mirror of
https://github.com/aljazceru/kata-containers.git
synced 2026-01-17 13:24:25 +01:00
It looks like the version check for cloud hypervisor (clh) was added initially when clh was actively evolving its API. We no longer need the version check as clh API has been fairly stable for its recent releases. Fixes: #1991 Signed-off-by: Bo Chen <chen.bo@intel.com>
1204 lines
34 KiB
Go
1204 lines
34 KiB
Go
// Copyright (c) 2019 Ericsson Eurolab Deutschland GmbH
|
|
//
|
|
// SPDX-License-Identifier: Apache-2.0
|
|
//
|
|
|
|
package virtcontainers
|
|
|
|
import (
|
|
"context"
|
|
"encoding/json"
|
|
"fmt"
|
|
"net"
|
|
"net/http"
|
|
"os"
|
|
"os/exec"
|
|
"path/filepath"
|
|
"strconv"
|
|
"strings"
|
|
"syscall"
|
|
"time"
|
|
|
|
"github.com/containerd/console"
|
|
persistapi "github.com/kata-containers/kata-containers/src/runtime/virtcontainers/persist/api"
|
|
chclient "github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/cloud-hypervisor/client"
|
|
"github.com/opencontainers/selinux/go-selinux/label"
|
|
"github.com/pkg/errors"
|
|
log "github.com/sirupsen/logrus"
|
|
"go.opentelemetry.io/otel"
|
|
otelLabel "go.opentelemetry.io/otel/label"
|
|
otelTrace "go.opentelemetry.io/otel/trace"
|
|
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/device/config"
|
|
vcTypes "github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/types"
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/types"
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/utils"
|
|
)
|
|
|
|
//
|
|
// Constants and type definitions related to cloud hypervisor
|
|
//
|
|
|
|
type clhState uint8
|
|
|
|
const (
|
|
clhNotReady clhState = iota
|
|
clhReady
|
|
)
|
|
|
|
const (
|
|
clhStateCreated = "Created"
|
|
clhStateRunning = "Running"
|
|
)
|
|
|
|
const (
|
|
// Values are mandatory by http API
|
|
// Values based on:
|
|
clhTimeout = 10
|
|
clhAPITimeout = 1
|
|
// Timeout for hot-plug - hotplug devices can take more time, than usual API calls
|
|
// Use longer time timeout for it.
|
|
clhHotPlugAPITimeout = 5
|
|
clhStopSandboxTimeout = 3
|
|
clhSocket = "clh.sock"
|
|
clhAPISocket = "clh-api.sock"
|
|
virtioFsSocket = "virtiofsd.sock"
|
|
defaultClhPath = "/usr/local/bin/cloud-hypervisor"
|
|
virtioFsCacheAlways = "always"
|
|
)
|
|
|
|
// Interface that hides the implementation of openAPI client
|
|
// If the client changes its methods, this interface should do it as well,
|
|
// The main purpose is to hide the client in an interface to allow mock testing.
|
|
// This is an interface that has to match with OpenAPI CLH client
|
|
type clhClient interface {
|
|
// Check for the REST API availability
|
|
VmmPingGet(ctx context.Context) (chclient.VmmPingResponse, *http.Response, error)
|
|
// Shut the VMM down
|
|
ShutdownVMM(ctx context.Context) (*http.Response, error)
|
|
// Create the VM
|
|
CreateVM(ctx context.Context, vmConfig chclient.VmConfig) (*http.Response, error)
|
|
// Dump the VM information
|
|
// No lint: golint suggest to rename to VMInfoGet.
|
|
VmInfoGet(ctx context.Context) (chclient.VmInfo, *http.Response, error) //nolint:golint
|
|
// Boot the VM
|
|
BootVM(ctx context.Context) (*http.Response, error)
|
|
// Add/remove CPUs to/from the VM
|
|
VmResizePut(ctx context.Context, vmResize chclient.VmResize) (*http.Response, error)
|
|
// Add VFIO PCI device to the VM
|
|
VmAddDevicePut(ctx context.Context, vmAddDevice chclient.VmAddDevice) (chclient.PciDeviceInfo, *http.Response, error)
|
|
// Add a new disk device to the VM
|
|
VmAddDiskPut(ctx context.Context, diskConfig chclient.DiskConfig) (chclient.PciDeviceInfo, *http.Response, error)
|
|
// Remove a device from the VM
|
|
VmRemoveDevicePut(ctx context.Context, vmRemoveDevice chclient.VmRemoveDevice) (*http.Response, error)
|
|
}
|
|
|
|
//
|
|
// Cloud hypervisor state
|
|
//
|
|
type CloudHypervisorState struct {
|
|
state clhState
|
|
PID int
|
|
VirtiofsdPID int
|
|
apiSocket string
|
|
}
|
|
|
|
func (s *CloudHypervisorState) reset() {
|
|
s.PID = 0
|
|
s.VirtiofsdPID = 0
|
|
s.state = clhNotReady
|
|
}
|
|
|
|
type cloudHypervisor struct {
|
|
id string
|
|
state CloudHypervisorState
|
|
config HypervisorConfig
|
|
ctx context.Context
|
|
APIClient clhClient
|
|
vmconfig chclient.VmConfig
|
|
virtiofsd Virtiofsd
|
|
store persistapi.PersistDriver
|
|
console console.Console
|
|
}
|
|
|
|
var clhKernelParams = []Param{
|
|
{"root", "/dev/pmem0p1"},
|
|
{"panic", "1"}, // upon kernel panic wait 1 second before reboot
|
|
{"no_timer_check", ""}, // do not check broken timer IRQ resources
|
|
{"noreplace-smp", ""}, // do not replace SMP instructions
|
|
{"rootflags", "dax,data=ordered,errors=remount-ro ro"}, // mount the root filesystem as readonly
|
|
{"rootfstype", "ext4"},
|
|
}
|
|
|
|
var clhDebugKernelParams = []Param{
|
|
{"console", "ttyS0,115200n8"}, // enable serial console
|
|
{"systemd.log_target", "console"}, // send loggng to the console
|
|
}
|
|
|
|
//###########################################################
|
|
//
|
|
// hypervisor interface implementation for cloud-hypervisor
|
|
//
|
|
//###########################################################
|
|
|
|
// For cloudHypervisor this call only sets the internal structure up.
