  // Live timer effect - triggers re-renders for live timing updates
+  useEffect(() => {
+    const interval = setInterval(() => {
+      // Force re-render to update live timing display
+      setLiveTiming(prev => prev)
+    }, 16) // ~60fps for smooth updates
+    return () => clearInterval(interval)
+  }, [])
+
+  const signer = useMemo(() => (activeAccount as unknown as { signer?: unknown })?.signer, [activeAccount])
+  const pubkey = (activeAccount as unknown as { pubkey?: string })?.pubkey
+
+  const hasNip04 = typeof (signer as { nip04?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip04?.encrypt === 'function'
+  const hasNip44 = typeof (signer as { nip44?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip44?.encrypt === 'function'
+
+  const doEncrypt = async (mode: 'nip44' | 'nip04') => {
+    if (!signer || !pubkey) return
+    try {
+      const api = (signer as { [key: string]: { encrypt: (pubkey: string, message: string) => Promise<string> } })[mode]
+      DebugBus.info('debug', `encrypt start ${mode}`, { pubkey, len: payload.length })
+      
+      // Start live timing
+      const start = performance.now()
+      setLiveTiming(prev => ({ ...prev, [mode]: { type: 'encrypt', startTime: start } }))
+      
+      const cipher = await api.encrypt(pubkey, payload)
+      const ms = Math.round(performance.now() - start)
+      
+      // Stop live timing
+      setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
+      
+      DebugBus.info('debug', `encrypt done ${mode}`, { len: typeof cipher === 'string' ? cipher.length : -1, ms })
+      if (mode === 'nip44') setCipher44(cipher)
+      else setCipher04(cipher)
+      if (mode === 'nip44') setTEncrypt44(ms)
+      else setTEncrypt04(ms)
+    } catch (e) {
+      // Stop live timing on error
+      setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
+      DebugBus.error('debug', `encrypt error ${mode}`, e instanceof Error ? e.message : String(e))
+    }
+  }
+
+  const doDecrypt = async (mode: 'nip44' | 'nip04') => {
+    if (!signer || !pubkey) return
+    try {
+      const api = (signer as { [key: string]: { decrypt: (pubkey: string, ciphertext: string) => Promise<string> } })[mode]
+      const cipher = mode === 'nip44' ? cipher44 : cipher04
+      if (!cipher) {
+        DebugBus.warn('debug', `no cipher to decrypt for ${mode}`)
+        return
+      }
+      DebugBus.info('debug', `decrypt start ${mode}`, { len: cipher.length })
+      
+      // Start live timing
+      const start = performance.now()
+      setLiveTiming(prev => ({ ...prev, [mode]: { type: 'decrypt', startTime: start } }))
+      
+      const plain = await api.decrypt(pubkey, cipher)
+      const ms = Math.round(performance.now() - start)
+      
+      // Stop live timing
+      setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
+      
+      DebugBus.info('debug', `decrypt done ${mode}`, { len: typeof plain === 'string' ? plain.length : -1, ms })
+      if (mode === 'nip44') setPlain44(String(plain))
+      else setPlain04(String(plain))
+      if (mode === 'nip44') setTDecrypt44(ms)
+      else setTDecrypt04(ms)
+    } catch (e) {
+      // Stop live timing on error
+      setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
+      DebugBus.error('debug', `decrypt error ${mode}`, e instanceof Error ? e.message : String(e))
+    }
+  }
+
+  const toggleDebug = () => {
+    const next = !debugEnabled
+    setDebugEnabled(next)
+    if (next) localStorage.setItem('debug', '*')
+    else localStorage.removeItem('debug')
+  }
+
+  const handleBunkerLogin = async () => {
+    if (!bunkerUri.trim()) {
+      setBunkerError('Please enter a bunker URI')
+      return
+    }
+
+    if (!bunkerUri.startsWith('bunker://')) {
+      setBunkerError('Invalid bunker URI. Must start with bunker://')
+      return
+    }
+
+    try {
+      setIsBunkerLoading(true)
+      setBunkerError(null)
+      
+      // Create signer from bunker URI with default permissions
+      const permissions = getDefaultBunkerPermissions()
+      const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
+      
+      // Get pubkey from signer
+      const pubkey = await signer.getPublicKey()
+      
+      // Create account from signer
+      const account = new Accounts.NostrConnectAccount(pubkey, signer)
+      
+      // Add to account manager and set active
+      accountManager.addAccount(account)
+      accountManager.setActive(account)
+      
+      // Clear input on success
+      setBunkerUri('')
+    } catch (err) {
+      console.error('[bunker] Login failed:', err)
+      const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
+      
+      // Check for permission-related errors
+      if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
+        setBunkerError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
+      } else {
+        setBunkerError(errorMessage)
+      }
+    } finally {
+      setIsBunkerLoading(false)
+    }
+  }
+
+  const CodeBox = ({ value }: { value: string }) => (
+    <div className="h-20 overflow-y-auto font-mono text-xs leading-relaxed p-2 bg-gray-100 dark:bg-gray-800 rounded whitespace-pre-wrap break-all">
+      {value || '—'}
+    </div>
+  )
+
+  const getLiveTiming = (mode: 'nip44' | 'nip04', type: 'encrypt' | 'decrypt') => {
+    const timing = liveTiming[mode]
+    if (timing && timing.type === type) {
+      const elapsed = Math.round(performance.now() - timing.startTime)
+      return elapsed
+    }
+    return null
+  }
+
+  const Stat = ({ label, value, mode, type }: { 
+    label: string; 
+    value?: string | number | null;
+    mode?: 'nip44' | 'nip04';
+    type?: 'encrypt' | 'decrypt';
+  }) => {
+    const liveValue = mode && type ? getLiveTiming(mode, type) : null
+    const isLive = !!liveValue
+    
+    let displayValue: string
+    if (isLive) {
+      displayValue = ''
+    } else if (value !== null && value !== undefined) {
+      displayValue = `${value}ms`
+    } else {
+      displayValue = '—'
+    }
+    
+    return (
+      <span className="badge" style={{ marginRight: 8 }}>
+        <FontAwesomeIcon icon={faClock} style={{ marginRight: 4, fontSize: '0.8em' }} />
+        {label}: {isLive ? (
+          <FontAwesomeIcon icon={faSpinner} className="animate-spin" style={{ fontSize: '0.8em' }} />
+        ) : (
+          displayValue
+        )}
+      </span>
+    )
+  }
+
+  return (
+    <div className="settings-view">
+      <div className="settings-header">
+        <h2>Debug</h2>
+        <div className="settings-header-actions">
+          <span className="opacity-70">Active pubkey:</span> <code className="text-sm">{pubkey || 'none'}</code>
+        </div>
+      </div>
+
+      <div className="settings-content">
+
+        {/* Bunker Login Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Bunker Connection</h3>
+          {!activeAccount ? (
+            <div>
+              <div className="text-sm opacity-70 mb-3">Connect to your bunker (Nostr Connect signer) to enable encryption/decryption testing</div>
+              <div className="flex gap-2 mb-3">
+                <input
+                  type="text"
+                  className="input flex-1"
+                  placeholder="bunker://..."
+                  value={bunkerUri}
+                  onChange={(e) => setBunkerUri(e.target.value)}
+                  disabled={isBunkerLoading}
+                />
+                <button 
+                  className="btn btn-primary" 
+                  onClick={handleBunkerLogin}
+                  disabled={isBunkerLoading || !bunkerUri.trim()}
+                >
+                  {isBunkerLoading ? 'Connecting...' : 'Connect'}
+                </button>
+              </div>
+              {bunkerError && (
+                <div className="text-sm text-red-600 dark:text-red-400 mb-2">{bunkerError}</div>
+              )}
+            </div>
+          ) : (
+            <div className="flex items-center justify-between">
+              <div>
+                <div className="text-sm opacity-70">Connected to bunker</div>
+                <div className="text-sm font-mono">{pubkey}</div>
+              </div>
+                  <button
+                    className="btn"
+                    style={{ 
+                      background: 'rgb(220 38 38)', 
+                      color: 'white', 
+                      border: '1px solid rgb(220 38 38)',
+                      padding: '0.75rem 1.5rem',
+                      borderRadius: '6px',
+                      fontSize: '1rem',
+                      cursor: 'pointer',
+                      transition: 'background-color 0.2s'
+                    }}
+                    onMouseEnter={(e) => e.currentTarget.style.background = 'rgb(185 28 28)'}
+                    onMouseLeave={(e) => e.currentTarget.style.background = 'rgb(220 38 38)'}
+                    onClick={() => accountManager.removeAccount(activeAccount)}
+                  >
+                    Disconnect
+                  </button>
+            </div>
+          )}
+        </div>
+
+        {/* Encryption Tools Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Encryption Tools</h3>
+          <div className="setting-group">
+            <label className="setting-label">Payload</label>
+                <textarea 
+                  className="textarea w-full bg-gray-50 dark:bg-gray-900 border border-gray-200 dark:border-gray-700" 
+                  value={payload} 
+                  onChange={e => setPayload(e.target.value)} 
+                  rows={3} 
+                />
+            <div className="flex gap-2 mt-3 justify-end">
+              <button className="btn btn-secondary" onClick={() => setPayload(defaultPayload)}>Reset</button>
+              <button className="btn btn-secondary" onClick={() => { setCipher44(''); setCipher04(''); setPlain44(''); setPlain04(''); setTEncrypt44(null); setTEncrypt04(null); setTDecrypt44(null); setTDecrypt04(null) }}>Clear</button>
+            </div>
+          </div>
+          
+          <div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
+            <div className="setting-group">
+              <label className="setting-label">NIP-44</label>
+              <div className="flex gap-2 mb-3">
+                <button className="btn btn-primary" onClick={() => doEncrypt('nip44')} disabled={!hasNip44}>Encrypt</button>
+                <button className="btn btn-secondary" onClick={() => doDecrypt('nip44')} disabled={!cipher44}>Decrypt</button>
+              </div>
+              <label className="block text-sm opacity-70 mb-2">Encrypted:</label>
+              <CodeBox value={cipher44} />
+              <div className="mt-3">
+                <span className="text-sm opacity-70">Plain:</span>
+                <CodeBox value={plain44} />
+              </div>
+            </div>
+
+            <div className="setting-group">
+              <label className="setting-label">NIP-04</label>
+              <div className="flex gap-2 mb-3">
+                <button className="btn btn-primary" onClick={() => doEncrypt('nip04')} disabled={!hasNip04}>Encrypt</button>
+                <button className="btn btn-secondary" onClick={() => doDecrypt('nip04')} disabled={!cipher04}>Decrypt</button>
+              </div>
+              <label className="block text-sm opacity-70 mb-2">Encrypted:</label>
+              <CodeBox value={cipher04} />
+              <div className="mt-3">
+                <span className="text-sm opacity-70">Plain:</span>
+                <CodeBox value={plain04} />
+              </div>
+            </div>
+          </div>
+        </div>
+
+        {/* Performance Timing Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Performance Timing</h3>
+          <div className="text-sm opacity-70 mb-3">Encryption and decryption operation durations</div>
+          <div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
+            <div className="setting-group">
+              <label className="setting-label">NIP-44</label>
+              <div className="flex flex-wrap items-center gap-2">
+                <Stat label="enc" value={tEncrypt44} mode="nip44" type="encrypt" />
+                <Stat label="dec" value={tDecrypt44} mode="nip44" type="decrypt" />
+              </div>
+            </div>
+            <div className="setting-group">
+              <label className="setting-label">NIP-04</label>
+              <div className="flex flex-wrap items-center gap-2">
+                <Stat label="enc" value={tEncrypt04} mode="nip04" type="encrypt" />
+                <Stat label="dec" value={tDecrypt04} mode="nip04" type="decrypt" />
+              </div>
+            </div>
+          </div>
+        </div>
+
+        {/* Debug Logs Section */}
+        <div className="settings-section">
+          <h3 className="section-title">Debug Logs</h3>
+          <div className="text-sm opacity-70 mb-3">Recent bunker logs:</div>
+            <div className="max-h-192 overflow-y-auto font-mono text-xs leading-relaxed">
+            {logs.length === 0 ? (
+              <div className="text-sm opacity-50 italic">No logs yet</div>
+            ) : (
+              logs.slice(-200).map((l, i) => (
+                <div key={i} className="mb-1 p-2 bg-gray-100 dark:bg-gray-800 rounded">
+                  <span className="opacity-70">[{new Date(l.ts).toLocaleTimeString()}]</span> <span className="font-semibold">{l.level.toUpperCase()}</span> {l.source}: {l.message}
+                  {l.data !== undefined && (
+                    <span className="opacity-70"> — {typeof l.data === 'string' ? l.data : JSON.stringify(l.data)}</span>
+                  )}
+                </div>
+              ))
+            )}
+          </div>
+            <div className="mt-3">
+              <div className="flex justify-end mb-2">
+                <label className="flex items-center gap-2 cursor-pointer">
+                  <input
+                    type="checkbox"
+                    checked={debugEnabled}
+                    onChange={toggleDebug}
+                    className="checkbox"
+                  />
+                  <span className="text-sm">Show all applesauce debug logs</span>
+                </label>
+              </div>
+              <div className="flex justify-end">
+                <button className="btn btn-secondary" onClick={() => setLogs([])}>Clear logs</button>
+              </div>
+            </div>
+        </div>
+      </div>
+
+      <VersionFooter />
+    </div>
+  )
+}
+
+export default Debug

src/components/Explore.tsx

@@ -1,6 +1,6 @@
 import React, { useState, useEffect, useMemo } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate } from '@fortawesome/free-solid-svg-icons'
+import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate, faSpinner } from '@fortawesome/free-solid-svg-icons'
 import IconButton from './IconButton'
 import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
 import { Hooks } from 'applesauce-react'
@@ -237,35 +237,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
     return `/a/${naddr}`
   }
 
-  const handleHighlightClick = (highlightId: string) => {
-    const highlight = highlights.find(h => h.id === highlightId)
-    if (!highlight) return
-
-    // For nostr-native articles
-    if (highlight.eventReference) {
-      // Convert eventReference to naddr
-      if (highlight.eventReference.includes(':')) {
-        const parts = highlight.eventReference.split(':')
-        const kind = parseInt(parts[0])
-        const pubkey = parts[1]
-        const identifier = parts[2] || ''
-        
-        const naddr = nip19.naddrEncode({
-          kind,
-          pubkey,
-          identifier
-        })
-        navigate(`/a/${naddr}`, { state: { highlightId, openHighlights: true } })
-      } else {
-        // Already an naddr
-        navigate(`/a/${highlight.eventReference}`, { state: { highlightId, openHighlights: true } })
-      }
-    } 
-    // For web URLs
-    else if (highlight.urlReference) {
-      navigate(`/r/${encodeURIComponent(highlight.urlReference)}`, { state: { highlightId, openHighlights: true } })
-    }
-  }
 
   // Classify highlights with levels based on user context and apply visibility filters
   const classifiedHighlights = useMemo(() => {
@@ -320,8 +291,8 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
           )
         }
         return filteredBlogPosts.length === 0 ? (
-          <div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)', padding: '2rem' }}>
-            <p>No blog posts yet. Pull to refresh!</p>
+          <div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+            <FontAwesomeIcon icon={faSpinner} spin size="2x" />
           </div>
         ) : (
           <div className="explore-grid">
@@ -347,8 +318,8 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
           )
         }
         return classifiedHighlights.length === 0 ? (
-          <div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)', padding: '2rem' }}>
-            <p>No highlights yet. Pull to refresh!</p>
+          <div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+            <FontAwesomeIcon icon={faSpinner} spin size="2x" />
           </div>
         ) : (
           <div className="explore-grid">
@@ -357,7 +328,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
                 key={highlight.id}
                 highlight={highlight}
                 relayPool={relayPool}
-                onHighlightClick={handleHighlightClick}
               />
             ))}
           </div>

src/components/HighlightItem.tsx

@@ -13,10 +13,10 @@ import { areAllRelaysLocal } from '../utils/helpers'
 import { nip19 } from 'nostr-tools'
 import { formatDateCompact } from '../utils/bookmarkUtils'
 import { createDeletionRequest } from '../services/deletionService'
-import ConfirmDialog from './ConfirmDialog'
 import { getNostrUrl } from '../config/nostrGateways'
 import CompactButton from './CompactButton'
 import { HighlightCitation } from './HighlightCitation'
+import { useNavigate } from 'react-router-dom'
 
 // Helper to detect if a URL is an image
 const isImageUrl = (url: string): boolean => {
@@ -207,6 +207,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
   const [showMenu, setShowMenu] = useState(false)
   
   const activeAccount = Hooks.useActiveAccount()
+  const navigate = useNavigate()
   
   // Resolve the profile of the user who made the highlight
   const profile = useEventModel(Models.ProfileModel, [highlight.pubkey])
@@ -257,25 +258,52 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     }
   }, [isSelected])
   
-  // Close menu when clicking outside
+  // Close menu and reset delete confirm when clicking outside
   useEffect(() => {
     const handleClickOutside = (event: MouseEvent) => {
       if (menuRef.current && !menuRef.current.contains(event.target as Node)) {
         setShowMenu(false)
+        setShowDeleteConfirm(false)
       }
     }
     
-    if (showMenu) {
+    if (showMenu || showDeleteConfirm) {
       document.addEventListener('mousedown', handleClickOutside)
       return () => {
         document.removeEventListener('mousedown', handleClickOutside)
       }
     }
-  }, [showMenu])
+  }, [showMenu, showDeleteConfirm])
   
   const handleItemClick = () => {
+    // If onHighlightClick is provided, use it (legacy behavior)
     if (onHighlightClick) {
       onHighlightClick(highlight.id)
+      return
+    }
+    
+    // Otherwise, navigate to the article that this highlight references
+    if (highlight.eventReference) {
+      // Parse the event reference - it can be an event ID or article coordinate (kind:pubkey:identifier)
+      const parts = highlight.eventReference.split(':')
+      
+      // If it's an article coordinate (3 parts) and kind is 30023, navigate to it
+      if (parts.length === 3) {
+        const [kind, pubkey, identifier] = parts
+        
+        if (kind === '30023') {
+          // Encode as naddr and navigate
+          const naddr = nip19.naddrEncode({
+            kind: 30023,
+            pubkey,
+            identifier
+          })
+          navigate(`/a/${naddr}`)
+        }
+      }
+    } else if (highlight.urlReference) {
+      // Navigate to external URL
+      navigate(`/r/${encodeURIComponent(highlight.urlReference)}`)
     }
   }
   
@@ -434,12 +462,12 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     }
   }
   
-  const handleCancelDelete = () => {
-    setShowDeleteConfirm(false)
-  }
-  
   const handleMenuToggle = (e: React.MouseEvent) => {
     e.stopPropagation()
+    // Reset delete confirm state when opening/closing menu
+    if (!showMenu) {
+      setShowDeleteConfirm(false)
+    }
     setShowMenu(!showMenu)
   }
   
@@ -461,6 +489,11 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
     setShowDeleteConfirm(true)
   }
   
+  const handleConfirmDeleteClick = (e: React.MouseEvent) => {
+    e.stopPropagation()
+    handleConfirmDelete()
+  }
+  
   return (
     <>
     <div 
@@ -468,7 +501,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
       className={`highlight-item ${isSelected ? 'selected' : ''} ${highlight.level ? `level-${highlight.level}` : ''}`} 
       data-highlight-id={highlight.id}
       onClick={handleItemClick}
-      style={{ cursor: onHighlightClick ? 'pointer' : 'default' }}
+      style={{ cursor: (onHighlightClick || highlight.eventReference || highlight.urlReference) ? 'pointer' : 'default' }}
     >
       <div className="highlight-header">
         <CompactButton
@@ -533,6 +566,33 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
           </div>
           
           <div className="highlight-menu-wrapper" ref={menuRef}>
+            {showDeleteConfirm && canDelete && (
+              <div style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', marginRight: '0.5rem' }}>
+                <span style={{ fontSize: '0.875rem', color: 'rgb(220 38 38)', fontWeight: 500 }}>Confirm?</span>
+                <button
+                  onClick={handleConfirmDeleteClick}
+                  disabled={isDeleting}
+                  title="Confirm deletion"
+                  style={{ 
+                    color: 'rgb(220 38 38)',
+                    background: 'rgba(220, 38, 38, 0.1)',
+                    border: '1px solid rgb(220 38 38)',
+                    borderRadius: '4px',
+                    padding: '0.375rem',
+                    cursor: isDeleting ? 'not-allowed' : 'pointer',
+                    display: 'flex',
+                    alignItems: 'center',
+                    justifyContent: 'center',
+                    minWidth: '33px',
+                    minHeight: '33px',
+                    transition: 'all 0.2s'
+                  }}
+                >
+                  <FontAwesomeIcon icon={isDeleting ? faSpinner : faTrash} spin={isDeleting} />
+                </button>
+              </div>
+            )}
+            
             <CompactButton
               icon={faEllipsisH}
               onClick={handleMenuToggle}
@@ -546,7 +606,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
                   onClick={handleOpenPortal}
                 >
                   <FontAwesomeIcon icon={faExternalLinkAlt} />
-                  <span>Open on Nostr</span>
+                  <span>Open with njump</span>
                 </button>
                 <button
                   className="highlight-menu-item"
@@ -571,17 +631,6 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
         </div>
       </div>
     </div>
-    
-    <ConfirmDialog
-      isOpen={showDeleteConfirm}
-      title="Delete Highlight?"
-      message="This will request deletion of your highlight. It may still be visible on some relays that don't honor deletion requests."
-      confirmText="Delete"
-      cancelText="Cancel"
-      variant="danger"
-      onConfirm={handleConfirmDelete}
-      onCancel={handleCancelDelete}
-    />
     </>
   )
 }

src/components/LoginOptions.tsx

@@ -0,0 +1,179 @@
+import React, { useState } from 'react'
+import { Hooks } from 'applesauce-react'
+import { Accounts } from 'applesauce-accounts'
+import { NostrConnectSigner } from 'applesauce-signers'
+import { getDefaultBunkerPermissions } from '../services/nostrConnect'
+
+const LoginOptions: React.FC = () => {
+  const accountManager = Hooks.useAccountManager()
+  const [showBunkerInput, setShowBunkerInput] = useState(false)
+  const [bunkerUri, setBunkerUri] = useState('')
+  const [isLoading, setIsLoading] = useState(false)
+  const [error, setError] = useState<string | null>(null)
+
+  const handleExtensionLogin = async () => {
+    try {
+      setIsLoading(true)
+      setError(null)
+      const account = await Accounts.ExtensionAccount.fromExtension()
+      accountManager.addAccount(account)
+      accountManager.setActive(account)
+    } catch (err) {
+      console.error('Extension login failed:', err)
+      setError('Login failed. Please install a nostr browser extension and try again.')
+    } finally {
+      setIsLoading(false)
+    }
+  }
+
+  const handleBunkerLogin = async () => {
+    if (!bunkerUri.trim()) {
+      setError('Please enter a bunker URI')
+      return
+    }
+
+    if (!bunkerUri.startsWith('bunker://')) {
+      setError('Invalid bunker URI. Must start with bunker://')
+      return
+    }
+
+    try {
+      setIsLoading(true)
+      setError(null)
+      
+      // Create signer from bunker URI with default permissions
+      const permissions = getDefaultBunkerPermissions()
+      const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
+      
+      // Get pubkey from signer
+      const pubkey = await signer.getPublicKey()
+      
+      // Create account from signer
+      const account = new Accounts.NostrConnectAccount(pubkey, signer)
+      
+      // Add to account manager and set active
+      accountManager.addAccount(account)
+      accountManager.setActive(account)
+      
+      // Clear input on success
+      setBunkerUri('')
+      setShowBunkerInput(false)
+    } catch (err) {
+      console.error('[bunker] Login failed:', err)
+      const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
+      
+      // Check for permission-related errors
+      if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
+        setError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
+      } else {
+        setError(errorMessage)
+      }
+    } finally {
+      setIsLoading(false)
+    }
+  }
+
+  return (
+    <div className="empty-state">
+      <p style={{ marginBottom: '1rem' }}>Login with:</p>
+      
+      <div style={{ display: 'flex', flexDirection: 'column', gap: '0.75rem', maxWidth: '300px', margin: '0 auto' }}>
+        <button
+          onClick={handleExtensionLogin}
+          disabled={isLoading}
+          style={{
+            padding: '0.75rem 1.5rem',
+            fontSize: '1rem',
+            cursor: isLoading ? 'wait' : 'pointer',
+            opacity: isLoading ? 0.6 : 1
+          }}
+        >
+          {isLoading && !showBunkerInput ? 'Connecting...' : 'Extension'}
+        </button>
+        
+        {!showBunkerInput ? (
+          <button
+            onClick={() => setShowBunkerInput(true)}
+            disabled={isLoading}
+            style={{
+              padding: '0.75rem 1.5rem',
+              fontSize: '1rem',
+              cursor: isLoading ? 'wait' : 'pointer',
+              opacity: isLoading ? 0.6 : 1
+            }}
+          >
+            Bunker
+          </button>
+        ) : (
+          <div style={{ display: 'flex', flexDirection: 'column', gap: '0.5rem' }}>
+            <input
+              type="text"
+              placeholder="bunker://..."
+              value={bunkerUri}
+              onChange={(e) => setBunkerUri(e.target.value)}
+              disabled={isLoading}
+              style={{
+                padding: '0.75rem',
+                fontSize: '0.9rem',
+                width: '100%',
+                boxSizing: 'border-box'
+              }}
+              onKeyDown={(e) => {
+                if (e.key === 'Enter') {
+                  handleBunkerLogin()
+                }
+              }}
+            />
+            <div style={{ display: 'flex', gap: '0.5rem' }}>
+              <button
+                onClick={handleBunkerLogin}
+                disabled={isLoading || !bunkerUri.trim()}
+                style={{
+                  padding: '0.5rem 1rem',
+                  fontSize: '0.9rem',
+                  flex: 1,
+                  cursor: isLoading || !bunkerUri.trim() ? 'not-allowed' : 'pointer',
+                  opacity: isLoading || !bunkerUri.trim() ? 0.6 : 1
+                }}
+              >
+                {isLoading && showBunkerInput ? 'Connecting...' : 'Connect'}
+              </button>
+              <button
+                onClick={() => {
+                  setShowBunkerInput(false)
+                  setBunkerUri('')
+                  setError(null)
+                }}
+                disabled={isLoading}
+                style={{
+                  padding: '0.5rem 1rem',
+                  fontSize: '0.9rem',
+                  cursor: isLoading ? 'not-allowed' : 'pointer',
+                  opacity: isLoading ? 0.6 : 1
+                }}
+              >
+                Cancel
+              </button>
+            </div>
+          </div>
+        )}
+      </div>
+      
+      {error && (
+        <p style={{ color: 'var(--color-error, #ef4444)', marginTop: '1rem', fontSize: '0.9rem' }}>
+          {error}
+        </p>
+      )}
+      
+      <p style={{ marginTop: '1.5rem', fontSize: '0.9rem' }}>
+        If you aren't on nostr yet, start here:{' '}
+        <a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">
+          nstart.me
+        </a>
+      </p>
+    </div>
+  )
+}
+
+export default LoginOptions
+

