mirror of
https://github.com/dergigi/boris.git
synced 2026-02-22 23:44:51 +01:00
Compare commits
384 Commits
v0.6.12
...
bunker-enc
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
2c3aff0407 | ||
|
|
aad35d41db | ||
|
|
cc6189a5d9 | ||
|
|
18bf8f9a2c | ||
|
|
37f3a32a1c | ||
|
|
c9678564a5 | ||
|
|
721c18c509 | ||
|
|
9e30fe683b | ||
|
|
7fff50c146 | ||
|
|
fc1c845b67 | ||
|
|
c2ec1f3677 | ||
|
|
0cbd357856 | ||
|
|
26ea9ed547 | ||
|
|
9cbbecb32c | ||
|
|
db12c89731 | ||
|
|
6f413deb90 | ||
|
|
0127e2dc86 | ||
|
|
7743928702 | ||
|
|
bf76150fc1 | ||
|
|
c62107172b | ||
|
|
a253587dfa | ||
|
|
1938533d53 | ||
|
|
28943c55bd | ||
|
|
791bbb68b6 | ||
|
|
ec8adcc794 | ||
|
|
68058e7661 | ||
|
|
416c62369c | ||
|
|
a19dd53423 | ||
|
|
79ec33b79a | ||
|
|
be881b957c | ||
|
|
244872e9f2 | ||
|
|
1397f7f0f4 | ||
|
|
96424dd65c | ||
|
|
9efc5459fb | ||
|
|
7e02168e54 | ||
|
|
f8e6b3e828 | ||
|
|
c06176bfc9 | ||
|
|
e2a1701000 | ||
|
|
d7703ceef4 | ||
|
|
93daabc673 | ||
|
|
9264245944 | ||
|
|
f56423040b | ||
|
|
4b91504a50 | ||
|
|
1f0f7fef5e | ||
|
|
6aced653fb | ||
|
|
0899482869 | ||
|
|
1bdfa1e6e1 | ||
|
|
f22a8f15c0 | ||
|
|
bf6394fc7d | ||
|
|
6f08586e8f | ||
|
|
d60a4a24ad | ||
|
|
51069f3623 | ||
|
|
1407af22e3 | ||
|
|
ea6220277d | ||
|
|
fbffa03dad | ||
|
|
a74760d804 | ||
|
|
c4b0a712d2 | ||
|
|
1fecf9c7f4 | ||
|
|
7be21203d9 | ||
|
|
f65f2c6597 | ||
|
|
227def4328 | ||
|
|
b506624f57 | ||
|
|
fbb6a0a153 | ||
|
|
528de32689 | ||
|
|
230e5380ca | ||
|
|
349237d097 | ||
|
|
d4df9f0424 | ||
|
|
2f68e84002 | ||
|
|
b18dcc29cd | ||
|
|
680169e312 | ||
|
|
11753c4515 | ||
|
|
bd29dfd65f | ||
|
|
4b1ae838e5 | ||
|
|
85599d3103 | ||
|
|
4603c5a258 | ||
|
|
ec45fbc5e8 | ||
|
|
53400334b2 | ||
|
|
af4ff7081a | ||
|
|
7f21b8ed76 | ||
|
|
55e44dcc9c | ||
|
|
59dac947ab | ||
|
|
7d33c3c024 | ||
|
|
38a014ef84 | ||
|
|
f451348430 | ||
|
|
685aaf43b0 | ||
|
|
d6a20b5272 | ||
|
|
d8d7a19fa1 | ||
|
|
63626fae3a | ||
|
|
de09ef2935 | ||
|
|
bcb28a63a7 | ||
|
|
a479903ce3 | ||
|
|
567d105261 | ||
|
|
83743c5a9f | ||
|
|
0b8f88ea1d | ||
|
|
fadc755930 | ||
|
|
f67f171e64 | ||
|
|
449c59015e | ||
|
|
4d697e6a79 | ||
|
|
04ae70873a | ||
|
|
2f8a64826a | ||
|
|
11cb3542ee | ||
|
|
905296621c | ||
|
|
769484bc0d | ||
|
|
27ff4cef22 | ||
|
|
a352e2616e | ||
|
|
77cbb9394f | ||
|
|
39c8b3dfe4 | ||
|
|
7bd11e695e | ||
|
|
a76b703d36 | ||
|
|
df51173405 | ||
|
|
a79d7f9eaf | ||
|
|
1032a46456 | ||
|
|
ae997758ab | ||
|
|
91a827324d | ||
|
|
bf849c9faa | ||
|
|
118ab46ac0 | ||
|
|
d2f2b689f9 | ||
|
|
5229e45566 | ||
|
|
b17043e85d | ||
|
|
19ca909ef5 | ||
|
|
f7ff309b6e | ||
|
|
ea5a8486b9 | ||
|
|
58897b3436 | ||
|
|
6a59ecfa47 | ||
|
|
272066c6e0 | ||
|
|
0426c9d3b0 | ||
|
|
c22419ba0e | ||
|
|
8278fed2fb | ||
|
|
b24a65b490 | ||
|
|
fb509fabd8 | ||
|
|
d21285123f | ||
|
|
1029b6be0c | ||
|
|
3fff9455a1 | ||
|
|
8c6232e029 | ||
|
|
f6c562e9be | ||
|
|
a92b14e877 | ||
|
|
b69a956247 | ||
|
|
82a8dcf6eb | ||
|
|
8e19e22289 | ||
|
|
e167b57810 | ||
|
|
ba3b82e6b5 | ||
|
|
b5edfbb2c9 | ||
|
|
48048f877a | ||
|
|
bd1afc54c3 | ||
|
|
a2c4bed0f5 | ||
|
|
9bad49fe5f | ||
|
|
2aa6536496 | ||
|
|
bd6d8a0342 | ||
|
|
dc8e86bc57 | ||
|
|
32b843908e | ||
|
|
5a71480459 | ||
|
|
17455aa47b | ||
|
|
4cc32c27de | ||
|
|
99bfe209a5 | ||
|
|
0a28bfbd50 | ||
|
|
ba9fb109f6 | ||
|
|
ec9d2fcb49 | ||
|
|
f841043e03 | ||
|
|
94dc95e1f0 | ||
|
|
32a5145d8f | ||
|
|
a856e8ca26 | ||
|
|
d54306cf92 | ||
|
|
9fdb96b64e | ||
|
|
c50aa3a243 | ||
|
|
adef1a922c | ||
|
|
99df4d6761 | ||
|
|
5f6a414953 | ||
|
|
ed17a68986 | ||
|
|
bedf3daed1 | ||
|
|
2c913cf7e8 | ||
|
|
aff5bff03b | ||
|
|
e90f902f0b | ||
|
|
d763aa5f15 | ||
|
|
9d6b1f6f84 | ||
|
|
9eb2f35dbf | ||
|
|
5f33ad3ba0 | ||
|
|
3db4855532 | ||
|
|
3305be1da5 | ||
|
|
fe55e87496 | ||
|
|
f78f1a3460 | ||
|
|
e73d89739b | ||
|
|
7e2b4b46c9 | ||
|
|
fddf79e0c6 | ||
|
|
cf2098a723 | ||
|
|
5568437663 | ||
|
|
7bfd7fdf6c | ||
|
|
e6876d141f | ||
|
|
5bb81b3c22 | ||
|
|
1e8e58fa05 | ||
|
|
f44e36e4bf | ||
|
|
11c7564f8c | ||
|
|
a064376bd8 | ||
|
|
292e8e9bda | ||
|
|
951a3699ca | ||
|
|
860ec70b1c | ||
|
|
2b69c72939 | ||
|
|
b98d774cbf | ||
|
|
8972571a18 | ||
|
|
ab5d5dca58 | ||
|
|
e383356af1 | ||
|
|
165d10c49b | ||
|
|
e0869c436b | ||
|
|
95432fc276 | ||
|
|
1982d25fa8 | ||
|
|
2fc64b6028 | ||
|
|
6e8686a49d | ||
|
|
fd5ce80a06 | ||
|
|
ac4185e2cc | ||
|
|
9217077283 | ||
|
|
b7c14b5c7c | ||
|
|
9b3cc41770 | ||
|
|
4c4bd2214c | ||
|
|
93c31650f4 | ||
|
|
7f0d99fc29 | ||
|
|
eb6dbe1644 | ||
|
|
474da25f77 | ||
|
|
02eaa1c8f8 | ||
|
|
8800791723 | ||
|
|
6758b9678b | ||
|
|
63f58e010f | ||
|
|
85649ae283 | ||
|
|
d0b814e39d | ||
|
|
f4a227e40a | ||
|
|
6ef0a6dd71 | ||
|
|
5502d71ac4 | ||
|
|
5e1146b015 | ||
|
|
8f89165711 | ||
|
|
674634326f | ||
|
|
30eaec5770 | ||
|
|
0ff3c864a9 | ||
|
|
ab2ca1f5e7 | ||
|
|
cf2d227f61 | ||
|
|
2c9e6cc54e | ||
|
|
8da0a06711 | ||
|
|
be8d857223 | ||
|
|
d50bcd700e | ||
|
|
820ab1d902 | ||
|
|
f5e9e5bf61 | ||
|
|
40b43532e8 | ||
|
|
51a3008730 | ||
|
|
e30cbc72c3 | ||
|
|
6f913262f4 | ||
|
|
0f0462e6ac | ||
|
|
e353f0e2d6 | ||
|
|
ee1365d3ca | ||
|
|
a215d0b026 | ||
|
|
b8d76c0bd8 | ||
|
|
233169b082 | ||
|
|
72b9a04cd2 | ||
|
|
432715efb6 | ||
|
|
8b2b954dde | ||
|
|
c2d2bd8106 | ||
|
|
a5c3085c59 | ||
|
|
c0332f08d6 | ||
|
|
38a1d6caec | ||
|
|
39dd607e7b | ||
|
|
9dc0db3e06 | ||
|
|
b1eb58a385 | ||
|
|
f3c6404f76 | ||
|
|
1a42a6422d | ||
|
|
2e2de4ccda | ||
|
|
4325d3a519 | ||
|
|
51115c5f68 | ||
|
|
2aa6fe860b | ||
|
|
86f39eacf8 | ||
|
|
d15daef3ea | ||
|
|
281c70cdea | ||
|
|
d6d6087543 | ||
|
|
d06e38bc19 | ||
|
|
cfc8eb0bbc | ||
|
|
b85f9b79c3 | ||
|
|
1b0045c737 | ||
|
|
3dc8d7d440 | ||
|
|
bf9ca48d64 | ||
|
|
70441f3d59 | ||
|
|
431f28e861 | ||
|
|
3b1fc095c4 | ||
|
|
9a6c7a29d0 | ||
|
|
c1d173f40e | ||
|
|
f03ec5df8c | ||
|
|
6c74a12636 | ||
|
|
39797803d3 | ||
|
|
c66c1e928d | ||
|
|
f934b641bb | ||
|
|
1128a11603 | ||
|
|
9f90718918 | ||
|
|
067a07fc00 | ||
|
|
1811cf045e | ||
|
|
270b4f429f | ||
|
|
380acbb55f | ||
|
|
c384f0b4fb | ||
|
|
27cf393a03 | ||
|
|
8831726913 | ||
|
|
2f4327874c | ||
|
|
483845962e | ||
|
|
c44b1d6349 | ||
|
|
79f28a142d | ||
|
|
02dd537cd9 | ||
|
|
5af1f14a0b | ||
|
|
664f59a9cc | ||
|
|
7d3641aab7 | ||
|
|
7924df4c67 | ||
|
|
68a8eed4af | ||
|
|
887db84ce7 | ||
|
|
05348fbfeb | ||
|
|
38eb6716f8 | ||
|
|
d7f9cd30eb | ||
|
|
922d041e0e | ||
|
|
76f4588c85 | ||
|
|
e163b92a7e | ||
|
|
11925a42b0 | ||
|
|
acf45530ca | ||
|
|
3792ad6abf | ||
|
|
bf98b307e8 | ||
|
|
d15392f41e | ||
|
|
f26a024255 | ||
|
|
bf9f894c0d | ||
|
|
53a7b7d1c5 | ||
|
|
a12a883cc6 | ||
|
|
0cf076b010 | ||
|
|
e2c712033f | ||
|
|
e38237ca8e | ||
|
|
1fff44fc6c | ||
|
|
4e50073e07 | ||
|
|
0ce64fe83f | ||
|
|
ef848aa93e | ||
|
|
67b287d75d | ||
|
|
b795dfd2c6 | ||
|
|
c68d855983 | ||
|
|
fb1c19e64b | ||
|
|
384c16e29d | ||
|
|
789982bd76 | ||
|
|
8bccc9de48 | ||
|
|
ec8584b4d2 | ||
|
|
54bd59fa2d | ||
|
|
b19f5f55f7 | ||
|
|
0964f25f97 | ||
|
|
5f3e6335c1 | ||
|
|
f30c894c87 | ||
|
|
bec769ac1b | ||
|
|
cb3748e06f | ||
|
|
d5a24f0a46 | ||
|
|
401a8241bd | ||
|
|
2193a7a863 | ||
|
|
e6bc4d7fda | ||
|
|
aee9f73316 | ||
|
|
aef7b4cea4 | ||
|
|
c9a8a3b91e | ||
|
|
0c7b11bdf8 | ||
|
|
8c151a5855 | ||
|
|
9b54fa9c14 | ||
|
|
99d7705404 | ||
|
|
eaa590b8e2 | ||
|
|
715fd8cf10 | ||
|
|
99a9709605 | ||
|
|
65d330d5ed | ||
|
|
1d1d389a03 | ||
|
|
0392389355 | ||
|
|
cf2a500a07 | ||
|
|
7d3748202e | ||
|
|
d7f90faea9 | ||
|
|
cb0066aac9 | ||
|
|
b48397b7a6 | ||
|
|
82ab8419e3 | ||
|
|
142a2414d3 | ||
|
|
081bd95f60 | ||
|
|
300aed0589 | ||
|
|
b2b23c66cf | ||
|
|
838bb6aa3d | ||
|
|
f14ecc5acb | ||
|
|
d533e23dc0 | ||
|
|
eefcf99364 | ||
|
|
1c0790bfb6 | ||
|
|
29e351ba78 | ||
|
|
7592c5c327 | ||
|
|
f5018204ab | ||
|
|
7ae74268fd | ||
|
|
52e959a7f5 | ||
|
|
4f03a2c276 | ||
|
|
bc4c96ee35 | ||
|
|
a866040fc1 | ||
|
|
c90fad268a | ||
|
|
8ef1f775f9 | ||
|
|
90af87339c |
4
.gitignore
vendored
4
.gitignore
vendored
@@ -8,6 +8,8 @@ dist
|
|||||||
*.log
|
*.log
|
||||||
.DS_Store
|
.DS_Store
|
||||||
|
|
||||||
# Applesauce Reference
|
# Reference Projects
|
||||||
applesauce
|
applesauce
|
||||||
|
primal-web-app
|
||||||
|
Amber
|
||||||
|
|
||||||
|
|||||||
77
Amber.md
Normal file
77
Amber.md
Normal file
@@ -0,0 +1,77 @@
|
|||||||
|
## Boris ↔ Amber bunker: current findings
|
||||||
|
|
||||||
|
- **Environment**
|
||||||
|
- Client: Boris (web) using `applesauce` stack (`NostrConnectSigner`, `RelayPool`).
|
||||||
|
- Bunker: Amber (mobile).
|
||||||
|
- We restored a `nostr-connect` account from localStorage and re-wired the signer to the app `RelayPool` before use.
|
||||||
|
|
||||||
|
## What we changed client-side
|
||||||
|
|
||||||
|
- **Signer wiring**
|
||||||
|
- Bound `NostrConnectSigner.subscriptionMethod/publishMethod` to the app `RelayPool` at startup.
|
||||||
|
- After deserialization, recreated the signer with pool context and merged its relays with app `RELAYS` (includes local relays).
|
||||||
|
- Opened the signer subscription and performed a guarded `connect()` with default permissions including `nip04_encrypt/decrypt` and `nip44_encrypt/decrypt`.
|
||||||
|
|
||||||
|
- **Probes and timeouts**
|
||||||
|
- Initial probe tried `decrypt('invalid-ciphertext')` → timed out.
|
||||||
|
- Switched to roundtrip probes: `encrypt(self, ... )` then `decrypt(self, cipher)` for both nip-44 and nip-04.
|
||||||
|
- Increased probe timeout from 3s → 10s; increased bookmark decrypt timeout from 15s → 30s.
|
||||||
|
|
||||||
|
- **Logging**
|
||||||
|
- Added logs for publish/subscribe and parsed the NIP-46 request content length.
|
||||||
|
- Confirmed NIP‑46 request events are kind `24133` with a single `p` tag (expected). The method is inside the encrypted content, so it prints as `method: undefined` (expected).
|
||||||
|
|
||||||
|
## Evidence from logs (client)
|
||||||
|
|
||||||
|
```
|
||||||
|
[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription
|
||||||
|
[bunker] 🔗 Signer relays merged with app RELAYS: (19) [...]
|
||||||
|
[bunker] subscribe via signer: { relays: [...], filters: [...] }
|
||||||
|
[bunker] ✅ Signer subscription opened
|
||||||
|
[bunker] publish via signer: { relays: [...], kind: 24133, tags: [['p', <remote>]], contentLength: 260|304|54704 }
|
||||||
|
[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
|
||||||
|
[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)… → probe timeout after 10000ms
|
||||||
|
bookmarkProcessing.ts: ❌ nip44.decrypt failed: Decrypt timeout after 30000ms
|
||||||
|
bookmarkProcessing.ts: ❌ nip04.decrypt failed: Decrypt timeout after 30000ms
|
||||||
|
```
|
||||||
|
|
||||||
|
Notes:
|
||||||
|
- Final signer status shows `listening: true`, `isConnected: true`, and requests are published to 19 relays (includes Amber’s).
|
||||||
|
|
||||||
|
## Evidence from Amber (device)
|
||||||
|
|
||||||
|
- Activity screen shows multiple entries for: “Encrypt data using nip 4” and “Encrypt data using nip 44” with green checkmarks.
|
||||||
|
- No entries for “Decrypt data using nip 4” or “Decrypt data using nip 44”.
|
||||||
|
|
||||||
|
## Interpretation
|
||||||
|
|
||||||
|
- Transport and publish paths are working: Boris is publishing NIP‑46 requests (kind 24133) and Amber receives them (ENCRYPT activity visible).
|
||||||
|
- The persistent failure is specific to DECRYPT handling: Amber does not show any DECRYPT activity and Boris receives no decrypt responses within 10–30s windows.
|
||||||
|
- Client-side wiring is likely correct (subscription open, permissions requested, relays merged). The remaining issue appears provider-side in Amber’s NIP‑46 decrypt handling or permission gating.
|
||||||
|
|
||||||
|
## Repro steps (quick)
|
||||||
|
|
||||||
|
1) Revoke Boris in Amber.
|
||||||
|
2) Reconnect with a fresh bunker URI; approve signing and both encrypt/decrypt scopes for nip‑04 and nip‑44.
|
||||||
|
3) Keep Amber unlocked and foregrounded.
|
||||||
|
4) Reload Boris; observe:
|
||||||
|
- Logs showing `publish via signer` for kind 24133.
|
||||||
|
- In Amber, activity should include “Decrypt data using nip 4/44”.
|
||||||
|
|
||||||
|
If DECRYPT entries still don’t appear:
|
||||||
|
|
||||||
|
- This points to Amber’s NIP‑46 provider not executing/authorizing `nip04_decrypt`/`nip44_decrypt` methods, or not publishing responses.
|
||||||
|
|
||||||
|
## Suggestions for Amber-side debugging
|
||||||
|
|
||||||
|
- Verify permission gating allows `nip04_decrypt` and `nip44_decrypt` (not just encrypt).
|
||||||
|
- Confirm the provider recognizes NIP‑46 methods `nip04_decrypt` and `nip44_decrypt` in the decrypted payload and routes them to decrypt routines.
|
||||||
|
- Ensure the response event is published back to the same relays and correctly addressed to the client (`p` tag set and content encrypted back to client pubkey).
|
||||||
|
- Add activity logging for “Decrypt …” attempts and failures to surface denial/exception states.
|
||||||
|
|
||||||
|
## Current conclusion
|
||||||
|
|
||||||
|
- Client is configured and publishing requests correctly; encryption proves end‑to‑end path is alive.
|
||||||
|
- The missing DECRYPT activity in Amber is the blocker. Fixing Amber’s NIP‑46 decrypt handling should resolve bookmark decryption in Boris without further client changes.
|
||||||
|
|
||||||
|
|
||||||
401
CHANGELOG.md
401
CHANGELOG.md
@@ -7,6 +7,393 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
## [Unreleased]
|
## [Unreleased]
|
||||||
|
|
||||||
|
## [0.6.24] - 2025-01-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- TypeScript global declarations for build-time defines
|
||||||
|
- Added proper type declarations for `__APP_VERSION__`, `__GIT_COMMIT__`, `__GIT_BRANCH__`, `__BUILD_TIME__`, and `__GIT_COMMIT_URL__`
|
||||||
|
- Resolved ESLint no-undef errors for build-time injected variables
|
||||||
|
- Added Node.js environment hint to Vite configuration
|
||||||
|
|
||||||
|
## [0.6.23] - 2025-01-16
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Deep-link refresh redirect issue for nostr-native articles
|
||||||
|
- Limited `/a/:naddr` rewrite to bot user-agents only in Vercel configuration
|
||||||
|
- Real browsers now hit the SPA directly, preventing redirect to root path
|
||||||
|
- Bot crawlers still receive proper OpenGraph metadata for social sharing
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Version and git commit information in Settings footer
|
||||||
|
- Displays app version and short commit hash with link to GitHub
|
||||||
|
- Build-time metadata injection via Vite configuration
|
||||||
|
- Subtle footer styling with selectable text
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Article OG handler now uses proper RelayPool.request() API
|
||||||
|
- Aligned with applesauce RelayPool interface
|
||||||
|
- Removed deprecated open/close methods
|
||||||
|
- Fixed TypeScript linting errors
|
||||||
|
|
||||||
|
### Technical
|
||||||
|
|
||||||
|
- Added debug logging for route state and article OG handler
|
||||||
|
- Gated by `?debug=1` query parameter for production testing
|
||||||
|
- Structured logging for troubleshooting deep-link issues
|
||||||
|
- Temporary debug components for validation
|
||||||
|
|
||||||
|
## [0.6.22] - 2025-10-16
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Dynamic OpenGraph and Twitter Card meta tags for article deep-links
|
||||||
|
- Social media platforms display article title, author, cover image, and summary when sharing `/a/{naddr}` links
|
||||||
|
- Serverless endpoint fetches article metadata from Nostr relays (kind:30023) and author profiles (kind:0)
|
||||||
|
- User-agent detection serves appropriate content to crawlers vs browsers
|
||||||
|
- Falls back to default social preview image when articles have no cover image
|
||||||
|
- Social preview image for homepage and article links
|
||||||
|
- Added `boris-social-1200.png` as default OpenGraph image (1200x630)
|
||||||
|
- Homepage now includes social preview image in meta tags
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Article deep-links now properly preserve URL when loading in browser
|
||||||
|
- Uses `history.replaceState()` to maintain correct article path
|
||||||
|
- Browser navigation works correctly on refresh and new tab opens
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Vercel rewrite configuration for article routes
|
||||||
|
- Routes `/a/:naddr` to serverless OG endpoint for dynamic meta tags
|
||||||
|
- Regular SPA routing preserved for browser navigation
|
||||||
|
|
||||||
|
## [0.6.21] - 2025-10-16
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Reading position sync across devices using Nostr Kind 30078 (NIP-78)
|
||||||
|
- Automatically saves and syncs reading position as you scroll
|
||||||
|
- Visual reading progress indicator on article cards
|
||||||
|
- Reading progress shown in Explore and Bookmarks sidebar
|
||||||
|
- Auto-scroll to last reading position setting (configurable in Settings)
|
||||||
|
- Reading position displayed as colored progress bar on cards
|
||||||
|
- Reading progress filters for organizing articles
|
||||||
|
- Filter by reading state: Unopened, Started (0-10%), Reading (11-94%), Completed (95-100% or marked as read)
|
||||||
|
- Filter icons colored when active (blue for most, green for completed)
|
||||||
|
- URL routing support for reading progress filters
|
||||||
|
- Reading progress filters available in Archive tab and bookmarks sidebar
|
||||||
|
- Reads and Links tabs on `/me` page
|
||||||
|
- Reads tab shows nostr-native articles with reading progress
|
||||||
|
- Links tab shows external URLs with reading progress
|
||||||
|
- Both tabs populate instantly from bookmarks for fast loading
|
||||||
|
- Lazy loading for improved performance
|
||||||
|
- Auto-mark as read at 100% reading progress
|
||||||
|
- Articles automatically marked as read when scrolled to end
|
||||||
|
- Marked-as-read articles treated as 100% progress
|
||||||
|
- Fancy checkmark animation on Mark as Read button
|
||||||
|
- Click-to-open article navigation on highlights
|
||||||
|
- Clicking highlights in Explore and Me pages opens the source article
|
||||||
|
- Automatically scrolls to highlighted text position
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Renamed Archive to Reads with expanded functionality
|
||||||
|
- Merged 'Completed' and 'Marked as Read' filters into one unified filter
|
||||||
|
- Simplified filter icon colors to blue (except green for completed)
|
||||||
|
- Started reading progress state (0-10%) uses neutral text color
|
||||||
|
- Replace spinners with skeleton placeholders during refresh in Archive/Reads/Links tabs
|
||||||
|
- Removed unused IEventStore import in ContentPanel
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Reading position calculation now accurately reaches 100%
|
||||||
|
- Reading position filters work correctly in bookmarks sidebar
|
||||||
|
- Filter out reads without timestamps or 'Untitled' items
|
||||||
|
- Show skeleton placeholders correctly during initial tab load
|
||||||
|
- External URLs in Reads tab only shown if they have reading progress
|
||||||
|
- Reading progress merges even when timestamp is older than bookmark
|
||||||
|
- Resolved all linter errors and TypeScript type issues
|
||||||
|
|
||||||
|
### Refactored
|
||||||
|
|
||||||
|
- Renamed ArchiveFilters component to ReadingProgressFilters
|
||||||
|
- Extracted shared utilities from readsFromBookmarks for DRY code
|
||||||
|
- Use setState callback pattern for background enrichment
|
||||||
|
- Use naddr format for article IDs to match reading positions
|
||||||
|
- Extract article titles, images, summaries from bookmark tags using applesauce helpers
|
||||||
|
|
||||||
|
## [0.6.20] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Bookmark filter buttons by content type (articles, videos, images, web links)
|
||||||
|
- Filter bookmarks by their content type on bookmarks sidebar
|
||||||
|
- Filters also available on `/me` page bookmarks tab
|
||||||
|
- Separate filter for external articles with link icon
|
||||||
|
- Multiple filters can be active simultaneously
|
||||||
|
- Private Bookmarks section for encrypted legacy bookmarks
|
||||||
|
- Encrypted legacy bookmarks now grouped in separate section
|
||||||
|
- Better organization and clarity for different bookmark types
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Bookmark section labels improved for clarity
|
||||||
|
- More descriptive section headings throughout
|
||||||
|
- Better categorization of bookmark types
|
||||||
|
- Bookmark filter button styling refined
|
||||||
|
- Reduced whitespace around bookmark filters for cleaner layout
|
||||||
|
- Dramatically reduced whitespace on both sidebar and `/me` page
|
||||||
|
- Lock icon removed from individual bookmarks
|
||||||
|
- Encryption status now indicated by section grouping
|
||||||
|
- Cleaner bookmark item appearance
|
||||||
|
- External article icon changed to link icon (`faLink`)
|
||||||
|
- More intuitive icon for external content
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Highlight button positioning and visibility
|
||||||
|
- Fixed to viewport for consistent placement
|
||||||
|
- Sticky and always visible when needed
|
||||||
|
- Properly positioned inside reader pane
|
||||||
|
|
||||||
|
## [0.6.19] - 2025-10-15
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Highlights disappearing on external URLs after a few seconds
|
||||||
|
- Fixed `useBookmarksData` from fetching general highlights when viewing external URLs
|
||||||
|
- External URL highlights now managed exclusively by `useExternalUrlLoader`
|
||||||
|
- Removed redundant `setHighlights` call that was overwriting streamed highlights
|
||||||
|
- Improved error handling in `fetchHighlightsForUrl` to prevent silent failures
|
||||||
|
- Isolated rebroadcast errors so they don't break highlight display
|
||||||
|
- Added logging to help diagnose highlight fetching issues
|
||||||
|
|
||||||
|
## [0.6.18] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Zap split labels simplified and terminology updated
|
||||||
|
- Removed redundant "Weight: xy" label to save space
|
||||||
|
- Changed "Author(s) Share" to "Author's Share" (possessive singular)
|
||||||
|
- Changed "Support Boris" to "Boris' Share" for consistency
|
||||||
|
- Weight value now shown directly in label (e.g., "Your Share: 50")
|
||||||
|
- Share and percentage now displayed on same line for cleaner layout
|
||||||
|
- Zap preset buttons on desktop now expand to match slider width
|
||||||
|
- Added `flex: 1` to buttons for equal width distribution
|
||||||
|
- Buttons still wrap properly on smaller screens
|
||||||
|
- PWA install section now always visible in settings
|
||||||
|
- Section shows regardless of installation or device capability status
|
||||||
|
- Button adapts with proper disabled states and visual feedback
|
||||||
|
- "Installed" state shows checkmark icon and disabled button
|
||||||
|
- Non-installable state shows disabled button
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- PWA install button now properly disabled when installation is not possible on device
|
||||||
|
- Button only enabled when browser fires `beforeinstallprompt` event
|
||||||
|
- Removed hardcoded testing state that always showed button as installable
|
||||||
|
- App & Airplane Mode section now always visible regardless of PWA status
|
||||||
|
- Image cache and local relay settings always accessible
|
||||||
|
- Previously entire section was hidden if PWA not installable/installed
|
||||||
|
- Only PWA-specific install button is conditionally affected
|
||||||
|
|
||||||
|
## [0.6.17] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- PWA settings illustration (`pwa.svg`) displayed on right side of section
|
||||||
|
- Responsive design: hidden on mobile, 30% width on desktop
|
||||||
|
- Visual enhancement for App & Airplane Mode section
|
||||||
|
- Zaps illustration (`zaps.svg`) displayed on right side of Zap Splits section
|
||||||
|
- Matching responsive layout and styling as PWA illustration
|
||||||
|
- Visual 50% indicators on zap split sliders
|
||||||
|
- Linear gradient background using highlight colors (yellow/orange) at 50% opacity
|
||||||
|
- Datalist tick marks at 50% for "Your Share" and "Author(s) Share" sliders
|
||||||
|
- Tick mark at 5 for "Support Boris" slider
|
||||||
|
- Lightning bolt icons as slider thumbs for zap splits
|
||||||
|
- Replaces default circular slider handles
|
||||||
|
- White lightning bolt SVG embedded in slider thumb background
|
||||||
|
- 24px square thumb with 4px border radius
|
||||||
|
- Offline-first description paragraph at beginning of App & Airplane Mode section
|
||||||
|
- Explains Boris's offline capabilities upfront
|
||||||
|
- Settings page width constraint (900px max-width)
|
||||||
|
- Matches article view max-width for consistent reading experience
|
||||||
|
- Centered layout with proper margins
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Settings section reorganization
|
||||||
|
- "PWA & Flight Mode" merged into single "App & Airplane Mode" section
|
||||||
|
- "Layout & Navigation" and "Startup & Behavior" merged into "Layout & Behavior"
|
||||||
|
- Section order: Theme → Reading & Display → Zap Splits → Layout & Behavior → App & Airplane Mode → Relays
|
||||||
|
- "Startup & Behavior" moved after "Zap Splits"
|
||||||
|
- "Layout & Navigation" moved below "Zap Splits"
|
||||||
|
- PWA settings section restructure
|
||||||
|
- Checkboxes moved to top (image cache, local relays)
|
||||||
|
- Descriptive paragraphs in middle
|
||||||
|
- Install button at bottom
|
||||||
|
- Note about local relays moved before install paragraph
|
||||||
|
- Zap split sliders styling
|
||||||
|
- Left side (0-50%): highlight color (yellow) at 50% opacity
|
||||||
|
- Right side (50-100%): friend-highlight color (orange) at 50% opacity
|
||||||
|
- Creates visual distinction tied to app's highlight color scheme
|
||||||
|
- Zap split description text styling
|
||||||
|
- Now matches offline-first paragraph style with secondary color and smaller font size
|
||||||
|
- Clear cache button styling
|
||||||
|
- Replaced `IconButton` with plain `FontAwesomeIcon` for subtler appearance
|
||||||
|
- No border or background, just icon with opacity
|
||||||
|
- Font Size buttons alignment
|
||||||
|
- Now properly align to the right using `setting-control` wrapper
|
||||||
|
- Matches alignment of highlight color picker buttons
|
||||||
|
- Default Highlight Visibility position
|
||||||
|
- Moved back to original position after "Paragraph Alignment"
|
||||||
|
- Grouped with other reading display controls
|
||||||
|
- Spacing adjustments in App & Airplane Mode section
|
||||||
|
- Reduced gap between elements from 1rem → 0.5rem → 0.25rem for tighter layout
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- PWA settings paragraph wrapping
|
||||||
|
- Moved offline-first paragraph inside flex container to prevent extending above image
|
||||||
|
- Font Size buttons alignment issues
|
||||||
|
- Properly implemented `setting-control` wrapper for right alignment
|
||||||
|
- Previously attempted alignment didn't work correctly
|
||||||
|
- Slider thumb icon centering
|
||||||
|
- Lightning bolt icons properly centered vertically on slider
|
||||||
|
- Added `position: relative`, `top: 0`, `margin-top: 0` for accurate positioning
|
||||||
|
|
||||||
|
## [0.6.16] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Replaced delete dialog popup with inline confirmation UI
|
||||||
|
- Shows red "Confirm?" text with trash icon when delete is clicked
|
||||||
|
- Clicking the red trash icon confirms deletion
|
||||||
|
- No more modal overlay or backdrop
|
||||||
|
- Click outside or reopen menu to cancel
|
||||||
|
- Reordered Reading & Display settings for better organization
|
||||||
|
- Highlight Style, Paragraph Alignment, and Default Highlight Visibility moved to top
|
||||||
|
- Followed by Reading Font, Font Size, and color pickers
|
||||||
|
- Setting buttons now align vertically with fixed label width (220px)
|
||||||
|
- Creates consistent "tab stops" for cleaner visual alignment
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Removed unused `handleCancelDelete` function after dialog removal
|
||||||
|
|
||||||
|
## [0.6.15] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Paragraph alignment setting with left-aligned and justified text options
|
||||||
|
- Icon buttons in Reading & Display settings for switching alignment
|
||||||
|
- CSS variable system for applying alignment to reader content
|
||||||
|
- Real-time preview of alignment changes in settings
|
||||||
|
- Headings remain left-aligned for optimal readability
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Default paragraph alignment changed to justified for improved reading experience
|
||||||
|
- Applies to paragraphs, list items, divs, and blockquotes
|
||||||
|
- Settings stored and synced via Nostr (NIP-78)
|
||||||
|
|
||||||
|
## [0.6.14] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for bookmark sets (NIP-51 kind:30003)
|
||||||
|
- Bookmark sets now display alongside regular bookmark lists
|
||||||
|
- Properly handles AddressPointer bookmarks for long-form articles
|
||||||
|
- Content type icons for bookmarks
|
||||||
|
- Article, video, web, and image icons to indicate bookmark content type
|
||||||
|
- Camera icon for image bookmarks
|
||||||
|
- Sticky note icon for text-only bookmarks without URLs
|
||||||
|
- Bookmark grouping and sections
|
||||||
|
- Grouped sections in sidebar and `/me` reading-list
|
||||||
|
- Web bookmarks, default bookmarks, and legacy bookmarks in separate sections
|
||||||
|
- Grouping and sorting helpers for organizing bookmark sections
|
||||||
|
- Adaptive text color for publication date over hero images
|
||||||
|
- Automatically detects image brightness and adjusts text color
|
||||||
|
- Improved contrast for better readability
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Renamed "Amethyst-style bookmarks" to "Old Bookmarks (Legacy)"
|
||||||
|
- Hide cover images in compact view for cleaner layout
|
||||||
|
- Support button improvements
|
||||||
|
- Moved to bottom-left of bookmarks bar
|
||||||
|
- Changed icon from lightning bolt to heart (orange color)
|
||||||
|
- Left-aligned support button, right-aligned view mode buttons
|
||||||
|
- Section headings improved with better typography (removed counts)
|
||||||
|
- Icon changed from book to file-lines for default bookmarks
|
||||||
|
- Use regular (outlined) icon variants for lighter, more refined appearance
|
||||||
|
- Add bookmark button moved to web bookmarks section
|
||||||
|
- Empty state messages replaced with loading spinners
|
||||||
|
- Section dividers made more subtle
|
||||||
|
- Simplified bookmark filtering to only exclude empty content
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Removed borders from compact bookmark cards for cleaner look
|
||||||
|
- Removed duplicate type indicator icons from bookmark cards
|
||||||
|
- Reduced section heading bottom padding for better spacing
|
||||||
|
- Aligned add bookmark button with section heading
|
||||||
|
- Removed redundant loading spinner above tabs
|
||||||
|
- Resolved linter and type errors
|
||||||
|
- Include kind:30003 in default bookmark list detection
|
||||||
|
- Removed text shadows from publication date for cleaner look
|
||||||
|
- Improved shadow contrast without background overlay
|
||||||
|
- Corrected async handling in adaptive color detection
|
||||||
|
- Corrected FastAverageColor import to use named export
|
||||||
|
- Section heading styles now properly override with `!important`
|
||||||
|
- Removed unused articleImage prop from CompactView
|
||||||
|
|
||||||
|
## [0.6.13] - 2025-10-15
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Support for `nprofile` identifiers on `/p/` profile pages (NIP-19)
|
||||||
|
- Profile pages now accept both `npub` and `nprofile` identifiers
|
||||||
|
- Extracts pubkey from nprofile data structure
|
||||||
|
- Users can share profiles with relay metadata included
|
||||||
|
- Gradient placeholder images for articles without cover images
|
||||||
|
- Blog post cards show subtle diagonal gradient using theme colors
|
||||||
|
- Reader view displays gradient background with newspaper icon
|
||||||
|
- Placeholders adapt automatically to light/dark themes
|
||||||
|
- Large view bookmarks use matching gradient backgrounds
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- PWA install section styling in settings
|
||||||
|
- Heading now matches other section headings with proper styling
|
||||||
|
- Install button uses standard app button styling instead of custom gradient
|
||||||
|
- Consistent with app's design system and theme colors
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Mobile bookmark button visibility across all pages
|
||||||
|
- Now visible on `/p/` (profile), `/explore`, `/me`, and `/support` pages
|
||||||
|
- Only hidden on settings page or when scrolling down while reading
|
||||||
|
- Prevents users from getting stuck without navigation options
|
||||||
|
- Mobile highlights button behavior at page top
|
||||||
|
- Hidden when scrolled to the very top of the page
|
||||||
|
- Appears when scrolling up from below
|
||||||
|
- Bookmark button remains visible at top (only hides on scroll down)
|
||||||
|
- Separate visibility logic for each button improves UX
|
||||||
|
|
||||||
|
## [0.6.12] - 2025-10-15
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Horizontal dividers (`<hr>`) in blog posts now display with more subtle styling
|
||||||
|
- Reduced visual weight with 69% opacity for better readability
|
||||||
|
- Added increased vertical padding (2.5rem) above and below dividers
|
||||||
|
- Improved visual separation without disrupting reading flow
|
||||||
|
|
||||||
## [0.6.11] - 2025-10-15
|
## [0.6.11] - 2025-10-15
|
||||||
|
|
||||||
### Added
|
### Added
|
||||||
@@ -1373,7 +1760,19 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
- Optimize relay usage following applesauce-relay best practices
|
- Optimize relay usage following applesauce-relay best practices
|
||||||
- Use applesauce-react event models for better profile handling
|
- Use applesauce-react event models for better profile handling
|
||||||
|
|
||||||
[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.11...HEAD
|
[Unreleased]: https://github.com/dergigi/boris/compare/v0.6.24...HEAD
|
||||||
|
[0.6.24]: https://github.com/dergigi/boris/compare/v0.6.23...v0.6.24
|
||||||
|
[0.6.23]: https://github.com/dergigi/boris/compare/v0.6.22...v0.6.23
|
||||||
|
[0.6.21]: https://github.com/dergigi/boris/compare/v0.6.20...v0.6.21
|
||||||
|
[0.6.20]: https://github.com/dergigi/boris/compare/v0.6.19...v0.6.20
|
||||||
|
[0.6.19]: https://github.com/dergigi/boris/compare/v0.6.18...v0.6.19
|
||||||
|
[0.6.18]: https://github.com/dergigi/boris/compare/v0.6.17...v0.6.18
|
||||||
|
[0.6.17]: https://github.com/dergigi/boris/compare/v0.6.16...v0.6.17
|
||||||
|
[0.6.16]: https://github.com/dergigi/boris/compare/v0.6.15...v0.6.16
|
||||||
|
[0.6.15]: https://github.com/dergigi/boris/compare/v0.6.14...v0.6.15
|
||||||
|
[0.6.14]: https://github.com/dergigi/boris/compare/v0.6.13...v0.6.14
|
||||||
|
[0.6.13]: https://github.com/dergigi/boris/compare/v0.6.12...v0.6.13
|
||||||
|
[0.6.12]: https://github.com/dergigi/boris/compare/v0.6.11...v0.6.12
|
||||||
[0.6.11]: https://github.com/dergigi/boris/compare/v0.6.10...v0.6.11
|
[0.6.11]: https://github.com/dergigi/boris/compare/v0.6.10...v0.6.11
|
||||||
[0.6.10]: https://github.com/dergigi/boris/compare/v0.6.9...v0.6.10
|
[0.6.10]: https://github.com/dergigi/boris/compare/v0.6.9...v0.6.10
|
||||||
[0.6.9]: https://github.com/dergigi/boris/compare/v0.6.8...v0.6.9
|
[0.6.9]: https://github.com/dergigi/boris/compare/v0.6.8...v0.6.9
|
||||||
|
|||||||
304
api/article-og.ts
Normal file
304
api/article-og.ts
Normal file
@@ -0,0 +1,304 @@
|
|||||||
|
import type { VercelRequest, VercelResponse } from '@vercel/node'
|
||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
import { AddressPointer } from 'nostr-tools/nip19'
|
||||||
|
import { NostrEvent, Filter } from 'nostr-tools'
|
||||||
|
import { Helpers } from 'applesauce-core'
|
||||||
|
|
||||||
|
const { getArticleTitle, getArticleImage, getArticleSummary } = Helpers
|
||||||
|
|
||||||
|
// Relay configuration (from src/config/relays.ts)
|
||||||
|
const RELAYS = [
|
||||||
|
'wss://relay.damus.io',
|
||||||
|
'wss://nos.lol',
|
||||||
|
'wss://relay.nostr.band',
|
||||||
|
'wss://relay.dergigi.com',
|
||||||
|
'wss://wot.dergigi.com',
|
||||||
|
'wss://relay.snort.social',
|
||||||
|
'wss://relay.current.fyi',
|
||||||
|
'wss://nostr-pub.wellorder.net',
|
||||||
|
'wss://purplepag.es',
|
||||||
|
'wss://relay.primal.net'
|
||||||
|
]
|
||||||
|
|
||||||
|
type CacheEntry = {
|
||||||
|
html: string
|
||||||
|
expires: number
|
||||||
|
}
|
||||||
|
|
||||||
|
const WEEK_MS = 7 * 24 * 60 * 60 * 1000
|
||||||
|
const memoryCache = new Map<string, CacheEntry>()
|
||||||
|
|
||||||
|
function escapeHtml(text: string): string {
|
||||||
|
return text
|
||||||
|
.replace(/&/g, '&')
|
||||||
|
.replace(/</g, '<')
|
||||||
|
.replace(/>/g, '>')
|
||||||
|
.replace(/"/g, '"')
|
||||||
|
.replace(/'/g, ''')
|
||||||
|
}
|
||||||
|
|
||||||
|
function setCacheHeaders(res: VercelResponse, maxAge: number = 86400): void {
|
||||||
|
res.setHeader('Cache-Control', `public, max-age=${maxAge}, s-maxage=604800`)
|
||||||
|
res.setHeader('Content-Type', 'text/html; charset=utf-8')
|
||||||
|
}
|
||||||
|
|
||||||
|
interface ArticleMetadata {
|
||||||
|
title: string
|
||||||
|
summary: string
|
||||||
|
image: string
|
||||||
|
author: string
|
||||||
|
published?: number
|
||||||
|
}
|
||||||
|
|
||||||
|
async function fetchEventsFromRelays(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
relayUrls: string[],
|
||||||
|
filter: Filter,
|
||||||
|
timeoutMs: number
|
||||||
|
): Promise<NostrEvent[]> {
|
||||||
|
const events: NostrEvent[] = []
|
||||||
|
|
||||||
|
await new Promise<void>((resolve) => {
|
||||||
|
const timeout = setTimeout(() => resolve(), timeoutMs)
|
||||||
|
|
||||||
|
// `request` emits NostrEvent objects directly
|
||||||
|
relayPool.request(relayUrls, filter).subscribe({
|
||||||
|
next: (event) => {
|
||||||
|
events.push(event)
|
||||||
|
},
|
||||||
|
error: () => resolve(),
|
||||||
|
complete: () => {
|
||||||
|
clearTimeout(timeout)
|
||||||
|
resolve()
|
||||||
|
}
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
|
// Sort by created_at and return most recent first
|
||||||
|
return events.sort((a, b) => b.created_at - a.created_at)
|
||||||
|
}
|
||||||
|
|
||||||
|
async function fetchArticleMetadata(naddr: string): Promise<ArticleMetadata | null> {
|
||||||
|
const relayPool = new RelayPool()
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Decode naddr
|
||||||
|
const decoded = nip19.decode(naddr)
|
||||||
|
if (decoded.type !== 'naddr') {
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const pointer = decoded.data as AddressPointer
|
||||||
|
|
||||||
|
// Determine relay URLs
|
||||||
|
const relayUrls = pointer.relays && pointer.relays.length > 0 ? pointer.relays : RELAYS
|
||||||
|
|
||||||
|
// Fetch article and profile in parallel
|
||||||
|
const [articleEvents, profileEvents] = await Promise.all([
|
||||||
|
fetchEventsFromRelays(relayPool, relayUrls, {
|
||||||
|
kinds: [pointer.kind],
|
||||||
|
authors: [pointer.pubkey],
|
||||||
|
'#d': [pointer.identifier || '']
|
||||||
|
}, 5000),
|
||||||
|
fetchEventsFromRelays(relayPool, relayUrls, {
|
||||||
|
kinds: [0],
|
||||||
|
authors: [pointer.pubkey]
|
||||||
|
}, 3000)
|
||||||
|
])
|
||||||
|
|
||||||
|
if (articleEvents.length === 0) {
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const article = articleEvents[0]
|
||||||
|
|
||||||
|
// Extract article metadata
|
||||||
|
const title = getArticleTitle(article) || 'Untitled Article'
|
||||||
|
const summary = getArticleSummary(article) || 'Read this article on Boris'
|
||||||
|
const image = getArticleImage(article) || '/boris-social-1200.png'
|
||||||
|
|
||||||
|
// Extract author name from profile
|
||||||
|
let authorName = pointer.pubkey.slice(0, 8) + '...'
|
||||||
|
if (profileEvents.length > 0) {
|
||||||
|
try {
|
||||||
|
const profileData = JSON.parse(profileEvents[0].content)
|
||||||
|
authorName = profileData.display_name || profileData.name || authorName
|
||||||
|
} catch {
|
||||||
|
// Use fallback
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
title,
|
||||||
|
summary,
|
||||||
|
image,
|
||||||
|
author: authorName,
|
||||||
|
published: article.created_at
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to fetch article metadata:', err)
|
||||||
|
return null
|
||||||
|
} finally {
|
||||||
|
// No explicit close needed; pool manages connections internally
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
function generateHtml(naddr: string, meta: ArticleMetadata | null): string {
|
||||||
|
const baseUrl = 'https://read.withboris.com'
|
||||||
|
const articleUrl = `${baseUrl}/a/${naddr}`
|
||||||
|
|
||||||
|
const title = meta?.title || 'Boris – Nostr Bookmarks'
|
||||||
|
const description = meta?.summary || 'Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights.'