|
|
// The VM will be created and started through startSandbox().
|
|
func (clh *cloudHypervisor) createSandbox(ctx context.Context, id string, networkNS NetworkNamespace, hypervisorConfig *HypervisorConfig) error {
|
|
clh.ctx = ctx
|
|
|
|
var span otelTrace.Span
|
|
span, clh.ctx = clh.trace(clh.ctx, "createSandbox")
|
|
defer span.End()
|
|
|
|
err := hypervisorConfig.valid()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.id = id
|
|
clh.config = *hypervisorConfig
|
|
clh.state.state = clhNotReady
|
|
|
|
clh.Logger().WithField("function", "createSandbox").Info("creating Sandbox")
|
|
|
|
virtiofsdSocketPath, err := clh.virtioFsSocketPath(clh.id)
|
|
if err != nil {
|
|
return nil
|
|
}
|
|
|
|
if clh.state.PID > 0 {
|
|
clh.Logger().WithField("function", "createSandbox").Info("Sandbox already exist, loading from state")
|
|
clh.virtiofsd = &virtiofsd{
|
|
PID: clh.state.VirtiofsdPID,
|
|
sourcePath: filepath.Join(getSharePath(clh.id)),
|
|
debug: clh.config.Debug,
|
|
socketPath: virtiofsdSocketPath,
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// No need to return an error from there since there might be nothing
|
|
// to fetch if this is the first time the hypervisor is created.
|
|
clh.Logger().WithField("function", "createSandbox").Info("Sandbox not found creating")
|
|
|
|
// Set initial memomory size of the virtual machine
|
|
// Convert to int64 openApiClient only support int64
|
|
clh.vmconfig.Memory.Size = int64((utils.MemUnit(clh.config.MemorySize) * utils.MiB).ToBytes())
|
|
// shared memory should be enabled if using vhost-user(kata uses virtiofsd)
|
|
clh.vmconfig.Memory.Shared = true
|
|
hostMemKb, err := getHostMemorySizeKb(procMemInfo)
|
|
if err != nil {
|
|
return nil
|
|
}
|
|
|
|
// OpenAPI only supports int64 values
|
|
clh.vmconfig.Memory.HotplugSize = int64((utils.MemUnit(hostMemKb) * utils.KiB).ToBytes())
|
|
// Set initial amount of cpu's for the virtual machine
|
|
clh.vmconfig.Cpus = chclient.CpusConfig{
|
|
// cast to int32, as openAPI has a limitation that it does not support unsigned values
|
|
BootVcpus: int32(clh.config.NumVCPUs),
|
|
MaxVcpus: int32(clh.config.DefaultMaxVCPUs),
|
|
}
|
|
|
|
// Add the kernel path
|
|
kernelPath, err := clh.config.KernelAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.vmconfig.Kernel = chclient.KernelConfig{
|
|
Path: kernelPath,
|
|
}
|
|
|
|
// First take the default parameters defined by this driver
|
|
params := clhKernelParams
|
|
|
|
// Followed by extra debug parameters if debug enabled in configuration file
|
|
if clh.config.Debug {
|
|
params = append(params, clhDebugKernelParams...)
|
|
}
|
|
|
|
// Followed by extra kernel parameters defined in the configuration file
|
|
params = append(params, clh.config.KernelParams...)
|
|
|
|
clh.vmconfig.Cmdline.Args = kernelParamsToString(params)
|
|
|
|
// set random device generator to hypervisor
|
|
clh.vmconfig.Rng = chclient.RngConfig{
|
|
Src: clh.config.EntropySource,
|
|
}
|
|
|
|
// set the initial root/boot disk of hypervisor
|
|
imagePath, err := clh.config.ImageAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if imagePath == "" {
|
|
return errors.New("image path is empty")
|
|
}
|
|
|
|
pmem := chclient.PmemConfig{
|
|
File: imagePath,
|
|
DiscardWrites: true,
|
|
}
|
|
clh.vmconfig.Pmem = append(clh.vmconfig.Pmem, pmem)
|
|
|
|
// set the serial console to the cloud hypervisor
|
|
if clh.config.Debug {
|
|
clh.vmconfig.Serial = chclient.ConsoleConfig{
|
|
Mode: cctTTY,
|
|
}
|
|
} else {
|
|
clh.vmconfig.Serial = chclient.ConsoleConfig{
|
|
Mode: cctNULL,
|
|
}
|
|
}
|
|
|
|
clh.vmconfig.Console = chclient.ConsoleConfig{
|
|
Mode: cctOFF,
|
|
}
|
|
|
|
clh.vmconfig.Cpus.Topology = chclient.CpuTopology{
|
|
ThreadsPerCore: 1,
|
|
CoresPerDie: int32(clh.config.DefaultMaxVCPUs),
|
|
DiesPerPackage: 1,
|
|
Packages: 1,
|
|
}
|
|
// Overwrite the default value of HTTP API socket path for cloud hypervisor
|
|
apiSocketPath, err := clh.apiSocketPath(id)
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Info("Invalid api socket path for cloud-hypervisor")
|
|
return err
|
|
}
|
|
clh.state.apiSocket = apiSocketPath
|
|
|
|
clh.virtiofsd = &virtiofsd{
|
|
path: clh.config.VirtioFSDaemon,
|
|
sourcePath: filepath.Join(getSharePath(clh.id)),
|
|
socketPath: virtiofsdSocketPath,
|
|
extraArgs: clh.config.VirtioFSExtraArgs,
|
|
debug: clh.config.Debug,
|
|
cache: clh.config.VirtioFSCache,
|
|
}
|
|
|
|
if clh.config.SGXEPCSize > 0 {
|
|
epcSection := chclient.SgxEpcConfig{
|
|
Size: clh.config.SGXEPCSize,
|
|
Prefault: true,
|
|
}
|
|
|
|
clh.vmconfig.SgxEpc = append(clh.vmconfig.SgxEpc, epcSection)
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// startSandbox will start the VMM and boot the virtual machine for the given sandbox.