src/components/Me.tsx

@@ -1,16 +1,17 @@
 import React, { useState, useEffect } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faSpinner, faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare } from '@fortawesome/free-solid-svg-icons'
+import { faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare, faLink } from '@fortawesome/free-solid-svg-icons'
 import { Hooks } from 'applesauce-react'
 import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
 import { RelayPool } from 'applesauce-relay'
 import { nip19 } from 'nostr-tools'
-import { useNavigate } from 'react-router-dom'
+import { useNavigate, useParams } from 'react-router-dom'
 import { Highlight } from '../types/highlights'
 import { HighlightItem } from './HighlightItem'
 import { fetchHighlights } from '../services/highlightService'
 import { fetchBookmarks } from '../services/bookmarkService'
-import { fetchReadArticlesWithData } from '../services/libraryService'
+import { fetchAllReads, ReadItem } from '../services/readsService'
+import { fetchLinks } from '../services/linksService'
 import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
 import { RELAYS } from '../config/relays'
 import { Bookmark, IndividualBookmark } from '../types/bookmarks'
@@ -19,11 +20,18 @@ import BlogPostCard from './BlogPostCard'
 import { BookmarkItem } from './BookmarkItem'
 import IconButton from './IconButton'
 import { ViewMode } from './Bookmarks'
-import { extractUrlsFromContent } from '../services/bookmarkHelpers'
-import { getCachedMeData, setCachedMeData, updateCachedHighlights } from '../services/meCache'
+import { getCachedMeData, updateCachedHighlights } from '../services/meCache'
 import { faBooks } from '../icons/customIcons'
 import { usePullToRefresh } from 'use-pull-to-refresh'
 import RefreshIndicator from './RefreshIndicator'
+import { groupIndividualBookmarks, hasContent } from '../utils/bookmarkUtils'
+import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
+import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
+import ReadingProgressFilters, { ReadingProgressFilterType } from './ReadingProgressFilters'
+import { filterByReadingProgress } from '../utils/readingProgressUtils'
+import { deriveReadsFromBookmarks } from '../utils/readsFromBookmarks'
+import { deriveLinksFromBookmarks } from '../utils/linksFromBookmarks'
+import { mergeReadItem } from '../utils/readItemMerge'
 
 interface MeProps {
   relayPool: RelayPool
@@ -31,11 +39,15 @@ interface MeProps {
   pubkey?: string // Optional pubkey for viewing other users' profiles
 }
 
-type TabType = 'highlights' | 'reading-list' | 'archive' | 'writings'
+type TabType = 'highlights' | 'reading-list' | 'reads' | 'links' | 'writings'
+
+// Valid reading progress filters
+const VALID_FILTERS: ReadingProgressFilterType[] = ['all', 'unopened', 'started', 'reading', 'completed']
 
 const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: propPubkey }) => {
   const activeAccount = Hooks.useActiveAccount()
   const navigate = useNavigate()
+  const { filter: urlFilter } = useParams<{ filter?: string }>()
   const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
   
   // Use provided pubkey or fall back to active account
@@ -43,11 +55,22 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
   const isOwnProfile = !propPubkey || (activeAccount?.pubkey === propPubkey)
   const [highlights, setHighlights] = useState<Highlight[]>([])
   const [bookmarks, setBookmarks] = useState<Bookmark[]>([])
-  const [readArticles, setReadArticles] = useState<BlogPostPreview[]>([])
+  const [reads, setReads] = useState<ReadItem[]>([])
+  const [, setReadsMap] = useState<Map<string, ReadItem>>(new Map())
+  const [links, setLinks] = useState<ReadItem[]>([])
+  const [, setLinksMap] = useState<Map<string, ReadItem>>(new Map())
   const [writings, setWritings] = useState<BlogPostPreview[]>([])
   const [loading, setLoading] = useState(true)
+  const [loadedTabs, setLoadedTabs] = useState<Set<TabType>>(new Set())
   const [viewMode, setViewMode] = useState<ViewMode>('cards')
   const [refreshTrigger, setRefreshTrigger] = useState(0)
+  const [bookmarkFilter, setBookmarkFilter] = useState<BookmarkFilterType>('all')
+  
+  // Initialize reading progress filter from URL param
+  const initialFilter = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType) 
+    ? (urlFilter as ReadingProgressFilterType) 
+    : 'all'
+  const [readingProgressFilter, setReadingProgressFilter] = useState<ReadingProgressFilterType>(initialFilter)
 
   // Update local state when prop changes
   useEffect(() => {
@@ -56,72 +79,246 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
     }
   }, [propActiveTab])
 
+  // Sync filter state with URL changes
   useEffect(() => {
-    const loadData = async () => {
-      if (!viewingPubkey) {
-        setLoading(false)
-        return
+    const filterFromUrl = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType) 
+      ? (urlFilter as ReadingProgressFilterType) 
+      : 'all'
+    setReadingProgressFilter(filterFromUrl)
+  }, [urlFilter])
+
+  // Handler to change reading progress filter and update URL
+  const handleReadingProgressFilterChange = (filter: ReadingProgressFilterType) => {
+    setReadingProgressFilter(filter)
+    if (activeTab === 'reads') {
+      if (filter === 'all') {
+        navigate('/me/reads', { replace: true })
+      } else {
+        navigate(`/me/reads/${filter}`, { replace: true })
+      }
+    }
+  }
+
+  // Tab-specific loading functions
+  const loadHighlightsTab = async () => {
+    if (!viewingPubkey) return
+    
+    // Only show loading skeleton if tab hasn't been loaded yet
+    const hasBeenLoaded = loadedTabs.has('highlights')
+    
+    try {
+      if (!hasBeenLoaded) setLoading(true)
+      const userHighlights = await fetchHighlights(relayPool, viewingPubkey)
+      setHighlights(userHighlights)
+      setLoadedTabs(prev => new Set(prev).add('highlights'))
+    } catch (err) {
+      console.error('Failed to load highlights:', err)
+    } finally {
+      if (!hasBeenLoaded) setLoading(false)
+    }
+  }
+
+  const loadWritingsTab = async () => {
+    if (!viewingPubkey) return
+    
+    const hasBeenLoaded = loadedTabs.has('writings')
+    
+    try {
+      if (!hasBeenLoaded) setLoading(true)
+      const userWritings = await fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
+      setWritings(userWritings)
+      setLoadedTabs(prev => new Set(prev).add('writings'))
+    } catch (err) {
+      console.error('Failed to load writings:', err)
+    } finally {
+      if (!hasBeenLoaded) setLoading(false)
+    }
+  }
+
+  const loadReadingListTab = async () => {
+    if (!viewingPubkey || !isOwnProfile || !activeAccount) return
+    
+    const hasBeenLoaded = loadedTabs.has('reading-list')
+    
+    try {
+      if (!hasBeenLoaded) setLoading(true)
+      try {
+        await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
+          setBookmarks(newBookmarks)
+        })
+      } catch (err) {
+        console.warn('Failed to load bookmarks:', err)
+        setBookmarks([])
+      }
+      setLoadedTabs(prev => new Set(prev).add('reading-list'))
+    } catch (err) {
+      console.error('Failed to load reading list:', err)
+    } finally {
+      if (!hasBeenLoaded) setLoading(false)
+    }
+  }
+
+  const loadReadsTab = async () => {
+    if (!viewingPubkey || !isOwnProfile || !activeAccount) return
+    
+    const hasBeenLoaded = loadedTabs.has('reads')
+    
+    try {
+      if (!hasBeenLoaded) setLoading(true)
+      
+      // Ensure bookmarks are loaded
+      let fetchedBookmarks: Bookmark[] = bookmarks
+      if (bookmarks.length === 0) {
+        try {
+          await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
+            fetchedBookmarks = newBookmarks
+            setBookmarks(newBookmarks)
+          })
+        } catch (err) {
+          console.warn('Failed to load bookmarks:', err)
+          fetchedBookmarks = []
+        }
       }
 
-      try {
-        setLoading(true)
-
-        // Seed from cache if available to avoid empty flash (own profile only)
-        if (isOwnProfile) {
-          const cached = getCachedMeData(viewingPubkey)
-          if (cached) {
-            setHighlights(cached.highlights)
-            setBookmarks(cached.bookmarks)
-            setReadArticles(cached.readArticles)
+      // Derive reads from bookmarks immediately
+      const initialReads = deriveReadsFromBookmarks(fetchedBookmarks)
+      const initialMap = new Map(initialReads.map(item => [item.id, item]))
+      setReadsMap(initialMap)
+      setReads(initialReads)
+      setLoadedTabs(prev => new Set(prev).add('reads'))
+      if (!hasBeenLoaded) setLoading(false)
+      
+      // Background enrichment: merge reading progress and mark-as-read
+      // Only update items that are already in our map
+      fetchAllReads(relayPool, viewingPubkey, fetchedBookmarks, (item) => {
+        console.log('📈 [Reads] Enrichment item received:', {
+          id: item.id.slice(0, 20) + '...',
+          progress: item.readingProgress,
+          hasProgress: item.readingProgress !== undefined && item.readingProgress > 0
+        })
+        
+        setReadsMap(prevMap => {
+          // Only update if item exists in our current map
+          if (!prevMap.has(item.id)) {
+            console.log('⚠️ [Reads] Item not in map, skipping:', item.id.slice(0, 20) + '...')
+            return prevMap
           }
-        }
-
-        // Fetch highlights and writings (public data)
-        const [userHighlights, userWritings] = await Promise.all([
-          fetchHighlights(relayPool, viewingPubkey),
-          fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
-        ])
-
-        setHighlights(userHighlights)
-        setWritings(userWritings)
-
-        // Only fetch private data for own profile
-        if (isOwnProfile && activeAccount) {
-          const userReadArticles = await fetchReadArticlesWithData(relayPool, viewingPubkey)
-          setReadArticles(userReadArticles)
-
-          // Fetch bookmarks using callback pattern
-          let fetchedBookmarks: Bookmark[] = []
-          try {
-            await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
-              fetchedBookmarks = newBookmarks
-              setBookmarks(newBookmarks)
-            })
-          } catch (err) {
-            console.warn('Failed to load bookmarks:', err)
-            setBookmarks([])
+          
+          const newMap = new Map(prevMap)
+          const merged = mergeReadItem(newMap, item)
+          if (merged) {
+            console.log('✅ [Reads] Merged progress:', item.id.slice(0, 20) + '...', item.readingProgress)
+            // Update reads array after map is updated
+            setReads(Array.from(newMap.values()))
+            return newMap
           }
+          return prevMap
+        })
+      }).catch(err => console.warn('Failed to enrich reads:', err))
+      
+    } catch (err) {
+      console.error('Failed to load reads:', err)
+      if (!hasBeenLoaded) setLoading(false)
+    }
+  }
 
-          // Update cache with all fetched data
-          setCachedMeData(viewingPubkey, userHighlights, fetchedBookmarks, userReadArticles)
-        } else {
-          setBookmarks([])
-          setReadArticles([])
+  const loadLinksTab = async () => {
+    if (!viewingPubkey || !isOwnProfile || !activeAccount) return
+    
+    const hasBeenLoaded = loadedTabs.has('links')
+    
+    try {
+      if (!hasBeenLoaded) setLoading(true)
+      
+      // Ensure bookmarks are loaded
+      let fetchedBookmarks: Bookmark[] = bookmarks
+      if (bookmarks.length === 0) {
+        try {
+          await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
+            fetchedBookmarks = newBookmarks
+            setBookmarks(newBookmarks)
+          })
+        } catch (err) {
+          console.warn('Failed to load bookmarks:', err)
+          fetchedBookmarks = []
         }
-      } catch (err) {
-        console.error('Failed to load data:', err)
-        // No blocking error - user can pull-to-refresh
-      } finally {
-        setLoading(false)
+      }
+
+      // Derive links from bookmarks immediately
+      const initialLinks = deriveLinksFromBookmarks(fetchedBookmarks)
+      const initialMap = new Map(initialLinks.map(item => [item.id, item]))
+      setLinksMap(initialMap)
+      setLinks(initialLinks)
+      setLoadedTabs(prev => new Set(prev).add('links'))
+      if (!hasBeenLoaded) setLoading(false)
+      
+      // Background enrichment: merge reading progress and mark-as-read
+      // Only update items that are already in our map
+      fetchLinks(relayPool, viewingPubkey, (item) => {
+        setLinksMap(prevMap => {
+          // Only update if item exists in our current map
+          if (!prevMap.has(item.id)) return prevMap
+          
+          const newMap = new Map(prevMap)
+          if (mergeReadItem(newMap, item)) {
+            // Update links array after map is updated
+            setLinks(Array.from(newMap.values()))
+            return newMap
+          }
+          return prevMap
+        })
+      }).catch(err => console.warn('Failed to enrich links:', err))
+      
+    } catch (err) {
+      console.error('Failed to load links:', err)
+      if (!hasBeenLoaded) setLoading(false)
+    }
+  }
+
+  // Load active tab data
+  useEffect(() => {
+    if (!viewingPubkey || !activeTab) {
+      setLoading(false)
+      return
+    }
+
+    // Load cached data immediately if available
+    if (isOwnProfile) {
+      const cached = getCachedMeData(viewingPubkey)
+      if (cached) {
+        setHighlights(cached.highlights)
+        setBookmarks(cached.bookmarks)
+        setReads(cached.reads || [])
+        setLinks(cached.links || [])
       }
     }
 
-    loadData()
-  }, [relayPool, viewingPubkey, isOwnProfile, activeAccount, refreshTrigger])
+    // Load data for active tab (refresh in background if already loaded)
+    switch (activeTab) {
+      case 'highlights':
+        loadHighlightsTab()
+        break
+      case 'writings':
+        loadWritingsTab()
+        break
+      case 'reading-list':
+        loadReadingListTab()
+        break
+      case 'reads':
+        loadReadsTab()
+        break
+      case 'links':
+        loadLinksTab()
+        break
+    }
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [activeTab, viewingPubkey, refreshTrigger])
 
-  // Pull-to-refresh
+
+  // Pull-to-refresh - reload active tab without clearing state
   const { isRefreshing, pullPosition } = usePullToRefresh({
     onRefresh: () => {
+      // Just trigger refresh - loaders will merge new data
       setRefreshTrigger(prev => prev + 1)
     },
     maximumPullLength: 240,
@@ -150,21 +347,47 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
     return `/a/${naddr}`
   }
 
-  // Helper to check if a bookmark has either content or a URL (same logic as BookmarkList)
-  const hasContentOrUrl = (ib: IndividualBookmark) => {
-    const hasContent = ib.content && ib.content.trim().length > 0
-    
-    let hasUrl = false
-    if (ib.kind === 39701) {
-      const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
-      hasUrl = !!dTag && dTag.trim().length > 0
-    } else {
-      const urls = extractUrlsFromContent(ib.content || '')
-      hasUrl = urls.length > 0
+  const getReadItemUrl = (item: ReadItem) => {
+    if (item.type === 'article') {
+      // ID is already in naddr format
+      return `/a/${item.id}`
+    } else if (item.url) {
+      return `/r/${encodeURIComponent(item.url)}`
+    }
+    return '#'
+  }
+
+  const convertReadItemToBlogPostPreview = (item: ReadItem): BlogPostPreview => {
+    if (item.event) {
+      return {
+        event: item.event,
+        title: item.title || 'Untitled',
+        summary: item.summary,
+        image: item.image,
+        published: item.published,
+        author: item.author || item.event.pubkey
+      }
     }
     
-    if (ib.kind === 30023) return true
-    return hasContent || hasUrl
+    // Create a mock event for external URLs
+    const mockEvent = {
+      id: item.id,
+      pubkey: item.author || '',
+      created_at: item.readingTimestamp || Math.floor(Date.now() / 1000),
+      kind: 1,
+      tags: [] as string[][],
+      content: item.title || item.url || 'Untitled',
+      sig: ''
+    } as const
+    
+    return {
+      event: mockEvent as unknown as import('nostr-tools').NostrEvent,
+      title: item.title || item.url || 'Untitled',
+      summary: item.summary,
+      image: item.image,
+      published: item.published,
+      author: item.author || ''
+    }
   }
 
   const handleSelectUrl = (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => {
@@ -186,13 +409,27 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
     }
   }
 
-  // Merge and flatten all individual bookmarks (same logic as BookmarkList)
+  // Merge and flatten all individual bookmarks
   const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
-    .filter(hasContentOrUrl)
-    .sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
+    .filter(hasContent)
+  
+  // Apply bookmark filter
+  const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, bookmarkFilter)
+  
+  const groups = groupIndividualBookmarks(filteredBookmarks)
+
+  // Apply reading progress filter
+  const filteredReads = filterByReadingProgress(reads, readingProgressFilter)
+  const filteredLinks = filterByReadingProgress(links, readingProgressFilter)
+  const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
+    { key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
+    { key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
+    { key: 'web', title: 'Web Bookmarks', items: groups.web },
+    { key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
+  ]
 
   // Show content progressively - no blocking error screens
-  const hasData = highlights.length > 0 || bookmarks.length > 0 || readArticles.length > 0 || writings.length > 0
+  const hasData = highlights.length > 0 || bookmarks.length > 0 || reads.length > 0 || links.length > 0 || writings.length > 0
   const showSkeletons = loading && !hasData
 
   const renderTabContent = () => {
@@ -207,13 +444,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
             </div>
           )
         }
-        return highlights.length === 0 ? (
-          <div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
-            <p>
-              {isOwnProfile 
-                ? 'No highlights yet. Pull to refresh!'
-                : 'No highlights yet. Pull to refresh!'}
-            </p>
+        return highlights.length === 0 && !loading ? (
+          <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+            No highlights yet.
           </div>
         ) : (
           <div className="highlights-list me-highlights-list">
@@ -240,23 +473,39 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
             </div>
           )
         }
-        return allIndividualBookmarks.length === 0 ? (
-          <div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
-            <p>No bookmarks yet. Pull to refresh!</p>
+        return allIndividualBookmarks.length === 0 && !loading ? (
+          <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+            No bookmarks yet.
           </div>
         ) : (
           <div className="bookmarks-list">
-            <div className={`bookmarks-grid bookmarks-${viewMode}`}>
-              {allIndividualBookmarks.map((individualBookmark, index) => (
-                <BookmarkItem
-                  key={`${individualBookmark.id}-${index}`}
-                  bookmark={individualBookmark}
-                  index={index}
-                  viewMode={viewMode}
-                  onSelectUrl={handleSelectUrl}
-                />
-              ))}
-            </div>
+            {allIndividualBookmarks.length > 0 && (
+              <BookmarkFilters
+                selectedFilter={bookmarkFilter}
+                onFilterChange={setBookmarkFilter}
+              />
+            )}
+            {filteredBookmarks.length === 0 ? (
+              <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+                No bookmarks match this filter.
+              </div>
+            ) : (
+              sections.filter(s => s.items.length > 0).map(section => (
+              <div key={section.key} className="bookmarks-section">
+                <h3 className="bookmarks-section-title">{section.title}</h3>
+                <div className={`bookmarks-grid bookmarks-${viewMode}`}>
+                  {section.items.map((individualBookmark, index) => (
+                    <BookmarkItem
+                      key={`${section.key}-${individualBookmark.id}-${index}`}
+                      bookmark={individualBookmark}
+                      index={index}
+                      viewMode={viewMode}
+                      onSelectUrl={handleSelectUrl}
+                    />
+                  ))}
+                </div>
+              </div>
+            )))}
             <div className="view-mode-controls" style={{
               display: 'flex',
               justifyContent: 'center',
@@ -290,8 +539,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
           </div>
         )
 
-      case 'archive':
-        if (showSkeletons) {
+      case 'reads':
+        // Show loading skeletons only while initially loading
+        if (loading && !loadedTabs.has('reads')) {
           return (
             <div className="explore-grid">
               {Array.from({ length: 6 }).map((_, i) => (
@@ -300,20 +550,87 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
             </div>
           )
         }
-        return readArticles.length === 0 ? (
-          <div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
-            <p>No read articles yet. Pull to refresh!</p>
-          </div>
-        ) : (
-          <div className="explore-grid">
-            {readArticles.map((post) => (
-              <BlogPostCard
-                key={post.event.id}
-                post={post}
-                href={getPostUrl(post)}
-              />
-            ))}
-          </div>
+        
+        // Show empty state if loaded but no reads
+        if (reads.length === 0 && loadedTabs.has('reads')) {
+          return (
+            <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+              No articles read yet.
+            </div>
+          )
+        }
+        
+        // Show reads with filters
+        return (
+          <>
+            <ReadingProgressFilters
+              selectedFilter={readingProgressFilter}
+              onFilterChange={handleReadingProgressFilterChange}
+            />
+            {filteredReads.length === 0 ? (
+              <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+                No articles match this filter.
+              </div>
+            ) : (
+              <div className="explore-grid">
+              {filteredReads.map((item) => (
+                <BlogPostCard
+                  key={item.id}
+                  post={convertReadItemToBlogPostPreview(item)}
+                  href={getReadItemUrl(item)}
+                  readingProgress={item.readingProgress}
+                />
+              ))}
+              </div>
+            )}
+          </>
+        )
+
+      case 'links':
+        // Show loading skeletons only while initially loading
+        if (loading && !loadedTabs.has('links')) {
+          return (
+            <div className="explore-grid">
+              {Array.from({ length: 6 }).map((_, i) => (
+                <BlogPostSkeleton key={i} />
+              ))}
+            </div>
+          )
+        }
+        
+        // Show empty state if loaded but no links
+        if (links.length === 0 && loadedTabs.has('links')) {
+          return (
+            <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+              No links with reading progress yet.
+            </div>
+          )
+        }
+        
+        // Show links with filters
+        return (
+          <>
+            <ReadingProgressFilters
+              selectedFilter={readingProgressFilter}
+              onFilterChange={handleReadingProgressFilterChange}
+            />
+            {filteredLinks.length === 0 ? (
+              <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+                No links match this filter.
+              </div>
+            ) : (
+              <div className="explore-grid">
+              {filteredLinks.map((item) => (
+                <BlogPostCard
+                  key={item.id}
+                  post={convertReadItemToBlogPostPreview(item)}
+                  href={getReadItemUrl(item)}
+                  readingProgress={item.readingProgress}
+                />
+              ))}
+              </div>
+            )}
+          </>
         )
 
       case 'writings':
@@ -326,13 +643,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
             </div>
           )
         }
-        return writings.length === 0 ? (
-          <div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
-            <p>
-              {isOwnProfile 
-                ? 'No articles written yet. Pull to refresh!'
-                : 'No articles written yet. Pull to refresh!'}
-            </p>
+        return writings.length === 0 && !loading ? (
+          <div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
+            No articles written yet.
           </div>
         ) : (
           <div className="explore-grid">
@@ -360,12 +673,6 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
       <div className="explore-header">
         {viewingPubkey && <AuthorCard authorPubkey={viewingPubkey} clickable={false} />}
         
