mirror of
https://github.com/aljazceru/kata-containers.git
synced 2026-01-28 10:44:25 +01:00
Booting up TDX takes more time than booting up a normal VM. Those values are being already used as part of the CCv0 branch, and we're just bringing them to the `main` branch as well. Signed-off-by: Fabiano Fidêncio <fabiano.fidencio@intel.com>
1755 lines
51 KiB
Go
1755 lines
51 KiB
Go
//go:build linux
|
|
|
|
// Copyright (c) 2019 Ericsson Eurolab Deutschland GmbH
|
|
//
|
|
// SPDX-License-Identifier: Apache-2.0
|
|
//
|
|
|
|
package virtcontainers
|
|
|
|
import (
|
|
"bufio"
|
|
"bytes"
|
|
"context"
|
|
"encoding/json"
|
|
"fmt"
|
|
"io"
|
|
"net"
|
|
"net/http"
|
|
"net/http/httputil"
|
|
"os"
|
|
"os/exec"
|
|
"os/user"
|
|
"path/filepath"
|
|
"regexp"
|
|
"strconv"
|
|
"strings"
|
|
"sync"
|
|
"sync/atomic"
|
|
"syscall"
|
|
"time"
|
|
|
|
"github.com/containerd/console"
|
|
chclient "github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/cloud-hypervisor/client"
|
|
"github.com/opencontainers/selinux/go-selinux/label"
|
|
"github.com/pkg/errors"
|
|
log "github.com/sirupsen/logrus"
|
|
|
|
"github.com/kata-containers/kata-containers/src/runtime/pkg/device/config"
|
|
hv "github.com/kata-containers/kata-containers/src/runtime/pkg/hypervisors"
|
|
"github.com/kata-containers/kata-containers/src/runtime/pkg/katautils/katatrace"
|
|
pkgUtils "github.com/kata-containers/kata-containers/src/runtime/pkg/utils"
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/rootless"
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/types"
|
|
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/utils"
|
|
)
|
|
|
|
// clhTracingTags defines tags for the trace span
|
|
var clhTracingTags = map[string]string{
|
|
"source": "runtime",
|
|
"package": "virtcontainers",
|
|
"subsystem": "hypervisor",
|
|
"type": "clh",
|
|
}
|
|
|
|
//
|
|
// Constants and type definitions related to cloud hypervisor
|
|
//
|
|
|
|
type clhState uint8
|
|
|
|
const (
|
|
clhNotReady clhState = iota
|
|
clhReady
|
|
)
|
|
|
|
const (
|
|
clhStateCreated = "Created"
|
|
clhStateRunning = "Running"
|
|
)
|
|
|
|
const (
|
|
// Values are mandatory by http API
|
|
// Values based on:
|
|
clhTimeout = 10
|
|
clhAPITimeout = 1
|
|
clhAPITimeoutConfidentialGuest = 20
|
|
// Timeout for hot-plug - hotplug devices can take more time, than usual API calls
|
|
// Use longer time timeout for it.
|
|
clhHotPlugAPITimeout = 5
|
|
clhStopSandboxTimeout = 3
|
|
clhStopSandboxTimeoutConfidentialGuest = 10
|
|
clhSocket = "clh.sock"
|
|
clhAPISocket = "clh-api.sock"
|
|
virtioFsSocket = "virtiofsd.sock"
|
|
defaultClhPath = "/usr/local/bin/cloud-hypervisor"
|
|
)
|
|
|
|
// Interface that hides the implementation of openAPI client
|
|
// If the client changes its methods, this interface should do it as well,
|
|
// The main purpose is to hide the client in an interface to allow mock testing.
|
|
// This is an interface that has to match with OpenAPI CLH client
|
|
type clhClient interface {
|
|
// Check for the REST API availability
|
|
VmmPingGet(ctx context.Context) (chclient.VmmPingResponse, *http.Response, error)
|
|
// Shut the VMM down
|
|
ShutdownVMM(ctx context.Context) (*http.Response, error)
|
|
// Create the VM
|
|
CreateVM(ctx context.Context, vmConfig chclient.VmConfig) (*http.Response, error)
|
|
// Dump the VM information
|
|
// No lint: golint suggest to rename to VMInfoGet.