|
|
func (clh *cloudHypervisor) startSandbox(ctx context.Context, timeout int) error {
|
|
span, _ := clh.trace(ctx, "startSandbox")
|
|
defer span.End()
|
|
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
clh.Logger().WithField("function", "startSandbox").Info("starting Sandbox")
|
|
|
|
vmPath := filepath.Join(clh.store.RunVMStoragePath(), clh.id)
|
|
err := os.MkdirAll(vmPath, DirMode)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if clh.virtiofsd == nil {
|
|
return errors.New("Missing virtiofsd configuration")
|
|
}
|
|
|
|
// This needs to be done as late as possible, just before launching
|
|
// virtiofsd are executed by kata-runtime after this call, run with
|
|
// the SELinux label. If these processes require privileged, we do
|
|
// notwant to run them under confinement.
|
|
if err := label.SetProcessLabel(clh.config.SELinuxProcessLabel); err != nil {
|
|
return err
|
|
}
|
|
defer label.SetProcessLabel("")
|
|
|
|
if clh.config.SharedFS == config.VirtioFS {
|
|
clh.Logger().WithField("function", "startSandbox").Info("Starting virtiofsd")
|
|
pid, err := clh.virtiofsd.Start(ctx, func() {
|
|
clh.stopSandbox(ctx, false)
|
|
})
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.state.VirtiofsdPID = pid
|
|
} else {
|
|
return errors.New("cloud-hypervisor only supports virtio based file sharing")
|
|
}
|
|
|
|
pid, err := clh.launchClh()
|
|
if err != nil {
|
|
if shutdownErr := clh.virtiofsd.Stop(ctx); shutdownErr != nil {
|
|
clh.Logger().WithError(shutdownErr).Warn("error shutting down Virtiofsd")
|
|
}
|
|
return fmt.Errorf("failed to launch cloud-hypervisor: %q", err)
|
|
}
|
|
clh.state.PID = pid
|
|
|
|
if err := clh.bootVM(ctx); err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.state.state = clhReady
|
|
return nil
|
|
}
|
|
|
|
// getSandboxConsole builds the path of the console where we can read
|
|
// logs coming from the sandbox.
|
|
func (clh *cloudHypervisor) getSandboxConsole(ctx context.Context, id string) (string, string, error) {
|
|
clh.Logger().WithField("function", "getSandboxConsole").WithField("id", id).Info("Get Sandbox Console")
|
|
master, slave, err := console.NewPty()
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Error("Error create pseudo tty")
|
|
return consoleProtoPty, "", err
|
|
}
|
|
clh.console = master
|
|
|
|
return consoleProtoPty, slave, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) disconnect(ctx context.Context) {
|
|
clh.Logger().WithField("function", "disconnect").Info("Disconnecting Sandbox Console")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getThreadIDs(ctx context.Context) (vcpuThreadIDs, error) {
|
|
|
|
clh.Logger().WithField("function", "getThreadIDs").Info("get thread ID's")
|
|
|
|
var vcpuInfo vcpuThreadIDs
|
|
|
|
vcpuInfo.vcpus = make(map[int]int)
|
|
|
|
return vcpuInfo, nil
|
|
}
|
|
|
|
func clhDriveIndexToID(i int) string {
|
|
return "clh_drive_" + strconv.Itoa(i)
|
|
}
|
|
|
|
// Various cloud-hypervisor APIs report a PCI address in "BB:DD.F"
|
|
// form within the PciDeviceInfo struct. This is a broken API,
|
|
// because there's no way clh can reliably know the guest side bdf for
|
|
// a device, since the bus number depends on how the guest firmware
|
|
// and/or kernel enumerates it. They get away with it only because
|
|
// they don't use bridges, and so the bus is always 0. Under that
|
|
// assumption convert a clh PciDeviceInfo into a PCI path
|
|
func clhPciInfoToPath(pciInfo chclient.PciDeviceInfo) (vcTypes.PciPath, error) {
|
|
tokens := strings.Split(pciInfo.Bdf, ":")
|
|
if len(tokens) != 3 || tokens[0] != "0000" || tokens[1] != "00" {
|
|
return vcTypes.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
tokens = strings.Split(tokens[2], ".")