|
||||||
|
const image = meta?.image?.startsWith('http') ? meta.image : `${baseUrl}${meta?.image || '/boris-social-1200.png'}`
|
||||||
|
const author = meta?.author || 'Boris'
|
||||||
|
|
||||||
|
return `<!doctype html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="UTF-8" />
|
||||||
|
<link rel="icon" type="image/x-icon" href="/favicon.ico" />
|
||||||
|
<link rel="icon" type="image/png" sizes="32x32" href="/favicon-32x32.png" />
|
||||||
|
<link rel="icon" type="image/png" sizes="16x16" href="/favicon-16x16.png" />
|
||||||
|
<link rel="apple-touch-icon" sizes="180x180" href="/apple-touch-icon.png" />
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1, viewport-fit=cover" />
|
||||||
|
<meta name="theme-color" content="#0f172a" />
|
||||||
|
<link rel="manifest" href="/manifest.webmanifest" />
|
||||||
|
<title>${escapeHtml(title)}</title>
|
||||||
|
<meta name="description" content="${escapeHtml(description)}" />
|
||||||
|
<link rel="canonical" href="${articleUrl}" />
|
||||||
|
|
||||||
|
<!-- Open Graph / Social Media -->
|
||||||
|
<meta property="og:type" content="article" />
|
||||||
|
<meta property="og:url" content="${articleUrl}" />
|
||||||
|
<meta property="og:title" content="${escapeHtml(title)}" />
|
||||||
|
<meta property="og:description" content="${escapeHtml(description)}" />
|
||||||
|
<meta property="og:image" content="${escapeHtml(image)}" />
|
||||||
|
<meta property="og:site_name" content="Boris" />
|
||||||
|
${meta?.published ? `<meta property="article:published_time" content="${new Date(meta.published * 1000).toISOString()}" />` : ''}
|
||||||
|
<meta property="article:author" content="${escapeHtml(author)}" />
|
||||||
|
|
||||||
|
<!-- Twitter Card -->
|
||||||
|
<meta name="twitter:card" content="summary_large_image" />
|
||||||
|
<meta name="twitter:url" content="${articleUrl}" />
|
||||||
|
<meta name="twitter:title" content="${escapeHtml(title)}" />
|
||||||
|
<meta name="twitter:description" content="${escapeHtml(description)}" />
|
||||||
|
<meta name="twitter:image" content="${escapeHtml(image)}" />
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<noscript>
|
||||||
|
<p>Redirecting to <a href="/">Boris</a>...</p>
|
||||||
|
</noscript>
|
||||||
|
</body>
|
||||||
|
</html>`
|
||||||
|
}
|
||||||
|
|
||||||
|
function isCrawler(userAgent: string | undefined): boolean {
|
||||||
|
if (!userAgent) return false
|
||||||
|
const crawlers = [
|
||||||
|
'bot', 'crawl', 'spider', 'slurp', 'facebook', 'twitter', 'linkedin',
|
||||||
|
'whatsapp', 'telegram', 'slack', 'discord', 'preview'
|
||||||
|
]
|
||||||
|
const ua = userAgent.toLowerCase()
|
||||||
|
return crawlers.some(crawler => ua.includes(crawler))
|
||||||
|
}
|
||||||
|
|
||||||
|
export default async function handler(req: VercelRequest, res: VercelResponse) {
|
||||||
|
const naddr = (req.query.naddr as string | undefined)?.trim()
|
||||||
|
|
||||||
|
if (!naddr) {
|
||||||
|
return res.status(400).json({ error: 'Missing naddr parameter' })
|
||||||
|
}
|
||||||
|
|
||||||
|
const userAgent = req.headers['user-agent'] as string | undefined
|
||||||
|
const isCrawlerRequest = isCrawler(userAgent)
|
||||||
|
|
||||||
|
const debugEnabled = req.query.debug === '1' || req.headers['x-boris-debug'] === '1'
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] request', JSON.stringify({
|
||||||
|
naddr,
|
||||||
|
ua: userAgent || null,
|
||||||
|
isCrawlerRequest,
|
||||||
|
path: req.url || null
|
||||||
|
}))
|
||||||
|
res.setHeader('X-Boris-Debug', '1')
|
||||||
|
}
|
||||||
|
|
||||||
|
// If it's a regular browser (not a bot), serve HTML that loads SPA
|
||||||
|
// Use history.replaceState to set the URL before the SPA boots
|
||||||
|
if (!isCrawlerRequest) {
|
||||||
|
const articlePath = `/a/${naddr}`
|
||||||
|
// Serve a minimal HTML that sets up the URL and loads the SPA
|
||||||
|
const html = `<!DOCTYPE html>
|
||||||
|
<html lang="en">
|
||||||
|
<head>
|
||||||
|
<meta charset="UTF-8">
|
||||||
|
<link rel="icon" type="image/x-icon" href="/favicon.ico">
|
||||||
|
<meta name="viewport" content="width=device-width, initial-scale=1">
|
||||||
|
<title>Boris - Loading Article...</title>
|
||||||
|
<script>
|
||||||
|
// Set the URL to the article path before SPA loads
|
||||||
|
if (window.location.pathname !== '${articlePath}') {
|
||||||
|
history.replaceState(null, '', '${articlePath}');
|
||||||
|
}
|
||||||
|
</script>
|
||||||
|
${debugEnabled ? `<script>console.debug('article-og', { mode: 'browser', naddr: '${naddr}', path: location.pathname, referrer: document.referrer });</script>` : ''}
|
||||||
|
<script>
|
||||||
|
// Redirect to index.html which will load the SPA
|
||||||
|
// The history state is already set, so SPA will see the correct URL
|
||||||
|
window.location.replace('/');
|
||||||
|
</script>
|
||||||
|
</head>
|
||||||
|
<body>
|
||||||
|
<div id="root"></div>
|
||||||
|
</body>
|
||||||
|
</html>`
|
||||||
|
|
||||||
|
res.setHeader('Content-Type', 'text/html; charset=utf-8')
|
||||||
|
res.setHeader('Cache-Control', 'no-cache, no-store, must-revalidate')
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'browser', naddr }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check cache for bots/crawlers
|
||||||
|
const now = Date.now()
|
||||||
|
const cached = memoryCache.get(naddr)
|
||||||
|
if (cached && cached.expires > now) {
|
||||||
|
setCacheHeaders(res)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: true }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(cached.html)
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch metadata
|
||||||
|
const meta = await fetchArticleMetadata(naddr)
|
||||||
|
|
||||||
|
// Generate HTML
|
||||||
|
const html = generateHtml(naddr, meta)
|
||||||
|
|
||||||
|
// Cache the result
|
||||||
|
memoryCache.set(naddr, { html, expires: now + WEEK_MS })
|
||||||
|
|
||||||
|
// Send response
|
||||||
|
setCacheHeaders(res)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot', naddr, cache: false }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Error generating article OG HTML:', err)
|
||||||
|
|
||||||
|
// Fallback to basic HTML with SPA boot
|
||||||
|
const html = generateHtml(naddr, null)
|
||||||
|
setCacheHeaders(res, 3600)
|
||||||
|
if (debugEnabled) {
|
||||||
|
console.log('[article-og] response', JSON.stringify({ mode: 'bot-fallback', naddr }))
|
||||||
|
}
|
||||||
|
return res.status(200).send(html)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@@ -18,6 +18,7 @@
|
|||||||
<meta property="og:url" content="https://read.withboris.com/" />
|
<meta property="og:url" content="https://read.withboris.com/" />
|
||||||
<meta property="og:title" content="Boris - Nostr Bookmarks" />
|
<meta property="og:title" content="Boris - Nostr Bookmarks" />
|
||||||
<meta property="og:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
<meta property="og:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
||||||
|
<meta property="og:image" content="https://read.withboris.com/boris-social-1200.png" />
|
||||||
<meta property="og:site_name" content="Boris" />
|
<meta property="og:site_name" content="Boris" />
|
||||||
|
|
||||||
<!-- Twitter Card -->
|
<!-- Twitter Card -->
|
||||||
@@ -25,6 +26,7 @@
|
|||||||
<meta name="twitter:url" content="https://read.withboris.com/" />
|
<meta name="twitter:url" content="https://read.withboris.com/" />
|
||||||
<meta name="twitter:title" content="Boris - Nostr Bookmarks" />
|
<meta name="twitter:title" content="Boris - Nostr Bookmarks" />
|
||||||
<meta name="twitter:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
<meta name="twitter:description" content="Your reading list for the Nostr world. A minimal nostr client for bookmark management with highlights." />
|
||||||
|
<meta name="twitter:image" content="https://read.withboris.com/boris-social-1200.png" />
|
||||||
|
|
||||||
<!-- Default to system theme until settings load from Nostr -->
|
<!-- Default to system theme until settings load from Nostr -->
|
||||||
<script>
|
<script>
|
||||||
|
|||||||
14
package-lock.json
generated
14
package-lock.json
generated
@@ -1,12 +1,12 @@
|
|||||||
{
|
{
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.9",
|
"version": "0.6.13",
|
||||||
"lockfileVersion": 3,
|
"lockfileVersion": 3,
|
||||||
"requires": true,
|
"requires": true,
|
||||||
"packages": {
|
"packages": {
|
||||||
"": {
|
"": {
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.9",
|
"version": "0.6.13",
|
||||||
"dependencies": {
|
"dependencies": {
|
||||||
"@fortawesome/fontawesome-svg-core": "^7.1.0",
|
"@fortawesome/fontawesome-svg-core": "^7.1.0",
|
||||||
"@fortawesome/free-regular-svg-icons": "^7.1.0",
|
"@fortawesome/free-regular-svg-icons": "^7.1.0",
|
||||||
@@ -22,6 +22,7 @@
|
|||||||
"applesauce-react": "^4.0.0",
|
"applesauce-react": "^4.0.0",
|
||||||
"applesauce-relay": "^4.0.0",
|
"applesauce-relay": "^4.0.0",
|
||||||
"date-fns": "^4.1.0",
|
"date-fns": "^4.1.0",
|
||||||
|
"fast-average-color": "^9.5.0",
|
||||||
"nostr-tools": "^2.4.0",
|
"nostr-tools": "^2.4.0",
|
||||||
"prismjs": "^1.30.0",
|
"prismjs": "^1.30.0",
|
||||||
"react": "^18.2.0",
|
"react": "^18.2.0",
|
||||||
@@ -6086,6 +6087,15 @@
|
|||||||
"integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
|
"integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
|
||||||
"license": "MIT"
|
"license": "MIT"
|
||||||
},
|
},
|
||||||
|
"node_modules/fast-average-color": {
|
||||||
|
"version": "9.5.0",
|
||||||
|
"resolved": "https://registry.npmjs.org/fast-average-color/-/fast-average-color-9.5.0.tgz",
|
||||||
|
"integrity": "sha512-nC6x2YIlJ9xxgkMFMd1BNoM1ctMjNoRKfRliPmiEWW3S6rLTHiQcy9g3pt/xiKv/D0NAAkhb9VyV+WJFvTqMGg==",
|
||||||
|
"license": "MIT",
|
||||||
|
"engines": {
|
||||||
|
"node": ">= 12"
|
||||||
|
}
|
||||||
|
},
|
||||||
"node_modules/fast-deep-equal": {
|
"node_modules/fast-deep-equal": {
|
||||||
"version": "3.1.3",
|
"version": "3.1.3",
|
||||||
"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
|
"resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
{
|
{
|
||||||
"name": "boris",
|
"name": "boris",
|
||||||
"version": "0.6.12",
|
"version": "0.6.24",
|
||||||
"description": "A minimal nostr client for bookmark management",
|
"description": "A minimal nostr client for bookmark management",
|
||||||
"homepage": "https://read.withboris.com/",
|
"homepage": "https://read.withboris.com/",
|
||||||
"type": "module",
|
"type": "module",
|
||||||
@@ -25,6 +25,7 @@
|
|||||||
"applesauce-react": "^4.0.0",
|
"applesauce-react": "^4.0.0",
|
||||||
"applesauce-relay": "^4.0.0",
|
"applesauce-relay": "^4.0.0",
|
||||||
"date-fns": "^4.1.0",
|
"date-fns": "^4.1.0",
|
||||||
|
"fast-average-color": "^9.5.0",
|
||||||
"nostr-tools": "^2.4.0",
|
"nostr-tools": "^2.4.0",
|
||||||
"prismjs": "^1.30.0",
|
"prismjs": "^1.30.0",
|
||||||
"react": "^18.2.0",
|
"react": "^18.2.0",
|
||||||
|
|||||||
BIN
public/boris-social-1200.png
Normal file
BIN
public/boris-social-1200.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 819 KiB |
215
public/pwa.svg
Normal file
215
public/pwa.svg
Normal file
@@ -0,0 +1,215 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
|
||||||
|
<svg
|
||||||
|
width="649.67538"
|
||||||
|
height="568.22024"
|
||||||
|
viewBox="0 0 649.67538 568.22024"
|
||||||
|
role="img"
|
||||||
|
artist="Katerina Limpitsouni"
|
||||||
|
source="https://undraw.co/"
|
||||||
|
version="1.1"
|
||||||
|
id="svg31"
|
||||||
|
sodipodi:docname="pwa.svg"
|
||||||
|
inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
|
||||||
|
xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
|
||||||
|
xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
|
||||||
|
xmlns="http://www.w3.org/2000/svg"
|
||||||
|
xmlns:svg="http://www.w3.org/2000/svg">
|
||||||
|
<defs
|
||||||
|
id="defs31" />
|
||||||
|
<sodipodi:namedview
|
||||||
|
id="namedview31"
|
||||||
|
pagecolor="#ffffff"
|
||||||
|
bordercolor="#000000"
|
||||||
|
borderopacity="0.25"
|
||||||
|
inkscape:showpageshadow="2"
|
||||||
|
inkscape:pageopacity="0.0"
|
||||||
|
inkscape:pagecheckerboard="0"
|
||||||
|
inkscape:deskcolor="#d1d1d1"
|
||||||
|
inkscape:zoom="1.6866359"
|
||||||
|
inkscape:cx="303.56285"
|
||||||
|
inkscape:cy="531.82789"
|
||||||
|
inkscape:window-width="3840"
|
||||||
|
inkscape:window-height="1027"
|
||||||
|
inkscape:window-x="0"
|
||||||
|
inkscape:window-y="25"
|
||||||
|
inkscape:window-maximized="0"
|
||||||
|
inkscape:current-layer="svg31" />
|
||||||
|
<path
|
||||||
|
d="M397.23858,566.04035,390.539,618.81819l-9.85909-59.95407c-47.3817-18.18194-102.78179-21.713-102.78179-21.713s-12.22552,114.50728,28.139,162.38683,82.92182,40.60129,118.03379,11.00042c35.1114-29.60039,49.48123-70.31412,9.11675-118.19368C424.20327,581.68766,411.521,573.04476,397.23858,566.04035Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path1" />
|
||||||
|
<path
|
||||||
|
d="M384.1004,626.79762l1.98958,2.36c22.98681,27.551,36.40476,52.8555,40.0327,75.5803.05864.33032.09573.65881.15431.98919l-1.53846.23773-1.48187.20991c-3.64942-24.76543-19.47993-50.77428-39.52347-74.8103-.63842-.781-1.28663-1.57364-1.95824-2.34655-8.57477-10.1-17.832-19.82437-27.217-28.9415-.72021-.712-1.46191-1.42587-2.20361-2.13968-12.44963-11.96994-25.01434-22.84351-36.237-32.03036-.7903-.653-1.59224-1.296-2.38439-1.92739-19.05943-15.4717-33.9044-25.802-37.21424-28.06849-.39875-.28343-.62465-.43273-.67573-.46958l.844-1.25121.00183-.02155.85568-1.26106c.05113.03692.81117.53546,2.18233,1.49814,5.15056,3.57268,18.987,13.39417,36.1433,27.27236.77059.62957,1.57259,1.27267,2.36284,1.92555,9.11521,7.44575,19.072,15.96086,29.1037,25.25221q3.78542,3.49455,7.37706,6.9724c.75332.704,1.495,1.41783,2.21523,2.12988Q372.14864,612.73905,384.1004,626.79762Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path2" />
|
||||||
|
<path
|
||||||
|
d="M315.8701,561.67759c-.6941.76509-1.39989,1.54-2.13716,2.30139a84.299,84.299,0,0,1-6.3038,5.89408,82.00518,82.00518,0,0,1-32.26683,16.72907c.03131,1.03285.06269,2.06578.09217,3.12018a85.04164,85.04164,0,0,0,34.14459-17.51256,87.22471,87.22471,0,0,0,6.71826-6.30338c.72551-.75156,1.43131-1.52651,2.11561-2.30323a84.3256,84.3256,0,0,0,13.87772-21.35332q-1.56615-.32858-3.06776-.65165A81.72351,81.72351,0,0,1,315.8701,561.67759Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path3" />
|
||||||
|
<path
|
||||||
|
d="M354.7137,595.82775q-1.15019,1.08949-2.35939,2.109c-.23552.21856-.49252.43522-.7379.64208a82.4401,82.4401,0,0,1-74.51659,16.59042c.1138,1.08323.22759,2.1666.36294,3.25167a85.5013,85.5013,0,0,0,76.12358-17.5054c.32717-.27581.65427-.55157.97158-.83909.80793-.70112,1.59437-1.40414,2.371-2.11878a85.04917,85.04917,0,0,0,24.39782-41.355c-.955-.37409-1.91-.74825-2.87668-1.11248A81.874,81.874,0,0,1,354.7137,595.82775Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path4" />
|
||||||
|
<path
|
||||||
|
d="M384.1004,626.79762c-.75869.75952-1.53717,1.49572-2.32545,2.22029-.84674.77374-1.70328,1.53585-2.57954,2.27457a82.66307,82.66307,0,0,1-98.92522,5.60818c.27211,1.38968.5343,2.76759.82973,4.13747a85.69022,85.69022,0,0,0,100.06542-7.409c.87626-.73872,1.74266-1.48914,2.56785-2.26471.80983-.72274,1.58831-1.45893,2.35679-2.20683a85.43958,85.43958,0,0,0,25.37276-57.38712c-.97424-.6577-1.97364-1.27419-2.98289-1.90237A82.39644,82.39644,0,0,1,384.1004,626.79762Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path5" />
|
||||||
|
<path
|
||||||
|
d="M648.03621,300.20693V215.13007a49.24034,49.24034,0,0,0-49.24-49.24019H418.54942a49.24029,49.24029,0,0,0-49.2406,49.24V271.632h-3.16709v19.90855h3.16709V312.7763h-3.16709v30.52644h3.16709V356.5751h-3.16709v30.52643h3.16709v294.7669a49.23993,49.23993,0,0,0,49.23995,49.24019H598.79561a49.24028,49.24028,0,0,0,49.2406-49.24V360.76613h3.10552v-60.5592Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path6" />
|
||||||
|
<path
|
||||||
|
d="M600.78268,178.70047H577.2545a17.47031,17.47031,0,0,1-16.17511,24.06836H457.81825a17.4703,17.4703,0,0,1-16.17512-24.06839H419.66775a36.772,36.772,0,0,0-36.772,36.772V681.526a36.772,36.772,0,0,0,36.772,36.77205h181.115a36.772,36.772,0,0,0,36.772-36.772h0V215.47244A36.772,36.772,0,0,0,600.78268,178.70047Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path7" />
|
||||||
|
<path
|
||||||
|
d="M605.33827,340.8917H415.11207a5.0058,5.0058,0,0,1-5-5V258.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V335.8917A5.00573,5.00573,0,0,1,605.33827,340.8917Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path8" />
|
||||||
|
<path
|
||||||
|
d="M587.22522,377.41807h-154a5.5,5.5,0,0,1,0-11h154a5.5,5.5,0,0,1,0,11Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path9" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,405.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path10" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,432.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path11" />
|
||||||
|
<path
|
||||||
|
d="M605.33827,571.8917H415.11207a5.0058,5.0058,0,0,1-5-5V489.70616a5.0058,5.0058,0,0,1,5-5h190.2262a5.00573,5.00573,0,0,1,5,5V566.8917A5.00573,5.00573,0,0,1,605.33827,571.8917Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path12" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,608.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path13" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,636.41807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path14" />
|
||||||
|
<path
|
||||||
|
d="M587.22523,663.91807h-154a6,6,0,0,1,0-12h154a6,6,0,0,1,0,12Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path15" />
|
||||||
|
<path
|
||||||
|
d="M760.06605,312.22721c-1.93457-14.18963-4.36084-29.42431-14.3689-39.66754a33.65518,33.65518,0,0,0-48.62622.5033c-7.28515,7.77185-10.50244,18.68475-10.79687,29.33325s2.07714,21.17865,4.708,31.50122a97.0913,97.0913,0,0,0,40.52124-7.97583,65.28916,65.28916,0,0,1,9.71558-3.81427c3.376-.85925,5.78247,1.303,8.92285,2.81073l1.72388-3.30078c1.41113,2.62616,5.78076,1.84772,7.36572-.67737C760.81605,318.41483,760.46888,315.18107,760.06605,312.22721Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path16" />
|
||||||
|
<polygon
|
||||||
|
points="612.434 535.007 602.208 541.77 571.257 505.545 586.349 495.564 612.434 535.007"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="polygon16" />
|
||||||
|
<path
|
||||||
|
d="M896.7595,709.08432,863.787,730.89015l-.27582-.417a15.38729,15.38729,0,0,1,4.34573-21.32122l.00081-.00054,20.13853-13.31819Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path17" />
|
||||||
|
<polygon
|
||||||
|
points="480.429 553.116 468.169 553.116 462.337 505.828 480.431 505.829 480.429 553.116"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="polygon17" />
|
||||||
|
<path
|
||||||
|
d="M758.71777,730.89015l-39.53076-.00146v-.5a15.3873,15.3873,0,0,1,15.38647-15.38623h.001l24.144.001Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path18" />
|
||||||
|
<path
|
||||||
|
d="M668.3639,394.03709l-46.28906-33.06561a8.99743,8.99743,0,1,0-10.80762,7.74816c5.78613,4.85816,48.04785,46.88825,54.09888,44.67127,6.1416-2.25012,32.99341-6.32324,32.99341-6.32324l.74755-25.4953Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="path19" />
|
||||||
|
<path
|
||||||
|
d="M704.73272,454.19782l.437,58.1781s10.01741,86.201,13.712,100.76318,18.69148,81.94564,18.69148,81.94564l24.3788-3.93292-15.69975-88.09791,4.74535-73.017,27.36445,73.178L847.847,675.848l17.61024-14.2095-60.48051-88.88116-18.47283-72.811s2.29785-37.66031-18.40081-52.16322Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path20" />
|
||||||
|
<circle
|
||||||
|
cx="443.5739"
|
||||||
|
cy="133.65539"
|
||||||
|
r="26.72083"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="circle20" />
|
||||||
|
<rect
|
||||||
|
x="722.98731"
|
||||||
|
y="465.33587"
|
||||||
|
width="24.29166"
|
||||||
|
height="31.57916"
|
||||||
|
transform="translate(-279.66359 789.41207) rotate(-65.86746)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="rect20" />
|
||||||
|
<path
|
||||||
|
d="M593.23271,362.65743"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path21" />
|
||||||
|
<path
|
||||||
|
d="M761.53382,350.95884c-3.14892-6.267-4.67895-14.009-11.39209-16.04077-4.5332-1.372-22.86841.68408-27,3-6.87231,3.85236-.64453,11.07111-4.699,17.82642q-6.61121,11.01552-13.22241,22.031c-3.03,5.04852-6.0918,10.16889-7.73023,15.82434-1.63818,5.65546-1.717,12.00305,1.074,17.18756,2.4978,4.64045,7.02294,7.93158,9.53515,12.56433,2.61231,4.81806-2.07715,26.33136-4.50854,31.24341l1.167.539a263.08934,263.08934,0,0,0,48.448-1.63024c3.9873-.50489,8.12744-1.16449,11.41308-3.47895,4.83985-3.40918,6.75318-9.5954,7.949-15.39337A129.67713,129.67713,0,0,0,761.53382,350.95884Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path22" />
|
||||||
|
<path
|
||||||
|
d="M706.84845,411.65133c7.23924-7.1146,14.51542-14.27181,20.47486-22.48827s10.5936-17.62115,11.88744-27.68835a20.50914,20.50914,0,0,0-.64136-9.62007c-1.11054-3.049-3.56912-5.755-6.73861-6.45068-5.07194-1.11355-9.6829,2.93435-13.30226,6.6577q-16.00732,16.46812-32.01478,32.936,10.19649,13.42191,20.393,26.84353Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path23" />
|
||||||
|
<path
|
||||||
|
d="M785.75257,417.13127c-2.25-6.14148-6.32324-32.99323-6.32324-32.99323l-25.49512-.74756,12.4646,30.7431-34.01367,47.61615s.063.10462.17749.2912a8.99538,8.99538,0,1,0,7.54468,9.55927.62106.62106,0,0,0,.77978-.13385C744.67176,466.7169,788.00257,423.27281,785.75257,417.13127Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#9e616a"
|
||||||
|
id="path24" />
|
||||||
|
<path
|
||||||
|
d="M788.34461,400.17338c-2.34008-9.87665-4.69751-19.807-8.64282-29.15894s-9.59326-18.18512-17.53711-24.50317a20.50909,20.50909,0,0,0-8.563-4.43085c-3.18359-.62805-6.77148.07483-9.00732,2.42658-3.57813,3.76318-2.50147,9.80365-1.18921,14.8277q5.80444,22.2203,11.60864,44.44061,16.76184-1.77667,33.52344-3.55347Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#e4e4e4"
|
||||||
|
id="path25" />
|
||||||
|
<path
|
||||||
|
d="M752.14124,301.6237c-.83545-6.464-1.708-12.98224-3.67065-19.06879-1.96265-6.08661-5.12622-11.78747-9.66431-15.23547-7.1853-5.459-16.488-4.40613-24.54394-1.266-6.23,2.42846-12.31153,6.1195-16.70484,12.05346-4.39355,5.934-6.86108,14.40119-5.2268,22.1601q12.88989-3.58722,25.77954-7.1745l-.94068.783c5.57642,3.14221,9.81153,9.64361,11.07691,17.00482a28.7171,28.7171,0,0,1-4.53662,21.03778q8.79089-3.67337,17.58178-7.34662c3.61744-1.51153,7.489-3.25317,9.634-7.13025C753.41273,312.94608,752.83485,306.98814,752.14124,301.6237Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#2f2e41"
|
||||||
|
id="path26" />
|
||||||
|
<path
|
||||||
|
d="M625.98113,343.51431,608.792,369.31226a4.46863,4.46863,0,0,1-3.75549,2.00125,4.47943,4.47943,0,0,1-4.13509-2.75491,4.12763,4.12763,0,0,1-.2689-.85745,4.51165,4.51165,0,0,1,.66976-3.37929l17.18913-25.79794a4.5,4.5,0,1,1,7.48973,4.99039Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path27" />
|
||||||
|
<path
|
||||||
|
d="M610.17821,367.23178l-3.47923,5.19091-6.15652,5.42689a2.45095,2.45095,0,0,1-3.94221-2.627l2.69471-7.8881,3.39353-5.09311Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path28" />
|
||||||
|
<path
|
||||||
|
d="M626.74053,329.98545l-8.6142,7.59289a2.45233,2.45233,0,0,0,.26168,3.88081l1.62984,1.086-4.71315,7.07363a1,1,0,0,0,1.66439,1.109l4.71314-7.07362,1.62985,1.086a2.45552,2.45552,0,0,0,3.39872-.675,2.46816,2.46816,0,0,0,.28357-.57793l3.69013-10.8738a2.45251,2.45251,0,0,0-3.944-2.62786Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#3f3d56"
|
||||||
|
id="path29" />
|
||||||
|
<path
|
||||||
|
d="M516.97522,187.41807h-27a2,2,0,0,1,0-4h27a2,2,0,0,1,0,4Z"
|
||||||
|
transform="translate(-275.16231 -165.88988)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path31" />
|
||||||
|
<circle
|
||||||
|
cx="255.31291"
|
||||||
|
cy="19.52819"
|
||||||
|
r="2"
|
||||||
|
fill="#fff"
|
||||||
|
id="circle31" />
|
||||||
|
</svg>
|
||||||
|
After Width: | Height: | Size: 12 KiB |
235
public/zaps.svg
Normal file
235
public/zaps.svg
Normal file
@@ -0,0 +1,235 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8" standalone="no"?>
|
||||||
|
<svg
|
||||||
|
width="720.44"
|
||||||
|
height="718.635"
|
||||||
|
viewBox="0 0 720.44 718.635"
|
||||||
|
role="img"
|
||||||
|
artist="Katerina Limpitsouni"
|
||||||
|
source="https://undraw.co/"
|
||||||
|
version="1.1"
|
||||||
|
id="svg30"
|
||||||
|
sodipodi:docname="zaps.svg"
|
||||||
|
xml:space="preserve"
|
||||||
|
inkscape:version="1.4.2 (ebf0e940, 2025-05-08)"
|
||||||
|
xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
|
||||||
|
xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
|
||||||
|
xmlns="http://www.w3.org/2000/svg"
|
||||||
|
xmlns:svg="http://www.w3.org/2000/svg"><defs
|
||||||
|
id="defs30" /><sodipodi:namedview
|
||||||
|
id="namedview30"
|
||||||
|
pagecolor="#ffffff"
|
||||||
|
bordercolor="#000000"
|
||||||
|
borderopacity="0.25"
|
||||||
|
inkscape:showpageshadow="2"
|
||||||
|
inkscape:pageopacity="0.0"
|
||||||
|
inkscape:pagecheckerboard="0"
|
||||||
|
inkscape:deskcolor="#d1d1d1"
|
||||||
|
inkscape:zoom="2.6746164"
|
||||||
|
inkscape:cx="38.510195"
|
||||||
|
inkscape:cy="485.67712"
|
||||||
|
inkscape:window-width="3840"
|
||||||
|
inkscape:window-height="1027"
|
||||||
|
inkscape:window-x="0"
|
||||||
|
inkscape:window-y="25"
|
||||||
|
inkscape:window-maximized="0"
|
||||||
|
inkscape:current-layer="g27" /><g
|
||||||
|
transform="translate(-600 -181)"
|
||||||
|
id="g30"><g
|
||||||
|
transform="translate(783.85 181)"
|
||||||
|
id="g2"><path
|
||||||
|
d="M624.7,249.968h-3.952V141.8a62.6,62.6,0,0,0-62.6-62.6H328.97a62.6,62.6,0,0,0-62.6,62.6V735.225a62.6,62.6,0,0,0,62.6,62.6H558.143a62.6,62.6,0,0,0,62.6-62.6V326.965H624.7Z"
|
||||||
|
transform="translate(-266.365 -79.193)"
|
||||||
|
fill="#090814"
|
||||||
|
id="path1" /><path
|
||||||
|
d="M560.888,95.686H530.974a22.212,22.212,0,0,1-20.565,30.6h-131.3a22.212,22.212,0,0,1-20.566-30.6H330.607a46.752,46.752,0,0,0-46.752,46.752V735a46.752,46.752,0,0,0,46.752,46.752H560.879A46.752,46.752,0,0,0,607.63,735V142.439a46.752,46.752,0,0,0-46.744-46.752Z"
|
||||||
|
transform="translate(-266.577 -79.397)"
|
||||||
|
fill="#fff"
|
||||||
|
id="path2" /></g><path
|
||||||
|
d="M8,0H256a8,8,0,0,1,8,8V72a8,8,0,0,1-8,8H8a8,8,0,0,1-8-8V8A8,8,0,0,1,8,0Z"
|
||||||
|
transform="translate(828 265)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path3" /><path
|
||||||
|
d="M8,0H256a8.065,8.065,0,0,1,8,8.128V475.474a8.065,8.065,0,0,1-8,8.128H8a8.065,8.065,0,0,1-8-8.128V8.128A8.065,8.065,0,0,1,8,0Z"
|
||||||
|
transform="translate(828 358.398)"
|
||||||
|
fill="#f2f2f2"
|
||||||
|
id="path4" /><g
|
||||||
|
transform="translate(623.104 296.398)"
|
||||||
|
id="g9"><rect
|
||||||
|
width="278.304"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect4" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect5" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-53.047 -325.676)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path5" /><g
|
||||||
|
transform="translate(17.038 13.546)"
|
||||||
|
id="g7"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path6" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.7844991 20.830193,9.2808662 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(72.886 17.036)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path8" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(72.886 37.98)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path9" /></g><g
|
||||||
|
transform="translate(1003.278 402.469)"
|
||||||
|
id="g14"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect9" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect10" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.751 -325.287)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path10" /><g
|
||||||
|
transform="translate(17.334 13.936)"
|
||||||
|
id="g12"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path11" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-7"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.181 17.426)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path13" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.181 38.369)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path14" /></g><g
|
||||||
|
transform="translate(663.012 510.639)"
|
||||||
|
id="g19"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect14" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect15" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.814 -325.25)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path15" /><g
|
||||||
|
transform="translate(17.272 13.972)"
|
||||||
|
id="g17"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path16" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-0"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.119 17.463)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path18" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.119 38.406)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path19" /></g><g
|
||||||
|
transform="translate(1041.086 616.711)"
|
||||||
|
id="g24"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="70.364"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect19" /><rect
|
||||||
|
width="272.003"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(4.201 4.201)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect20" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.163 -324.86)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path20" /><g
|
||||||
|
transform="translate(17.922 14.362)"
|
||||||
|
id="g22"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path21" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 L 22.849909,9.784499 20.830193,9.2808661 20.001937,12.599667 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-9"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.77 17.853)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path23" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.77 38.796)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path24" /></g><g
|
||||||
|
transform="translate(600 723.832)"
|
||||||
|
id="g29"><rect
|
||||||
|
width="279.354"
|
||||||
|
height="69.313"
|
||||||
|
rx="16"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#090814"
|
||||||
|
id="rect24" /><rect
|
||||||
|
width="273.053"
|
||||||
|
height="63.012"
|
||||||
|
rx="15"
|
||||||
|
transform="translate(3.151 3.151)"
|
||||||
|
fill="#fff"
|
||||||
|
id="rect25" /><path
|
||||||
|
d="M301.207,370.636a2.238,2.238,0,0,1-1.791-.9l-5.489-7.318a2.238,2.238,0,0,1,3.581-2.686l3.591,4.788,9.223-13.834a2.238,2.238,0,0,1,3.725,2.483L303.07,369.639a2.239,2.239,0,0,1-1.8,1Z"
|
||||||
|
transform="translate(-52.631 -325.518)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path25" /><g
|
||||||
|
transform="translate(17.454 13.704)"
|
||||||
|
id="g27"><path
|
||||||
|
d="M8.377,0H33.509a8.377,8.377,0,0,1,8.377,8.377V33.509a8.377,8.377,0,0,1-8.377,8.377H8.377A8.377,8.377,0,0,1,0,33.509V8.377A8.377,8.377,0,0,1,8.377,0Z"
|
||||||
|
transform="translate(0 0)"
|
||||||
|
fill="#6c63ff"
|
||||||
|
id="path26" /><path
|
||||||
|
fill="#ffffff"
|
||||||
|
d="m 29.707386,18.657657 c 0.366641,-2.450824 -1.499389,-3.768325 -4.05094,-4.647244 l 0.827682,-3.319949 -2.020864,-0.503633 -0.805812,3.232462 C 23.126191,13.286911 22.580541,13.16201 22.038338,13.038257 l 0.811571,-3.253758 -2.019716,-0.503633 -0.828256,3.318801 c -0.439747,-0.100152 -0.87143,-0.199148 -1.290455,-0.303328 l 0.0023,-0.0104 -2.786965,-0.695882 -0.537594,2.158431 c 0,0 1.49939,0.343622 1.467733,0.364918 0.818479,0.204332 0.966398,0.745954 0.941649,1.17534 l -0.942797,3.782139 c 0.05642,0.01436 0.129503,0.03508 0.210083,0.06736 -0.06736,-0.01669 -0.13929,-0.03516 -0.213537,-0.05293 l -1.321536,5.29823 c -0.100152,0.248646 -0.353983,0.621627 -0.926112,0.480032 0.02018,0.02934 -1.468882,-0.366648 -1.468882,-0.366648 l -1.003261,2.313258 2.629833,0.65558 c 0.489237,0.122604 0.968703,0.250959 1.44068,0.371832 l -0.83632,3.357938 2.018559,0.503633 0.828264,-3.322254 c 0.551408,0.14965 1.086697,0.287791 1.610477,0.417869 l -0.825385,3.306717 2.020864,0.503632 0.83632,-3.351612 c 3.446006,0.652134 6.037269,0.3891 7.127993,-2.727673 0.878911,-2.509534 -0.04377,-3.957121 -1.856825,-4.901074 1.320388,-0.304485 2.314988,-1.173035 2.580335,-2.967123 z m -4.61731,6.474711 c -0.624507,2.509534 -4.849846,1.152888 -6.219732,0.812719 l 1.109723,-4.448662 c 1.369878,0.341891 5.762717,1.018775 5.110009,3.635943 z m 0.62508,-6.510969 c -0.569824,2.28275 -4.086632,1.122955 -5.227429,0.838617 l 1.006118,-4.034821 c 1.140796,0.284338 4.814736,0.815024 4.221311,3.196204 z"
|
||||||
|
id="path2-8-2-98"
|
||||||
|
style="stroke-width:0.575581" /></g><path
|
||||||
|
d="M6.981,0h125.66a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.301 17.194)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path28" /><path
|
||||||
|
d="M6.981,0H76.792a6.981,6.981,0,1,1,0,13.962H6.981A6.981,6.981,0,0,1,6.981,0Z"
|
||||||
|
transform="translate(73.301 38.138)"
|
||||||
|
fill="#e6e6e6"
|
||||||
|
id="path29" /></g></g></svg>
|
||||||
|
After Width: | Height: | Size: 17 KiB |
276
src/App.tsx
276
src/App.tsx
@@ -4,16 +4,21 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
|||||||
import { faSpinner } from '@fortawesome/free-solid-svg-icons'
|
import { faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { EventStoreProvider, AccountsProvider, Hooks } from 'applesauce-react'
|
import { EventStoreProvider, AccountsProvider, Hooks } from 'applesauce-react'
|
||||||
import { EventStore } from 'applesauce-core'
|
import { EventStore } from 'applesauce-core'
|
||||||
import { AccountManager } from 'applesauce-accounts'
|
import { AccountManager, Accounts } from 'applesauce-accounts'
|
||||||
import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
|
import { registerCommonAccountTypes } from 'applesauce-accounts/accounts'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from './services/nostrConnect'
|
||||||
import { createAddressLoader } from 'applesauce-loaders/loaders'
|
import { createAddressLoader } from 'applesauce-loaders/loaders'
|
||||||
|
import Debug from './components/Debug'
|
||||||
import Bookmarks from './components/Bookmarks'
|
import Bookmarks from './components/Bookmarks'
|
||||||
|
import RouteDebug from './components/RouteDebug'
|
||||||
import Toast from './components/Toast'
|
import Toast from './components/Toast'
|
||||||
import { useToast } from './hooks/useToast'
|
import { useToast } from './hooks/useToast'
|
||||||
import { useOnlineStatus } from './hooks/useOnlineStatus'
|
import { useOnlineStatus } from './hooks/useOnlineStatus'
|
||||||
import { RELAYS } from './config/relays'
|
import { RELAYS } from './config/relays'
|
||||||
import { SkeletonThemeProvider } from './components/Skeletons'
|
import { SkeletonThemeProvider } from './components/Skeletons'
|
||||||
|
import { DebugBus } from './utils/debugBus'
|
||||||
|
|
||||||
const DEFAULT_ARTICLE = import.meta.env.VITE_DEFAULT_ARTICLE_NADDR ||
|
const DEFAULT_ARTICLE = import.meta.env.VITE_DEFAULT_ARTICLE_NADDR ||
|
||||||
'naddr1qvzqqqr4gupzqmjxss3dld622uu8q25gywum9qtg4w4cv4064jmg20xsac2aam5nqqxnzd3cxqmrzv3exgmr2wfesgsmew'
|
'naddr1qvzqqqr4gupzqmjxss3dld622uu8q25gywum9qtg4w4cv4064jmg20xsac2aam5nqqxnzd3cxqmrzv3exgmr2wfesgsmew'
|
||||||
@@ -112,7 +117,25 @@ function AppRoutes({
|
|||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
<Route
|
<Route
|
||||||
path="/me/archive"
|
path="/me/reads"
|
||||||
|
element={
|
||||||
|
<Bookmarks
|
||||||
|
relayPool={relayPool}
|
||||||
|
onLogout={handleLogout}
|
||||||
|
/>
|
||||||
|
}
|
||||||
|
/>
|
||||||
|
<Route
|
||||||
|
path="/me/reads/:filter"
|
||||||
|
element={
|
||||||
|
<Bookmarks
|
||||||
|
relayPool={relayPool}
|
||||||
|
onLogout={handleLogout}
|
||||||
|
/>
|
||||||
|
}
|
||||||
|
/>
|
||||||
|
<Route
|
||||||
|
path="/me/links"
|
||||||
element={
|
element={
|
||||||
<Bookmarks
|
<Bookmarks
|
||||||
relayPool={relayPool}
|
relayPool={relayPool}
|
||||||
@@ -147,6 +170,7 @@ function AppRoutes({
|
|||||||
/>
|
/>
|
||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
|
<Route path="/debug" element={<Debug />} />
|
||||||
<Route path="/" element={<Navigate to={`/a/${DEFAULT_ARTICLE}`} replace />} />
|
<Route path="/" element={<Navigate to={`/a/${DEFAULT_ARTICLE}`} replace />} />
|
||||||
</Routes>
|
</Routes>
|
||||||
)
|
)
|
||||||
@@ -168,20 +192,57 @@ function App() {
|
|||||||
// Register common account types (needed for deserialization)
|
// Register common account types (needed for deserialization)
|
||||||
registerCommonAccountTypes(accounts)
|
registerCommonAccountTypes(accounts)
|
||||||
|
|
||||||
|
// Create relay pool and set it up BEFORE loading accounts
|
||||||
|
// NostrConnectAccount.fromJSON needs this to restore the signer
|
||||||
|
const pool = new RelayPool()
|
||||||
|
// Wire the signer to use this pool; make publish non-blocking so callers don't
|
||||||
|
// wait for every relay send to finish. Responses still resolve the pending request.
|
||||||
|
NostrConnectSigner.subscriptionMethod = pool.subscription.bind(pool)
|
||||||
|
NostrConnectSigner.publishMethod = (relays: string[], event: unknown) => {
|
||||||
|
const result: any = pool.publish(relays, event as any)
|
||||||
|
if (result && typeof (result as any).subscribe === 'function') {
|
||||||
|
try { (result as any).subscribe({ complete: () => {}, error: () => {} }) } catch {}
|
||||||
|
}
|
||||||
|
// Return an already-resolved promise so upstream await finishes immediately
|
||||||
|
return Promise.resolve()
|
||||||
|
}
|
||||||
|
console.log('[bunker] ✅ Wired NostrConnectSigner to RelayPool publish/subscription (before account load)')
|
||||||
|
|
||||||
|
// Create a relay group for better event deduplication and management
|
||||||
|
pool.group(RELAYS)
|
||||||
|
console.log('[bunker] Created relay group with', RELAYS.length, 'relays (including local)')
|
||||||
|
|
||||||
// Load persisted accounts from localStorage
|
// Load persisted accounts from localStorage
|
||||||
try {
|
try {
|
||||||
const json = JSON.parse(localStorage.getItem('accounts') || '[]')
|
const accountsJson = localStorage.getItem('accounts')
|
||||||
|
console.log('[bunker] Raw accounts from localStorage:', accountsJson)
|
||||||
|
|
||||||
|
const json = JSON.parse(accountsJson || '[]')
|
||||||
|
console.log('[bunker] Parsed accounts:', json.length, 'accounts')
|
||||||
|
|
||||||
await accounts.fromJSON(json)
|
await accounts.fromJSON(json)
|
||||||
console.log('Loaded', accounts.accounts.length, 'accounts from storage')
|
console.log('[bunker] Loaded', accounts.accounts.length, 'accounts from storage')
|
||||||
|
console.log('[bunker] Account types:', accounts.accounts.map(a => ({ id: a.id, type: a.type })))
|
||||||
|
|
||||||
// Load active account from storage
|
// Load active account from storage
|
||||||
const activeId = localStorage.getItem('active')
|
const activeId = localStorage.getItem('active')
|
||||||
if (activeId && accounts.getAccount(activeId)) {
|
console.log('[bunker] Active ID from localStorage:', activeId)
|
||||||
accounts.setActive(activeId)
|
|
||||||
console.log('Restored active account:', activeId)
|
if (activeId) {
|
||||||
|
const account = accounts.getAccount(activeId)
|
||||||
|
console.log('[bunker] Found account for ID?', !!account, account?.type)
|
||||||
|
|
||||||
|
if (account) {
|
||||||
|
accounts.setActive(activeId)
|
||||||
|
console.log('[bunker] ✅ Restored active account:', activeId, 'type:', account.type)
|
||||||
|
} else {
|
||||||
|
console.warn('[bunker] ⚠️ Active ID found but account not in list')
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] No active account ID in localStorage')
|
||||||
}
|
}
|
||||||
} catch (err) {
|
} catch (err) {
|
||||||
console.error('Failed to load accounts from storage:', err)
|
console.error('[bunker] ❌ Failed to load accounts from storage:', err)
|
||||||
}
|
}
|
||||||
|
|
||||||
// Subscribe to accounts changes and persist to localStorage
|
// Subscribe to accounts changes and persist to localStorage
|
||||||
@@ -198,12 +259,197 @@ function App() {
|
|||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
const pool = new RelayPool()
|
// Reconnect bunker signers when active account changes
|
||||||
|
// Keep track of which accounts we've already reconnected to avoid double-connecting
|
||||||
|
const reconnectedAccounts = new Set<string>()
|
||||||
|
|
||||||
// Create a relay group for better event deduplication and management
|
const bunkerReconnectSub = accounts.active$.subscribe(async (account) => {
|
||||||
pool.group(RELAYS)
|
console.log('[bunker] Active account changed:', {
|
||||||
console.log('Created relay group with', RELAYS.length, 'relays (including local)')
|
hasAccount: !!account,
|
||||||
console.log('Relay URLs:', RELAYS)
|
type: account?.type,
|
||||||
|
id: account?.id
|
||||||
|
})
|
||||||
|
|
||||||
|
if (account && account.type === 'nostr-connect') {
|
||||||
|
const nostrConnectAccount = account as Accounts.NostrConnectAccount<unknown>
|
||||||
|
// Disable applesauce account queueing so decrypt requests aren't serialized behind earlier ops
|
||||||
|
try {
|
||||||
|
if (!(nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue) {
|
||||||
|
(nostrConnectAccount as unknown as { disableQueue?: boolean }).disableQueue = true
|
||||||
|
console.log('[bunker] ⚙️ Disabled account request queueing for nostr-connect')
|
||||||
|
}
|
||||||
|
} catch (err) { console.warn('[bunker] failed to disable queue', err) }
|
||||||
|
// Note: for Amber bunker, the remote signer pubkey is the user's pubkey. This is expected.
|
||||||
|
|
||||||
|
// Skip if we've already reconnected this account
|
||||||
|
if (reconnectedAccounts.has(account.id)) {
|
||||||
|
console.log('[bunker] ⏭️ Already reconnected this account, skipping')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('[bunker] Account detected. Status:', {
|
||||||
|
listening: nostrConnectAccount.signer.listening,
|
||||||
|
isConnected: nostrConnectAccount.signer.isConnected,
|
||||||
|
hasRemote: !!nostrConnectAccount.signer.remote,
|
||||||
|
bunkerRelays: nostrConnectAccount.signer.relays
|
||||||
|
})
|
||||||
|
|
||||||
|
try {
|
||||||
|
// For restored signers, ensure they have the pool's subscription methods
|
||||||
|
// The signer was created in fromJSON without pool context, so we need to recreate it
|
||||||
|
const signerData = nostrConnectAccount.toJSON().signer
|
||||||
|
|
||||||
|
// Add bunker's relays to the pool BEFORE recreating the signer
|
||||||
|
// This ensures the pool has all relays when the signer sets up its methods
|
||||||
|
const bunkerRelays = signerData.relays || []
|
||||||
|
const existingRelayUrls = new Set(Array.from(pool.relays.keys()))
|
||||||
|
const newBunkerRelays = bunkerRelays.filter(url => !existingRelayUrls.has(url))
|
||||||
|
|
||||||
|
if (newBunkerRelays.length > 0) {
|
||||||
|
console.log('[bunker] Adding bunker relays to pool BEFORE signer recreation:', newBunkerRelays)
|
||||||
|
pool.group(newBunkerRelays)
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] Bunker relays already in pool')
|
||||||
|
}
|
||||||
|
|
||||||
|
const recreatedSigner = new NostrConnectSigner({
|
||||||
|
relays: signerData.relays,
|
||||||
|
pubkey: nostrConnectAccount.pubkey,
|
||||||
|
remote: signerData.remote,
|
||||||
|
signer: nostrConnectAccount.signer.signer, // Use the existing SimpleSigner
|
||||||
|
pool: pool
|
||||||
|
})
|
||||||
|
// Ensure local relays are included for NIP-46 request/response traffic (e.g., Amber bunker)
|
||||||
|
try {
|
||||||
|
const mergedRelays = Array.from(new Set([...(signerData.relays || []), ...RELAYS]))
|
||||||
|
recreatedSigner.relays = mergedRelays
|
||||||
|
console.log('[bunker] 🔗 Signer relays merged with app RELAYS:', mergedRelays)
|
||||||
|
} catch (err) { console.warn('[bunker] failed to merge signer relays', err) }
|
||||||
|
|
||||||
|
// Replace the signer on the account
|
||||||
|
nostrConnectAccount.signer = recreatedSigner
|
||||||
|
console.log('[bunker] ✅ Signer recreated with pool context')
|
||||||
|
|
||||||
|
// Debug: log publish/subscription calls made by signer (decrypt/sign requests)
|
||||||
|
// IMPORTANT: bind originals to preserve `this` context used internally by the signer
|
||||||
|
const originalPublish = (recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod.bind(recreatedSigner)
|
||||||
|
;(recreatedSigner as unknown as { publishMethod: (relays: string[], event: unknown) => unknown }).publishMethod = (relays: string[], event: unknown) => {
|
||||||
|
try {
|
||||||
|
let method: string | undefined
|
||||||
|
const content = (event as { content?: unknown })?.content
|
||||||
|
if (typeof content === 'string') {
|
||||||
|
try {
|
||||||
|
const parsed = JSON.parse(content) as { method?: string; id?: unknown }
|
||||||
|
method = parsed?.method
|
||||||
|
} catch (err) { console.warn('[bunker] failed to parse event content', err) }
|
||||||
|
}
|
||||||
|
const summary = {
|
||||||
|
relays,
|
||||||
|
kind: (event as { kind?: number })?.kind,
|
||||||
|
method,
|
||||||
|
// include tags array for debugging (NIP-46 expects method tag)
|
||||||
|
tags: (event as { tags?: unknown })?.tags,
|
||||||
|
contentLength: typeof content === 'string' ? content.length : undefined
|
||||||
|
}
|
||||||
|
console.log('[bunker] publish via signer:', summary)
|
||||||
|
try { DebugBus.info('bunker', 'publish', summary) } catch (err) { console.warn('[bunker] failed to log to DebugBus', err) }
|
||||||
|
} catch (err) { console.warn('[bunker] failed to log publish summary', err) }
|
||||||
|
// Fire-and-forget publish: trigger the publish but do not return the
|
||||||
|
// Observable/Promise to upstream to avoid their awaiting of completion.
|
||||||
|
const result = originalPublish(relays, event)
|
||||||
|
if (result && typeof (result as { subscribe?: unknown }).subscribe === 'function') {
|
||||||
|
try { (result as { subscribe: (h: { complete?: () => void; error?: (e: unknown) => void }) => unknown }).subscribe({ complete: () => {}, error: () => {} }) } catch {}
|
||||||
|
}
|
||||||
|
// If it's a Promise, simply ignore it (no await) so it resolves in the background.
|
||||||
|
// Return a benign object so callers that probe for a "subscribe" property
|
||||||
|
// (e.g., applesauce makeRequest) won't throw on `"subscribe" in result`.
|
||||||
|
return {} as unknown as never
|
||||||
|
}
|
||||||
|
const originalSubscribe = (recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod.bind(recreatedSigner)
|
||||||
|
;(recreatedSigner as unknown as { subscriptionMethod: (relays: string[], filters: unknown[]) => unknown }).subscriptionMethod = (relays: string[], filters: unknown[]) => {
|
||||||
|
try {
|
||||||
|
console.log('[bunker] subscribe via signer:', { relays, filters })
|
||||||
|
try { DebugBus.info('bunker', 'subscribe', { relays, filters }) } catch (err) { console.warn('[bunker] failed to log subscribe to DebugBus', err) }
|
||||||
|
} catch (err) { console.warn('[bunker] failed to log subscribe summary', err) }
|
||||||
|
return originalSubscribe(relays, filters)
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
// Just ensure the signer is listening for responses - don't call connect() again
|
||||||
|
// The fromBunkerURI already connected with permissions during login
|
||||||
|
if (!nostrConnectAccount.signer.listening) {
|
||||||
|
console.log('[bunker] Opening signer subscription...')