|
|
VmInfoGet(ctx context.Context) (chclient.VmInfo, *http.Response, error) //nolint:golint
|
|
// Boot the VM
|
|
BootVM(ctx context.Context) (*http.Response, error)
|
|
// Add/remove CPUs to/from the VM
|
|
VmResizePut(ctx context.Context, vmResize chclient.VmResize) (*http.Response, error)
|
|
// Add VFIO PCI device to the VM
|
|
VmAddDevicePut(ctx context.Context, deviceConfig chclient.DeviceConfig) (chclient.PciDeviceInfo, *http.Response, error)
|
|
// Add a new disk device to the VM
|
|
VmAddDiskPut(ctx context.Context, diskConfig chclient.DiskConfig) (chclient.PciDeviceInfo, *http.Response, error)
|
|
// Remove a device from the VM
|
|
VmRemoveDevicePut(ctx context.Context, vmRemoveDevice chclient.VmRemoveDevice) (*http.Response, error)
|
|
}
|
|
|
|
type clhClientApi struct {
|
|
ApiInternal *chclient.DefaultApiService
|
|
}
|
|
|
|
func (c *clhClientApi) VmmPingGet(ctx context.Context) (chclient.VmmPingResponse, *http.Response, error) {
|
|
return c.ApiInternal.VmmPingGet(ctx).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) ShutdownVMM(ctx context.Context) (*http.Response, error) {
|
|
return c.ApiInternal.ShutdownVMM(ctx).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) CreateVM(ctx context.Context, vmConfig chclient.VmConfig) (*http.Response, error) {
|
|
return c.ApiInternal.CreateVM(ctx).VmConfig(vmConfig).Execute()
|
|
}
|
|
|
|
//nolint:golint
|
|
func (c *clhClientApi) VmInfoGet(ctx context.Context) (chclient.VmInfo, *http.Response, error) {
|
|
return c.ApiInternal.VmInfoGet(ctx).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) BootVM(ctx context.Context) (*http.Response, error) {
|
|
return c.ApiInternal.BootVM(ctx).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) VmResizePut(ctx context.Context, vmResize chclient.VmResize) (*http.Response, error) {
|
|
return c.ApiInternal.VmResizePut(ctx).VmResize(vmResize).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) VmAddDevicePut(ctx context.Context, deviceConfig chclient.DeviceConfig) (chclient.PciDeviceInfo, *http.Response, error) {
|
|
return c.ApiInternal.VmAddDevicePut(ctx).DeviceConfig(deviceConfig).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) VmAddDiskPut(ctx context.Context, diskConfig chclient.DiskConfig) (chclient.PciDeviceInfo, *http.Response, error) {
|
|
return c.ApiInternal.VmAddDiskPut(ctx).DiskConfig(diskConfig).Execute()
|
|
}
|
|
|
|
func (c *clhClientApi) VmRemoveDevicePut(ctx context.Context, vmRemoveDevice chclient.VmRemoveDevice) (*http.Response, error) {
|
|
return c.ApiInternal.VmRemoveDevicePut(ctx).VmRemoveDevice(vmRemoveDevice).Execute()
|
|
}
|
|
|
|
// This is done in order to be able to override such a function as part of
|
|
// our unit tests, as when testing bootVM we're on a mocked scenario already.