|
|
if len(tokens) != 2 || tokens[1] != "0" || len(tokens[0]) != 2 {
|
|
return vcTypes.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
return vcTypes.PciPathFromString(tokens[0])
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotplugAddBlockDevice(drive *config.BlockDrive) error {
|
|
if clh.config.BlockDeviceDriver != config.VirtioBlock {
|
|
return fmt.Errorf("incorrect hypervisor configuration on 'block_device_driver':"+
|
|
" using '%v' but only support '%v'", clh.config.BlockDeviceDriver, config.VirtioBlock)
|
|
}
|
|
|
|
var err error
|
|
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
driveID := clhDriveIndexToID(drive.Index)
|
|
|
|
if drive.Pmem {
|
|
return fmt.Errorf("pmem device hotplug not supported")
|
|
}
|
|
|
|
blkDevice := chclient.DiskConfig{
|
|
Path: drive.File,
|
|
Readonly: drive.ReadOnly,
|
|
VhostUser: false,
|
|
Id: driveID,
|
|
}
|
|
pciInfo, _, err := cl.VmAddDiskPut(ctx, blkDevice)
|
|
|
|
if err != nil {
|
|
return fmt.Errorf("failed to hotplug block device %+v %s", drive, openAPIClientError(err))
|
|
}
|
|
|
|
drive.PCIPath, err = clhPciInfoToPath(pciInfo)
|
|
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotPlugVFIODevice(device config.VFIODev) error {
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
_, _, err := cl.VmAddDevicePut(ctx, chclient.VmAddDevice{Path: device.SysfsDev, Id: device.ID})
|
|
if err != nil {
|
|
err = fmt.Errorf("Failed to hotplug device %+v %s", device, openAPIClientError(err))
|
|
}
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotplugAddDevice(ctx context.Context, devInfo interface{}, devType deviceType) (interface{}, error) {
|
|
span, _ := clh.trace(ctx, "hotplugAddDevice")
|
|
defer span.End()
|
|
|
|
switch devType {
|
|
case blockDev:
|
|
drive := devInfo.(*config.BlockDrive)
|
|
return nil, clh.hotplugAddBlockDevice(drive)
|
|
case vfioDev:
|
|
device := devInfo.(*config.VFIODev)
|
|
return nil, clh.hotPlugVFIODevice(*device)
|
|
default:
|
|
return nil, fmt.Errorf("cannot hotplug device: unsupported device type '%v'", devType)
|
|
}
|
|
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotplugRemoveDevice(ctx context.Context, devInfo interface{}, devType deviceType) (interface{}, error) {
|
|
span, _ := clh.trace(ctx, "hotplugRemoveDevice")
|
|
defer span.End()
|
|
|
|
var deviceID string
|
|
|
|
switch devType {
|
|
case blockDev:
|
|
deviceID = clhDriveIndexToID(devInfo.(*config.BlockDrive).Index)
|
|
case vfioDev:
|
|
deviceID = devInfo.(*config.VFIODev).ID
|
|
default:
|
|
clh.Logger().WithFields(log.Fields{"devInfo": devInfo,
|
|
"deviceType": devType}).Error("hotplugRemoveDevice: unsupported device")
|
|
return nil, fmt.Errorf("Could not hot remove device: unsupported device: %v, type: %v",
|
|
devInfo, devType)
|
|
}
|
|
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
_, err := cl.VmRemoveDevicePut(ctx, chclient.VmRemoveDevice{Id: deviceID})
|
|
if err != nil {
|
|
err = fmt.Errorf("failed to hotplug remove (unplug) device %+v: %s", devInfo, openAPIClientError(err))
|
|
}
|
|
|
|
return nil, err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hypervisorConfig() HypervisorConfig {
|
|
return clh.config
|
|
}
|
|
|
|
func (clh *cloudHypervisor) resizeMemory(ctx context.Context, reqMemMB uint32, memoryBlockSizeMB uint32, probe bool) (uint32, memoryDevice, error) {
|
|
|
|
// TODO: Add support for virtio-mem
|
|
|
|
if probe {
|
|
return 0, memoryDevice{}, errors.New("probe memory is not supported for cloud-hypervisor")
|
|
}
|
|
|
|
if reqMemMB == 0 {
|
|
// This is a corner case if requested to resize to 0 means something went really wrong.
|
|
return 0, memoryDevice{}, errors.New("Can not resize memory to 0")
|
|
}
|
|
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
return 0, memoryDevice{}, err
|
|
}
|
|
|
|
currentMem := utils.MemUnit(info.Config.Memory.Size) * utils.Byte
|
|
newMem := utils.MemUnit(reqMemMB) * utils.MiB
|
|
|
|
// Early check to verify if boot memory is the same as requested
|
|
if currentMem == newMem {
|
|
clh.Logger().WithField("memory", reqMemMB).Debugf("VM already has requested memory")
|
|
return uint32(currentMem.ToMiB()), memoryDevice{}, nil
|
|
}
|
|
|
|
if currentMem > newMem {
|
|
clh.Logger().Warn("Remove memory is not supported, nothing to do")
|
|
return uint32(currentMem.ToMiB()), memoryDevice{}, nil
|
|
}
|
|
|
|
blockSize := utils.MemUnit(memoryBlockSizeMB) * utils.MiB
|
|
hotplugSize := (newMem - currentMem).AlignMem(blockSize)
|
|
|
|
// Update memory request to increase memory aligned block
|
|
alignedRequest := currentMem + hotplugSize
|
|
if newMem != alignedRequest {
|
|
clh.Logger().WithFields(log.Fields{"request": newMem, "aligned-request": alignedRequest}).Debug("aligning VM memory request")
|
|
newMem = alignedRequest
|
|
}
|
|
|
|
// Check if memory is the same as requested, a second check is done
|
|
// to consider the memory request now that is updated to be memory aligned
|
|
if currentMem == newMem {
|
|
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("VM already has requested memory(after alignment)")