|
||||||
|
await nostrConnectAccount.signer.open()
|
||||||
|
console.log('[bunker] ✅ Signer subscription opened')
|
||||||
|
} else {
|
||||||
|
console.log('[bunker] ✅ Signer already listening')
|
||||||
|
}
|
||||||
|
|
||||||
|
// Attempt a guarded reconnect to ensure Amber authorizes decrypt operations
|
||||||
|
try {
|
||||||
|
if (nostrConnectAccount.signer.remote && !reconnectedAccounts.has(account.id)) {
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
console.log('[bunker] Attempting guarded connect() with permissions to ensure decrypt perms', { count: permissions.length })
|
||||||
|
await nostrConnectAccount.signer.connect(undefined, permissions)
|
||||||
|
console.log('[bunker] ✅ Guarded connect() succeeded with permissions')
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('[bunker] ⚠️ Guarded connect() failed:', e)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Give the subscription a moment to fully establish before allowing decrypt operations
|
||||||
|
// This ensures the signer is ready to handle and receive responses
|
||||||
|
await new Promise(resolve => setTimeout(resolve, 100))
|
||||||
|
console.log("[bunker] Subscription ready after startup delay")
|
||||||
|
// Fire-and-forget: probe decrypt path to verify Amber responds to NIP-46 decrypt
|
||||||
|
try {
|
||||||
|
const withTimeout = async <T,>(p: Promise<T>, ms = 10000): Promise<T> => {
|
||||||
|
return await Promise.race([
|
||||||
|
p,
|
||||||
|
new Promise<T>((_, rej) => setTimeout(() => rej(new Error(`probe timeout after ${ms}ms`)), ms)),
|
||||||
|
])
|
||||||
|
}
|
||||||
|
setTimeout(async () => {
|
||||||
|
const self = nostrConnectAccount.pubkey
|
||||||
|
// Try a roundtrip so the bunker can respond successfully
|
||||||
|
try {
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 roundtrip (encrypt→decrypt)…')
|
||||||
|
const cipher44 = await withTimeout(nostrConnectAccount.signer.nip44!.encrypt(self, 'probe-nip44'))
|
||||||
|
const plain44 = await withTimeout(nostrConnectAccount.signer.nip44!.decrypt(self, cipher44))
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 responded:', typeof plain44 === 'string' ? plain44 : typeof plain44)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe nip44 result:', err instanceof Error ? err.message : err)
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 roundtrip (encrypt→decrypt)…')
|
||||||
|
const cipher04 = await withTimeout(nostrConnectAccount.signer.nip04!.encrypt(self, 'probe-nip04'))
|
||||||
|
const plain04 = await withTimeout(nostrConnectAccount.signer.nip04!.decrypt(self, cipher04))
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 responded:', typeof plain04 === 'string' ? plain04 : typeof plain04)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe nip04 result:', err instanceof Error ? err.message : err)
|
||||||
|
}
|
||||||
|
}, 0)
|
||||||
|
} catch (err) {
|
||||||
|
console.log('[bunker] 🔎 Probe setup failed:', err)
|
||||||
|
}
|
||||||
|
// The bunker remembers the permissions from the initial connection
|
||||||
|
nostrConnectAccount.signer.isConnected = true
|
||||||
|
|
||||||
|
console.log('[bunker] Final signer status:', {
|
||||||
|
listening: nostrConnectAccount.signer.listening,
|
||||||
|
isConnected: nostrConnectAccount.signer.isConnected,
|
||||||
|
remote: nostrConnectAccount.signer.remote,
|
||||||
|
relays: nostrConnectAccount.signer.relays
|
||||||
|
})
|
||||||
|
|
||||||
|
// Mark this account as reconnected
|
||||||
|
reconnectedAccounts.add(account.id)
|
||||||
|
console.log('[bunker] 🎉 Signer ready for signing')
|
||||||
|
} catch (error) {
|
||||||
|
console.error('[bunker] ❌ Failed to open signer:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
// Keep all relay connections alive indefinitely by creating a persistent subscription
|
// Keep all relay connections alive indefinitely by creating a persistent subscription
|
||||||
// This prevents disconnection when no other subscriptions are active
|
// This prevents disconnection when no other subscriptions are active
|
||||||
@@ -233,6 +479,7 @@ function App() {
|
|||||||
return () => {
|
return () => {
|
||||||
accountsSub.unsubscribe()
|
accountsSub.unsubscribe()
|
||||||
activeSub.unsubscribe()
|
activeSub.unsubscribe()
|
||||||
|
bunkerReconnectSub.unsubscribe()
|
||||||
// Clean up keep-alive subscription if it exists
|
// Clean up keep-alive subscription if it exists
|
||||||
const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
|
const poolWithSub = pool as unknown as { _keepAliveSubscription?: { unsubscribe: () => void } }
|
||||||
if (poolWithSub._keepAliveSubscription) {
|
if (poolWithSub._keepAliveSubscription) {
|
||||||
@@ -249,7 +496,7 @@ function App() {
|
|||||||
return () => {
|
return () => {
|
||||||
if (cleanup) cleanup()
|
if (cleanup) cleanup()
|
||||||
}
|
}
|
||||||
}, [])
|
}, [isOnline, showToast])
|
||||||
|
|
||||||
// Monitor online/offline status
|
// Monitor online/offline status
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -285,6 +532,7 @@ function App() {
|
|||||||
<BrowserRouter>
|
<BrowserRouter>
|
||||||
<div className="min-h-screen p-0 max-w-none m-0 relative">
|
<div className="min-h-screen p-0 max-w-none m-0 relative">
|
||||||
<AppRoutes relayPool={relayPool} showToast={showToast} />
|
<AppRoutes relayPool={relayPool} showToast={showToast} />
|
||||||
|
<RouteDebug />
|
||||||
</div>
|
</div>
|
||||||
</BrowserRouter>
|
</BrowserRouter>
|
||||||
{toastMessage && (
|
{toastMessage && (
|
||||||
|
|||||||
47
src/components/ArchiveFilters.tsx
Normal file
47
src/components/ArchiveFilters.tsx
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faBookOpen, faBookmark, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { faBooks } from '../icons/customIcons'
|
||||||
|
|
||||||
|
export type ArchiveFilterType = 'all' | 'to-read' | 'reading' | 'completed' | 'marked'
|
||||||
|
|
||||||
|
interface ArchiveFiltersProps {
|
||||||
|
selectedFilter: ArchiveFilterType
|
||||||
|
onFilterChange: (filter: ArchiveFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const ArchiveFilters: React.FC<ArchiveFiltersProps> = ({ selectedFilter, onFilterChange }) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'to-read' as const, icon: faBookmark, label: 'To Read' },
|
||||||
|
{ type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
|
||||||
|
{ type: 'completed' as const, icon: faCheckCircle, label: 'Completed' },
|
||||||
|
{ type: 'marked' as const, icon: faBooks, label: 'Marked as Read' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => {
|
||||||
|
const isActive = selectedFilter === filter.type
|
||||||
|
// Only "completed" gets green color, everything else uses default blue
|
||||||
|
const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
|
||||||
|
|
||||||
|
return (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${isActive ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
style={activeStyle}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
)
|
||||||
|
})}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default ArchiveFilters
|
||||||
|
|
||||||
@@ -11,9 +11,10 @@ interface BlogPostCardProps {
|
|||||||
post: BlogPostPreview
|
post: BlogPostPreview
|
||||||
href: string
|
href: string
|
||||||
level?: 'mine' | 'friends' | 'nostrverse'
|
level?: 'mine' | 'friends' | 'nostrverse'
|
||||||
|
readingProgress?: number // 0-1 reading progress (optional)
|
||||||
}
|
}
|
||||||
|
|
||||||
const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
|
const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level, readingProgress }) => {
|
||||||
const profile = useEventModel(Models.ProfileModel, [post.author])
|
const profile = useEventModel(Models.ProfileModel, [post.author])
|
||||||
const displayName = profile?.name || profile?.display_name ||
|
const displayName = profile?.name || profile?.display_name ||
|
||||||
`${post.author.slice(0, 8)}...${post.author.slice(-4)}`
|
`${post.author.slice(0, 8)}...${post.author.slice(-4)}`
|
||||||
@@ -23,6 +24,16 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
|
|||||||
addSuffix: true
|
addSuffix: true
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Calculate progress percentage and determine color (matching readingProgressUtils.ts logic)
|
||||||
|
const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
|
||||||
|
let progressColor = '#6366f1' // Default blue (reading)
|
||||||
|
|
||||||
|
if (readingProgress && readingProgress >= 0.95) {
|
||||||
|
progressColor = '#10b981' // Green (completed)
|
||||||
|
} else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
|
||||||
|
progressColor = 'var(--color-text)' // Neutral text color (started)
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<Link
|
<Link
|
||||||
to={href}
|
to={href}
|
||||||
@@ -47,7 +58,37 @@ const BlogPostCard: React.FC<BlogPostCardProps> = ({ post, href, level }) => {
|
|||||||
{post.summary && (
|
{post.summary && (
|
||||||
<p className="blog-post-card-summary">{post.summary}</p>
|
<p className="blog-post-card-summary">{post.summary}</p>
|
||||||
)}
|
)}
|
||||||
<div className="blog-post-card-meta">
|
|
||||||
|
{/* Reading progress indicator - replaces the dividing line */}
|
||||||
|
{readingProgress !== undefined && readingProgress > 0 ? (
|
||||||
|
<div
|
||||||
|
className="blog-post-reading-progress"
|
||||||
|
style={{
|
||||||
|
height: '3px',
|
||||||
|
width: '100%',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
overflow: 'hidden',
|
||||||
|
marginTop: '1rem'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '100%',
|
||||||
|
width: `${progressPercent}%`,
|
||||||
|
background: progressColor,
|
||||||
|
transition: 'width 0.3s ease, background 0.3s ease'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div style={{
|
||||||
|
height: '1px',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
marginTop: '1rem'
|
||||||
|
}} />
|
||||||
|
)}
|
||||||
|
|
||||||
|
<div className="blog-post-card-meta" style={{ borderTop: 'none', paddingTop: '0.75rem' }}>
|
||||||
<span className="blog-post-card-author">
|
<span className="blog-post-card-author">
|
||||||
<FontAwesomeIcon icon={faUser} />
|
<FontAwesomeIcon icon={faUser} />
|
||||||
{displayName}
|
{displayName}
|
||||||
|
|||||||
44
src/components/BookmarkFilters.tsx
Normal file
44
src/components/BookmarkFilters.tsx
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faNewspaper, faStickyNote, faCirclePlay } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
import { faGlobe, faAsterisk, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
|
||||||
|
export type BookmarkFilterType = 'all' | 'article' | 'external' | 'video' | 'note' | 'web'
|
||||||
|
|
||||||
|
interface BookmarkFiltersProps {
|
||||||
|
selectedFilter: BookmarkFilterType
|
||||||
|
onFilterChange: (filter: BookmarkFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const BookmarkFilters: React.FC<BookmarkFiltersProps> = ({
|
||||||
|
selectedFilter,
|
||||||
|
onFilterChange
|
||||||
|
}) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'article' as const, icon: faNewspaper, label: 'Articles' },
|
||||||
|
{ type: 'external' as const, icon: faLink, label: 'External Articles' },
|
||||||
|
{ type: 'video' as const, icon: faCirclePlay, label: 'Videos' },
|
||||||
|
{ type: 'note' as const, icon: faStickyNote, label: 'Notes' },
|
||||||
|
{ type: 'web' as const, icon: faGlobe, label: 'Web' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${selectedFilter === filter.type ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default BookmarkFilters
|
||||||
|
|
||||||
@@ -1,5 +1,7 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { faBookOpen, faPlay, faEye } from '@fortawesome/free-solid-svg-icons'
|
import { faNewspaper, faStickyNote, faCirclePlay, faCamera, faFileLines } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
import { faGlobe, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { useEventModel } from 'applesauce-react/hooks'
|
import { useEventModel } from 'applesauce-react/hooks'
|
||||||
import { Models } from 'applesauce-core'
|
import { Models } from 'applesauce-core'
|
||||||
import { npubEncode, neventEncode } from 'nostr-tools/nip19'
|
import { npubEncode, neventEncode } from 'nostr-tools/nip19'
|
||||||
@@ -66,18 +68,41 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
return short(bookmark.pubkey) // fallback to short pubkey
|
return short(bookmark.pubkey) // fallback to short pubkey
|
||||||
}
|
}
|
||||||
|
|
||||||
// use helper from kindIcon.ts
|
// Get content type icon based on bookmark kind and URL classification
|
||||||
|
const getContentTypeIcon = (): IconDefinition => {
|
||||||
|
if (isArticle) return faNewspaper // Nostr-native article
|
||||||
|
|
||||||
|
// For web bookmarks, classify the URL to determine icon
|
||||||
|
if (isWebBookmark && firstUrlClassification) {
|
||||||
|
switch (firstUrlClassification.type) {
|
||||||
|
case 'youtube':
|
||||||
|
case 'video':
|
||||||
|
return faCirclePlay
|
||||||
|
case 'image':
|
||||||
|
return faCamera
|
||||||
|
case 'article':
|
||||||
|
return faLink // External article
|
||||||
|
default:
|
||||||
|
return faGlobe
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!hasUrls) return faStickyNote // Just a text note
|
||||||
|
if (firstUrlClassification?.type === 'youtube' || firstUrlClassification?.type === 'video') return faCirclePlay
|
||||||
|
if (firstUrlClassification?.type === 'article') return faLink // External article
|
||||||
|
return faFileLines
|
||||||
|
}
|
||||||
|
|
||||||
const getIconForUrlType = (url: string) => {
|
const getIconForUrlType = (url: string) => {
|
||||||
const classification = classifyUrl(url)
|
const classification = classifyUrl(url)
|
||||||
switch (classification.type) {
|
switch (classification.type) {
|
||||||
case 'youtube':
|
case 'youtube':
|
||||||
case 'video':
|
case 'video':
|
||||||
return faPlay
|
return faCirclePlay
|
||||||
case 'image':
|
case 'image':
|
||||||
return faEye
|
return faCamera
|
||||||
default:
|
default:
|
||||||
return faBookOpen
|
return faFileLines
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -113,11 +138,14 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
getAuthorDisplayName,
|
getAuthorDisplayName,
|
||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleImage,
|
articleImage,
|
||||||
articleSummary
|
articleSummary,
|
||||||
|
contentTypeIcon: getContentTypeIcon()
|
||||||
}
|
}
|
||||||
|
|
||||||
if (viewMode === 'compact') {
|
if (viewMode === 'compact') {
|
||||||
return <CompactView {...sharedProps} />
|
// eslint-disable-next-line @typescript-eslint/no-unused-vars, no-unused-vars
|
||||||
|
const { articleImage, ...compactProps } = sharedProps
|
||||||
|
return <CompactView {...compactProps} />
|
||||||
}
|
}
|
||||||
|
|
||||||
if (viewMode === 'large') {
|
if (viewMode === 'large') {
|
||||||
@@ -125,5 +153,5 @@ export const BookmarkItem: React.FC<BookmarkItemProps> = ({ bookmark, index, onS
|
|||||||
return <LargeView {...sharedProps} getIconForUrlType={getIconForUrlType} previewImage={previewImage} />
|
return <LargeView {...sharedProps} getIconForUrlType={getIconForUrlType} previewImage={previewImage} />
|
||||||
}
|
}
|
||||||
|
|
||||||
return <CardView {...sharedProps} getIconForUrlType={getIconForUrlType} articleImage={articleImage} />
|
return <CardView {...sharedProps} articleImage={articleImage} />
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,17 +1,27 @@
|
|||||||
import React, { useRef } from 'react'
|
import React, { useRef, useState } from 'react'
|
||||||
|
import { useNavigate } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronLeft, faBookmark, faList, faThLarge, faImage, faRotate, faHeart, faPlus } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { formatDistanceToNow } from 'date-fns'
|
import { formatDistanceToNow } from 'date-fns'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
||||||
import { BookmarkItem } from './BookmarkItem'
|
import { BookmarkItem } from './BookmarkItem'
|
||||||
import SidebarHeader from './SidebarHeader'
|
import SidebarHeader from './SidebarHeader'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
|
import CompactButton from './CompactButton'
|
||||||
import { ViewMode } from './Bookmarks'
|
import { ViewMode } from './Bookmarks'
|
||||||
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
|
||||||
import { usePullToRefresh } from 'use-pull-to-refresh'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import RefreshIndicator from './RefreshIndicator'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
import { BookmarkSkeleton } from './Skeletons'
|
import { BookmarkSkeleton } from './Skeletons'
|
||||||
|
import { groupIndividualBookmarks, hasContent, getBookmarkSets, getBookmarksWithoutSet } from '../utils/bookmarkUtils'
|
||||||
|
import { UserSettings } from '../services/settingsService'
|
||||||
|
import AddBookmarkModal from './AddBookmarkModal'
|
||||||
|
import { createWebBookmark } from '../services/webBookmarkService'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
|
||||||
|
import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import LoginOptions from './LoginOptions'
|
||||||
|
|
||||||
interface BookmarkListProps {
|
interface BookmarkListProps {
|
||||||
bookmarks: Bookmark[]
|
bookmarks: Bookmark[]
|
||||||
@@ -29,6 +39,7 @@ interface BookmarkListProps {
|
|||||||
loading?: boolean
|
loading?: boolean
|
||||||
relayPool: RelayPool | null
|
relayPool: RelayPool | null
|
||||||
isMobile?: boolean
|
isMobile?: boolean
|
||||||
|
settings?: UserSettings
|
||||||
}
|
}
|
||||||
|
|
||||||
export const BookmarkList: React.FC<BookmarkListProps> = ({
|
export const BookmarkList: React.FC<BookmarkListProps> = ({
|
||||||
@@ -46,9 +57,23 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
lastFetchTime,
|
lastFetchTime,
|
||||||
loading = false,
|
loading = false,
|
||||||
relayPool,
|
relayPool,
|
||||||
isMobile = false
|
isMobile = false,
|
||||||
|
settings
|
||||||
}) => {
|
}) => {
|
||||||
|
const navigate = useNavigate()
|
||||||
const bookmarksListRef = useRef<HTMLDivElement>(null)
|
const bookmarksListRef = useRef<HTMLDivElement>(null)
|
||||||
|
const friendsColor = settings?.highlightColorFriends || '#f97316'
|
||||||
|
const [showAddModal, setShowAddModal] = useState(false)
|
||||||
|
const [selectedFilter, setSelectedFilter] = useState<BookmarkFilterType>('all')
|
||||||
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
|
||||||
|
const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
|
||||||
|
if (!activeAccount || !relayPool) {
|
||||||
|
throw new Error('Please login to create bookmarks')
|
||||||
|
}
|
||||||
|
|
||||||
|
await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
|
||||||
|
}
|
||||||
|
|
||||||
// Pull-to-refresh for bookmarks
|
// Pull-to-refresh for bookmarks
|
||||||
const { isRefreshing: isPulling, pullPosition } = usePullToRefresh({
|
const { isRefreshing: isPulling, pullPosition } = usePullToRefresh({
|
||||||
@@ -62,36 +87,34 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
isDisabled: !onRefresh
|
isDisabled: !onRefresh
|
||||||
})
|
})
|
||||||
|
|
||||||
// Helper to check if a bookmark has either content or a URL
|
|
||||||
const hasContentOrUrl = (ib: IndividualBookmark) => {
|
|
||||||
// Check if has content (text)
|
|
||||||
const hasContent = ib.content && ib.content.trim().length > 0
|
|
||||||
|
|
||||||
// Check if has URL
|
|
||||||
let hasUrl = false
|
|
||||||
|
|
||||||
// For web bookmarks (kind:39701), URL is in the 'd' tag
|
|
||||||
if (ib.kind === 39701) {
|
|
||||||
const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
|
|
||||||
hasUrl = !!dTag && dTag.trim().length > 0
|
|
||||||
} else {
|
|
||||||
// For other bookmarks, extract URLs from content
|
|
||||||
const urls = extractUrlsFromContent(ib.content || '')
|
|
||||||
hasUrl = urls.length > 0
|
|
||||||
}
|
|
||||||
|
|
||||||
// Always show articles (kind:30023) as they have special handling
|
|
||||||
if (ib.kind === 30023) return true
|
|
||||||
|
|
||||||
// Otherwise, must have either content or URL
|
|
||||||
return hasContent || hasUrl
|
|
||||||
}
|
|
||||||
|
|
||||||
// Merge and flatten all individual bookmarks from all lists
|
// Merge and flatten all individual bookmarks from all lists
|
||||||
// Re-sort after flattening to ensure newest first across all lists
|
|
||||||
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
.filter(hasContentOrUrl)
|
.filter(hasContent)
|
||||||
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
|
||||||
|
// Apply filter
|
||||||
|
const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, selectedFilter)
|
||||||
|
|
||||||
|
// Separate bookmarks with setName (kind 30003) from regular bookmarks
|
||||||
|
const bookmarksWithoutSet = getBookmarksWithoutSet(filteredBookmarks)
|
||||||
|
const bookmarkSets = getBookmarkSets(filteredBookmarks)
|
||||||
|
|
||||||
|
// Group non-set bookmarks as before
|
||||||
|
const groups = groupIndividualBookmarks(bookmarksWithoutSet)
|
||||||
|
const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
|
||||||
|
{ key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
|
||||||
|
{ key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
|
||||||
|
{ key: 'web', title: 'Web Bookmarks', items: groups.web },
|
||||||
|
{ key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
|
||||||
|
]
|
||||||
|
|
||||||
|
// Add bookmark sets as additional sections
|
||||||
|
bookmarkSets.forEach(set => {
|
||||||
|
sections.push({
|
||||||
|
key: `set-${set.name}`,
|
||||||
|
title: set.title || set.name,
|
||||||
|
items: set.bookmarks
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
if (isCollapsed) {
|
if (isCollapsed) {
|
||||||
// Check if the selected URL is in bookmarks
|
// Check if the selected URL is in bookmarks
|
||||||
@@ -121,11 +144,23 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
onToggleCollapse={onToggleCollapse}
|
onToggleCollapse={onToggleCollapse}
|
||||||
onLogout={onLogout}
|
onLogout={onLogout}
|
||||||
onOpenSettings={onOpenSettings}
|
onOpenSettings={onOpenSettings}
|
||||||
relayPool={relayPool}
|
|
||||||
isMobile={isMobile}
|
isMobile={isMobile}
|
||||||
/>
|
/>
|
||||||
|
|
||||||
{allIndividualBookmarks.length === 0 ? (
|
{allIndividualBookmarks.length > 0 && (
|
||||||
|
<BookmarkFilters
|
||||||
|
selectedFilter={selectedFilter}
|
||||||
|
onFilterChange={setSelectedFilter}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
|
|
||||||
|
{!activeAccount ? (
|
||||||
|
<LoginOptions />
|
||||||
|
) : filteredBookmarks.length === 0 && allIndividualBookmarks.length > 0 ? (
|
||||||
|
<div className="empty-state">
|
||||||
|
<p>No bookmarks match this filter.</p>
|
||||||
|
</div>
|
||||||
|
) : allIndividualBookmarks.length === 0 ? (
|
||||||
loading ? (
|
loading ? (
|
||||||
<div className={`bookmarks-list ${viewMode}`} aria-busy="true">
|
<div className={`bookmarks-list ${viewMode}`} aria-busy="true">
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
@@ -138,7 +173,6 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
<div className="empty-state">
|
<div className="empty-state">
|
||||||
<p>No bookmarks found.</p>
|
<p>No bookmarks found.</p>
|
||||||
<p>Add bookmarks using your nostr client to see them here.</p>
|
<p>Add bookmarks using your nostr client to see them here.</p>
|
||||||
<p>If you aren't on nostr yet, start here: <a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">nstart.me</a></p>
|
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
) : (
|
) : (
|
||||||
@@ -150,53 +184,87 @@ export const BookmarkList: React.FC<BookmarkListProps> = ({
|
|||||||
isRefreshing={isPulling || isRefreshing || false}
|
isRefreshing={isPulling || isRefreshing || false}
|
||||||
pullPosition={pullPosition}
|
pullPosition={pullPosition}
|
||||||
/>
|
/>
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
{sections.filter(s => s.items.length > 0).map(section => (
|
||||||
{allIndividualBookmarks.map((individualBookmark, index) =>
|
<div key={section.key} className="bookmarks-section">
|
||||||
<BookmarkItem
|
<div style={{ display: 'flex', alignItems: 'center', justifyContent: 'space-between' }}>
|
||||||
key={`${individualBookmark.id}-${index}`}
|
<h3 className="bookmarks-section-title" style={{ margin: 0, padding: '1.5rem 0.5rem 0.375rem', flex: 1 }}>{section.title}</h3>
|
||||||
bookmark={individualBookmark}
|
{section.key === 'web' && activeAccount && (
|
||||||
index={index}
|
<CompactButton
|
||||||
onSelectUrl={onSelectUrl}
|
icon={faPlus}
|
||||||
viewMode={viewMode}
|
onClick={() => setShowAddModal(true)}
|
||||||
/>
|
title="Add web bookmark"
|
||||||
)}
|
ariaLabel="Add web bookmark"
|
||||||
</div>
|
className="bookmark-section-action"
|
||||||
|
/>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
|
{section.items.map((individualBookmark, index) => (
|
||||||
|
<BookmarkItem
|
||||||
|
key={`${section.key}-${individualBookmark.id}-${index}`}
|
||||||
|
bookmark={individualBookmark}
|
||||||
|
index={index}
|
||||||
|
onSelectUrl={onSelectUrl}
|
||||||
|
viewMode={viewMode}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
))}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
<div className="view-mode-controls">
|
<div className="view-mode-controls">
|
||||||
{onRefresh && (
|
<div className="view-mode-left">
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faRotate}
|
icon={faHeart}
|
||||||
onClick={onRefresh}
|
onClick={() => navigate('/support')}
|
||||||
title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
|
title="Support Boris"
|
||||||
ariaLabel="Refresh bookmarks"
|
ariaLabel="Support"
|
||||||
variant="ghost"
|
variant="ghost"
|
||||||
disabled={isRefreshing}
|
style={{ color: friendsColor }}
|
||||||
spin={isRefreshing}
|
|
||||||
/>
|
/>
|
||||||
)}
|
</div>
|
||||||
<IconButton
|
<div className="view-mode-right">
|
||||||
icon={faList}
|
{onRefresh && (
|
||||||
onClick={() => onViewModeChange('compact')}
|
<IconButton
|
||||||
title="Compact list view"
|
icon={faRotate}
|
||||||
ariaLabel="Compact list view"
|
onClick={onRefresh}
|
||||||
variant={viewMode === 'compact' ? 'primary' : 'ghost'}
|
title={lastFetchTime ? `Refresh bookmarks (updated ${formatDistanceToNow(lastFetchTime, { addSuffix: true })})` : 'Refresh bookmarks'}
|
||||||
/>
|
ariaLabel="Refresh bookmarks"
|
||||||
<IconButton
|
variant="ghost"
|
||||||
icon={faThLarge}
|
disabled={isRefreshing}
|
||||||
onClick={() => onViewModeChange('cards')}
|
spin={isRefreshing}
|
||||||
title="Cards view"
|
/>
|
||||||
ariaLabel="Cards view"
|
)}
|
||||||
variant={viewMode === 'cards' ? 'primary' : 'ghost'}
|
<IconButton
|
||||||
/>
|
icon={faList}
|
||||||
<IconButton
|
onClick={() => onViewModeChange('compact')}
|
||||||
icon={faImage}
|
title="Compact list view"
|
||||||
onClick={() => onViewModeChange('large')}
|
ariaLabel="Compact list view"
|
||||||
title="Large preview view"
|
variant={viewMode === 'compact' ? 'primary' : 'ghost'}
|
||||||
ariaLabel="Large preview view"
|
/>
|
||||||
variant={viewMode === 'large' ? 'primary' : 'ghost'}
|
<IconButton
|
||||||
/>
|
icon={faThLarge}
|
||||||
|
onClick={() => onViewModeChange('cards')}
|
||||||
|
title="Cards view"
|
||||||
|
ariaLabel="Cards view"
|
||||||
|
variant={viewMode === 'cards' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faImage}
|
||||||
|
onClick={() => onViewModeChange('large')}
|
||||||
|
title="Large preview view"
|
||||||
|
ariaLabel="Large preview view"
|
||||||
|
variant={viewMode === 'large' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
{showAddModal && (
|
||||||
|
<AddBookmarkModal
|
||||||
|
onClose={() => setShowAddModal(false)}
|
||||||
|
onSave={handleSaveBookmark}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,13 +1,12 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { Link } from 'react-router-dom'
|
import { Link } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faUserLock, faChevronDown, faChevronUp, faGlobe } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronDown, faChevronUp } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
|
import { formatDate, renderParsedContent } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
import IconButton from '../IconButton'
|
|
||||||
import { classifyUrl } from '../../utils/helpers'
|
import { classifyUrl } from '../../utils/helpers'
|
||||||
import { IconGetter } from './shared'
|
|
||||||
import { useImageCache } from '../../hooks/useImageCache'
|
import { useImageCache } from '../../hooks/useImageCache'
|
||||||
import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
|
import { getPreviewImage, fetchOgImage } from '../../utils/imagePreview'
|
||||||
import { getEventUrl } from '../../config/nostrGateways'
|
import { getEventUrl } from '../../config/nostrGateways'
|
||||||
@@ -18,13 +17,13 @@ interface CardViewProps {
|
|||||||
hasUrls: boolean
|
hasUrls: boolean
|
||||||
extractedUrls: string[]
|
extractedUrls: string[]
|
||||||
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
||||||
getIconForUrlType: IconGetter
|
|
||||||
authorNpub: string
|
authorNpub: string
|
||||||
eventNevent?: string
|
eventNevent?: string
|
||||||
getAuthorDisplayName: () => string
|
getAuthorDisplayName: () => string
|
||||||
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
||||||
articleImage?: string
|
articleImage?: string
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
|
contentTypeIcon: IconDefinition
|
||||||
}
|
}
|
||||||
|
|
||||||
export const CardView: React.FC<CardViewProps> = ({
|
export const CardView: React.FC<CardViewProps> = ({
|
||||||
@@ -33,13 +32,13 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
hasUrls,
|
hasUrls,
|
||||||
extractedUrls,
|
extractedUrls,
|
||||||
onSelectUrl,
|
onSelectUrl,
|
||||||
getIconForUrlType,
|
|
||||||
authorNpub,
|
authorNpub,
|
||||||
eventNevent,
|
eventNevent,
|
||||||
getAuthorDisplayName,
|
getAuthorDisplayName,
|
||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleImage,
|
articleImage,
|
||||||
articleSummary
|
articleSummary,
|
||||||
|
contentTypeIcon
|
||||||
}) => {
|
}) => {
|
||||||
const firstUrl = hasUrls ? extractedUrls[0] : null
|
const firstUrl = hasUrls ? extractedUrls[0] : null
|
||||||
const firstUrlClassificationType = firstUrl ? classifyUrl(firstUrl)?.type : null
|
const firstUrlClassificationType = firstUrl ? classifyUrl(firstUrl)?.type : null
|
||||||
@@ -52,7 +51,6 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
const contentLength = (bookmark.content || '').length
|
const contentLength = (bookmark.content || '').length
|
||||||
const shouldTruncate = !expanded && contentLength > 210
|
const shouldTruncate = !expanded && contentLength > 210
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
const isWebBookmark = bookmark.kind === 39701
|
|
||||||
|
|
||||||
// Determine which image to use (article image, instant preview, or OG image)
|
// Determine which image to use (article image, instant preview, or OG image)
|
||||||
const previewImage = articleImage || instantPreview || ogImage
|
const previewImage = articleImage || instantPreview || ogImage
|
||||||
@@ -92,19 +90,7 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
)}
|
)}
|
||||||
<div className="bookmark-header">
|
<div className="bookmark-header">
|
||||||
<span className="bookmark-type">
|
<span className="bookmark-type">
|
||||||
{isWebBookmark ? (
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
<span className="fa-layers fa-fw">
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
|
|
||||||
</span>
|
|
||||||
) : bookmark.isPrivate ? (
|
|
||||||
<>
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
|
|
||||||
</>
|
|
||||||
) : (
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
)}
|
|
||||||
</span>
|
</span>
|
||||||
|
|
||||||
{eventNevent ? (
|
{eventNevent ? (
|
||||||
@@ -127,23 +113,14 @@ export const CardView: React.FC<CardViewProps> = ({
|
|||||||
<div className="bookmark-urls">
|
<div className="bookmark-urls">
|
||||||
{(urlsExpanded ? extractedUrls : extractedUrls.slice(0, 1)).map((url, urlIndex) => {
|
{(urlsExpanded ? extractedUrls : extractedUrls.slice(0, 1)).map((url, urlIndex) => {
|
||||||
return (
|
return (
|
||||||
<div key={urlIndex} className="url-row">
|
<button
|
||||||
<button
|
key={urlIndex}
|
||||||
className="bookmark-url"
|
className="bookmark-url"
|
||||||
onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
|
onClick={(e) => { e.stopPropagation(); onSelectUrl?.(url) }}
|
||||||
title="Open in reader"
|
title="Open in reader"
|
||||||
>
|
>
|
||||||
{url}
|
{url}
|
||||||
</button>
|
</button>
|
||||||
<IconButton
|
|
||||||
icon={getIconForUrlType(url)}
|
|
||||||
ariaLabel="Open"
|
|
||||||
title="Open"
|
|
||||||
variant="success"
|
|
||||||
size={32}
|
|
||||||
onClick={(e) => { e.preventDefault(); e.stopPropagation(); onSelectUrl?.(url) }}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
)
|
)
|
||||||
})}
|
})}
|
||||||
{extractedUrls.length > 1 && (
|
{extractedUrls.length > 1 && (
|
||||||
|
|||||||
@@ -1,10 +1,9 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faUserLock, faGlobe } from '@fortawesome/free-solid-svg-icons'
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDateCompact } from '../../utils/bookmarkUtils'
|
import { formatDateCompact } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
import { useImageCache } from '../../hooks/useImageCache'
|
|
||||||
|
|
||||||
interface CompactViewProps {
|
interface CompactViewProps {
|
||||||
bookmark: IndividualBookmark
|
bookmark: IndividualBookmark
|
||||||
@@ -12,8 +11,8 @@ interface CompactViewProps {
|
|||||||
hasUrls: boolean
|
hasUrls: boolean
|
||||||
extractedUrls: string[]
|
extractedUrls: string[]
|
||||||
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
onSelectUrl?: (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => void
|
||||||
articleImage?: string
|
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
|
contentTypeIcon: IconDefinition
|
||||||
}
|
}
|
||||||
|
|
||||||
export const CompactView: React.FC<CompactViewProps> = ({
|
export const CompactView: React.FC<CompactViewProps> = ({
|
||||||
@@ -22,16 +21,13 @@ export const CompactView: React.FC<CompactViewProps> = ({
|
|||||||
hasUrls,
|
hasUrls,
|
||||||
extractedUrls,
|
extractedUrls,
|
||||||
onSelectUrl,
|
onSelectUrl,
|
||||||
articleImage,
|
articleSummary,
|
||||||
articleSummary
|
contentTypeIcon
|
||||||
}) => {
|
}) => {
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
const isWebBookmark = bookmark.kind === 39701
|
const isWebBookmark = bookmark.kind === 39701
|
||||||
const isClickable = hasUrls || isArticle || isWebBookmark
|
const isClickable = hasUrls || isArticle || isWebBookmark
|
||||||
|
|
||||||
// Get cached image for thumbnail
|
|
||||||
const cachedImage = useImageCache(articleImage || undefined)
|
|
||||||
|
|
||||||
const handleCompactClick = () => {
|
const handleCompactClick = () => {
|
||||||
if (!onSelectUrl) return
|
if (!onSelectUrl) return
|
||||||
|
|
||||||
@@ -55,27 +51,8 @@ export const CompactView: React.FC<CompactViewProps> = ({
|
|||||||
role={isClickable ? 'button' : undefined}
|
role={isClickable ? 'button' : undefined}
|
||||||
tabIndex={isClickable ? 0 : undefined}
|
tabIndex={isClickable ? 0 : undefined}
|
||||||
>
|
>
|
||||||
{/* Thumbnail image */}
|
|
||||||
{cachedImage && (
|
|
||||||
<div className="compact-thumbnail">
|
|
||||||
<img src={cachedImage} alt="" />
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
|
|
||||||
<span className="bookmark-type-compact">
|
<span className="bookmark-type-compact">
|
||||||
{isWebBookmark ? (
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
<span className="fa-layers fa-fw">
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faGlobe} className="bookmark-visibility public" transform="shrink-8 down-2" />
|
|
||||||
</span>
|
|
||||||
) : bookmark.isPrivate ? (
|
|
||||||
<>
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
<FontAwesomeIcon icon={faUserLock} className="bookmark-visibility private" />
|
|
||||||
</>
|
|
||||||
) : (
|
|
||||||
<FontAwesomeIcon icon={faBookmark} className="bookmark-visibility public" />
|
|
||||||
)}
|
|
||||||
</span>
|
</span>
|
||||||
{displayText && (
|
{displayText && (
|
||||||
<div className="compact-text">
|
<div className="compact-text">
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { Link } from 'react-router-dom'
|
import { Link } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { IconDefinition } from '@fortawesome/fontawesome-svg-core'
|
||||||
import { IndividualBookmark } from '../../types/bookmarks'
|
import { IndividualBookmark } from '../../types/bookmarks'
|
||||||
import { formatDate } from '../../utils/bookmarkUtils'
|
import { formatDate } from '../../utils/bookmarkUtils'
|
||||||
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
import ContentWithResolvedProfiles from '../ContentWithResolvedProfiles'
|
||||||
@@ -21,6 +22,8 @@ interface LargeViewProps {
|
|||||||
getAuthorDisplayName: () => string
|
getAuthorDisplayName: () => string
|
||||||
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
handleReadNow: (e: React.MouseEvent<HTMLButtonElement>) => void
|
||||||
articleSummary?: string
|
articleSummary?: string
|
||||||
|
contentTypeIcon: IconDefinition
|
||||||
|
readingProgress?: number // 0-1 reading progress (optional)
|
||||||
}
|
}
|
||||||
|
|
||||||
export const LargeView: React.FC<LargeViewProps> = ({
|
export const LargeView: React.FC<LargeViewProps> = ({
|
||||||
@@ -35,11 +38,23 @@ export const LargeView: React.FC<LargeViewProps> = ({
|
|||||||
eventNevent,
|
eventNevent,
|
||||||
getAuthorDisplayName,
|
getAuthorDisplayName,
|
||||||
handleReadNow,
|
handleReadNow,
|
||||||
articleSummary
|
articleSummary,
|
||||||
|
contentTypeIcon,
|
||||||
|
readingProgress
|
||||||
}) => {
|
}) => {
|
||||||
const cachedImage = useImageCache(previewImage || undefined)
|
const cachedImage = useImageCache(previewImage || undefined)
|
||||||
const isArticle = bookmark.kind === 30023
|
const isArticle = bookmark.kind === 30023
|
||||||
|
|
||||||
|
// Calculate progress display (matching readingProgressUtils.ts logic)
|
||||||
|
const progressPercent = readingProgress ? Math.round(readingProgress * 100) : 0
|
||||||
|
let progressColor = '#6366f1' // Default blue (reading)
|
||||||
|
|
||||||
|
if (readingProgress && readingProgress >= 0.95) {
|
||||||
|
progressColor = '#10b981' // Green (completed)
|
||||||
|
} else if (readingProgress && readingProgress > 0 && readingProgress <= 0.10) {
|
||||||
|
progressColor = 'var(--color-text)' // Neutral text color (started)
|
||||||
|
}
|
||||||
|
|
||||||
const triggerOpen = () => handleReadNow({ preventDefault: () => {} } as React.MouseEvent<HTMLButtonElement>)
|
const triggerOpen = () => handleReadNow({ preventDefault: () => {} } as React.MouseEvent<HTMLButtonElement>)
|
||||||
const handleKeyDown: React.KeyboardEventHandler<HTMLDivElement> = (e) => {
|
const handleKeyDown: React.KeyboardEventHandler<HTMLDivElement> = (e) => {
|
||||||
if (e.key === 'Enter' || e.key === ' ') {
|
if (e.key === 'Enter' || e.key === ' ') {
|
||||||
@@ -89,7 +104,32 @@ export const LargeView: React.FC<LargeViewProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
|
|
||||||
|
{/* Reading progress indicator for articles - shown only if there's progress */}
|
||||||
|
{isArticle && readingProgress !== undefined && readingProgress > 0 && (
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '3px',
|
||||||
|
width: '100%',
|
||||||
|
background: 'var(--color-border)',
|
||||||
|
overflow: 'hidden',
|
||||||
|
marginTop: '0.75rem'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<div
|
||||||
|
style={{
|
||||||
|
height: '100%',
|
||||||
|
width: `${progressPercent}%`,
|
||||||
|
background: progressColor,
|
||||||
|
transition: 'width 0.3s ease, background 0.3s ease'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
|
||||||
<div className="large-footer">
|
<div className="large-footer">
|
||||||
|
<span className="bookmark-type-large">
|
||||||
|
<FontAwesomeIcon icon={contentTypeIcon} className="content-type-icon" />
|
||||||
|
</span>
|
||||||
<span className="large-author">
|
<span className="large-author">
|
||||||
<Link
|
<Link
|
||||||
to={`/p/${authorNpub}`}
|
to={`/p/${authorNpub}`}
|
||||||
|
|||||||
@@ -52,22 +52,25 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
const meTab = location.pathname === '/me' ? 'highlights' :
|
const meTab = location.pathname === '/me' ? 'highlights' :
|
||||||
location.pathname === '/me/highlights' ? 'highlights' :
|
location.pathname === '/me/highlights' ? 'highlights' :
|
||||||
location.pathname === '/me/reading-list' ? 'reading-list' :
|
location.pathname === '/me/reading-list' ? 'reading-list' :
|
||||||
location.pathname === '/me/archive' ? 'archive' :
|
location.pathname.startsWith('/me/reads') ? 'reads' :
|
||||||
|
location.pathname === '/me/links' ? 'links' :
|
||||||
location.pathname === '/me/writings' ? 'writings' : 'highlights'
|
location.pathname === '/me/writings' ? 'writings' : 'highlights'
|
||||||
|
|
||||||
// Extract tab from profile routes
|
// Extract tab from profile routes
|
||||||
const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
|
const profileTab = location.pathname.endsWith('/writings') ? 'writings' : 'highlights'
|
||||||
|
|
||||||
// Decode npub to pubkey for profile view
|
// Decode npub or nprofile to pubkey for profile view
|
||||||
let profilePubkey: string | undefined
|
let profilePubkey: string | undefined
|
||||||
if (npub && showProfile) {
|
if (npub && showProfile) {
|
||||||
try {
|
try {
|
||||||
const decoded = nip19.decode(npub)
|
const decoded = nip19.decode(npub)
|
||||||
if (decoded.type === 'npub') {
|
if (decoded.type === 'npub') {
|
||||||
profilePubkey = decoded.data
|
profilePubkey = decoded.data
|
||||||
|
} else if (decoded.type === 'nprofile') {
|
||||||
|
profilePubkey = decoded.data.pubkey
|
||||||
}
|
}
|
||||||
} catch (err) {
|
} catch (err) {
|
||||||
console.error('Failed to decode npub:', err)
|
console.error('Failed to decode npub/nprofile:', err)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -165,6 +168,7 @@ const Bookmarks: React.FC<BookmarksProps> = ({ relayPool, onLogout }) => {
|
|||||||
activeAccount,
|
activeAccount,
|
||||||
accountManager,
|
accountManager,
|
||||||
naddr,
|
naddr,
|
||||||
|
externalUrl,
|
||||||
currentArticleCoordinate,
|
currentArticleCoordinate,
|
||||||
currentArticleEventId,
|
currentArticleEventId,
|
||||||
settings
|
settings
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
import React, { useMemo, useState, useEffect, useRef } from 'react'
|
import React, { useMemo, useState, useEffect, useRef, useCallback } from 'react'
|
||||||
import ReactPlayer from 'react-player'
|
import ReactPlayer from 'react-player'
|
||||||
import ReactMarkdown from 'react-markdown'
|
import ReactMarkdown from 'react-markdown'
|
||||||
import remarkGfm from 'remark-gfm'
|
import remarkGfm from 'remark-gfm'
|
||||||
@@ -6,10 +6,10 @@ import rehypeRaw from 'rehype-raw'
|
|||||||
import rehypePrism from 'rehype-prism-plus'
|
import rehypePrism from 'rehype-prism-plus'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import 'prismjs/themes/prism-tomorrow.css'
|
import 'prismjs/themes/prism-tomorrow.css'
|
||||||
import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare } from '@fortawesome/free-solid-svg-icons'
|
import { faSpinner, faCheckCircle, faEllipsisH, faExternalLinkAlt, faMobileAlt, faCopy, faShare, faSearch } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { ContentSkeleton } from './Skeletons'
|
import { ContentSkeleton } from './Skeletons'
|
||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { getNostrUrl } from '../config/nostrGateways'
|
import { getNostrUrl, getSearchUrl } from '../config/nostrGateways'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { IAccount } from 'applesauce-accounts'
|
import { IAccount } from 'applesauce-accounts'
|
||||||
@@ -36,6 +36,13 @@ import { classifyUrl } from '../utils/helpers'
|
|||||||
import { buildNativeVideoUrl } from '../utils/videoHelpers'
|
import { buildNativeVideoUrl } from '../utils/videoHelpers'
|
||||||
import { useReadingPosition } from '../hooks/useReadingPosition'
|
import { useReadingPosition } from '../hooks/useReadingPosition'
|
||||||
import { ReadingProgressIndicator } from './ReadingProgressIndicator'
|
import { ReadingProgressIndicator } from './ReadingProgressIndicator'
|
||||||
|
import { EventFactory } from 'applesauce-factory'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import {
|
||||||
|
generateArticleIdentifier,
|
||||||
|
loadReadingPosition,
|
||||||
|
saveReadingPosition
|
||||||
|
} from '../services/readingPositionService'
|
||||||
|
|
||||||
interface ContentPanelProps {
|
interface ContentPanelProps {
|
||||||
loading: boolean
|
loading: boolean
|
||||||
@@ -100,6 +107,9 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
const [showArticleMenu, setShowArticleMenu] = useState(false)
|
const [showArticleMenu, setShowArticleMenu] = useState(false)
|
||||||
const [showVideoMenu, setShowVideoMenu] = useState(false)
|
const [showVideoMenu, setShowVideoMenu] = useState(false)
|
||||||
const [showExternalMenu, setShowExternalMenu] = useState(false)
|
const [showExternalMenu, setShowExternalMenu] = useState(false)
|
||||||
|
const [articleMenuOpenUpward, setArticleMenuOpenUpward] = useState(false)
|
||||||
|
const [videoMenuOpenUpward, setVideoMenuOpenUpward] = useState(false)
|
||||||
|
const [externalMenuOpenUpward, setExternalMenuOpenUpward] = useState(false)
|
||||||
const articleMenuRef = useRef<HTMLDivElement>(null)
|
const articleMenuRef = useRef<HTMLDivElement>(null)
|
||||||
const videoMenuRef = useRef<HTMLDivElement>(null)
|
const videoMenuRef = useRef<HTMLDivElement>(null)
|
||||||
const externalMenuRef = useRef<HTMLDivElement>(null)
|
const externalMenuRef = useRef<HTMLDivElement>(null)
|
||||||
@@ -126,10 +136,58 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
onClearSelection
|
onClearSelection
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Get event store for reading position service
|
||||||
|
const eventStore = Hooks.useEventStore()
|
||||||
|
|
||||||
// Reading position tracking - only for text content, not videos
|
// Reading position tracking - only for text content, not videos
|
||||||
const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
|
const isTextContent = !loading && !!(markdown || html) && !selectedUrl?.includes('youtube') && !selectedUrl?.includes('vimeo')
|
||||||
const { isReadingComplete, progressPercentage } = useReadingPosition({
|
|
||||||
|
// Generate article identifier for saving/loading position
|
||||||
|
const articleIdentifier = useMemo(() => {
|
||||||
|
if (!selectedUrl) return null
|
||||||
|
return generateArticleIdentifier(selectedUrl)
|
||||||
|
}, [selectedUrl])
|
||||||
|
|
||||||
|
// Callback to save reading position
|
||||||
|
const handleSavePosition = useCallback(async (position: number) => {
|
||||||
|
if (!activeAccount || !relayPool || !eventStore || !articleIdentifier) {
|
||||||
|
console.log('⏭️ [ContentPanel] Skipping save - missing requirements:', {
|
||||||
|
hasAccount: !!activeAccount,
|
||||||
|
hasRelayPool: !!relayPool,
|
||||||
|
hasEventStore: !!eventStore,
|
||||||
|
hasIdentifier: !!articleIdentifier
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if (!settings?.syncReadingPosition) {
|
||||||
|
console.log('⏭️ [ContentPanel] Sync disabled in settings')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('💾 [ContentPanel] Saving position:', Math.round(position * 100) + '%', 'for article:', selectedUrl?.slice(0, 50))
|
||||||
|
|
||||||
|
try {
|
||||||
|
const factory = new EventFactory({ signer: activeAccount })
|
||||||
|
await saveReadingPosition(
|
||||||
|
relayPool,
|
||||||
|
eventStore,
|
||||||
|
factory,
|
||||||
|
articleIdentifier,
|
||||||
|
{
|
||||||
|
position,
|
||||||
|
timestamp: Math.floor(Date.now() / 1000),
|
||||||
|
scrollTop: window.pageYOffset || document.documentElement.scrollTop
|
||||||
|
}
|
||||||
|
)
|
||||||
|
} catch (error) {
|
||||||
|
console.error('❌ [ContentPanel] Failed to save reading position:', error)
|
||||||
|
}
|
||||||
|
}, [activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
|
||||||
|
|
||||||
|
const { isReadingComplete, progressPercentage, saveNow } = useReadingPosition({
|
||||||
enabled: isTextContent,
|
enabled: isTextContent,
|
||||||
|
syncEnabled: settings?.syncReadingPosition,
|
||||||
|
onSave: handleSavePosition,
|
||||||
onReadingComplete: () => {
|
onReadingComplete: () => {
|
||||||
// Optional: Auto-mark as read when reading is complete
|
// Optional: Auto-mark as read when reading is complete
|
||||||
if (activeAccount && !isMarkedAsRead) {
|
if (activeAccount && !isMarkedAsRead) {
|
||||||
@@ -138,6 +196,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Load saved reading position when article loads
|
||||||
|
useEffect(() => {
|
||||||
|
if (!isTextContent || !activeAccount || !relayPool || !eventStore || !articleIdentifier) {
|
||||||
|
console.log('⏭️ [ContentPanel] Skipping position restore - missing requirements:', {
|
||||||
|
isTextContent,
|
||||||
|
hasAccount: !!activeAccount,
|
||||||
|
hasRelayPool: !!relayPool,
|
||||||
|
hasEventStore: !!eventStore,
|
||||||
|
hasIdentifier: !!articleIdentifier
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if (!settings?.syncReadingPosition) {
|
||||||
|
console.log('⏭️ [ContentPanel] Sync disabled - not restoring position')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('📖 [ContentPanel] Loading position for article:', selectedUrl?.slice(0, 50))
|
||||||
|
|
||||||
|
const loadPosition = async () => {
|
||||||
|
try {
|
||||||
|
const savedPosition = await loadReadingPosition(
|
||||||
|
relayPool,
|
||||||
|
eventStore,
|
||||||
|
activeAccount.pubkey,
|
||||||
|
articleIdentifier
|
||||||
|
)
|
||||||
|
|
||||||
|
if (savedPosition && savedPosition.position > 0.05 && savedPosition.position < 1) {
|
||||||
|
console.log('🎯 [ContentPanel] Restoring position:', Math.round(savedPosition.position * 100) + '%')
|
||||||
|
// Wait for content to be fully rendered before scrolling
|
||||||
|
setTimeout(() => {
|
||||||
|
const documentHeight = document.documentElement.scrollHeight
|
||||||
|
const windowHeight = window.innerHeight
|
||||||
|
const scrollTop = savedPosition.position * (documentHeight - windowHeight)
|
||||||
|
|
||||||
|
window.scrollTo({
|
||||||
|
top: scrollTop,
|
||||||
|
behavior: 'smooth'
|
||||||
|
})
|
||||||
|
|
||||||
|
console.log('✅ [ContentPanel] Restored to position:', Math.round(savedPosition.position * 100) + '%', 'scrollTop:', scrollTop)
|
||||||
|
}, 500) // Give content time to render
|
||||||
|
} else if (savedPosition) {
|
||||||
|
if (savedPosition.position === 1) {
|
||||||
|
console.log('✅ [ContentPanel] Article completed (100%), starting from top')
|
||||||
|
} else {
|
||||||
|
console.log('⏭️ [ContentPanel] Position too early (<5%):', Math.round(savedPosition.position * 100) + '%')
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.error('❌ [ContentPanel] Failed to load reading position:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
loadPosition()
|
||||||
|
}, [isTextContent, activeAccount, relayPool, eventStore, articleIdentifier, settings?.syncReadingPosition, selectedUrl])
|
||||||
|
|
||||||
|
// Save position before unmounting or changing article
|
||||||
|
useEffect(() => {
|
||||||
|
return () => {
|
||||||
|
if (saveNow) {
|
||||||
|
saveNow()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}, [saveNow, selectedUrl])
|
||||||
|
|
||||||
// Close menu when clicking outside
|
// Close menu when clicking outside
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const handleClickOutside = (event: MouseEvent) => {
|
const handleClickOutside = (event: MouseEvent) => {
|
||||||
@@ -161,6 +286,35 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
||||||
|
|
||||||
|
// Check available space and position menu upward if needed
|
||||||
|
useEffect(() => {
|
||||||
|
const checkMenuPosition = (menuRef: React.RefObject<HTMLDivElement>, setOpenUpward: (value: boolean) => void) => {
|
||||||
|
if (!menuRef.current) return
|
||||||
|
|
||||||
|
const menuWrapper = menuRef.current
|
||||||
|
const menuElement = menuWrapper.querySelector('.article-menu') as HTMLElement
|
||||||
|
if (!menuElement) return
|
||||||
|
|
||||||
|
const rect = menuWrapper.getBoundingClientRect()
|
||||||
|
const viewportHeight = window.innerHeight
|
||||||
|
const spaceBelow = viewportHeight - rect.bottom
|
||||||
|
const menuHeight = menuElement.offsetHeight || 300 // estimate if not rendered yet
|
||||||
|
|
||||||
|
// Open upward if there's not enough space below (with 20px buffer)
|
||||||
|
setOpenUpward(spaceBelow < menuHeight + 20 && rect.top > menuHeight)
|
||||||
|
}
|
||||||
|
|
||||||
|
if (showArticleMenu) {
|
||||||
|
checkMenuPosition(articleMenuRef, setArticleMenuOpenUpward)
|
||||||
|
}
|
||||||
|
if (showVideoMenu) {
|
||||||
|
checkMenuPosition(videoMenuRef, setVideoMenuOpenUpward)
|
||||||
|
}
|
||||||
|
if (showExternalMenu) {
|
||||||
|
checkMenuPosition(externalMenuRef, setExternalMenuOpenUpward)
|
||||||
|
}
|
||||||
|
}, [showArticleMenu, showVideoMenu, showExternalMenu])
|
||||||
|
|
||||||
const readingStats = useMemo(() => {
|
const readingStats = useMemo(() => {
|
||||||
const content = markdown || html || ''
|
const content = markdown || html || ''
|
||||||
if (!content) return null
|
if (!content) return null
|
||||||
@@ -218,9 +372,15 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
relays: relayHints
|
relays: relayHints
|
||||||
})
|
})
|
||||||
|
|
||||||
|
// Check for source URL in 'r' tags
|
||||||
|
const sourceUrl = currentArticle.tags.find(t => t[0] === 'r')?.[1]
|
||||||
|
|
||||||
return {
|
return {
|
||||||
portal: getNostrUrl(naddr),
|
portal: getNostrUrl(naddr),
|
||||||
native: `nostr:${naddr}`
|
native: `nostr:${naddr}`,
|
||||||
|
naddr,
|
||||||
|
sourceUrl,
|
||||||
|
borisUrl: `${window.location.origin}/a/${naddr}`
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -245,6 +405,73 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
}
|
}
|
||||||
setShowArticleMenu(false)
|
setShowArticleMenu(false)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleShareBoris = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks) return
|
||||||
|
|
||||||
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: articleLinks.borisUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(articleLinks.borisUrl)
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Share failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleShareOriginal = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks?.sourceUrl) return
|
||||||
|
|
||||||
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: articleLinks.sourceUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(articleLinks.sourceUrl)
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Share failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleCopyBoris = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks) return
|
||||||
|
await navigator.clipboard.writeText(articleLinks.borisUrl)
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Copy failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleCopyOriginal = async () => {
|
||||||
|
try {
|
||||||
|
if (!articleLinks?.sourceUrl) return
|
||||||
|
await navigator.clipboard.writeText(articleLinks.sourceUrl)
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Copy failed', e)
|
||||||
|
} finally {
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleOpenSearch = () => {
|
||||||
|
if (articleLinks) {
|
||||||
|
window.open(getSearchUrl(articleLinks.naddr), '_blank', 'noopener,noreferrer')
|
||||||
|
}
|
||||||
|
setShowArticleMenu(false)
|
||||||
|
}
|
||||||
|
|
||||||
// Video actions
|
// Video actions
|
||||||
const handleOpenVideoExternal = () => {
|
const handleOpenVideoExternal = () => {
|
||||||
@@ -307,10 +534,16 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
|
|
||||||
const handleShareExternalUrl = async () => {
|
const handleShareExternalUrl = async () => {
|
||||||
try {
|
try {
|
||||||
if (selectedUrl && (navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
if (!selectedUrl) return
|
||||||
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({ title: title || 'Article', url: selectedUrl })
|
const borisUrl = `${window.location.origin}/r/${encodeURIComponent(selectedUrl)}`
|
||||||
} else if (selectedUrl) {
|
|
||||||
await navigator.clipboard.writeText(selectedUrl)
|
if ((navigator as { share?: (d: { title?: string; url?: string }) => Promise<void> }).share) {
|
||||||
|
await (navigator as { share: (d: { title?: string; url?: string }) => Promise<void> }).share({
|
||||||
|
title: title || 'Article',
|
||||||
|
url: borisUrl
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
await navigator.clipboard.writeText(borisUrl)
|
||||||
}
|
}
|
||||||
} catch (e) {
|
} catch (e) {
|
||||||
console.warn('Share failed', e)
|
console.warn('Share failed', e)
|
||||||
@@ -318,6 +551,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
setShowExternalMenu(false)
|
setShowExternalMenu(false)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleSearchExternalUrl = () => {
|
||||||
|
if (selectedUrl) {
|
||||||
|
window.open(getSearchUrl(selectedUrl), '_blank', 'noopener,noreferrer')
|
||||||
|
}
|
||||||
|
setShowExternalMenu(false)
|
||||||
|
}
|
||||||
|
|
||||||
// Check if article is already marked as read when URL/article changes
|
// Check if article is already marked as read when URL/article changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -501,7 +741,7 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
<FontAwesomeIcon icon={faEllipsisH} />
|
<FontAwesomeIcon icon={faEllipsisH} />
|
||||||
</button>
|
</button>
|
||||||
{showVideoMenu && (
|
{showVideoMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${videoMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
<button className="article-menu-item" onClick={handleOpenVideoExternal}>
|
<button className="article-menu-item" onClick={handleOpenVideoExternal}>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open Link</span>
|
<span>Open Link</span>
|
||||||
@@ -582,13 +822,13 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
|
|
||||||
{showExternalMenu && (
|
{showExternalMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${externalMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleOpenExternalUrl}
|
onClick={handleShareExternalUrl}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faShare} />
|
||||||
<span>Open Original URL</span>
|
<span>Share</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
@@ -599,10 +839,17 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleShareExternalUrl}
|
onClick={handleOpenExternalUrl}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faShare} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Share</span>
|
<span>Open Original</span>
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleSearchExternalUrl}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faSearch} />
|
||||||
|
<span>Search</span>
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
@@ -623,13 +870,52 @@ const ContentPanel: React.FC<ContentPanelProps> = ({
|
|||||||
</button>
|
</button>
|
||||||
|
|
||||||
{showArticleMenu && (
|
{showArticleMenu && (
|
||||||
<div className="article-menu">
|
<div className={`article-menu ${articleMenuOpenUpward ? 'open-upward' : ''}`}>
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleShareBoris}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faShare} />
|
||||||
|
<span>Share</span>
|
||||||
|
</button>
|
||||||
|
{articleLinks.sourceUrl && (
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleShareOriginal}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faShare} />
|
||||||
|
<span>Share Original</span>
|
||||||
|
</button>
|
||||||
|
)}
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleCopyBoris}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faCopy} />
|
||||||
|
<span>Copy Link</span>
|
||||||
|
</button>
|
||||||
|
{articleLinks.sourceUrl && (
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleCopyOriginal}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faCopy} />
|
||||||
|
<span>Copy Original</span>
|
||||||
|
</button>
|
||||||
|
)}
|
||||||
|
<button
|
||||||
|
className="article-menu-item"
|
||||||
|
onClick={handleOpenSearch}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faSearch} />
|
||||||
|
<span>Search</span>
|
||||||
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
onClick={handleOpenPortal}
|
onClick={handleOpenPortal}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open on Nostr</span>
|
<span>Open with njump</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="article-menu-item"
|
className="article-menu-item"
|
||||||
|
|||||||
395
src/components/Debug.tsx
Normal file
395
src/components/Debug.tsx
Normal file
@@ -0,0 +1,395 @@
|
|||||||
|
import React, { useEffect, useMemo, useState } from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faClock, faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import { Accounts } from 'applesauce-accounts'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from '../services/nostrConnect'
|
||||||
|
import { DebugBus, type DebugLogEntry } from '../utils/debugBus'
|
||||||
|
import VersionFooter from './VersionFooter'
|
||||||
|
|
||||||
|
const defaultPayload = 'The quick brown fox jumps over the lazy dog.'