|
|
var vmAddNetPutRequest = func(clh *cloudHypervisor) error {
|
|
if clh.netDevices == nil {
|
|
clh.Logger().Info("No network device has been configured by the upper layer")
|
|
return nil
|
|
}
|
|
|
|
addr, err := net.ResolveUnixAddr("unix", clh.state.apiSocket)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
conn, err := net.DialUnix("unix", nil, addr)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
defer conn.Close()
|
|
|
|
for _, netDevice := range *clh.netDevices {
|
|
clh.Logger().Infof("Adding the net device to the Cloud Hypervisor VM configuration: %+v", netDevice)
|
|
|
|
netDeviceAsJson, err := json.Marshal(netDevice)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
netDeviceAsIoReader := bytes.NewBuffer(netDeviceAsJson)
|
|
|
|
req, err := http.NewRequest(http.MethodPut, "http://localhost/api/v1/vm.add-net", netDeviceAsIoReader)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
req.Header.Set("Accept", "application/json")
|
|
req.Header.Set("Content-Type", "application/json")
|
|
req.Header.Set("Content-Length", strconv.Itoa(int(netDeviceAsIoReader.Len())))
|
|
|
|
payload, err := httputil.DumpRequest(req, true)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
files := clh.netDevicesFiles[*netDevice.Mac]
|
|
var fds []int
|
|
for _, f := range files {
|
|
fds = append(fds, int(f.Fd()))
|
|
}
|
|
oob := syscall.UnixRights(fds...)
|
|
payloadn, oobn, err := conn.WriteMsgUnix([]byte(payload), oob, nil)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
if payloadn != len(payload) || oobn != len(oob) {
|
|
return fmt.Errorf("Failed to send all the request to Cloud Hypervisor. %d bytes expect to send as payload, %d bytes expect to send as oob date, but only %d sent as payload, and %d sent as oob", len(payload), len(oob), payloadn, oobn)
|
|
}
|
|
|
|
reader := bufio.NewReader(conn)
|
|
resp, err := http.ReadResponse(reader, req)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
respBody, err := io.ReadAll(resp.Body)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
resp.Body.Close()
|
|
resp.Body = io.NopCloser(bytes.NewBuffer(respBody))
|
|
|
|
if resp.StatusCode != 200 && resp.StatusCode != 204 {
|
|
clh.Logger().Errorf("vmAddNetPut failed with error '%d'. Response: %+v", resp.StatusCode, resp)
|
|
return fmt.Errorf("Failed to add the network device '%+v' to Cloud Hypervisor: %v", netDevice, resp.StatusCode)
|
|
}
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// Cloud hypervisor state
|
|
type CloudHypervisorState struct {
|
|
apiSocket string
|
|
PID int
|
|
VirtiofsDaemonPid int
|
|
state clhState
|
|
}
|
|
|
|
func (s *CloudHypervisorState) reset() {
|
|
s.PID = 0
|
|
s.VirtiofsDaemonPid = 0
|
|
s.state = clhNotReady
|
|
}
|
|
|
|
type cloudHypervisor struct {
|
|
console console.Console
|
|
virtiofsDaemon VirtiofsDaemon
|
|
APIClient clhClient
|
|
ctx context.Context
|
|
id string
|
|
netDevices *[]chclient.NetConfig
|
|
devicesIds map[string]string
|
|
netDevicesFiles map[string][]*os.File
|
|
vmconfig chclient.VmConfig
|
|
state CloudHypervisorState
|
|
config HypervisorConfig
|
|
stopped int32
|
|
mu sync.Mutex
|
|
}
|
|
|
|
var clhKernelParams = []Param{
|
|
{"panic", "1"}, // upon kernel panic wait 1 second before reboot
|
|
{"no_timer_check", ""}, // do not Check broken timer IRQ resources
|
|
{"noreplace-smp", ""}, // do not replace SMP instructions
|
|
}
|
|
|
|
var clhDebugKernelParams = []Param{
|
|
{"console", "ttyS0,115200n8"}, // enable serial console
|
|
}
|
|
|
|
var clhDebugConfidentialGuestKernelParams = []Param{
|
|
{"console", "hvc0"}, // enable HVC console
|
|
}
|
|
|
|
var clhDebugKernelParamsCommon = []Param{
|
|
{"systemd.log_target", "console"}, // send loggng to the console
|
|
}
|
|
|
|
//###########################################################
|
|
//
|
|
// hypervisor interface implementation for cloud-hypervisor
|
|
//
|
|
//###########################################################
|
|
|
|
func (clh *cloudHypervisor) getClhAPITimeout() time.Duration {
|
|
// Increase the APITimeout when dealing with a Confidential Guest.