|
|
return uint32(currentMem.ToMiB()), memoryDevice{}, nil
|
|
}
|
|
|
|
cl := clh.client()
|
|
ctx, cancelResize := context.WithTimeout(ctx, clhAPITimeout*time.Second)
|
|
defer cancelResize()
|
|
|
|
// OpenApi does not support uint64, convert to int64
|
|
resize := chclient.VmResize{DesiredRam: int64(newMem.ToBytes())}
|
|
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("updating VM memory")
|
|
if _, err = cl.VmResizePut(ctx, resize); err != nil {
|
|
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Warnf("failed to update memory %s", openAPIClientError(err))
|
|
err = fmt.Errorf("Failed to resize memory from %d to %d: %s", currentMem, newMem, openAPIClientError(err))
|
|
return uint32(currentMem.ToMiB()), memoryDevice{}, openAPIClientError(err)
|
|
}
|
|
|
|
return uint32(newMem.ToMiB()), memoryDevice{sizeMB: int(hotplugSize.ToMiB())}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) resizeVCPUs(ctx context.Context, reqVCPUs uint32) (currentVCPUs uint32, newVCPUs uint32, err error) {
|
|
cl := clh.client()
|
|
|
|
// Retrieve the number of current vCPUs via HTTP API
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
clh.Logger().WithField("function", "resizeVCPUs").WithError(err).Info("[clh] vmInfo failed")
|
|
return 0, 0, openAPIClientError(err)
|
|
}
|
|
|
|
currentVCPUs = uint32(info.Config.Cpus.BootVcpus)
|
|
newVCPUs = currentVCPUs
|
|
|
|
// Sanity check
|
|
if reqVCPUs == 0 {
|
|
clh.Logger().WithField("function", "resizeVCPUs").Debugf("Cannot resize vCPU to 0")
|
|
return currentVCPUs, newVCPUs, fmt.Errorf("Cannot resize vCPU to 0")
|
|
}
|
|
if reqVCPUs > uint32(info.Config.Cpus.MaxVcpus) {
|
|
clh.Logger().WithFields(log.Fields{
|
|
"function": "resizeVCPUs",
|
|
"reqVCPUs": reqVCPUs,
|
|
"clhMaxVCPUs": info.Config.Cpus.MaxVcpus,
|
|
}).Warn("exceeding the 'clhMaxVCPUs' (resizing to 'clhMaxVCPUs')")
|
|
|
|
reqVCPUs = uint32(info.Config.Cpus.MaxVcpus)
|
|
}
|
|
|
|
// Resize (hot-plug) vCPUs via HTTP API
|
|
ctx, cancel := context.WithTimeout(ctx, clhAPITimeout*time.Second)
|
|
defer cancel()
|
|
if _, err = cl.VmResizePut(ctx, chclient.VmResize{DesiredVcpus: int32(reqVCPUs)}); err != nil {
|
|
return currentVCPUs, newVCPUs, errors.Wrap(err, "[clh] VmResizePut failed")
|
|
}
|
|
|
|
newVCPUs = reqVCPUs
|
|
|
|
return currentVCPUs, newVCPUs, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) cleanup(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "cleanup").Info("cleanup")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) pauseSandbox(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "pauseSandbox").Info("Pause Sandbox")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) saveSandbox() error {
|
|
clh.Logger().WithField("function", "saveSandboxC").Info("Save Sandbox")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) resumeSandbox(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "resumeSandbox").Info("Resume Sandbox")
|
|
return nil
|
|
}
|
|
|
|
// stopSandbox will stop the Sandbox's VM.
|
|
func (clh *cloudHypervisor) stopSandbox(ctx context.Context, waitOnly bool) (err error) {
|
|
span, _ := clh.trace(ctx, "stopSandbox")
|
|
defer span.End()
|
|
clh.Logger().WithField("function", "stopSandbox").Info("Stop Sandbox")
|
|
return clh.terminate(ctx, waitOnly)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) fromGrpc(ctx context.Context, hypervisorConfig *HypervisorConfig, j []byte) error {
|
|
return errors.New("cloudHypervisor is not supported by VM cache")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) toGrpc(ctx context.Context) ([]byte, error) {
|
|
return nil, errors.New("cloudHypervisor is not supported by VM cache")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) save() (s persistapi.HypervisorState) {
|
|
s.Pid = clh.state.PID
|
|
s.Type = string(ClhHypervisor)
|
|
s.VirtiofsdPid = clh.state.VirtiofsdPID
|
|
s.APISocket = clh.state.apiSocket
|
|
return
|
|
}
|
|
|
|
func (clh *cloudHypervisor) load(s persistapi.HypervisorState) {
|
|
clh.state.PID = s.Pid
|
|
clh.state.VirtiofsdPID = s.VirtiofsdPid
|
|
clh.state.apiSocket = s.APISocket
|
|
}
|
|
|
|
func (clh *cloudHypervisor) check() error {
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
_, _, err := cl.VmmPingGet(ctx)
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getPids() []int {
|
|
|
|
var pids []int
|
|
pids = append(pids, clh.state.PID)
|
|
|
|
return pids
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getVirtioFsPid() *int {
|
|
return &clh.state.VirtiofsdPID
|
|
}
|
|
|
|
func (clh *cloudHypervisor) addDevice(ctx context.Context, devInfo interface{}, devType deviceType) error {
|
|
span, _ := clh.trace(ctx, "addDevice")
|
|
defer span.End()
|
|
|
|
var err error
|
|
|
|
switch v := devInfo.(type) {
|
|
case Endpoint:
|
|
if err := clh.addNet(v); err != nil {
|
|
return err
|
|
}
|
|
case types.HybridVSock:
|
|
clh.addVSock(defaultGuestVSockCID, v.UdsPath)
|
|
case types.Volume:
|
|
err = clh.addVolume(v)
|
|
default:
|
|