-        {loading && hasData && (
-          <div className="explore-loading" style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', padding: '0.5rem 0' }}>
-            <FontAwesomeIcon icon={faSpinner} spin />
-          </div>
-        )}
-        
         <div className="me-tabs">
           <button
             className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
@@ -386,12 +693,20 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
                 <span className="tab-label">Bookmarks</span>
               </button>
               <button
-                className={`me-tab ${activeTab === 'archive' ? 'active' : ''}`}
-                data-tab="archive"
-                onClick={() => navigate('/me/archive')}
+                className={`me-tab ${activeTab === 'reads' ? 'active' : ''}`}
+                data-tab="reads"
+                onClick={() => navigate('/me/reads')}
               >
                 <FontAwesomeIcon icon={faBooks} />
-                <span className="tab-label">Archive</span>
+                <span className="tab-label">Reads</span>
+              </button>
+              <button
+                className={`me-tab ${activeTab === 'links' ? 'active' : ''}`}
+                data-tab="links"
+                onClick={() => navigate('/me/links')}
+              >
+                <FontAwesomeIcon icon={faLink} />
+                <span className="tab-label">Links</span>
               </button>
             </>
           )}

src/components/ReaderHeader.tsx

@@ -1,8 +1,9 @@
 import React, { useMemo } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faHighlighter, faClock } from '@fortawesome/free-solid-svg-icons'
+import { faHighlighter, faClock, faNewspaper } from '@fortawesome/free-solid-svg-icons'
 import { format } from 'date-fns'
 import { useImageCache } from '../hooks/useImageCache'
+import { useAdaptiveTextColor } from '../hooks/useAdaptiveTextColor'
 import { UserSettings } from '../services/settingsService'
 import { Highlight, HighlightLevel } from '../types/highlights'
 import { HighlightVisibility } from './HighlightsPanel'
@@ -34,6 +35,7 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
   highlightVisibility = { nostrverse: true, friends: true, mine: true }
 }) => {
   const cachedImage = useImageCache(image)
+  const { textColor } = useAdaptiveTextColor(cachedImage)
   const formattedDate = published ? format(new Date(published * 1000), 'MMM d, yyyy') : null
   const isLongSummary = summary && summary.length > 150
   
@@ -70,13 +72,25 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
     }
   }, [highlights, highlightVisibility, settings])
   
-  if (cachedImage) {
+  // Show hero section if we have an image OR a title
+  if (cachedImage || title) {
     return (
       <>
         <div className="reader-hero-image">
-          <img src={cachedImage} alt={title || 'Article image'} />
+          {cachedImage ? (
+            <img src={cachedImage} alt={title || 'Article image'} />
+          ) : (
+            <div className="reader-hero-placeholder">
+              <FontAwesomeIcon icon={faNewspaper} />
+            </div>
+          )}
           {formattedDate && (
-            <div className="publish-date-topright">
+            <div 
+              className="publish-date-topright"
+              style={{ 
+                color: textColor
+              }}
+            >
               {formattedDate}
             </div>
           )}
@@ -118,7 +132,12 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
       {title && (
         <div className="reader-header">
           {formattedDate && (
-            <div className="publish-date-topright">
+            <div 
+              className="publish-date-topright"
+              style={{ 
+                color: textColor
+              }}
+            >
               {formattedDate}
             </div>
           )}

src/components/ReadingProgressFilters.tsx

@@ -0,0 +1,47 @@
+import React from 'react'
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
+import { faBookOpen, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
+import { faEnvelope, faEnvelopeOpen } from '@fortawesome/free-regular-svg-icons'
+
+export type ReadingProgressFilterType = 'all' | 'unopened' | 'started' | 'reading' | 'completed'
+
+interface ReadingProgressFiltersProps {
+  selectedFilter: ReadingProgressFilterType
+  onFilterChange: (filter: ReadingProgressFilterType) => void
+}
+
+const ReadingProgressFilters: React.FC<ReadingProgressFiltersProps> = ({ selectedFilter, onFilterChange }) => {
+  const filters = [
+    { type: 'all' as const, icon: faAsterisk, label: 'All' },
+    { type: 'unopened' as const, icon: faEnvelope, label: 'Unopened' },
+    { type: 'started' as const, icon: faEnvelopeOpen, label: 'Started' },
+    { type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
+    { type: 'completed' as const, icon: faCheckCircle, label: 'Completed' }
+  ]
+
+  return (
+    <div className="bookmark-filters">
+      {filters.map(filter => {
+        const isActive = selectedFilter === filter.type
+        // Only "completed" gets green color, everything else uses default blue
+        const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
+        
+        return (
+          <button
+            key={filter.type}
+            onClick={() => onFilterChange(filter.type)}
+            className={`filter-btn ${isActive ? 'active' : ''}`}
+            title={filter.label}
+            aria-label={`Filter by ${filter.label}`}
+            style={activeStyle}
+          >
+            <FontAwesomeIcon icon={filter.icon} />
+          </button>
+        )
+      })}
+    </div>
+  )
+}
+
+export default ReadingProgressFilters
+

src/components/ReadingProgressIndicator.tsx

@@ -19,6 +19,21 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
 }) => {
   const clampedProgress = Math.min(100, Math.max(0, progress))
   
+  // Determine reading state based on progress (matching readingProgressUtils.ts logic)
+  const progressDecimal = clampedProgress / 100
+  const isStarted = progressDecimal > 0 && progressDecimal <= 0.10
+  
+  // Determine bar color based on state
+  let barColorClass = ''
+  let barColorStyle: string | undefined = 'var(--color-primary)' // Default blue
+  
+  if (isComplete) {
+    barColorClass = 'bg-green-500'
+    barColorStyle = undefined
+  } else if (isStarted) {
+    barColorStyle = 'var(--color-text)' // Neutral text color (matches card titles)
+  }
+  
   // Calculate left and right offsets based on sidebar states (desktop only)
   const leftOffset = isSidebarCollapsed 
     ? 'var(--sidebar-collapsed-width)' 
@@ -42,14 +57,10 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
         style={{ backgroundColor: 'var(--color-border)' }}
       >
         <div 
-          className={`h-full rounded-full transition-all duration-300 relative ${
-            isComplete 
-              ? 'bg-green-500' 
-              : ''
-          }`}
+          className={`h-full rounded-full transition-all duration-300 relative ${barColorClass}`}
           style={{ 
             width: `${clampedProgress}%`,
-            backgroundColor: isComplete ? undefined : 'var(--color-primary)'
+            backgroundColor: barColorStyle
           }}
         >
           <div className="absolute inset-0 bg-gradient-to-r from-transparent via-white/30 to-transparent animate-[shimmer_2s_infinite]" />
@@ -60,7 +71,9 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
           className={`text-[0.625rem] font-normal min-w-[32px] text-right tabular-nums ${
             isComplete ? 'text-green-500' : ''
           }`}
-          style={{ color: isComplete ? undefined : 'var(--color-text-muted)' }}
+          style={{ 
+            color: isComplete ? undefined : isStarted ? 'var(--color-text)' : 'var(--color-text-muted)' 
+          }}
         >
           {isComplete ? '✓' : `${clampedProgress}%`}
         </div>

src/components/RouteDebug.tsx

@@ -0,0 +1,30 @@
+import { useEffect } from 'react'
+import { useLocation, useMatch } from 'react-router-dom'
+
+export default function RouteDebug() {
+  const location = useLocation()
+  const matchArticle = useMatch('/a/:naddr')
+
+  useEffect(() => {
+    const params = new URLSearchParams(location.search)
+    if (params.get('debug') !== '1') return
+
+    const info: Record<string, unknown> = {
+      pathname: location.pathname,
+      search: location.search || null,
+      matchedArticleRoute: Boolean(matchArticle),
+      referrer: document.referrer || null
+    }
+
+    if (location.pathname === '/') {
+      // Unexpected during deep-link refresh tests
+      console.warn('[RouteDebug] unexpected root redirect', info)
+    } else {
+      console.debug('[RouteDebug]', info)
+    }
+  }, [location, matchArticle])
+
+  return null
+}
+
+

src/components/Settings.tsx

@@ -6,13 +6,12 @@ import IconButton from './IconButton'
 import { loadFont } from '../utils/fontLoader'
 import ThemeSettings from './Settings/ThemeSettings'
 import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
-import LayoutNavigationSettings from './Settings/LayoutNavigationSettings'
-import StartupPreferencesSettings from './Settings/StartupPreferencesSettings'
+import LayoutBehaviorSettings from './Settings/LayoutBehaviorSettings'
 import ZapSettings from './Settings/ZapSettings'
-import OfflineModeSettings from './Settings/OfflineModeSettings'
 import RelaySettings from './Settings/RelaySettings'
 import PWASettings from './Settings/PWASettings'
 import { useRelayStatus } from '../hooks/useRelayStatus'
+import VersionFooter from './VersionFooter'
 
 const DEFAULT_SETTINGS: UserSettings = {
   collapseOnArticleOpen: true,
@@ -35,6 +34,8 @@ const DEFAULT_SETTINGS: UserSettings = {
   zapSplitAuthorWeight: 50,
   useLocalRelayAsCache: true,
   rebroadcastToAllRelays: false,
+  paragraphAlignment: 'justify',
+  syncReadingPosition: false,
 }
 
 interface SettingsProps {
@@ -162,13 +163,12 @@ const Settings: React.FC<SettingsProps> = ({ settings, onSave, onClose, relayPoo
       <div className="settings-content">
         <ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
         <ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
-        <LayoutNavigationSettings settings={localSettings} onUpdate={handleUpdate} />
-        <StartupPreferencesSettings settings={localSettings} onUpdate={handleUpdate} />
         <ZapSettings settings={localSettings} onUpdate={handleUpdate} />
-        <OfflineModeSettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
+        <LayoutBehaviorSettings settings={localSettings} onUpdate={handleUpdate} />
+        <PWASettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
         <RelaySettings relayStatuses={relayStatuses} onClose={onClose} />
-        <PWASettings />
       </div>
+      <VersionFooter />
     </div>
   )
 }

src/components/Settings/LayoutBehaviorSettings.tsx

@@ -0,0 +1,125 @@
+import React from 'react'
+import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
+import { UserSettings } from '../../services/settingsService'
+import IconButton from '../IconButton'
+
+interface LayoutBehaviorSettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+}
+
+const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
+  return (
+    <div className="settings-section">
+      <h3 className="section-title">Layout & Behavior</h3>
+      
+      <div className="setting-group setting-inline">
+        <label>Default Bookmark View</label>
+        <div className="setting-buttons">
+          <IconButton 
+            icon={faList} 
+            onClick={() => onUpdate({ defaultViewMode: 'compact' })} 
+            title="Compact list view" 
+            ariaLabel="Compact list view" 
+            variant={(settings.defaultViewMode || 'compact') === 'compact' ? 'primary' : 'ghost'} 
+          />
+          <IconButton 
+            icon={faThLarge} 
+            onClick={() => onUpdate({ defaultViewMode: 'cards' })} 
+            title="Cards view" 
+            ariaLabel="Cards view" 
+            variant={settings.defaultViewMode === 'cards' ? 'primary' : 'ghost'} 
+          />
+          <IconButton 
+            icon={faImage} 
+            onClick={() => onUpdate({ defaultViewMode: 'large' })} 
+            title="Large preview view" 
+            ariaLabel="Large preview view" 
+            variant={settings.defaultViewMode === 'large' ? 'primary' : 'ghost'} 
+          />
+        </div>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="collapseOnArticleOpen" className="checkbox-label">
+          <input
+            id="collapseOnArticleOpen"
+            type="checkbox"
+            checked={settings.collapseOnArticleOpen !== false}
+            onChange={(e) => onUpdate({ collapseOnArticleOpen: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Collapse bookmark bar when opening an article</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="sidebarCollapsed" className="checkbox-label">
+          <input
+            id="sidebarCollapsed"
+            type="checkbox"
+            checked={settings.sidebarCollapsed !== false}
+            onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Start with bookmarks sidebar collapsed</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="highlightsCollapsed" className="checkbox-label">
+          <input
+            id="highlightsCollapsed"
+            type="checkbox"
+            checked={settings.highlightsCollapsed !== false}
+            onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Start with highlights panel collapsed</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
+          <input
+            id="rebroadcastToAllRelays"
+            type="checkbox"
+            checked={settings.rebroadcastToAllRelays ?? false}
+            onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Rebroadcast events while browsing</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
+          <input
+            id="autoCollapseSidebarOnMobile"
+            type="checkbox"
+            checked={settings.autoCollapseSidebarOnMobile !== false}
+            onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Auto-collapse sidebar on small screens</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="syncReadingPosition" className="checkbox-label">
+          <input
+            id="syncReadingPosition"
+            type="checkbox"
+            checked={settings.syncReadingPosition ?? false}
+            onChange={(e) => onUpdate({ syncReadingPosition: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Sync reading position across devices</span>
+        </label>
+      </div>
+    </div>
+  )
+}
+
+export default LayoutBehaviorSettings
+

src/components/Settings/LayoutNavigationSettings.tsx

@@ -3,15 +3,15 @@ import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
 import { UserSettings } from '../../services/settingsService'
 import IconButton from '../IconButton'
 
-interface LayoutNavigationSettingsProps {
+interface LayoutBehaviorSettingsProps {
   settings: UserSettings
   onUpdate: (updates: Partial<UserSettings>) => void
 }
 
-const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ settings, onUpdate }) => {
+const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
   return (
     <div className="settings-section">
-      <h3 className="section-title">Layout & Navigation</h3>
+      <h3 className="section-title">Layout & Behavior</h3>
       
       <div className="setting-group setting-inline">
         <label>Default Bookmark View</label>
@@ -52,9 +52,61 @@ const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ set
           <span>Collapse bookmark bar when opening an article</span>
         </label>
       </div>
+
+      <div className="setting-group">
+        <label htmlFor="sidebarCollapsed" className="checkbox-label">
+          <input
+            id="sidebarCollapsed"
+            type="checkbox"
+            checked={settings.sidebarCollapsed !== false}
+            onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Start with bookmarks sidebar collapsed</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="highlightsCollapsed" className="checkbox-label">
+          <input
+            id="highlightsCollapsed"
+            type="checkbox"
+            checked={settings.highlightsCollapsed !== false}
+            onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Start with highlights panel collapsed</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
+          <input
+            id="rebroadcastToAllRelays"
+            type="checkbox"
+            checked={settings.rebroadcastToAllRelays ?? false}
+            onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Rebroadcast events while browsing</span>
+        </label>
+      </div>
+
+      <div className="setting-group">
+        <label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
+          <input
+            id="autoCollapseSidebarOnMobile"
+            type="checkbox"
+            checked={settings.autoCollapseSidebarOnMobile !== false}
+            onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
+            className="setting-checkbox"
+          />
+          <span>Auto-collapse sidebar on small screens</span>
+        </label>
+      </div>
     </div>
   )
 }
 
-export default LayoutNavigationSettings
+export default LayoutBehaviorSettings
 

src/components/Settings/OfflineModeSettings.tsx

@@ -1,173 +0,0 @@
-import React, { useState, useEffect } from 'react'
-import { useNavigate } from 'react-router-dom'
-import { faTrash } from '@fortawesome/free-solid-svg-icons'
-import { UserSettings } from '../../services/settingsService'
-import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
-import IconButton from '../IconButton'
-
-interface OfflineModeSettingsProps {
-  settings: UserSettings
-  onUpdate: (updates: Partial<UserSettings>) => void
-  onClose?: () => void
-}
-
-const OfflineModeSettings: React.FC<OfflineModeSettingsProps> = ({ settings, onUpdate, onClose }) => {
-  const navigate = useNavigate()
-  const [cacheStats, setCacheStats] = useState<{
-    totalSizeMB: number
-    itemCount: number
-    items: Array<{ url: string, sizeMB: number }>
-  }>({ totalSizeMB: 0, itemCount: 0, items: [] })
-
-  const handleLinkClick = (url: string) => {
-    if (onClose) onClose()
-    navigate(`/r/${encodeURIComponent(url)}`)
-  }
-
-  const handleClearCache = async () => {
-    if (confirm('Are you sure you want to clear all cached images?')) {
-      await clearImageCache()
-      const stats = await getImageCacheStatsAsync()
-      setCacheStats(stats)
-    }
-  }
-
-  // Update cache stats periodically
-  useEffect(() => {
-    const updateStats = async () => {
-      const stats = await getImageCacheStatsAsync()
-      setCacheStats(stats)
-    }
-    
-    updateStats() // Initial load
-    const interval = setInterval(updateStats, 3000) // Update every 3 seconds
-    return () => clearInterval(interval)
-  }, [])
-
-  return (
-    <div className="settings-section">
-      <h3 className="section-title">Flight Mode</h3>
-      
-      <div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
-        <label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
-          <input
-            id="enableImageCache"
-            type="checkbox"
-            checked={settings.enableImageCache ?? true}
-            onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Use local image cache</span>
-        </label>
-
-        {(settings.enableImageCache ?? true) && (
-          <div style={{ 
-            fontSize: '0.85rem',
-            color: 'var(--text-secondary)',
-            display: 'flex',
-            alignItems: 'center',
-            gap: '0.5rem'
-          }}>
-            <span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
-              ( {cacheStats.totalSizeMB.toFixed(1)} MB / 
-              <input
-                id="imageCacheSizeMB"
-                type="number"
-                min="10"
-                max="500"
-                value={settings.imageCacheSizeMB ?? 210}
-                onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
-                style={{
-                  width: '50px',
-                  padding: '0.15rem 0.35rem',
-                  background: 'var(--surface-secondary)',
-                  border: '1px solid var(--border-color, #333)',
-                  borderRadius: '4px',
-                  color: 'inherit',
-                  fontSize: 'inherit',
-                  fontFamily: 'inherit',
-                  textAlign: 'center'
-                }}
-              />
-              MB used )
-            </span>
-            <IconButton
-              icon={faTrash}
-              onClick={handleClearCache}
-              title="Clear cache"
-              variant="ghost"
-              size={28}
-            />
-          </div>
-        )}
-      </div>
-
-      <div className="setting-group">
-        <label htmlFor="useLocalRelayAsCache" className="checkbox-label">
-          <input
-            id="useLocalRelayAsCache"
-            type="checkbox"
-            checked={settings.useLocalRelayAsCache ?? true}
-            onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Use local relays as cache</span>
-        </label>
-      </div>
-
-      <div style={{ 
-        marginTop: '1.5rem', 
-        padding: '1rem',
-        background: 'var(--surface-secondary)',
-        borderRadius: '6px',
-        fontSize: '0.9rem',
-        lineHeight: '1.6'
-      }}>
-        <p style={{ margin: 0, color: 'var(--text-secondary)' }}>
-          Boris works best with a local relay. Consider running{' '}
-          <a 
-            href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download" 
-            target="_blank" 
-            rel="noopener noreferrer"
-            style={{ color: 'var(--accent, #8b5cf6)' }}
-          >
-            Citrine
-          </a>
-          {' or '}
-          <a 
-            href="https://github.com/CodyTseng/nostr-relay-tray/releases" 
-            target="_blank" 
-            rel="noopener noreferrer"
-            style={{ color: 'var(--accent, #8b5cf6)' }}
-          >
-            nostr-relay-tray
-          </a>
-          . Don't know what relays are? Learn more{' '}
-          <a 
-            onClick={(e) => {
-              e.preventDefault()
-              handleLinkClick('https://nostr.how/en/relays')
-            }}
-            style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
-          >
-            here
-          </a>
-          {' and '}
-          <a 
-            onClick={(e) => {
-              e.preventDefault()
-              handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
-            }}
-            style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
-          >
-            here
-          </a>
-          .
-        </p>
-      </div>
-    </div>
-  )
-}
-
-export default OfflineModeSettings
-

src/components/Settings/PWASettings.tsx

@@ -1,80 +1,206 @@
-import React from 'react'
-import { faDownload, faCheckCircle, faMobileAlt } from '@fortawesome/free-solid-svg-icons'
+import React, { useState, useEffect } from 'react'
+import { useNavigate } from 'react-router-dom'
+import { faDownload, faCheckCircle, faTrash } from '@fortawesome/free-solid-svg-icons'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { usePWAInstall } from '../../hooks/usePWAInstall'
+import { useIsMobile } from '../../hooks/useMediaQuery'
+import { UserSettings } from '../../services/settingsService'
+import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
 
-const PWASettings: React.FC = () => {
+interface PWASettingsProps {
+  settings: UserSettings
+  onUpdate: (updates: Partial<UserSettings>) => void
+  onClose?: () => void
+}
+
+const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }) => {
+  const navigate = useNavigate()
+  const isMobile = useIsMobile()
   const { isInstallable, isInstalled, installApp } = usePWAInstall()
+  const [cacheStats, setCacheStats] = useState<{
+    totalSizeMB: number
+    itemCount: number
+    items: Array<{ url: string, sizeMB: number }>
+  }>({ totalSizeMB: 0, itemCount: 0, items: [] })
 
   const handleInstall = async () => {
+    if (isInstalled) return
     const success = await installApp()
     if (success) {
       console.log('App installed successfully')
     }
   }
 
-  if (isInstalled) {
-    return (
-      <div className="settings-section">
-        <h3>Progressive Web App</h3>
-        <div className="setting-item">
-          <div className="setting-info">
-            <FontAwesomeIcon icon={faCheckCircle} style={{ color: '#22c55e', marginRight: '8px' }} />
-            <span>Boris is installed as an app</span>
-          </div>
-          <p className="setting-description">
-            You can launch Boris from your home screen or app drawer.
-          </p>
-        </div>
-      </div>
-    )
+  const handleLinkClick = (url: string) => {
+    if (onClose) onClose()
+    navigate(`/r/${encodeURIComponent(url)}`)
   }
 
-  if (!isInstallable) {
-    return null
+  const handleClearCache = async () => {
+    if (confirm('Are you sure you want to clear all cached images?')) {
+      await clearImageCache()
+      const stats = await getImageCacheStatsAsync()
+      setCacheStats(stats)
+    }
   }
 