|
|
// The value has been chosen based on tests using `ctr`, and hopefully
|
|
// this change can be dropped in further steps of the development.
|
|
if clh.config.ConfidentialGuest {
|
|
return clhAPITimeoutConfidentialGuest
|
|
}
|
|
|
|
return clhAPITimeout
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getClhStopSandboxTimeout() time.Duration {
|
|
// Increase the StopSandboxTimeout when dealing with a Confidential Guest.
|
|
// The value has been chosen based on tests using `ctr`, and hopefully
|
|
// this change can be dropped in further steps of the development.
|
|
if clh.config.ConfidentialGuest {
|
|
return clhStopSandboxTimeoutConfidentialGuest
|
|
}
|
|
|
|
return clhStopSandboxTimeout
|
|
}
|
|
|
|
func (clh *cloudHypervisor) setConfig(config *HypervisorConfig) error {
|
|
clh.config = *config
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) createVirtiofsDaemon(sharedPath string) (VirtiofsDaemon, error) {
|
|
virtiofsdSocketPath, err := clh.virtioFsSocketPath(clh.id)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
if clh.config.SharedFS == config.VirtioFSNydus {
|
|
apiSockPath, err := clh.nydusdAPISocketPath(clh.id)
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Error("Invalid api socket path for nydusd")
|
|
return nil, err
|
|
}
|
|
nd := &nydusd{
|
|
path: clh.config.VirtioFSDaemon,
|
|
sockPath: virtiofsdSocketPath,
|
|
apiSockPath: apiSockPath,
|
|
sourcePath: sharedPath,
|
|
debug: clh.config.Debug,
|
|
extraArgs: clh.config.VirtioFSExtraArgs,
|
|
startFn: startInShimNS,
|
|
}
|
|
nd.setupShareDirFn = nd.setupPassthroughFS
|
|
return nd, nil
|
|
}
|
|
|
|
// default: use virtiofsd
|
|
return &virtiofsd{
|
|
path: clh.config.VirtioFSDaemon,
|
|
sourcePath: sharedPath,
|
|
socketPath: virtiofsdSocketPath,
|
|
extraArgs: clh.config.VirtioFSExtraArgs,
|
|
cache: clh.config.VirtioFSCache,
|
|
}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) setupVirtiofsDaemon(ctx context.Context) error {
|
|
if clh.config.SharedFS == config.Virtio9P {
|
|
return errors.New("cloud-hypervisor only supports virtio based file sharing")
|
|
}
|
|
|
|
// virtioFS or virtioFsNydus
|
|
clh.Logger().WithField("function", "setupVirtiofsDaemon").Info("Starting virtiofsDaemon")
|
|
|
|
if clh.virtiofsDaemon == nil {
|
|
return errors.New("Missing virtiofsDaemon configuration")
|
|
}
|
|
|
|
pid, err := clh.virtiofsDaemon.Start(ctx, func() {
|
|
clh.StopVM(ctx, false)
|
|
})
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.state.VirtiofsDaemonPid = pid
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) stopVirtiofsDaemon(ctx context.Context) (err error) {
|
|
if clh.state.VirtiofsDaemonPid == 0 {
|
|
clh.Logger().Warn("The virtiofsd had stopped")
|
|
return nil
|
|
}
|
|
|
|
err = clh.virtiofsDaemon.Stop(ctx)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.state.VirtiofsDaemonPid = 0
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) loadVirtiofsDaemon(sharedPath string) (VirtiofsDaemon, error) {
|
|
virtiofsdSocketPath, err := clh.virtioFsSocketPath(clh.id)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
return &virtiofsd{
|
|
PID: clh.state.VirtiofsDaemonPid,
|
|
sourcePath: sharedPath,
|
|
socketPath: virtiofsdSocketPath,
|
|
}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) nydusdAPISocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.config.VMStorePath, id, nydusdAPISock)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) enableProtection() error {
|
|
protection, err := availableGuestProtection()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
switch protection {
|
|
case tdxProtection:
|
|
firmwarePath, err := clh.config.FirmwareAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if firmwarePath == "" {
|
|
return errors.New("Firmware path is not specified")
|
|
}
|
|
|
|
clh.vmconfig.Payload.SetFirmware(firmwarePath)
|
|
|
|
if clh.vmconfig.Platform == nil {
|
|
clh.vmconfig.Platform = chclient.NewPlatformConfig()
|
|
}
|
|
clh.vmconfig.Platform.SetTdx(true)
|
|
|
|
return nil
|
|
|
|
case sevProtection:
|
|
return errors.New("SEV protection is not supported by Cloud Hypervisor")
|
|
case snpProtection:
|
|
return errors.New("SEV-SNP protection is not supported by Cloud Hypervisor")
|
|
|
|
default:
|
|
return errors.New("This system doesn't support Confidential Computing (Guest Protection)")
|
|
}
|
|
}
|
|
|
|
// For cloudHypervisor this call only sets the internal structure up.