|
||||||
|
|
||||||
|
const Debug: React.FC = () => {
|
||||||
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
const accountManager = Hooks.useAccountManager()
|
||||||
|
const [payload, setPayload] = useState<string>(defaultPayload)
|
||||||
|
const [cipher44, setCipher44] = useState<string>('')
|
||||||
|
const [cipher04, setCipher04] = useState<string>('')
|
||||||
|
const [plain44, setPlain44] = useState<string>('')
|
||||||
|
const [plain04, setPlain04] = useState<string>('')
|
||||||
|
const [tEncrypt44, setTEncrypt44] = useState<number | null>(null)
|
||||||
|
const [tEncrypt04, setTEncrypt04] = useState<number | null>(null)
|
||||||
|
const [tDecrypt44, setTDecrypt44] = useState<number | null>(null)
|
||||||
|
const [tDecrypt04, setTDecrypt04] = useState<number | null>(null)
|
||||||
|
const [logs, setLogs] = useState<DebugLogEntry[]>(DebugBus.snapshot())
|
||||||
|
const [debugEnabled, setDebugEnabled] = useState<boolean>(() => localStorage.getItem('debug') === '*')
|
||||||
|
|
||||||
|
// Bunker login state
|
||||||
|
const [bunkerUri, setBunkerUri] = useState<string>('')
|
||||||
|
const [isBunkerLoading, setIsBunkerLoading] = useState<boolean>(false)
|
||||||
|
const [bunkerError, setBunkerError] = useState<string | null>(null)
|
||||||
|
|
||||||
|
// Live timing state
|
||||||
|
const [liveTiming, setLiveTiming] = useState<{
|
||||||
|
nip44?: { type: 'encrypt' | 'decrypt'; startTime: number }
|
||||||
|
nip04?: { type: 'encrypt' | 'decrypt'; startTime: number }
|
||||||
|
}>({})
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
return DebugBus.subscribe((e) => setLogs(prev => [...prev, e].slice(-300)))
|
||||||
|
}, [])
|
||||||
|
|
||||||
|
// Live timer effect - triggers re-renders for live timing updates
|
||||||
|
useEffect(() => {
|
||||||
|
const interval = setInterval(() => {
|
||||||
|
// Force re-render to update live timing display
|
||||||
|
setLiveTiming(prev => prev)
|
||||||
|
}, 16) // ~60fps for smooth updates
|
||||||
|
return () => clearInterval(interval)
|
||||||
|
}, [])
|
||||||
|
|
||||||
|
const signer = useMemo(() => (activeAccount as unknown as { signer?: unknown })?.signer, [activeAccount])
|
||||||
|
const pubkey = (activeAccount as unknown as { pubkey?: string })?.pubkey
|
||||||
|
|
||||||
|
const hasNip04 = typeof (signer as { nip04?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip04?.encrypt === 'function'
|
||||||
|
const hasNip44 = typeof (signer as { nip44?: { encrypt?: unknown; decrypt?: unknown } } | undefined)?.nip44?.encrypt === 'function'
|
||||||
|
|
||||||
|
const doEncrypt = async (mode: 'nip44' | 'nip04') => {
|
||||||
|
if (!signer || !pubkey) return
|
||||||
|
try {
|
||||||
|
const api = (signer as { [key: string]: { encrypt: (pubkey: string, message: string) => Promise<string> } })[mode]
|
||||||
|
DebugBus.info('debug', `encrypt start ${mode}`, { pubkey, len: payload.length })
|
||||||
|
|
||||||
|
// Start live timing
|
||||||
|
const start = performance.now()
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: { type: 'encrypt', startTime: start } }))
|
||||||
|
|
||||||
|
const cipher = await api.encrypt(pubkey, payload)
|
||||||
|
const ms = Math.round(performance.now() - start)
|
||||||
|
|
||||||
|
// Stop live timing
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
|
||||||
|
DebugBus.info('debug', `encrypt done ${mode}`, { len: typeof cipher === 'string' ? cipher.length : -1, ms })
|
||||||
|
if (mode === 'nip44') setCipher44(cipher)
|
||||||
|
else setCipher04(cipher)
|
||||||
|
if (mode === 'nip44') setTEncrypt44(ms)
|
||||||
|
else setTEncrypt04(ms)
|
||||||
|
} catch (e) {
|
||||||
|
// Stop live timing on error
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
DebugBus.error('debug', `encrypt error ${mode}`, e instanceof Error ? e.message : String(e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const doDecrypt = async (mode: 'nip44' | 'nip04') => {
|
||||||
|
if (!signer || !pubkey) return
|
||||||
|
try {
|
||||||
|
const api = (signer as { [key: string]: { decrypt: (pubkey: string, ciphertext: string) => Promise<string> } })[mode]
|
||||||
|
const cipher = mode === 'nip44' ? cipher44 : cipher04
|
||||||
|
if (!cipher) {
|
||||||
|
DebugBus.warn('debug', `no cipher to decrypt for ${mode}`)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
DebugBus.info('debug', `decrypt start ${mode}`, { len: cipher.length })
|
||||||
|
|
||||||
|
// Start live timing
|
||||||
|
const start = performance.now()
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: { type: 'decrypt', startTime: start } }))
|
||||||
|
|
||||||
|
const plain = await api.decrypt(pubkey, cipher)
|
||||||
|
const ms = Math.round(performance.now() - start)
|
||||||
|
|
||||||
|
// Stop live timing
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
|
||||||
|
DebugBus.info('debug', `decrypt done ${mode}`, { len: typeof plain === 'string' ? plain.length : -1, ms })
|
||||||
|
if (mode === 'nip44') setPlain44(String(plain))
|
||||||
|
else setPlain04(String(plain))
|
||||||
|
if (mode === 'nip44') setTDecrypt44(ms)
|
||||||
|
else setTDecrypt04(ms)
|
||||||
|
} catch (e) {
|
||||||
|
// Stop live timing on error
|
||||||
|
setLiveTiming(prev => ({ ...prev, [mode]: undefined }))
|
||||||
|
DebugBus.error('debug', `decrypt error ${mode}`, e instanceof Error ? e.message : String(e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const toggleDebug = () => {
|
||||||
|
const next = !debugEnabled
|
||||||
|
setDebugEnabled(next)
|
||||||
|
if (next) localStorage.setItem('debug', '*')
|
||||||
|
else localStorage.removeItem('debug')
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleBunkerLogin = async () => {
|
||||||
|
if (!bunkerUri.trim()) {
|
||||||
|
setBunkerError('Please enter a bunker URI')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!bunkerUri.startsWith('bunker://')) {
|
||||||
|
setBunkerError('Invalid bunker URI. Must start with bunker://')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
setIsBunkerLoading(true)
|
||||||
|
setBunkerError(null)
|
||||||
|
|
||||||
|
// Create signer from bunker URI with default permissions
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
|
||||||
|
|
||||||
|
// Get pubkey from signer
|
||||||
|
const pubkey = await signer.getPublicKey()
|
||||||
|
|
||||||
|
// Create account from signer
|
||||||
|
const account = new Accounts.NostrConnectAccount(pubkey, signer)
|
||||||
|
|
||||||
|
// Add to account manager and set active
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
|
||||||
|
// Clear input on success
|
||||||
|
setBunkerUri('')
|
||||||
|
} catch (err) {
|
||||||
|
console.error('[bunker] Login failed:', err)
|
||||||
|
const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
|
||||||
|
|
||||||
|
// Check for permission-related errors
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
setBunkerError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
|
||||||
|
} else {
|
||||||
|
setBunkerError(errorMessage)
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
setIsBunkerLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const CodeBox = ({ value }: { value: string }) => (
|
||||||
|
<div className="h-20 overflow-y-auto font-mono text-xs leading-relaxed p-2 bg-gray-100 dark:bg-gray-800 rounded whitespace-pre-wrap break-all">
|
||||||
|
{value || '—'}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
|
||||||
|
const getLiveTiming = (mode: 'nip44' | 'nip04', type: 'encrypt' | 'decrypt') => {
|
||||||
|
const timing = liveTiming[mode]
|
||||||
|
if (timing && timing.type === type) {
|
||||||
|
const elapsed = Math.round(performance.now() - timing.startTime)
|
||||||
|
return elapsed
|
||||||
|
}
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
const Stat = ({ label, value, mode, type }: {
|
||||||
|
label: string;
|
||||||
|
value?: string | number | null;
|
||||||
|
mode?: 'nip44' | 'nip04';
|
||||||
|
type?: 'encrypt' | 'decrypt';
|
||||||
|
}) => {
|
||||||
|
const liveValue = mode && type ? getLiveTiming(mode, type) : null
|
||||||
|
const isLive = !!liveValue
|
||||||
|
|
||||||
|
let displayValue: string
|
||||||
|
if (isLive) {
|
||||||
|
displayValue = ''
|
||||||
|
} else if (value !== null && value !== undefined) {
|
||||||
|
displayValue = `${value}ms`
|
||||||
|
} else {
|
||||||
|
displayValue = '—'
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<span className="badge" style={{ marginRight: 8 }}>
|
||||||
|
<FontAwesomeIcon icon={faClock} style={{ marginRight: 4, fontSize: '0.8em' }} />
|
||||||
|
{label}: {isLive ? (
|
||||||
|
<FontAwesomeIcon icon={faSpinner} className="animate-spin" style={{ fontSize: '0.8em' }} />
|
||||||
|
) : (
|
||||||
|
displayValue
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="settings-view">
|
||||||
|
<div className="settings-header">
|
||||||
|
<h2>Debug</h2>
|
||||||
|
<div className="settings-header-actions">
|
||||||
|
<span className="opacity-70">Active pubkey:</span> <code className="text-sm">{pubkey || 'none'}</code>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="settings-content">
|
||||||
|
|
||||||
|
{/* Bunker Login Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Bunker Connection</h3>
|
||||||
|
{!activeAccount ? (
|
||||||
|
<div>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Connect to your bunker (Nostr Connect signer) to enable encryption/decryption testing</div>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<input
|
||||||
|
type="text"
|
||||||
|
className="input flex-1"
|
||||||
|
placeholder="bunker://..."
|
||||||
|
value={bunkerUri}
|
||||||
|
onChange={(e) => setBunkerUri(e.target.value)}
|
||||||
|
disabled={isBunkerLoading}
|
||||||
|
/>
|
||||||
|
<button
|
||||||
|
className="btn btn-primary"
|
||||||
|
onClick={handleBunkerLogin}
|
||||||
|
disabled={isBunkerLoading || !bunkerUri.trim()}
|
||||||
|
>
|
||||||
|
{isBunkerLoading ? 'Connecting...' : 'Connect'}
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
{bunkerError && (
|
||||||
|
<div className="text-sm text-red-600 dark:text-red-400 mb-2">{bunkerError}</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="flex items-center justify-between">
|
||||||
|
<div>
|
||||||
|
<div className="text-sm opacity-70">Connected to bunker</div>
|
||||||
|
<div className="text-sm font-mono">{pubkey}</div>
|
||||||
|
</div>
|
||||||
|
<button
|
||||||
|
className="btn"
|
||||||
|
style={{
|
||||||
|
background: 'rgb(220 38 38)',
|
||||||
|
color: 'white',
|
||||||
|
border: '1px solid rgb(220 38 38)',
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
borderRadius: '6px',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: 'pointer',
|
||||||
|
transition: 'background-color 0.2s'
|
||||||
|
}}
|
||||||
|
onMouseEnter={(e) => e.currentTarget.style.background = 'rgb(185 28 28)'}
|
||||||
|
onMouseLeave={(e) => e.currentTarget.style.background = 'rgb(220 38 38)'}
|
||||||
|
onClick={() => accountManager.removeAccount(activeAccount)}
|
||||||
|
>
|
||||||
|
Disconnect
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Encryption Tools Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Encryption Tools</h3>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">Payload</label>
|
||||||
|
<textarea
|
||||||
|
className="textarea w-full bg-gray-50 dark:bg-gray-900 border border-gray-200 dark:border-gray-700"
|
||||||
|
value={payload}
|
||||||
|
onChange={e => setPayload(e.target.value)}
|
||||||
|
rows={3}
|
||||||
|
/>
|
||||||
|
<div className="flex gap-2 mt-3 justify-end">
|
||||||
|
<button className="btn btn-secondary" onClick={() => setPayload(defaultPayload)}>Reset</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => { setCipher44(''); setCipher04(''); setPlain44(''); setPlain04(''); setTEncrypt44(null); setTEncrypt04(null); setTDecrypt44(null); setTDecrypt04(null) }}>Clear</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-44</label>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<button className="btn btn-primary" onClick={() => doEncrypt('nip44')} disabled={!hasNip44}>Encrypt</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => doDecrypt('nip44')} disabled={!cipher44}>Decrypt</button>
|
||||||
|
</div>
|
||||||
|
<label className="block text-sm opacity-70 mb-2">Encrypted:</label>
|
||||||
|
<CodeBox value={cipher44} />
|
||||||
|
<div className="mt-3">
|
||||||
|
<span className="text-sm opacity-70">Plain:</span>
|
||||||
|
<CodeBox value={plain44} />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-04</label>
|
||||||
|
<div className="flex gap-2 mb-3">
|
||||||
|
<button className="btn btn-primary" onClick={() => doEncrypt('nip04')} disabled={!hasNip04}>Encrypt</button>
|
||||||
|
<button className="btn btn-secondary" onClick={() => doDecrypt('nip04')} disabled={!cipher04}>Decrypt</button>
|
||||||
|
</div>
|
||||||
|
<label className="block text-sm opacity-70 mb-2">Encrypted:</label>
|
||||||
|
<CodeBox value={cipher04} />
|
||||||
|
<div className="mt-3">
|
||||||
|
<span className="text-sm opacity-70">Plain:</span>
|
||||||
|
<CodeBox value={plain04} />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Performance Timing Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Performance Timing</h3>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Encryption and decryption operation durations</div>
|
||||||
|
<div className="grid" style={{ gap: 12, gridTemplateColumns: 'minmax(0,1fr) minmax(0,1fr)' }}>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-44</label>
|
||||||
|
<div className="flex flex-wrap items-center gap-2">
|
||||||
|
<Stat label="enc" value={tEncrypt44} mode="nip44" type="encrypt" />
|
||||||
|
<Stat label="dec" value={tDecrypt44} mode="nip44" type="decrypt" />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
<div className="setting-group">
|
||||||
|
<label className="setting-label">NIP-04</label>
|
||||||
|
<div className="flex flex-wrap items-center gap-2">
|
||||||
|
<Stat label="enc" value={tEncrypt04} mode="nip04" type="encrypt" />
|
||||||
|
<Stat label="dec" value={tDecrypt04} mode="nip04" type="decrypt" />
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* Debug Logs Section */}
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Debug Logs</h3>
|
||||||
|
<div className="text-sm opacity-70 mb-3">Recent bunker logs:</div>
|
||||||
|
<div className="max-h-192 overflow-y-auto font-mono text-xs leading-relaxed">
|
||||||
|
{logs.length === 0 ? (
|
||||||
|
<div className="text-sm opacity-50 italic">No logs yet</div>
|
||||||
|
) : (
|
||||||
|
logs.slice(-200).map((l, i) => (
|
||||||
|
<div key={i} className="mb-1 p-2 bg-gray-100 dark:bg-gray-800 rounded">
|
||||||
|
<span className="opacity-70">[{new Date(l.ts).toLocaleTimeString()}]</span> <span className="font-semibold">{l.level.toUpperCase()}</span> {l.source}: {l.message}
|
||||||
|
{l.data !== undefined && (
|
||||||
|
<span className="opacity-70"> — {typeof l.data === 'string' ? l.data : JSON.stringify(l.data)}</span>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
))
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
<div className="mt-3">
|
||||||
|
<div className="flex justify-end mb-2">
|
||||||
|
<label className="flex items-center gap-2 cursor-pointer">
|
||||||
|
<input
|
||||||
|
type="checkbox"
|
||||||
|
checked={debugEnabled}
|
||||||
|
onChange={toggleDebug}
|
||||||
|
className="checkbox"
|
||||||
|
/>
|
||||||
|
<span className="text-sm">Show all applesauce debug logs</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
<div className="flex justify-end">
|
||||||
|
<button className="btn btn-secondary" onClick={() => setLogs([])}>Clear logs</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<VersionFooter />
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default Debug
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
import React, { useState, useEffect, useMemo } from 'react'
|
import React, { useState, useEffect, useMemo } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate } from '@fortawesome/free-solid-svg-icons'
|
import { faNewspaper, faHighlighter, faUser, faUserGroup, faNetworkWired, faArrowsRotate, faSpinner } from '@fortawesome/free-solid-svg-icons'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
|
import { BlogPostSkeleton, HighlightSkeleton } from './Skeletons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
@@ -237,35 +237,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
return `/a/${naddr}`
|
return `/a/${naddr}`
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleHighlightClick = (highlightId: string) => {
|
|
||||||
const highlight = highlights.find(h => h.id === highlightId)
|
|
||||||
if (!highlight) return
|
|
||||||
|
|
||||||
// For nostr-native articles
|
|
||||||
if (highlight.eventReference) {
|
|
||||||
// Convert eventReference to naddr
|
|
||||||
if (highlight.eventReference.includes(':')) {
|
|
||||||
const parts = highlight.eventReference.split(':')
|
|
||||||
const kind = parseInt(parts[0])
|
|
||||||
const pubkey = parts[1]
|
|
||||||
const identifier = parts[2] || ''
|
|
||||||
|
|
||||||
const naddr = nip19.naddrEncode({
|
|
||||||
kind,
|
|
||||||
pubkey,
|
|
||||||
identifier
|
|
||||||
})
|
|
||||||
navigate(`/a/${naddr}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
} else {
|
|
||||||
// Already an naddr
|
|
||||||
navigate(`/a/${highlight.eventReference}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
}
|
|
||||||
}
|
|
||||||
// For web URLs
|
|
||||||
else if (highlight.urlReference) {
|
|
||||||
navigate(`/r/${encodeURIComponent(highlight.urlReference)}`, { state: { highlightId, openHighlights: true } })
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Classify highlights with levels based on user context and apply visibility filters
|
// Classify highlights with levels based on user context and apply visibility filters
|
||||||
const classifiedHighlights = useMemo(() => {
|
const classifiedHighlights = useMemo(() => {
|
||||||
@@ -320,8 +291,8 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
return filteredBlogPosts.length === 0 ? (
|
return filteredBlogPosts.length === 0 ? (
|
||||||
<div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)', padding: '2rem' }}>
|
<div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>No blog posts yet. Pull to refresh!</p>
|
<FontAwesomeIcon icon={faSpinner} spin size="2x" />
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -347,8 +318,8 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
return classifiedHighlights.length === 0 ? (
|
return classifiedHighlights.length === 0 ? (
|
||||||
<div className="explore-empty" style={{ gridColumn: '1/-1', textAlign: 'center', color: 'var(--text-secondary)', padding: '2rem' }}>
|
<div className="explore-loading" style={{ gridColumn: '1/-1', display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>No highlights yet. Pull to refresh!</p>
|
<FontAwesomeIcon icon={faSpinner} spin size="2x" />
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -357,7 +328,6 @@ const Explore: React.FC<ExploreProps> = ({ relayPool, eventStore, settings, acti
|
|||||||
key={highlight.id}
|
key={highlight.id}
|
||||||
highlight={highlight}
|
highlight={highlight}
|
||||||
relayPool={relayPool}
|
relayPool={relayPool}
|
||||||
onHighlightClick={handleHighlightClick}
|
|
||||||
/>
|
/>
|
||||||
))}
|
))}
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -13,10 +13,10 @@ import { areAllRelaysLocal } from '../utils/helpers'
|
|||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { formatDateCompact } from '../utils/bookmarkUtils'
|
import { formatDateCompact } from '../utils/bookmarkUtils'
|
||||||
import { createDeletionRequest } from '../services/deletionService'
|
import { createDeletionRequest } from '../services/deletionService'
|
||||||
import ConfirmDialog from './ConfirmDialog'
|
|
||||||
import { getNostrUrl } from '../config/nostrGateways'
|
import { getNostrUrl } from '../config/nostrGateways'
|
||||||
import CompactButton from './CompactButton'
|
import CompactButton from './CompactButton'
|
||||||
import { HighlightCitation } from './HighlightCitation'
|
import { HighlightCitation } from './HighlightCitation'
|
||||||
|
import { useNavigate } from 'react-router-dom'
|
||||||
|
|
||||||
// Helper to detect if a URL is an image
|
// Helper to detect if a URL is an image
|
||||||
const isImageUrl = (url: string): boolean => {
|
const isImageUrl = (url: string): boolean => {
|
||||||
@@ -207,6 +207,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
const [showMenu, setShowMenu] = useState(false)
|
const [showMenu, setShowMenu] = useState(false)
|
||||||
|
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
|
const navigate = useNavigate()
|
||||||
|
|
||||||
// Resolve the profile of the user who made the highlight
|
// Resolve the profile of the user who made the highlight
|
||||||
const profile = useEventModel(Models.ProfileModel, [highlight.pubkey])
|
const profile = useEventModel(Models.ProfileModel, [highlight.pubkey])
|
||||||
@@ -257,25 +258,52 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
}
|
}
|
||||||
}, [isSelected])
|
}, [isSelected])
|
||||||
|
|
||||||
// Close menu when clicking outside
|
// Close menu and reset delete confirm when clicking outside
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const handleClickOutside = (event: MouseEvent) => {
|
const handleClickOutside = (event: MouseEvent) => {
|
||||||
if (menuRef.current && !menuRef.current.contains(event.target as Node)) {
|
if (menuRef.current && !menuRef.current.contains(event.target as Node)) {
|
||||||
setShowMenu(false)
|
setShowMenu(false)
|
||||||
|
setShowDeleteConfirm(false)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (showMenu) {
|
if (showMenu || showDeleteConfirm) {
|
||||||
document.addEventListener('mousedown', handleClickOutside)
|
document.addEventListener('mousedown', handleClickOutside)
|
||||||
return () => {
|
return () => {
|
||||||
document.removeEventListener('mousedown', handleClickOutside)
|
document.removeEventListener('mousedown', handleClickOutside)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}, [showMenu])
|
}, [showMenu, showDeleteConfirm])
|
||||||
|
|
||||||
const handleItemClick = () => {
|
const handleItemClick = () => {
|
||||||
|
// If onHighlightClick is provided, use it (legacy behavior)
|
||||||
if (onHighlightClick) {
|
if (onHighlightClick) {
|
||||||
onHighlightClick(highlight.id)
|
onHighlightClick(highlight.id)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// Otherwise, navigate to the article that this highlight references
|
||||||
|
if (highlight.eventReference) {
|
||||||
|
// Parse the event reference - it can be an event ID or article coordinate (kind:pubkey:identifier)
|
||||||
|
const parts = highlight.eventReference.split(':')
|
||||||
|
|
||||||
|
// If it's an article coordinate (3 parts) and kind is 30023, navigate to it
|
||||||
|
if (parts.length === 3) {
|
||||||
|
const [kind, pubkey, identifier] = parts
|
||||||
|
|
||||||
|
if (kind === '30023') {
|
||||||
|
// Encode as naddr and navigate
|
||||||
|
const naddr = nip19.naddrEncode({
|
||||||
|
kind: 30023,
|
||||||
|
pubkey,
|
||||||
|
identifier
|
||||||
|
})
|
||||||
|
navigate(`/a/${naddr}`)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else if (highlight.urlReference) {
|
||||||
|
// Navigate to external URL
|
||||||
|
navigate(`/r/${encodeURIComponent(highlight.urlReference)}`)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -434,12 +462,12 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleCancelDelete = () => {
|
|
||||||
setShowDeleteConfirm(false)
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleMenuToggle = (e: React.MouseEvent) => {
|
const handleMenuToggle = (e: React.MouseEvent) => {
|
||||||
e.stopPropagation()
|
e.stopPropagation()
|
||||||
|
// Reset delete confirm state when opening/closing menu
|
||||||
|
if (!showMenu) {
|
||||||
|
setShowDeleteConfirm(false)
|
||||||
|
}
|
||||||
setShowMenu(!showMenu)
|
setShowMenu(!showMenu)
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -461,6 +489,11 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
setShowDeleteConfirm(true)
|
setShowDeleteConfirm(true)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const handleConfirmDeleteClick = (e: React.MouseEvent) => {
|
||||||
|
e.stopPropagation()
|
||||||
|
handleConfirmDelete()
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
<div
|
<div
|
||||||
@@ -468,7 +501,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
className={`highlight-item ${isSelected ? 'selected' : ''} ${highlight.level ? `level-${highlight.level}` : ''}`}
|
className={`highlight-item ${isSelected ? 'selected' : ''} ${highlight.level ? `level-${highlight.level}` : ''}`}
|
||||||
data-highlight-id={highlight.id}
|
data-highlight-id={highlight.id}
|
||||||
onClick={handleItemClick}
|
onClick={handleItemClick}
|
||||||
style={{ cursor: onHighlightClick ? 'pointer' : 'default' }}
|
style={{ cursor: (onHighlightClick || highlight.eventReference || highlight.urlReference) ? 'pointer' : 'default' }}
|
||||||
>
|
>
|
||||||
<div className="highlight-header">
|
<div className="highlight-header">
|
||||||
<CompactButton
|
<CompactButton
|
||||||
@@ -533,6 +566,33 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div className="highlight-menu-wrapper" ref={menuRef}>
|
<div className="highlight-menu-wrapper" ref={menuRef}>
|
||||||
|
{showDeleteConfirm && canDelete && (
|
||||||
|
<div style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', marginRight: '0.5rem' }}>
|
||||||
|
<span style={{ fontSize: '0.875rem', color: 'rgb(220 38 38)', fontWeight: 500 }}>Confirm?</span>
|
||||||
|
<button
|
||||||
|
onClick={handleConfirmDeleteClick}
|
||||||
|
disabled={isDeleting}
|
||||||
|
title="Confirm deletion"
|
||||||
|
style={{
|
||||||
|
color: 'rgb(220 38 38)',
|
||||||
|
background: 'rgba(220, 38, 38, 0.1)',
|
||||||
|
border: '1px solid rgb(220 38 38)',
|
||||||
|
borderRadius: '4px',
|
||||||
|
padding: '0.375rem',
|
||||||
|
cursor: isDeleting ? 'not-allowed' : 'pointer',
|
||||||
|
display: 'flex',
|
||||||
|
alignItems: 'center',
|
||||||
|
justifyContent: 'center',
|
||||||
|
minWidth: '33px',
|
||||||
|
minHeight: '33px',
|
||||||
|
transition: 'all 0.2s'
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={isDeleting ? faSpinner : faTrash} spin={isDeleting} />
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
|
||||||
<CompactButton
|
<CompactButton
|
||||||
icon={faEllipsisH}
|
icon={faEllipsisH}
|
||||||
onClick={handleMenuToggle}
|
onClick={handleMenuToggle}
|
||||||
@@ -546,7 +606,7 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
onClick={handleOpenPortal}
|
onClick={handleOpenPortal}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
<FontAwesomeIcon icon={faExternalLinkAlt} />
|
||||||
<span>Open on Nostr</span>
|
<span>Open with njump</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className="highlight-menu-item"
|
className="highlight-menu-item"
|
||||||
@@ -571,17 +631,6 @@ export const HighlightItem: React.FC<HighlightItemProps> = ({
|
|||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<ConfirmDialog
|
|
||||||
isOpen={showDeleteConfirm}
|
|
||||||
title="Delete Highlight?"
|
|
||||||
message="This will request deletion of your highlight. It may still be visible on some relays that don't honor deletion requests."
|
|
||||||
confirmText="Delete"
|
|
||||||
cancelText="Cancel"
|
|
||||||
variant="danger"
|
|
||||||
onConfirm={handleConfirmDelete}
|
|
||||||
onCancel={handleCancelDelete}
|
|
||||||
/>
|
|
||||||
</>
|
</>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
179
src/components/LoginOptions.tsx
Normal file
179
src/components/LoginOptions.tsx
Normal file
@@ -0,0 +1,179 @@
|
|||||||
|
import React, { useState } from 'react'
|
||||||
|
import { Hooks } from 'applesauce-react'
|
||||||
|
import { Accounts } from 'applesauce-accounts'
|
||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
import { getDefaultBunkerPermissions } from '../services/nostrConnect'
|
||||||
|
|
||||||
|
const LoginOptions: React.FC = () => {
|
||||||
|
const accountManager = Hooks.useAccountManager()
|
||||||
|
const [showBunkerInput, setShowBunkerInput] = useState(false)
|
||||||
|
const [bunkerUri, setBunkerUri] = useState('')
|
||||||
|
const [isLoading, setIsLoading] = useState(false)
|
||||||
|
const [error, setError] = useState<string | null>(null)
|
||||||
|
|
||||||
|
const handleExtensionLogin = async () => {
|
||||||
|
try {
|
||||||
|
setIsLoading(true)
|
||||||
|
setError(null)
|
||||||
|
const account = await Accounts.ExtensionAccount.fromExtension()
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Extension login failed:', err)
|
||||||
|
setError('Login failed. Please install a nostr browser extension and try again.')
|
||||||
|
} finally {
|
||||||
|
setIsLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const handleBunkerLogin = async () => {
|
||||||
|
if (!bunkerUri.trim()) {
|
||||||
|
setError('Please enter a bunker URI')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!bunkerUri.startsWith('bunker://')) {
|
||||||
|
setError('Invalid bunker URI. Must start with bunker://')
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
setIsLoading(true)
|
||||||
|
setError(null)
|
||||||
|
|
||||||
|
// Create signer from bunker URI with default permissions
|
||||||
|
const permissions = getDefaultBunkerPermissions()
|
||||||
|
const signer = await NostrConnectSigner.fromBunkerURI(bunkerUri, { permissions })
|
||||||
|
|
||||||
|
// Get pubkey from signer
|
||||||
|
const pubkey = await signer.getPublicKey()
|
||||||
|
|
||||||
|
// Create account from signer
|
||||||
|
const account = new Accounts.NostrConnectAccount(pubkey, signer)
|
||||||
|
|
||||||
|
// Add to account manager and set active
|
||||||
|
accountManager.addAccount(account)
|
||||||
|
accountManager.setActive(account)
|
||||||
|
|
||||||
|
// Clear input on success
|
||||||
|
setBunkerUri('')
|
||||||
|
setShowBunkerInput(false)
|
||||||
|
} catch (err) {
|
||||||
|
console.error('[bunker] Login failed:', err)
|
||||||
|
const errorMessage = err instanceof Error ? err.message : 'Failed to connect to bunker'
|
||||||
|
|
||||||
|
// Check for permission-related errors
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
setError('Your bunker connection is missing signing permissions. Reconnect and approve signing.')
|
||||||
|
} else {
|
||||||
|
setError(errorMessage)
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
setIsLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="empty-state">
|
||||||
|
<p style={{ marginBottom: '1rem' }}>Login with:</p>
|
||||||
|
|
||||||
|
<div style={{ display: 'flex', flexDirection: 'column', gap: '0.75rem', maxWidth: '300px', margin: '0 auto' }}>
|
||||||
|
<button
|
||||||
|
onClick={handleExtensionLogin}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: isLoading ? 'wait' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
{isLoading && !showBunkerInput ? 'Connecting...' : 'Extension'}
|
||||||
|
</button>
|
||||||
|
|
||||||
|
{!showBunkerInput ? (
|
||||||
|
<button
|
||||||
|
onClick={() => setShowBunkerInput(true)}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem 1.5rem',
|
||||||
|
fontSize: '1rem',
|
||||||
|
cursor: isLoading ? 'wait' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
Bunker
|
||||||
|
</button>
|
||||||
|
) : (
|
||||||
|
<div style={{ display: 'flex', flexDirection: 'column', gap: '0.5rem' }}>
|
||||||
|
<input
|
||||||
|
type="text"
|
||||||
|
placeholder="bunker://..."
|
||||||
|
value={bunkerUri}
|
||||||
|
onChange={(e) => setBunkerUri(e.target.value)}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.75rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
width: '100%',
|
||||||
|
boxSizing: 'border-box'
|
||||||
|
}}
|
||||||
|
onKeyDown={(e) => {
|
||||||
|
if (e.key === 'Enter') {
|
||||||
|
handleBunkerLogin()
|
||||||
|
}
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
<div style={{ display: 'flex', gap: '0.5rem' }}>
|
||||||
|
<button
|
||||||
|
onClick={handleBunkerLogin}
|
||||||
|
disabled={isLoading || !bunkerUri.trim()}
|
||||||
|
style={{
|
||||||
|
padding: '0.5rem 1rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
flex: 1,
|
||||||
|
cursor: isLoading || !bunkerUri.trim() ? 'not-allowed' : 'pointer',
|
||||||
|
opacity: isLoading || !bunkerUri.trim() ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
{isLoading && showBunkerInput ? 'Connecting...' : 'Connect'}
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
onClick={() => {
|
||||||
|
setShowBunkerInput(false)
|
||||||
|
setBunkerUri('')
|
||||||
|
setError(null)
|
||||||
|
}}
|
||||||
|
disabled={isLoading}
|
||||||
|
style={{
|
||||||
|
padding: '0.5rem 1rem',
|
||||||
|
fontSize: '0.9rem',
|
||||||
|
cursor: isLoading ? 'not-allowed' : 'pointer',
|
||||||
|
opacity: isLoading ? 0.6 : 1
|
||||||
|
}}
|
||||||
|
>
|
||||||
|
Cancel
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{error && (
|
||||||
|
<p style={{ color: 'var(--color-error, #ef4444)', marginTop: '1rem', fontSize: '0.9rem' }}>
|
||||||
|
{error}
|
||||||
|
</p>
|
||||||
|
)}
|
||||||
|
|
||||||
|
<p style={{ marginTop: '1.5rem', fontSize: '0.9rem' }}>
|
||||||
|
If you aren't on nostr yet, start here:{' '}
|
||||||
|
<a href="https://nstart.me/" target="_blank" rel="noopener noreferrer">
|
||||||
|
nstart.me
|
||||||
|
</a>
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default LoginOptions
|
||||||
|
|
||||||
@@ -1,16 +1,17 @@
|
|||||||
import React, { useState, useEffect } from 'react'
|
import React, { useState, useEffect } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faSpinner, faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faBookmark, faList, faThLarge, faImage, faPenToSquare, faLink } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
|
import { BlogPostSkeleton, HighlightSkeleton, BookmarkSkeleton } from './Skeletons'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { nip19 } from 'nostr-tools'
|
import { nip19 } from 'nostr-tools'
|
||||||
import { useNavigate } from 'react-router-dom'
|
import { useNavigate, useParams } from 'react-router-dom'
|
||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { HighlightItem } from './HighlightItem'
|
import { HighlightItem } from './HighlightItem'
|
||||||
import { fetchHighlights } from '../services/highlightService'
|
import { fetchHighlights } from '../services/highlightService'
|
||||||
import { fetchBookmarks } from '../services/bookmarkService'
|
import { fetchBookmarks } from '../services/bookmarkService'
|
||||||
import { fetchReadArticlesWithData } from '../services/libraryService'
|
import { fetchAllReads, ReadItem } from '../services/readsService'
|
||||||
|
import { fetchLinks } from '../services/linksService'
|
||||||
import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
|
import { BlogPostPreview, fetchBlogPostsFromAuthors } from '../services/exploreService'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
import { Bookmark, IndividualBookmark } from '../types/bookmarks'
|
||||||
@@ -19,11 +20,18 @@ import BlogPostCard from './BlogPostCard'
|
|||||||
import { BookmarkItem } from './BookmarkItem'
|
import { BookmarkItem } from './BookmarkItem'
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import { ViewMode } from './Bookmarks'
|
import { ViewMode } from './Bookmarks'
|
||||||
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
import { getCachedMeData, updateCachedHighlights } from '../services/meCache'
|
||||||
import { getCachedMeData, setCachedMeData, updateCachedHighlights } from '../services/meCache'
|
|
||||||
import { faBooks } from '../icons/customIcons'
|
import { faBooks } from '../icons/customIcons'
|
||||||
import { usePullToRefresh } from 'use-pull-to-refresh'
|
import { usePullToRefresh } from 'use-pull-to-refresh'
|
||||||
import RefreshIndicator from './RefreshIndicator'
|
import RefreshIndicator from './RefreshIndicator'
|
||||||
|
import { groupIndividualBookmarks, hasContent } from '../utils/bookmarkUtils'
|
||||||
|
import BookmarkFilters, { BookmarkFilterType } from './BookmarkFilters'
|
||||||
|
import { filterBookmarksByType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import ReadingProgressFilters, { ReadingProgressFilterType } from './ReadingProgressFilters'
|
||||||
|
import { filterByReadingProgress } from '../utils/readingProgressUtils'
|
||||||
|
import { deriveReadsFromBookmarks } from '../utils/readsFromBookmarks'
|
||||||
|
import { deriveLinksFromBookmarks } from '../utils/linksFromBookmarks'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
interface MeProps {
|
interface MeProps {
|
||||||
relayPool: RelayPool
|
relayPool: RelayPool
|
||||||
@@ -31,11 +39,15 @@ interface MeProps {
|
|||||||
pubkey?: string // Optional pubkey for viewing other users' profiles
|
pubkey?: string // Optional pubkey for viewing other users' profiles
|
||||||
}
|
}
|
||||||
|
|
||||||
type TabType = 'highlights' | 'reading-list' | 'archive' | 'writings'
|
type TabType = 'highlights' | 'reading-list' | 'reads' | 'links' | 'writings'
|
||||||
|
|
||||||
|
// Valid reading progress filters
|
||||||
|
const VALID_FILTERS: ReadingProgressFilterType[] = ['all', 'unopened', 'started', 'reading', 'completed']
|
||||||
|
|
||||||
const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: propPubkey }) => {
|
const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: propPubkey }) => {
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
const navigate = useNavigate()
|
const navigate = useNavigate()
|
||||||
|
const { filter: urlFilter } = useParams<{ filter?: string }>()
|
||||||
const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
|
const [activeTab, setActiveTab] = useState<TabType>(propActiveTab || 'highlights')
|
||||||
|
|
||||||
// Use provided pubkey or fall back to active account
|
// Use provided pubkey or fall back to active account
|
||||||
@@ -43,11 +55,22 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
const isOwnProfile = !propPubkey || (activeAccount?.pubkey === propPubkey)
|
const isOwnProfile = !propPubkey || (activeAccount?.pubkey === propPubkey)
|
||||||
const [highlights, setHighlights] = useState<Highlight[]>([])
|
const [highlights, setHighlights] = useState<Highlight[]>([])
|
||||||
const [bookmarks, setBookmarks] = useState<Bookmark[]>([])
|
const [bookmarks, setBookmarks] = useState<Bookmark[]>([])
|
||||||
const [readArticles, setReadArticles] = useState<BlogPostPreview[]>([])
|
const [reads, setReads] = useState<ReadItem[]>([])
|
||||||
|
const [, setReadsMap] = useState<Map<string, ReadItem>>(new Map())
|
||||||
|
const [links, setLinks] = useState<ReadItem[]>([])
|
||||||
|
const [, setLinksMap] = useState<Map<string, ReadItem>>(new Map())
|
||||||
const [writings, setWritings] = useState<BlogPostPreview[]>([])
|
const [writings, setWritings] = useState<BlogPostPreview[]>([])
|
||||||
const [loading, setLoading] = useState(true)
|
const [loading, setLoading] = useState(true)
|
||||||
|
const [loadedTabs, setLoadedTabs] = useState<Set<TabType>>(new Set())
|
||||||
const [viewMode, setViewMode] = useState<ViewMode>('cards')
|
const [viewMode, setViewMode] = useState<ViewMode>('cards')
|
||||||
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
const [refreshTrigger, setRefreshTrigger] = useState(0)
|
||||||
|
const [bookmarkFilter, setBookmarkFilter] = useState<BookmarkFilterType>('all')
|
||||||
|
|
||||||
|
// Initialize reading progress filter from URL param
|
||||||
|
const initialFilter = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType)
|
||||||
|
? (urlFilter as ReadingProgressFilterType)
|
||||||
|
: 'all'
|
||||||
|
const [readingProgressFilter, setReadingProgressFilter] = useState<ReadingProgressFilterType>(initialFilter)
|
||||||
|
|
||||||
// Update local state when prop changes
|
// Update local state when prop changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -56,72 +79,246 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
}
|
}
|
||||||
}, [propActiveTab])
|
}, [propActiveTab])
|
||||||
|
|
||||||
|
// Sync filter state with URL changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
const loadData = async () => {
|
const filterFromUrl = urlFilter && VALID_FILTERS.includes(urlFilter as ReadingProgressFilterType)
|
||||||
if (!viewingPubkey) {
|
? (urlFilter as ReadingProgressFilterType)
|
||||||
setLoading(false)
|
: 'all'
|
||||||
return
|
setReadingProgressFilter(filterFromUrl)
|
||||||
|
}, [urlFilter])
|
||||||
|
|
||||||
|
// Handler to change reading progress filter and update URL
|
||||||
|
const handleReadingProgressFilterChange = (filter: ReadingProgressFilterType) => {
|
||||||
|
setReadingProgressFilter(filter)
|
||||||
|
if (activeTab === 'reads') {
|
||||||
|
if (filter === 'all') {
|
||||||
|
navigate('/me/reads', { replace: true })
|
||||||
|
} else {
|
||||||
|
navigate(`/me/reads/${filter}`, { replace: true })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Tab-specific loading functions
|
||||||
|
const loadHighlightsTab = async () => {
|
||||||
|
if (!viewingPubkey) return
|
||||||
|
|
||||||
|
// Only show loading skeleton if tab hasn't been loaded yet
|
||||||
|
const hasBeenLoaded = loadedTabs.has('highlights')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
const userHighlights = await fetchHighlights(relayPool, viewingPubkey)
|
||||||
|
setHighlights(userHighlights)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('highlights'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load highlights:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadWritingsTab = async () => {
|
||||||
|
if (!viewingPubkey) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('writings')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
const userWritings = await fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
|
||||||
|
setWritings(userWritings)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('writings'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load writings:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadReadingListTab = async () => {
|
||||||
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('reading-list')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
setBookmarks([])
|
||||||
|
}
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('reading-list'))
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load reading list:', err)
|
||||||
|
} finally {
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const loadReadsTab = async () => {
|
||||||
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
|
|
||||||
|
const hasBeenLoaded = loadedTabs.has('reads')
|
||||||
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
|
||||||
|
// Ensure bookmarks are loaded
|
||||||
|
let fetchedBookmarks: Bookmark[] = bookmarks
|
||||||
|
if (bookmarks.length === 0) {
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
fetchedBookmarks = newBookmarks
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
fetchedBookmarks = []
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
try {
|
// Derive reads from bookmarks immediately
|
||||||
setLoading(true)
|
const initialReads = deriveReadsFromBookmarks(fetchedBookmarks)
|
||||||
|
const initialMap = new Map(initialReads.map(item => [item.id, item]))
|
||||||
// Seed from cache if available to avoid empty flash (own profile only)
|
setReadsMap(initialMap)
|
||||||
if (isOwnProfile) {
|
setReads(initialReads)
|
||||||
const cached = getCachedMeData(viewingPubkey)
|
setLoadedTabs(prev => new Set(prev).add('reads'))
|
||||||
if (cached) {
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
setHighlights(cached.highlights)
|
|
||||||
setBookmarks(cached.bookmarks)
|
// Background enrichment: merge reading progress and mark-as-read
|
||||||
setReadArticles(cached.readArticles)
|
// Only update items that are already in our map
|
||||||
|
fetchAllReads(relayPool, viewingPubkey, fetchedBookmarks, (item) => {
|
||||||
|
console.log('📈 [Reads] Enrichment item received:', {
|
||||||
|
id: item.id.slice(0, 20) + '...',
|
||||||
|
progress: item.readingProgress,
|
||||||
|
hasProgress: item.readingProgress !== undefined && item.readingProgress > 0
|
||||||
|
})
|
||||||
|
|
||||||
|
setReadsMap(prevMap => {
|
||||||
|
// Only update if item exists in our current map
|
||||||
|
if (!prevMap.has(item.id)) {
|
||||||
|
console.log('⚠️ [Reads] Item not in map, skipping:', item.id.slice(0, 20) + '...')
|
||||||
|
return prevMap
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
const newMap = new Map(prevMap)
|
||||||
// Fetch highlights and writings (public data)
|
const merged = mergeReadItem(newMap, item)
|
||||||
const [userHighlights, userWritings] = await Promise.all([
|
if (merged) {
|
||||||
fetchHighlights(relayPool, viewingPubkey),
|
console.log('✅ [Reads] Merged progress:', item.id.slice(0, 20) + '...', item.readingProgress)
|
||||||
fetchBlogPostsFromAuthors(relayPool, [viewingPubkey], RELAYS)
|
// Update reads array after map is updated
|
||||||
])
|
setReads(Array.from(newMap.values()))
|
||||||
|
return newMap
|
||||||
setHighlights(userHighlights)
|
|
||||||
setWritings(userWritings)
|
|
||||||
|
|
||||||
// Only fetch private data for own profile
|
|
||||||
if (isOwnProfile && activeAccount) {
|
|
||||||
const userReadArticles = await fetchReadArticlesWithData(relayPool, viewingPubkey)
|
|
||||||
setReadArticles(userReadArticles)
|
|
||||||
|
|
||||||
// Fetch bookmarks using callback pattern
|
|
||||||
let fetchedBookmarks: Bookmark[] = []
|
|
||||||
try {
|
|
||||||
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
|
||||||
fetchedBookmarks = newBookmarks
|
|
||||||
setBookmarks(newBookmarks)
|
|
||||||
})
|
|
||||||
} catch (err) {
|
|
||||||
console.warn('Failed to load bookmarks:', err)
|
|
||||||
setBookmarks([])
|
|
||||||
}
|
}
|
||||||
|
return prevMap
|
||||||
|
})
|
||||||
|
}).catch(err => console.warn('Failed to enrich reads:', err))
|
||||||
|
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load reads:', err)
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// Update cache with all fetched data
|
const loadLinksTab = async () => {
|
||||||
setCachedMeData(viewingPubkey, userHighlights, fetchedBookmarks, userReadArticles)
|
if (!viewingPubkey || !isOwnProfile || !activeAccount) return
|
||||||
} else {
|
|
||||||
setBookmarks([])
|
const hasBeenLoaded = loadedTabs.has('links')
|
||||||
setReadArticles([])
|
|
||||||
|
try {
|
||||||
|
if (!hasBeenLoaded) setLoading(true)
|
||||||
|
|
||||||
|
// Ensure bookmarks are loaded
|
||||||
|
let fetchedBookmarks: Bookmark[] = bookmarks
|
||||||
|
if (bookmarks.length === 0) {
|
||||||
|
try {
|
||||||
|
await fetchBookmarks(relayPool, activeAccount, (newBookmarks) => {
|
||||||
|
fetchedBookmarks = newBookmarks
|
||||||
|
setBookmarks(newBookmarks)
|
||||||
|
})
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to load bookmarks:', err)
|
||||||
|
fetchedBookmarks = []
|
||||||
}
|
}
|
||||||
} catch (err) {
|
}
|
||||||
console.error('Failed to load data:', err)
|
|
||||||
// No blocking error - user can pull-to-refresh
|
// Derive links from bookmarks immediately
|
||||||
} finally {
|
const initialLinks = deriveLinksFromBookmarks(fetchedBookmarks)
|
||||||
setLoading(false)
|
const initialMap = new Map(initialLinks.map(item => [item.id, item]))
|
||||||
|
setLinksMap(initialMap)
|
||||||
|
setLinks(initialLinks)
|
||||||
|
setLoadedTabs(prev => new Set(prev).add('links'))
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
|
||||||
|
// Background enrichment: merge reading progress and mark-as-read
|
||||||
|
// Only update items that are already in our map
|
||||||
|
fetchLinks(relayPool, viewingPubkey, (item) => {
|
||||||
|
setLinksMap(prevMap => {
|
||||||
|
// Only update if item exists in our current map
|
||||||
|
if (!prevMap.has(item.id)) return prevMap
|
||||||
|
|
||||||
|
const newMap = new Map(prevMap)
|
||||||
|
if (mergeReadItem(newMap, item)) {
|
||||||
|
// Update links array after map is updated
|
||||||
|
setLinks(Array.from(newMap.values()))
|
||||||
|
return newMap
|
||||||
|
}
|
||||||
|
return prevMap
|
||||||
|
})
|
||||||
|
}).catch(err => console.warn('Failed to enrich links:', err))
|
||||||
|
|
||||||
|
} catch (err) {
|
||||||
|
console.error('Failed to load links:', err)
|
||||||
|
if (!hasBeenLoaded) setLoading(false)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Load active tab data
|
||||||
|
useEffect(() => {
|
||||||
|
if (!viewingPubkey || !activeTab) {
|
||||||
|
setLoading(false)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
// Load cached data immediately if available
|
||||||
|
if (isOwnProfile) {
|
||||||
|
const cached = getCachedMeData(viewingPubkey)
|
||||||
|
if (cached) {
|
||||||
|
setHighlights(cached.highlights)
|
||||||
|
setBookmarks(cached.bookmarks)
|
||||||
|
setReads(cached.reads || [])
|
||||||
|
setLinks(cached.links || [])
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
loadData()
|
// Load data for active tab (refresh in background if already loaded)
|
||||||
}, [relayPool, viewingPubkey, isOwnProfile, activeAccount, refreshTrigger])
|
switch (activeTab) {
|
||||||
|
case 'highlights':
|
||||||
|
loadHighlightsTab()
|
||||||
|
break
|
||||||
|
case 'writings':
|
||||||
|
loadWritingsTab()
|
||||||
|
break
|
||||||
|
case 'reading-list':
|
||||||
|
loadReadingListTab()
|
||||||
|
break
|
||||||
|
case 'reads':
|
||||||
|
loadReadsTab()
|
||||||
|
break
|
||||||
|
case 'links':
|
||||||
|
loadLinksTab()
|
||||||
|
break
|
||||||
|
}
|
||||||
|
// eslint-disable-next-line react-hooks/exhaustive-deps
|
||||||
|
}, [activeTab, viewingPubkey, refreshTrigger])
|
||||||
|
|
||||||
// Pull-to-refresh
|
|
||||||
|
// Pull-to-refresh - reload active tab without clearing state
|
||||||
const { isRefreshing, pullPosition } = usePullToRefresh({
|
const { isRefreshing, pullPosition } = usePullToRefresh({
|
||||||
onRefresh: () => {
|
onRefresh: () => {
|
||||||
|
// Just trigger refresh - loaders will merge new data
|
||||||
setRefreshTrigger(prev => prev + 1)
|
setRefreshTrigger(prev => prev + 1)
|
||||||
},
|
},
|
||||||
maximumPullLength: 240,
|
maximumPullLength: 240,
|
||||||
@@ -150,21 +347,47 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
return `/a/${naddr}`
|
return `/a/${naddr}`
|
||||||
}
|
}
|
||||||
|
|
||||||
// Helper to check if a bookmark has either content or a URL (same logic as BookmarkList)
|
const getReadItemUrl = (item: ReadItem) => {
|
||||||
const hasContentOrUrl = (ib: IndividualBookmark) => {
|
if (item.type === 'article') {
|
||||||
const hasContent = ib.content && ib.content.trim().length > 0
|
// ID is already in naddr format
|
||||||
|
return `/a/${item.id}`
|
||||||
let hasUrl = false
|
} else if (item.url) {
|
||||||
if (ib.kind === 39701) {
|
return `/r/${encodeURIComponent(item.url)}`
|
||||||
const dTag = ib.tags?.find((t: string[]) => t[0] === 'd')?.[1]
|
}
|
||||||
hasUrl = !!dTag && dTag.trim().length > 0
|
return '#'
|
||||||
} else {
|
}
|
||||||
const urls = extractUrlsFromContent(ib.content || '')
|
|
||||||
hasUrl = urls.length > 0
|
const convertReadItemToBlogPostPreview = (item: ReadItem): BlogPostPreview => {
|
||||||
|
if (item.event) {
|
||||||
|
return {
|
||||||
|
event: item.event,
|
||||||
|
title: item.title || 'Untitled',
|
||||||
|
summary: item.summary,
|
||||||
|
image: item.image,
|
||||||
|
published: item.published,
|
||||||
|
author: item.author || item.event.pubkey
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (ib.kind === 30023) return true
|
// Create a mock event for external URLs
|
||||||
return hasContent || hasUrl
|
const mockEvent = {
|
||||||
|
id: item.id,
|
||||||
|
pubkey: item.author || '',
|
||||||
|
created_at: item.readingTimestamp || Math.floor(Date.now() / 1000),
|
||||||
|
kind: 1,
|
||||||
|
tags: [] as string[][],
|
||||||
|
content: item.title || item.url || 'Untitled',
|
||||||
|
sig: ''
|
||||||
|
} as const
|
||||||
|
|
||||||
|
return {
|
||||||
|
event: mockEvent as unknown as import('nostr-tools').NostrEvent,
|
||||||
|
title: item.title || item.url || 'Untitled',
|
||||||
|
summary: item.summary,
|
||||||
|
image: item.image,
|
||||||
|
published: item.published,
|
||||||
|
author: item.author || ''
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleSelectUrl = (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => {
|
const handleSelectUrl = (url: string, bookmark?: { id: string; kind: number; tags: string[][]; pubkey: string }) => {
|
||||||
@@ -186,13 +409,27 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Merge and flatten all individual bookmarks (same logic as BookmarkList)
|
// Merge and flatten all individual bookmarks
|
||||||
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
const allIndividualBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
.filter(hasContentOrUrl)
|
.filter(hasContent)
|
||||||
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
|
||||||
|
// Apply bookmark filter
|
||||||
|
const filteredBookmarks = filterBookmarksByType(allIndividualBookmarks, bookmarkFilter)
|
||||||
|
|
||||||
|
const groups = groupIndividualBookmarks(filteredBookmarks)
|
||||||
|
|
||||||
|
// Apply reading progress filter
|
||||||
|
const filteredReads = filterByReadingProgress(reads, readingProgressFilter)
|
||||||
|
const filteredLinks = filterByReadingProgress(links, readingProgressFilter)
|
||||||
|
const sections: Array<{ key: string; title: string; items: IndividualBookmark[] }> = [
|
||||||
|
{ key: 'private', title: 'Private Bookmarks', items: groups.privateItems },
|
||||||
|
{ key: 'public', title: 'Public Bookmarks', items: groups.publicItems },
|
||||||
|
{ key: 'web', title: 'Web Bookmarks', items: groups.web },
|
||||||
|
{ key: 'amethyst', title: 'Legacy Bookmarks', items: groups.amethyst }
|
||||||
|
]
|
||||||
|
|
||||||
// Show content progressively - no blocking error screens
|
// Show content progressively - no blocking error screens
|
||||||
const hasData = highlights.length > 0 || bookmarks.length > 0 || readArticles.length > 0 || writings.length > 0
|
const hasData = highlights.length > 0 || bookmarks.length > 0 || reads.length > 0 || links.length > 0 || writings.length > 0
|
||||||
const showSkeletons = loading && !hasData
|
const showSkeletons = loading && !hasData
|
||||||
|
|
||||||
const renderTabContent = () => {
|
const renderTabContent = () => {
|
||||||
@@ -207,13 +444,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
return highlights.length === 0 ? (
|
return highlights.length === 0 && !loading ? (
|
||||||
<div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>
|
No highlights yet.
|
||||||
{isOwnProfile
|
|
||||||
? 'No highlights yet. Pull to refresh!'
|
|
||||||
: 'No highlights yet. Pull to refresh!'}
|
|
||||||
</p>
|
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="highlights-list me-highlights-list">
|
<div className="highlights-list me-highlights-list">
|
||||||
@@ -240,23 +473,39 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
return allIndividualBookmarks.length === 0 ? (
|
return allIndividualBookmarks.length === 0 && !loading ? (
|
||||||
<div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>No bookmarks yet. Pull to refresh!</p>
|
No bookmarks yet.