+  // Update cache stats periodically
+  useEffect(() => {
+    const updateStats = async () => {
+      const stats = await getImageCacheStatsAsync()
+      setCacheStats(stats)
+    }
+    
+    updateStats() // Initial load
+    const interval = setInterval(updateStats, 3000) // Update every 3 seconds
+    return () => clearInterval(interval)
+  }, [])
+
   return (
     <div className="settings-section">
-      <h3>Progressive Web App</h3>
-      <div className="setting-item">
-        <div className="setting-info">
-          <FontAwesomeIcon icon={faMobileAlt} style={{ marginRight: '8px' }} />
-          <span>Install Boris as an app</span>
+      <h3 className="section-title">App & Airplane Mode</h3>
+      
+      <div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
+        <div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
+          <p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
+            Boris is offline‑first by design. You can read, create highlights, and browse your library without being connected to the internet. Boris will store changes locally and sync later.
+          </p>
+          
+          {/* Flight Mode Section - Checkboxes First */}
+          <div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
+            <label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
+              <input
+                id="enableImageCache"
+                type="checkbox"
+                checked={settings.enableImageCache ?? true}
+                onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
+                className="setting-checkbox"
+              />
+              <span>Use local image cache</span>
+            </label>
+
+            {(settings.enableImageCache ?? true) && (
+              <div style={{ 
+                fontSize: '0.85rem',
+                color: 'var(--text-secondary)',
+                display: 'flex',
+                alignItems: 'center',
+                gap: '0.5rem'
+              }}>
+                <span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
+                  ( {cacheStats.totalSizeMB.toFixed(1)} MB / 
+                  <input
+                    id="imageCacheSizeMB"
+                    type="number"
+                    min="10"
+                    max="500"
+                    value={settings.imageCacheSizeMB ?? 210}
+                    onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
+                    style={{
+                      width: '50px',
+                      padding: '0.15rem 0.35rem',
+                      background: 'var(--surface-secondary)',
+                      border: '1px solid var(--border-color, #333)',
+                      borderRadius: '4px',
+                      color: 'inherit',
+                      fontSize: 'inherit',
+                      fontFamily: 'inherit',
+                      textAlign: 'center'
+                    }}
+                  />
+                  MB used )
+                </span>
+                <FontAwesomeIcon 
+                  icon={faTrash}
+                  onClick={handleClearCache}
+                  title="Clear cache"
+                  style={{ cursor: 'pointer', fontSize: '0.85rem', opacity: 0.7 }}
+                />
+              </div>
+            )}
+          </div>
+
+          {/* PWA Install Section - Paragraphs */}
+          <div className="setting-group">
+            <p className="setting-description" style={{ marginTop: '0.5rem', marginBottom: '0.75rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
+              <strong>Note:</strong> Boris works best with a local relay. Consider running{' '}
+              <a 
+                href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download" 
+                target="_blank" 
+                rel="noopener noreferrer"
+                style={{ color: 'var(--accent, #8b5cf6)' }}
+              >
+                Citrine
+              </a>
+              {' or '}
+              <a 
+                href="https://github.com/CodyTseng/nostr-relay-tray/releases" 
+                target="_blank" 
+                rel="noopener noreferrer"
+                style={{ color: 'var(--accent, #8b5cf6)' }}
+              >
+                nostr-relay-tray
+              </a>
+              {' '}to bring full offline functionality to Boris. Don't know what relays are? Learn more{' '}
+              <a 
+                onClick={(e) => {
+                  e.preventDefault()
+                  handleLinkClick('https://nostr.how/en/relays')
+                }}
+                style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
+              >
+                here
+              </a>
+              {' and '}
+              <a 
+                onClick={(e) => {
+                  e.preventDefault()
+                  handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
+                }}
+                style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
+              >
+                here
+              </a>
+              .
+            </p>
+          </div>
+
+          <div className="setting-group">
+            <label htmlFor="useLocalRelayAsCache" className="checkbox-label">
+              <input
+                id="useLocalRelayAsCache"
+                type="checkbox"
+                checked={settings.useLocalRelayAsCache ?? true}
+                onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
+                className="setting-checkbox"
+              />
+              <span>Use local relays as cache</span>
+            </label>
+          </div>
+
+          <div className="setting-group">
+            <p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
+              Install Boris on your device for a native app experience.
+            </p>
+            <button
+              onClick={handleInstall}
+              className="zap-preset-btn"
+              style={{ display: 'flex', alignItems: 'center', gap: '0.5rem' }}
+              disabled={isInstalled || !isInstallable}
+            >
+              <FontAwesomeIcon icon={isInstalled ? faCheckCircle : faDownload} />
+              {isInstalled ? 'Installed' : 'Install App'}
+            </button>
+          </div>
         </div>
-        <p className="setting-description">
-          Install Boris on your device for a native app experience with offline support.
-        </p>
-        <button
-          onClick={handleInstall}
-          className="install-button"
-          style={{
-            marginTop: '12px',
-            padding: '8px 16px',
-            background: 'linear-gradient(135deg, #3b82f6 0%, #1e40af 100%)',
-            color: 'white',
-            border: 'none',
-            borderRadius: '8px',
-            cursor: 'pointer',
-            display: 'flex',
-            alignItems: 'center',
-            gap: '8px',
-            fontSize: '14px',
-            fontWeight: '500',
-            transition: 'transform 0.2s, box-shadow 0.2s',
-          }}
-          onMouseEnter={(e) => {
-            e.currentTarget.style.transform = 'translateY(-2px)'
-            e.currentTarget.style.boxShadow = '0 4px 12px rgba(59, 130, 246, 0.3)'
-          }}
-          onMouseLeave={(e) => {
-            e.currentTarget.style.transform = 'translateY(0)'
-            e.currentTarget.style.boxShadow = 'none'
-          }}
-        >
-          <FontAwesomeIcon icon={faDownload} />
-          Install App
-        </button>
+
+        {!isMobile && (
+          <img 
+            src="/pwa.svg" 
+            alt="Progressive Web App" 
+            style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
+          />
+        )}
       </div>
     </div>
   )

src/components/Settings/ReadingDisplaySettings.tsx

@@ -1,5 +1,5 @@
 import React from 'react'
-import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser } from '@fortawesome/free-solid-svg-icons'
+import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser, faAlignLeft, faAlignJustify } from '@fortawesome/free-solid-svg-icons'
 import { UserSettings } from '../../services/settingsService'
 import IconButton from '../IconButton'
 import ColorPicker from '../ColorPicker'
@@ -19,35 +19,6 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
     <div className="settings-section">
       <h3 className="section-title">Reading & Display</h3>
       
-      <div style={{ display: 'flex', gap: '1rem', flexWrap: 'wrap' }}>
-        <div className="setting-group setting-inline" style={{ flex: '1 1 auto', minWidth: '200px' }}>
-          <label htmlFor="readingFont">Reading Font</label>
-          <div className="setting-control">
-            <FontSelector
-              value={settings.readingFont || 'source-serif-4'}
-              onChange={(font) => onUpdate({ readingFont: font })}
-            />
-          </div>
-        </div>
-
-        <div className="setting-group setting-inline" style={{ flex: '0 1 auto' }}>
-          <label>Font Size</label>
-          <div className="setting-buttons">
-            {[16, 18, 21, 24, 28, 32].map(size => (
-              <button
-                key={size}
-                onClick={() => onUpdate({ fontSize: size })}
-                className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
-                title={`${size}px`}
-                style={{ fontSize: `${size - 2}px` }}
-              >
-                A
-              </button>
-            ))}
-          </div>
-        </div>
-      </div>
-
       <div className="setting-group setting-inline">
         <label>Highlight Style</label>
         <div className="setting-buttons">
@@ -69,31 +40,21 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
       </div>
 
       <div className="setting-group setting-inline">
-        <label className="setting-label">My Highlights</label>
-        <div className="setting-control">
-          <ColorPicker
-            selectedColor={settings.highlightColorMine || '#fde047'}
-            onColorChange={(color) => onUpdate({ highlightColorMine: color })}
+        <label>Paragraph Alignment</label>
+        <div className="setting-buttons">
+          <IconButton 
+            icon={faAlignLeft} 
+            onClick={() => onUpdate({ paragraphAlignment: 'left' })} 
+            title="Left aligned" 
+            ariaLabel="Left aligned" 
+            variant={settings.paragraphAlignment === 'left' ? 'primary' : 'ghost'} 
           />
-        </div>
-      </div>
-
-      <div className="setting-group setting-inline">
-        <label className="setting-label">Friends Highlights</label>
-        <div className="setting-control">
-          <ColorPicker
-            selectedColor={settings.highlightColorFriends || '#f97316'}
-            onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
-          />
-        </div>
-      </div>
-
-      <div className="setting-group setting-inline">
-        <label className="setting-label">Nostrverse Highlights</label>
-        <div className="setting-control">
-          <ColorPicker
-            selectedColor={settings.highlightColorNostrverse || '#9333ea'}
-            onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
+          <IconButton 
+            icon={faAlignJustify} 
+            onClick={() => onUpdate({ paragraphAlignment: 'justify' })} 
+            title="Justified" 
+            ariaLabel="Justified" 
+            variant={(settings.paragraphAlignment || 'justify') === 'justify' ? 'primary' : 'ghost'} 
           />
         </div>
       </div>
@@ -137,6 +98,65 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
         </div>
       </div>
 
+      <div className="setting-group setting-inline">
+        <label htmlFor="readingFont">Reading Font</label>
+        <div className="setting-control">
+          <FontSelector
+            value={settings.readingFont || 'source-serif-4'}
+            onChange={(font) => onUpdate({ readingFont: font })}
+          />
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label className="setting-label">Font Size</label>
+        <div className="setting-control">
+          <div className="setting-buttons">
+            {[16, 18, 21, 24, 28, 32].map(size => (
+              <button
+                key={size}
+                onClick={() => onUpdate({ fontSize: size })}
+                className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
+                title={`${size}px`}
+                style={{ fontSize: `${size - 2}px` }}
+              >
+                A
+              </button>
+            ))}
+          </div>
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label className="setting-label">My Highlights</label>
+        <div className="setting-control">
+          <ColorPicker
+            selectedColor={settings.highlightColorMine || '#fde047'}
+            onColorChange={(color) => onUpdate({ highlightColorMine: color })}
+          />
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label className="setting-label">Friends Highlights</label>
+        <div className="setting-control">
+          <ColorPicker
+            selectedColor={settings.highlightColorFriends || '#f97316'}
+            onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
+          />
+        </div>
+      </div>
+
+      <div className="setting-group setting-inline">
+        <label className="setting-label">Nostrverse Highlights</label>
+        <div className="setting-control">
+          <ColorPicker
+            selectedColor={settings.highlightColorNostrverse || '#9333ea'}
+            onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
+          />
+        </div>
+      </div>
+
       <div className="setting-group">
         <label htmlFor="showHighlights" className="checkbox-label">
           <input
@@ -157,7 +177,8 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
           style={{ 
             fontFamily: previewFontFamily,
             fontSize: `${settings.fontSize || 21}px`,
-            '--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00')
+            '--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00'),
+            '--paragraph-alignment': settings.paragraphAlignment || 'justify'
           } as React.CSSProperties}
         >
           <h3>The Quick Brown Fox</h3>

src/components/Settings/StartupPreferencesSettings.tsx

@@ -1,70 +0,0 @@
-import React from 'react'
-import { UserSettings } from '../../services/settingsService'
-
-interface StartupPreferencesSettingsProps {
-  settings: UserSettings
-  onUpdate: (updates: Partial<UserSettings>) => void
-}
-
-const StartupPreferencesSettings: React.FC<StartupPreferencesSettingsProps> = ({ settings, onUpdate }) => {
-  return (
-    <div className="settings-section">
-      <h3 className="section-title">Startup & Behavior</h3>
-      
-      <div className="setting-group">
-        <label htmlFor="sidebarCollapsed" className="checkbox-label">
-          <input
-            id="sidebarCollapsed"
-            type="checkbox"
-            checked={settings.sidebarCollapsed !== false}
-            onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Start with bookmarks sidebar collapsed</span>
-        </label>
-      </div>
-
-      <div className="setting-group">
-        <label htmlFor="highlightsCollapsed" className="checkbox-label">
-          <input
-            id="highlightsCollapsed"
-            type="checkbox"
-            checked={settings.highlightsCollapsed !== false}
-            onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Start with highlights panel collapsed</span>
-        </label>
-      </div>
-
-      <div className="setting-group">
-        <label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
-          <input
-            id="rebroadcastToAllRelays"
-            type="checkbox"
-            checked={settings.rebroadcastToAllRelays ?? false}
-            onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Rebroadcast events while browsing</span>
-        </label>
-      </div>
-
-      <div className="setting-group">
-        <label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
-          <input
-            id="autoCollapseSidebarOnMobile"
-            type="checkbox"
-            checked={settings.autoCollapseSidebarOnMobile !== false}
-            onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
-            className="setting-checkbox"
-          />
-          <span>Auto-collapse sidebar on small screens</span>
-        </label>
-      </div>
-    </div>
-  )
-}
-
-export default StartupPreferencesSettings
-

src/components/Settings/ZapSettings.tsx

@@ -1,5 +1,6 @@
 import React from 'react'
 import { UserSettings } from '../../services/settingsService'
+import { useIsMobile } from '../../hooks/useMediaQuery'
 
 interface ZapSettingsProps {
   settings: UserSettings
@@ -7,6 +8,7 @@ interface ZapSettingsProps {
 }
 
 const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
+  const isMobile = useIsMobile()
   const highlighterWeight = settings.zapSplitHighlighterWeight ?? 50
   const borisWeight = settings.zapSplitBorisWeight ?? 2.1
   const authorWeight = settings.zapSplitAuthorWeight ?? 50
@@ -42,98 +44,119 @@ const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
     <div className="settings-section">
       <h3 className="section-title">Zap Splits</h3>
       
-      <div className="setting-group">
-        <label className="setting-label">Presets</label>
-        <div className="zap-preset-buttons">
-          <button
-            onClick={() => applyPreset(presets.default)}
-            className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
-            title="You: 49%, Author: 49%, Boris: 2%"
-          >
-            Default
-          </button>
-          <button
-            onClick={() => applyPreset(presets.generous)}
-            className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
-            title="You: 6%, Author: 83%, Boris: 11%"
-          >
-            Generous
-          </button>
-          <button
-            onClick={() => applyPreset(presets.selfless)}
-            className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
-            title="You: 1%, Author: 80%, Boris: 19%"
-          >
-            Selfless
-          </button>
-          <button
-            onClick={() => applyPreset(presets.boris)}
-            className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
-            title="You: 10%, Author: 10%, Boris: 80%"
-          >
-            Boris 🧡
-          </button>
-        </div>
-      </div>
-      
-      <div className="setting-group">
-        <label className="setting-label">Your Share</label>
-        <div className="zap-split-container">
-          <div className="zap-split-labels">
-            <span className="zap-split-label">Weight: {highlighterWeight}</span>
-            <span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
+      <div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
+        <div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
+          <div className="setting-group">
+            <label className="setting-label">Presets</label>
+            <div className="zap-preset-buttons">
+              <button
+                onClick={() => applyPreset(presets.default)}
+                className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
+                title="You: 49%, Author: 49%, Boris: 2%"
+              >
+                Default
+              </button>
+              <button
+                onClick={() => applyPreset(presets.generous)}
+                className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
+                title="You: 6%, Author: 83%, Boris: 11%"
+              >
+                Generous
+              </button>
+              <button
+                onClick={() => applyPreset(presets.selfless)}
+                className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
+                title="You: 1%, Author: 80%, Boris: 19%"
+              >
+                Selfless
+              </button>
+              <button
+                onClick={() => applyPreset(presets.boris)}
+                className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
+                title="You: 10%, Author: 10%, Boris: 80%"
+              >
+                Boris 🧡
+              </button>
+            </div>
           </div>
-          <input
-            type="range"
-            min="0"
-            max="100"
-            value={highlighterWeight}
-            onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
-            className="zap-split-slider"
-          />
-        </div>
-      </div>
-
-      <div className="setting-group">
-        <label className="setting-label">Author(s) Share</label>
-        <div className="zap-split-container">
-          <div className="zap-split-labels">
-            <span className="zap-split-label">Weight: {authorWeight}</span>
-            <span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
+          
+          <div className="setting-group">
+            <div className="zap-split-container">
+              <div className="zap-split-labels">
+                <span className="zap-split-label">Your Share: {highlighterWeight}</span>
+                <span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
+              </div>
+              <input
+                type="range"
+                min="0"
+                max="100"
+                value={highlighterWeight}
+                onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
+                className="zap-split-slider"
+                list="highlighter-ticks"
+              />
+              <datalist id="highlighter-ticks">
+                <option value="50" label="50%"></option>
+              </datalist>
+            </div>
           </div>
-          <input
-            type="range"
-            min="0"
-            max="100"
-            value={authorWeight}
-            onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
-            className="zap-split-slider"
-          />
-        </div>
-      </div>
 
-      <div className="setting-group">
-        <label className="setting-label">Support Boris</label>
-        <div className="zap-split-container">
-          <div className="zap-split-labels">
-            <span className="zap-split-label">Weight: {borisWeight.toFixed(1)}</span>
-            <span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
+          <div className="setting-group">
+            <div className="zap-split-container">
+              <div className="zap-split-labels">
+                <span className="zap-split-label">Author's Share: {authorWeight}</span>
+                <span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
+              </div>
+              <input
+                type="range"
+                min="0"
+                max="100"
+                value={authorWeight}
+                onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
+                className="zap-split-slider"
+                list="author-ticks"
+              />
+              <datalist id="author-ticks">
+                <option value="50" label="50%"></option>
+              </datalist>
+            </div>
           </div>
-          <input
-            type="range"
-            min="0"
-            max="10"
-            step="0.1"
-            value={borisWeight}
-            onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
-            className="zap-split-slider"
-          />
-        </div>
-      </div>
 
-      <div className="zap-split-description">
-        Weights determine zap splits when highlighting nostr-native content. 
-        If the content has multiple authors, their share is divided proportionally.
+          <div className="setting-group">
+            <div className="zap-split-container">
+              <div className="zap-split-labels">
+                <span className="zap-split-label">Boris' Share: {borisWeight.toFixed(1)}</span>
+                <span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
+              </div>
+              <input
+                type="range"
+                min="0"
+                max="10"
+                step="0.1"
+                value={borisWeight}
+                onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
+                className="zap-split-slider"
+                list="boris-ticks"
+              />
+              <datalist id="boris-ticks">
+                <option value="5" label="5"></option>
+              </datalist>
+            </div>
+          </div>
+
+          <p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
+            Weights determine zap splits when highlighting nostr-native content. 
+            If the content has multiple authors, their share is divided proportionally.
+          </p>
+        </div>
+
+        {!isMobile && (
+          <img 
+            src="/zaps.svg" 
+            alt="Zap Splits" 
+            style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
+          />
+        )}
       </div>
     </div>
   )

src/components/SidebarHeader.tsx

@@ -1,28 +1,22 @@
 import React, { useState } from 'react'
 import { useNavigate } from 'react-router-dom'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faPlus, faNewspaper, faTimes, faBolt } from '@fortawesome/free-solid-svg-icons'
+import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faNewspaper, faTimes } from '@fortawesome/free-solid-svg-icons'
 import { Hooks } from 'applesauce-react'
 import { useEventModel } from 'applesauce-react/hooks'
 import { Models } from 'applesauce-core'
 import { Accounts } from 'applesauce-accounts'
-import { RelayPool } from 'applesauce-relay'
 import IconButton from './IconButton'
-import AddBookmarkModal from './AddBookmarkModal'
-import { createWebBookmark } from '../services/webBookmarkService'
-import { RELAYS } from '../config/relays'
 
 interface SidebarHeaderProps {
   onToggleCollapse: () => void
   onLogout: () => void
   onOpenSettings: () => void
-  relayPool: RelayPool | null
   isMobile?: boolean
 }
 
-const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, relayPool, isMobile = false }) => {
+const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, isMobile = false }) => {
   const [isConnecting, setIsConnecting] = useState(false)
-  const [showAddModal, setShowAddModal] = useState(false)
   const navigate = useNavigate()
   const activeAccount = Hooks.useActiveAccount()
   const accountManager = Hooks.useAccountManager()
@@ -54,14 +48,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
     return `${activeAccount.pubkey.slice(0, 8)}...${activeAccount.pubkey.slice(-8)}`
   }
 
-  const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
-    if (!activeAccount || !relayPool) {
-      throw new Error('Please login to create bookmarks')
-    }
-
-    await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
-  }
-
   const profileImage = getProfileImage()
 
   return (
@@ -117,13 +103,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
           ariaLabel="Explore"
           variant="ghost"
         />
-        <IconButton
-          icon={faBolt}
-          onClick={() => navigate('/support')}
-          title="Support"
-          ariaLabel="Support"
-          variant="ghost"
-        />
         <IconButton
           icon={faGear}
           onClick={onOpenSettings}
@@ -131,15 +110,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
           ariaLabel="Settings"
           variant="ghost"
         />
-        {activeAccount && (
-          <IconButton
-            icon={faPlus}
-            onClick={() => setShowAddModal(true)}
-            title="Add bookmark"
-            ariaLabel="Add bookmark"
-            variant="ghost"
-          />
-        )}
         {activeAccount ? (
           <IconButton
             icon={faRightFromBracket}
@@ -159,12 +129,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
         )}
         </div>
       </div>
-      {showAddModal && (
-        <AddBookmarkModal
-          onClose={() => setShowAddModal(false)}
-          onSave={handleSaveBookmark}
-        />
-      )}
     </>
   )
 }

src/components/Support.tsx

@@ -2,7 +2,7 @@ import React, { useEffect, useState } from 'react'
 import { RelayPool } from 'applesauce-relay'
 import { IEventStore } from 'applesauce-core'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
-import { faBolt, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
+import { faHeart, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
 import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
 import { fetchProfiles } from '../services/profileService'
 import { UserSettings } from '../services/settingsService'
@@ -207,7 +207,7 @@ const SupporterCard: React.FC<SupporterCardProps> = ({ supporter, isWhale }) =>
             className="absolute -bottom-1 -right-1 w-8 h-8 bg-yellow-400 rounded-full flex items-center justify-center border-2"
             style={{ borderColor: 'var(--color-bg)' }}
           >
-            <FontAwesomeIcon icon={faBolt} className="text-zinc-900 text-sm" />
+            <FontAwesomeIcon icon={faHeart} className="text-zinc-900 text-sm" />
           </div>
         )}
       </div>

src/components/ThreePaneLayout.tsx

@@ -1,4 +1,4 @@
-import React, { useEffect, useRef } from 'react'
+import React, { useEffect, useRef, useState } from 'react'
 import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
 import { faBookmark, faHighlighter } from '@fortawesome/free-solid-svg-icons'
 import { RelayPool } from 'applesauce-relay'
@@ -105,13 +105,33 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
   const highlightsRef = useRef<HTMLDivElement>(null)
   const mainPaneRef = useRef<HTMLDivElement>(null)
   
-  // Detect scroll direction to hide/show mobile buttons
-  // Now using window scroll (document scroll) instead of pane scroll
+  // Detect scroll direction and position to hide/show mobile buttons
+  // Only hide on scroll down when viewing article content
+  const isViewingArticle = !!(props.selectedUrl)
   const scrollDirection = useScrollDirection({ 
     threshold: 10, 
-    enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed
+    enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && isViewingArticle
   })
-  const showMobileButtons = scrollDirection !== 'down'
+  
+  // Track if we're at the top of the page
+  const [isAtTop, setIsAtTop] = useState(true)
+  useEffect(() => {
+    if (!isMobile || !isViewingArticle) return
+    
+    const handleScroll = () => {
+      setIsAtTop(window.scrollY <= 10)
+    }
+    
+    handleScroll() // Check initial position
+    window.addEventListener('scroll', handleScroll, { passive: true })
+    
+    return () => window.removeEventListener('scroll', handleScroll)
+  }, [isMobile, isViewingArticle])
+  
+  // Bookmark button: hide only when scrolling down
+  const showBookmarkButton = scrollDirection !== 'down'
+  // Highlights button: hide when scrolling down OR at the top
+  const showHighlightsButton = scrollDirection !== 'down' && !isAtTop
 
   // Lock body scroll when mobile sidebar or highlights is open
   useEffect(() => {
@@ -229,11 +249,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
 
   return (
     <>
-      {/* Mobile bookmark button - only show when viewing article or explore (not on settings/me/profile/support) */}
-      {isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showMe && !props.showProfile && !props.showSupport && (
+      {/* Mobile bookmark button - always show except on settings page */}
+      {isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && (
         <button
           className={`fixed z-[900] bg-zinc-800/70 border border-zinc-600/40 rounded-lg text-zinc-200 flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
-            showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
+            showBookmarkButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
           }`}
           style={{
             top: 'calc(1rem + env(safe-area-inset-top))',
@@ -249,11 +269,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
         </button>
       )}
 
-      {/* Mobile highlights button - only show when viewing article or explore (not on settings/me/profile/support) */}
-      {isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showMe && !props.showProfile && !props.showSupport && (
+      {/* Mobile highlights button - only show when viewing article content */}
+      {isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && isViewingArticle && (
         <button
           className={`fixed z-[900] border border-zinc-600/40 rounded-lg flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
-            showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
+            showHighlightsButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
           }`}
           style={{ 
             top: 'calc(1rem + env(safe-area-inset-top))',
@@ -304,6 +324,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
             loading={props.bookmarksLoading}
             relayPool={props.relayPool}
             isMobile={isMobile}
+            settings={props.settings}
           />
         </div>
         <div 
@@ -402,7 +423,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
       )}
       <RelayStatusIndicator 
         relayPool={props.relayPool}
-        showOnMobile={showMobileButtons}
+        showOnMobile={showBookmarkButton}
       />
       {props.toastMessage && (
         <Toast

src/components/VersionFooter.tsx

@@ -0,0 +1,32 @@
+/* global __APP_VERSION__, __GIT_COMMIT__, __GIT_COMMIT_URL__, __RELEASE_URL__ */
+import React from 'react'
+
+const VersionFooter: React.FC = () => {
+  return (
+    <div className="text-xs opacity-60 mt-4 px-4 pb-3 select-text">
+      <span>
+        {typeof __RELEASE_URL__ !== 'undefined' && __RELEASE_URL__ ? (
+          <a href={__RELEASE_URL__} target="_blank" rel="noopener noreferrer">
+            Version {typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}
+          </a>
+        ) : (
+          `Version ${typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}`
+        )}
+      </span>
+      {typeof __GIT_COMMIT__ !== 'undefined' && __GIT_COMMIT__ ? (
+        <span>
+          {' '}·{' '}
+          {typeof __GIT_COMMIT_URL__ !== 'undefined' && __GIT_COMMIT_URL__ ? (
+            <a href={__GIT_COMMIT_URL__} target="_blank" rel="noopener noreferrer">
+              <code>{__GIT_COMMIT__.slice(0, 7)}</code>
+            </a>
+          ) : (
+            <code>{__GIT_COMMIT__.slice(0, 7)}</code>
+          )}
+        </span>
+      ) : null}
+    </div>
+  )
+}
+
+export default VersionFooter

src/config/kinds.ts

@@ -0,0 +1,15 @@
+// Nostr event kinds used throughout the application
+export const KINDS = {
+  Highlights: 9802,              // NIP-?? user highlights
+  BlogPost: 30023,               // NIP-23 long-form article
+  AppData: 30078,                // NIP-78 application data (reading positions)
+  List: 30001,                   // NIP-51 list (addressable)
+  ListReplaceable: 30003,        // NIP-51 replaceable list
+  ListSimple: 10003,             // NIP-51 simple list
+  WebBookmark: 39701,            // NIP-B0 web bookmark
+  ReactionToEvent: 7,            // emoji reaction to event (used for mark-as-read)
+  ReactionToUrl: 17              // emoji reaction to URL (used for mark-as-read)
+} as const
+
+export type KindValue = typeof KINDS[keyof typeof KINDS]
+

src/config/nostrGateways.ts

@@ -2,20 +2,21 @@
  * Nostr gateway URLs for viewing events and profiles on the web
  */
 