|
|
// The VM will be created and started through StartVM().
|
|
func (clh *cloudHypervisor) CreateVM(ctx context.Context, id string, network Network, hypervisorConfig *HypervisorConfig) error {
|
|
clh.ctx = ctx
|
|
|
|
span, newCtx := katatrace.Trace(clh.ctx, clh.Logger(), "CreateVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
clh.ctx = newCtx
|
|
defer span.End()
|
|
|
|
if err := clh.setConfig(hypervisorConfig); err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.id = id
|
|
clh.state.state = clhNotReady
|
|
clh.devicesIds = make(map[string]string)
|
|
clh.netDevicesFiles = make(map[string][]*os.File)
|
|
|
|
clh.Logger().WithField("function", "CreateVM").Info("creating Sandbox")
|
|
|
|
if clh.state.PID > 0 {
|
|
clh.Logger().WithField("function", "CreateVM").Info("Sandbox already exist, loading from state")
|
|
|
|
virtiofsDaemon, err := clh.loadVirtiofsDaemon(hypervisorConfig.SharedFS)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.virtiofsDaemon = virtiofsDaemon
|
|
|
|
return nil
|
|
}
|
|
|
|
// No need to return an error from there since there might be nothing
|
|
// to fetch if this is the first time the hypervisor is created.
|
|
clh.Logger().WithField("function", "CreateVM").Info("Sandbox not found creating")
|
|
|
|
// Create the VM config via the constructor to ensure default values are properly assigned
|
|
clh.vmconfig = *chclient.NewVmConfig(*chclient.NewPayloadConfig())
|
|
|
|
// Make sure the kernel path is valid
|
|
kernelPath, err := clh.config.KernelAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.vmconfig.Payload.SetKernel(kernelPath)
|
|
|
|
if clh.config.ConfidentialGuest {
|
|
if err := clh.enableProtection(); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
|
|
// Create the VM memory config via the constructor to ensure default values are properly assigned
|
|
clh.vmconfig.Memory = chclient.NewMemoryConfig(int64((utils.MemUnit(clh.config.MemorySize) * utils.MiB).ToBytes()))
|
|
// shared memory should be enabled if using vhost-user(kata uses virtiofsd)
|
|
clh.vmconfig.Memory.Shared = func(b bool) *bool { return &b }(true)
|
|
// Enable hugepages if needed
|
|
clh.vmconfig.Memory.Hugepages = func(b bool) *bool { return &b }(clh.config.HugePages)
|
|
if !clh.config.ConfidentialGuest {
|
|
hotplugSize := clh.config.DefaultMaxMemorySize
|
|
// OpenAPI only supports int64 values
|
|
clh.vmconfig.Memory.HotplugSize = func(i int64) *int64 { return &i }(int64((utils.MemUnit(hotplugSize) * utils.MiB).ToBytes()))
|
|
}
|
|
// Set initial amount of cpu's for the virtual machine
|
|
clh.vmconfig.Cpus = chclient.NewCpusConfig(int32(clh.config.NumVCPUs), int32(clh.config.DefaultMaxVCPUs))
|
|
|
|
params, err := GetKernelRootParams(hypervisorConfig.RootfsType, clh.config.ConfidentialGuest, false)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
params = append(params, clhKernelParams...)