clh.Logger().WithField("function", "addDevice").Warnf("Add device of type %v is not supported.", v)
|
|
return fmt.Errorf("Not implemented support for %s", v)
|
|
}
|
|
|
|
return err
|
|
}
|
|
|
|
//###########################################################################
|
|
//
|
|
// Local helper methods related to the hypervisor interface implementation
|
|
//
|
|
//###########################################################################
|
|
|
|
func (clh *cloudHypervisor) Logger() *log.Entry {
|
|
return virtLog.WithField("subsystem", "cloudHypervisor")
|
|
}
|
|
|
|
// Adds all capabilities supported by cloudHypervisor implementation of hypervisor interface
|
|
func (clh *cloudHypervisor) capabilities(ctx context.Context) types.Capabilities {
|
|
span, _ := clh.trace(ctx, "capabilities")
|
|
defer span.End()
|
|
|
|
clh.Logger().WithField("function", "capabilities").Info("get Capabilities")
|
|
var caps types.Capabilities
|
|
caps.SetFsSharingSupport()
|
|
caps.SetBlockDeviceHotplugSupport()
|
|
return caps
|
|
}
|
|
|
|
func (clh *cloudHypervisor) trace(parent context.Context, name string) (otelTrace.Span, context.Context) {
|
|
if parent == nil {
|
|
clh.Logger().WithField("type", "bug").Error("trace called before context set")
|
|
parent = context.Background()
|
|
}
|
|
|
|
tracer := otel.Tracer("kata")
|
|
ctx, span := tracer.Start(parent, name, otelTrace.WithAttributes(otelLabel.String("source", "runtime"), otelLabel.String("package", "virtcontainers"), otelLabel.String("subsystem", "hypervisor"), otelLabel.String("type", "clh"), otelLabel.String("sandbox_id", clh.id)))
|
|
|
|
return span, ctx
|
|
}
|
|
|
|
func (clh *cloudHypervisor) terminate(ctx context.Context, waitOnly bool) (err error) {
|
|
span, _ := clh.trace(ctx, "terminate")
|
|
defer span.End()
|
|
|
|
pid := clh.state.PID
|
|
pidRunning := true
|
|
if pid == 0 {
|
|
pidRunning = false
|
|
}
|
|
|
|
defer func() {
|
|
clh.Logger().Debug("cleanup VM")
|
|
if err1 := clh.cleanupVM(true); err1 != nil {
|
|
clh.Logger().WithError(err1).Error("failed to cleanupVM")
|
|
}
|
|
}()
|
|
|
|
clh.Logger().Debug("Stopping Cloud Hypervisor")
|
|
|
|
if pidRunning && !waitOnly {
|
|
clhRunning, _ := clh.isClhRunning(clhStopSandboxTimeout)
|
|
if clhRunning {
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhStopSandboxTimeout*time.Second)
|
|
defer cancel()
|
|
if _, err = clh.client().ShutdownVMM(ctx); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
}
|
|
|
|
if err = utils.WaitLocalProcess(pid, clhStopSandboxTimeout, syscall.Signal(0), clh.Logger()); err != nil {
|
|
return err
|
|
}
|
|
|
|
if clh.virtiofsd == nil {
|
|
return errors.New("virtiofsd config is nil, failed to stop it")
|
|
}
|
|
|
|
clh.Logger().Debug("stop virtiofsd")
|
|
if err = clh.virtiofsd.Stop(ctx); err != nil {
|
|
clh.Logger().Error("failed to stop virtiofsd")
|
|
}
|
|
|
|
return
|
|
}
|
|
|
|
func (clh *cloudHypervisor) reset() {
|
|
clh.state.reset()
|
|
}
|
|
|
|
func (clh *cloudHypervisor) generateSocket(id string) (interface{}, error) {
|
|
udsPath, err := clh.vsockSocketPath(id)
|
|
if err != nil {
|
|
clh.Logger().Info("Can't generate socket path for cloud-hypervisor")
|
|
return types.HybridVSock{}, err
|
|
}
|
|
|
|
return types.HybridVSock{
|
|
UdsPath: udsPath,
|
|
Port: uint32(vSockPort),
|
|
}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) virtioFsSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.store.RunVMStoragePath(), id, virtioFsSocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) vsockSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.store.RunVMStoragePath(), id, clhSocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) apiSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.store.RunVMStoragePath(), id, clhAPISocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) waitVMM(timeout uint) error {
|
|
clhRunning, err := clh.isClhRunning(timeout)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if !clhRunning {
|
|
return fmt.Errorf("CLH is not running")
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) clhPath() (string, error) {
|
|
p, err := clh.config.HypervisorAssetPath()
|
|
if err != nil {
|
|
return "", err
|
|
}
|
|
|
|
if p == "" {
|
|
p = defaultClhPath
|
|
}
|
|
|
|
if _, err = os.Stat(p); os.IsNotExist(err) {
|
|
return "", fmt.Errorf("Cloud-Hypervisor path (%s) does not exist", p)
|
|
}
|
|
|
|
return p, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) launchClh() (int, error) {
|
|
|
|
clhPath, err := clh.clhPath()
|
|
if err != nil {
|
|
return -1, err
|
|
}
|
|
|
|
args := []string{cscAPIsocket, clh.state.apiSocket}
|
|
if clh.config.Debug {
|
|
// Cloud hypervisor log levels
|
|
// 'v' occurrences increase the level
|
|
//0 => Error
|
|
//1 => Warn
|
|
//2 => Info
|
|
//3 => Debug
|
|
//4+ => Trace
|
|
// Use Info, the CI runs with debug enabled
|
|
// a high level of logging increases the boot time
|
|
// and in a nested environment this could increase
|
|
// the chances to fail because agent is not
|
|
// ready on time.