-export const NOSTR_GATEWAY = 'https://ants.sh' as const
+export const NOSTR_GATEWAY = 'https://nostr.at' as const
+export const SEARCH_PORTAL = 'https://ants.sh' as const
 
 /**
  * Get a profile URL on the gateway
  */
 export function getProfileUrl(npub: string): string {
-  return `${NOSTR_GATEWAY}/p/${npub}`
+  return `${NOSTR_GATEWAY}/${npub}`
 }
 
 /**
  * Get an event URL on the gateway
  */
 export function getEventUrl(nevent: string): string {
-  return `${NOSTR_GATEWAY}/e/${nevent}`
+  return `${NOSTR_GATEWAY}/${nevent}`
 }
 
 /**
@@ -23,12 +24,14 @@ export function getEventUrl(nevent: string): string {
  * Automatically detects if it's a profile (npub/nprofile) or event (note/nevent/naddr)
  */
 export function getNostrUrl(identifier: string): string {
-  // Check the prefix to determine if it's a profile or event
-  if (identifier.startsWith('npub') || identifier.startsWith('nprofile')) {
-    return `${NOSTR_GATEWAY}/p/${identifier}`
-  }
-  
-  // Everything else (note, nevent, naddr) goes to /e/
-  return `${NOSTR_GATEWAY}/e/${identifier}`
+  // nostr.at uses simple /{identifier} format for all types
+  return `${NOSTR_GATEWAY}/${identifier}`
+}
+
+/**
+ * Get a search portal URL with a query
+ */
+export function getSearchUrl(query: string): string {
+  return `${SEARCH_PORTAL}/?q=${encodeURIComponent(query)}`
 }
 

src/config/relays.ts

@@ -7,6 +7,7 @@
 export const RELAYS = [
   'ws://localhost:10547',
   'ws://localhost:4869',
+  'wss://relay.nsec.app',
   'wss://relay.damus.io',
   'wss://nos.lol',
   'wss://relay.nostr.band',

src/hooks/useAdaptiveTextColor.ts

@@ -0,0 +1,90 @@
+import { useEffect, useState } from 'react'
+import { FastAverageColor } from 'fast-average-color'
+
+interface AdaptiveTextColor {
+  textColor: string
+}
+
+/**
+ * Hook to determine optimal text color based on image background
+ * Samples the top-right corner of the image to ensure publication date is readable
+ * 
+ * @param imageUrl - The URL of the image to analyze
+ * @returns Object containing textColor for optimal contrast
+ */
+export function useAdaptiveTextColor(imageUrl: string | undefined): AdaptiveTextColor {
+  const [colors, setColors] = useState<AdaptiveTextColor>({
+    textColor: '#ffffff'
+  })
+
+  useEffect(() => {
+    if (!imageUrl) {
+      // No image, use default white text
+      setColors({
+        textColor: '#ffffff'
+      })
+      return
+    }
+
+    const fac = new FastAverageColor()
+    const img = new Image()
+    img.crossOrigin = 'anonymous'
+    
+    img.onload = () => {
+      try {
+        const width = img.naturalWidth
+        const height = img.naturalHeight
+        
+        // Sample top-right corner (last 25% width, first 25% height)
+        const color = fac.getColor(img, {
+          left: Math.floor(width * 0.75),
+          top: 0,
+          width: Math.floor(width * 0.25),
+          height: Math.floor(height * 0.25)
+        })
+        
+        console.log('Adaptive color detected:', {
+          hex: color.hex,
+          rgb: color.rgb,
+          isLight: color.isLight,
+          isDark: color.isDark
+        })
+        
+        // Use library's built-in isLight check for optimal contrast
+        if (color.isLight) {
+          console.log('Light background detected, using black text')
+          setColors({
+            textColor: '#000000'
+          })
+        } else {
+          console.log('Dark background detected, using white text')
+          setColors({
+            textColor: '#ffffff'
+          })
+        }
+      } catch (error) {
+        // Fallback to default on error
+        console.error('Error analyzing image color:', error)
+        setColors({
+          textColor: '#ffffff'
+        })
+      }
+    }
+    
+    img.onerror = () => {
+      // Fallback to default if image fails to load
+      setColors({
+        textColor: '#ffffff'
+      })
+    }
+    
+    img.src = imageUrl
+
+    return () => {
+      fac.destroy()
+    }
+  }, [imageUrl])
+
+  return colors
+}
+

src/hooks/useBookmarksData.ts

@@ -13,6 +13,7 @@ interface UseBookmarksDataParams {
   activeAccount: IAccount | undefined
   accountManager: AccountManager
   naddr?: string
+  externalUrl?: string
   currentArticleCoordinate?: string
   currentArticleEventId?: string
   settings?: UserSettings
@@ -23,6 +24,7 @@ export const useBookmarksData = ({
   activeAccount,
   accountManager,
   naddr,
+  externalUrl,
   currentArticleCoordinate,
   currentArticleEventId,
   settings
@@ -115,11 +117,13 @@ export const useBookmarksData = ({
   // Fetch highlights/contacts independently to avoid disturbing bookmarks
   useEffect(() => {
     if (!relayPool || !activeAccount) return
-    if (!naddr) {
+    // Only fetch general highlights when not viewing an article (naddr) or external URL
+    // External URLs have their highlights fetched by useExternalUrlLoader
+    if (!naddr && !externalUrl) {
       handleFetchHighlights()
     }
     handleFetchContacts()
-  }, [relayPool, activeAccount, naddr, handleFetchHighlights, handleFetchContacts])
+  }, [relayPool, activeAccount, naddr, externalUrl, handleFetchHighlights, handleFetchContacts])
 
   return {
     bookmarks,

src/hooks/useExternalUrlLoader.ts

@@ -71,7 +71,7 @@ export function useExternalUrlLoader({
           // Check if fetchHighlightsForUrl exists, otherwise skip
           if (typeof fetchHighlightsForUrl === 'function') {
             const seen = new Set<string>()
-            const highlightsList = await fetchHighlightsForUrl(
+            await fetchHighlightsForUrl(
               relayPool,
               url,
               (highlight) => {
@@ -84,9 +84,9 @@ export function useExternalUrlLoader({
                 })
               }
             )
-            // Ensure final list is sorted and contains all items
-            setHighlights(highlightsList.sort((a, b) => b.created_at - a.created_at))
-            console.log(`📌 Found ${highlightsList.length} highlights for URL`)
+            // Highlights are already set via the streaming callback
+            // No need to set them again as that could cause a flash/disappearance
+            console.log(`📌 Finished fetching highlights for URL`)
           } else {
             console.log('📌 Highlight fetching for URLs not yet implemented')
           }

src/hooks/useHighlightCreation.ts

@@ -9,6 +9,7 @@ import { ReadableContent } from '../services/readerService'
 import { createHighlight } from '../services/highlightCreationService'
 import { HighlightButtonRef } from '../components/HighlightButton'
 import { UserSettings } from '../services/settingsService'
+import { useToast } from './useToast'
 
 interface UseHighlightCreationParams {
   activeAccount: IAccount | undefined
@@ -32,6 +33,7 @@ export const useHighlightCreation = ({
   settings
 }: UseHighlightCreationParams) => {
   const highlightButtonRef = useRef<HighlightButtonRef>(null)
+  const { showToast } = useToast()
 
   const handleTextSelection = useCallback((text: string) => {
     highlightButtonRef.current?.updateSelection(text)
@@ -92,10 +94,19 @@ export const useHighlightCreation = ({
       })
     } catch (error) {
       console.error('❌ Failed to create highlight:', error)
+      
+      // Show user-friendly error messages
+      const errorMessage = error instanceof Error ? error.message : 'Failed to create highlight'
+      if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
+        showToast('Reconnect bunker and approve signing permissions to create highlights')
+      } else {
+        showToast(`Failed to create highlight: ${errorMessage}`)
+      }
+      
       // Re-throw to allow parent to handle
       throw error
     }
-  }, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings])
+  }, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings, showToast])
 
   return {
     highlightButtonRef,

src/hooks/useReadingPosition.ts

@@ -1,21 +1,72 @@
-import { useEffect, useRef, useState } from 'react'
+import { useEffect, useRef, useState, useCallback } from 'react'
 
 interface UseReadingPositionOptions {
   enabled?: boolean
   onPositionChange?: (position: number) => void
   onReadingComplete?: () => void
   readingCompleteThreshold?: number // Default 0.9 (90%)
+  syncEnabled?: boolean // Whether to sync positions to Nostr
+  onSave?: (position: number) => void // Callback for saving position
+  autoSaveInterval?: number // Auto-save interval in ms (default 5000)
 }
 
 export const useReadingPosition = ({
   enabled = true,
   onPositionChange,
   onReadingComplete,
-  readingCompleteThreshold = 0.9
+  readingCompleteThreshold = 0.9,
+  syncEnabled = false,
+  onSave,
+  autoSaveInterval = 5000
 }: UseReadingPositionOptions = {}) => {
   const [position, setPosition] = useState(0)
   const [isReadingComplete, setIsReadingComplete] = useState(false)
   const hasTriggeredComplete = useRef(false)
+  const lastSavedPosition = useRef(0)
+  const saveTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
+
+  // Debounced save function
+  const scheduleSave = useCallback((currentPosition: number) => {
+    if (!syncEnabled || !onSave) return
+    
+    // Don't save if position is too low (< 5%)
+    if (currentPosition < 0.05) return
+    
+    // Don't save if position hasn't changed significantly (less than 1%)
+    // But always save if we've reached 100% (completion)
+    const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= 0.01
+    const hasReachedCompletion = currentPosition === 1 && lastSavedPosition.current < 1
+    
+    if (!hasSignificantChange && !hasReachedCompletion) return
+
+    // Clear existing timer
+    if (saveTimerRef.current) {
+      clearTimeout(saveTimerRef.current)
+    }
+
+    // Schedule new save
+    saveTimerRef.current = setTimeout(() => {
+      lastSavedPosition.current = currentPosition
+      onSave(currentPosition)
+    }, autoSaveInterval)
+  }, [syncEnabled, onSave, autoSaveInterval])
+
+  // Immediate save function
+  const saveNow = useCallback(() => {
+    if (!syncEnabled || !onSave) return
+    
+    // Cancel any pending saves
+    if (saveTimerRef.current) {
+      clearTimeout(saveTimerRef.current)
+      saveTimerRef.current = null
+    }
+
+    // Save if position is meaningful (>= 5%)
+    if (position >= 0.05) {
+      lastSavedPosition.current = position
+      onSave(position)
+    }
+  }, [syncEnabled, onSave, position])
 
   useEffect(() => {
     if (!enabled) return
@@ -30,12 +81,20 @@ export const useReadingPosition = ({
       const documentHeight = document.documentElement.scrollHeight
       
       // Calculate position based on how much of the content has been scrolled through
-      const scrollProgress = Math.min(scrollTop / (documentHeight - windowHeight), 1)
-      const clampedProgress = Math.max(0, Math.min(1, scrollProgress))
+      // Add a small threshold (5px) to account for rounding and make it easier to reach 100%
+      const maxScroll = documentHeight - windowHeight
+      const scrollProgress = maxScroll > 0 ? scrollTop / maxScroll : 0
+      
+      // If we're within 5px of the bottom, consider it 100%
+      const isAtBottom = scrollTop + windowHeight >= documentHeight - 5
+      const clampedProgress = isAtBottom ? 1 : Math.max(0, Math.min(1, scrollProgress))
       
       setPosition(clampedProgress)
       onPositionChange?.(clampedProgress)
 
+      // Schedule auto-save if sync is enabled
+      scheduleSave(clampedProgress)
+
       // Check if reading is complete
       if (clampedProgress >= readingCompleteThreshold && !hasTriggeredComplete.current) {
         setIsReadingComplete(true)
@@ -54,8 +113,13 @@ export const useReadingPosition = ({
     return () => {
       window.removeEventListener('scroll', handleScroll)
       window.removeEventListener('resize', handleScroll)
+      
+      // Clear save timer on unmount
+      if (saveTimerRef.current) {
+        clearTimeout(saveTimerRef.current)
+      }
     }
-  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold])
+  }, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave])
 
   // Reset reading complete state when enabled changes
   useEffect(() => {
@@ -68,6 +132,7 @@ export const useReadingPosition = ({
   return {
     position,
     isReadingComplete,
-    progressPercentage: Math.round(position * 100)
+    progressPercentage: Math.round(position * 100),
+    saveNow
   }
 }

src/hooks/useSettings.ts

@@ -73,6 +73,9 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
       root.setProperty('--highlight-color-friends', settings.highlightColorFriends || '#f97316')
       root.setProperty('--highlight-color-nostrverse', settings.highlightColorNostrverse || '#9333ea')
       
+      // Set paragraph alignment
+      root.setProperty('--paragraph-alignment', settings.paragraphAlignment || 'justify')
+      
       console.log('✅ All styles applied')
     }
     

src/services/bookmarkEvents.ts

@@ -19,7 +19,7 @@ export function dedupeNip51Events(events: NostrEvent[]): NostrEvent[] {
   const webBookmarks = unique.filter(e => e.kind === 39701)
 
   const bookmarkLists = unique
-    .filter(e => e.kind === 10003 || e.kind === 30001)
+    .filter(e => e.kind === 10003 || e.kind === 30003 || e.kind === 30001)
     .sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
   const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
 

src/services/bookmarkHelpers.ts

@@ -16,11 +16,24 @@ export interface BookmarkData {
   tags?: string[][]
 }
 
+export interface AddressPointer {
+  kind: number
+  pubkey: string
+  identifier: string
+  relays?: string[]
+}
+
+export interface EventPointer {
+  id: string
+  relays?: string[]
+  author?: string
+}
+
 export interface ApplesauceBookmarks {
-  notes?: BookmarkData[]
-  articles?: BookmarkData[]
-  hashtags?: BookmarkData[]
-  urls?: BookmarkData[]
+  notes?: EventPointer[]
+  articles?: AddressPointer[]
+  hashtags?: string[]
+  urls?: string[]
 }
 
 export interface AccountWithExtension {
@@ -55,25 +68,83 @@ export const processApplesauceBookmarks = (
 
   if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
     const applesauceBookmarks = bookmarks as ApplesauceBookmarks
-    const allItems: BookmarkData[] = []
-    if (applesauceBookmarks.notes) allItems.push(...applesauceBookmarks.notes)
-    if (applesauceBookmarks.articles) allItems.push(...applesauceBookmarks.articles)
-    if (applesauceBookmarks.hashtags) allItems.push(...applesauceBookmarks.hashtags)
-    if (applesauceBookmarks.urls) allItems.push(...applesauceBookmarks.urls)
+    const allItems: IndividualBookmark[] = []
+    
+    // Process notes (EventPointer[])
+    if (applesauceBookmarks.notes) {
+      applesauceBookmarks.notes.forEach((note: EventPointer) => {
+        allItems.push({
+          id: note.id,
+          content: '',
+          created_at: Math.floor(Date.now() / 1000),
+          pubkey: note.author || activeAccount.pubkey,
+          kind: 1, // Short note kind
+          tags: [],
+          parsedContent: undefined,
+          type: 'event' as const,
+          isPrivate,
+          added_at: Math.floor(Date.now() / 1000)
+        })
+      })
+    }
+    
+    // Process articles (AddressPointer[])
+    if (applesauceBookmarks.articles) {
+      applesauceBookmarks.articles.forEach((article: AddressPointer) => {
+        // Convert AddressPointer to coordinate format: kind:pubkey:identifier
+        const coordinate = `${article.kind}:${article.pubkey}:${article.identifier || ''}`
+        allItems.push({
+          id: coordinate,
+          content: '',
+          created_at: Math.floor(Date.now() / 1000),
+          pubkey: article.pubkey,
+          kind: article.kind, // Usually 30023 for long-form articles
+          tags: [],
+          parsedContent: undefined,
+          type: 'event' as const,
+          isPrivate,
+          added_at: Math.floor(Date.now() / 1000)
+        })
+      })
+    }
+    
+    // Process hashtags (string[])
+    if (applesauceBookmarks.hashtags) {
+      applesauceBookmarks.hashtags.forEach((hashtag: string) => {
+        allItems.push({
+          id: `hashtag-${hashtag}`,
+          content: `#${hashtag}`,
+          created_at: Math.floor(Date.now() / 1000),
+          pubkey: activeAccount.pubkey,
+          kind: 1,
+          tags: [['t', hashtag]],
+          parsedContent: undefined,
+          type: 'event' as const,
+          isPrivate,
+          added_at: Math.floor(Date.now() / 1000)
+        })
+      })
+    }
+    
+    // Process URLs (string[])
+    if (applesauceBookmarks.urls) {
+      applesauceBookmarks.urls.forEach((url: string) => {
+        allItems.push({
+          id: `url-${url}`,
+          content: url,
+          created_at: Math.floor(Date.now() / 1000),
+          pubkey: activeAccount.pubkey,
+          kind: 1,
+          tags: [['r', url]],
+          parsedContent: undefined,
+          type: 'event' as const,
+          isPrivate,
+          added_at: Math.floor(Date.now() / 1000)
+        })
+      })
+    }
+    
     return allItems
-      .filter((bookmark: BookmarkData) => bookmark.id) // Skip bookmarks without valid IDs
-      .map((bookmark: BookmarkData) => ({
-        id: bookmark.id!,
-        content: bookmark.content || '',
-        created_at: bookmark.created_at || Math.floor(Date.now() / 1000),
-        pubkey: activeAccount.pubkey,
-        kind: bookmark.kind || 30001,
-        tags: bookmark.tags || [],
-        parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
-        type: 'event' as const,
-        isPrivate,
-        added_at: bookmark.created_at || Math.floor(Date.now() / 1000)
-      }))
   }
 
   const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]

src/services/bookmarkProcessing.ts

@@ -11,6 +11,18 @@ type UnlockHiddenTagsFn = typeof Helpers.unlockHiddenTags
 type HiddenContentSigner = Parameters<UnlockHiddenTagsFn>[1]
 type UnlockMode = Parameters<UnlockHiddenTagsFn>[2]
 
+/**
+ * Wrap a decrypt promise with a timeout to prevent hanging (using 30s timeout for bunker)
+ */
+function withDecryptTimeout<T>(promise: Promise<T>, timeoutMs = 30000): Promise<T> {
+  return Promise.race([
+    promise,
+    new Promise<T>((_, reject) =>
+      setTimeout(() => reject(new Error(`Decrypt timeout after ${timeoutMs}ms`)), timeoutMs)
+    )
+  ])
+}
+
 export async function collectBookmarksFromEvents(
   bookmarkListEvents: NostrEvent[],
   activeAccount: ActiveAccount,
@@ -33,6 +45,12 @@ export async function collectBookmarksFromEvents(
     if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
     if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
 
+    // Extract the 'd' tag and metadata for bookmark sets (kind 30003)
+    const dTag = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] : undefined
+    const setTitle = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'title')?.[1] : undefined
+    const setDescription = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'description')?.[1] : undefined
+    const setImage = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'image')?.[1] : undefined
+
     // Handle web bookmarks (kind:39701) as individual bookmarks
     if (evt.kind === 39701) {
       publicItemsAll.push({
@@ -45,13 +63,27 @@ export async function collectBookmarksFromEvents(
         parsedContent: undefined,
         type: 'web' as const,
         isPrivate: false,
-        added_at: evt.created_at || Math.floor(Date.now() / 1000)
+        added_at: evt.created_at || Math.floor(Date.now() / 1000),
+        sourceKind: 39701,
+        setName: dTag,
+        setTitle,
+        setDescription,
+        setImage
       })
       continue
     }
 
     const pub = Helpers.getPublicBookmarks(evt)
-    publicItemsAll.push(...processApplesauceBookmarks(pub, activeAccount, false))
+    publicItemsAll.push(
+      ...processApplesauceBookmarks(pub, activeAccount, false).map(i => ({
+        ...i,
+        sourceKind: evt.kind,
+        setName: dTag,
+        setTitle,
+        setDescription,
+        setImage
+      }))
+    )
 
     try {
       if (Helpers.hasHiddenTags(evt) && !Helpers.isHiddenTagsUnlocked(evt) && signerCandidate) {
@@ -60,7 +92,8 @@ export async function collectBookmarksFromEvents(
         } catch {
           try {
             await Helpers.unlockHiddenTags(evt, signerCandidate as HiddenContentSigner, 'nip44' as UnlockMode)
-          } catch {
+          } catch (err) {
+          console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
             // ignore
           }
         }
@@ -68,24 +101,26 @@ export async function collectBookmarksFromEvents(
         let decryptedContent: string | undefined
         try {
           if (hasNip44Decrypt(signerCandidate)) {
-            decryptedContent = await (signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
+            decryptedContent = await withDecryptTimeout((signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
               evt.pubkey,
               evt.content
-            )
+            ))
           }
-        } catch {
+        } catch (err) {
+          console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
           // ignore
         }
 
         if (!decryptedContent) {
           try {
             if (hasNip04Decrypt(signerCandidate)) {
-              decryptedContent = await (signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
+              decryptedContent = await withDecryptTimeout((signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
                 evt.pubkey,
                 evt.content
-              )
+              ))
             }
-          } catch {
+          } catch (err) {
+          console.log("[bunker] ❌ nip04.decrypt failed:", err instanceof Error ? err.message : String(err))
             // ignore
           }
         }
@@ -94,11 +129,20 @@ export async function collectBookmarksFromEvents(
           try {
             const hiddenTags = JSON.parse(decryptedContent) as string[][]
             const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
-            privateItemsAll.push(...processApplesauceBookmarks(manualPrivate, activeAccount, true))
+            privateItemsAll.push(
+              ...processApplesauceBookmarks(manualPrivate, activeAccount, true).map(i => ({
+                ...i,
+                sourceKind: evt.kind,
+                setName: dTag,
+                setTitle,
+                setDescription,
+                setImage
+              }))
+            )
             Reflect.set(evt, BookmarkHiddenSymbol, manualPrivate)
             Reflect.set(evt, 'EncryptedContentSymbol', decryptedContent)
             // Don't set latestContent to decrypted JSON - it's not user-facing content
-          } catch {
+          } catch (err) {
             // ignore
           }
         }
@@ -106,7 +150,16 @@ export async function collectBookmarksFromEvents(
 
       const priv = Helpers.getHiddenBookmarks(evt)
       if (priv) {
-        privateItemsAll.push(...processApplesauceBookmarks(priv, activeAccount, true))
+        privateItemsAll.push(
+          ...processApplesauceBookmarks(priv, activeAccount, true).map(i => ({
+            ...i,
+            sourceKind: evt.kind,
+            setName: dTag,
+            setTitle,
+            setDescription,
+            setImage
+          }))
+        )
       }
     } catch {
       // ignore individual event failures

src/services/bookmarkService.ts

@@ -5,7 +5,6 @@ import {
   dedupeNip51Events,
   hydrateItems,
   isAccountWithExtension,
-  isHexId,
   hasNip04Decrypt,
   hasNip44Decrypt,
   dedupeBookmarksById,
@@ -16,6 +15,7 @@ import { collectBookmarksFromEvents } from './bookmarkProcessing.ts'
 import { UserSettings } from './settingsService'
 import { rebroadcastEvents } from './rebroadcastService'
 import { queryEvents } from './dataFetch'
+import { KINDS } from '../config/kinds'
 
 
 