|
|
|
|
// Followed by extra debug parameters if debug enabled in configuration file
|
|
if clh.config.Debug {
|
|
if clh.config.ConfidentialGuest {
|
|
params = append(params, clhDebugConfidentialGuestKernelParams...)
|
|
} else {
|
|
params = append(params, clhDebugKernelParams...)
|
|
}
|
|
params = append(params, clhDebugKernelParamsCommon...)
|
|
} else {
|
|
// start the guest kernel with 'quiet' in non-debug mode
|
|
params = append(params, Param{"quiet", ""})
|
|
}
|
|
|
|
// Followed by extra kernel parameters defined in the configuration file
|
|
params = append(params, clh.config.KernelParams...)
|
|
|
|
clh.vmconfig.Payload.SetCmdline(kernelParamsToString(params))
|
|
|
|
// set random device generator to hypervisor
|
|
clh.vmconfig.Rng = chclient.NewRngConfig(clh.config.EntropySource)
|
|
|
|
// set the initial root/boot disk of hypervisor
|
|
imagePath, err := clh.config.ImageAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if imagePath != "" {
|
|
if clh.config.ConfidentialGuest {
|
|
disk := chclient.NewDiskConfig(imagePath)
|
|
disk.SetReadonly(true)
|
|
|
|
diskRateLimiterConfig := clh.getDiskRateLimiterConfig()
|
|
if diskRateLimiterConfig != nil {
|
|
disk.SetRateLimiterConfig(*diskRateLimiterConfig)
|
|
}
|
|
|
|
if clh.vmconfig.Disks != nil {
|
|
*clh.vmconfig.Disks = append(*clh.vmconfig.Disks, *disk)
|
|
} else {
|
|
clh.vmconfig.Disks = &[]chclient.DiskConfig{*disk}
|
|
}
|
|
} else {
|
|
pmem := chclient.NewPmemConfig(imagePath)
|
|
*pmem.DiscardWrites = true
|
|
|
|
if clh.vmconfig.Pmem != nil {
|
|
*clh.vmconfig.Pmem = append(*clh.vmconfig.Pmem, *pmem)
|
|
} else {
|
|
clh.vmconfig.Pmem = &[]chclient.PmemConfig{*pmem}
|
|
}
|
|
}
|
|
} else {
|
|
initrdPath, err := clh.config.InitrdAssetPath()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.vmconfig.Payload.SetInitramfs(initrdPath)
|
|
}
|
|
|
|
if clh.config.ConfidentialGuest {
|
|
// Use HVC as the guest console only in debug mode, only
|
|
// for Confidential Guests
|
|
if clh.config.Debug {
|
|
clh.vmconfig.Console = chclient.NewConsoleConfig(cctTTY)
|
|
} else {
|
|
clh.vmconfig.Console = chclient.NewConsoleConfig(cctOFF)
|
|
}
|
|
|
|
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctOFF)
|
|
} else {
|
|
// Use serial port as the guest console only in debug mode,
|
|
// so that we can gather early OS booting log
|
|
if clh.config.Debug {
|
|
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctTTY)
|
|
} else {
|
|
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctOFF)
|
|
}
|
|
|
|
clh.vmconfig.Console = chclient.NewConsoleConfig(cctOFF)
|
|
}
|
|
|
|
cpu_topology := chclient.NewCpuTopology()
|
|
cpu_topology.ThreadsPerCore = func(i int32) *int32 { return &i }(1)
|
|
cpu_topology.CoresPerDie = func(i int32) *int32 { return &i }(int32(clh.config.DefaultMaxVCPUs))
|
|
cpu_topology.DiesPerPackage = func(i int32) *int32 { return &i }(1)
|
|
cpu_topology.Packages = func(i int32) *int32 { return &i }(1)
|
|
clh.vmconfig.Cpus.Topology = cpu_topology
|
|
|
|
// Overwrite the default value of HTTP API socket path for cloud hypervisor