|
|
args = append(args, "-vv")
|
|
}
|
|
|
|
// Disable the 'seccomp' option in clh for now.
|
|
// In this way, we can separate the periodic failures caused
|
|
// by incomplete `seccomp` filters from other failures.
|
|
// We will bring it back after completing the `seccomp` filter.
|
|
args = append(args, "--seccomp", "false")
|
|
|
|
clh.Logger().WithField("path", clhPath).Info()
|
|
clh.Logger().WithField("args", strings.Join(args, " ")).Info()
|
|
|
|
cmdHypervisor := exec.Command(clhPath, args...)
|
|
if clh.config.Debug {
|
|
cmdHypervisor.Env = os.Environ()
|
|
cmdHypervisor.Env = append(cmdHypervisor.Env, "RUST_BACKTRACE=full")
|
|
if clh.console != nil {
|
|
cmdHypervisor.Stderr = clh.console
|
|
cmdHypervisor.Stdout = clh.console
|
|
}
|
|
}
|
|
|
|
cmdHypervisor.Stderr = cmdHypervisor.Stdout
|
|
|
|
err = utils.StartCmd(cmdHypervisor)
|
|
if err != nil {
|
|
return -1, err
|
|
}
|
|
|
|
if err := clh.waitVMM(clhTimeout); err != nil {
|
|
clh.Logger().WithField("error", err).Warn("cloud-hypervisor init failed")
|
|
return -1, err
|
|
}
|
|
|
|
return cmdHypervisor.Process.Pid, nil
|
|
}
|
|
|
|
//###########################################################################
|
|
//
|
|
// Cloud-hypervisor CLI builder
|
|
//
|
|
//###########################################################################
|
|
|
|
const (
|
|
cctOFF string = "Off"
|
|
cctNULL string = "Null"
|
|
cctTTY string = "Tty"
|
|
)
|
|
|
|
const (
|
|
cscAPIsocket string = "--api-socket"
|
|
)
|
|
|
|
//****************************************
|
|
// The kernel command line
|
|
//****************************************
|
|
|
|
func kernelParamsToString(params []Param) string {
|
|
|
|
var paramBuilder strings.Builder
|
|
for _, p := range params {
|
|
paramBuilder.WriteString(p.Key)
|
|
if len(p.Value) > 0 {
|
|
paramBuilder.WriteString("=")
|
|
paramBuilder.WriteString(p.Value)
|
|
}
|
|
paramBuilder.WriteString(" ")
|
|
}
|
|
return strings.TrimSpace(paramBuilder.String())
|
|
}
|
|
|
|
//****************************************
|
|
// API calls
|
|
//****************************************
|
|
func (clh *cloudHypervisor) isClhRunning(timeout uint) (bool, error) {
|
|
|
|
pid := clh.state.PID
|
|
|
|
// Check if clh process is running, in case it is not, let's
|
|
// return from here.
|
|
if err := syscall.Kill(pid, syscall.Signal(0)); err != nil {
|
|
return false, nil
|
|
}
|
|
|
|
timeStart := time.Now()
|
|
cl := clh.client()
|
|
for {
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhAPITimeout*time.Second)
|
|
defer cancel()
|
|
_, _, err := cl.VmmPingGet(ctx)
|
|
if err == nil {
|
|
return true, nil
|
|
}
|
|
|
|
if time.Since(timeStart).Seconds() > float64(timeout) {
|
|
return false, fmt.Errorf("Failed to connect to API (timeout %ds): %s", timeout, openAPIClientError(err))
|
|
}
|
|
|
|
time.Sleep(time.Duration(10) * time.Millisecond)
|
|
}
|
|
|
|
}
|
|
|
|
func (clh *cloudHypervisor) client() clhClient {
|
|
if clh.APIClient == nil {
|
|
clh.APIClient = clh.newAPIClient()
|
|
}
|
|
|
|
return clh.APIClient
|
|
}
|
|
|
|
func (clh *cloudHypervisor) newAPIClient() *chclient.DefaultApiService {
|
|
|
|
cfg := chclient.NewConfiguration()
|
|
|
|
socketTransport := &http.Transport{
|
|
DialContext: func(ctx context.Context, network, path string) (net.Conn, error) {
|
|
addr, err := net.ResolveUnixAddr("unix", clh.state.apiSocket)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
return net.DialUnix("unix", nil, addr)
|
|
},
|
|
}
|
|
|
|
cfg.HTTPClient = http.DefaultClient
|
|
cfg.HTTPClient.Transport = socketTransport
|
|
|
|
return chclient.NewAPIClient(cfg).DefaultApi
|
|
}
|
|
|
|
func openAPIClientError(err error) error {
|
|
|
|
if err == nil {
|
|
return nil
|
|
}
|
|
|
|
reason := ""
|
|
if apierr, ok := err.(chclient.GenericOpenAPIError); ok {
|
|
reason = string(apierr.Body())
|
|
}
|
|
|
|
return fmt.Errorf("error: %v reason: %s", err, reason)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) bootVM(ctx context.Context) error {
|
|
|
|
cl := clh.client()
|
|
|
|
if clh.config.Debug {
|
|
bodyBuf, err := json.Marshal(clh.vmconfig)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.Logger().WithField("body", string(bodyBuf)).Debug("VM config")
|
|
}
|
|
_, err := cl.CreateVM(ctx, clh.vmconfig)
|
|
if err != nil {
|
|
return openAPIClientError(err)
|
|
}
|
|
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debugf("VM state after create: %#v", info)
|
|
|
|
if info.State != clhStateCreated {
|
|