@@ -35,7 +35,7 @@ export const fetchBookmarks = async (
 
     const rawEvents = await queryEvents(
       relayPool,
-      { kinds: [10003, 30003, 30001, 39701], authors: [activeAccount.pubkey] },
+      { kinds: [KINDS.ListSimple, KINDS.ListReplaceable, KINDS.List, KINDS.WebBookmark], authors: [activeAccount.pubkey] },
       {}
     )
     console.log('📊 Raw events fetched:', rawEvents.length, 'events')
@@ -57,18 +57,35 @@ export const fetchBookmarks = async (
     rawEvents.forEach((evt, i) => {
       const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
       const contentPreview = evt.content ? evt.content.slice(0, 50) + (evt.content.length > 50 ? '...' : '') : 'empty'
-      console.log(`  Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, contentPreview=${contentPreview}`)
+      const eTags = evt.tags?.filter((t: string[]) => t[0] === 'e').length || 0
+      const aTags = evt.tags?.filter((t: string[]) => t[0] === 'a').length || 0
+      console.log(`  Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, eTags=${eTags}, aTags=${aTags}, contentPreview=${contentPreview}`)
     })
 
     const bookmarkListEvents = dedupeNip51Events(rawEvents)
     console.log('📋 After deduplication:', bookmarkListEvents.length, 'bookmark events')
+    
+    // Log which events made it through deduplication
+    bookmarkListEvents.forEach((evt, i) => {
+      const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
+      console.log(`  Dedupe ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag="${dTag}"`)
+    })
+    
+    // Check specifically for Primal's "reads" list
+    const primalReads = rawEvents.find(e => e.kind === KINDS.ListSimple && e.tags?.find((t: string[]) => t[0] === 'd' && t[1] === 'reads'))
+    if (primalReads) {
+      console.log('✅ Found Primal reads list:', primalReads.id.slice(0, 8))
+    } else {
+      console.log('❌ No Primal reads list found (kind:10003 with d="reads")')
+    }
+    
     if (bookmarkListEvents.length === 0) {
       // Keep existing bookmarks visible; do not clear list if nothing new found
       return
     }
     // Aggregate across events
     const maybeAccount = activeAccount as AccountWithExtension
-    console.log('🔐 Account object:', {
+    console.log('[bunker] 🔐 Account object:', {
       hasSignEvent: typeof maybeAccount?.signEvent === 'function',
       hasSigner: !!maybeAccount?.signer,
       accountType: typeof maybeAccount,
@@ -85,32 +102,107 @@ export const fetchBookmarks = async (
       signerCandidate = maybeAccount.signer
     }
 
-    console.log('🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
+    console.log('[bunker] 🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
     if (signerCandidate) {
-      console.log('🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
-      console.log('🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
+      console.log('[bunker] 🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
+      console.log('[bunker] 🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
     }
-    const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
+    
+    // Debug relay connectivity for bunker relays
+    try {
+      const urls = Array.from(relayPool.relays.values()).map(r => ({ url: r.url, connected: (r as unknown as { connected?: boolean }).connected }))
+      console.log('[bunker] Relay connections:', urls)
+    } catch (err) { console.warn('[bunker] Failed to read relay connections', err) }
+
+const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
       bookmarkListEvents,
       activeAccount,
       signerCandidate
     )
 
     const allItems = [...publicItemsAll, ...privateItemsAll]
-    const noteIds = Array.from(new Set(allItems.map(i => i.id).filter(isHexId)))
-    let idToEvent: Map<string, NostrEvent> = new Map()
+    
+    // Separate hex IDs (regular events) from coordinates (addressable events)
+    const noteIds: string[] = []
+    const coordinates: string[] = []
+    
+    allItems.forEach(i => {
+      // Check if it's a hex ID (64 character hex string)
+      if (/^[0-9a-f]{64}$/i.test(i.id)) {
+        noteIds.push(i.id)
+      } else if (i.id.includes(':')) {
+        // Coordinate format: kind:pubkey:identifier
+        coordinates.push(i.id)
+      }
+    })
+    
+    const idToEvent: Map<string, NostrEvent> = new Map()
+    
+    // Fetch regular events by ID
     if (noteIds.length > 0) {
       try {
         const events = await queryEvents(
           relayPool,
-          { ids: noteIds },
+          { ids: Array.from(new Set(noteIds)) },
           { localTimeoutMs: 800, remoteTimeoutMs: 2500 }
         )
-        idToEvent = new Map(events.map((e: NostrEvent) => [e.id, e]))
+        events.forEach((e: NostrEvent) => {
+          idToEvent.set(e.id, e)
+          // Also store by coordinate if it's an addressable event
+          if (e.kind && e.kind >= 30000 && e.kind < 40000) {
+            const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
+            const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
+            idToEvent.set(coordinate, e)
+          }
+        })
       } catch (error) {
-        console.warn('Failed to fetch events for hydration:', error)
+        console.warn('Failed to fetch events by ID:', error)
       }
     }
+    
+    // Fetch addressable events by coordinates
+    if (coordinates.length > 0) {
+      try {
+        // Group by kind for more efficient querying
+        const byKind = new Map<number, Array<{ pubkey: string; identifier: string }>>()
+        
+        coordinates.forEach(coord => {
+          const parts = coord.split(':')
+          const kind = parseInt(parts[0])
+          const pubkey = parts[1]
+          const identifier = parts[2] || ''
+          
+          if (!byKind.has(kind)) {
+            byKind.set(kind, [])
+          }
+          byKind.get(kind)!.push({ pubkey, identifier })
+        })
+        
+        // Query each kind group
+        for (const [kind, items] of byKind.entries()) {
+          const authors = Array.from(new Set(items.map(i => i.pubkey)))
+          const identifiers = Array.from(new Set(items.map(i => i.identifier)))
+          
+          const events = await queryEvents(
+            relayPool,
+            { kinds: [kind], authors, '#d': identifiers },
+            { localTimeoutMs: 800, remoteTimeoutMs: 2500 }
+          )
+          
+          events.forEach((e: NostrEvent) => {
+            const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
+            const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
+            idToEvent.set(coordinate, e)
+            // Also store by event ID
+            idToEvent.set(e.id, e)
+          })
+        }
+      } catch (error) {
+        console.warn('Failed to fetch addressable events:', error)
+      }
+    }
+    
+    console.log(`📦 Hydration: fetched ${idToEvent.size} events for ${allItems.length} bookmarks (${noteIds.length} notes, ${coordinates.length} articles)`)
     const allBookmarks = dedupeBookmarksById([
       ...hydrateItems(publicItemsAll, idToEvent),
       ...hydrateItems(privateItemsAll, idToEvent)

src/services/exploreService.ts

@@ -2,6 +2,7 @@ import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { Helpers } from 'applesauce-core'
 import { queryEvents } from './dataFetch'
+import { KINDS } from '../config/kinds'
 
 const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
 
@@ -41,7 +42,7 @@ export const fetchBlogPostsFromAuthors = async (
 
     await queryEvents(
       relayPool,
-      { kinds: [30023], authors: pubkeys, limit: 100 },
+      { kinds: [KINDS.BlogPost], authors: pubkeys, limit: 100 },
       {
         relayUrls,
         onEvent: (event: NostrEvent) => {

src/services/highlightCreationService.ts

@@ -46,7 +46,8 @@ export async function createHighlight(
   }
 
   // Create EventFactory with the account as signer
-  const factory = new EventFactory({ signer: account })
+  console.log("[bunker] Creating EventFactory with signer:", { signerType: account.signer?.constructor?.name })
+  const factory = new EventFactory({ signer: account.signer })
 
   let blueprintSource: NostrEvent | AddressPointer | string
   let context: string | undefined
@@ -116,7 +117,9 @@ export async function createHighlight(
   }
 
   // Sign the event
+  console.log('[bunker] Signing highlight event...', { kind: highlightEvent.kind, tags: highlightEvent.tags.length })
   const signedEvent = await factory.sign(highlightEvent)
+  console.log('[bunker] ✅ Highlight signed successfully!', { id: signedEvent.id.slice(0, 8) })
 
   // Use unified write service to store and publish
   await publishEvent(relayPool, eventStore, signedEvent)

src/services/highlights/fetchByAuthor.ts

@@ -6,6 +6,7 @@ import { prioritizeLocalRelays, partitionRelays } from '../../utils/helpers'
 import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
 import { UserSettings } from '../settingsService'
 import { rebroadcastEvents } from '../rebroadcastService'
+import { KINDS } from '../../config/kinds'
 
 export const fetchHighlights = async (
   relayPool: RelayPool,
@@ -21,7 +22,7 @@ export const fetchHighlights = async (
     const seenIds = new Set<string>()
     const local$ = localRelays.length > 0
       ? relayPool
-          .req(localRelays, { kinds: [9802], authors: [pubkey] })
+          .req(localRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
           .pipe(
             onlyEvents(),
             tap((event: NostrEvent) => {
@@ -36,7 +37,7 @@ export const fetchHighlights = async (
       : new Observable<NostrEvent>((sub) => sub.complete())
     const remote$ = remoteRelays.length > 0
       ? relayPool
-          .req(remoteRelays, { kinds: [9802], authors: [pubkey] })
+          .req(remoteRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
           .pipe(
             onlyEvents(),
             tap((event: NostrEvent) => {

src/services/highlights/fetchForUrl.ts

@@ -14,10 +14,11 @@ export const fetchHighlightsForUrl = async (
   onHighlight?: (highlight: Highlight) => void,
   settings?: UserSettings
 ): Promise<Highlight[]> => {
+  const seenIds = new Set<string>()
+  const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
+  const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
+  
   try {
-    const seenIds = new Set<string>()
-    const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
-    const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
     const local$ = localRelaysUrl.length > 0
       ? relayPool
           .req(localRelaysUrl, { kinds: [9802], '#r': [url] })
@@ -45,11 +46,23 @@ export const fetchHighlightsForUrl = async (
           )
       : new Observable<NostrEvent>((sub) => sub.complete())
     const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
-    await rebroadcastEvents(rawEvents, relayPool, settings)
+    
+    console.log(`📌 Fetched ${rawEvents.length} highlight events for URL:`, url)
+    
+    // Rebroadcast events - but don't let errors here break the highlight display
+    try {
+      await rebroadcastEvents(rawEvents, relayPool, settings)
+    } catch (err) {
+      console.warn('Failed to rebroadcast highlight events:', err)
+    }
+    
     const uniqueEvents = dedupeHighlights(rawEvents)
     const highlights: Highlight[] = uniqueEvents.map(eventToHighlight)
     return sortHighlights(highlights)
-  } catch {
+  } catch (err) {
+    console.error('Error fetching highlights for URL:', err)
+    // Return highlights that were already streamed via callback
+    // Don't return empty array as that would clear already-displayed highlights
     return []
   }
 }

src/services/libraryService.ts

@@ -2,6 +2,7 @@ import { RelayPool } from 'applesauce-relay'
 import { NostrEvent } from 'nostr-tools'
 import { Helpers } from 'applesauce-core'
 import { RELAYS } from '../config/relays'
+import { KINDS } from '../config/kinds'
 import { MARK_AS_READ_EMOJI } from './reactionService'
 import { BlogPostPreview } from './exploreService'
 import { queryEvents } from './dataFetch'
@@ -29,8 +30,8 @@ export async function fetchReadArticles(
   try {
     // Fetch kind:7 and kind:17 reactions in parallel
     const [kind7Events, kind17Events] = await Promise.all([
-      queryEvents(relayPool, { kinds: [7], authors: [userPubkey] }, { relayUrls: RELAYS }),
-      queryEvents(relayPool, { kinds: [17], authors: [userPubkey] }, { relayUrls: RELAYS })
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }, { relayUrls: RELAYS }),
+      queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] }, { relayUrls: RELAYS })
     ])
 
     const readArticles: ReadArticle[] = []
@@ -102,7 +103,7 @@ export async function fetchReadArticlesWithData(
     
     // Filter to only nostr-native articles (kind 30023)
     const nostrArticles = readArticles.filter(
-      article => article.eventKind === 30023 && article.eventId
+      article => article.eventKind === KINDS.BlogPost && article.eventId
     )
 
     if (nostrArticles.length === 0) {
@@ -114,7 +115,7 @@ export async function fetchReadArticlesWithData(
     
     const articleEvents = await queryEvents(
       relayPool,
-      { kinds: [30023], ids: eventIds },
+      { kinds: [KINDS.BlogPost], ids: eventIds },
       { relayUrls: RELAYS }
     )
 

src/services/linksService.ts

@@ -0,0 +1,90 @@
+import { RelayPool } from 'applesauce-relay'
+import { fetchReadArticles } from './libraryService'
+import { queryEvents } from './dataFetch'
+import { RELAYS } from '../config/relays'
+import { KINDS } from '../config/kinds'
+import { ReadItem } from './readsService'
+import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
+import { mergeReadItem } from '../utils/readItemMerge'
+
+/**
+ * Fetches external URL links with reading progress from:
+ * - URLs with reading progress (kind:30078)
+ * - Manually marked as read URLs (kind:7, kind:17)
+ */
+export async function fetchLinks(
+  relayPool: RelayPool,
+  userPubkey: string,
+  onItem?: (item: ReadItem) => void
+): Promise<ReadItem[]> {
+  console.log('🔗 [Links] Fetching external links for user:', userPubkey.slice(0, 8))
+  
+  const linksMap = new Map<string, ReadItem>()
+  
+  // Helper to emit items as they're added/updated
+  const emitItem = (item: ReadItem) => {
+    if (onItem && mergeReadItem(linksMap, item)) {
+      onItem(linksMap.get(item.id)!)
+    } else if (!onItem) {
+      linksMap.set(item.id, item)
+    }
+  }
+  
+  try {
+    // Fetch all data sources in parallel
+    const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
+      queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
+      fetchReadArticles(relayPool, userPubkey)
+    ])
+
+    console.log('📊 [Links] Data fetched:', {
+      readingPositions: readingPositionEvents.length,
+      markedAsRead: markedAsReadArticles.length
+    })
+
+    // Process reading positions and emit external items
+    processReadingPositions(readingPositionEvents, linksMap)
+    if (onItem) {
+      linksMap.forEach(item => {
+        if (item.type === 'external') {
+          const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
+          if (hasProgress) emitItem(item)
+        }
+      })
+    }
+    
+    // Process marked-as-read and emit external items
+    processMarkedAsRead(markedAsReadArticles, linksMap)
+    if (onItem) {
+      linksMap.forEach(item => {
+        if (item.type === 'external') {
+          const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
+          if (hasProgress) emitItem(item)
+        }
+      })
+    }
+
+    // Filter for external URLs only with reading progress
+    const links = Array.from(linksMap.values())
+      .filter(item => {
+        // Only external URLs
+        if (item.type !== 'external') return false
+        
+        // Only include if there's reading progress or marked as read
+        const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
+        return hasProgress
+      })
+
+    // Apply common validation and sorting
+    const validLinks = filterValidItems(links)
+    const sortedLinks = sortByReadingActivity(validLinks)
+
+    console.log('✅ [Links] Processed', sortedLinks.length, 'total links')
+    return sortedLinks
+
+  } catch (error) {
+    console.error('Failed to fetch links:', error)
+    return []
+  }
+}
+

src/services/meCache.ts

@@ -1,11 +1,14 @@
 import { Highlight } from '../types/highlights'
 import { Bookmark } from '../types/bookmarks'
 import { BlogPostPreview } from './exploreService'
+import { ReadItem } from './readsService'
 
 export interface MeCache {
   highlights: Highlight[]
   bookmarks: Bookmark[]
   readArticles: BlogPostPreview[]
+  reads?: ReadItem[]
+  links?: ReadItem[]
   timestamp: number
 }
 

src/services/nostrConnect.ts

@@ -0,0 +1,26 @@
+import { NostrConnectSigner } from 'applesauce-signers'
+
+/**
+ * Get default NIP-46 permissions for bunker connections
+ * These permissions cover all event kinds and encryption/decryption operations Boris needs
+ */
+export function getDefaultBunkerPermissions(): string[] {
+  return [
+    // Signing permissions for event kinds we create
+    ...NostrConnectSigner.buildSigningPermissions([
+      0,      // Profile metadata
+      5,      // Event deletion
+      7,      // Reactions (nostr events)
+      17,     // Reactions (websites)
+      9802,   // Highlights
+      30078,  // Settings & reading positions
+      39701,  // Web bookmarks
+    ]),
+    // Encryption/decryption for hidden content
+    'nip04_encrypt',
+    'nip04_decrypt',
+    'nip44_encrypt',
+    'nip44_decrypt',
+  ]
+}
+

src/services/readingDataProcessor.ts

@@ -0,0 +1,147 @@
+import { NostrEvent } from 'nostr-tools'
+import { ReadItem } from './readsService'
+import { fallbackTitleFromUrl } from '../utils/readItemMerge'
+
+const READING_POSITION_PREFIX = 'boris:reading-position:'
+
+interface ReadArticle {
+  id: string
+  url?: string
+  eventId?: string
+  eventKind?: number
+  markedAt: number
+}
+
+/**
+ * Processes reading position events into ReadItems
+ */
+export function processReadingPositions(
+  events: NostrEvent[],
+  readsMap: Map<string, ReadItem>
+): void {
+  for (const event of events) {
+    const dTag = event.tags.find(t => t[0] === 'd')?.[1]
+    if (!dTag || !dTag.startsWith(READING_POSITION_PREFIX)) continue
+
+    const identifier = dTag.replace(READING_POSITION_PREFIX, '')
+    
+    try {
+      const positionData = JSON.parse(event.content)
+      const position = positionData.position
+      const timestamp = positionData.timestamp
+
+      let itemId: string
+      let itemUrl: string | undefined
+      let itemType: 'article' | 'external' = 'external'
+
+      // Check if it's a nostr article (naddr format)
+      if (identifier.startsWith('naddr1')) {
+        itemId = identifier
+        itemType = 'article'
+      } else {
+        // It's a base64url-encoded URL
+        try {
+          itemUrl = atob(identifier.replace(/-/g, '+').replace(/_/g, '/'))
+          itemId = itemUrl
+          itemType = 'external'
+        } catch (e) {
+          console.warn('Failed to decode URL identifier:', identifier)
+          continue
+        }
+      }
+
+      // Add or update the item
+      const existing = readsMap.get(itemId)
+      if (!existing || !existing.readingTimestamp || timestamp > existing.readingTimestamp) {
+        readsMap.set(itemId, {
+          ...existing,
+          id: itemId,
+          source: 'reading-progress',
+          type: itemType,
+          url: itemUrl,
+          readingProgress: position,
+          readingTimestamp: timestamp
+        })
+      }
+    } catch (error) {
+      console.warn('Failed to parse reading position:', error)
+    }
+  }
+}
+
+/**
+ * Processes marked-as-read articles into ReadItems
+ */
+export function processMarkedAsRead(
+  articles: ReadArticle[],
+  readsMap: Map<string, ReadItem>
+): void {
+  for (const article of articles) {
+    const existing = readsMap.get(article.id)
+    
+    if (article.eventId && article.eventKind === 30023) {
+      // Nostr article
+      readsMap.set(article.id, {
+        ...existing,
+        id: article.id,
+        source: 'marked-as-read',
+        type: 'article',
+        markedAsRead: true,
+        markedAt: article.markedAt,
+        readingTimestamp: existing?.readingTimestamp || article.markedAt
+      })
+    } else if (article.url) {
+      // External URL
+      readsMap.set(article.id, {
+        ...existing,
+        id: article.id,
+        source: 'marked-as-read',
+        type: 'external',
+        url: article.url,
+        markedAsRead: true,
+        markedAt: article.markedAt,
+        readingTimestamp: existing?.readingTimestamp || article.markedAt
+      })
+    }
+  }
+}
+
+/**
+ * Sorts ReadItems by most recent reading activity
+ */
+export function sortByReadingActivity(items: ReadItem[]): ReadItem[] {
+  return items.sort((a, b) => {
+    const timeA = a.readingTimestamp || a.markedAt || 0
+    const timeB = b.readingTimestamp || b.markedAt || 0
+    return timeB - timeA
+  })
+}
+
+/**
+ * Filters out items without timestamps and enriches external items with fallback titles
+ */
+export function filterValidItems(items: ReadItem[]): ReadItem[] {
+  return items
+    .filter(item => {
+      // Only include items that have a timestamp
+      const hasTimestamp = (item.readingTimestamp && item.readingTimestamp > 0) || 
+                          (item.markedAt && item.markedAt > 0)
+      if (!hasTimestamp) return false
+      
+      // For Nostr articles, we need the event to be valid
+      if (item.type === 'article' && !item.event) return false
+      
+      // For external URLs, we need at least a URL
+      if (item.type === 'external' && !item.url) return false
+      
+      return true
+    })
+    .map(item => {
+      // Add fallback title for external URLs without titles
+      if (item.type === 'external' && !item.title && item.url) {
+        return { ...item, title: fallbackTitleFromUrl(item.url) }
+      }
+      return item
+    })
+}
+

src/services/readingPositionService.ts

@@ -0,0 +1,196 @@
+import { IEventStore, mapEventsToStore } from 'applesauce-core'
+import { EventFactory } from 'applesauce-factory'
+import { RelayPool, onlyEvents } from 'applesauce-relay'
+import { NostrEvent } from 'nostr-tools'
+import { firstValueFrom } from 'rxjs'
+import { publishEvent } from './writeService'
+import { RELAYS } from '../config/relays'
+
+const APP_DATA_KIND = 30078 // NIP-78 Application Data
+const READING_POSITION_PREFIX = 'boris:reading-position:'
+
+export interface ReadingPosition {
+  position: number // 0-1 scroll progress
+  timestamp: number // Unix timestamp
+  scrollTop?: number // Optional: pixel position
+}
+
+// Helper to extract and parse reading position from an event
+function getReadingPositionContent(event: NostrEvent): ReadingPosition | undefined {
+  if (!event.content || event.content.length === 0) return undefined
+  try {
+    return JSON.parse(event.content) as ReadingPosition
+  } catch {
+    return undefined
+  }
+}
+
+/**
+ * Generate a unique identifier for an article
+ * For Nostr articles: use the naddr directly
+ * For external URLs: use base64url encoding of the URL
+ */
+export function generateArticleIdentifier(naddrOrUrl: string): string {
+  // If it starts with "nostr:", extract the naddr
+  if (naddrOrUrl.startsWith('nostr:')) {
+    return naddrOrUrl.replace('nostr:', '')
+  }
+  // For URLs, use base64url encoding (URL-safe)
+  return btoa(naddrOrUrl)
+    .replace(/\+/g, '-')
+    .replace(/\//g, '_')
+    .replace(/=+$/, '')
+}
+
+/**
+ * Save reading position to Nostr (Kind 30078)
+ */
+export async function saveReadingPosition(
+  relayPool: RelayPool,
+  eventStore: IEventStore,
+  factory: EventFactory,
+  articleIdentifier: string,
+  position: ReadingPosition
+): Promise<void> {
+  console.log('💾 [ReadingPosition] Saving position:', {
+    identifier: articleIdentifier.slice(0, 32) + '...',
+    position: position.position,
+    positionPercent: Math.round(position.position * 100) + '%',
+    timestamp: position.timestamp,
+    scrollTop: position.scrollTop
+  })
+
+  const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
+
+  const draft = await factory.create(async () => ({
+    kind: APP_DATA_KIND,
+    content: JSON.stringify(position),
+    tags: [
+      ['d', dTag],
+      ['client', 'boris']
+    ],
+    created_at: Math.floor(Date.now() / 1000)
+  }))
+
+  const signed = await factory.sign(draft)
+
+  // Use unified write service
+  await publishEvent(relayPool, eventStore, signed)
+
+  console.log('✅ [ReadingPosition] Position saved successfully, event ID:', signed.id.slice(0, 8))
+}
+
+/**
+ * Load reading position from Nostr
+ */
+export async function loadReadingPosition(
+  relayPool: RelayPool,
+  eventStore: IEventStore,
+  pubkey: string,
+  articleIdentifier: string
+): Promise<ReadingPosition | null> {
+  const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
+
+  console.log('📖 [ReadingPosition] Loading position:', {
+    pubkey: pubkey.slice(0, 8) + '...',
+    identifier: articleIdentifier.slice(0, 32) + '...',
+    dTag: dTag.slice(0, 50) + '...'
+  })
+
+  // First, check if we already have the position in the local event store
+  try {
+    const localEvent = await firstValueFrom(
+      eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
+    )
+    if (localEvent) {
+      const content = getReadingPositionContent(localEvent)
+      if (content) {
+        console.log('✅ [ReadingPosition] Loaded from local store:', {
+          position: content.position,
+          positionPercent: Math.round(content.position * 100) + '%',
+          timestamp: content.timestamp
+        })
+        
+        // Still fetch from relays in the background to get any updates
+        relayPool
+          .subscription(RELAYS, {
+            kinds: [APP_DATA_KIND],
+            authors: [pubkey],
+            '#d': [dTag]
+          })
+          .pipe(onlyEvents(), mapEventsToStore(eventStore))
+          .subscribe()
+        
+        return content
+      }
+    }
+  } catch (err) {
+    console.log('📭 No cached reading position found, fetching from relays...')
+  }
+
+  // If not in local store, fetch from relays
+  return new Promise((resolve) => {
+    let hasResolved = false
+    const timeout = setTimeout(() => {
+      if (!hasResolved) {
+        console.log('⏱️ Reading position load timeout - no position found')
+        hasResolved = true
+        resolve(null)
+      }
+    }, 3000) // Shorter timeout for reading positions
+
+    const sub = relayPool
+      .subscription(RELAYS, {
+        kinds: [APP_DATA_KIND],
+        authors: [pubkey],
+        '#d': [dTag]
+      })
+      .pipe(onlyEvents(), mapEventsToStore(eventStore))
+      .subscribe({
+        complete: async () => {
+          clearTimeout(timeout)
+          if (!hasResolved) {
+            hasResolved = true
+            try {
+              const event = await firstValueFrom(
+                eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
+              )
+              if (event) {
+                const content = getReadingPositionContent(event)
+                if (content) {
+                  console.log('✅ [ReadingPosition] Loaded from relays:', {
+                    position: content.position,
+                    positionPercent: Math.round(content.position * 100) + '%',
+                    timestamp: content.timestamp
+                  })
+                  resolve(content)
+                } else {
+                  console.log('⚠️ [ReadingPosition] Event found but no valid content')
+                  resolve(null)
+                }
+              } else {
+                console.log('📭 [ReadingPosition] No position found on relays')
+                resolve(null)
+              }
+            } catch (err) {
+              console.error('❌ Error loading reading position:', err)
+              resolve(null)
+            }
+          }
+        },
+        error: (err) => {
+          console.error('❌ Reading position subscription error:', err)
+          clearTimeout(timeout)
+          if (!hasResolved) {
+            hasResolved = true
+            resolve(null)
+          }
+        }
+      })
+
+    setTimeout(() => {
+      sub.unsubscribe()
+    }, 3000)
+  })
+}
+