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="bookmarks-list">
|
<div className="bookmarks-list">
|
||||||
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
{allIndividualBookmarks.length > 0 && (
|
||||||
{allIndividualBookmarks.map((individualBookmark, index) => (
|
<BookmarkFilters
|
||||||
<BookmarkItem
|
selectedFilter={bookmarkFilter}
|
||||||
key={`${individualBookmark.id}-${index}`}
|
onFilterChange={setBookmarkFilter}
|
||||||
bookmark={individualBookmark}
|
/>
|
||||||
index={index}
|
)}
|
||||||
viewMode={viewMode}
|
{filteredBookmarks.length === 0 ? (
|
||||||
onSelectUrl={handleSelectUrl}
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
/>
|
No bookmarks match this filter.
|
||||||
))}
|
</div>
|
||||||
</div>
|
) : (
|
||||||
|
sections.filter(s => s.items.length > 0).map(section => (
|
||||||
|
<div key={section.key} className="bookmarks-section">
|
||||||
|
<h3 className="bookmarks-section-title">{section.title}</h3>
|
||||||
|
<div className={`bookmarks-grid bookmarks-${viewMode}`}>
|
||||||
|
{section.items.map((individualBookmark, index) => (
|
||||||
|
<BookmarkItem
|
||||||
|
key={`${section.key}-${individualBookmark.id}-${index}`}
|
||||||
|
bookmark={individualBookmark}
|
||||||
|
index={index}
|
||||||
|
viewMode={viewMode}
|
||||||
|
onSelectUrl={handleSelectUrl}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)))}
|
||||||
<div className="view-mode-controls" style={{
|
<div className="view-mode-controls" style={{
|
||||||
display: 'flex',
|
display: 'flex',
|
||||||
justifyContent: 'center',
|
justifyContent: 'center',
|
||||||
@@ -290,8 +539,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|
||||||
case 'archive':
|
case 'reads':
|
||||||
if (showSkeletons) {
|
// Show loading skeletons only while initially loading
|
||||||
|
if (loading && !loadedTabs.has('reads')) {
|
||||||
return (
|
return (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
{Array.from({ length: 6 }).map((_, i) => (
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
@@ -300,20 +550,87 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
return readArticles.length === 0 ? (
|
|
||||||
<div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
// Show empty state if loaded but no reads
|
||||||
<p>No read articles yet. Pull to refresh!</p>
|
if (reads.length === 0 && loadedTabs.has('reads')) {
|
||||||
</div>
|
return (
|
||||||
) : (
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<div className="explore-grid">
|
No articles read yet.
|
||||||
{readArticles.map((post) => (
|
</div>
|
||||||
<BlogPostCard
|
)
|
||||||
key={post.event.id}
|
}
|
||||||
post={post}
|
|
||||||
href={getPostUrl(post)}
|
// Show reads with filters
|
||||||
/>
|
return (
|
||||||
))}
|
<>
|
||||||
</div>
|
<ReadingProgressFilters
|
||||||
|
selectedFilter={readingProgressFilter}
|
||||||
|
onFilterChange={handleReadingProgressFilterChange}
|
||||||
|
/>
|
||||||
|
{filteredReads.length === 0 ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No articles match this filter.
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{filteredReads.map((item) => (
|
||||||
|
<BlogPostCard
|
||||||
|
key={item.id}
|
||||||
|
post={convertReadItemToBlogPostPreview(item)}
|
||||||
|
href={getReadItemUrl(item)}
|
||||||
|
readingProgress={item.readingProgress}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</>
|
||||||
|
)
|
||||||
|
|
||||||
|
case 'links':
|
||||||
|
// Show loading skeletons only while initially loading
|
||||||
|
if (loading && !loadedTabs.has('links')) {
|
||||||
|
return (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{Array.from({ length: 6 }).map((_, i) => (
|
||||||
|
<BlogPostSkeleton key={i} />
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show empty state if loaded but no links
|
||||||
|
if (links.length === 0 && loadedTabs.has('links')) {
|
||||||
|
return (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No links with reading progress yet.
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show links with filters
|
||||||
|
return (
|
||||||
|
<>
|
||||||
|
<ReadingProgressFilters
|
||||||
|
selectedFilter={readingProgressFilter}
|
||||||
|
onFilterChange={handleReadingProgressFilterChange}
|
||||||
|
/>
|
||||||
|
{filteredLinks.length === 0 ? (
|
||||||
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
|
No links match this filter.
|
||||||
|
</div>
|
||||||
|
) : (
|
||||||
|
<div className="explore-grid">
|
||||||
|
{filteredLinks.map((item) => (
|
||||||
|
<BlogPostCard
|
||||||
|
key={item.id}
|
||||||
|
post={convertReadItemToBlogPostPreview(item)}
|
||||||
|
href={getReadItemUrl(item)}
|
||||||
|
readingProgress={item.readingProgress}
|
||||||
|
/>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</>
|
||||||
)
|
)
|
||||||
|
|
||||||
case 'writings':
|
case 'writings':
|
||||||
@@ -326,13 +643,9 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
return writings.length === 0 ? (
|
return writings.length === 0 && !loading ? (
|
||||||
<div className="explore-empty" style={{ padding: '2rem', textAlign: 'center', color: 'var(--text-secondary)' }}>
|
<div className="explore-loading" style={{ display: 'flex', justifyContent: 'center', alignItems: 'center', padding: '4rem', color: 'var(--text-secondary)' }}>
|
||||||
<p>
|
No articles written yet.
|
||||||
{isOwnProfile
|
|
||||||
? 'No articles written yet. Pull to refresh!'
|
|
||||||
: 'No articles written yet. Pull to refresh!'}
|
|
||||||
</p>
|
|
||||||
</div>
|
</div>
|
||||||
) : (
|
) : (
|
||||||
<div className="explore-grid">
|
<div className="explore-grid">
|
||||||
@@ -360,12 +673,6 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
<div className="explore-header">
|
<div className="explore-header">
|
||||||
{viewingPubkey && <AuthorCard authorPubkey={viewingPubkey} clickable={false} />}
|
{viewingPubkey && <AuthorCard authorPubkey={viewingPubkey} clickable={false} />}
|
||||||
|
|
||||||
{loading && hasData && (
|
|
||||||
<div className="explore-loading" style={{ display: 'flex', alignItems: 'center', gap: '0.5rem', padding: '0.5rem 0' }}>
|
|
||||||
<FontAwesomeIcon icon={faSpinner} spin />
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
|
|
||||||
<div className="me-tabs">
|
<div className="me-tabs">
|
||||||
<button
|
<button
|
||||||
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
className={`me-tab ${activeTab === 'highlights' ? 'active' : ''}`}
|
||||||
@@ -386,12 +693,20 @@ const Me: React.FC<MeProps> = ({ relayPool, activeTab: propActiveTab, pubkey: pr
|
|||||||
<span className="tab-label">Bookmarks</span>
|
<span className="tab-label">Bookmarks</span>
|
||||||
</button>
|
</button>
|
||||||
<button
|
<button
|
||||||
className={`me-tab ${activeTab === 'archive' ? 'active' : ''}`}
|
className={`me-tab ${activeTab === 'reads' ? 'active' : ''}`}
|
||||||
data-tab="archive"
|
data-tab="reads"
|
||||||
onClick={() => navigate('/me/archive')}
|
onClick={() => navigate('/me/reads')}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faBooks} />
|
<FontAwesomeIcon icon={faBooks} />
|
||||||
<span className="tab-label">Archive</span>
|
<span className="tab-label">Reads</span>
|
||||||
|
</button>
|
||||||
|
<button
|
||||||
|
className={`me-tab ${activeTab === 'links' ? 'active' : ''}`}
|
||||||
|
data-tab="links"
|
||||||
|
onClick={() => navigate('/me/links')}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={faLink} />
|
||||||
|
<span className="tab-label">Links</span>
|
||||||
</button>
|
</button>
|
||||||
</>
|
</>
|
||||||
)}
|
)}
|
||||||
|
|||||||
@@ -1,8 +1,9 @@
|
|||||||
import React, { useMemo } from 'react'
|
import React, { useMemo } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faHighlighter, faClock } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faClock, faNewspaper } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { format } from 'date-fns'
|
import { format } from 'date-fns'
|
||||||
import { useImageCache } from '../hooks/useImageCache'
|
import { useImageCache } from '../hooks/useImageCache'
|
||||||
|
import { useAdaptiveTextColor } from '../hooks/useAdaptiveTextColor'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
import { Highlight, HighlightLevel } from '../types/highlights'
|
import { Highlight, HighlightLevel } from '../types/highlights'
|
||||||
import { HighlightVisibility } from './HighlightsPanel'
|
import { HighlightVisibility } from './HighlightsPanel'
|
||||||
@@ -34,6 +35,7 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
highlightVisibility = { nostrverse: true, friends: true, mine: true }
|
highlightVisibility = { nostrverse: true, friends: true, mine: true }
|
||||||
}) => {
|
}) => {
|
||||||
const cachedImage = useImageCache(image)
|
const cachedImage = useImageCache(image)
|
||||||
|
const { textColor } = useAdaptiveTextColor(cachedImage)
|
||||||
const formattedDate = published ? format(new Date(published * 1000), 'MMM d, yyyy') : null
|
const formattedDate = published ? format(new Date(published * 1000), 'MMM d, yyyy') : null
|
||||||
const isLongSummary = summary && summary.length > 150
|
const isLongSummary = summary && summary.length > 150
|
||||||
|
|
||||||
@@ -70,13 +72,25 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
}
|
}
|
||||||
}, [highlights, highlightVisibility, settings])
|
}, [highlights, highlightVisibility, settings])
|
||||||
|
|
||||||
if (cachedImage) {
|
// Show hero section if we have an image OR a title
|
||||||
|
if (cachedImage || title) {
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
<div className="reader-hero-image">
|
<div className="reader-hero-image">
|
||||||
<img src={cachedImage} alt={title || 'Article image'} />
|
{cachedImage ? (
|
||||||
|
<img src={cachedImage} alt={title || 'Article image'} />
|
||||||
|
) : (
|
||||||
|
<div className="reader-hero-placeholder">
|
||||||
|
<FontAwesomeIcon icon={faNewspaper} />
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
{formattedDate && (
|
{formattedDate && (
|
||||||
<div className="publish-date-topright">
|
<div
|
||||||
|
className="publish-date-topright"
|
||||||
|
style={{
|
||||||
|
color: textColor
|
||||||
|
}}
|
||||||
|
>
|
||||||
{formattedDate}
|
{formattedDate}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
@@ -118,7 +132,12 @@ const ReaderHeader: React.FC<ReaderHeaderProps> = ({
|
|||||||
{title && (
|
{title && (
|
||||||
<div className="reader-header">
|
<div className="reader-header">
|
||||||
{formattedDate && (
|
{formattedDate && (
|
||||||
<div className="publish-date-topright">
|
<div
|
||||||
|
className="publish-date-topright"
|
||||||
|
style={{
|
||||||
|
color: textColor
|
||||||
|
}}
|
||||||
|
>
|
||||||
{formattedDate}
|
{formattedDate}
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
|
|||||||
47
src/components/ReadingProgressFilters.tsx
Normal file
47
src/components/ReadingProgressFilters.tsx
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
|
import { faBookOpen, faCheckCircle, faAsterisk } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { faEnvelope, faEnvelopeOpen } from '@fortawesome/free-regular-svg-icons'
|
||||||
|
|
||||||
|
export type ReadingProgressFilterType = 'all' | 'unopened' | 'started' | 'reading' | 'completed'
|
||||||
|
|
||||||
|
interface ReadingProgressFiltersProps {
|
||||||
|
selectedFilter: ReadingProgressFilterType
|
||||||
|
onFilterChange: (filter: ReadingProgressFilterType) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const ReadingProgressFilters: React.FC<ReadingProgressFiltersProps> = ({ selectedFilter, onFilterChange }) => {
|
||||||
|
const filters = [
|
||||||
|
{ type: 'all' as const, icon: faAsterisk, label: 'All' },
|
||||||
|
{ type: 'unopened' as const, icon: faEnvelope, label: 'Unopened' },
|
||||||
|
{ type: 'started' as const, icon: faEnvelopeOpen, label: 'Started' },
|
||||||
|
{ type: 'reading' as const, icon: faBookOpen, label: 'Reading' },
|
||||||
|
{ type: 'completed' as const, icon: faCheckCircle, label: 'Completed' }
|
||||||
|
]
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div className="bookmark-filters">
|
||||||
|
{filters.map(filter => {
|
||||||
|
const isActive = selectedFilter === filter.type
|
||||||
|
// Only "completed" gets green color, everything else uses default blue
|
||||||
|
const activeStyle = isActive && filter.type === 'completed' ? { color: '#10b981' } : undefined
|
||||||
|
|
||||||
|
return (
|
||||||
|
<button
|
||||||
|
key={filter.type}
|
||||||
|
onClick={() => onFilterChange(filter.type)}
|
||||||
|
className={`filter-btn ${isActive ? 'active' : ''}`}
|
||||||
|
title={filter.label}
|
||||||
|
aria-label={`Filter by ${filter.label}`}
|
||||||
|
style={activeStyle}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={filter.icon} />
|
||||||
|
</button>
|
||||||
|
)
|
||||||
|
})}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default ReadingProgressFilters
|
||||||
|
|
||||||
@@ -19,6 +19,21 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
}) => {
|
}) => {
|
||||||
const clampedProgress = Math.min(100, Math.max(0, progress))
|
const clampedProgress = Math.min(100, Math.max(0, progress))
|
||||||
|
|
||||||
|
// Determine reading state based on progress (matching readingProgressUtils.ts logic)
|
||||||
|
const progressDecimal = clampedProgress / 100
|
||||||
|
const isStarted = progressDecimal > 0 && progressDecimal <= 0.10
|
||||||
|
|
||||||
|
// Determine bar color based on state
|
||||||
|
let barColorClass = ''
|
||||||
|
let barColorStyle: string | undefined = 'var(--color-primary)' // Default blue
|
||||||
|
|
||||||
|
if (isComplete) {
|
||||||
|
barColorClass = 'bg-green-500'
|
||||||
|
barColorStyle = undefined
|
||||||
|
} else if (isStarted) {
|
||||||
|
barColorStyle = 'var(--color-text)' // Neutral text color (matches card titles)
|
||||||
|
}
|
||||||
|
|
||||||
// Calculate left and right offsets based on sidebar states (desktop only)
|
// Calculate left and right offsets based on sidebar states (desktop only)
|
||||||
const leftOffset = isSidebarCollapsed
|
const leftOffset = isSidebarCollapsed
|
||||||
? 'var(--sidebar-collapsed-width)'
|
? 'var(--sidebar-collapsed-width)'
|
||||||
@@ -42,14 +57,10 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
style={{ backgroundColor: 'var(--color-border)' }}
|
style={{ backgroundColor: 'var(--color-border)' }}
|
||||||
>
|
>
|
||||||
<div
|
<div
|
||||||
className={`h-full rounded-full transition-all duration-300 relative ${
|
className={`h-full rounded-full transition-all duration-300 relative ${barColorClass}`}
|
||||||
isComplete
|
|
||||||
? 'bg-green-500'
|
|
||||||
: ''
|
|
||||||
}`}
|
|
||||||
style={{
|
style={{
|
||||||
width: `${clampedProgress}%`,
|
width: `${clampedProgress}%`,
|
||||||
backgroundColor: isComplete ? undefined : 'var(--color-primary)'
|
backgroundColor: barColorStyle
|
||||||
}}
|
}}
|
||||||
>
|
>
|
||||||
<div className="absolute inset-0 bg-gradient-to-r from-transparent via-white/30 to-transparent animate-[shimmer_2s_infinite]" />
|
<div className="absolute inset-0 bg-gradient-to-r from-transparent via-white/30 to-transparent animate-[shimmer_2s_infinite]" />
|
||||||
@@ -60,7 +71,9 @@ export const ReadingProgressIndicator: React.FC<ReadingProgressIndicatorProps> =
|
|||||||
className={`text-[0.625rem] font-normal min-w-[32px] text-right tabular-nums ${
|
className={`text-[0.625rem] font-normal min-w-[32px] text-right tabular-nums ${
|
||||||
isComplete ? 'text-green-500' : ''
|
isComplete ? 'text-green-500' : ''
|
||||||
}`}
|
}`}
|
||||||
style={{ color: isComplete ? undefined : 'var(--color-text-muted)' }}
|
style={{
|
||||||
|
color: isComplete ? undefined : isStarted ? 'var(--color-text)' : 'var(--color-text-muted)'
|
||||||
|
}}
|
||||||
>
|
>
|
||||||
{isComplete ? '✓' : `${clampedProgress}%`}
|
{isComplete ? '✓' : `${clampedProgress}%`}
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
30
src/components/RouteDebug.tsx
Normal file
30
src/components/RouteDebug.tsx
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
import { useEffect } from 'react'
|
||||||
|
import { useLocation, useMatch } from 'react-router-dom'
|
||||||
|
|
||||||
|
export default function RouteDebug() {
|
||||||
|
const location = useLocation()
|
||||||
|
const matchArticle = useMatch('/a/:naddr')
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
const params = new URLSearchParams(location.search)
|
||||||
|
if (params.get('debug') !== '1') return
|
||||||
|
|
||||||
|
const info: Record<string, unknown> = {
|
||||||
|
pathname: location.pathname,
|
||||||
|
search: location.search || null,
|
||||||
|
matchedArticleRoute: Boolean(matchArticle),
|
||||||
|
referrer: document.referrer || null
|
||||||
|
}
|
||||||
|
|
||||||
|
if (location.pathname === '/') {
|
||||||
|
// Unexpected during deep-link refresh tests
|
||||||
|
console.warn('[RouteDebug] unexpected root redirect', info)
|
||||||
|
} else {
|
||||||
|
console.debug('[RouteDebug]', info)
|
||||||
|
}
|
||||||
|
}, [location, matchArticle])
|
||||||
|
|
||||||
|
return null
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
@@ -6,13 +6,12 @@ import IconButton from './IconButton'
|
|||||||
import { loadFont } from '../utils/fontLoader'
|
import { loadFont } from '../utils/fontLoader'
|
||||||
import ThemeSettings from './Settings/ThemeSettings'
|
import ThemeSettings from './Settings/ThemeSettings'
|
||||||
import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
|
import ReadingDisplaySettings from './Settings/ReadingDisplaySettings'
|
||||||
import LayoutNavigationSettings from './Settings/LayoutNavigationSettings'
|
import LayoutBehaviorSettings from './Settings/LayoutBehaviorSettings'
|
||||||
import StartupPreferencesSettings from './Settings/StartupPreferencesSettings'
|
|
||||||
import ZapSettings from './Settings/ZapSettings'
|
import ZapSettings from './Settings/ZapSettings'
|
||||||
import OfflineModeSettings from './Settings/OfflineModeSettings'
|
|
||||||
import RelaySettings from './Settings/RelaySettings'
|
import RelaySettings from './Settings/RelaySettings'
|
||||||
import PWASettings from './Settings/PWASettings'
|
import PWASettings from './Settings/PWASettings'
|
||||||
import { useRelayStatus } from '../hooks/useRelayStatus'
|
import { useRelayStatus } from '../hooks/useRelayStatus'
|
||||||
|
import VersionFooter from './VersionFooter'
|
||||||
|
|
||||||
const DEFAULT_SETTINGS: UserSettings = {
|
const DEFAULT_SETTINGS: UserSettings = {
|
||||||
collapseOnArticleOpen: true,
|
collapseOnArticleOpen: true,
|
||||||
@@ -35,6 +34,8 @@ const DEFAULT_SETTINGS: UserSettings = {
|
|||||||
zapSplitAuthorWeight: 50,
|
zapSplitAuthorWeight: 50,
|
||||||
useLocalRelayAsCache: true,
|
useLocalRelayAsCache: true,
|
||||||
rebroadcastToAllRelays: false,
|
rebroadcastToAllRelays: false,
|
||||||
|
paragraphAlignment: 'justify',
|
||||||
|
syncReadingPosition: false,
|
||||||
}
|
}
|
||||||
|
|
||||||
interface SettingsProps {
|
interface SettingsProps {
|
||||||
@@ -162,13 +163,12 @@ const Settings: React.FC<SettingsProps> = ({ settings, onSave, onClose, relayPoo
|
|||||||
<div className="settings-content">
|
<div className="settings-content">
|
||||||
<ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
|
<ThemeSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
|
<ReadingDisplaySettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<LayoutNavigationSettings settings={localSettings} onUpdate={handleUpdate} />
|
|
||||||
<StartupPreferencesSettings settings={localSettings} onUpdate={handleUpdate} />
|
|
||||||
<ZapSettings settings={localSettings} onUpdate={handleUpdate} />
|
<ZapSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
<OfflineModeSettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
|
<LayoutBehaviorSettings settings={localSettings} onUpdate={handleUpdate} />
|
||||||
|
<PWASettings settings={localSettings} onUpdate={handleUpdate} onClose={onClose} />
|
||||||
<RelaySettings relayStatuses={relayStatuses} onClose={onClose} />
|
<RelaySettings relayStatuses={relayStatuses} onClose={onClose} />
|
||||||
<PWASettings />
|
|
||||||
</div>
|
</div>
|
||||||
|
<VersionFooter />
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
125
src/components/Settings/LayoutBehaviorSettings.tsx
Normal file
125
src/components/Settings/LayoutBehaviorSettings.tsx
Normal file
@@ -0,0 +1,125 @@
|
|||||||
|
import React from 'react'
|
||||||
|
import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
|
||||||
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import IconButton from '../IconButton'
|
||||||
|
|
||||||
|
interface LayoutBehaviorSettingsProps {
|
||||||
|
settings: UserSettings
|
||||||
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
|
return (
|
||||||
|
<div className="settings-section">
|
||||||
|
<h3 className="section-title">Layout & Behavior</h3>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label>Default Bookmark View</label>
|
||||||
|
<div className="setting-buttons">
|
||||||
|
<IconButton
|
||||||
|
icon={faList}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'compact' })}
|
||||||
|
title="Compact list view"
|
||||||
|
ariaLabel="Compact list view"
|
||||||
|
variant={(settings.defaultViewMode || 'compact') === 'compact' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faThLarge}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'cards' })}
|
||||||
|
title="Cards view"
|
||||||
|
ariaLabel="Cards view"
|
||||||
|
variant={settings.defaultViewMode === 'cards' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
<IconButton
|
||||||
|
icon={faImage}
|
||||||
|
onClick={() => onUpdate({ defaultViewMode: 'large' })}
|
||||||
|
title="Large preview view"
|
||||||
|
ariaLabel="Large preview view"
|
||||||
|
variant={settings.defaultViewMode === 'large' ? 'primary' : 'ghost'}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="collapseOnArticleOpen" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="collapseOnArticleOpen"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.collapseOnArticleOpen !== false}
|
||||||
|
onChange={(e) => onUpdate({ collapseOnArticleOpen: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Collapse bookmark bar when opening an article</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="sidebarCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.sidebarCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with bookmarks sidebar collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="highlightsCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.highlightsCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with highlights panel collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="rebroadcastToAllRelays"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.rebroadcastToAllRelays ?? false}
|
||||||
|
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Rebroadcast events while browsing</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="autoCollapseSidebarOnMobile"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.autoCollapseSidebarOnMobile !== false}
|
||||||
|
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Auto-collapse sidebar on small screens</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="syncReadingPosition" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="syncReadingPosition"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.syncReadingPosition ?? false}
|
||||||
|
onChange={(e) => onUpdate({ syncReadingPosition: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Sync reading position across devices</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default LayoutBehaviorSettings
|
||||||
|
|
||||||
@@ -3,15 +3,15 @@ import { faList, faThLarge, faImage } from '@fortawesome/free-solid-svg-icons'
|
|||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
import IconButton from '../IconButton'
|
import IconButton from '../IconButton'
|
||||||
|
|
||||||
interface LayoutNavigationSettingsProps {
|
interface LayoutBehaviorSettingsProps {
|
||||||
settings: UserSettings
|
settings: UserSettings
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
}
|
}
|
||||||
|
|
||||||
const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ settings, onUpdate }) => {
|
const LayoutBehaviorSettings: React.FC<LayoutBehaviorSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
return (
|
return (
|
||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Layout & Navigation</h3>
|
<h3 className="section-title">Layout & Behavior</h3>
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label>Default Bookmark View</label>
|
<label>Default Bookmark View</label>
|
||||||
@@ -52,9 +52,61 @@ const LayoutNavigationSettings: React.FC<LayoutNavigationSettingsProps> = ({ set
|
|||||||
<span>Collapse bookmark bar when opening an article</span>
|
<span>Collapse bookmark bar when opening an article</span>
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="sidebarCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.sidebarCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with bookmarks sidebar collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="highlightsCollapsed"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.highlightsCollapsed !== false}
|
||||||
|
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Start with highlights panel collapsed</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="rebroadcastToAllRelays"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.rebroadcastToAllRelays ?? false}
|
||||||
|
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Rebroadcast events while browsing</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="autoCollapseSidebarOnMobile"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.autoCollapseSidebarOnMobile !== false}
|
||||||
|
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Auto-collapse sidebar on small screens</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
export default LayoutNavigationSettings
|
export default LayoutBehaviorSettings
|
||||||
|
|
||||||
|
|||||||
@@ -1,173 +0,0 @@
|
|||||||
import React, { useState, useEffect } from 'react'
|
|
||||||
import { useNavigate } from 'react-router-dom'
|
|
||||||
import { faTrash } from '@fortawesome/free-solid-svg-icons'
|
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
|
|
||||||
import IconButton from '../IconButton'
|
|
||||||
|
|
||||||
interface OfflineModeSettingsProps {
|
|
||||||
settings: UserSettings
|
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
|
||||||
onClose?: () => void
|
|
||||||
}
|
|
||||||
|
|
||||||
const OfflineModeSettings: React.FC<OfflineModeSettingsProps> = ({ settings, onUpdate, onClose }) => {
|
|
||||||
const navigate = useNavigate()
|
|
||||||
const [cacheStats, setCacheStats] = useState<{
|
|
||||||
totalSizeMB: number
|
|
||||||
itemCount: number
|
|
||||||
items: Array<{ url: string, sizeMB: number }>
|
|
||||||
}>({ totalSizeMB: 0, itemCount: 0, items: [] })
|
|
||||||
|
|
||||||
const handleLinkClick = (url: string) => {
|
|
||||||
if (onClose) onClose()
|
|
||||||
navigate(`/r/${encodeURIComponent(url)}`)
|
|
||||||
}
|
|
||||||
|
|
||||||
const handleClearCache = async () => {
|
|
||||||
if (confirm('Are you sure you want to clear all cached images?')) {
|
|
||||||
await clearImageCache()
|
|
||||||
const stats = await getImageCacheStatsAsync()
|
|
||||||
setCacheStats(stats)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Update cache stats periodically
|
|
||||||
useEffect(() => {
|
|
||||||
const updateStats = async () => {
|
|
||||||
const stats = await getImageCacheStatsAsync()
|
|
||||||
setCacheStats(stats)
|
|
||||||
}
|
|
||||||
|
|
||||||
updateStats() // Initial load
|
|
||||||
const interval = setInterval(updateStats, 3000) // Update every 3 seconds
|
|
||||||
return () => clearInterval(interval)
|
|
||||||
}, [])
|
|
||||||
|
|
||||||
return (
|
|
||||||
<div className="settings-section">
|
|
||||||
<h3 className="section-title">Flight Mode</h3>
|
|
||||||
|
|
||||||
<div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
|
|
||||||
<label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
|
|
||||||
<input
|
|
||||||
id="enableImageCache"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.enableImageCache ?? true}
|
|
||||||
onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Use local image cache</span>
|
|
||||||
</label>
|
|
||||||
|
|
||||||
{(settings.enableImageCache ?? true) && (
|
|
||||||
<div style={{
|
|
||||||
fontSize: '0.85rem',
|
|
||||||
color: 'var(--text-secondary)',
|
|
||||||
display: 'flex',
|
|
||||||
alignItems: 'center',
|
|
||||||
gap: '0.5rem'
|
|
||||||
}}>
|
|
||||||
<span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
|
|
||||||
( {cacheStats.totalSizeMB.toFixed(1)} MB /
|
|
||||||
<input
|
|
||||||
id="imageCacheSizeMB"
|
|
||||||
type="number"
|
|
||||||
min="10"
|
|
||||||
max="500"
|
|
||||||
value={settings.imageCacheSizeMB ?? 210}
|
|
||||||
onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
|
|
||||||
style={{
|
|
||||||
width: '50px',
|
|
||||||
padding: '0.15rem 0.35rem',
|
|
||||||
background: 'var(--surface-secondary)',
|
|
||||||
border: '1px solid var(--border-color, #333)',
|
|
||||||
borderRadius: '4px',
|
|
||||||
color: 'inherit',
|
|
||||||
fontSize: 'inherit',
|
|
||||||
fontFamily: 'inherit',
|
|
||||||
textAlign: 'center'
|
|
||||||
}}
|
|
||||||
/>
|
|
||||||
MB used )
|
|
||||||
</span>
|
|
||||||
<IconButton
|
|
||||||
icon={faTrash}
|
|
||||||
onClick={handleClearCache}
|
|
||||||
title="Clear cache"
|
|
||||||
variant="ghost"
|
|
||||||
size={28}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
)}
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="useLocalRelayAsCache" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="useLocalRelayAsCache"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.useLocalRelayAsCache ?? true}
|
|
||||||
onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Use local relays as cache</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div style={{
|
|
||||||
marginTop: '1.5rem',
|
|
||||||
padding: '1rem',
|
|
||||||
background: 'var(--surface-secondary)',
|
|
||||||
borderRadius: '6px',
|
|
||||||
fontSize: '0.9rem',
|
|
||||||
lineHeight: '1.6'
|
|
||||||
}}>
|
|
||||||
<p style={{ margin: 0, color: 'var(--text-secondary)' }}>
|
|
||||||
Boris works best with a local relay. Consider running{' '}
|
|
||||||
<a
|
|
||||||
href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download"
|
|
||||||
target="_blank"
|
|
||||||
rel="noopener noreferrer"
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)' }}
|
|
||||||
>
|
|
||||||
Citrine
|
|
||||||
</a>
|
|
||||||
{' or '}
|
|
||||||
<a
|
|
||||||
href="https://github.com/CodyTseng/nostr-relay-tray/releases"
|
|
||||||
target="_blank"
|
|
||||||
rel="noopener noreferrer"
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)' }}
|
|
||||||
>
|
|
||||||
nostr-relay-tray
|
|
||||||
</a>
|
|
||||||
. Don't know what relays are? Learn more{' '}
|
|
||||||
<a
|
|
||||||
onClick={(e) => {
|
|
||||||
e.preventDefault()
|
|
||||||
handleLinkClick('https://nostr.how/en/relays')
|
|
||||||
}}
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
|
||||||
>
|
|
||||||
here
|
|
||||||
</a>
|
|
||||||
{' and '}
|
|
||||||
<a
|
|
||||||
onClick={(e) => {
|
|
||||||
e.preventDefault()
|
|
||||||
handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
|
|
||||||
}}
|
|
||||||
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
|
||||||
>
|
|
||||||
here
|
|
||||||
</a>
|
|
||||||
.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
export default OfflineModeSettings
|
|
||||||
|
|
||||||
@@ -1,80 +1,206 @@
|
|||||||
import React from 'react'
|
import React, { useState, useEffect } from 'react'
|
||||||
import { faDownload, faCheckCircle, faMobileAlt } from '@fortawesome/free-solid-svg-icons'
|
import { useNavigate } from 'react-router-dom'
|
||||||
|
import { faDownload, faCheckCircle, faTrash } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { usePWAInstall } from '../../hooks/usePWAInstall'
|
import { usePWAInstall } from '../../hooks/usePWAInstall'
|
||||||
|
import { useIsMobile } from '../../hooks/useMediaQuery'
|
||||||
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import { getImageCacheStatsAsync, clearImageCache } from '../../services/imageCacheService'
|
||||||
|
|
||||||
const PWASettings: React.FC = () => {
|
interface PWASettingsProps {
|
||||||
|
settings: UserSettings
|
||||||
|
onUpdate: (updates: Partial<UserSettings>) => void
|
||||||
|
onClose?: () => void
|
||||||
|
}
|
||||||
|
|
||||||
|
const PWASettings: React.FC<PWASettingsProps> = ({ settings, onUpdate, onClose }) => {
|
||||||
|
const navigate = useNavigate()
|
||||||
|
const isMobile = useIsMobile()
|
||||||
const { isInstallable, isInstalled, installApp } = usePWAInstall()
|
const { isInstallable, isInstalled, installApp } = usePWAInstall()
|
||||||
|
const [cacheStats, setCacheStats] = useState<{
|
||||||
|
totalSizeMB: number
|
||||||
|
itemCount: number
|
||||||
|
items: Array<{ url: string, sizeMB: number }>
|
||||||
|
}>({ totalSizeMB: 0, itemCount: 0, items: [] })
|
||||||
|
|
||||||
const handleInstall = async () => {
|
const handleInstall = async () => {
|
||||||
|
if (isInstalled) return
|
||||||
const success = await installApp()
|
const success = await installApp()
|
||||||
if (success) {
|
if (success) {
|
||||||
console.log('App installed successfully')
|
console.log('App installed successfully')
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if (isInstalled) {
|
const handleLinkClick = (url: string) => {
|
||||||
return (
|
if (onClose) onClose()
|
||||||
<div className="settings-section">
|
navigate(`/r/${encodeURIComponent(url)}`)
|
||||||
<h3>Progressive Web App</h3>
|
|
||||||
<div className="setting-item">
|
|
||||||
<div className="setting-info">
|
|
||||||
<FontAwesomeIcon icon={faCheckCircle} style={{ color: '#22c55e', marginRight: '8px' }} />
|
|
||||||
<span>Boris is installed as an app</span>
|
|
||||||
</div>
|
|
||||||
<p className="setting-description">
|
|
||||||
You can launch Boris from your home screen or app drawer.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!isInstallable) {
|
const handleClearCache = async () => {
|
||||||
return null
|
if (confirm('Are you sure you want to clear all cached images?')) {
|
||||||
|
await clearImageCache()
|
||||||
|
const stats = await getImageCacheStatsAsync()
|
||||||
|
setCacheStats(stats)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Update cache stats periodically
|
||||||
|
useEffect(() => {
|
||||||
|
const updateStats = async () => {
|
||||||
|
const stats = await getImageCacheStatsAsync()
|
||||||
|
setCacheStats(stats)
|
||||||
|
}
|
||||||
|
|
||||||
|
updateStats() // Initial load
|
||||||
|
const interval = setInterval(updateStats, 3000) // Update every 3 seconds
|
||||||
|
return () => clearInterval(interval)
|
||||||
|
}, [])
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3>Progressive Web App</h3>
|
<h3 className="section-title">App & Airplane Mode</h3>
|
||||||
<div className="setting-item">
|
|
||||||
<div className="setting-info">
|
<div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
|
||||||
<FontAwesomeIcon icon={faMobileAlt} style={{ marginRight: '8px' }} />
|
<div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
|
||||||
<span>Install Boris as an app</span>
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Boris is offline‑first by design. You can read, create highlights, and browse your library without being connected to the internet. Boris will store changes locally and sync later.
|
||||||
|
</p>
|
||||||
|
|
||||||
|
{/* Flight Mode Section - Checkboxes First */}
|
||||||
|
<div className="setting-group" style={{ display: 'flex', alignItems: 'center', gap: '1rem', flexWrap: 'wrap' }}>
|
||||||
|
<label htmlFor="enableImageCache" className="checkbox-label" style={{ marginBottom: 0 }}>
|
||||||
|
<input
|
||||||
|
id="enableImageCache"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.enableImageCache ?? true}
|
||||||
|
onChange={(e) => onUpdate({ enableImageCache: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Use local image cache</span>
|
||||||
|
</label>
|
||||||
|
|
||||||
|
{(settings.enableImageCache ?? true) && (
|
||||||
|
<div style={{
|
||||||
|
fontSize: '0.85rem',
|
||||||
|
color: 'var(--text-secondary)',
|
||||||
|
display: 'flex',
|
||||||
|
alignItems: 'center',
|
||||||
|
gap: '0.5rem'
|
||||||
|
}}>
|
||||||
|
<span style={{ display: 'flex', alignItems: 'center', gap: '0.25rem' }}>
|
||||||
|
( {cacheStats.totalSizeMB.toFixed(1)} MB /
|
||||||
|
<input
|
||||||
|
id="imageCacheSizeMB"
|
||||||
|
type="number"
|
||||||
|
min="10"
|
||||||
|
max="500"
|
||||||
|
value={settings.imageCacheSizeMB ?? 210}
|
||||||
|
onChange={(e) => onUpdate({ imageCacheSizeMB: parseInt(e.target.value) || 210 })}
|
||||||
|
style={{
|
||||||
|
width: '50px',
|
||||||
|
padding: '0.15rem 0.35rem',
|
||||||
|
background: 'var(--surface-secondary)',
|
||||||
|
border: '1px solid var(--border-color, #333)',
|
||||||
|
borderRadius: '4px',
|
||||||
|
color: 'inherit',
|
||||||
|
fontSize: 'inherit',
|
||||||
|
fontFamily: 'inherit',
|
||||||
|
textAlign: 'center'
|
||||||
|
}}
|
||||||
|
/>
|
||||||
|
MB used )
|
||||||
|
</span>
|
||||||
|
<FontAwesomeIcon
|
||||||
|
icon={faTrash}
|
||||||
|
onClick={handleClearCache}
|
||||||
|
title="Clear cache"
|
||||||
|
style={{ cursor: 'pointer', fontSize: '0.85rem', opacity: 0.7 }}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{/* PWA Install Section - Paragraphs */}
|
||||||
|
<div className="setting-group">
|
||||||
|
<p className="setting-description" style={{ marginTop: '0.5rem', marginBottom: '0.75rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
<strong>Note:</strong> Boris works best with a local relay. Consider running{' '}
|
||||||
|
<a
|
||||||
|
href="https://github.com/greenart7c3/Citrine?tab=readme-ov-file#download"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)' }}
|
||||||
|
>
|
||||||
|
Citrine
|
||||||
|
</a>
|
||||||
|
{' or '}
|
||||||
|
<a
|
||||||
|
href="https://github.com/CodyTseng/nostr-relay-tray/releases"
|
||||||
|
target="_blank"
|
||||||
|
rel="noopener noreferrer"
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)' }}
|
||||||
|
>
|
||||||
|
nostr-relay-tray
|
||||||
|
</a>
|
||||||
|
{' '}to bring full offline functionality to Boris. Don't know what relays are? Learn more{' '}
|
||||||
|
<a
|
||||||
|
onClick={(e) => {
|
||||||
|
e.preventDefault()
|
||||||
|
handleLinkClick('https://nostr.how/en/relays')
|
||||||
|
}}
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
||||||
|
>
|
||||||
|
here
|
||||||
|
</a>
|
||||||
|
{' and '}
|
||||||
|
<a
|
||||||
|
onClick={(e) => {
|
||||||
|
e.preventDefault()
|
||||||
|
handleLinkClick('https://davidebtc186.substack.com/p/the-importance-of-hosting-your-own')
|
||||||
|
}}
|
||||||
|
style={{ color: 'var(--accent, #8b5cf6)', cursor: 'pointer' }}
|
||||||
|
>
|
||||||
|
here
|
||||||
|
</a>
|
||||||
|
.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<label htmlFor="useLocalRelayAsCache" className="checkbox-label">
|
||||||
|
<input
|
||||||
|
id="useLocalRelayAsCache"
|
||||||
|
type="checkbox"
|
||||||
|
checked={settings.useLocalRelayAsCache ?? true}
|
||||||
|
onChange={(e) => onUpdate({ useLocalRelayAsCache: e.target.checked })}
|
||||||
|
className="setting-checkbox"
|
||||||
|
/>
|
||||||
|
<span>Use local relays as cache</span>
|
||||||
|
</label>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group">
|
||||||
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Install Boris on your device for a native app experience.
|
||||||
|
</p>
|
||||||
|
<button
|
||||||
|
onClick={handleInstall}
|
||||||
|
className="zap-preset-btn"
|
||||||
|
style={{ display: 'flex', alignItems: 'center', gap: '0.5rem' }}
|
||||||
|
disabled={isInstalled || !isInstallable}
|
||||||
|
>
|
||||||
|
<FontAwesomeIcon icon={isInstalled ? faCheckCircle : faDownload} />
|
||||||
|
{isInstalled ? 'Installed' : 'Install App'}
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<p className="setting-description">
|
|
||||||
Install Boris on your device for a native app experience with offline support.
|
{!isMobile && (
|
||||||
</p>
|
<img
|
||||||
<button
|
src="/pwa.svg"
|
||||||
onClick={handleInstall}
|
alt="Progressive Web App"
|
||||||
className="install-button"
|
style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
|
||||||
style={{
|
/>
|
||||||
marginTop: '12px',
|
)}
|
||||||
padding: '8px 16px',
|
|
||||||
background: 'linear-gradient(135deg, #3b82f6 0%, #1e40af 100%)',
|
|
||||||
color: 'white',
|
|
||||||
border: 'none',
|
|
||||||
borderRadius: '8px',
|
|
||||||
cursor: 'pointer',
|
|
||||||
display: 'flex',
|
|
||||||
alignItems: 'center',
|
|
||||||
gap: '8px',
|
|
||||||
fontSize: '14px',
|
|
||||||
fontWeight: '500',
|
|
||||||
transition: 'transform 0.2s, box-shadow 0.2s',
|
|
||||||
}}
|
|
||||||
onMouseEnter={(e) => {
|
|
||||||
e.currentTarget.style.transform = 'translateY(-2px)'
|
|
||||||
e.currentTarget.style.boxShadow = '0 4px 12px rgba(59, 130, 246, 0.3)'
|
|
||||||
}}
|
|
||||||
onMouseLeave={(e) => {
|
|
||||||
e.currentTarget.style.transform = 'translateY(0)'
|
|
||||||
e.currentTarget.style.boxShadow = 'none'
|
|
||||||
}}
|
|
||||||
>
|
|
||||||
<FontAwesomeIcon icon={faDownload} />
|
|
||||||
Install App
|
|
||||||
</button>
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -1,5 +1,5 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser } from '@fortawesome/free-solid-svg-icons'
|
import { faHighlighter, faUnderline, faNetworkWired, faUserGroup, faUser, faAlignLeft, faAlignJustify } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
import IconButton from '../IconButton'
|
import IconButton from '../IconButton'
|
||||||
import ColorPicker from '../ColorPicker'
|
import ColorPicker from '../ColorPicker'
|
||||||
@@ -19,35 +19,6 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Reading & Display</h3>
|
<h3 className="section-title">Reading & Display</h3>
|
||||||
|
|
||||||
<div style={{ display: 'flex', gap: '1rem', flexWrap: 'wrap' }}>
|
|
||||||
<div className="setting-group setting-inline" style={{ flex: '1 1 auto', minWidth: '200px' }}>
|
|
||||||
<label htmlFor="readingFont">Reading Font</label>
|
|
||||||
<div className="setting-control">
|
|
||||||
<FontSelector
|
|
||||||
value={settings.readingFont || 'source-serif-4'}
|
|
||||||
onChange={(font) => onUpdate({ readingFont: font })}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline" style={{ flex: '0 1 auto' }}>
|
|
||||||
<label>Font Size</label>
|
|
||||||
<div className="setting-buttons">
|
|
||||||
{[16, 18, 21, 24, 28, 32].map(size => (
|
|
||||||
<button
|
|
||||||
key={size}
|
|
||||||
onClick={() => onUpdate({ fontSize: size })}
|
|
||||||
className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
|
|
||||||
title={`${size}px`}
|
|
||||||
style={{ fontSize: `${size - 2}px` }}
|
|
||||||
>
|
|
||||||
A
|
|
||||||
</button>
|
|
||||||
))}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label>Highlight Style</label>
|
<label>Highlight Style</label>
|
||||||
<div className="setting-buttons">
|
<div className="setting-buttons">
|
||||||
@@ -69,31 +40,21 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
<div className="setting-group setting-inline">
|
||||||
<label className="setting-label">My Highlights</label>
|
<label>Paragraph Alignment</label>
|
||||||
<div className="setting-control">
|
<div className="setting-buttons">
|
||||||
<ColorPicker
|
<IconButton
|
||||||
selectedColor={settings.highlightColorMine || '#fde047'}
|
icon={faAlignLeft}
|
||||||
onColorChange={(color) => onUpdate({ highlightColorMine: color })}
|
onClick={() => onUpdate({ paragraphAlignment: 'left' })}
|
||||||
|
title="Left aligned"
|
||||||
|
ariaLabel="Left aligned"
|
||||||
|
variant={settings.paragraphAlignment === 'left' ? 'primary' : 'ghost'}
|
||||||
/>
|
/>
|
||||||
</div>
|
<IconButton
|
||||||
</div>
|
icon={faAlignJustify}
|
||||||
|
onClick={() => onUpdate({ paragraphAlignment: 'justify' })}
|
||||||
<div className="setting-group setting-inline">
|
title="Justified"
|
||||||
<label className="setting-label">Friends Highlights</label>
|
ariaLabel="Justified"
|
||||||
<div className="setting-control">
|
variant={(settings.paragraphAlignment || 'justify') === 'justify' ? 'primary' : 'ghost'}
|
||||||
<ColorPicker
|
|
||||||
selectedColor={settings.highlightColorFriends || '#f97316'}
|
|
||||||
onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group setting-inline">
|
|
||||||
<label className="setting-label">Nostrverse Highlights</label>
|
|
||||||
<div className="setting-control">
|
|
||||||
<ColorPicker
|
|
||||||
selectedColor={settings.highlightColorNostrverse || '#9333ea'}
|
|
||||||
onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
|
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
@@ -137,6 +98,65 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label htmlFor="readingFont">Reading Font</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<FontSelector
|
||||||
|
value={settings.readingFont || 'source-serif-4'}
|
||||||
|
onChange={(font) => onUpdate({ readingFont: font })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Font Size</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<div className="setting-buttons">
|
||||||
|
{[16, 18, 21, 24, 28, 32].map(size => (
|
||||||
|
<button
|
||||||
|
key={size}
|
||||||
|
onClick={() => onUpdate({ fontSize: size })}
|
||||||
|
className={`font-size-btn ${(settings.fontSize || 21) === size ? 'active' : ''}`}
|
||||||
|
title={`${size}px`}
|
||||||
|
style={{ fontSize: `${size - 2}px` }}
|
||||||
|
>
|
||||||
|
A
|
||||||
|
</button>
|
||||||
|
))}
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">My Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorMine || '#fde047'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorMine: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Friends Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorFriends || '#f97316'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorFriends: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div className="setting-group setting-inline">
|
||||||
|
<label className="setting-label">Nostrverse Highlights</label>
|
||||||
|
<div className="setting-control">
|
||||||
|
<ColorPicker
|
||||||
|
selectedColor={settings.highlightColorNostrverse || '#9333ea'}
|
||||||
|
onColorChange={(color) => onUpdate({ highlightColorNostrverse: color })}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
<div className="setting-group">
|
<div className="setting-group">
|
||||||
<label htmlFor="showHighlights" className="checkbox-label">
|
<label htmlFor="showHighlights" className="checkbox-label">
|
||||||
<input
|
<input
|
||||||
@@ -157,7 +177,8 @@ const ReadingDisplaySettings: React.FC<ReadingDisplaySettingsProps> = ({ setting
|
|||||||
style={{
|
style={{
|
||||||
fontFamily: previewFontFamily,
|
fontFamily: previewFontFamily,
|
||||||
fontSize: `${settings.fontSize || 21}px`,
|
fontSize: `${settings.fontSize || 21}px`,
|
||||||
'--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00')
|
'--highlight-rgb': hexToRgb(settings.highlightColor || '#ffff00'),
|
||||||
|
'--paragraph-alignment': settings.paragraphAlignment || 'justify'
|
||||||
} as React.CSSProperties}
|
} as React.CSSProperties}
|
||||||
>
|
>
|
||||||
<h3>The Quick Brown Fox</h3>
|
<h3>The Quick Brown Fox</h3>
|
||||||
|
|||||||
@@ -1,70 +0,0 @@
|
|||||||
import React from 'react'
|
|
||||||
import { UserSettings } from '../../services/settingsService'
|
|
||||||
|
|
||||||
interface StartupPreferencesSettingsProps {
|
|
||||||
settings: UserSettings
|
|
||||||
onUpdate: (updates: Partial<UserSettings>) => void
|
|
||||||
}
|
|
||||||
|
|
||||||
const StartupPreferencesSettings: React.FC<StartupPreferencesSettingsProps> = ({ settings, onUpdate }) => {
|
|
||||||
return (
|
|
||||||
<div className="settings-section">
|
|
||||||
<h3 className="section-title">Startup & Behavior</h3>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="sidebarCollapsed" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="sidebarCollapsed"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.sidebarCollapsed !== false}
|
|
||||||
onChange={(e) => onUpdate({ sidebarCollapsed: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Start with bookmarks sidebar collapsed</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="highlightsCollapsed" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="highlightsCollapsed"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.highlightsCollapsed !== false}
|
|
||||||
onChange={(e) => onUpdate({ highlightsCollapsed: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Start with highlights panel collapsed</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="rebroadcastToAllRelays" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="rebroadcastToAllRelays"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.rebroadcastToAllRelays ?? false}
|
|
||||||
onChange={(e) => onUpdate({ rebroadcastToAllRelays: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Rebroadcast events while browsing</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
|
||||||
<label htmlFor="autoCollapseSidebarOnMobile" className="checkbox-label">
|
|
||||||
<input
|
|
||||||
id="autoCollapseSidebarOnMobile"
|
|
||||||
type="checkbox"
|
|
||||||
checked={settings.autoCollapseSidebarOnMobile !== false}
|
|
||||||
onChange={(e) => onUpdate({ autoCollapseSidebarOnMobile: e.target.checked })}
|
|
||||||
className="setting-checkbox"
|
|
||||||
/>
|
|
||||||
<span>Auto-collapse sidebar on small screens</span>
|
|
||||||
</label>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
export default StartupPreferencesSettings
|
|
||||||
|
|
||||||
@@ -1,5 +1,6 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { UserSettings } from '../../services/settingsService'
|
import { UserSettings } from '../../services/settingsService'
|
||||||
|
import { useIsMobile } from '../../hooks/useMediaQuery'
|
||||||
|
|
||||||
interface ZapSettingsProps {
|
interface ZapSettingsProps {
|
||||||
settings: UserSettings
|
settings: UserSettings
|
||||||
@@ -7,6 +8,7 @@ interface ZapSettingsProps {
|
|||||||
}
|
}
|
||||||
|
|
||||||
const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
||||||
|
const isMobile = useIsMobile()
|
||||||
const highlighterWeight = settings.zapSplitHighlighterWeight ?? 50
|
const highlighterWeight = settings.zapSplitHighlighterWeight ?? 50
|
||||||
const borisWeight = settings.zapSplitBorisWeight ?? 2.1
|
const borisWeight = settings.zapSplitBorisWeight ?? 2.1
|
||||||
const authorWeight = settings.zapSplitAuthorWeight ?? 50
|
const authorWeight = settings.zapSplitAuthorWeight ?? 50
|
||||||
@@ -42,98 +44,119 @@ const ZapSettings: React.FC<ZapSettingsProps> = ({ settings, onUpdate }) => {
|
|||||||
<div className="settings-section">
|
<div className="settings-section">
|
||||||
<h3 className="section-title">Zap Splits</h3>
|
<h3 className="section-title">Zap Splits</h3>
|
||||||
|
|
||||||
<div className="setting-group">
|
<div style={{ display: 'flex', gap: '2rem', alignItems: 'stretch' }}>
|
||||||
<label className="setting-label">Presets</label>
|
<div style={{ flex: 1, display: 'flex', flexDirection: 'column', gap: '0.25rem' }}>
|
||||||
<div className="zap-preset-buttons">
|
<div className="setting-group">
|
||||||
<button
|
<label className="setting-label">Presets</label>
|
||||||
onClick={() => applyPreset(presets.default)}
|
<div className="zap-preset-buttons">
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 49%, Author: 49%, Boris: 2%"
|
onClick={() => applyPreset(presets.default)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.default) ? 'active' : ''}`}
|
||||||
Default
|
title="You: 49%, Author: 49%, Boris: 2%"
|
||||||
</button>
|
>
|
||||||
<button
|
Default
|
||||||
onClick={() => applyPreset(presets.generous)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 6%, Author: 83%, Boris: 11%"
|
onClick={() => applyPreset(presets.generous)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.generous) ? 'active' : ''}`}
|
||||||
Generous
|
title="You: 6%, Author: 83%, Boris: 11%"
|
||||||
</button>
|
>
|
||||||
<button
|
Generous
|
||||||
onClick={() => applyPreset(presets.selfless)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 1%, Author: 80%, Boris: 19%"
|
onClick={() => applyPreset(presets.selfless)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.selfless) ? 'active' : ''}`}
|
||||||
Selfless
|
title="You: 1%, Author: 80%, Boris: 19%"
|
||||||
</button>
|
>
|
||||||
<button
|
Selfless
|
||||||
onClick={() => applyPreset(presets.boris)}
|
</button>
|
||||||
className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
|
<button
|
||||||
title="You: 10%, Author: 10%, Boris: 80%"
|
onClick={() => applyPreset(presets.boris)}
|
||||||
>
|
className={`zap-preset-btn ${isPresetActive(presets.boris) ? 'active' : ''}`}
|
||||||
Boris 🧡
|
title="You: 10%, Author: 10%, Boris: 80%"
|
||||||
</button>
|
>
|
||||||
</div>
|
Boris 🧡
|
||||||
</div>
|
</button>
|
||||||
|
</div>
|
||||||
<div className="setting-group">
|
|
||||||
<label className="setting-label">Your Share</label>
|
|
||||||
<div className="zap-split-container">
|
|
||||||
<div className="zap-split-labels">
|
|
||||||
<span className="zap-split-label">Weight: {highlighterWeight}</span>
|
|
||||||
<span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
|
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
<div className="setting-group">
|
||||||
min="0"
|
<div className="zap-split-container">
|
||||||
max="100"
|
<div className="zap-split-labels">
|
||||||
value={highlighterWeight}
|
<span className="zap-split-label">Your Share: {highlighterWeight}</span>
|
||||||
onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
|
<span className="zap-split-label">({highlighterPercentage.toFixed(1)}%)</span>
|
||||||
className="zap-split-slider"
|
</div>
|
||||||
/>
|
<input
|
||||||
</div>
|
type="range"
|
||||||
</div>
|
min="0"
|
||||||
|
max="100"
|
||||||
<div className="setting-group">
|
value={highlighterWeight}
|
||||||
<label className="setting-label">Author(s) Share</label>
|
onChange={(e) => onUpdate({ zapSplitHighlighterWeight: parseInt(e.target.value) })}
|
||||||
<div className="zap-split-container">
|
className="zap-split-slider"
|
||||||
<div className="zap-split-labels">
|
list="highlighter-ticks"
|
||||||
<span className="zap-split-label">Weight: {authorWeight}</span>
|
/>
|
||||||
<span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
|
<datalist id="highlighter-ticks">
|
||||||
|
<option value="50" label="50%"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
|
||||||
min="0"
|
|
||||||
max="100"
|
|
||||||
value={authorWeight}
|
|
||||||
onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
|
|
||||||
className="zap-split-slider"
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="setting-group">
|
<div className="setting-group">
|
||||||
<label className="setting-label">Support Boris</label>
|
<div className="zap-split-container">
|
||||||
<div className="zap-split-container">
|
<div className="zap-split-labels">
|
||||||
<div className="zap-split-labels">
|
<span className="zap-split-label">Author's Share: {authorWeight}</span>
|
||||||
<span className="zap-split-label">Weight: {borisWeight.toFixed(1)}</span>
|
<span className="zap-split-label">({authorPercentage.toFixed(1)}%)</span>
|
||||||
<span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
|
</div>
|
||||||
|
<input
|
||||||
|
type="range"
|
||||||
|
min="0"
|
||||||
|
max="100"
|
||||||
|
value={authorWeight}
|
||||||
|
onChange={(e) => onUpdate({ zapSplitAuthorWeight: parseInt(e.target.value) })}
|
||||||
|
className="zap-split-slider"
|
||||||
|
list="author-ticks"
|
||||||
|
/>
|
||||||
|
<datalist id="author-ticks">
|
||||||
|
<option value="50" label="50%"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<input
|
|
||||||
type="range"
|
|
||||||
min="0"
|
|
||||||
max="10"
|
|
||||||
step="0.1"
|
|
||||||
value={borisWeight}
|
|
||||||
onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
|
|
||||||
className="zap-split-slider"
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
|
|
||||||
<div className="zap-split-description">
|
<div className="setting-group">
|
||||||
Weights determine zap splits when highlighting nostr-native content.