return fmt.Errorf("VM state is not 'Created' after 'CreateVM'")
|
|
}
|
|
|
|
clh.Logger().Debug("Booting VM")
|
|
_, err = cl.BootVM(ctx)
|
|
if err != nil {
|
|
return openAPIClientError(err)
|
|
}
|
|
|
|
info, err = clh.vmInfo()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debugf("VM state after boot: %#v", info)
|
|
|
|
if info.State != clhStateRunning {
|
|
return fmt.Errorf("VM state is not 'Running' after 'BootVM'")
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) addVSock(cid int64, path string) {
|
|
clh.Logger().WithFields(log.Fields{
|
|
"path": path,
|
|
"cid": cid,
|
|
}).Info("Adding HybridVSock")
|
|
|
|
clh.vmconfig.Vsock = chclient.VsockConfig{Cid: cid, Socket: path}
|
|
}
|
|
|
|
func (clh *cloudHypervisor) addNet(e Endpoint) error {
|
|
clh.Logger().WithField("endpoint-type", e).Debugf("Adding Endpoint of type %v", e)
|
|
|
|
mac := e.HardwareAddr()
|
|
netPair := e.NetworkPair()
|
|
if netPair == nil {
|
|
return errors.New("net Pair to be added is nil, needed to get TAP path")
|
|
}
|
|
|
|
tapPath := netPair.TapInterface.TAPIface.Name
|
|
if tapPath == "" {
|
|
return errors.New("TAP path in network pair is empty")
|
|
}
|
|
|
|
clh.Logger().WithFields(log.Fields{
|
|
"mac": mac,
|
|
"tap": tapPath,
|
|
}).Info("Adding Net")
|
|
|
|
clh.vmconfig.Net = append(clh.vmconfig.Net, chclient.NetConfig{Mac: mac, Tap: tapPath})
|
|
return nil
|
|
}
|
|
|
|
// Add shared Volume using virtiofs
|
|
func (clh *cloudHypervisor) addVolume(volume types.Volume) error {
|
|
if clh.config.SharedFS != config.VirtioFS {
|
|
return fmt.Errorf("shared fs method not supported %s", clh.config.SharedFS)
|
|
}
|
|
|
|
vfsdSockPath, err := clh.virtioFsSocketPath(clh.id)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// disable DAX if VirtioFSCacheSize is 0
|
|
dax := clh.config.VirtioFSCacheSize != 0
|
|
|
|
// numQueues and queueSize are required, let's use the
|
|
// default values defined by cloud-hypervisor
|
|
numQueues := int32(1)
|
|
queueSize := int32(1024)
|
|
|
|
clh.vmconfig.Fs = []chclient.FsConfig{
|
|
{
|
|
Tag: volume.MountTag,
|
|
Socket: vfsdSockPath,
|
|
Dax: dax,
|
|
CacheSize: int64(clh.config.VirtioFSCacheSize << 20),
|
|
NumQueues: numQueues,
|
|
QueueSize: queueSize,
|
|
},
|
|
}
|
|
|
|
clh.Logger().Debug("Adding share volume to hypervisor: ", volume.MountTag)
|
|
return nil
|
|
}
|
|
|
|
// cleanupVM will remove generated files and directories related with the virtual machine
|
|
func (clh *cloudHypervisor) cleanupVM(force bool) error {
|
|
|
|
if clh.id == "" {
|
|
return errors.New("Hypervisor ID is empty")
|
|
}
|
|
|
|
clh.Logger().Debug("removing vm sockets")
|
|
|
|
path, err := clh.vsockSocketPath(clh.id)
|
|
if err == nil {
|
|
if err := os.Remove(path); err != nil {
|
|
clh.Logger().WithField("path", path).Warn("removing vm socket failed")
|
|
}
|
|
}
|
|
|
|
// cleanup vm path
|
|
dir := filepath.Join(clh.store.RunVMStoragePath(), clh.id)
|
|
|
|
// If it's a symlink, remove both dir and the target.
|
|
link, err := filepath.EvalSymlinks(dir)
|
|
if err != nil {
|
|
clh.Logger().WithError(err).WithField("dir", dir).Warn("failed to resolve vm path")
|
|
}
|
|
|
|
clh.Logger().WithFields(log.Fields{
|
|
"link": link,
|
|
"dir": dir,
|
|
}).Infof("cleanup vm path")
|
|
|
|
if err := os.RemoveAll(dir); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).Warnf("failed to remove vm path %s", dir)
|
|
}
|
|
if link != dir && link != "" {
|
|
if err := os.RemoveAll(link); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).WithField("link", link).Warn("failed to remove resolved vm path")
|
|
}
|
|
}
|
|
|
|
if clh.config.VMid != "" {
|
|
dir = filepath.Join(clh.store.RunStoragePath(), clh.config.VMid)
|
|
if err := os.RemoveAll(dir); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).WithField("path", dir).Warnf("failed to remove vm path")
|
|
}
|
|
}
|
|
|
|
clh.reset()
|
|
|
|
return nil
|
|
}
|
|
|
|
// vmInfo ask to hypervisor for current VM status
|
|
func (clh *cloudHypervisor) vmInfo() (chclient.VmInfo, error) {
|
|
cl := clh.client()
|
|
ctx, cancelInfo := context.WithTimeout(context.Background(), clhAPITimeout*time.Second)
|
|
defer cancelInfo()
|
|
|
|
info, _, err := cl.VmInfoGet(ctx)
|
|
if err != nil {
|
|
clh.Logger().WithError(openAPIClientError(err)).Warn("VmInfoGet failed")
|
|
}
|
|
return info, openAPIClientError(err)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) isRateLimiterBuiltin() bool {
|
|
return false
|
|
}
|
|
|
|
func (clh *cloudHypervisor) setSandbox(sandbox *Sandbox) {
|
|
}
|