src/services/readsService.ts

@@ -0,0 +1,197 @@
+import { RelayPool } from 'applesauce-relay'
+import { NostrEvent } from 'nostr-tools'
+import { Helpers } from 'applesauce-core'
+import { Bookmark } from '../types/bookmarks'
+import { fetchReadArticles } from './libraryService'
+import { queryEvents } from './dataFetch'
+import { RELAYS } from '../config/relays'
+import { KINDS } from '../config/kinds'
+import { classifyBookmarkType } from '../utils/bookmarkTypeClassifier'
+import { nip19 } from 'nostr-tools'
+import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
+import { mergeReadItem } from '../utils/readItemMerge'
+
+const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
+
+export interface ReadItem {
+  id: string // event ID or URL or coordinate
+  source: 'bookmark' | 'reading-progress' | 'marked-as-read'
+  type: 'article' | 'external' // article=kind:30023, external=URL
+  
+  // Article data
+  event?: NostrEvent
+  url?: string
+  title?: string
+  summary?: string
+  image?: string
+  published?: number
+  author?: string
+  
+  // Reading metadata
+  readingProgress?: number // 0-1
+  readingTimestamp?: number // Unix timestamp of last reading activity
+  markedAsRead?: boolean
+  markedAt?: number
+}
+
+/**
+ * Fetches all reads from multiple sources:
+ * - Bookmarked articles (kind:30023) and article/website URLs
+ * - Articles/URLs with reading progress (kind:30078)
+ * - Manually marked as read articles/URLs (kind:7, kind:17)
+ */
+export async function fetchAllReads(
+  relayPool: RelayPool,
+  userPubkey: string,
+  bookmarks: Bookmark[],
+  onItem?: (item: ReadItem) => void
+): Promise<ReadItem[]> {
+  console.log('📚 [Reads] Fetching all reads for user:', userPubkey.slice(0, 8))
+  
+  const readsMap = new Map<string, ReadItem>()
+  
+  // Helper to emit items as they're added/updated
+  const emitItem = (item: ReadItem) => {
+    if (onItem && mergeReadItem(readsMap, item)) {
+      onItem(readsMap.get(item.id)!)
+    } else if (!onItem) {
+      readsMap.set(item.id, item)
+    }
+  }
+  
+  try {
+    // Fetch all data sources in parallel
+    const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
+      queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
+      fetchReadArticles(relayPool, userPubkey)
+    ])
+
+    console.log('📊 [Reads] Data fetched:', {
+      readingPositions: readingPositionEvents.length,
+      markedAsRead: markedAsReadArticles.length,
+      bookmarks: bookmarks.length
+    })
+
+    // Process reading positions and emit items
+    processReadingPositions(readingPositionEvents, readsMap)
+    if (onItem) {
+      readsMap.forEach(item => {
+        if (item.type === 'article') onItem(item)
+      })
+    }
+    
+    // Process marked-as-read and emit items
+    processMarkedAsRead(markedAsReadArticles, readsMap)
+    if (onItem) {
+      readsMap.forEach(item => {
+        if (item.type === 'article') onItem(item)
+      })
+    }
+
+    // 3. Process bookmarked articles and article/website URLs
+    const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
+    
+    for (const bookmark of allBookmarks) {
+      const bookmarkType = classifyBookmarkType(bookmark)
+      
+      // Only include articles
+      if (bookmarkType === 'article') {
+        // Kind:30023 nostr article
+        const coordinate = bookmark.id // Already in coordinate format
+        const existing = readsMap.get(coordinate)
+        
+        if (!existing) {
+          const item: ReadItem = {
+            id: coordinate,
+            source: 'bookmark',
+            type: 'article',
+            readingProgress: 0,
+            readingTimestamp: bookmark.added_at || bookmark.created_at
+          }
+          readsMap.set(coordinate, item)
+          if (onItem) emitItem(item)
+        }
+      }
+    }
+
+    // 4. Fetch full event data for nostr articles
+    const articleCoordinates = Array.from(readsMap.values())
+      .filter(item => item.type === 'article' && !item.event)
+      .map(item => item.id)
+
+    if (articleCoordinates.length > 0) {
+      console.log('📖 [Reads] Fetching article events for', articleCoordinates.length, 'articles')
+      
+      // Parse coordinates and fetch events
+      const articlesToFetch: Array<{ pubkey: string; identifier: string }> = []
+      
+      for (const coord of articleCoordinates) {
+        try {
+          // Try to decode as naddr
+          if (coord.startsWith('naddr1')) {
+            const decoded = nip19.decode(coord)
+            if (decoded.type === 'naddr' && decoded.data.kind === KINDS.BlogPost) {
+              articlesToFetch.push({
+                pubkey: decoded.data.pubkey,
+                identifier: decoded.data.identifier || ''
+              })
+            }
+          } else {
+            // Try coordinate format (kind:pubkey:identifier)
+            const parts = coord.split(':')
+            if (parts.length === 3 && parseInt(parts[0]) === KINDS.BlogPost) {
+              articlesToFetch.push({
+                pubkey: parts[1],
+                identifier: parts[2]
+              })
+            }
+          }
+        } catch (e) {
+          console.warn('Failed to decode article coordinate:', coord)
+        }
+      }
+
+      if (articlesToFetch.length > 0) {
+        const authors = Array.from(new Set(articlesToFetch.map(a => a.pubkey)))
+        const identifiers = Array.from(new Set(articlesToFetch.map(a => a.identifier)))
+        
+        const events = await queryEvents(
+          relayPool,
+          { kinds: [KINDS.BlogPost], authors, '#d': identifiers },
+          { relayUrls: RELAYS }
+        )
+
+        // Merge event data into ReadItems and emit
+        for (const event of events) {
+          const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
+          const coordinate = `${KINDS.BlogPost}:${event.pubkey}:${dTag}`
+          
+          const item = readsMap.get(coordinate) || readsMap.get(event.id)
+          if (item) {
+            item.event = event
+            item.title = getArticleTitle(event) || 'Untitled'
+            item.summary = getArticleSummary(event)
+            item.image = getArticleImage(event)
+            item.published = getArticlePublished(event)
+            item.author = event.pubkey
+            if (onItem) emitItem(item)
+          }
+        }
+      }
+    }
+
+    // 5. Filter for Nostr articles only and apply common validation/sorting
+    const articles = Array.from(readsMap.values())
+      .filter(item => item.type === 'article')
+    
+    const validArticles = filterValidItems(articles)
+    const sortedReads = sortByReadingActivity(validArticles)
+
+    console.log('✅ [Reads] Processed', sortedReads.length, 'total reads')
+    return sortedReads
+
+  } catch (error) {
+    console.error('Failed to fetch all reads:', error)
+    return []
+  }
+}

src/services/settingsService.ts

@@ -52,6 +52,10 @@ export interface UserSettings {
   theme?: 'dark' | 'light' | 'system' // default: system
   darkColorTheme?: 'black' | 'midnight' | 'charcoal' // default: midnight
   lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
+  // Reading settings
+  paragraphAlignment?: 'left' | 'justify' // default: justify
+  // Reading position sync
+  syncReadingPosition?: boolean // default: false (opt-in)
 }
 
 export async function loadSettings(

src/services/writeService.ts

@@ -52,6 +52,11 @@ export async function publishEvent(
     })
     .catch((error) => {
       console.warn('⚠️ Failed to publish event to relays (event still saved locally):', error)
+      
+      // Surface common bunker signing errors for debugging
+      if (error instanceof Error && error.message.includes('permission')) {
+        console.warn('💡 Hint: This may be a bunker permission issue. Ensure your bunker connection has signing permissions.')
+      }
     })
 }
 

src/styles/components/cards.css

@@ -7,6 +7,27 @@
 .bookmark-content { color: var(--color-text); margin: 0.5rem 0; line-height: 1.4; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; }
 .bookmark-meta { color: var(--color-text-secondary); font-size: 0.9rem; margin-top: 0.5rem; }
 
+.bookmarks-section-title { 
+  font-size: 0.75rem !important; 
+  font-weight: 700 !important; 
+  text-transform: uppercase !important; 
+  letter-spacing: 0.05em !important; 
+  color: var(--color-text-muted) !important; 
+  padding: 1.5rem 0.5rem 0.375rem !important; 
+  margin: 0 !important; 
+  border-top: 1px solid rgba(255, 255, 255, 0.05); 
+}
+.bookmarks-section:first-of-type .bookmarks-section-title { 
+  border-top: none; 
+  padding-top: 0.5rem !important; 
+}
+.bookmark-section-action {
+  padding: 1.5rem 0.5rem 0.375rem;
+}
+.bookmarks-section:first-of-type .bookmark-section-action {
+  padding-top: 0.5rem;
+}
+
 .individual-bookmarks { margin: 1rem 0; }
 .individual-bookmarks h4 { margin: 0 0 1rem 0; font-size: 1rem; color: var(--color-text); }
 
@@ -23,8 +44,8 @@
 .individual-bookmark:hover { border-color: var(--color-border); background: var(--color-bg-elevated); }
 
 /* Compact view */
-.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none; border-bottom: 1px solid var(--color-bg-elevated); border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
-.individual-bookmark.compact:hover { background: var(--color-bg-elevated); border-bottom-color: var(--color-border); transform: none; box-shadow: none; }
+.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none !important; border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
+.individual-bookmark.compact:hover { background: var(--color-bg-elevated); transform: none; box-shadow: none; border: none !important; }
 .compact-row { display: flex; align-items: center; gap: 0.5rem; height: 28px; width: 100%; min-width: 0; overflow: hidden; }
 .compact-thumbnail { width: 24px; height: 24px; flex-shrink: 0; border-radius: 4px; overflow: hidden; background: var(--color-bg-elevated); display: flex; align-items: center; justify-content: center; }
 .compact-thumbnail img { width: 100%; height: 100%; object-fit: cover; }
@@ -57,10 +78,10 @@
 
 /* Large preview view */
 .individual-bookmark.large { padding: 0; display: flex; flex-direction: column; overflow: hidden; border: 1px solid var(--color-bg-elevated); }
-.large-preview-image { width: 100%; height: 180px; background: var(--color-bg); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
+.large-preview-image { width: 100%; height: 180px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
 .large-preview-image:hover { opacity: 0.9; }
 .large-preview-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.3) 100%); pointer-events: none; }
-.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); }
+.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; }
 .large-content { padding: 1.25rem; }
 .large-text { color: var(--color-text); font-size: 0.95rem; line-height: 1.6; margin-bottom: 1rem; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
 .large-footer { display: flex; align-items: center; gap: 1rem; flex-wrap: wrap; font-size: 0.8rem; color: var(--color-text-secondary); padding-top: 0.75rem; border-top: 1px solid var(--color-border); }
@@ -84,10 +105,10 @@
 .blog-post-card.level-mine { border-color: color-mix(in srgb, var(--highlight-color-mine, #fde047) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-mine, #fde047) 25%, transparent); }
 .blog-post-card.level-friends { border-color: color-mix(in srgb, var(--highlight-color-friends, #f97316) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-friends, #f97316) 25%, transparent); }
 .blog-post-card.level-nostrverse { border-color: color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 25%, transparent); }
-.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: var(--color-bg-subtle); display: flex; align-items: center; justify-content: center; }
+.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); display: flex; align-items: center; justify-content: center; position: relative; }
 .blog-post-card-image img { width: 100%; height: 100%; object-fit: cover; transition: transform 0.3s ease; }
 .blog-post-card:hover .blog-post-card-image img { transform: scale(1.05); }
-.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); display: flex; align-items: center; justify-content: center; }
+.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; display: flex; align-items: center; justify-content: center; width: 100%; height: 100%; }
 .blog-post-card-content { padding: 1.5rem; display: flex; flex-direction: column; gap: 1rem; flex: 1; }
 .blog-post-card-title { font-size: 1.25rem; font-weight: 600; margin: 0; color: var(--color-text); line-height: 1.4; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
 .blog-post-card-summary { font-size: 0.875rem; color: var(--color-text-secondary); margin: 0; line-height: 1.6; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; flex: 1; }

src/styles/components/forms.css

@@ -3,7 +3,7 @@
 .setting-group.setting-inline { display: flex; align-items: center; gap: 1rem; }
 .setting-label { text-align: left; flex: 1; }
 .setting-control { display: flex; justify-content: flex-end; align-items: center; }
-.setting-group.setting-inline label { margin-bottom: 0; }
+.setting-group.setting-inline label { margin-bottom: 0; min-width: 220px; }
 .setting-group label { display: block; margin-bottom: 0.5rem; color: var(--color-text); font-weight: 500; text-align: left; }
 .setting-buttons { display: flex; align-items: center; gap: 0.5rem; }
 .color-picker { display: flex; align-items: center; gap: 0.5rem; }
@@ -41,6 +41,7 @@
 .preview-content p { 
   margin: 0.75rem 0;
   word-wrap: break-word;
+  text-align: var(--paragraph-alignment, justify);
 }
 .setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
 .setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
@@ -58,6 +59,10 @@
     gap: 0.75rem;
   }
   
+  .setting-group.setting-inline label {
+    min-width: unset;
+  }
+  
   .setting-inline .setting-select {
     width: 100%;
     min-width: unset;

src/styles/components/me.css

@@ -67,6 +67,10 @@
   width: 100%;
 }
 
+.me-tab-content:has(.bookmark-filters) {
+  padding-top: 0.25rem;
+}
+
 /* Align highlight list width with profile card width on /me */
 .me-highlights-list { padding-left: 0; padding-right: 0; }
 .explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
@@ -79,6 +83,15 @@
   text-align: left; /* Override center alignment from .app */
 }
 
+/* Bookmark filters in Me page */
+.me-tab-content .bookmark-filters {
+  background: transparent;
+  border: none;
+  padding: 0;
+  justify-content: center;
+  margin-bottom: 0.25rem;
+}
+
 /* Ensure all reading list elements are left-aligned */
 .bookmarks-list .individual-bookmark,
 .bookmarks-list .individual-bookmark * {

src/styles/components/modals.css

@@ -25,3 +25,23 @@
 .btn-primary:hover:not(:disabled) { background: var(--color-primary-hover); }
 .btn-primary:disabled { opacity: 0.6; cursor: not-allowed; }
 
+/* Confirm Dialog */
+.confirm-dialog-overlay { position: fixed; inset: 0; background: rgba(0, 0, 0, 0.7); backdrop-filter: blur(4px); display: flex; align-items: center; justify-content: center; z-index: 10000; padding: 1rem; }
+.confirm-dialog { background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 12px; max-width: 400px; width: 100%; padding: 1.5rem; box-shadow: 0 8px 32px rgba(0, 0, 0, 0.5); }
+.confirm-dialog-icon { display: flex; align-items: center; justify-content: center; width: 48px; height: 48px; border-radius: 50%; margin: 0 auto 1rem; font-size: 1.5rem; }
+.confirm-dialog-icon.danger { background: rgba(220, 38, 38, 0.1); color: rgb(220 38 38); }
+.confirm-dialog-icon.warning { background: rgba(251, 191, 36, 0.1); color: rgb(251 191 36); }
+.confirm-dialog-icon.info { background: rgba(59, 130, 246, 0.1); color: rgb(59 130 246); }
+.confirm-dialog-title { margin: 0 0 0.5rem 0; font-size: 1.25rem; font-weight: 600; color: var(--color-text); text-align: center; }
+.confirm-dialog-message { margin: 0 0 1.5rem 0; font-size: 0.9rem; color: var(--color-text-secondary); text-align: center; line-height: 1.5; }
+.confirm-dialog-actions { display: flex; gap: 0.75rem; }
+.confirm-dialog-btn { flex: 1; padding: 0.75rem 1rem; border: none; border-radius: 8px; font-size: 0.9rem; font-weight: 500; cursor: pointer; transition: all 0.2s; }
+.confirm-dialog-btn.cancel { background: var(--color-bg); border: 1px solid var(--color-border); color: var(--color-text); }
+.confirm-dialog-btn.cancel:hover { background: var(--color-border); }
+.confirm-dialog-btn.confirm.danger { background: rgb(220 38 38); color: white; }
+.confirm-dialog-btn.confirm.danger:hover { background: rgb(185 28 28); }
+.confirm-dialog-btn.confirm.warning { background: rgb(251 191 36); color: rgb(17 24 39); }
+.confirm-dialog-btn.confirm.warning:hover { background: rgb(245 158 11); }
+.confirm-dialog-btn.confirm.info { background: rgb(59 130 246); color: white; }
+.confirm-dialog-btn.confirm.info:hover { background: rgb(37 99 235); }
+

src/styles/components/reader.css

@@ -30,16 +30,29 @@
 .reader-meta { display: flex; align-items: center; gap: 0.75rem; flex-wrap: wrap; }
 .publish-date { display: flex; align-items: center; gap: 0.4rem; font-size: 0.813rem; color: var(--color-text-muted); opacity: 0.85; }
 .publish-date svg { font-size: 0.75rem; opacity: 0.6; }
-.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; text-shadow: 0 2px 4px rgba(0, 0, 0, 0.5); z-index: 10; }
+.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; z-index: 10; }
 .reading-time { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 6px; font-size: 0.875rem; color: var(--color-text-secondary); }
 .reading-time svg { font-size: 0.875rem; }
 .highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
 .highlight-indicator svg { font-size: 0.875rem; }
 .reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
 .reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
-/* Ensure content is left-aligned even if source markup uses center */
-.reader .reader-html *, .reader .reader-markdown * { text-align: left !important; font-family: inherit !important; }
-.reader center, .reader [align="center"] { text-align: left !important; }
+/* Ensure font inheritance */
+.reader .reader-html *, .reader .reader-markdown * { font-family: inherit !important; }
+/* Apply paragraph alignment from settings */
+.reader .reader-html p,
+.reader .reader-markdown p,
+.reader .reader-html div,
+.reader .reader-markdown div,
+.reader .reader-html li,
+.reader .reader-markdown li,
+.reader .reader-html blockquote,
+.reader .reader-markdown blockquote { text-align: var(--paragraph-alignment, justify); }
+/* Override centered content with user preference */
+.reader center, .reader [align="center"] { text-align: var(--paragraph-alignment, justify) !important; }
+/* Keep headings left-aligned */
+.reader .reader-html h1, .reader .reader-html h2, .reader .reader-html h3, .reader .reader-html h4, .reader .reader-html h5, .reader .reader-html h6,
+.reader .reader-markdown h1, .reader .reader-markdown h2, .reader .reader-markdown h3, .reader .reader-markdown h4, .reader .reader-markdown h5, .reader .reader-markdown h6 { text-align: left !important; }
 /* Tame images from external content */
 .reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
 /* Headlines with Tailwind typography */
@@ -192,6 +205,7 @@
 .article-menu-btn { background: none; border: none; color: var(--color-text-secondary); cursor: pointer; padding: 0.5rem 0.75rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.5rem; transition: all 0.2s ease; border-radius: 6px; }
 .article-menu-btn:hover { color: var(--color-primary); background: rgba(99, 102, 241, 0.1); }
 .article-menu { position: absolute; right: 0; top: calc(100% + 4px); background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 6px; box-shadow: 0 4px 12px rgba(0, 0, 0, 0.3); z-index: 1000; min-width: 180px; overflow: hidden; }
+.article-menu.open-upward { top: auto; bottom: calc(100% + 4px); }
 .article-menu-item { width: 100%; background: none; border: none; color: var(--color-text); padding: 0.75rem 1rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.75rem; cursor: pointer; transition: all 0.15s ease; text-align: left; white-space: nowrap; }
 .article-menu-item:hover { background: rgba(99, 102, 241, 0.15); color: var(--color-text); }
 .article-menu-item svg { font-size: 0.875rem; flex-shrink: 0; }
@@ -221,8 +235,9 @@
 .article-hero-image { width: 100%; height: 200px; background-size: cover; background-position: center; background-repeat: no-repeat; cursor: pointer; transition: all 0.2s ease; border-radius: 8px 8px 0 0; position: relative; }
 .article-hero-image:hover { opacity: 0.9; }
 .article-hero-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.4) 100%); pointer-events: none; border-radius: 8px 8px 0 0; }
-.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; }
+.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 25%, var(--color-bg-elevated) 50%, var(--color-bg-subtle) 75%, var(--color-bg-elevated) 100%); }
 .reader-hero-image img { width: 100%; height: auto; max-height: 500px; object-fit: cover; display: block; }
+.reader-hero-placeholder { width: 100%; height: 300px; display: flex; align-items: center; justify-content: center; font-size: 4rem; color: var(--color-border-subtle); opacity: 0.3; }
 .reader-header-overlay { position: absolute; bottom: 0; left: 0; right: 0; padding: 2rem 2rem 1.5rem; background: linear-gradient(to top, rgba(0, 0, 0, 0.85) 0%, rgba(0, 0, 0, 0.6) 60%, rgba(0, 0, 0, 0) 100%); }
 .reader-header-overlay .reader-title { color: #fff; text-shadow: 0 2px 8px rgba(0, 0, 0, 0.5); margin-bottom: 0.75rem; font-size: 2.5rem; font-weight: 700; line-height: 1.2; }
 .reader-header-overlay .reader-summary { color: rgba(255, 255, 255, 0.9); font-size: 1.2rem; line-height: 1.6; margin: 0 0 1rem 0; text-shadow: 0 1px 4px rgba(0, 0, 0, 0.4); font-family: var(--reading-font); }

src/styles/components/settings.css

@@ -1,9 +1,9 @@
 /* Settings view containers */
 .settings-view { display: flex; flex-direction: column; height: 100%; overflow: hidden; padding: 0.75rem 1rem; text-align: left; }
-.settings-header { display: flex; align-items: center; justify-content: space-between; margin-bottom: 1.5rem; padding: 0; }
+.settings-header { display: flex; align-items: center; justify-content: space-between; padding: 0; max-width: 900px; margin: 0 auto 1.5rem auto; width: 100%; }
 .settings-header h2 { margin: 0; font-size: 1.5rem; font-weight: 600; text-align: left; }
 .settings-header-actions { display: flex; gap: 0.5rem; align-items: center; }
-.settings-content { overflow-y: auto; flex: 1; margin-bottom: 1rem; text-align: left; padding: 0 0.25rem 2rem 0.25rem; }
+.settings-content { overflow-y: auto; flex: 1; text-align: left; padding: 0 0.25rem 2rem 0.25rem; max-width: 900px; margin: 0 auto 1rem auto; width: 100%; }
 .settings-section { margin-bottom: 2.5rem; }
 .settings-section:last-child { margin-bottom: 0; }
 .section-title { font-size: 1rem; font-weight: 600; color: var(--color-text); margin: 0 0 1rem 0; padding-bottom: 0.5rem; border-bottom: 1px solid var(--color-border); text-transform: uppercase; letter-spacing: 0.05em; }
@@ -19,6 +19,7 @@
 /* Zap splits preset buttons */
 .zap-preset-buttons { display: flex; gap: 0.5rem; flex-wrap: wrap; }
 .zap-preset-btn {
+  flex: 1;
   padding: 0.625rem 1.25rem;
   background: var(--color-bg-elevated);
   border: 1px solid var(--color-border-subtle);
@@ -54,35 +55,56 @@
   width: 100%;
   height: 8px;
   border-radius: 4px;
-  background: var(--color-bg-elevated);
+  background: linear-gradient(
+    to right,
+    color-mix(in srgb, var(--highlight-color) 50%, transparent) 0%,
+    color-mix(in srgb, var(--highlight-color) 50%, transparent) 50%,
+    color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 50%,
+    color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 100%
+  );
   outline: none;
   -webkit-appearance: none;
+  position: relative;
 }
 .zap-split-slider::-webkit-slider-thumb {
   -webkit-appearance: none;
   appearance: none;
-  width: 20px;
-  height: 20px;
-  border-radius: 50%;
-  background: var(--color-primary);
+  width: 24px;
+  height: 24px;
+  border-radius: 4px;
+  background-color: var(--color-primary);
+  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
+  background-size: 14px 14px;
+  background-repeat: no-repeat;
+  background-position: center center;
   cursor: pointer;
   transition: all 0.2s ease;
+  position: relative;
+  top: 0;
+  margin-top: 0;
 }
 .zap-split-slider::-webkit-slider-thumb:hover {
-  background: var(--color-primary-hover);
+  background-color: var(--color-primary-hover);
   transform: scale(1.1);
 }
 .zap-split-slider::-moz-range-thumb {
-  width: 20px;
-  height: 20px;
-  border-radius: 50%;
-  background: var(--color-primary);
+  width: 24px;
+  height: 24px;
+  border-radius: 4px;
+  background-color: var(--color-primary);
+  background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
+  background-size: 14px 14px;
+  background-repeat: no-repeat;
+  background-position: center center;
   cursor: pointer;
   border: none;
   transition: all 0.2s ease;
+  position: relative;
+  top: 0;
+  margin-top: 0;
 }
 .zap-split-slider::-moz-range-thumb:hover {
-  background: var(--color-primary-hover);
+  background-color: var(--color-primary-hover);
   transform: scale(1.1);
 }
 .zap-split-description {

src/styles/layout/sidebar.css

@@ -81,7 +81,14 @@
 .view-mode-controls {
   display: flex;
   align-items: center;
-  justify-content: center;
+  justify-content: space-between;
+  gap: 0.5rem;
+}
+
+.view-mode-left,
+.view-mode-right {
+  display: flex;
+  align-items: center;
   gap: 0.5rem;
 }
 