|
|
apiSocketPath, err := clh.apiSocketPath(id)
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Info("Invalid api socket path for cloud-hypervisor")
|
|
return err
|
|
}
|
|
clh.state.apiSocket = apiSocketPath
|
|
|
|
cfg := chclient.NewConfiguration()
|
|
cfg.HTTPClient = &http.Client{
|
|
Transport: &http.Transport{
|
|
DialContext: func(ctx context.Context, network, path string) (net.Conn, error) {
|
|
addr, err := net.ResolveUnixAddr("unix", clh.state.apiSocket)
|
|
if err != nil {
|
|
return nil, err
|
|
}
|
|
|
|
return net.DialUnix("unix", nil, addr)
|
|
},
|
|
},
|
|
}
|
|
|
|
clh.APIClient = &clhClientApi{
|
|
ApiInternal: chclient.NewAPIClient(cfg).DefaultApi,
|
|
}
|
|
|
|
clh.virtiofsDaemon, err = clh.createVirtiofsDaemon(filepath.Join(GetSharePath(clh.id)))
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if clh.config.SGXEPCSize > 0 {
|
|
epcSection := chclient.NewSgxEpcConfig("kata-epc", clh.config.SGXEPCSize)
|
|
epcSection.Prefault = func(b bool) *bool { return &b }(true)
|
|
|
|
if clh.vmconfig.SgxEpc != nil {
|
|
*clh.vmconfig.SgxEpc = append(*clh.vmconfig.SgxEpc, *epcSection)
|
|
} else {
|
|
clh.vmconfig.SgxEpc = &[]chclient.SgxEpcConfig{*epcSection}
|
|
}
|
|
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
// StartVM will start the VMM and boot the virtual machine for the given sandbox.
|
|
func (clh *cloudHypervisor) StartVM(ctx context.Context, timeout int) error {
|
|
span, ctx := katatrace.Trace(ctx, clh.Logger(), "StartVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
clh.Logger().WithField("function", "StartVM").Info("starting Sandbox")
|
|
|
|
vmPath := filepath.Join(clh.config.VMStorePath, clh.id)
|
|
err := utils.MkdirAllWithInheritedOwner(vmPath, DirMode)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// This needs to be done as late as possible, just before launching
|
|
// virtiofsd are executed by kata-runtime after this call, run with
|
|
// the SELinux label. If these processes require privileged, we do
|
|
// notwant to run them under confinement.
|
|
if !clh.config.DisableSeLinux {
|
|
|
|
if err := label.SetProcessLabel(clh.config.SELinuxProcessLabel); err != nil {
|
|
return err
|
|
}
|
|
defer label.SetProcessLabel("")
|
|
}
|
|
|
|
err = clh.setupVirtiofsDaemon(ctx)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
defer func() {
|
|
if err != nil {
|
|
if shutdownErr := clh.stopVirtiofsDaemon(ctx); shutdownErr != nil {
|
|
clh.Logger().WithError(shutdownErr).Warn("error shutting down VirtiofsDaemon")
|
|
}
|
|
}
|
|
}()
|
|
|
|
pid, err := clh.launchClh()
|
|
if err != nil {
|
|
return fmt.Errorf("failed to launch cloud-hypervisor: %q", err)
|
|
}
|
|
clh.state.PID = pid
|
|
|
|
ctx, cancel := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
|
|
defer cancel()
|
|
|
|
if err := clh.bootVM(ctx); err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.state.state = clhReady
|
|
return nil
|
|
}
|
|
|
|
// GetVMConsole builds the path of the console where we can read logs coming
|
|
// from the sandbox.