|
<div className="zap-split-container">
|
||||||
If the content has multiple authors, their share is divided proportionally.
|
<div className="zap-split-labels">
|
||||||
|
<span className="zap-split-label">Boris' Share: {borisWeight.toFixed(1)}</span>
|
||||||
|
<span className="zap-split-label">({borisPercentage.toFixed(1)}%)</span>
|
||||||
|
</div>
|
||||||
|
<input
|
||||||
|
type="range"
|
||||||
|
min="0"
|
||||||
|
max="10"
|
||||||
|
step="0.1"
|
||||||
|
value={borisWeight}
|
||||||
|
onChange={(e) => onUpdate({ zapSplitBorisWeight: parseFloat(e.target.value) })}
|
||||||
|
className="zap-split-slider"
|
||||||
|
list="boris-ticks"
|
||||||
|
/>
|
||||||
|
<datalist id="boris-ticks">
|
||||||
|
<option value="5" label="5"></option>
|
||||||
|
</datalist>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<p className="setting-description" style={{ marginBottom: '1rem', color: 'var(--color-text-secondary)', fontSize: '0.875rem' }}>
|
||||||
|
Weights determine zap splits when highlighting nostr-native content.
|
||||||
|
If the content has multiple authors, their share is divided proportionally.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
{!isMobile && (
|
||||||
|
<img
|
||||||
|
src="/zaps.svg"
|
||||||
|
alt="Zap Splits"
|
||||||
|
style={{ width: '30%', height: 'auto', flexShrink: 0, opacity: 0.8 }}
|
||||||
|
/>
|
||||||
|
)}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
|
|||||||
@@ -1,28 +1,22 @@
|
|||||||
import React, { useState } from 'react'
|
import React, { useState } from 'react'
|
||||||
import { useNavigate } from 'react-router-dom'
|
import { useNavigate } from 'react-router-dom'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faPlus, faNewspaper, faTimes, faBolt } from '@fortawesome/free-solid-svg-icons'
|
import { faChevronRight, faRightFromBracket, faRightToBracket, faUserCircle, faGear, faHome, faNewspaper, faTimes } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { Hooks } from 'applesauce-react'
|
import { Hooks } from 'applesauce-react'
|
||||||
import { useEventModel } from 'applesauce-react/hooks'
|
import { useEventModel } from 'applesauce-react/hooks'
|
||||||
import { Models } from 'applesauce-core'
|
import { Models } from 'applesauce-core'
|
||||||
import { Accounts } from 'applesauce-accounts'
|
import { Accounts } from 'applesauce-accounts'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
|
||||||
import IconButton from './IconButton'
|
import IconButton from './IconButton'
|
||||||
import AddBookmarkModal from './AddBookmarkModal'
|
|
||||||
import { createWebBookmark } from '../services/webBookmarkService'
|
|
||||||
import { RELAYS } from '../config/relays'
|
|
||||||
|
|
||||||
interface SidebarHeaderProps {
|
interface SidebarHeaderProps {
|
||||||
onToggleCollapse: () => void
|
onToggleCollapse: () => void
|
||||||
onLogout: () => void
|
onLogout: () => void
|
||||||
onOpenSettings: () => void
|
onOpenSettings: () => void
|
||||||
relayPool: RelayPool | null
|
|
||||||
isMobile?: boolean
|
isMobile?: boolean
|
||||||
}
|
}
|
||||||
|
|
||||||
const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, relayPool, isMobile = false }) => {
|
const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogout, onOpenSettings, isMobile = false }) => {
|
||||||
const [isConnecting, setIsConnecting] = useState(false)
|
const [isConnecting, setIsConnecting] = useState(false)
|
||||||
const [showAddModal, setShowAddModal] = useState(false)
|
|
||||||
const navigate = useNavigate()
|
const navigate = useNavigate()
|
||||||
const activeAccount = Hooks.useActiveAccount()
|
const activeAccount = Hooks.useActiveAccount()
|
||||||
const accountManager = Hooks.useAccountManager()
|
const accountManager = Hooks.useAccountManager()
|
||||||
@@ -54,14 +48,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
return `${activeAccount.pubkey.slice(0, 8)}...${activeAccount.pubkey.slice(-8)}`
|
return `${activeAccount.pubkey.slice(0, 8)}...${activeAccount.pubkey.slice(-8)}`
|
||||||
}
|
}
|
||||||
|
|
||||||
const handleSaveBookmark = async (url: string, title?: string, description?: string, tags?: string[]) => {
|
|
||||||
if (!activeAccount || !relayPool) {
|
|
||||||
throw new Error('Please login to create bookmarks')
|
|
||||||
}
|
|
||||||
|
|
||||||
await createWebBookmark(url, title, description, tags, activeAccount, relayPool, RELAYS)
|
|
||||||
}
|
|
||||||
|
|
||||||
const profileImage = getProfileImage()
|
const profileImage = getProfileImage()
|
||||||
|
|
||||||
return (
|
return (
|
||||||
@@ -117,13 +103,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
ariaLabel="Explore"
|
ariaLabel="Explore"
|
||||||
variant="ghost"
|
variant="ghost"
|
||||||
/>
|
/>
|
||||||
<IconButton
|
|
||||||
icon={faBolt}
|
|
||||||
onClick={() => navigate('/support')}
|
|
||||||
title="Support"
|
|
||||||
ariaLabel="Support"
|
|
||||||
variant="ghost"
|
|
||||||
/>
|
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faGear}
|
icon={faGear}
|
||||||
onClick={onOpenSettings}
|
onClick={onOpenSettings}
|
||||||
@@ -131,15 +110,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
ariaLabel="Settings"
|
ariaLabel="Settings"
|
||||||
variant="ghost"
|
variant="ghost"
|
||||||
/>
|
/>
|
||||||
{activeAccount && (
|
|
||||||
<IconButton
|
|
||||||
icon={faPlus}
|
|
||||||
onClick={() => setShowAddModal(true)}
|
|
||||||
title="Add bookmark"
|
|
||||||
ariaLabel="Add bookmark"
|
|
||||||
variant="ghost"
|
|
||||||
/>
|
|
||||||
)}
|
|
||||||
{activeAccount ? (
|
{activeAccount ? (
|
||||||
<IconButton
|
<IconButton
|
||||||
icon={faRightFromBracket}
|
icon={faRightFromBracket}
|
||||||
@@ -159,12 +129,6 @@ const SidebarHeader: React.FC<SidebarHeaderProps> = ({ onToggleCollapse, onLogou
|
|||||||
)}
|
)}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
{showAddModal && (
|
|
||||||
<AddBookmarkModal
|
|
||||||
onClose={() => setShowAddModal(false)}
|
|
||||||
onSave={handleSaveBookmark}
|
|
||||||
/>
|
|
||||||
)}
|
|
||||||
</>
|
</>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -2,7 +2,7 @@ import React, { useEffect, useState } from 'react'
|
|||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
import { IEventStore } from 'applesauce-core'
|
import { IEventStore } from 'applesauce-core'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBolt, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
|
import { faHeart, faSpinner, faUserCircle } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
|
import { fetchBorisZappers, ZapSender } from '../services/zapReceiptService'
|
||||||
import { fetchProfiles } from '../services/profileService'
|
import { fetchProfiles } from '../services/profileService'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
@@ -207,7 +207,7 @@ const SupporterCard: React.FC<SupporterCardProps> = ({ supporter, isWhale }) =>
|
|||||||
className="absolute -bottom-1 -right-1 w-8 h-8 bg-yellow-400 rounded-full flex items-center justify-center border-2"
|
className="absolute -bottom-1 -right-1 w-8 h-8 bg-yellow-400 rounded-full flex items-center justify-center border-2"
|
||||||
style={{ borderColor: 'var(--color-bg)' }}
|
style={{ borderColor: 'var(--color-bg)' }}
|
||||||
>
|
>
|
||||||
<FontAwesomeIcon icon={faBolt} className="text-zinc-900 text-sm" />
|
<FontAwesomeIcon icon={faHeart} className="text-zinc-900 text-sm" />
|
||||||
</div>
|
</div>
|
||||||
)}
|
)}
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
import React, { useEffect, useRef } from 'react'
|
import React, { useEffect, useRef, useState } from 'react'
|
||||||
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'
|
||||||
import { faBookmark, faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
import { faBookmark, faHighlighter } from '@fortawesome/free-solid-svg-icons'
|
||||||
import { RelayPool } from 'applesauce-relay'
|
import { RelayPool } from 'applesauce-relay'
|
||||||
@@ -105,13 +105,33 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
const highlightsRef = useRef<HTMLDivElement>(null)
|
const highlightsRef = useRef<HTMLDivElement>(null)
|
||||||
const mainPaneRef = useRef<HTMLDivElement>(null)
|
const mainPaneRef = useRef<HTMLDivElement>(null)
|
||||||
|
|
||||||
// Detect scroll direction to hide/show mobile buttons
|
// Detect scroll direction and position to hide/show mobile buttons
|
||||||
// Now using window scroll (document scroll) instead of pane scroll
|
// Only hide on scroll down when viewing article content
|
||||||
|
const isViewingArticle = !!(props.selectedUrl)
|
||||||
const scrollDirection = useScrollDirection({
|
const scrollDirection = useScrollDirection({
|
||||||
threshold: 10,
|
threshold: 10,
|
||||||
enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed
|
enabled: isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && isViewingArticle
|
||||||
})
|
})
|
||||||
const showMobileButtons = scrollDirection !== 'down'
|
|
||||||
|
// Track if we're at the top of the page
|
||||||
|
const [isAtTop, setIsAtTop] = useState(true)
|
||||||
|
useEffect(() => {
|
||||||
|
if (!isMobile || !isViewingArticle) return
|
||||||
|
|
||||||
|
const handleScroll = () => {
|
||||||
|
setIsAtTop(window.scrollY <= 10)
|
||||||
|
}
|
||||||
|
|
||||||
|
handleScroll() // Check initial position
|
||||||
|
window.addEventListener('scroll', handleScroll, { passive: true })
|
||||||
|
|
||||||
|
return () => window.removeEventListener('scroll', handleScroll)
|
||||||
|
}, [isMobile, isViewingArticle])
|
||||||
|
|
||||||
|
// Bookmark button: hide only when scrolling down
|
||||||
|
const showBookmarkButton = scrollDirection !== 'down'
|
||||||
|
// Highlights button: hide when scrolling down OR at the top
|
||||||
|
const showHighlightsButton = scrollDirection !== 'down' && !isAtTop
|
||||||
|
|
||||||
// Lock body scroll when mobile sidebar or highlights is open
|
// Lock body scroll when mobile sidebar or highlights is open
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -229,11 +249,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
|
|
||||||
return (
|
return (
|
||||||
<>
|
<>
|
||||||
{/* Mobile bookmark button - only show when viewing article or explore (not on settings/me/profile/support) */}
|
{/* Mobile bookmark button - always show except on settings page */}
|
||||||
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showMe && !props.showProfile && !props.showSupport && (
|
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && (
|
||||||
<button
|
<button
|
||||||
className={`fixed z-[900] bg-zinc-800/70 border border-zinc-600/40 rounded-lg text-zinc-200 flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
className={`fixed z-[900] bg-zinc-800/70 border border-zinc-600/40 rounded-lg text-zinc-200 flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
||||||
showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
showBookmarkButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
||||||
}`}
|
}`}
|
||||||
style={{
|
style={{
|
||||||
top: 'calc(1rem + env(safe-area-inset-top))',
|
top: 'calc(1rem + env(safe-area-inset-top))',
|
||||||
@@ -249,11 +269,11 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
</button>
|
</button>
|
||||||
)}
|
)}
|
||||||
|
|
||||||
{/* Mobile highlights button - only show when viewing article or explore (not on settings/me/profile/support) */}
|
{/* Mobile highlights button - only show when viewing article content */}
|
||||||
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && !props.showMe && !props.showProfile && !props.showSupport && (
|
{isMobile && !props.isSidebarOpen && props.isHighlightsCollapsed && !props.showSettings && isViewingArticle && (
|
||||||
<button
|
<button
|
||||||
className={`fixed z-[900] border border-zinc-600/40 rounded-lg flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
className={`fixed z-[900] border border-zinc-600/40 rounded-lg flex items-center justify-center transition-all duration-300 active:scale-95 backdrop-blur-sm md:hidden ${
|
||||||
showMobileButtons ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
showHighlightsButton ? 'opacity-90 visible' : 'opacity-0 invisible pointer-events-none'
|
||||||
}`}
|
}`}
|
||||||
style={{
|
style={{
|
||||||
top: 'calc(1rem + env(safe-area-inset-top))',
|
top: 'calc(1rem + env(safe-area-inset-top))',
|
||||||
@@ -304,6 +324,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
loading={props.bookmarksLoading}
|
loading={props.bookmarksLoading}
|
||||||
relayPool={props.relayPool}
|
relayPool={props.relayPool}
|
||||||
isMobile={isMobile}
|
isMobile={isMobile}
|
||||||
|
settings={props.settings}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
<div
|
<div
|
||||||
@@ -402,7 +423,7 @@ const ThreePaneLayout: React.FC<ThreePaneLayoutProps> = (props) => {
|
|||||||
)}
|
)}
|
||||||
<RelayStatusIndicator
|
<RelayStatusIndicator
|
||||||
relayPool={props.relayPool}
|
relayPool={props.relayPool}
|
||||||
showOnMobile={showMobileButtons}
|
showOnMobile={showBookmarkButton}
|
||||||
/>
|
/>
|
||||||
{props.toastMessage && (
|
{props.toastMessage && (
|
||||||
<Toast
|
<Toast
|
||||||
|
|||||||
32
src/components/VersionFooter.tsx
Normal file
32
src/components/VersionFooter.tsx
Normal file
@@ -0,0 +1,32 @@
|
|||||||
|
/* global __APP_VERSION__, __GIT_COMMIT__, __GIT_COMMIT_URL__, __RELEASE_URL__ */
|
||||||
|
import React from 'react'
|
||||||
|
|
||||||
|
const VersionFooter: React.FC = () => {
|
||||||
|
return (
|
||||||
|
<div className="text-xs opacity-60 mt-4 px-4 pb-3 select-text">
|
||||||
|
<span>
|
||||||
|
{typeof __RELEASE_URL__ !== 'undefined' && __RELEASE_URL__ ? (
|
||||||
|
<a href={__RELEASE_URL__} target="_blank" rel="noopener noreferrer">
|
||||||
|
Version {typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}
|
||||||
|
</a>
|
||||||
|
) : (
|
||||||
|
`Version ${typeof __APP_VERSION__ !== 'undefined' ? __APP_VERSION__ : 'dev'}`
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
{typeof __GIT_COMMIT__ !== 'undefined' && __GIT_COMMIT__ ? (
|
||||||
|
<span>
|
||||||
|
{' '}·{' '}
|
||||||
|
{typeof __GIT_COMMIT_URL__ !== 'undefined' && __GIT_COMMIT_URL__ ? (
|
||||||
|
<a href={__GIT_COMMIT_URL__} target="_blank" rel="noopener noreferrer">
|
||||||
|
<code>{__GIT_COMMIT__.slice(0, 7)}</code>
|
||||||
|
</a>
|
||||||
|
) : (
|
||||||
|
<code>{__GIT_COMMIT__.slice(0, 7)}</code>
|
||||||
|
)}
|
||||||
|
</span>
|
||||||
|
) : null}
|
||||||
|
</div>
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
export default VersionFooter
|
||||||
15
src/config/kinds.ts
Normal file
15
src/config/kinds.ts
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
// Nostr event kinds used throughout the application
|
||||||
|
export const KINDS = {
|
||||||
|
Highlights: 9802, // NIP-?? user highlights
|
||||||
|
BlogPost: 30023, // NIP-23 long-form article
|
||||||
|
AppData: 30078, // NIP-78 application data (reading positions)
|
||||||
|
List: 30001, // NIP-51 list (addressable)
|
||||||
|
ListReplaceable: 30003, // NIP-51 replaceable list
|
||||||
|
ListSimple: 10003, // NIP-51 simple list
|
||||||
|
WebBookmark: 39701, // NIP-B0 web bookmark
|
||||||
|
ReactionToEvent: 7, // emoji reaction to event (used for mark-as-read)
|
||||||
|
ReactionToUrl: 17 // emoji reaction to URL (used for mark-as-read)
|
||||||
|
} as const
|
||||||
|
|
||||||
|
export type KindValue = typeof KINDS[keyof typeof KINDS]
|
||||||
|
|
||||||
@@ -2,20 +2,21 @@
|
|||||||
* Nostr gateway URLs for viewing events and profiles on the web
|
* Nostr gateway URLs for viewing events and profiles on the web
|
||||||
*/
|
*/
|
||||||
|
|
||||||
export const NOSTR_GATEWAY = 'https://ants.sh' as const
|
export const NOSTR_GATEWAY = 'https://nostr.at' as const
|
||||||
|
export const SEARCH_PORTAL = 'https://ants.sh' as const
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get a profile URL on the gateway
|
* Get a profile URL on the gateway
|
||||||
*/
|
*/
|
||||||
export function getProfileUrl(npub: string): string {
|
export function getProfileUrl(npub: string): string {
|
||||||
return `${NOSTR_GATEWAY}/p/${npub}`
|
return `${NOSTR_GATEWAY}/${npub}`
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get an event URL on the gateway
|
* Get an event URL on the gateway
|
||||||
*/
|
*/
|
||||||
export function getEventUrl(nevent: string): string {
|
export function getEventUrl(nevent: string): string {
|
||||||
return `${NOSTR_GATEWAY}/e/${nevent}`
|
return `${NOSTR_GATEWAY}/${nevent}`
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -23,12 +24,14 @@ export function getEventUrl(nevent: string): string {
|
|||||||
* Automatically detects if it's a profile (npub/nprofile) or event (note/nevent/naddr)
|
* Automatically detects if it's a profile (npub/nprofile) or event (note/nevent/naddr)
|
||||||
*/
|
*/
|
||||||
export function getNostrUrl(identifier: string): string {
|
export function getNostrUrl(identifier: string): string {
|
||||||
// Check the prefix to determine if it's a profile or event
|
// nostr.at uses simple /{identifier} format for all types
|
||||||
if (identifier.startsWith('npub') || identifier.startsWith('nprofile')) {
|
return `${NOSTR_GATEWAY}/${identifier}`
|
||||||
return `${NOSTR_GATEWAY}/p/${identifier}`
|
}
|
||||||
}
|
|
||||||
|
/**
|
||||||
// Everything else (note, nevent, naddr) goes to /e/
|
* Get a search portal URL with a query
|
||||||
return `${NOSTR_GATEWAY}/e/${identifier}`
|
*/
|
||||||
|
export function getSearchUrl(query: string): string {
|
||||||
|
return `${SEARCH_PORTAL}/?q=${encodeURIComponent(query)}`
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -7,6 +7,7 @@
|
|||||||
export const RELAYS = [
|
export const RELAYS = [
|
||||||
'ws://localhost:10547',
|
'ws://localhost:10547',
|
||||||
'ws://localhost:4869',
|
'ws://localhost:4869',
|
||||||
|
'wss://relay.nsec.app',
|
||||||
'wss://relay.damus.io',
|
'wss://relay.damus.io',
|
||||||
'wss://nos.lol',
|
'wss://nos.lol',
|
||||||
'wss://relay.nostr.band',
|
'wss://relay.nostr.band',
|
||||||
|
|||||||
90
src/hooks/useAdaptiveTextColor.ts
Normal file
90
src/hooks/useAdaptiveTextColor.ts
Normal file
@@ -0,0 +1,90 @@
|
|||||||
|
import { useEffect, useState } from 'react'
|
||||||
|
import { FastAverageColor } from 'fast-average-color'
|
||||||
|
|
||||||
|
interface AdaptiveTextColor {
|
||||||
|
textColor: string
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Hook to determine optimal text color based on image background
|
||||||
|
* Samples the top-right corner of the image to ensure publication date is readable
|
||||||
|
*
|
||||||
|
* @param imageUrl - The URL of the image to analyze
|
||||||
|
* @returns Object containing textColor for optimal contrast
|
||||||
|
*/
|
||||||
|
export function useAdaptiveTextColor(imageUrl: string | undefined): AdaptiveTextColor {
|
||||||
|
const [colors, setColors] = useState<AdaptiveTextColor>({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
|
||||||
|
useEffect(() => {
|
||||||
|
if (!imageUrl) {
|
||||||
|
// No image, use default white text
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
const fac = new FastAverageColor()
|
||||||
|
const img = new Image()
|
||||||
|
img.crossOrigin = 'anonymous'
|
||||||
|
|
||||||
|
img.onload = () => {
|
||||||
|
try {
|
||||||
|
const width = img.naturalWidth
|
||||||
|
const height = img.naturalHeight
|
||||||
|
|
||||||
|
// Sample top-right corner (last 25% width, first 25% height)
|
||||||
|
const color = fac.getColor(img, {
|
||||||
|
left: Math.floor(width * 0.75),
|
||||||
|
top: 0,
|
||||||
|
width: Math.floor(width * 0.25),
|
||||||
|
height: Math.floor(height * 0.25)
|
||||||
|
})
|
||||||
|
|
||||||
|
console.log('Adaptive color detected:', {
|
||||||
|
hex: color.hex,
|
||||||
|
rgb: color.rgb,
|
||||||
|
isLight: color.isLight,
|
||||||
|
isDark: color.isDark
|
||||||
|
})
|
||||||
|
|
||||||
|
// Use library's built-in isLight check for optimal contrast
|
||||||
|
if (color.isLight) {
|
||||||
|
console.log('Light background detected, using black text')
|
||||||
|
setColors({
|
||||||
|
textColor: '#000000'
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
console.log('Dark background detected, using white text')
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
// Fallback to default on error
|
||||||
|
console.error('Error analyzing image color:', error)
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
img.onerror = () => {
|
||||||
|
// Fallback to default if image fails to load
|
||||||
|
setColors({
|
||||||
|
textColor: '#ffffff'
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
img.src = imageUrl
|
||||||
|
|
||||||
|
return () => {
|
||||||
|
fac.destroy()
|
||||||
|
}
|
||||||
|
}, [imageUrl])
|
||||||
|
|
||||||
|
return colors
|
||||||
|
}
|
||||||
|
|
||||||
@@ -13,6 +13,7 @@ interface UseBookmarksDataParams {
|
|||||||
activeAccount: IAccount | undefined
|
activeAccount: IAccount | undefined
|
||||||
accountManager: AccountManager
|
accountManager: AccountManager
|
||||||
naddr?: string
|
naddr?: string
|
||||||
|
externalUrl?: string
|
||||||
currentArticleCoordinate?: string
|
currentArticleCoordinate?: string
|
||||||
currentArticleEventId?: string
|
currentArticleEventId?: string
|
||||||
settings?: UserSettings
|
settings?: UserSettings
|
||||||
@@ -23,6 +24,7 @@ export const useBookmarksData = ({
|
|||||||
activeAccount,
|
activeAccount,
|
||||||
accountManager,
|
accountManager,
|
||||||
naddr,
|
naddr,
|
||||||
|
externalUrl,
|
||||||
currentArticleCoordinate,
|
currentArticleCoordinate,
|
||||||
currentArticleEventId,
|
currentArticleEventId,
|
||||||
settings
|
settings
|
||||||
@@ -115,11 +117,13 @@ export const useBookmarksData = ({
|
|||||||
// Fetch highlights/contacts independently to avoid disturbing bookmarks
|
// Fetch highlights/contacts independently to avoid disturbing bookmarks
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
if (!relayPool || !activeAccount) return
|
if (!relayPool || !activeAccount) return
|
||||||
if (!naddr) {
|
// Only fetch general highlights when not viewing an article (naddr) or external URL
|
||||||
|
// External URLs have their highlights fetched by useExternalUrlLoader
|
||||||
|
if (!naddr && !externalUrl) {
|
||||||
handleFetchHighlights()
|
handleFetchHighlights()
|
||||||
}
|
}
|
||||||
handleFetchContacts()
|
handleFetchContacts()
|
||||||
}, [relayPool, activeAccount, naddr, handleFetchHighlights, handleFetchContacts])
|
}, [relayPool, activeAccount, naddr, externalUrl, handleFetchHighlights, handleFetchContacts])
|
||||||
|
|
||||||
return {
|
return {
|
||||||
bookmarks,
|
bookmarks,
|
||||||
|
|||||||
@@ -71,7 +71,7 @@ export function useExternalUrlLoader({
|
|||||||
// Check if fetchHighlightsForUrl exists, otherwise skip
|
// Check if fetchHighlightsForUrl exists, otherwise skip
|
||||||
if (typeof fetchHighlightsForUrl === 'function') {
|
if (typeof fetchHighlightsForUrl === 'function') {
|
||||||
const seen = new Set<string>()
|
const seen = new Set<string>()
|
||||||
const highlightsList = await fetchHighlightsForUrl(
|
await fetchHighlightsForUrl(
|
||||||
relayPool,
|
relayPool,
|
||||||
url,
|
url,
|
||||||
(highlight) => {
|
(highlight) => {
|
||||||
@@ -84,9 +84,9 @@ export function useExternalUrlLoader({
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
// Ensure final list is sorted and contains all items
|
// Highlights are already set via the streaming callback
|
||||||
setHighlights(highlightsList.sort((a, b) => b.created_at - a.created_at))
|
// No need to set them again as that could cause a flash/disappearance
|
||||||
console.log(`📌 Found ${highlightsList.length} highlights for URL`)
|
console.log(`📌 Finished fetching highlights for URL`)
|
||||||
} else {
|
} else {
|
||||||
console.log('📌 Highlight fetching for URLs not yet implemented')
|
console.log('📌 Highlight fetching for URLs not yet implemented')
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -9,6 +9,7 @@ import { ReadableContent } from '../services/readerService'
|
|||||||
import { createHighlight } from '../services/highlightCreationService'
|
import { createHighlight } from '../services/highlightCreationService'
|
||||||
import { HighlightButtonRef } from '../components/HighlightButton'
|
import { HighlightButtonRef } from '../components/HighlightButton'
|
||||||
import { UserSettings } from '../services/settingsService'
|
import { UserSettings } from '../services/settingsService'
|
||||||
|
import { useToast } from './useToast'
|
||||||
|
|
||||||
interface UseHighlightCreationParams {
|
interface UseHighlightCreationParams {
|
||||||
activeAccount: IAccount | undefined
|
activeAccount: IAccount | undefined
|
||||||
@@ -32,6 +33,7 @@ export const useHighlightCreation = ({
|
|||||||
settings
|
settings
|
||||||
}: UseHighlightCreationParams) => {
|
}: UseHighlightCreationParams) => {
|
||||||
const highlightButtonRef = useRef<HighlightButtonRef>(null)
|
const highlightButtonRef = useRef<HighlightButtonRef>(null)
|
||||||
|
const { showToast } = useToast()
|
||||||
|
|
||||||
const handleTextSelection = useCallback((text: string) => {
|
const handleTextSelection = useCallback((text: string) => {
|
||||||
highlightButtonRef.current?.updateSelection(text)
|
highlightButtonRef.current?.updateSelection(text)
|
||||||
@@ -92,10 +94,19 @@ export const useHighlightCreation = ({
|
|||||||
})
|
})
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('❌ Failed to create highlight:', error)
|
console.error('❌ Failed to create highlight:', error)
|
||||||
|
|
||||||
|
// Show user-friendly error messages
|
||||||
|
const errorMessage = error instanceof Error ? error.message : 'Failed to create highlight'
|
||||||
|
if (errorMessage.toLowerCase().includes('permission') || errorMessage.toLowerCase().includes('unauthorized')) {
|
||||||
|
showToast('Reconnect bunker and approve signing permissions to create highlights')
|
||||||
|
} else {
|
||||||
|
showToast(`Failed to create highlight: ${errorMessage}`)
|
||||||
|
}
|
||||||
|
|
||||||
// Re-throw to allow parent to handle
|
// Re-throw to allow parent to handle
|
||||||
throw error
|
throw error
|
||||||
}
|
}
|
||||||
}, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings])
|
}, [activeAccount, relayPool, eventStore, currentArticle, selectedUrl, readerContent, onHighlightCreated, settings, showToast])
|
||||||
|
|
||||||
return {
|
return {
|
||||||
highlightButtonRef,
|
highlightButtonRef,
|
||||||
|
|||||||
@@ -1,21 +1,72 @@
|
|||||||
import { useEffect, useRef, useState } from 'react'
|
import { useEffect, useRef, useState, useCallback } from 'react'
|
||||||
|
|
||||||
interface UseReadingPositionOptions {
|
interface UseReadingPositionOptions {
|
||||||
enabled?: boolean
|
enabled?: boolean
|
||||||
onPositionChange?: (position: number) => void
|
onPositionChange?: (position: number) => void
|
||||||
onReadingComplete?: () => void
|
onReadingComplete?: () => void
|
||||||
readingCompleteThreshold?: number // Default 0.9 (90%)
|
readingCompleteThreshold?: number // Default 0.9 (90%)
|
||||||
|
syncEnabled?: boolean // Whether to sync positions to Nostr
|
||||||
|
onSave?: (position: number) => void // Callback for saving position
|
||||||
|
autoSaveInterval?: number // Auto-save interval in ms (default 5000)
|
||||||
}
|
}
|
||||||
|
|
||||||
export const useReadingPosition = ({
|
export const useReadingPosition = ({
|
||||||
enabled = true,
|
enabled = true,
|
||||||
onPositionChange,
|
onPositionChange,
|
||||||
onReadingComplete,
|
onReadingComplete,
|
||||||
readingCompleteThreshold = 0.9
|
readingCompleteThreshold = 0.9,
|
||||||
|
syncEnabled = false,
|
||||||
|
onSave,
|
||||||
|
autoSaveInterval = 5000
|
||||||
}: UseReadingPositionOptions = {}) => {
|
}: UseReadingPositionOptions = {}) => {
|
||||||
const [position, setPosition] = useState(0)
|
const [position, setPosition] = useState(0)
|
||||||
const [isReadingComplete, setIsReadingComplete] = useState(false)
|
const [isReadingComplete, setIsReadingComplete] = useState(false)
|
||||||
const hasTriggeredComplete = useRef(false)
|
const hasTriggeredComplete = useRef(false)
|
||||||
|
const lastSavedPosition = useRef(0)
|
||||||
|
const saveTimerRef = useRef<ReturnType<typeof setTimeout> | null>(null)
|
||||||
|
|
||||||
|
// Debounced save function
|
||||||
|
const scheduleSave = useCallback((currentPosition: number) => {
|
||||||
|
if (!syncEnabled || !onSave) return
|
||||||
|
|
||||||
|
// Don't save if position is too low (< 5%)
|
||||||
|
if (currentPosition < 0.05) return
|
||||||
|
|
||||||
|
// Don't save if position hasn't changed significantly (less than 1%)
|
||||||
|
// But always save if we've reached 100% (completion)
|
||||||
|
const hasSignificantChange = Math.abs(currentPosition - lastSavedPosition.current) >= 0.01
|
||||||
|
const hasReachedCompletion = currentPosition === 1 && lastSavedPosition.current < 1
|
||||||
|
|
||||||
|
if (!hasSignificantChange && !hasReachedCompletion) return
|
||||||
|
|
||||||
|
// Clear existing timer
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Schedule new save
|
||||||
|
saveTimerRef.current = setTimeout(() => {
|
||||||
|
lastSavedPosition.current = currentPosition
|
||||||
|
onSave(currentPosition)
|
||||||
|
}, autoSaveInterval)
|
||||||
|
}, [syncEnabled, onSave, autoSaveInterval])
|
||||||
|
|
||||||
|
// Immediate save function
|
||||||
|
const saveNow = useCallback(() => {
|
||||||
|
if (!syncEnabled || !onSave) return
|
||||||
|
|
||||||
|
// Cancel any pending saves
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
saveTimerRef.current = null
|
||||||
|
}
|
||||||
|
|
||||||
|
// Save if position is meaningful (>= 5%)
|
||||||
|
if (position >= 0.05) {
|
||||||
|
lastSavedPosition.current = position
|
||||||
|
onSave(position)
|
||||||
|
}
|
||||||
|
}, [syncEnabled, onSave, position])
|
||||||
|
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
if (!enabled) return
|
if (!enabled) return
|
||||||
@@ -30,12 +81,20 @@ export const useReadingPosition = ({
|
|||||||
const documentHeight = document.documentElement.scrollHeight
|
const documentHeight = document.documentElement.scrollHeight
|
||||||
|
|
||||||
// Calculate position based on how much of the content has been scrolled through
|
// Calculate position based on how much of the content has been scrolled through
|
||||||
const scrollProgress = Math.min(scrollTop / (documentHeight - windowHeight), 1)
|
// Add a small threshold (5px) to account for rounding and make it easier to reach 100%
|
||||||
const clampedProgress = Math.max(0, Math.min(1, scrollProgress))
|
const maxScroll = documentHeight - windowHeight
|
||||||
|
const scrollProgress = maxScroll > 0 ? scrollTop / maxScroll : 0
|
||||||
|
|
||||||
|
// If we're within 5px of the bottom, consider it 100%
|
||||||
|
const isAtBottom = scrollTop + windowHeight >= documentHeight - 5
|
||||||
|
const clampedProgress = isAtBottom ? 1 : Math.max(0, Math.min(1, scrollProgress))
|
||||||
|
|
||||||
setPosition(clampedProgress)
|
setPosition(clampedProgress)
|
||||||
onPositionChange?.(clampedProgress)
|
onPositionChange?.(clampedProgress)
|
||||||
|
|
||||||
|
// Schedule auto-save if sync is enabled
|
||||||
|
scheduleSave(clampedProgress)
|
||||||
|
|
||||||
// Check if reading is complete
|
// Check if reading is complete
|
||||||
if (clampedProgress >= readingCompleteThreshold && !hasTriggeredComplete.current) {
|
if (clampedProgress >= readingCompleteThreshold && !hasTriggeredComplete.current) {
|
||||||
setIsReadingComplete(true)
|
setIsReadingComplete(true)
|
||||||
@@ -54,8 +113,13 @@ export const useReadingPosition = ({
|
|||||||
return () => {
|
return () => {
|
||||||
window.removeEventListener('scroll', handleScroll)
|
window.removeEventListener('scroll', handleScroll)
|
||||||
window.removeEventListener('resize', handleScroll)
|
window.removeEventListener('resize', handleScroll)
|
||||||
|
|
||||||
|
// Clear save timer on unmount
|
||||||
|
if (saveTimerRef.current) {
|
||||||
|
clearTimeout(saveTimerRef.current)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold])
|
}, [enabled, onPositionChange, onReadingComplete, readingCompleteThreshold, scheduleSave])
|
||||||
|
|
||||||
// Reset reading complete state when enabled changes
|
// Reset reading complete state when enabled changes
|
||||||
useEffect(() => {
|
useEffect(() => {
|
||||||
@@ -68,6 +132,7 @@ export const useReadingPosition = ({
|
|||||||
return {
|
return {
|
||||||
position,
|
position,
|
||||||
isReadingComplete,
|
isReadingComplete,
|
||||||
progressPercentage: Math.round(position * 100)
|
progressPercentage: Math.round(position * 100),
|
||||||
|
saveNow
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -73,6 +73,9 @@ export function useSettings({ relayPool, eventStore, pubkey, accountManager }: U
|
|||||||
root.setProperty('--highlight-color-friends', settings.highlightColorFriends || '#f97316')
|
root.setProperty('--highlight-color-friends', settings.highlightColorFriends || '#f97316')
|
||||||
root.setProperty('--highlight-color-nostrverse', settings.highlightColorNostrverse || '#9333ea')
|
root.setProperty('--highlight-color-nostrverse', settings.highlightColorNostrverse || '#9333ea')
|
||||||
|
|
||||||
|
// Set paragraph alignment
|
||||||
|
root.setProperty('--paragraph-alignment', settings.paragraphAlignment || 'justify')
|
||||||
|
|
||||||
console.log('✅ All styles applied')
|
console.log('✅ All styles applied')
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -19,7 +19,7 @@ export function dedupeNip51Events(events: NostrEvent[]): NostrEvent[] {
|
|||||||
const webBookmarks = unique.filter(e => e.kind === 39701)
|
const webBookmarks = unique.filter(e => e.kind === 39701)
|
||||||
|
|
||||||
const bookmarkLists = unique
|
const bookmarkLists = unique
|
||||||
.filter(e => e.kind === 10003 || e.kind === 30001)
|
.filter(e => e.kind === 10003 || e.kind === 30003 || e.kind === 30001)
|
||||||
.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
|
.sort((a, b) => (b.created_at || 0) - (a.created_at || 0))
|
||||||
const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
|
const latestBookmarkList = bookmarkLists.find(list => !list.tags?.some((t: string[]) => t[0] === 'd'))
|
||||||
|
|
||||||
|
|||||||
@@ -16,11 +16,24 @@ export interface BookmarkData {
|
|||||||
tags?: string[][]
|
tags?: string[][]
|
||||||
}
|
}
|
||||||
|
|
||||||
|
export interface AddressPointer {
|
||||||
|
kind: number
|
||||||
|
pubkey: string
|
||||||
|
identifier: string
|
||||||
|
relays?: string[]
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface EventPointer {
|
||||||
|
id: string
|
||||||
|
relays?: string[]
|
||||||
|
author?: string
|
||||||
|
}
|
||||||
|
|
||||||
export interface ApplesauceBookmarks {
|
export interface ApplesauceBookmarks {
|
||||||
notes?: BookmarkData[]
|
notes?: EventPointer[]
|
||||||
articles?: BookmarkData[]
|
articles?: AddressPointer[]
|
||||||
hashtags?: BookmarkData[]
|
hashtags?: string[]
|
||||||
urls?: BookmarkData[]
|
urls?: string[]
|
||||||
}
|
}
|
||||||
|
|
||||||
export interface AccountWithExtension {
|
export interface AccountWithExtension {
|
||||||
@@ -55,25 +68,83 @@ export const processApplesauceBookmarks = (
|
|||||||
|
|
||||||
if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
|
if (typeof bookmarks === 'object' && bookmarks !== null && !Array.isArray(bookmarks)) {
|
||||||
const applesauceBookmarks = bookmarks as ApplesauceBookmarks
|
const applesauceBookmarks = bookmarks as ApplesauceBookmarks
|
||||||
const allItems: BookmarkData[] = []
|
const allItems: IndividualBookmark[] = []
|
||||||
if (applesauceBookmarks.notes) allItems.push(...applesauceBookmarks.notes)
|
|
||||||
if (applesauceBookmarks.articles) allItems.push(...applesauceBookmarks.articles)
|
// Process notes (EventPointer[])
|
||||||
if (applesauceBookmarks.hashtags) allItems.push(...applesauceBookmarks.hashtags)
|
if (applesauceBookmarks.notes) {
|
||||||
if (applesauceBookmarks.urls) allItems.push(...applesauceBookmarks.urls)
|
applesauceBookmarks.notes.forEach((note: EventPointer) => {
|
||||||
|
allItems.push({
|
||||||
|
id: note.id,
|
||||||
|
content: '',
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: note.author || activeAccount.pubkey,
|
||||||
|
kind: 1, // Short note kind
|
||||||
|
tags: [],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process articles (AddressPointer[])
|
||||||
|
if (applesauceBookmarks.articles) {
|
||||||
|
applesauceBookmarks.articles.forEach((article: AddressPointer) => {
|
||||||
|
// Convert AddressPointer to coordinate format: kind:pubkey:identifier
|
||||||
|
const coordinate = `${article.kind}:${article.pubkey}:${article.identifier || ''}`
|
||||||
|
allItems.push({
|
||||||
|
id: coordinate,
|
||||||
|
content: '',
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: article.pubkey,
|
||||||
|
kind: article.kind, // Usually 30023 for long-form articles
|
||||||
|
tags: [],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process hashtags (string[])
|
||||||
|
if (applesauceBookmarks.hashtags) {
|
||||||
|
applesauceBookmarks.hashtags.forEach((hashtag: string) => {
|
||||||
|
allItems.push({
|
||||||
|
id: `hashtag-${hashtag}`,
|
||||||
|
content: `#${hashtag}`,
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: activeAccount.pubkey,
|
||||||
|
kind: 1,
|
||||||
|
tags: [['t', hashtag]],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process URLs (string[])
|
||||||
|
if (applesauceBookmarks.urls) {
|
||||||
|
applesauceBookmarks.urls.forEach((url: string) => {
|
||||||
|
allItems.push({
|
||||||
|
id: `url-${url}`,
|
||||||
|
content: url,
|
||||||
|
created_at: Math.floor(Date.now() / 1000),
|
||||||
|
pubkey: activeAccount.pubkey,
|
||||||
|
kind: 1,
|
||||||
|
tags: [['r', url]],
|
||||||
|
parsedContent: undefined,
|
||||||
|
type: 'event' as const,
|
||||||
|
isPrivate,
|
||||||
|
added_at: Math.floor(Date.now() / 1000)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
return allItems
|
return allItems
|
||||||
.filter((bookmark: BookmarkData) => bookmark.id) // Skip bookmarks without valid IDs
|
|
||||||
.map((bookmark: BookmarkData) => ({
|
|
||||||
id: bookmark.id!,
|
|
||||||
content: bookmark.content || '',
|
|
||||||
created_at: bookmark.created_at || Math.floor(Date.now() / 1000),
|
|
||||||
pubkey: activeAccount.pubkey,
|
|
||||||
kind: bookmark.kind || 30001,
|
|
||||||
tags: bookmark.tags || [],
|
|
||||||
parsedContent: bookmark.content ? (getParsedContent(bookmark.content) as ParsedContent) : undefined,
|
|
||||||
type: 'event' as const,
|
|
||||||
isPrivate,
|
|
||||||
added_at: bookmark.created_at || Math.floor(Date.now() / 1000)
|
|
||||||
}))
|
|
||||||
}
|
}
|
||||||
|
|
||||||
const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]
|
const bookmarkArray = Array.isArray(bookmarks) ? bookmarks : [bookmarks]
|
||||||
|
|||||||
@@ -11,6 +11,18 @@ type UnlockHiddenTagsFn = typeof Helpers.unlockHiddenTags
|
|||||||
type HiddenContentSigner = Parameters<UnlockHiddenTagsFn>[1]
|
type HiddenContentSigner = Parameters<UnlockHiddenTagsFn>[1]
|
||||||
type UnlockMode = Parameters<UnlockHiddenTagsFn>[2]
|
type UnlockMode = Parameters<UnlockHiddenTagsFn>[2]
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrap a decrypt promise with a timeout to prevent hanging (using 30s timeout for bunker)
|
||||||
|
*/
|
||||||
|
function withDecryptTimeout<T>(promise: Promise<T>, timeoutMs = 30000): Promise<T> {
|
||||||
|
return Promise.race([
|
||||||
|
promise,
|
||||||
|
new Promise<T>((_, reject) =>
|
||||||
|
setTimeout(() => reject(new Error(`Decrypt timeout after ${timeoutMs}ms`)), timeoutMs)
|
||||||
|
)
|
||||||
|
])
|
||||||
|
}
|
||||||
|
|
||||||
export async function collectBookmarksFromEvents(
|
export async function collectBookmarksFromEvents(
|
||||||
bookmarkListEvents: NostrEvent[],
|
bookmarkListEvents: NostrEvent[],
|
||||||
activeAccount: ActiveAccount,
|
activeAccount: ActiveAccount,
|
||||||
@@ -33,6 +45,12 @@ export async function collectBookmarksFromEvents(
|
|||||||
if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
|
if (!latestContent && evt.content && !Helpers.hasHiddenContent(evt)) latestContent = evt.content
|
||||||
if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
|
if (Array.isArray(evt.tags)) allTags = allTags.concat(evt.tags)
|
||||||
|
|
||||||
|
// Extract the 'd' tag and metadata for bookmark sets (kind 30003)
|
||||||
|
const dTag = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] : undefined
|
||||||
|
const setTitle = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'title')?.[1] : undefined
|
||||||
|
const setDescription = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'description')?.[1] : undefined
|
||||||
|
const setImage = evt.kind === 30003 ? evt.tags?.find((t: string[]) => t[0] === 'image')?.[1] : undefined
|
||||||
|
|
||||||
// Handle web bookmarks (kind:39701) as individual bookmarks
|
// Handle web bookmarks (kind:39701) as individual bookmarks
|
||||||
if (evt.kind === 39701) {
|
if (evt.kind === 39701) {
|
||||||
publicItemsAll.push({
|
publicItemsAll.push({
|
||||||
@@ -45,13 +63,27 @@ export async function collectBookmarksFromEvents(
|
|||||||
parsedContent: undefined,
|
parsedContent: undefined,
|
||||||
type: 'web' as const,
|
type: 'web' as const,
|
||||||
isPrivate: false,
|
isPrivate: false,
|
||||||
added_at: evt.created_at || Math.floor(Date.now() / 1000)
|
added_at: evt.created_at || Math.floor(Date.now() / 1000),
|
||||||
|
sourceKind: 39701,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
})
|
})
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
const pub = Helpers.getPublicBookmarks(evt)
|
const pub = Helpers.getPublicBookmarks(evt)
|
||||||
publicItemsAll.push(...processApplesauceBookmarks(pub, activeAccount, false))
|
publicItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(pub, activeAccount, false).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
|
|
||||||
try {
|
try {
|
||||||
if (Helpers.hasHiddenTags(evt) && !Helpers.isHiddenTagsUnlocked(evt) && signerCandidate) {
|
if (Helpers.hasHiddenTags(evt) && !Helpers.isHiddenTagsUnlocked(evt) && signerCandidate) {
|
||||||
@@ -60,7 +92,8 @@ export async function collectBookmarksFromEvents(
|
|||||||
} catch {
|
} catch {
|
||||||
try {
|
try {
|
||||||
await Helpers.unlockHiddenTags(evt, signerCandidate as HiddenContentSigner, 'nip44' as UnlockMode)
|
await Helpers.unlockHiddenTags(evt, signerCandidate as HiddenContentSigner, 'nip44' as UnlockMode)
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -68,24 +101,26 @@ export async function collectBookmarksFromEvents(
|
|||||||
let decryptedContent: string | undefined
|
let decryptedContent: string | undefined
|
||||||
try {
|
try {
|
||||||
if (hasNip44Decrypt(signerCandidate)) {
|
if (hasNip44Decrypt(signerCandidate)) {
|
||||||
decryptedContent = await (signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
|
decryptedContent = await withDecryptTimeout((signerCandidate as { nip44: { decrypt: DecryptFn } }).nip44.decrypt(
|
||||||
evt.pubkey,
|
evt.pubkey,
|
||||||
evt.content
|
evt.content
|
||||||
)
|
))
|
||||||
}
|
}
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip44.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!decryptedContent) {
|
if (!decryptedContent) {
|
||||||
try {
|
try {
|
||||||
if (hasNip04Decrypt(signerCandidate)) {
|
if (hasNip04Decrypt(signerCandidate)) {
|
||||||
decryptedContent = await (signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
|
decryptedContent = await withDecryptTimeout((signerCandidate as { nip04: { decrypt: DecryptFn } }).nip04.decrypt(
|
||||||
evt.pubkey,
|
evt.pubkey,
|
||||||
evt.content
|
evt.content
|
||||||
)
|
))
|
||||||
}
|
}
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.log("[bunker] ❌ nip04.decrypt failed:", err instanceof Error ? err.message : String(err))
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -94,11 +129,20 @@ export async function collectBookmarksFromEvents(
|
|||||||
try {
|
try {
|
||||||
const hiddenTags = JSON.parse(decryptedContent) as string[][]
|
const hiddenTags = JSON.parse(decryptedContent) as string[][]
|
||||||
const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
|
const manualPrivate = Helpers.parseBookmarkTags(hiddenTags)
|
||||||
privateItemsAll.push(...processApplesauceBookmarks(manualPrivate, activeAccount, true))
|
privateItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(manualPrivate, activeAccount, true).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
Reflect.set(evt, BookmarkHiddenSymbol, manualPrivate)
|
Reflect.set(evt, BookmarkHiddenSymbol, manualPrivate)
|
||||||
Reflect.set(evt, 'EncryptedContentSymbol', decryptedContent)
|
Reflect.set(evt, 'EncryptedContentSymbol', decryptedContent)
|
||||||
// Don't set latestContent to decrypted JSON - it's not user-facing content
|
// Don't set latestContent to decrypted JSON - it's not user-facing content
|
||||||
} catch {
|
} catch (err) {
|
||||||
// ignore
|
// ignore
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -106,7 +150,16 @@ export async function collectBookmarksFromEvents(
|
|||||||
|
|
||||||
const priv = Helpers.getHiddenBookmarks(evt)
|
const priv = Helpers.getHiddenBookmarks(evt)
|
||||||
if (priv) {
|
if (priv) {
|
||||||
privateItemsAll.push(...processApplesauceBookmarks(priv, activeAccount, true))
|
privateItemsAll.push(
|
||||||
|
...processApplesauceBookmarks(priv, activeAccount, true).map(i => ({
|
||||||
|
...i,
|
||||||
|
sourceKind: evt.kind,
|
||||||
|
setName: dTag,
|
||||||
|
setTitle,
|
||||||
|
setDescription,
|
||||||
|
setImage
|
||||||
|
}))
|
||||||
|
)
|
||||||
}
|
}
|
||||||
} catch {