@@ -169,3 +176,38 @@
 .read-inline-btn { background: rgb(34 197 94); /* green-500 */ color: white; border: none; padding: 0.25rem 0.5rem; border-radius: 4px; cursor: pointer; }
 .read-inline-btn:hover { background: rgb(22 163 74); /* green-600 */ }
 
+/* Bookmark filters */
+.bookmark-filters {
+  display: flex;
+  gap: 0.5rem;
+  padding: 0.5rem 1rem;
+  border-bottom: 1px solid var(--color-border);
+  background: var(--color-bg);
+}
+
+.bookmark-filters .filter-btn {
+  background: transparent;
+  color: var(--color-text-secondary);
+  border: none;
+  padding: 0.375rem;
+  border-radius: 4px;
+  cursor: pointer;
+  transition: all 0.15s ease;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  font-size: 0.875rem;
+  min-width: 32px;
+  min-height: 32px;
+}
+
+.bookmark-filters .filter-btn:hover {
+  color: var(--color-text);
+  background: var(--color-bg-elevated);
+}
+
+.bookmark-filters .filter-btn.active {
+  color: var(--color-primary);
+  background: transparent;
+}
+

src/types/bookmarks.ts

@@ -42,6 +42,14 @@ export interface IndividualBookmark {
   encryptedContent?: string
   // When the item was added to the bookmark list (synthetic, for sorting)
   added_at?: number
+  // The kind of the source list/set that produced this bookmark (e.g., 10003, 30003, 30001, or 39701 for web)
+  sourceKind?: number
+  // The 'd' tag value from kind 30003 bookmark sets
+  setName?: string
+  // Metadata from the bookmark set event (kind 30003)
+  setTitle?: string
+  setDescription?: string
+  setImage?: string
 }
 
 export interface ActiveAccount {

src/utils/bookmarkTypeClassifier.ts

@@ -0,0 +1,42 @@
+import { IndividualBookmark } from '../types/bookmarks'
+import { extractUrlsFromContent } from '../services/bookmarkHelpers'
+import { classifyUrl } from './helpers'
+
+export type BookmarkType = 'article' | 'external' | 'video' | 'note' | 'web'
+
+/**
+ * Classifies a bookmark into one of the content types
+ */
+export function classifyBookmarkType(bookmark: IndividualBookmark): BookmarkType {
+  // Kind 30023 is always a nostr-native article
+  if (bookmark.kind === 30023) return 'article'
+
+  const isWebBookmark = bookmark.kind === 39701
+  const webBookmarkUrl = isWebBookmark ? bookmark.tags.find(t => t[0] === 'd')?.[1] : null
+  
+  const extractedUrls = webBookmarkUrl 
+    ? [webBookmarkUrl.startsWith('http') ? webBookmarkUrl : `https://${webBookmarkUrl}`] 
+    : extractUrlsFromContent(bookmark.content)
+  
+  const firstUrl = extractedUrls[0]
+  if (!firstUrl) return 'note'
+
+  const urlType = classifyUrl(firstUrl)?.type
+  
+  if (urlType === 'youtube' || urlType === 'video') return 'video'
+  if (urlType === 'article') return 'external' // External article links
+  
+  return 'web'
+}
+
+/**
+ * Filters bookmarks by type
+ */
+export function filterBookmarksByType(
+  bookmarks: IndividualBookmark[],
+  filterType: 'all' | BookmarkType
+): IndividualBookmark[] {
+  if (filterType === 'all') return bookmarks
+  return bookmarks.filter(bookmark => classifyBookmarkType(bookmark) === filterType)
+}
+

src/utils/bookmarkUtils.tsx

@@ -1,6 +1,6 @@
 import React from 'react'
 import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
-import { ParsedContent, ParsedNode } from '../types/bookmarks'
+import { ParsedContent, ParsedNode, IndividualBookmark } from '../types/bookmarks'
 import ResolvedMention from '../components/ResolvedMention'
 // Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
 
@@ -82,3 +82,73 @@ export const renderParsedContent = (parsedContent: ParsedContent) => {
     </div>
   )
 }
+
+// Sorting and grouping for bookmarks
+export const sortIndividualBookmarks = (items: IndividualBookmark[]) => {
+  return items
+    .slice()
+    .sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
+}
+
+export function groupIndividualBookmarks(items: IndividualBookmark[]) {
+  const sorted = sortIndividualBookmarks(items)
+  const web = sorted.filter(i => i.kind === 39701 || i.type === 'web')
+  // Only non-encrypted legacy bookmarks go to the amethyst section
+  const amethyst = sorted.filter(i => i.sourceKind === 30001 && !i.isPrivate)
+  const isIn = (list: IndividualBookmark[], x: IndividualBookmark) => list.some(i => i.id === x.id)
+  // Private items include encrypted legacy bookmarks
+  const privateItems = sorted.filter(i => i.isPrivate && !isIn(web, i))
+  const publicItems = sorted.filter(i => !i.isPrivate && !isIn(amethyst, i) && !isIn(web, i))
+  return { privateItems, publicItems, web, amethyst }
+}
+
+// Simple filter: only exclude bookmarks with empty/whitespace-only content
+export function hasContent(bookmark: IndividualBookmark): boolean {
+  return !!(bookmark.content && bookmark.content.trim().length > 0)
+}
+
+// Bookmark sets helpers (kind 30003)
+export interface BookmarkSet {
+  name: string
+  title?: string
+  description?: string
+  image?: string
+  bookmarks: IndividualBookmark[]
+}
+
+export function getBookmarkSets(items: IndividualBookmark[]): BookmarkSet[] {
+  // Group bookmarks by setName
+  const setMap = new Map<string, IndividualBookmark[]>()
+  
+  items.forEach(bookmark => {
+    if (bookmark.setName) {
+      const existing = setMap.get(bookmark.setName) || []
+      existing.push(bookmark)
+      setMap.set(bookmark.setName, existing)
+    }
+  })
+  
+  // Convert to array and extract metadata from the bookmarks
+  const sets: BookmarkSet[] = []
+  setMap.forEach((bookmarks, name) => {
+    // Get metadata from the first bookmark (all bookmarks in a set share the same metadata)
+    const firstBookmark = bookmarks[0]
+    const title = firstBookmark?.setTitle
+    const description = firstBookmark?.setDescription
+    const image = firstBookmark?.setImage
+    
+    sets.push({
+      name,
+      title,
+      description,
+      image,
+      bookmarks: sortIndividualBookmarks(bookmarks)
+    })
+  })
+  
+  return sets.sort((a, b) => a.name.localeCompare(b.name))
+}
+
+export function getBookmarksWithoutSet(items: IndividualBookmark[]): IndividualBookmark[] {
+  return sortIndividualBookmarks(items.filter(b => !b.setName))
+}

src/utils/debugBus.ts

@@ -0,0 +1,36 @@
+export type DebugLevel = 'info' | 'warn' | 'error'
+
+export interface DebugLogEntry {
+  ts: number
+  level: DebugLevel
+  source: string
+  message: string
+  data?: unknown
+}
+
+type Listener = (entry: DebugLogEntry) => void
+
+const listeners = new Set<Listener>()
+const buffer: DebugLogEntry[] = []
+const MAX_BUFFER = 300
+
+export const DebugBus = {
+  log(level: DebugLevel, source: string, message: string, data?: unknown): void {
+    const entry: DebugLogEntry = { ts: Date.now(), level, source, message, data }
+    buffer.push(entry)
+    if (buffer.length > MAX_BUFFER) buffer.shift()
+    listeners.forEach(l => {
+      try { l(entry) } catch (err) { console.warn('[DebugBus] listener error:', err) }
+    })
+  },
+  info(source: string, message: string, data?: unknown): void { this.log('info', source, message, data) },
+  warn(source: string, message: string, data?: unknown): void { this.log('warn', source, message, data) },
+  error(source: string, message: string, data?: unknown): void { this.log('error', source, message, data) },
+  subscribe(listener: Listener): () => void {
+    listeners.add(listener)
+    return () => listeners.delete(listener)
+  },
+  snapshot(): DebugLogEntry[] { return buffer.slice() }
+}
+
+

src/utils/linksFromBookmarks.ts

@@ -0,0 +1,69 @@
+import { Bookmark } from '../types/bookmarks'
+import { ReadItem } from '../services/readsService'
+import { KINDS } from '../config/kinds'
+import { fallbackTitleFromUrl } from './readItemMerge'
+
+/**
+ * Derives ReadItems from bookmarks for external URLs:
+ * - Web bookmarks (kind:39701)
+ * - Any bookmark with http(s) URLs in content or urlReferences
+ */
+export function deriveLinksFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
+  const linksMap = new Map<string, ReadItem>()
+  
+  const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
+  
+  for (const bookmark of allBookmarks) {
+    const urls: string[] = []
+    
+    // Web bookmarks (kind:39701) - extract from 'd' tag
+    if (bookmark.kind === KINDS.WebBookmark) {
+      const dTag = bookmark.tags.find(t => t[0] === 'd')?.[1]
+      if (dTag) {
+        const url = dTag.startsWith('http') ? dTag : `https://${dTag}`
+        urls.push(url)
+      }
+    }
+    
+    // Extract URLs from content if not already captured
+    if (bookmark.content) {
+      const urlRegex = /(https?:\/\/[^\s]+)/g
+      const matches = bookmark.content.match(urlRegex)
+      if (matches) {
+        urls.push(...matches)
+      }
+    }
+    
+    // Extract metadata from tags (for web bookmarks and other types)
+    const title = bookmark.tags.find(t => t[0] === 'title')?.[1]
+    const summary = bookmark.tags.find(t => t[0] === 'summary')?.[1]
+    const image = bookmark.tags.find(t => t[0] === 'image')?.[1]
+    
+    // Create ReadItem for each unique URL
+    for (const url of [...new Set(urls)]) {
+      if (!linksMap.has(url)) {
+        const item: ReadItem = {
+          id: url,
+          source: 'bookmark',
+          type: 'external',
+          url,
+          title: title || fallbackTitleFromUrl(url),
+          summary,
+          image,
+          readingProgress: 0,
+          readingTimestamp: bookmark.added_at || bookmark.created_at
+        }
+        
+        linksMap.set(url, item)
+      }
+    }
+  }
+  
+  // Sort by most recent bookmark activity
+  return Array.from(linksMap.values()).sort((a, b) => {
+    const timeA = a.readingTimestamp || 0
+    const timeB = b.readingTimestamp || 0
+    return timeB - timeA
+  })
+}
+

src/utils/readItemMerge.ts

@@ -0,0 +1,83 @@
+import { ReadItem } from '../services/readsService'
+
+/**
+ * Merges a ReadItem into a state map, returning whether the state changed.
+ * Uses most recent reading activity to determine precedence.
+ */
+export function mergeReadItem(
+  stateMap: Map<string, ReadItem>,
+  incoming: ReadItem
+): boolean {
+  const existing = stateMap.get(incoming.id)
+  
+  if (!existing) {
+    stateMap.set(incoming.id, incoming)
+    return true
+  }
+  
+  // Always merge if incoming has reading progress data
+  const hasNewProgress = incoming.readingProgress !== undefined && 
+    (existing.readingProgress === undefined || existing.readingProgress !== incoming.readingProgress)
+  
+  const hasNewMarkedAsRead = incoming.markedAsRead !== undefined && existing.markedAsRead === undefined
+  
+  // Merge by taking the most recent reading activity
+  const existingTime = existing.readingTimestamp || existing.markedAt || 0
+  const incomingTime = incoming.readingTimestamp || incoming.markedAt || 0
+  
+  if (incomingTime > existingTime || hasNewProgress || hasNewMarkedAsRead) {
+    // Keep existing data, but update with newer reading metadata
+    stateMap.set(incoming.id, {
+      ...existing,
+      ...incoming,
+      // Preserve event data if incoming doesn't have it
+      event: incoming.event || existing.event,
+      title: incoming.title || existing.title,
+      summary: incoming.summary || existing.summary,
+      image: incoming.image || existing.image,
+      published: incoming.published || existing.published,
+      author: incoming.author || existing.author,
+      // Always take reading progress if available
+      readingProgress: incoming.readingProgress !== undefined ? incoming.readingProgress : existing.readingProgress,
+      readingTimestamp: incomingTime > existingTime ? incoming.readingTimestamp : existing.readingTimestamp
+    })
+    return true
+  }
+  
+  // If timestamps are equal but incoming has additional data, merge it
+  if (incomingTime === existingTime && (!existing.event && incoming.event || !existing.title && incoming.title)) {
+    stateMap.set(incoming.id, {
+      ...existing,
+      ...incoming,
+      event: incoming.event || existing.event,
+      title: incoming.title || existing.title,
+      summary: incoming.summary || existing.summary,
+      image: incoming.image || existing.image,
+      published: incoming.published || existing.published,
+      author: incoming.author || existing.author
+    })
+    return true
+  }
+  
+  return false
+}
+
+/**
+ * Extracts a readable title from a URL when no title is available.
+ * Removes protocol, www, and shows domain + path.
+ */
+export function fallbackTitleFromUrl(url: string): string {
+  try {
+    const parsed = new URL(url)
+    let title = parsed.hostname.replace(/^www\./, '')
+    if (parsed.pathname && parsed.pathname !== '/') {
+      const path = parsed.pathname.slice(0, 40)
+      title += path.length < parsed.pathname.length ? path + '...' : path
+    }
+    return title
+  } catch {
+    // If URL parsing fails, just return the URL truncated
+    return url.length > 50 ? url.slice(0, 47) + '...' : url
+  }
+}
+

src/utils/readingProgressUtils.ts

@@ -0,0 +1,30 @@
+import { ReadItem } from '../services/readsService'
+import { ReadingProgressFilterType } from '../components/ReadingProgressFilters'
+
+/**
+ * Filters ReadItems by reading progress
+ */
+export function filterByReadingProgress(
+  items: ReadItem[],
+  filter: ReadingProgressFilterType
+): ReadItem[] {
+  return items.filter((item) => {
+    const progress = item.readingProgress || 0
+    const isMarked = item.markedAsRead || false
+    
+    switch (filter) {
+      case 'unopened':
+        return progress === 0 && !isMarked
+      case 'started':
+        return progress > 0 && progress <= 0.10 && !isMarked
+      case 'reading':
+        return progress > 0.10 && progress <= 0.94 && !isMarked
+      case 'completed':
+        return progress >= 0.95 || isMarked
+      case 'all':
+      default:
+        return true
+    }
+  })
+}
+

src/utils/readsFromBookmarks.ts

@@ -0,0 +1,71 @@
+import { Bookmark } from '../types/bookmarks'
+import { ReadItem } from '../services/readsService'
+import { classifyBookmarkType } from './bookmarkTypeClassifier'
+import { KINDS } from '../config/kinds'
+import { nip19 } from 'nostr-tools'
+
+/**
+ * Derives ReadItems from bookmarks for Nostr articles (kind:30023).
+ * Returns items with type='article', using hydrated data when available.
+ * Note: After hydration, article titles are in bookmark.content, metadata in tags.
+ */
+export function deriveReadsFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
+  const readsMap = new Map<string, ReadItem>()
+  
+  const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
+  
+  for (const bookmark of allBookmarks) {
+    const bookmarkType = classifyBookmarkType(bookmark)
+    
+    // Only include articles (kind:30023)
+    if (bookmarkType === 'article' && bookmark.kind === KINDS.BlogPost) {
+      const coordinate = bookmark.id // coordinate format: kind:pubkey:identifier
+      
+      // Extract identifier from coordinate
+      const parts = coordinate.split(':')
+      const identifier = parts[2] || ''
+      
+      // Convert to naddr format (reading positions use naddr as ID)
+      let naddr: string
+      try {
+        naddr = nip19.naddrEncode({
+          kind: KINDS.BlogPost,
+          pubkey: bookmark.pubkey,
+          identifier
+        })
+      } catch (e) {
+        console.warn('Failed to encode naddr for bookmark:', coordinate)
+        continue
+      }
+      
+      // Extract metadata from tags (same as BookmarkItem does)
+      const title = bookmark.content || 'Untitled'
+      const image = bookmark.tags.find(t => t[0] === 'image')?.[1]
+      const summary = bookmark.tags.find(t => t[0] === 'summary')?.[1]
+      const published = bookmark.tags.find(t => t[0] === 'published_at')?.[1]
+      
+      const item: ReadItem = {
+        id: naddr, // Use naddr format to match reading positions
+        source: 'bookmark',
+        type: 'article',
+        readingProgress: 0,
+        readingTimestamp: bookmark.added_at || bookmark.created_at,
+        title,
+        summary,
+        image,
+        published: published ? parseInt(published) : undefined,
+        author: bookmark.pubkey
+      }
+      
+      readsMap.set(naddr, item)
+    }
+  }
+  
+  // Sort by most recent bookmark activity
+  return Array.from(readsMap.values()).sort((a, b) => {
+    const timeA = a.readingTimestamp || 0
+    const timeB = b.readingTimestamp || 0
+    return timeB - timeA
+  })
+}
+

src/vite-env.d.ts

@@ -8,3 +8,11 @@ declare module '*.svg?raw' {
   const content: string
   export default content
 }
+
+// Build-time defines injected by Vite in vite.config.ts
+declare const __APP_VERSION__: string
+declare const __GIT_COMMIT__: string
+declare const __GIT_BRANCH__: string
+declare const __BUILD_TIME__: string
+declare const __GIT_COMMIT_URL__: string
+declare const __RELEASE_URL__: string

vercel.json

@@ -1,5 +1,16 @@
 {
   "rewrites": [
+    {
+      "source": "/a/:naddr",
+      "has": [
+        {
+          "type": "header",
+          "key": "user-agent",
+          "value": ".*(bot|crawl|spider|slurp|facebook|twitter|linkedin|whatsapp|telegram|slack|discord|preview).*"
+        }
+      ],
+      "destination": "/api/article-og?naddr=:naddr"
+    },
     {
       "source": "/(.*)",
       "destination": "/index.html"

vite.config.ts

@@ -1,8 +1,101 @@
+/* eslint-env node */
 import { defineConfig } from 'vite'
 import react from '@vitejs/plugin-react'
 import { VitePWA } from 'vite-plugin-pwa'
+import { readFileSync } from 'node:fs'
+import { execSync } from 'node:child_process'
+
+function getGitMetadata() {
+  const envSha = process.env.VERCEL_GIT_COMMIT_SHA || ''
+  const envRef = process.env.VERCEL_GIT_COMMIT_REF || ''
+  let commit = envSha
+  let branch = envRef
+  try {
+    if (!commit) commit = execSync('git rev-parse HEAD', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
+  } catch {
+    // ignore
+  }
+  try {
+    if (!branch) branch = execSync('git rev-parse --abbrev-ref HEAD', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
+  } catch {
+    // ignore
+  }
+  return { commit, branch }
+}
+
+function getPackageVersion() {
+  try {
+    const pkg = JSON.parse(readFileSync(new URL('./package.json', import.meta.url)).toString())
+    return pkg.version as string
+  } catch {
+    return '0.0.0'
+  }
+}
+
+const { commit, branch } = getGitMetadata()
+const version = getPackageVersion()
+const buildTime = new Date().toISOString()
+
+function getReleaseUrl(version: string): string {
+  if (!version) return ''
+  const provider = process.env.VERCEL_GIT_PROVIDER || ''
+  const owner = process.env.VERCEL_GIT_REPO_OWNER || ''
+  const slug = process.env.VERCEL_GIT_REPO_SLUG || ''
+  if (provider.toLowerCase() === 'github' && owner && slug) {
+    return `https://github.com/${owner}/${slug}/releases/tag/v${version}`
+  }
+  try {
+    const remote = execSync('git config --get remote.origin.url', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
+    if (remote.includes('github.com')) {
+      // git@github.com:owner/repo.git or https://github.com/owner/repo.git
+      const https = remote.startsWith('git@')
+        ? `https://github.com/${remote.split(':')[1]}`
+        : remote
+      const cleaned = https.replace(/\.git$/, '')
+      return `${cleaned}/releases/tag/v${version}`
+    }
+  } catch {
+    // ignore
+  }
+  return ''
+}
+
+function getCommitUrl(commit: string): string {
+  if (!commit) return ''
+  const provider = process.env.VERCEL_GIT_PROVIDER || ''
+  const owner = process.env.VERCEL_GIT_REPO_OWNER || ''
+  const slug = process.env.VERCEL_GIT_REPO_SLUG || ''
+  if (provider.toLowerCase() === 'github' && owner && slug) {
+    return `https://github.com/${owner}/${slug}/commit/${commit}`
+  }
+  try {
+    const remote = execSync('git config --get remote.origin.url', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
+    if (remote.includes('github.com')) {
+      // git@github.com:owner/repo.git or https://github.com/owner/repo.git
+      const https = remote.startsWith('git@')
+        ? `https://github.com/${remote.split(':')[1]}`
+        : remote
+      const cleaned = https.replace(/\.git$/, '')
+      return `${cleaned}/commit/${commit}`
+    }
+  } catch {
+    // ignore
+  }
+  return ''
+}
+
+const releaseUrl = getReleaseUrl(version)
+const commitUrl = getCommitUrl(commit)
 
 export default defineConfig({
+  define: {
+    __APP_VERSION__: JSON.stringify(version),
+    __GIT_COMMIT__: JSON.stringify(commit),
+    __GIT_BRANCH__: JSON.stringify(branch),
+    __BUILD_TIME__: JSON.stringify(buildTime),
+    __GIT_COMMIT_URL__: JSON.stringify(commitUrl),
+    __RELEASE_URL__: JSON.stringify(releaseUrl)
+  },
   plugins: [
     react(),
     VitePWA({
@@ -48,7 +141,7 @@ export default defineConfig({
     mainFields: ['module', 'jsnext:main', 'jsnext', 'main']
   },
   optimizeDeps: {
-    include: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-react'],
+    include: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-react', 'applesauce-accounts', 'applesauce-signers'],
     esbuildOptions: {
       resolveExtensions: ['.js', '.ts', '.tsx', '.json']
     }
@@ -65,7 +158,7 @@ export default defineConfig({
     }
   },
   ssr: {
-    noExternal: ['applesauce-core', 'applesauce-factory', 'applesauce-relay']
+    noExternal: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-accounts', 'applesauce-signers']
   }
 })