|
} catch {
|
||||||
// ignore individual event failures
|
// ignore individual event failures
|
||||||
|
|||||||
@@ -5,7 +5,6 @@ import {
|
|||||||
dedupeNip51Events,
|
dedupeNip51Events,
|
||||||
hydrateItems,
|
hydrateItems,
|
||||||
isAccountWithExtension,
|
isAccountWithExtension,
|
||||||
isHexId,
|
|
||||||
hasNip04Decrypt,
|
hasNip04Decrypt,
|
||||||
hasNip44Decrypt,
|
hasNip44Decrypt,
|
||||||
dedupeBookmarksById,
|
dedupeBookmarksById,
|
||||||
@@ -16,6 +15,7 @@ import { collectBookmarksFromEvents } from './bookmarkProcessing.ts'
|
|||||||
import { UserSettings } from './settingsService'
|
import { UserSettings } from './settingsService'
|
||||||
import { rebroadcastEvents } from './rebroadcastService'
|
import { rebroadcastEvents } from './rebroadcastService'
|
||||||
import { queryEvents } from './dataFetch'
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
@@ -35,7 +35,7 @@ export const fetchBookmarks = async (
|
|||||||
|
|
||||||
const rawEvents = await queryEvents(
|
const rawEvents = await queryEvents(
|
||||||
relayPool,
|
relayPool,
|
||||||
{ kinds: [10003, 30003, 30001, 39701], authors: [activeAccount.pubkey] },
|
{ kinds: [KINDS.ListSimple, KINDS.ListReplaceable, KINDS.List, KINDS.WebBookmark], authors: [activeAccount.pubkey] },
|
||||||
{}
|
{}
|
||||||
)
|
)
|
||||||
console.log('📊 Raw events fetched:', rawEvents.length, 'events')
|
console.log('📊 Raw events fetched:', rawEvents.length, 'events')
|
||||||
@@ -57,18 +57,35 @@ export const fetchBookmarks = async (
|
|||||||
rawEvents.forEach((evt, i) => {
|
rawEvents.forEach((evt, i) => {
|
||||||
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
||||||
const contentPreview = evt.content ? evt.content.slice(0, 50) + (evt.content.length > 50 ? '...' : '') : 'empty'
|
const contentPreview = evt.content ? evt.content.slice(0, 50) + (evt.content.length > 50 ? '...' : '') : 'empty'
|
||||||
console.log(` Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, contentPreview=${contentPreview}`)
|
const eTags = evt.tags?.filter((t: string[]) => t[0] === 'e').length || 0
|
||||||
|
const aTags = evt.tags?.filter((t: string[]) => t[0] === 'a').length || 0
|
||||||
|
console.log(` Event ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag=${dTag}, contentLength=${evt.content?.length || 0}, eTags=${eTags}, aTags=${aTags}, contentPreview=${contentPreview}`)
|
||||||
})
|
})
|
||||||
|
|
||||||
const bookmarkListEvents = dedupeNip51Events(rawEvents)
|
const bookmarkListEvents = dedupeNip51Events(rawEvents)
|
||||||
console.log('📋 After deduplication:', bookmarkListEvents.length, 'bookmark events')
|
console.log('📋 After deduplication:', bookmarkListEvents.length, 'bookmark events')
|
||||||
|
|
||||||
|
// Log which events made it through deduplication
|
||||||
|
bookmarkListEvents.forEach((evt, i) => {
|
||||||
|
const dTag = evt.tags?.find((t: string[]) => t[0] === 'd')?.[1] || 'none'
|
||||||
|
console.log(` Dedupe ${i}: kind=${evt.kind}, id=${evt.id?.slice(0, 8)}, dTag="${dTag}"`)
|
||||||
|
})
|
||||||
|
|
||||||
|
// Check specifically for Primal's "reads" list
|
||||||
|
const primalReads = rawEvents.find(e => e.kind === KINDS.ListSimple && e.tags?.find((t: string[]) => t[0] === 'd' && t[1] === 'reads'))
|
||||||
|
if (primalReads) {
|
||||||
|
console.log('✅ Found Primal reads list:', primalReads.id.slice(0, 8))
|
||||||
|
} else {
|
||||||
|
console.log('❌ No Primal reads list found (kind:10003 with d="reads")')
|
||||||
|
}
|
||||||
|
|
||||||
if (bookmarkListEvents.length === 0) {
|
if (bookmarkListEvents.length === 0) {
|
||||||
// Keep existing bookmarks visible; do not clear list if nothing new found
|
// Keep existing bookmarks visible; do not clear list if nothing new found
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
// Aggregate across events
|
// Aggregate across events
|
||||||
const maybeAccount = activeAccount as AccountWithExtension
|
const maybeAccount = activeAccount as AccountWithExtension
|
||||||
console.log('🔐 Account object:', {
|
console.log('[bunker] 🔐 Account object:', {
|
||||||
hasSignEvent: typeof maybeAccount?.signEvent === 'function',
|
hasSignEvent: typeof maybeAccount?.signEvent === 'function',
|
||||||
hasSigner: !!maybeAccount?.signer,
|
hasSigner: !!maybeAccount?.signer,
|
||||||
accountType: typeof maybeAccount,
|
accountType: typeof maybeAccount,
|
||||||
@@ -85,32 +102,107 @@ export const fetchBookmarks = async (
|
|||||||
signerCandidate = maybeAccount.signer
|
signerCandidate = maybeAccount.signer
|
||||||
}
|
}
|
||||||
|
|
||||||
console.log('🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
|
console.log('[bunker] 🔑 Signer candidate:', !!signerCandidate, typeof signerCandidate)
|
||||||
if (signerCandidate) {
|
if (signerCandidate) {
|
||||||
console.log('🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
|
console.log('[bunker] 🔑 Signer has nip04:', hasNip04Decrypt(signerCandidate))
|
||||||
console.log('🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
|
console.log('[bunker] 🔑 Signer has nip44:', hasNip44Decrypt(signerCandidate))
|
||||||
}
|
}
|
||||||
const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
|
|
||||||
|
// Debug relay connectivity for bunker relays
|
||||||
|
try {
|
||||||
|
const urls = Array.from(relayPool.relays.values()).map(r => ({ url: r.url, connected: (r as unknown as { connected?: boolean }).connected }))
|
||||||
|
console.log('[bunker] Relay connections:', urls)
|
||||||
|
} catch (err) { console.warn('[bunker] Failed to read relay connections', err) }
|
||||||
|
|
||||||
|
const { publicItemsAll, privateItemsAll, newestCreatedAt, latestContent, allTags } = await collectBookmarksFromEvents(
|
||||||
bookmarkListEvents,
|
bookmarkListEvents,
|
||||||
activeAccount,
|
activeAccount,
|
||||||
signerCandidate
|
signerCandidate
|
||||||
)
|
)
|
||||||
|
|
||||||
const allItems = [...publicItemsAll, ...privateItemsAll]
|
const allItems = [...publicItemsAll, ...privateItemsAll]
|
||||||
const noteIds = Array.from(new Set(allItems.map(i => i.id).filter(isHexId)))
|
|
||||||
let idToEvent: Map<string, NostrEvent> = new Map()
|
// Separate hex IDs (regular events) from coordinates (addressable events)
|
||||||
|
const noteIds: string[] = []
|
||||||
|
const coordinates: string[] = []
|
||||||
|
|
||||||
|
allItems.forEach(i => {
|
||||||
|
// Check if it's a hex ID (64 character hex string)
|
||||||
|
if (/^[0-9a-f]{64}$/i.test(i.id)) {
|
||||||
|
noteIds.push(i.id)
|
||||||
|
} else if (i.id.includes(':')) {
|
||||||
|
// Coordinate format: kind:pubkey:identifier
|
||||||
|
coordinates.push(i.id)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
const idToEvent: Map<string, NostrEvent> = new Map()
|
||||||
|
|
||||||
|
// Fetch regular events by ID
|
||||||
if (noteIds.length > 0) {
|
if (noteIds.length > 0) {
|
||||||
try {
|
try {
|
||||||
const events = await queryEvents(
|
const events = await queryEvents(
|
||||||
relayPool,
|
relayPool,
|
||||||
{ ids: noteIds },
|
{ ids: Array.from(new Set(noteIds)) },
|
||||||
{ localTimeoutMs: 800, remoteTimeoutMs: 2500 }
|
{ localTimeoutMs: 800, remoteTimeoutMs: 2500 }
|
||||||
)
|
)
|
||||||
idToEvent = new Map(events.map((e: NostrEvent) => [e.id, e]))
|
events.forEach((e: NostrEvent) => {
|
||||||
|
idToEvent.set(e.id, e)
|
||||||
|
// Also store by coordinate if it's an addressable event
|
||||||
|
if (e.kind && e.kind >= 30000 && e.kind < 40000) {
|
||||||
|
const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
|
||||||
|
idToEvent.set(coordinate, e)
|
||||||
|
}
|
||||||
|
})
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.warn('Failed to fetch events for hydration:', error)
|
console.warn('Failed to fetch events by ID:', error)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Fetch addressable events by coordinates
|
||||||
|
if (coordinates.length > 0) {
|
||||||
|
try {
|
||||||
|
// Group by kind for more efficient querying
|
||||||
|
const byKind = new Map<number, Array<{ pubkey: string; identifier: string }>>()
|
||||||
|
|
||||||
|
coordinates.forEach(coord => {
|
||||||
|
const parts = coord.split(':')
|
||||||
|
const kind = parseInt(parts[0])
|
||||||
|
const pubkey = parts[1]
|
||||||
|
const identifier = parts[2] || ''
|
||||||
|
|
||||||
|
if (!byKind.has(kind)) {
|
||||||
|
byKind.set(kind, [])
|
||||||
|
}
|
||||||
|
byKind.get(kind)!.push({ pubkey, identifier })
|
||||||
|
})
|
||||||
|
|
||||||
|
// Query each kind group
|
||||||
|
for (const [kind, items] of byKind.entries()) {
|
||||||
|
const authors = Array.from(new Set(items.map(i => i.pubkey)))
|
||||||
|
const identifiers = Array.from(new Set(items.map(i => i.identifier)))
|
||||||
|
|
||||||
|
const events = await queryEvents(
|
||||||
|
relayPool,
|
||||||
|
{ kinds: [kind], authors, '#d': identifiers },
|
||||||
|
{ localTimeoutMs: 800, remoteTimeoutMs: 2500 }
|
||||||
|
)
|
||||||
|
|
||||||
|
events.forEach((e: NostrEvent) => {
|
||||||
|
const dTag = e.tags?.find((t: string[]) => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${e.kind}:${e.pubkey}:${dTag}`
|
||||||
|
idToEvent.set(coordinate, e)
|
||||||
|
// Also store by event ID
|
||||||
|
idToEvent.set(e.id, e)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.warn('Failed to fetch addressable events:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`📦 Hydration: fetched ${idToEvent.size} events for ${allItems.length} bookmarks (${noteIds.length} notes, ${coordinates.length} articles)`)
|
||||||
const allBookmarks = dedupeBookmarksById([
|
const allBookmarks = dedupeBookmarksById([
|
||||||
...hydrateItems(publicItemsAll, idToEvent),
|
...hydrateItems(publicItemsAll, idToEvent),
|
||||||
...hydrateItems(privateItemsAll, idToEvent)
|
...hydrateItems(privateItemsAll, idToEvent)
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ import { RelayPool } from 'applesauce-relay'
|
|||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { Helpers } from 'applesauce-core'
|
import { Helpers } from 'applesauce-core'
|
||||||
import { queryEvents } from './dataFetch'
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
|
||||||
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
@@ -41,7 +42,7 @@ export const fetchBlogPostsFromAuthors = async (
|
|||||||
|
|
||||||
await queryEvents(
|
await queryEvents(
|
||||||
relayPool,
|
relayPool,
|
||||||
{ kinds: [30023], authors: pubkeys, limit: 100 },
|
{ kinds: [KINDS.BlogPost], authors: pubkeys, limit: 100 },
|
||||||
{
|
{
|
||||||
relayUrls,
|
relayUrls,
|
||||||
onEvent: (event: NostrEvent) => {
|
onEvent: (event: NostrEvent) => {
|
||||||
|
|||||||
@@ -46,7 +46,8 @@ export async function createHighlight(
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Create EventFactory with the account as signer
|
// Create EventFactory with the account as signer
|
||||||
const factory = new EventFactory({ signer: account })
|
console.log("[bunker] Creating EventFactory with signer:", { signerType: account.signer?.constructor?.name })
|
||||||
|
const factory = new EventFactory({ signer: account.signer })
|
||||||
|
|
||||||
let blueprintSource: NostrEvent | AddressPointer | string
|
let blueprintSource: NostrEvent | AddressPointer | string
|
||||||
let context: string | undefined
|
let context: string | undefined
|
||||||
@@ -116,7 +117,9 @@ export async function createHighlight(
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Sign the event
|
// Sign the event
|
||||||
|
console.log('[bunker] Signing highlight event...', { kind: highlightEvent.kind, tags: highlightEvent.tags.length })
|
||||||
const signedEvent = await factory.sign(highlightEvent)
|
const signedEvent = await factory.sign(highlightEvent)
|
||||||
|
console.log('[bunker] ✅ Highlight signed successfully!', { id: signedEvent.id.slice(0, 8) })
|
||||||
|
|
||||||
// Use unified write service to store and publish
|
// Use unified write service to store and publish
|
||||||
await publishEvent(relayPool, eventStore, signedEvent)
|
await publishEvent(relayPool, eventStore, signedEvent)
|
||||||
|
|||||||
@@ -6,6 +6,7 @@ import { prioritizeLocalRelays, partitionRelays } from '../../utils/helpers'
|
|||||||
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
import { eventToHighlight, dedupeHighlights, sortHighlights } from '../highlightEventProcessor'
|
||||||
import { UserSettings } from '../settingsService'
|
import { UserSettings } from '../settingsService'
|
||||||
import { rebroadcastEvents } from '../rebroadcastService'
|
import { rebroadcastEvents } from '../rebroadcastService'
|
||||||
|
import { KINDS } from '../../config/kinds'
|
||||||
|
|
||||||
export const fetchHighlights = async (
|
export const fetchHighlights = async (
|
||||||
relayPool: RelayPool,
|
relayPool: RelayPool,
|
||||||
@@ -21,7 +22,7 @@ export const fetchHighlights = async (
|
|||||||
const seenIds = new Set<string>()
|
const seenIds = new Set<string>()
|
||||||
const local$ = localRelays.length > 0
|
const local$ = localRelays.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(localRelays, { kinds: [9802], authors: [pubkey] })
|
.req(localRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
|
||||||
.pipe(
|
.pipe(
|
||||||
onlyEvents(),
|
onlyEvents(),
|
||||||
tap((event: NostrEvent) => {
|
tap((event: NostrEvent) => {
|
||||||
@@ -36,7 +37,7 @@ export const fetchHighlights = async (
|
|||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
const remote$ = remoteRelays.length > 0
|
const remote$ = remoteRelays.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(remoteRelays, { kinds: [9802], authors: [pubkey] })
|
.req(remoteRelays, { kinds: [KINDS.Highlights], authors: [pubkey] })
|
||||||
.pipe(
|
.pipe(
|
||||||
onlyEvents(),
|
onlyEvents(),
|
||||||
tap((event: NostrEvent) => {
|
tap((event: NostrEvent) => {
|
||||||
|
|||||||
@@ -14,10 +14,11 @@ export const fetchHighlightsForUrl = async (
|
|||||||
onHighlight?: (highlight: Highlight) => void,
|
onHighlight?: (highlight: Highlight) => void,
|
||||||
settings?: UserSettings
|
settings?: UserSettings
|
||||||
): Promise<Highlight[]> => {
|
): Promise<Highlight[]> => {
|
||||||
|
const seenIds = new Set<string>()
|
||||||
|
const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
|
||||||
|
const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
|
||||||
|
|
||||||
try {
|
try {
|
||||||
const seenIds = new Set<string>()
|
|
||||||
const orderedRelaysUrl = prioritizeLocalRelays(RELAYS)
|
|
||||||
const { local: localRelaysUrl, remote: remoteRelaysUrl } = partitionRelays(orderedRelaysUrl)
|
|
||||||
const local$ = localRelaysUrl.length > 0
|
const local$ = localRelaysUrl.length > 0
|
||||||
? relayPool
|
? relayPool
|
||||||
.req(localRelaysUrl, { kinds: [9802], '#r': [url] })
|
.req(localRelaysUrl, { kinds: [9802], '#r': [url] })
|
||||||
@@ -45,11 +46,23 @@ export const fetchHighlightsForUrl = async (
|
|||||||
)
|
)
|
||||||
: new Observable<NostrEvent>((sub) => sub.complete())
|
: new Observable<NostrEvent>((sub) => sub.complete())
|
||||||
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
const rawEvents: NostrEvent[] = await lastValueFrom(merge(local$, remote$).pipe(toArray()))
|
||||||
await rebroadcastEvents(rawEvents, relayPool, settings)
|
|
||||||
|
console.log(`📌 Fetched ${rawEvents.length} highlight events for URL:`, url)
|
||||||
|
|
||||||
|
// Rebroadcast events - but don't let errors here break the highlight display
|
||||||
|
try {
|
||||||
|
await rebroadcastEvents(rawEvents, relayPool, settings)
|
||||||
|
} catch (err) {
|
||||||
|
console.warn('Failed to rebroadcast highlight events:', err)
|
||||||
|
}
|
||||||
|
|
||||||
const uniqueEvents = dedupeHighlights(rawEvents)
|
const uniqueEvents = dedupeHighlights(rawEvents)
|
||||||
const highlights: Highlight[] = uniqueEvents.map(eventToHighlight)
|
const highlights: Highlight[] = uniqueEvents.map(eventToHighlight)
|
||||||
return sortHighlights(highlights)
|
return sortHighlights(highlights)
|
||||||
} catch {
|
} catch (err) {
|
||||||
|
console.error('Error fetching highlights for URL:', err)
|
||||||
|
// Return highlights that were already streamed via callback
|
||||||
|
// Don't return empty array as that would clear already-displayed highlights
|
||||||
return []
|
return []
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ import { RelayPool } from 'applesauce-relay'
|
|||||||
import { NostrEvent } from 'nostr-tools'
|
import { NostrEvent } from 'nostr-tools'
|
||||||
import { Helpers } from 'applesauce-core'
|
import { Helpers } from 'applesauce-core'
|
||||||
import { RELAYS } from '../config/relays'
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
import { MARK_AS_READ_EMOJI } from './reactionService'
|
import { MARK_AS_READ_EMOJI } from './reactionService'
|
||||||
import { BlogPostPreview } from './exploreService'
|
import { BlogPostPreview } from './exploreService'
|
||||||
import { queryEvents } from './dataFetch'
|
import { queryEvents } from './dataFetch'
|
||||||
@@ -29,8 +30,8 @@ export async function fetchReadArticles(
|
|||||||
try {
|
try {
|
||||||
// Fetch kind:7 and kind:17 reactions in parallel
|
// Fetch kind:7 and kind:17 reactions in parallel
|
||||||
const [kind7Events, kind17Events] = await Promise.all([
|
const [kind7Events, kind17Events] = await Promise.all([
|
||||||
queryEvents(relayPool, { kinds: [7], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
queryEvents(relayPool, { kinds: [KINDS.ReactionToEvent], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
queryEvents(relayPool, { kinds: [17], authors: [userPubkey] }, { relayUrls: RELAYS })
|
queryEvents(relayPool, { kinds: [KINDS.ReactionToUrl], authors: [userPubkey] }, { relayUrls: RELAYS })
|
||||||
])
|
])
|
||||||
|
|
||||||
const readArticles: ReadArticle[] = []
|
const readArticles: ReadArticle[] = []
|
||||||
@@ -102,7 +103,7 @@ export async function fetchReadArticlesWithData(
|
|||||||
|
|
||||||
// Filter to only nostr-native articles (kind 30023)
|
// Filter to only nostr-native articles (kind 30023)
|
||||||
const nostrArticles = readArticles.filter(
|
const nostrArticles = readArticles.filter(
|
||||||
article => article.eventKind === 30023 && article.eventId
|
article => article.eventKind === KINDS.BlogPost && article.eventId
|
||||||
)
|
)
|
||||||
|
|
||||||
if (nostrArticles.length === 0) {
|
if (nostrArticles.length === 0) {
|
||||||
@@ -114,7 +115,7 @@ export async function fetchReadArticlesWithData(
|
|||||||
|
|
||||||
const articleEvents = await queryEvents(
|
const articleEvents = await queryEvents(
|
||||||
relayPool,
|
relayPool,
|
||||||
{ kinds: [30023], ids: eventIds },
|
{ kinds: [KINDS.BlogPost], ids: eventIds },
|
||||||
{ relayUrls: RELAYS }
|
{ relayUrls: RELAYS }
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|||||||
90
src/services/linksService.ts
Normal file
90
src/services/linksService.ts
Normal file
@@ -0,0 +1,90 @@
|
|||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { fetchReadArticles } from './libraryService'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fetches external URL links with reading progress from:
|
||||||
|
* - URLs with reading progress (kind:30078)
|
||||||
|
* - Manually marked as read URLs (kind:7, kind:17)
|
||||||
|
*/
|
||||||
|
export async function fetchLinks(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
userPubkey: string,
|
||||||
|
onItem?: (item: ReadItem) => void
|
||||||
|
): Promise<ReadItem[]> {
|
||||||
|
console.log('🔗 [Links] Fetching external links for user:', userPubkey.slice(0, 8))
|
||||||
|
|
||||||
|
const linksMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
// Helper to emit items as they're added/updated
|
||||||
|
const emitItem = (item: ReadItem) => {
|
||||||
|
if (onItem && mergeReadItem(linksMap, item)) {
|
||||||
|
onItem(linksMap.get(item.id)!)
|
||||||
|
} else if (!onItem) {
|
||||||
|
linksMap.set(item.id, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch all data sources in parallel
|
||||||
|
const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
|
||||||
|
queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
|
fetchReadArticles(relayPool, userPubkey)
|
||||||
|
])
|
||||||
|
|
||||||
|
console.log('📊 [Links] Data fetched:', {
|
||||||
|
readingPositions: readingPositionEvents.length,
|
||||||
|
markedAsRead: markedAsReadArticles.length
|
||||||
|
})
|
||||||
|
|
||||||
|
// Process reading positions and emit external items
|
||||||
|
processReadingPositions(readingPositionEvents, linksMap)
|
||||||
|
if (onItem) {
|
||||||
|
linksMap.forEach(item => {
|
||||||
|
if (item.type === 'external') {
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
if (hasProgress) emitItem(item)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process marked-as-read and emit external items
|
||||||
|
processMarkedAsRead(markedAsReadArticles, linksMap)
|
||||||
|
if (onItem) {
|
||||||
|
linksMap.forEach(item => {
|
||||||
|
if (item.type === 'external') {
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
if (hasProgress) emitItem(item)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Filter for external URLs only with reading progress
|
||||||
|
const links = Array.from(linksMap.values())
|
||||||
|
.filter(item => {
|
||||||
|
// Only external URLs
|
||||||
|
if (item.type !== 'external') return false
|
||||||
|
|
||||||
|
// Only include if there's reading progress or marked as read
|
||||||
|
const hasProgress = (item.readingProgress && item.readingProgress > 0) || item.markedAsRead
|
||||||
|
return hasProgress
|
||||||
|
})
|
||||||
|
|
||||||
|
// Apply common validation and sorting
|
||||||
|
const validLinks = filterValidItems(links)
|
||||||
|
const sortedLinks = sortByReadingActivity(validLinks)
|
||||||
|
|
||||||
|
console.log('✅ [Links] Processed', sortedLinks.length, 'total links')
|
||||||
|
return sortedLinks
|
||||||
|
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to fetch links:', error)
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
import { Highlight } from '../types/highlights'
|
import { Highlight } from '../types/highlights'
|
||||||
import { Bookmark } from '../types/bookmarks'
|
import { Bookmark } from '../types/bookmarks'
|
||||||
import { BlogPostPreview } from './exploreService'
|
import { BlogPostPreview } from './exploreService'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
|
||||||
export interface MeCache {
|
export interface MeCache {
|
||||||
highlights: Highlight[]
|
highlights: Highlight[]
|
||||||
bookmarks: Bookmark[]
|
bookmarks: Bookmark[]
|
||||||
readArticles: BlogPostPreview[]
|
readArticles: BlogPostPreview[]
|
||||||
|
reads?: ReadItem[]
|
||||||
|
links?: ReadItem[]
|
||||||
timestamp: number
|
timestamp: number
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
26
src/services/nostrConnect.ts
Normal file
26
src/services/nostrConnect.ts
Normal file
@@ -0,0 +1,26 @@
|
|||||||
|
import { NostrConnectSigner } from 'applesauce-signers'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get default NIP-46 permissions for bunker connections
|
||||||
|
* These permissions cover all event kinds and encryption/decryption operations Boris needs
|
||||||
|
*/
|
||||||
|
export function getDefaultBunkerPermissions(): string[] {
|
||||||
|
return [
|
||||||
|
// Signing permissions for event kinds we create
|
||||||
|
...NostrConnectSigner.buildSigningPermissions([
|
||||||
|
0, // Profile metadata
|
||||||
|
5, // Event deletion
|
||||||
|
7, // Reactions (nostr events)
|
||||||
|
17, // Reactions (websites)
|
||||||
|
9802, // Highlights
|
||||||
|
30078, // Settings & reading positions
|
||||||
|
39701, // Web bookmarks
|
||||||
|
]),
|
||||||
|
// Encryption/decryption for hidden content
|
||||||
|
'nip04_encrypt',
|
||||||
|
'nip04_decrypt',
|
||||||
|
'nip44_encrypt',
|
||||||
|
'nip44_decrypt',
|
||||||
|
]
|
||||||
|
}
|
||||||
|
|
||||||
147
src/services/readingDataProcessor.ts
Normal file
147
src/services/readingDataProcessor.ts
Normal file
@@ -0,0 +1,147 @@
|
|||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { ReadItem } from './readsService'
|
||||||
|
import { fallbackTitleFromUrl } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
const READING_POSITION_PREFIX = 'boris:reading-position:'
|
||||||
|
|
||||||
|
interface ReadArticle {
|
||||||
|
id: string
|
||||||
|
url?: string
|
||||||
|
eventId?: string
|
||||||
|
eventKind?: number
|
||||||
|
markedAt: number
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Processes reading position events into ReadItems
|
||||||
|
*/
|
||||||
|
export function processReadingPositions(
|
||||||
|
events: NostrEvent[],
|
||||||
|
readsMap: Map<string, ReadItem>
|
||||||
|
): void {
|
||||||
|
for (const event of events) {
|
||||||
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1]
|
||||||
|
if (!dTag || !dTag.startsWith(READING_POSITION_PREFIX)) continue
|
||||||
|
|
||||||
|
const identifier = dTag.replace(READING_POSITION_PREFIX, '')
|
||||||
|
|
||||||
|
try {
|
||||||
|
const positionData = JSON.parse(event.content)
|
||||||
|
const position = positionData.position
|
||||||
|
const timestamp = positionData.timestamp
|
||||||
|
|
||||||
|
let itemId: string
|
||||||
|
let itemUrl: string | undefined
|
||||||
|
let itemType: 'article' | 'external' = 'external'
|
||||||
|
|
||||||
|
// Check if it's a nostr article (naddr format)
|
||||||
|
if (identifier.startsWith('naddr1')) {
|
||||||
|
itemId = identifier
|
||||||
|
itemType = 'article'
|
||||||
|
} else {
|
||||||
|
// It's a base64url-encoded URL
|
||||||
|
try {
|
||||||
|
itemUrl = atob(identifier.replace(/-/g, '+').replace(/_/g, '/'))
|
||||||
|
itemId = itemUrl
|
||||||
|
itemType = 'external'
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Failed to decode URL identifier:', identifier)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Add or update the item
|
||||||
|
const existing = readsMap.get(itemId)
|
||||||
|
if (!existing || !existing.readingTimestamp || timestamp > existing.readingTimestamp) {
|
||||||
|
readsMap.set(itemId, {
|
||||||
|
...existing,
|
||||||
|
id: itemId,
|
||||||
|
source: 'reading-progress',
|
||||||
|
type: itemType,
|
||||||
|
url: itemUrl,
|
||||||
|
readingProgress: position,
|
||||||
|
readingTimestamp: timestamp
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
console.warn('Failed to parse reading position:', error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Processes marked-as-read articles into ReadItems
|
||||||
|
*/
|
||||||
|
export function processMarkedAsRead(
|
||||||
|
articles: ReadArticle[],
|
||||||
|
readsMap: Map<string, ReadItem>
|
||||||
|
): void {
|
||||||
|
for (const article of articles) {
|
||||||
|
const existing = readsMap.get(article.id)
|
||||||
|
|
||||||
|
if (article.eventId && article.eventKind === 30023) {
|
||||||
|
// Nostr article
|
||||||
|
readsMap.set(article.id, {
|
||||||
|
...existing,
|
||||||
|
id: article.id,
|
||||||
|
source: 'marked-as-read',
|
||||||
|
type: 'article',
|
||||||
|
markedAsRead: true,
|
||||||
|
markedAt: article.markedAt,
|
||||||
|
readingTimestamp: existing?.readingTimestamp || article.markedAt
|
||||||
|
})
|
||||||
|
} else if (article.url) {
|
||||||
|
// External URL
|
||||||
|
readsMap.set(article.id, {
|
||||||
|
...existing,
|
||||||
|
id: article.id,
|
||||||
|
source: 'marked-as-read',
|
||||||
|
type: 'external',
|
||||||
|
url: article.url,
|
||||||
|
markedAsRead: true,
|
||||||
|
markedAt: article.markedAt,
|
||||||
|
readingTimestamp: existing?.readingTimestamp || article.markedAt
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sorts ReadItems by most recent reading activity
|
||||||
|
*/
|
||||||
|
export function sortByReadingActivity(items: ReadItem[]): ReadItem[] {
|
||||||
|
return items.sort((a, b) => {
|
||||||
|
const timeA = a.readingTimestamp || a.markedAt || 0
|
||||||
|
const timeB = b.readingTimestamp || b.markedAt || 0
|
||||||
|
return timeB - timeA
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters out items without timestamps and enriches external items with fallback titles
|
||||||
|
*/
|
||||||
|
export function filterValidItems(items: ReadItem[]): ReadItem[] {
|
||||||
|
return items
|
||||||
|
.filter(item => {
|
||||||
|
// Only include items that have a timestamp
|
||||||
|
const hasTimestamp = (item.readingTimestamp && item.readingTimestamp > 0) ||
|
||||||
|
(item.markedAt && item.markedAt > 0)
|
||||||
|
if (!hasTimestamp) return false
|
||||||
|
|
||||||
|
// For Nostr articles, we need the event to be valid
|
||||||
|
if (item.type === 'article' && !item.event) return false
|
||||||
|
|
||||||
|
// For external URLs, we need at least a URL
|
||||||
|
if (item.type === 'external' && !item.url) return false
|
||||||
|
|
||||||
|
return true
|
||||||
|
})
|
||||||
|
.map(item => {
|
||||||
|
// Add fallback title for external URLs without titles
|
||||||
|
if (item.type === 'external' && !item.title && item.url) {
|
||||||
|
return { ...item, title: fallbackTitleFromUrl(item.url) }
|
||||||
|
}
|
||||||
|
return item
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
196
src/services/readingPositionService.ts
Normal file
196
src/services/readingPositionService.ts
Normal file
@@ -0,0 +1,196 @@
|
|||||||
|
import { IEventStore, mapEventsToStore } from 'applesauce-core'
|
||||||
|
import { EventFactory } from 'applesauce-factory'
|
||||||
|
import { RelayPool, onlyEvents } from 'applesauce-relay'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { firstValueFrom } from 'rxjs'
|
||||||
|
import { publishEvent } from './writeService'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
|
||||||
|
const APP_DATA_KIND = 30078 // NIP-78 Application Data
|
||||||
|
const READING_POSITION_PREFIX = 'boris:reading-position:'
|
||||||
|
|
||||||
|
export interface ReadingPosition {
|
||||||
|
position: number // 0-1 scroll progress
|
||||||
|
timestamp: number // Unix timestamp
|
||||||
|
scrollTop?: number // Optional: pixel position
|
||||||
|
}
|
||||||
|
|
||||||
|
// Helper to extract and parse reading position from an event
|
||||||
|
function getReadingPositionContent(event: NostrEvent): ReadingPosition | undefined {
|
||||||
|
if (!event.content || event.content.length === 0) return undefined
|
||||||
|
try {
|
||||||
|
return JSON.parse(event.content) as ReadingPosition
|
||||||
|
} catch {
|
||||||
|
return undefined
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Generate a unique identifier for an article
|
||||||
|
* For Nostr articles: use the naddr directly
|
||||||
|
* For external URLs: use base64url encoding of the URL
|
||||||
|
*/
|
||||||
|
export function generateArticleIdentifier(naddrOrUrl: string): string {
|
||||||
|
// If it starts with "nostr:", extract the naddr
|
||||||
|
if (naddrOrUrl.startsWith('nostr:')) {
|
||||||
|
return naddrOrUrl.replace('nostr:', '')
|
||||||
|
}
|
||||||
|
// For URLs, use base64url encoding (URL-safe)
|
||||||
|
return btoa(naddrOrUrl)
|
||||||
|
.replace(/\+/g, '-')
|
||||||
|
.replace(/\//g, '_')
|
||||||
|
.replace(/=+$/, '')
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Save reading position to Nostr (Kind 30078)
|
||||||
|
*/
|
||||||
|
export async function saveReadingPosition(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
eventStore: IEventStore,
|
||||||
|
factory: EventFactory,
|
||||||
|
articleIdentifier: string,
|
||||||
|
position: ReadingPosition
|
||||||
|
): Promise<void> {
|
||||||
|
console.log('💾 [ReadingPosition] Saving position:', {
|
||||||
|
identifier: articleIdentifier.slice(0, 32) + '...',
|
||||||
|
position: position.position,
|
||||||
|
positionPercent: Math.round(position.position * 100) + '%',
|
||||||
|
timestamp: position.timestamp,
|
||||||
|
scrollTop: position.scrollTop
|
||||||
|
})
|
||||||
|
|
||||||
|
const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
|
||||||
|
|
||||||
|
const draft = await factory.create(async () => ({
|
||||||
|
kind: APP_DATA_KIND,
|
||||||
|
content: JSON.stringify(position),
|
||||||
|
tags: [
|
||||||
|
['d', dTag],
|
||||||
|
['client', 'boris']
|
||||||
|
],
|
||||||
|
created_at: Math.floor(Date.now() / 1000)
|
||||||
|
}))
|
||||||
|
|
||||||
|
const signed = await factory.sign(draft)
|
||||||
|
|
||||||
|
// Use unified write service
|
||||||
|
await publishEvent(relayPool, eventStore, signed)
|
||||||
|
|
||||||
|
console.log('✅ [ReadingPosition] Position saved successfully, event ID:', signed.id.slice(0, 8))
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Load reading position from Nostr
|
||||||
|
*/
|
||||||
|
export async function loadReadingPosition(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
eventStore: IEventStore,
|
||||||
|
pubkey: string,
|
||||||
|
articleIdentifier: string
|
||||||
|
): Promise<ReadingPosition | null> {
|
||||||
|
const dTag = `${READING_POSITION_PREFIX}${articleIdentifier}`
|
||||||
|
|
||||||
|
console.log('📖 [ReadingPosition] Loading position:', {
|
||||||
|
pubkey: pubkey.slice(0, 8) + '...',
|
||||||
|
identifier: articleIdentifier.slice(0, 32) + '...',
|
||||||
|
dTag: dTag.slice(0, 50) + '...'
|
||||||
|
})
|
||||||
|
|
||||||
|
// First, check if we already have the position in the local event store
|
||||||
|
try {
|
||||||
|
const localEvent = await firstValueFrom(
|
||||||
|
eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
|
||||||
|
)
|
||||||
|
if (localEvent) {
|
||||||
|
const content = getReadingPositionContent(localEvent)
|
||||||
|
if (content) {
|
||||||
|
console.log('✅ [ReadingPosition] Loaded from local store:', {
|
||||||
|
position: content.position,
|
||||||
|
positionPercent: Math.round(content.position * 100) + '%',
|
||||||
|
timestamp: content.timestamp
|
||||||
|
})
|
||||||
|
|
||||||
|
// Still fetch from relays in the background to get any updates
|
||||||
|
relayPool
|
||||||
|
.subscription(RELAYS, {
|
||||||
|
kinds: [APP_DATA_KIND],
|
||||||
|
authors: [pubkey],
|
||||||
|
'#d': [dTag]
|
||||||
|
})
|
||||||
|
.pipe(onlyEvents(), mapEventsToStore(eventStore))
|
||||||
|
.subscribe()
|
||||||
|
|
||||||
|
return content
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.log('📭 No cached reading position found, fetching from relays...')
|
||||||
|
}
|
||||||
|
|
||||||
|
// If not in local store, fetch from relays
|
||||||
|
return new Promise((resolve) => {
|
||||||
|
let hasResolved = false
|
||||||
|
const timeout = setTimeout(() => {
|
||||||
|
if (!hasResolved) {
|
||||||
|
console.log('⏱️ Reading position load timeout - no position found')
|
||||||
|
hasResolved = true
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}, 3000) // Shorter timeout for reading positions
|
||||||
|
|
||||||
|
const sub = relayPool
|
||||||
|
.subscription(RELAYS, {
|
||||||
|
kinds: [APP_DATA_KIND],
|
||||||
|
authors: [pubkey],
|
||||||
|
'#d': [dTag]
|
||||||
|
})
|
||||||
|
.pipe(onlyEvents(), mapEventsToStore(eventStore))
|
||||||
|
.subscribe({
|
||||||
|
complete: async () => {
|
||||||
|
clearTimeout(timeout)
|
||||||
|
if (!hasResolved) {
|
||||||
|
hasResolved = true
|
||||||
|
try {
|
||||||
|
const event = await firstValueFrom(
|
||||||
|
eventStore.replaceable(APP_DATA_KIND, pubkey, dTag)
|
||||||
|
)
|
||||||
|
if (event) {
|
||||||
|
const content = getReadingPositionContent(event)
|
||||||
|
if (content) {
|
||||||
|
console.log('✅ [ReadingPosition] Loaded from relays:', {
|
||||||
|
position: content.position,
|
||||||
|
positionPercent: Math.round(content.position * 100) + '%',
|
||||||
|
timestamp: content.timestamp
|
||||||
|
})
|
||||||
|
resolve(content)
|
||||||
|
} else {
|
||||||
|
console.log('⚠️ [ReadingPosition] Event found but no valid content')
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
console.log('📭 [ReadingPosition] No position found on relays')
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
} catch (err) {
|
||||||
|
console.error('❌ Error loading reading position:', err)
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
},
|
||||||
|
error: (err) => {
|
||||||
|
console.error('❌ Reading position subscription error:', err)
|
||||||
|
clearTimeout(timeout)
|
||||||
|
if (!hasResolved) {
|
||||||
|
hasResolved = true
|
||||||
|
resolve(null)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
setTimeout(() => {
|
||||||
|
sub.unsubscribe()
|
||||||
|
}, 3000)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
197
src/services/readsService.ts
Normal file
197
src/services/readsService.ts
Normal file
@@ -0,0 +1,197 @@
|
|||||||
|
import { RelayPool } from 'applesauce-relay'
|
||||||
|
import { NostrEvent } from 'nostr-tools'
|
||||||
|
import { Helpers } from 'applesauce-core'
|
||||||
|
import { Bookmark } from '../types/bookmarks'
|
||||||
|
import { fetchReadArticles } from './libraryService'
|
||||||
|
import { queryEvents } from './dataFetch'
|
||||||
|
import { RELAYS } from '../config/relays'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { classifyBookmarkType } from '../utils/bookmarkTypeClassifier'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
import { processReadingPositions, processMarkedAsRead, filterValidItems, sortByReadingActivity } from './readingDataProcessor'
|
||||||
|
import { mergeReadItem } from '../utils/readItemMerge'
|
||||||
|
|
||||||
|
const { getArticleTitle, getArticleImage, getArticlePublished, getArticleSummary } = Helpers
|
||||||
|
|
||||||
|
export interface ReadItem {
|
||||||
|
id: string // event ID or URL or coordinate
|
||||||
|
source: 'bookmark' | 'reading-progress' | 'marked-as-read'
|
||||||
|
type: 'article' | 'external' // article=kind:30023, external=URL
|
||||||
|
|
||||||
|
// Article data
|
||||||
|
event?: NostrEvent
|
||||||
|
url?: string
|
||||||
|
title?: string
|
||||||
|
summary?: string
|
||||||
|
image?: string
|
||||||
|
published?: number
|
||||||
|
author?: string
|
||||||
|
|
||||||
|
// Reading metadata
|
||||||
|
readingProgress?: number // 0-1
|
||||||
|
readingTimestamp?: number // Unix timestamp of last reading activity
|
||||||
|
markedAsRead?: boolean
|
||||||
|
markedAt?: number
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Fetches all reads from multiple sources:
|
||||||
|
* - Bookmarked articles (kind:30023) and article/website URLs
|
||||||
|
* - Articles/URLs with reading progress (kind:30078)
|
||||||
|
* - Manually marked as read articles/URLs (kind:7, kind:17)
|
||||||
|
*/
|
||||||
|
export async function fetchAllReads(
|
||||||
|
relayPool: RelayPool,
|
||||||
|
userPubkey: string,
|
||||||
|
bookmarks: Bookmark[],
|
||||||
|
onItem?: (item: ReadItem) => void
|
||||||
|
): Promise<ReadItem[]> {
|
||||||
|
console.log('📚 [Reads] Fetching all reads for user:', userPubkey.slice(0, 8))
|
||||||
|
|
||||||
|
const readsMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
// Helper to emit items as they're added/updated
|
||||||
|
const emitItem = (item: ReadItem) => {
|
||||||
|
if (onItem && mergeReadItem(readsMap, item)) {
|
||||||
|
onItem(readsMap.get(item.id)!)
|
||||||
|
} else if (!onItem) {
|
||||||
|
readsMap.set(item.id, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Fetch all data sources in parallel
|
||||||
|
const [readingPositionEvents, markedAsReadArticles] = await Promise.all([
|
||||||
|
queryEvents(relayPool, { kinds: [KINDS.AppData], authors: [userPubkey] }, { relayUrls: RELAYS }),
|
||||||
|
fetchReadArticles(relayPool, userPubkey)
|
||||||
|
])
|
||||||
|
|
||||||
|
console.log('📊 [Reads] Data fetched:', {
|
||||||
|
readingPositions: readingPositionEvents.length,
|
||||||
|
markedAsRead: markedAsReadArticles.length,
|
||||||
|
bookmarks: bookmarks.length
|
||||||
|
})
|
||||||
|
|
||||||
|
// Process reading positions and emit items
|
||||||
|
processReadingPositions(readingPositionEvents, readsMap)
|
||||||
|
if (onItem) {
|
||||||
|
readsMap.forEach(item => {
|
||||||
|
if (item.type === 'article') onItem(item)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process marked-as-read and emit items
|
||||||
|
processMarkedAsRead(markedAsReadArticles, readsMap)
|
||||||
|
if (onItem) {
|
||||||
|
readsMap.forEach(item => {
|
||||||
|
if (item.type === 'article') onItem(item)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
// 3. Process bookmarked articles and article/website URLs
|
||||||
|
const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
|
|
||||||
|
for (const bookmark of allBookmarks) {
|
||||||
|
const bookmarkType = classifyBookmarkType(bookmark)
|
||||||
|
|
||||||
|
// Only include articles
|
||||||
|
if (bookmarkType === 'article') {
|
||||||
|
// Kind:30023 nostr article
|
||||||
|
const coordinate = bookmark.id // Already in coordinate format
|
||||||
|
const existing = readsMap.get(coordinate)
|
||||||
|
|
||||||
|
if (!existing) {
|
||||||
|
const item: ReadItem = {
|
||||||
|
id: coordinate,
|
||||||
|
source: 'bookmark',
|
||||||
|
type: 'article',
|
||||||
|
readingProgress: 0,
|
||||||
|
readingTimestamp: bookmark.added_at || bookmark.created_at
|
||||||
|
}
|
||||||
|
readsMap.set(coordinate, item)
|
||||||
|
if (onItem) emitItem(item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// 4. Fetch full event data for nostr articles
|
||||||
|
const articleCoordinates = Array.from(readsMap.values())
|
||||||
|
.filter(item => item.type === 'article' && !item.event)
|
||||||
|
.map(item => item.id)
|
||||||
|
|
||||||
|
if (articleCoordinates.length > 0) {
|
||||||
|
console.log('📖 [Reads] Fetching article events for', articleCoordinates.length, 'articles')
|
||||||
|
|
||||||
|
// Parse coordinates and fetch events
|
||||||
|
const articlesToFetch: Array<{ pubkey: string; identifier: string }> = []
|
||||||
|
|
||||||
|
for (const coord of articleCoordinates) {
|
||||||
|
try {
|
||||||
|
// Try to decode as naddr
|
||||||
|
if (coord.startsWith('naddr1')) {
|
||||||
|
const decoded = nip19.decode(coord)
|
||||||
|
if (decoded.type === 'naddr' && decoded.data.kind === KINDS.BlogPost) {
|
||||||
|
articlesToFetch.push({
|
||||||
|
pubkey: decoded.data.pubkey,
|
||||||
|
identifier: decoded.data.identifier || ''
|
||||||
|
})
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// Try coordinate format (kind:pubkey:identifier)
|
||||||
|
const parts = coord.split(':')
|
||||||
|
if (parts.length === 3 && parseInt(parts[0]) === KINDS.BlogPost) {
|
||||||
|
articlesToFetch.push({
|
||||||
|
pubkey: parts[1],
|
||||||
|
identifier: parts[2]
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Failed to decode article coordinate:', coord)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (articlesToFetch.length > 0) {
|
||||||
|
const authors = Array.from(new Set(articlesToFetch.map(a => a.pubkey)))
|
||||||
|
const identifiers = Array.from(new Set(articlesToFetch.map(a => a.identifier)))
|
||||||
|
|
||||||
|
const events = await queryEvents(
|
||||||
|
relayPool,
|
||||||
|
{ kinds: [KINDS.BlogPost], authors, '#d': identifiers },
|
||||||
|
{ relayUrls: RELAYS }
|
||||||
|
)
|
||||||
|
|
||||||
|
// Merge event data into ReadItems and emit
|
||||||
|
for (const event of events) {
|
||||||
|
const dTag = event.tags.find(t => t[0] === 'd')?.[1] || ''
|
||||||
|
const coordinate = `${KINDS.BlogPost}:${event.pubkey}:${dTag}`
|
||||||
|
|
||||||
|
const item = readsMap.get(coordinate) || readsMap.get(event.id)
|
||||||
|
if (item) {
|
||||||
|
item.event = event
|
||||||
|
item.title = getArticleTitle(event) || 'Untitled'
|
||||||
|
item.summary = getArticleSummary(event)
|
||||||
|
item.image = getArticleImage(event)
|
||||||
|
item.published = getArticlePublished(event)
|
||||||
|
item.author = event.pubkey
|
||||||
|
if (onItem) emitItem(item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// 5. Filter for Nostr articles only and apply common validation/sorting
|
||||||
|
const articles = Array.from(readsMap.values())
|
||||||
|
.filter(item => item.type === 'article')
|
||||||
|
|
||||||
|
const validArticles = filterValidItems(articles)
|
||||||
|
const sortedReads = sortByReadingActivity(validArticles)
|
||||||
|
|
||||||
|
console.log('✅ [Reads] Processed', sortedReads.length, 'total reads')
|
||||||
|
return sortedReads
|
||||||
|
|
||||||
|
} catch (error) {
|
||||||
|
console.error('Failed to fetch all reads:', error)
|
||||||
|
return []
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -52,6 +52,10 @@ export interface UserSettings {
|
|||||||
theme?: 'dark' | 'light' | 'system' // default: system
|
theme?: 'dark' | 'light' | 'system' // default: system
|
||||||
darkColorTheme?: 'black' | 'midnight' | 'charcoal' // default: midnight
|
darkColorTheme?: 'black' | 'midnight' | 'charcoal' // default: midnight
|
||||||
lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
|
lightColorTheme?: 'paper-white' | 'sepia' | 'ivory' // default: sepia
|
||||||
|
// Reading settings
|
||||||
|
paragraphAlignment?: 'left' | 'justify' // default: justify
|
||||||
|
// Reading position sync
|
||||||
|
syncReadingPosition?: boolean // default: false (opt-in)
|
||||||
}
|
}
|
||||||
|
|
||||||
export async function loadSettings(
|
export async function loadSettings(
|
||||||
|
|||||||
@@ -52,6 +52,11 @@ export async function publishEvent(
|
|||||||
})
|
})
|
||||||
.catch((error) => {
|
.catch((error) => {
|
||||||
console.warn('⚠️ Failed to publish event to relays (event still saved locally):', error)
|
console.warn('⚠️ Failed to publish event to relays (event still saved locally):', error)
|
||||||
|
|
||||||
|
// Surface common bunker signing errors for debugging
|
||||||
|
if (error instanceof Error && error.message.includes('permission')) {
|
||||||
|
console.warn('💡 Hint: This may be a bunker permission issue. Ensure your bunker connection has signing permissions.')
|
||||||
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -7,6 +7,27 @@
|
|||||||
.bookmark-content { color: var(--color-text); margin: 0.5rem 0; line-height: 1.4; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; }
|
.bookmark-content { color: var(--color-text); margin: 0.5rem 0; line-height: 1.4; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; }
|
||||||
.bookmark-meta { color: var(--color-text-secondary); font-size: 0.9rem; margin-top: 0.5rem; }
|
.bookmark-meta { color: var(--color-text-secondary); font-size: 0.9rem; margin-top: 0.5rem; }
|
||||||
|
|
||||||
|
.bookmarks-section-title {
|
||||||
|
font-size: 0.75rem !important;
|
||||||
|
font-weight: 700 !important;
|
||||||
|
text-transform: uppercase !important;
|
||||||
|
letter-spacing: 0.05em !important;
|
||||||
|
color: var(--color-text-muted) !important;
|
||||||
|
padding: 1.5rem 0.5rem 0.375rem !important;
|
||||||
|
margin: 0 !important;
|
||||||
|
border-top: 1px solid rgba(255, 255, 255, 0.05);
|
||||||
|
}
|
||||||
|
.bookmarks-section:first-of-type .bookmarks-section-title {
|
||||||
|
border-top: none;
|
||||||
|
padding-top: 0.5rem !important;
|
||||||
|
}
|
||||||
|
.bookmark-section-action {
|
||||||
|
padding: 1.5rem 0.5rem 0.375rem;
|
||||||
|
}
|
||||||
|
.bookmarks-section:first-of-type .bookmark-section-action {
|
||||||
|
padding-top: 0.5rem;
|
||||||
|
}
|
||||||
|
|
||||||
.individual-bookmarks { margin: 1rem 0; }
|
.individual-bookmarks { margin: 1rem 0; }
|
||||||
.individual-bookmarks h4 { margin: 0 0 1rem 0; font-size: 1rem; color: var(--color-text); }
|
.individual-bookmarks h4 { margin: 0 0 1rem 0; font-size: 1rem; color: var(--color-text); }
|
||||||
|
|
||||||
@@ -23,8 +44,8 @@
|
|||||||
.individual-bookmark:hover { border-color: var(--color-border); background: var(--color-bg-elevated); }
|
.individual-bookmark:hover { border-color: var(--color-border); background: var(--color-bg-elevated); }
|
||||||
|
|
||||||
/* Compact view */
|
/* Compact view */
|
||||||
.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none; border-bottom: 1px solid var(--color-bg-elevated); border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
|
.individual-bookmark.compact { padding: 0.5rem 0.5rem; background: transparent; border: none !important; border-radius: 0; box-shadow: none; width: 100%; max-width: 100%; overflow: hidden; }
|
||||||
.individual-bookmark.compact:hover { background: var(--color-bg-elevated); border-bottom-color: var(--color-border); transform: none; box-shadow: none; }
|
.individual-bookmark.compact:hover { background: var(--color-bg-elevated); transform: none; box-shadow: none; border: none !important; }
|
||||||
.compact-row { display: flex; align-items: center; gap: 0.5rem; height: 28px; width: 100%; min-width: 0; overflow: hidden; }
|
.compact-row { display: flex; align-items: center; gap: 0.5rem; height: 28px; width: 100%; min-width: 0; overflow: hidden; }
|
||||||
.compact-thumbnail { width: 24px; height: 24px; flex-shrink: 0; border-radius: 4px; overflow: hidden; background: var(--color-bg-elevated); display: flex; align-items: center; justify-content: center; }
|
.compact-thumbnail { width: 24px; height: 24px; flex-shrink: 0; border-radius: 4px; overflow: hidden; background: var(--color-bg-elevated); display: flex; align-items: center; justify-content: center; }
|
||||||
.compact-thumbnail img { width: 100%; height: 100%; object-fit: cover; }
|
.compact-thumbnail img { width: 100%; height: 100%; object-fit: cover; }
|
||||||
@@ -57,10 +78,10 @@
|
|||||||
|
|
||||||
/* Large preview view */
|
/* Large preview view */
|
||||||
.individual-bookmark.large { padding: 0; display: flex; flex-direction: column; overflow: hidden; border: 1px solid var(--color-bg-elevated); }
|
.individual-bookmark.large { padding: 0; display: flex; flex-direction: column; overflow: hidden; border: 1px solid var(--color-bg-elevated); }
|
||||||
.large-preview-image { width: 100%; height: 180px; background: var(--color-bg); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
|
.large-preview-image { width: 100%; height: 180px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); background-size: cover; background-position: center; background-repeat: no-repeat; display: flex; align-items: center; justify-content: center; cursor: pointer; transition: all 0.2s ease; border-bottom: 1px solid var(--color-border); position: relative; }
|
||||||
.large-preview-image:hover { opacity: 0.9; }
|
.large-preview-image:hover { opacity: 0.9; }
|
||||||
.large-preview-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.3) 100%); pointer-events: none; }
|
.large-preview-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.3) 100%); pointer-events: none; }
|
||||||
.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); }
|
.preview-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; }
|
||||||
.large-content { padding: 1.25rem; }
|
.large-content { padding: 1.25rem; }
|
||||||
.large-text { color: var(--color-text); font-size: 0.95rem; line-height: 1.6; margin-bottom: 1rem; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
|
.large-text { color: var(--color-text); font-size: 0.95rem; line-height: 1.6; margin-bottom: 1rem; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
|
||||||
.large-footer { display: flex; align-items: center; gap: 1rem; flex-wrap: wrap; font-size: 0.8rem; color: var(--color-text-secondary); padding-top: 0.75rem; border-top: 1px solid var(--color-border); }
|
.large-footer { display: flex; align-items: center; gap: 1rem; flex-wrap: wrap; font-size: 0.8rem; color: var(--color-text-secondary); padding-top: 0.75rem; border-top: 1px solid var(--color-border); }
|
||||||
@@ -84,10 +105,10 @@
|
|||||||
.blog-post-card.level-mine { border-color: color-mix(in srgb, var(--highlight-color-mine, #fde047) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-mine, #fde047) 25%, transparent); }
|
.blog-post-card.level-mine { border-color: color-mix(in srgb, var(--highlight-color-mine, #fde047) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-mine, #fde047) 25%, transparent); }
|
||||||
.blog-post-card.level-friends { border-color: color-mix(in srgb, var(--highlight-color-friends, #f97316) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-friends, #f97316) 25%, transparent); }
|
.blog-post-card.level-friends { border-color: color-mix(in srgb, var(--highlight-color-friends, #f97316) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-friends, #f97316) 25%, transparent); }
|
||||||
.blog-post-card.level-nostrverse { border-color: color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 25%, transparent); }
|
.blog-post-card.level-nostrverse { border-color: color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 60%, #333); box-shadow: 0 0 0 1px color-mix(in srgb, var(--highlight-color-nostrverse, #9333ea) 25%, transparent); }
|
||||||
.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: var(--color-bg-subtle); display: flex; align-items: center; justify-content: center; }
|
.blog-post-card-image { width: 100%; height: 200px; overflow: hidden; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 50%, var(--color-bg-elevated) 100%); display: flex; align-items: center; justify-content: center; position: relative; }
|
||||||
.blog-post-card-image img { width: 100%; height: 100%; object-fit: cover; transition: transform 0.3s ease; }
|
.blog-post-card-image img { width: 100%; height: 100%; object-fit: cover; transition: transform 0.3s ease; }
|
||||||
.blog-post-card:hover .blog-post-card-image img { transform: scale(1.05); }
|
.blog-post-card:hover .blog-post-card-image img { transform: scale(1.05); }
|
||||||
.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); display: flex; align-items: center; justify-content: center; }
|
.blog-post-image-placeholder { font-size: 3rem; color: var(--color-border-subtle); opacity: 0.4; display: flex; align-items: center; justify-content: center; width: 100%; height: 100%; }
|
||||||
.blog-post-card-content { padding: 1.5rem; display: flex; flex-direction: column; gap: 1rem; flex: 1; }
|
.blog-post-card-content { padding: 1.5rem; display: flex; flex-direction: column; gap: 1rem; flex: 1; }
|
||||||
.blog-post-card-title { font-size: 1.25rem; font-weight: 600; margin: 0; color: var(--color-text); line-height: 1.4; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
|
.blog-post-card-title { font-size: 1.25rem; font-weight: 600; margin: 0; color: var(--color-text); line-height: 1.4; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; }
|
||||||
.blog-post-card-summary { font-size: 0.875rem; color: var(--color-text-secondary); margin: 0; line-height: 1.6; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; flex: 1; }
|
.blog-post-card-summary { font-size: 0.875rem; color: var(--color-text-secondary); margin: 0; line-height: 1.6; overflow: hidden; text-overflow: ellipsis; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; flex: 1; }
|
||||||
|
|||||||
@@ -3,7 +3,7 @@
|
|||||||
.setting-group.setting-inline { display: flex; align-items: center; gap: 1rem; }
|
.setting-group.setting-inline { display: flex; align-items: center; gap: 1rem; }
|
||||||
.setting-label { text-align: left; flex: 1; }
|
.setting-label { text-align: left; flex: 1; }
|
||||||
.setting-control { display: flex; justify-content: flex-end; align-items: center; }
|
.setting-control { display: flex; justify-content: flex-end; align-items: center; }
|
||||||
.setting-group.setting-inline label { margin-bottom: 0; }
|
.setting-group.setting-inline label { margin-bottom: 0; min-width: 220px; }
|
||||||
.setting-group label { display: block; margin-bottom: 0.5rem; color: var(--color-text); font-weight: 500; text-align: left; }
|
.setting-group label { display: block; margin-bottom: 0.5rem; color: var(--color-text); font-weight: 500; text-align: left; }
|
||||||
.setting-buttons { display: flex; align-items: center; gap: 0.5rem; }
|
.setting-buttons { display: flex; align-items: center; gap: 0.5rem; }
|
||||||
.color-picker { display: flex; align-items: center; gap: 0.5rem; }
|
.color-picker { display: flex; align-items: center; gap: 0.5rem; }
|
||||||
@@ -41,6 +41,7 @@
|
|||||||
.preview-content p {
|
.preview-content p {
|
||||||
margin: 0.75rem 0;
|
margin: 0.75rem 0;
|
||||||
word-wrap: break-word;
|
word-wrap: break-word;
|
||||||
|
text-align: var(--paragraph-alignment, justify);
|
||||||
}
|
}
|
||||||
.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
|
.setting-select { width: 100%; padding: 0.5rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 4px; color: var(--color-text); font-size: 1rem; }
|
||||||
.setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
|
.setting-inline .setting-select { width: auto; min-width: 200px; flex: 1; }
|
||||||
@@ -58,6 +59,10 @@
|
|||||||
gap: 0.75rem;
|
gap: 0.75rem;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.setting-group.setting-inline label {
|
||||||
|
min-width: unset;
|
||||||
|
}
|
||||||
|
|
||||||
.setting-inline .setting-select {
|
.setting-inline .setting-select {
|
||||||
width: 100%;
|
width: 100%;
|
||||||
min-width: unset;
|
min-width: unset;
|
||||||
|
|||||||
@@ -67,6 +67,10 @@
|
|||||||
width: 100%;
|
width: 100%;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.me-tab-content:has(.bookmark-filters) {
|
||||||
|
padding-top: 0.25rem;
|
||||||
|
}
|
||||||
|
|
||||||
/* Align highlight list width with profile card width on /me */
|
/* Align highlight list width with profile card width on /me */
|
||||||
.me-highlights-list { padding-left: 0; padding-right: 0; }
|
.me-highlights-list { padding-left: 0; padding-right: 0; }
|
||||||
.explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
|
.explore-header .author-card { max-width: 600px; margin: 0 auto; width: 100%; }
|
||||||
@@ -79,6 +83,15 @@
|
|||||||
text-align: left; /* Override center alignment from .app */
|
text-align: left; /* Override center alignment from .app */
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/* Bookmark filters in Me page */
|
||||||
|
.me-tab-content .bookmark-filters {
|
||||||
|
background: transparent;
|
||||||
|
border: none;
|
||||||
|
padding: 0;
|
||||||
|
justify-content: center;
|
||||||
|
margin-bottom: 0.25rem;
|
||||||
|
}
|
||||||
|
|
||||||
/* Ensure all reading list elements are left-aligned */
|
/* Ensure all reading list elements are left-aligned */
|
||||||
.bookmarks-list .individual-bookmark,
|
.bookmarks-list .individual-bookmark,
|
||||||
.bookmarks-list .individual-bookmark * {
|
.bookmarks-list .individual-bookmark * {
|
||||||
|
|||||||
@@ -25,3 +25,23 @@
|
|||||||
.btn-primary:hover:not(:disabled) { background: var(--color-primary-hover); }
|
.btn-primary:hover:not(:disabled) { background: var(--color-primary-hover); }
|
||||||
.btn-primary:disabled { opacity: 0.6; cursor: not-allowed; }
|
.btn-primary:disabled { opacity: 0.6; cursor: not-allowed; }
|
||||||
|
|
||||||
|
/* Confirm Dialog */
|
||||||
|
.confirm-dialog-overlay { position: fixed; inset: 0; background: rgba(0, 0, 0, 0.7); backdrop-filter: blur(4px); display: flex; align-items: center; justify-content: center; z-index: 10000; padding: 1rem; }
|
||||||
|
.confirm-dialog { background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 12px; max-width: 400px; width: 100%; padding: 1.5rem; box-shadow: 0 8px 32px rgba(0, 0, 0, 0.5); }
|
||||||
|
.confirm-dialog-icon { display: flex; align-items: center; justify-content: center; width: 48px; height: 48px; border-radius: 50%; margin: 0 auto 1rem; font-size: 1.5rem; }
|
||||||
|
.confirm-dialog-icon.danger { background: rgba(220, 38, 38, 0.1); color: rgb(220 38 38); }
|
||||||
|
.confirm-dialog-icon.warning { background: rgba(251, 191, 36, 0.1); color: rgb(251 191 36); }
|
||||||
|
.confirm-dialog-icon.info { background: rgba(59, 130, 246, 0.1); color: rgb(59 130 246); }
|
||||||
|
.confirm-dialog-title { margin: 0 0 0.5rem 0; font-size: 1.25rem; font-weight: 600; color: var(--color-text); text-align: center; }
|
||||||
|
.confirm-dialog-message { margin: 0 0 1.5rem 0; font-size: 0.9rem; color: var(--color-text-secondary); text-align: center; line-height: 1.5; }
|
||||||
|
.confirm-dialog-actions { display: flex; gap: 0.75rem; }
|
||||||
|
.confirm-dialog-btn { flex: 1; padding: 0.75rem 1rem; border: none; border-radius: 8px; font-size: 0.9rem; font-weight: 500; cursor: pointer; transition: all 0.2s; }
|
||||||
|
.confirm-dialog-btn.cancel { background: var(--color-bg); border: 1px solid var(--color-border); color: var(--color-text); }
|
||||||
|
.confirm-dialog-btn.cancel:hover { background: var(--color-border); }
|
||||||
|
.confirm-dialog-btn.confirm.danger { background: rgb(220 38 38); color: white; }
|
||||||
|
.confirm-dialog-btn.confirm.danger:hover { background: rgb(185 28 28); }
|
||||||
|
.confirm-dialog-btn.confirm.warning { background: rgb(251 191 36); color: rgb(17 24 39); }
|
||||||
|
.confirm-dialog-btn.confirm.warning:hover { background: rgb(245 158 11); }
|
||||||
|
.confirm-dialog-btn.confirm.info { background: rgb(59 130 246); color: white; }
|
||||||
|
.confirm-dialog-btn.confirm.info:hover { background: rgb(37 99 235); }
|
||||||
|
|
||||||
|
|||||||
@@ -30,16 +30,29 @@
|
|||||||
.reader-meta { display: flex; align-items: center; gap: 0.75rem; flex-wrap: wrap; }
|
.reader-meta { display: flex; align-items: center; gap: 0.75rem; flex-wrap: wrap; }
|
||||||
.publish-date { display: flex; align-items: center; gap: 0.4rem; font-size: 0.813rem; color: var(--color-text-muted); opacity: 0.85; }
|
.publish-date { display: flex; align-items: center; gap: 0.4rem; font-size: 0.813rem; color: var(--color-text-muted); opacity: 0.85; }
|
||||||
.publish-date svg { font-size: 0.75rem; opacity: 0.6; }
|
.publish-date svg { font-size: 0.75rem; opacity: 0.6; }
|
||||||
.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; text-shadow: 0 2px 4px rgba(0, 0, 0, 0.5); z-index: 10; }
|
.publish-date-topright { position: absolute; top: 1rem; right: 1rem; font-size: 0.813rem; color: var(--color-text); padding: 0.4rem 0.75rem; z-index: 10; }
|
||||||
.reading-time { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 6px; font-size: 0.875rem; color: var(--color-text-secondary); }
|
.reading-time { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: var(--color-bg-elevated); border: 1px solid var(--color-border); border-radius: 6px; font-size: 0.875rem; color: var(--color-text-secondary); }
|
||||||
.reading-time svg { font-size: 0.875rem; }
|
.reading-time svg { font-size: 0.875rem; }
|
||||||
.highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
|
.highlight-indicator { display: flex; align-items: center; gap: 0.5rem; padding: 0.375rem 0.75rem; background: rgba(99, 102, 241, 0.1); border: 1px solid rgba(99, 102, 241, 0.3); border-radius: 6px; font-size: 0.875rem; color: var(--color-text); }
|
||||||
.highlight-indicator svg { font-size: 0.875rem; }
|
.highlight-indicator svg { font-size: 0.875rem; }
|
||||||
.reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
.reader-html { color: var(--color-text); line-height: 1.6; word-wrap: break-word; overflow-wrap: break-word; word-break: break-word; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
||||||
.reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
.reader-markdown { color: var(--color-text); line-height: 1.7; font-family: var(--reading-font); font-size: var(--reading-font-size); }
|
||||||
/* Ensure content is left-aligned even if source markup uses center */
|
/* Ensure font inheritance */
|
||||||
.reader .reader-html *, .reader .reader-markdown * { text-align: left !important; font-family: inherit !important; }
|
.reader .reader-html *, .reader .reader-markdown * { font-family: inherit !important; }
|
||||||
.reader center, .reader [align="center"] { text-align: left !important; }
|
/* Apply paragraph alignment from settings */
|
||||||
|
.reader .reader-html p,
|
||||||
|
.reader .reader-markdown p,
|
||||||
|
.reader .reader-html div,
|
||||||
|
.reader .reader-markdown div,
|
||||||
|
.reader .reader-html li,
|
||||||
|
.reader .reader-markdown li,
|
||||||
|
.reader .reader-html blockquote,
|
||||||
|
.reader .reader-markdown blockquote { text-align: var(--paragraph-alignment, justify); }
|
||||||
|
/* Override centered content with user preference */
|
||||||
|
.reader center, .reader [align="center"] { text-align: var(--paragraph-alignment, justify) !important; }
|
||||||
|
/* Keep headings left-aligned */
|
||||||
|
.reader .reader-html h1, .reader .reader-html h2, .reader .reader-html h3, .reader .reader-html h4, .reader .reader-html h5, .reader .reader-html h6,
|
||||||
|
.reader .reader-markdown h1, .reader .reader-markdown h2, .reader .reader-markdown h3, .reader .reader-markdown h4, .reader .reader-markdown h5, .reader .reader-markdown h6 { text-align: left !important; }
|
||||||
/* Tame images from external content */
|
/* Tame images from external content */
|
||||||
.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
|
.reader .reader-html img, .reader .reader-markdown img { max-width: 100%; max-height: 70vh; height: auto; width: auto; display: block; margin: 0.75rem 0; border-radius: 6px; }
|
||||||
/* Headlines with Tailwind typography */
|
/* Headlines with Tailwind typography */
|
||||||
@@ -192,6 +205,7 @@
|
|||||||
.article-menu-btn { background: none; border: none; color: var(--color-text-secondary); cursor: pointer; padding: 0.5rem 0.75rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.5rem; transition: all 0.2s ease; border-radius: 6px; }
|
.article-menu-btn { background: none; border: none; color: var(--color-text-secondary); cursor: pointer; padding: 0.5rem 0.75rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.5rem; transition: all 0.2s ease; border-radius: 6px; }
|
||||||
.article-menu-btn:hover { color: var(--color-primary); background: rgba(99, 102, 241, 0.1); }
|
.article-menu-btn:hover { color: var(--color-primary); background: rgba(99, 102, 241, 0.1); }
|
||||||
.article-menu { position: absolute; right: 0; top: calc(100% + 4px); background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 6px; box-shadow: 0 4px 12px rgba(0, 0, 0, 0.3); z-index: 1000; min-width: 180px; overflow: hidden; }
|
.article-menu { position: absolute; right: 0; top: calc(100% + 4px); background: var(--color-bg-elevated); border: 1px solid var(--color-border-subtle); border-radius: 6px; box-shadow: 0 4px 12px rgba(0, 0, 0, 0.3); z-index: 1000; min-width: 180px; overflow: hidden; }
|
||||||
|
.article-menu.open-upward { top: auto; bottom: calc(100% + 4px); }
|
||||||
.article-menu-item { width: 100%; background: none; border: none; color: var(--color-text); padding: 0.75rem 1rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.75rem; cursor: pointer; transition: all 0.15s ease; text-align: left; white-space: nowrap; }
|
.article-menu-item { width: 100%; background: none; border: none; color: var(--color-text); padding: 0.75rem 1rem; font-size: 0.875rem; display: flex; align-items: center; gap: 0.75rem; cursor: pointer; transition: all 0.15s ease; text-align: left; white-space: nowrap; }
|
||||||
.article-menu-item:hover { background: rgba(99, 102, 241, 0.15); color: var(--color-text); }
|
.article-menu-item:hover { background: rgba(99, 102, 241, 0.15); color: var(--color-text); }
|
||||||
.article-menu-item svg { font-size: 0.875rem; flex-shrink: 0; }
|
.article-menu-item svg { font-size: 0.875rem; flex-shrink: 0; }
|
||||||
@@ -221,8 +235,9 @@
|
|||||||
.article-hero-image { width: 100%; height: 200px; background-size: cover; background-position: center; background-repeat: no-repeat; cursor: pointer; transition: all 0.2s ease; border-radius: 8px 8px 0 0; position: relative; }
|
.article-hero-image { width: 100%; height: 200px; background-size: cover; background-position: center; background-repeat: no-repeat; cursor: pointer; transition: all 0.2s ease; border-radius: 8px 8px 0 0; position: relative; }
|
||||||
.article-hero-image:hover { opacity: 0.9; }
|
.article-hero-image:hover { opacity: 0.9; }
|
||||||
.article-hero-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.4) 100%); pointer-events: none; border-radius: 8px 8px 0 0; }
|
.article-hero-image::after { content: ''; position: absolute; inset: 0; background: linear-gradient(to bottom, transparent 60%, rgba(0,0,0,0.4) 100%); pointer-events: none; border-radius: 8px 8px 0 0; }
|
||||||
.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; }
|
.reader-hero-image { width: calc(100% + 1.5rem); margin: -0.75rem -0.75rem 2rem -0.75rem; border-radius: 0; overflow: hidden; position: relative; min-height: 300px; background: linear-gradient(135deg, var(--color-bg-elevated) 0%, var(--color-bg-subtle) 25%, var(--color-bg-elevated) 50%, var(--color-bg-subtle) 75%, var(--color-bg-elevated) 100%); }
|
||||||
.reader-hero-image img { width: 100%; height: auto; max-height: 500px; object-fit: cover; display: block; }
|
.reader-hero-image img { width: 100%; height: auto; max-height: 500px; object-fit: cover; display: block; }
|
||||||
|
.reader-hero-placeholder { width: 100%; height: 300px; display: flex; align-items: center; justify-content: center; font-size: 4rem; color: var(--color-border-subtle); opacity: 0.3; }
|
||||||
.reader-header-overlay { position: absolute; bottom: 0; left: 0; right: 0; padding: 2rem 2rem 1.5rem; background: linear-gradient(to top, rgba(0, 0, 0, 0.85) 0%, rgba(0, 0, 0, 0.6) 60%, rgba(0, 0, 0, 0) 100%); }
|
.reader-header-overlay { position: absolute; bottom: 0; left: 0; right: 0; padding: 2rem 2rem 1.5rem; background: linear-gradient(to top, rgba(0, 0, 0, 0.85) 0%, rgba(0, 0, 0, 0.6) 60%, rgba(0, 0, 0, 0) 100%); }
|
||||||
.reader-header-overlay .reader-title { color: #fff; text-shadow: 0 2px 8px rgba(0, 0, 0, 0.5); margin-bottom: 0.75rem; font-size: 2.5rem; font-weight: 700; line-height: 1.2; }
|
.reader-header-overlay .reader-title { color: #fff; text-shadow: 0 2px 8px rgba(0, 0, 0, 0.5); margin-bottom: 0.75rem; font-size: 2.5rem; font-weight: 700; line-height: 1.2; }
|
||||||
.reader-header-overlay .reader-summary { color: rgba(255, 255, 255, 0.9); font-size: 1.2rem; line-height: 1.6; margin: 0 0 1rem 0; text-shadow: 0 1px 4px rgba(0, 0, 0, 0.4); font-family: var(--reading-font); }
|
.reader-header-overlay .reader-summary { color: rgba(255, 255, 255, 0.9); font-size: 1.2rem; line-height: 1.6; margin: 0 0 1rem 0; text-shadow: 0 1px 4px rgba(0, 0, 0, 0.4); font-family: var(--reading-font); }
|
||||||
|
|||||||
@@ -1,9 +1,9 @@
|
|||||||
/* Settings view containers */
|
/* Settings view containers */
|
||||||
.settings-view { display: flex; flex-direction: column; height: 100%; overflow: hidden; padding: 0.75rem 1rem; text-align: left; }
|
.settings-view { display: flex; flex-direction: column; height: 100%; overflow: hidden; padding: 0.75rem 1rem; text-align: left; }
|
||||||
.settings-header { display: flex; align-items: center; justify-content: space-between; margin-bottom: 1.5rem; padding: 0; }
|
.settings-header { display: flex; align-items: center; justify-content: space-between; padding: 0; max-width: 900px; margin: 0 auto 1.5rem auto; width: 100%; }
|
||||||
.settings-header h2 { margin: 0; font-size: 1.5rem; font-weight: 600; text-align: left; }
|
.settings-header h2 { margin: 0; font-size: 1.5rem; font-weight: 600; text-align: left; }
|
||||||
.settings-header-actions { display: flex; gap: 0.5rem; align-items: center; }
|
.settings-header-actions { display: flex; gap: 0.5rem; align-items: center; }
|
||||||
.settings-content { overflow-y: auto; flex: 1; margin-bottom: 1rem; text-align: left; padding: 0 0.25rem 2rem 0.25rem; }
|
.settings-content { overflow-y: auto; flex: 1; text-align: left; padding: 0 0.25rem 2rem 0.25rem; max-width: 900px; margin: 0 auto 1rem auto; width: 100%; }
|
||||||
.settings-section { margin-bottom: 2.5rem; }
|
.settings-section { margin-bottom: 2.5rem; }
|
||||||
.settings-section:last-child { margin-bottom: 0; }
|
.settings-section:last-child { margin-bottom: 0; }
|
||||||
.section-title { font-size: 1rem; font-weight: 600; color: var(--color-text); margin: 0 0 1rem 0; padding-bottom: 0.5rem; border-bottom: 1px solid var(--color-border); text-transform: uppercase; letter-spacing: 0.05em; }
|
.section-title { font-size: 1rem; font-weight: 600; color: var(--color-text); margin: 0 0 1rem 0; padding-bottom: 0.5rem; border-bottom: 1px solid var(--color-border); text-transform: uppercase; letter-spacing: 0.05em; }
|
||||||
@@ -19,6 +19,7 @@
|
|||||||
/* Zap splits preset buttons */
|
/* Zap splits preset buttons */
|
||||||
.zap-preset-buttons { display: flex; gap: 0.5rem; flex-wrap: wrap; }
|
.zap-preset-buttons { display: flex; gap: 0.5rem; flex-wrap: wrap; }
|
||||||
.zap-preset-btn {
|
.zap-preset-btn {
|
||||||
|
flex: 1;
|
||||||
padding: 0.625rem 1.25rem;
|
padding: 0.625rem 1.25rem;
|
||||||
background: var(--color-bg-elevated);
|
background: var(--color-bg-elevated);
|
||||||
border: 1px solid var(--color-border-subtle);
|
border: 1px solid var(--color-border-subtle);
|
||||||
@@ -54,35 +55,56 @@
|
|||||||
width: 100%;
|
width: 100%;
|
||||||
height: 8px;
|
height: 8px;
|
||||||
border-radius: 4px;
|
border-radius: 4px;
|
||||||
background: var(--color-bg-elevated);
|
background: linear-gradient(
|
||||||
|
to right,
|
||||||
|
color-mix(in srgb, var(--highlight-color) 50%, transparent) 0%,
|
||||||
|
color-mix(in srgb, var(--highlight-color) 50%, transparent) 50%,
|
||||||
|
color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 50%,
|
||||||
|
color-mix(in srgb, var(--highlight-color-friends) 50%, transparent) 100%
|
||||||
|
);
|
||||||
outline: none;
|
outline: none;
|
||||||
-webkit-appearance: none;
|
-webkit-appearance: none;
|
||||||
|
position: relative;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-webkit-slider-thumb {
|
.zap-split-slider::-webkit-slider-thumb {
|
||||||
-webkit-appearance: none;
|
-webkit-appearance: none;
|
||||||
appearance: none;
|
appearance: none;
|
||||||
width: 20px;
|
width: 24px;
|
||||||
height: 20px;
|
height: 24px;
|
||||||
border-radius: 50%;
|
border-radius: 4px;
|
||||||
background: var(--color-primary);
|
background-color: var(--color-primary);
|
||||||
|
background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
|
||||||
|
background-size: 14px 14px;
|
||||||
|
background-repeat: no-repeat;
|
||||||
|
background-position: center center;
|
||||||
cursor: pointer;
|
cursor: pointer;
|
||||||
transition: all 0.2s ease;
|
transition: all 0.2s ease;
|
||||||
|
position: relative;
|
||||||
|
top: 0;
|
||||||
|
margin-top: 0;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-webkit-slider-thumb:hover {
|
.zap-split-slider::-webkit-slider-thumb:hover {
|
||||||
background: var(--color-primary-hover);
|
background-color: var(--color-primary-hover);
|
||||||
transform: scale(1.1);
|
transform: scale(1.1);
|
||||||
}
|
}
|
||||||
.zap-split-slider::-moz-range-thumb {
|
.zap-split-slider::-moz-range-thumb {
|
||||||
width: 20px;
|
width: 24px;
|
||||||
height: 20px;
|
height: 24px;
|
||||||
border-radius: 50%;
|
border-radius: 4px;
|
||||||
background: var(--color-primary);
|
background-color: var(--color-primary);
|
||||||
|
background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M13 2L3 14h8l-1 8 10-12h-8l1-8z'/%3E%3C/svg%3E");
|
||||||
|
background-size: 14px 14px;
|
||||||
|
background-repeat: no-repeat;
|
||||||
|
background-position: center center;
|
||||||
cursor: pointer;
|
cursor: pointer;
|
||||||
border: none;
|
border: none;
|
||||||
transition: all 0.2s ease;
|
transition: all 0.2s ease;
|
||||||
|
position: relative;
|
||||||
|
top: 0;
|
||||||
|
margin-top: 0;
|
||||||
}
|
}
|
||||||
.zap-split-slider::-moz-range-thumb:hover {
|
.zap-split-slider::-moz-range-thumb:hover {
|
||||||
background: var(--color-primary-hover);
|
background-color: var(--color-primary-hover);
|
||||||
transform: scale(1.1);
|
transform: scale(1.1);
|
||||||
}
|
}
|
||||||
.zap-split-description {
|
.zap-split-description {
|
||||||
|
|||||||
@@ -81,7 +81,14 @@
|
|||||||
.view-mode-controls {
|
.view-mode-controls {
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
justify-content: center;
|
justify-content: space-between;
|
||||||
|
gap: 0.5rem;
|
||||||
|
}
|
||||||
|
|
||||||
|
.view-mode-left,
|
||||||
|
.view-mode-right {
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
gap: 0.5rem;
|
gap: 0.5rem;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -169,3 +176,38 @@
|
|||||||
.read-inline-btn { background: rgb(34 197 94); /* green-500 */ color: white; border: none; padding: 0.25rem 0.5rem; border-radius: 4px; cursor: pointer; }
|
.read-inline-btn { background: rgb(34 197 94); /* green-500 */ color: white; border: none; padding: 0.25rem 0.5rem; border-radius: 4px; cursor: pointer; }
|
||||||
.read-inline-btn:hover { background: rgb(22 163 74); /* green-600 */ }
|
.read-inline-btn:hover { background: rgb(22 163 74); /* green-600 */ }
|
||||||
|
|
||||||
|
/* Bookmark filters */
|
||||||
|
.bookmark-filters {
|
||||||
|
display: flex;
|
||||||
|
gap: 0.5rem;
|
||||||
|
padding: 0.5rem 1rem;
|
||||||
|
border-bottom: 1px solid var(--color-border);
|
||||||
|
background: var(--color-bg);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn {
|
||||||
|
background: transparent;
|
||||||
|
color: var(--color-text-secondary);
|
||||||
|
border: none;
|
||||||
|
padding: 0.375rem;
|
||||||
|
border-radius: 4px;
|
||||||
|
cursor: pointer;
|
||||||
|
transition: all 0.15s ease;
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
|
justify-content: center;
|
||||||
|
font-size: 0.875rem;
|
||||||
|
min-width: 32px;
|
||||||
|
min-height: 32px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn:hover {
|
||||||
|
color: var(--color-text);
|
||||||
|
background: var(--color-bg-elevated);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bookmark-filters .filter-btn.active {
|
||||||
|
color: var(--color-primary);
|
||||||
|
background: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -42,6 +42,14 @@ export interface IndividualBookmark {
|
|||||||
encryptedContent?: string
|
encryptedContent?: string
|
||||||
// When the item was added to the bookmark list (synthetic, for sorting)
|
// When the item was added to the bookmark list (synthetic, for sorting)
|
||||||
added_at?: number
|
added_at?: number
|
||||||
|
// The kind of the source list/set that produced this bookmark (e.g., 10003, 30003, 30001, or 39701 for web)
|
||||||
|
sourceKind?: number
|
||||||
|
// The 'd' tag value from kind 30003 bookmark sets
|
||||||
|
setName?: string
|
||||||
|
// Metadata from the bookmark set event (kind 30003)
|
||||||
|
setTitle?: string
|
||||||
|
setDescription?: string
|
||||||
|
setImage?: string
|
||||||
}
|
}
|
||||||
|
|
||||||
export interface ActiveAccount {
|
export interface ActiveAccount {
|
||||||
|
|||||||
42
src/utils/bookmarkTypeClassifier.ts
Normal file
42
src/utils/bookmarkTypeClassifier.ts
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
import { IndividualBookmark } from '../types/bookmarks'
|
||||||
|
import { extractUrlsFromContent } from '../services/bookmarkHelpers'
|
||||||
|
import { classifyUrl } from './helpers'
|
||||||
|
|
||||||
|
export type BookmarkType = 'article' | 'external' | 'video' | 'note' | 'web'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Classifies a bookmark into one of the content types
|
||||||
|
*/
|
||||||
|
export function classifyBookmarkType(bookmark: IndividualBookmark): BookmarkType {
|
||||||
|
// Kind 30023 is always a nostr-native article
|
||||||
|
if (bookmark.kind === 30023) return 'article'
|
||||||
|
|
||||||
|
const isWebBookmark = bookmark.kind === 39701
|
||||||
|
const webBookmarkUrl = isWebBookmark ? bookmark.tags.find(t => t[0] === 'd')?.[1] : null
|
||||||
|
|
||||||
|
const extractedUrls = webBookmarkUrl
|
||||||
|
? [webBookmarkUrl.startsWith('http') ? webBookmarkUrl : `https://${webBookmarkUrl}`]
|
||||||
|
: extractUrlsFromContent(bookmark.content)
|
||||||
|
|
||||||
|
const firstUrl = extractedUrls[0]
|
||||||
|
if (!firstUrl) return 'note'
|
||||||
|
|
||||||
|
const urlType = classifyUrl(firstUrl)?.type
|
||||||
|
|
||||||
|
if (urlType === 'youtube' || urlType === 'video') return 'video'
|
||||||
|
if (urlType === 'article') return 'external' // External article links
|
||||||
|
|
||||||
|
return 'web'
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters bookmarks by type
|
||||||
|
*/
|
||||||
|
export function filterBookmarksByType(
|
||||||
|
bookmarks: IndividualBookmark[],
|
||||||
|
filterType: 'all' | BookmarkType
|
||||||
|
): IndividualBookmark[] {
|
||||||
|
if (filterType === 'all') return bookmarks
|
||||||
|
return bookmarks.filter(bookmark => classifyBookmarkType(bookmark) === filterType)
|
||||||
|
}
|
||||||
|
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
import React from 'react'
|
import React from 'react'
|
||||||
import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
|
import { formatDistanceToNow, differenceInSeconds, differenceInMinutes, differenceInHours, differenceInDays, differenceInMonths, differenceInYears } from 'date-fns'
|
||||||
import { ParsedContent, ParsedNode } from '../types/bookmarks'
|
import { ParsedContent, ParsedNode, IndividualBookmark } from '../types/bookmarks'
|
||||||
import ResolvedMention from '../components/ResolvedMention'
|
import ResolvedMention from '../components/ResolvedMention'
|
||||||
// Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
|
// Note: ContentWithResolvedProfiles is imported by components directly to keep this file component-only for fast refresh
|
||||||
|
|
||||||
@@ -82,3 +82,73 @@ export const renderParsedContent = (parsedContent: ParsedContent) => {
|
|||||||
</div>
|
</div>
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Sorting and grouping for bookmarks
|
||||||
|
export const sortIndividualBookmarks = (items: IndividualBookmark[]) => {
|
||||||
|
return items
|
||||||
|
.slice()
|
||||||
|
.sort((a, b) => ((b.added_at || 0) - (a.added_at || 0)) || ((b.created_at || 0) - (a.created_at || 0)))
|
||||||
|
}
|
||||||
|
|
||||||
|
export function groupIndividualBookmarks(items: IndividualBookmark[]) {
|
||||||
|
const sorted = sortIndividualBookmarks(items)
|
||||||
|
const web = sorted.filter(i => i.kind === 39701 || i.type === 'web')
|
||||||
|
// Only non-encrypted legacy bookmarks go to the amethyst section
|
||||||
|
const amethyst = sorted.filter(i => i.sourceKind === 30001 && !i.isPrivate)
|
||||||
|
const isIn = (list: IndividualBookmark[], x: IndividualBookmark) => list.some(i => i.id === x.id)
|
||||||
|
// Private items include encrypted legacy bookmarks
|
||||||
|
const privateItems = sorted.filter(i => i.isPrivate && !isIn(web, i))
|
||||||
|
const publicItems = sorted.filter(i => !i.isPrivate && !isIn(amethyst, i) && !isIn(web, i))
|
||||||
|
return { privateItems, publicItems, web, amethyst }
|
||||||
|
}
|
||||||
|
|
||||||
|
// Simple filter: only exclude bookmarks with empty/whitespace-only content
|
||||||
|
export function hasContent(bookmark: IndividualBookmark): boolean {
|
||||||
|
return !!(bookmark.content && bookmark.content.trim().length > 0)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Bookmark sets helpers (kind 30003)
|
||||||
|
export interface BookmarkSet {
|
||||||
|
name: string
|
||||||
|
title?: string
|
||||||
|
description?: string
|
||||||
|
image?: string
|
||||||
|
bookmarks: IndividualBookmark[]
|
||||||
|
}
|
||||||
|
|
||||||
|
export function getBookmarkSets(items: IndividualBookmark[]): BookmarkSet[] {
|
||||||
|
// Group bookmarks by setName
|
||||||
|
const setMap = new Map<string, IndividualBookmark[]>()
|
||||||
|
|
||||||
|
items.forEach(bookmark => {
|
||||||
|
if (bookmark.setName) {
|
||||||
|
const existing = setMap.get(bookmark.setName) || []
|
||||||
|
existing.push(bookmark)
|
||||||
|
setMap.set(bookmark.setName, existing)
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
// Convert to array and extract metadata from the bookmarks
|
||||||
|
const sets: BookmarkSet[] = []
|
||||||
|
setMap.forEach((bookmarks, name) => {
|
||||||
|
// Get metadata from the first bookmark (all bookmarks in a set share the same metadata)
|
||||||
|
const firstBookmark = bookmarks[0]
|
||||||
|
const title = firstBookmark?.setTitle
|
||||||
|
const description = firstBookmark?.setDescription
|
||||||
|
const image = firstBookmark?.setImage
|
||||||
|
|
||||||
|
sets.push({
|
||||||
|
name,
|
||||||
|
title,
|
||||||
|
description,
|
||||||
|
image,
|
||||||
|
bookmarks: sortIndividualBookmarks(bookmarks)
|
||||||
|
})
|
||||||
|
})
|
||||||
|
|
||||||
|
return sets.sort((a, b) => a.name.localeCompare(b.name))
|
||||||
|
}
|
||||||
|
|
||||||
|
export function getBookmarksWithoutSet(items: IndividualBookmark[]): IndividualBookmark[] {
|
||||||
|
return sortIndividualBookmarks(items.filter(b => !b.setName))
|
||||||
|
}
|
||||||
|
|||||||
36
src/utils/debugBus.ts
Normal file
36
src/utils/debugBus.ts
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
export type DebugLevel = 'info' | 'warn' | 'error'
|
||||||
|
|
||||||
|
export interface DebugLogEntry {
|
||||||
|
ts: number
|
||||||
|
level: DebugLevel
|
||||||
|
source: string
|
||||||
|
message: string
|
||||||
|
data?: unknown
|
||||||
|
}
|
||||||
|
|
||||||
|
type Listener = (entry: DebugLogEntry) => void
|
||||||
|
|
||||||
|
const listeners = new Set<Listener>()
|
||||||
|
const buffer: DebugLogEntry[] = []
|
||||||
|
const MAX_BUFFER = 300
|
||||||
|
|
||||||
|
export const DebugBus = {
|
||||||
|
log(level: DebugLevel, source: string, message: string, data?: unknown): void {
|
||||||
|
const entry: DebugLogEntry = { ts: Date.now(), level, source, message, data }
|
||||||
|
buffer.push(entry)
|
||||||
|
if (buffer.length > MAX_BUFFER) buffer.shift()
|
||||||
|
listeners.forEach(l => {
|
||||||
|
try { l(entry) } catch (err) { console.warn('[DebugBus] listener error:', err) }
|
||||||
|
})
|
||||||
|
},
|
||||||
|
info(source: string, message: string, data?: unknown): void { this.log('info', source, message, data) },
|
||||||
|
warn(source: string, message: string, data?: unknown): void { this.log('warn', source, message, data) },
|
||||||
|
error(source: string, message: string, data?: unknown): void { this.log('error', source, message, data) },
|
||||||
|
subscribe(listener: Listener): () => void {
|
||||||
|
listeners.add(listener)
|
||||||
|
return () => listeners.delete(listener)
|
||||||
|
},
|
||||||
|
snapshot(): DebugLogEntry[] { return buffer.slice() }
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
69
src/utils/linksFromBookmarks.ts
Normal file
69
src/utils/linksFromBookmarks.ts
Normal file
@@ -0,0 +1,69 @@
|
|||||||
|
import { Bookmark } from '../types/bookmarks'
|
||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { fallbackTitleFromUrl } from './readItemMerge'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Derives ReadItems from bookmarks for external URLs:
|
||||||
|
* - Web bookmarks (kind:39701)
|
||||||
|
* - Any bookmark with http(s) URLs in content or urlReferences
|
||||||
|
*/
|
||||||
|
export function deriveLinksFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
|
||||||
|
const linksMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
|
|
||||||
|
for (const bookmark of allBookmarks) {
|
||||||
|
const urls: string[] = []
|
||||||
|
|
||||||
|
// Web bookmarks (kind:39701) - extract from 'd' tag
|
||||||
|
if (bookmark.kind === KINDS.WebBookmark) {
|
||||||
|
const dTag = bookmark.tags.find(t => t[0] === 'd')?.[1]
|
||||||
|
if (dTag) {
|
||||||
|
const url = dTag.startsWith('http') ? dTag : `https://${dTag}`
|
||||||
|
urls.push(url)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Extract URLs from content if not already captured
|
||||||
|
if (bookmark.content) {
|
||||||
|
const urlRegex = /(https?:\/\/[^\s]+)/g
|
||||||
|
const matches = bookmark.content.match(urlRegex)
|
||||||
|
if (matches) {
|
||||||
|
urls.push(...matches)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Extract metadata from tags (for web bookmarks and other types)
|
||||||
|
const title = bookmark.tags.find(t => t[0] === 'title')?.[1]
|
||||||
|
const summary = bookmark.tags.find(t => t[0] === 'summary')?.[1]
|
||||||
|
const image = bookmark.tags.find(t => t[0] === 'image')?.[1]
|
||||||
|
|
||||||
|
// Create ReadItem for each unique URL
|
||||||
|
for (const url of [...new Set(urls)]) {
|
||||||
|
if (!linksMap.has(url)) {
|
||||||
|
const item: ReadItem = {
|
||||||
|
id: url,
|
||||||
|
source: 'bookmark',
|
||||||
|
type: 'external',
|
||||||
|
url,
|
||||||
|
title: title || fallbackTitleFromUrl(url),
|
||||||
|
summary,
|
||||||
|
image,
|
||||||
|
readingProgress: 0,
|
||||||
|
readingTimestamp: bookmark.added_at || bookmark.created_at
|
||||||
|
}
|
||||||
|
|
||||||
|
linksMap.set(url, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sort by most recent bookmark activity
|
||||||
|
return Array.from(linksMap.values()).sort((a, b) => {
|
||||||
|
const timeA = a.readingTimestamp || 0
|
||||||
|
const timeB = b.readingTimestamp || 0
|
||||||
|
return timeB - timeA
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
83
src/utils/readItemMerge.ts
Normal file
83
src/utils/readItemMerge.ts
Normal file
@@ -0,0 +1,83 @@
|
|||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merges a ReadItem into a state map, returning whether the state changed.
|
||||||
|
* Uses most recent reading activity to determine precedence.
|
||||||
|
*/
|
||||||
|
export function mergeReadItem(
|
||||||
|
stateMap: Map<string, ReadItem>,
|
||||||
|
incoming: ReadItem
|
||||||
|
): boolean {
|
||||||
|
const existing = stateMap.get(incoming.id)
|
||||||
|
|
||||||
|
if (!existing) {
|
||||||
|
stateMap.set(incoming.id, incoming)
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
// Always merge if incoming has reading progress data
|
||||||
|
const hasNewProgress = incoming.readingProgress !== undefined &&
|
||||||
|
(existing.readingProgress === undefined || existing.readingProgress !== incoming.readingProgress)
|
||||||
|
|
||||||
|
const hasNewMarkedAsRead = incoming.markedAsRead !== undefined && existing.markedAsRead === undefined
|
||||||
|
|
||||||
|
// Merge by taking the most recent reading activity
|
||||||
|
const existingTime = existing.readingTimestamp || existing.markedAt || 0
|
||||||
|
const incomingTime = incoming.readingTimestamp || incoming.markedAt || 0
|
||||||
|
|
||||||
|
if (incomingTime > existingTime || hasNewProgress || hasNewMarkedAsRead) {
|
||||||
|
// Keep existing data, but update with newer reading metadata
|
||||||
|
stateMap.set(incoming.id, {
|
||||||
|
...existing,
|
||||||
|
...incoming,
|
||||||
|
// Preserve event data if incoming doesn't have it
|
||||||
|
event: incoming.event || existing.event,
|
||||||
|
title: incoming.title || existing.title,
|
||||||
|
summary: incoming.summary || existing.summary,
|
||||||
|
image: incoming.image || existing.image,
|
||||||
|
published: incoming.published || existing.published,
|
||||||
|
author: incoming.author || existing.author,
|
||||||
|
// Always take reading progress if available
|
||||||
|
readingProgress: incoming.readingProgress !== undefined ? incoming.readingProgress : existing.readingProgress,
|
||||||
|
readingTimestamp: incomingTime > existingTime ? incoming.readingTimestamp : existing.readingTimestamp
|
||||||
|
})
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
// If timestamps are equal but incoming has additional data, merge it
|
||||||
|
if (incomingTime === existingTime && (!existing.event && incoming.event || !existing.title && incoming.title)) {
|
||||||
|
stateMap.set(incoming.id, {
|
||||||
|
...existing,
|
||||||
|
...incoming,
|
||||||
|
event: incoming.event || existing.event,
|
||||||
|
title: incoming.title || existing.title,
|
||||||
|
summary: incoming.summary || existing.summary,
|
||||||
|
image: incoming.image || existing.image,
|
||||||
|
published: incoming.published || existing.published,
|
||||||
|
author: incoming.author || existing.author
|
||||||
|
})
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
|
||||||
|
return false
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Extracts a readable title from a URL when no title is available.
|
||||||
|
* Removes protocol, www, and shows domain + path.
|
||||||
|
*/
|
||||||
|
export function fallbackTitleFromUrl(url: string): string {
|
||||||
|
try {
|
||||||
|
const parsed = new URL(url)
|
||||||
|
let title = parsed.hostname.replace(/^www\./, '')
|
||||||
|
if (parsed.pathname && parsed.pathname !== '/') {
|
||||||
|
const path = parsed.pathname.slice(0, 40)
|
||||||
|
title += path.length < parsed.pathname.length ? path + '...' : path
|
||||||
|
}
|
||||||
|
return title
|
||||||
|
} catch {
|
||||||
|
// If URL parsing fails, just return the URL truncated
|
||||||
|
return url.length > 50 ? url.slice(0, 47) + '...' : url
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
30
src/utils/readingProgressUtils.ts
Normal file
30
src/utils/readingProgressUtils.ts
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
import { ReadingProgressFilterType } from '../components/ReadingProgressFilters'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Filters ReadItems by reading progress
|
||||||
|
*/
|
||||||
|
export function filterByReadingProgress(
|
||||||
|
items: ReadItem[],
|
||||||
|
filter: ReadingProgressFilterType
|
||||||
|
): ReadItem[] {
|
||||||
|
return items.filter((item) => {
|
||||||
|
const progress = item.readingProgress || 0
|
||||||
|
const isMarked = item.markedAsRead || false
|
||||||
|
|
||||||
|
switch (filter) {
|
||||||
|
case 'unopened':
|
||||||
|
return progress === 0 && !isMarked
|
||||||
|
case 'started':
|
||||||
|
return progress > 0 && progress <= 0.10 && !isMarked
|
||||||
|
case 'reading':
|
||||||
|
return progress > 0.10 && progress <= 0.94 && !isMarked
|
||||||
|
case 'completed':
|
||||||
|
return progress >= 0.95 || isMarked
|
||||||
|
case 'all':
|
||||||
|
default:
|
||||||
|
return true
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
71
src/utils/readsFromBookmarks.ts
Normal file
71
src/utils/readsFromBookmarks.ts
Normal file
@@ -0,0 +1,71 @@
|
|||||||
|
import { Bookmark } from '../types/bookmarks'
|
||||||
|
import { ReadItem } from '../services/readsService'
|
||||||
|
import { classifyBookmarkType } from './bookmarkTypeClassifier'
|
||||||
|
import { KINDS } from '../config/kinds'
|
||||||
|
import { nip19 } from 'nostr-tools'
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Derives ReadItems from bookmarks for Nostr articles (kind:30023).
|
||||||
|
* Returns items with type='article', using hydrated data when available.
|
||||||
|
* Note: After hydration, article titles are in bookmark.content, metadata in tags.
|
||||||
|
*/
|
||||||
|
export function deriveReadsFromBookmarks(bookmarks: Bookmark[]): ReadItem[] {
|
||||||
|
const readsMap = new Map<string, ReadItem>()
|
||||||
|
|
||||||
|
const allBookmarks = bookmarks.flatMap(b => b.individualBookmarks || [])
|
||||||
|
|
||||||
|
for (const bookmark of allBookmarks) {
|
||||||
|
const bookmarkType = classifyBookmarkType(bookmark)
|
||||||
|
|
||||||
|
// Only include articles (kind:30023)
|
||||||
|
if (bookmarkType === 'article' && bookmark.kind === KINDS.BlogPost) {
|
||||||
|
const coordinate = bookmark.id // coordinate format: kind:pubkey:identifier
|
||||||
|
|
||||||
|
// Extract identifier from coordinate
|
||||||
|
const parts = coordinate.split(':')
|
||||||
|
const identifier = parts[2] || ''
|
||||||
|
|
||||||
|
// Convert to naddr format (reading positions use naddr as ID)
|
||||||
|
let naddr: string
|
||||||
|
try {
|
||||||
|
naddr = nip19.naddrEncode({
|
||||||
|
kind: KINDS.BlogPost,
|
||||||
|
pubkey: bookmark.pubkey,
|
||||||
|
identifier
|
||||||
|
})
|
||||||
|
} catch (e) {
|
||||||
|
console.warn('Failed to encode naddr for bookmark:', coordinate)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
// Extract metadata from tags (same as BookmarkItem does)
|
||||||
|
const title = bookmark.content || 'Untitled'
|
||||||
|
const image = bookmark.tags.find(t => t[0] === 'image')?.[1]
|
||||||
|
const summary = bookmark.tags.find(t => t[0] === 'summary')?.[1]
|
||||||
|
const published = bookmark.tags.find(t => t[0] === 'published_at')?.[1]
|
||||||
|
|
||||||
|
const item: ReadItem = {
|
||||||
|
id: naddr, // Use naddr format to match reading positions
|
||||||
|
source: 'bookmark',
|
||||||
|
type: 'article',
|
||||||
|
readingProgress: 0,
|
||||||
|
readingTimestamp: bookmark.added_at || bookmark.created_at,
|
||||||
|
title,
|
||||||
|
summary,
|
||||||
|
image,
|
||||||
|
published: published ? parseInt(published) : undefined,
|
||||||
|
author: bookmark.pubkey
|
||||||
|
}
|
||||||
|
|
||||||
|
readsMap.set(naddr, item)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sort by most recent bookmark activity
|
||||||
|
return Array.from(readsMap.values()).sort((a, b) => {
|
||||||
|
const timeA = a.readingTimestamp || 0
|
||||||
|
const timeB = b.readingTimestamp || 0
|
||||||
|
return timeB - timeA
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
8
src/vite-env.d.ts
vendored
8
src/vite-env.d.ts
vendored
@@ -8,3 +8,11 @@ declare module '*.svg?raw' {
|
|||||||
const content: string
|
const content: string
|
||||||
export default content
|
export default content
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Build-time defines injected by Vite in vite.config.ts
|
||||||
|
declare const __APP_VERSION__: string
|
||||||
|
declare const __GIT_COMMIT__: string
|
||||||
|
declare const __GIT_BRANCH__: string
|
||||||
|
declare const __BUILD_TIME__: string
|
||||||
|
declare const __GIT_COMMIT_URL__: string
|
||||||
|
declare const __RELEASE_URL__: string
|
||||||
|
|||||||
11
vercel.json
11
vercel.json
@@ -1,5 +1,16 @@
|
|||||||
{
|
{
|
||||||
"rewrites": [
|
"rewrites": [
|
||||||
|
{
|
||||||
|
"source": "/a/:naddr",
|
||||||
|
"has": [
|
||||||
|
{
|
||||||
|
"type": "header",
|
||||||
|
"key": "user-agent",
|
||||||
|
"value": ".*(bot|crawl|spider|slurp|facebook|twitter|linkedin|whatsapp|telegram|slack|discord|preview).*"
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"destination": "/api/article-og?naddr=:naddr"
|
||||||
|
},
|
||||||
{
|
{
|
||||||
"source": "/(.*)",
|
"source": "/(.*)",
|
||||||
"destination": "/index.html"
|
"destination": "/index.html"
|
||||||
|
|||||||
@@ -1,8 +1,101 @@
|
|||||||
|
/* eslint-env node */
|
||||||
import { defineConfig } from 'vite'
|
import { defineConfig } from 'vite'
|
||||||
import react from '@vitejs/plugin-react'
|
import react from '@vitejs/plugin-react'
|
||||||
import { VitePWA } from 'vite-plugin-pwa'
|
import { VitePWA } from 'vite-plugin-pwa'
|
||||||
|
import { readFileSync } from 'node:fs'
|
||||||
|
import { execSync } from 'node:child_process'
|
||||||
|
|
||||||
|
function getGitMetadata() {
|
||||||
|
const envSha = process.env.VERCEL_GIT_COMMIT_SHA || ''
|
||||||
|
const envRef = process.env.VERCEL_GIT_COMMIT_REF || ''
|
||||||
|
let commit = envSha
|
||||||
|
let branch = envRef
|
||||||
|
try {
|
||||||
|
if (!commit) commit = execSync('git rev-parse HEAD', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
|
||||||
|
} catch {
|
||||||
|
// ignore
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
if (!branch) branch = execSync('git rev-parse --abbrev-ref HEAD', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
|
||||||
|
} catch {
|
||||||
|
// ignore
|
||||||
|
}
|
||||||
|
return { commit, branch }
|
||||||
|
}
|
||||||
|
|
||||||
|
function getPackageVersion() {
|
||||||
|
try {
|
||||||
|
const pkg = JSON.parse(readFileSync(new URL('./package.json', import.meta.url)).toString())
|
||||||
|
return pkg.version as string
|
||||||
|
} catch {
|
||||||
|
return '0.0.0'
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const { commit, branch } = getGitMetadata()
|
||||||
|
const version = getPackageVersion()
|
||||||
|
const buildTime = new Date().toISOString()
|
||||||
|
|
||||||
|
function getReleaseUrl(version: string): string {
|
||||||
|
if (!version) return ''
|
||||||
|
const provider = process.env.VERCEL_GIT_PROVIDER || ''
|
||||||
|
const owner = process.env.VERCEL_GIT_REPO_OWNER || ''
|
||||||
|
const slug = process.env.VERCEL_GIT_REPO_SLUG || ''
|
||||||
|
if (provider.toLowerCase() === 'github' && owner && slug) {
|
||||||
|
return `https://github.com/${owner}/${slug}/releases/tag/v${version}`
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
const remote = execSync('git config --get remote.origin.url', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
|
||||||
|
if (remote.includes('github.com')) {
|
||||||
|
// git@github.com:owner/repo.git or https://github.com/owner/repo.git
|
||||||
|
const https = remote.startsWith('git@')
|
||||||
|
? `https://github.com/${remote.split(':')[1]}`
|
||||||
|
: remote
|
||||||
|
const cleaned = https.replace(/\.git$/, '')
|
||||||
|
return `${cleaned}/releases/tag/v${version}`
|
||||||
|
}
|
||||||
|
} catch {
|
||||||
|
// ignore
|
||||||
|
}
|
||||||
|
return ''
|
||||||
|
}
|
||||||
|
|
||||||
|
function getCommitUrl(commit: string): string {
|
||||||
|
if (!commit) return ''
|
||||||
|
const provider = process.env.VERCEL_GIT_PROVIDER || ''
|
||||||
|
const owner = process.env.VERCEL_GIT_REPO_OWNER || ''
|
||||||
|
const slug = process.env.VERCEL_GIT_REPO_SLUG || ''
|
||||||
|
if (provider.toLowerCase() === 'github' && owner && slug) {
|
||||||
|
return `https://github.com/${owner}/${slug}/commit/${commit}`
|
||||||
|
}
|
||||||
|
try {
|
||||||
|
const remote = execSync('git config --get remote.origin.url', { stdio: ['ignore', 'pipe', 'ignore'] }).toString().trim()
|
||||||
|
if (remote.includes('github.com')) {
|
||||||
|
// git@github.com:owner/repo.git or https://github.com/owner/repo.git
|
||||||
|
const https = remote.startsWith('git@')
|
||||||
|
? `https://github.com/${remote.split(':')[1]}`
|
||||||
|
: remote
|
||||||
|
const cleaned = https.replace(/\.git$/, '')
|
||||||
|
return `${cleaned}/commit/${commit}`
|
||||||
|
}
|
||||||
|
} catch {
|
||||||
|
// ignore
|
||||||
|
}
|
||||||
|
return ''
|
||||||
|
}
|
||||||
|
|
||||||
|
const releaseUrl = getReleaseUrl(version)
|
||||||
|
const commitUrl = getCommitUrl(commit)
|
||||||
|
|
||||||
export default defineConfig({
|
export default defineConfig({
|
||||||
|
define: {
|
||||||
|
__APP_VERSION__: JSON.stringify(version),
|
||||||
|
__GIT_COMMIT__: JSON.stringify(commit),
|
||||||
|
__GIT_BRANCH__: JSON.stringify(branch),
|
||||||
|
__BUILD_TIME__: JSON.stringify(buildTime),
|
||||||
|
__GIT_COMMIT_URL__: JSON.stringify(commitUrl),
|
||||||
|
__RELEASE_URL__: JSON.stringify(releaseUrl)
|
||||||
|
},
|
||||||
plugins: [
|
plugins: [
|
||||||
react(),
|
react(),
|
||||||
VitePWA({
|
VitePWA({
|
||||||
@@ -48,7 +141,7 @@ export default defineConfig({
|
|||||||
mainFields: ['module', 'jsnext:main', 'jsnext', 'main']
|
mainFields: ['module', 'jsnext:main', 'jsnext', 'main']
|
||||||
},
|
},
|
||||||
optimizeDeps: {
|
optimizeDeps: {
|
||||||
include: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-react'],
|
include: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-react', 'applesauce-accounts', 'applesauce-signers'],
|
||||||
esbuildOptions: {
|
esbuildOptions: {
|
||||||
resolveExtensions: ['.js', '.ts', '.tsx', '.json']
|
resolveExtensions: ['.js', '.ts', '.tsx', '.json']
|
||||||
}
|
}
|
||||||
@@ -65,7 +158,7 @@ export default defineConfig({
|
|||||||
}
|
}
|
||||||
},
|
},
|
||||||
ssr: {
|
ssr: {
|
||||||
noExternal: ['applesauce-core', 'applesauce-factory', 'applesauce-relay']
|
noExternal: ['applesauce-core', 'applesauce-factory', 'applesauce-relay', 'applesauce-accounts', 'applesauce-signers']
|
||||||
}
|
}
|
||||||
})
|
})
|
||||||
|
|
||||||
|
|||||||
Reference in New Issue
Block a user