|
|
func (clh *cloudHypervisor) GetVMConsole(ctx context.Context, id string) (string, string, error) {
|
|
clh.Logger().WithField("function", "GetVMConsole").WithField("id", id).Info("Get Sandbox Console")
|
|
master, slave, err := console.NewPty()
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Error("Error create pseudo tty")
|
|
return consoleProtoPty, "", err
|
|
}
|
|
clh.console = master
|
|
|
|
return consoleProtoPty, slave, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) Disconnect(ctx context.Context) {
|
|
clh.Logger().WithField("function", "Disconnect").Info("Disconnecting Sandbox Console")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) GetThreadIDs(ctx context.Context) (VcpuThreadIDs, error) {
|
|
|
|
clh.Logger().WithField("function", "GetThreadIDs").Info("get thread ID's")
|
|
|
|
var vcpuInfo VcpuThreadIDs
|
|
|
|
vcpuInfo.vcpus = make(map[int]int)
|
|
|
|
getVcpus := func(pid int) (map[int]int, error) {
|
|
vcpus := make(map[int]int)
|
|
|
|
dir := fmt.Sprintf("/proc/%d/task", pid)
|
|
files, err := os.ReadDir(dir)
|
|
if err != nil {
|
|
return vcpus, err
|
|
}
|
|
|
|
pattern, err := regexp.Compile(`^vcpu\d+$`)
|
|
if err != nil {
|
|
return vcpus, err
|
|
}
|
|
for _, file := range files {
|
|
comm, err := os.ReadFile(fmt.Sprintf("%s/%s/comm", dir, file.Name()))
|
|
if err != nil {
|
|
return vcpus, err
|
|
}
|
|
pName := strings.TrimSpace(string(comm))
|
|
if !pattern.MatchString(pName) {
|
|
continue
|
|
}
|
|
|
|
cpuID := strings.TrimPrefix(pName, "vcpu")
|
|
threadID := file.Name()
|
|
|
|
k, err := strconv.Atoi(cpuID)
|
|
if err != nil {
|
|
return vcpus, err
|
|
}
|
|
v, err := strconv.Atoi(threadID)
|
|
if err != nil {
|
|
return vcpus, err
|
|
}
|
|
vcpus[k] = v
|
|
}
|
|
return vcpus, nil
|
|
}
|
|
|
|
if clh.state.PID == 0 {
|
|
return vcpuInfo, nil
|
|
}
|
|
|
|
vcpus, err := getVcpus(clh.state.PID)
|
|
if err != nil {
|
|
return vcpuInfo, err
|
|
}
|
|
vcpuInfo.vcpus = vcpus
|
|
|
|
return vcpuInfo, nil
|
|
}
|
|
|
|
func clhDriveIndexToID(i int) string {
|
|
return "clh_drive_" + strconv.Itoa(i)
|
|
}
|
|
|
|
// Various cloud-hypervisor APIs report a PCI address in "BB:DD.F"
|
|
// form within the PciDeviceInfo struct. This is a broken API,
|
|
// because there's no way clh can reliably know the guest side bdf for
|
|
// a device, since the bus number depends on how the guest firmware
|
|
// and/or kernel enumerates it. They get away with it only because
|
|
// they don't use bridges, and so the bus is always 0. Under that
|
|
// assumption convert a clh PciDeviceInfo into a PCI path
|
|
func clhPciInfoToPath(pciInfo chclient.PciDeviceInfo) (types.PciPath, error) {
|
|
tokens := strings.Split(pciInfo.Bdf, ":")
|
|
if len(tokens) != 3 || tokens[0] != "0000" || tokens[1] != "00" {
|
|
return types.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
tokens = strings.Split(tokens[2], ".")
|
|
if len(tokens) != 2 || tokens[1] != "0" || len(tokens[0]) != 2 {
|
|
return types.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
return types.PciPathFromString(tokens[0])
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotplugAddBlockDevice(drive *config.BlockDrive) error {
|
|
if drive.Swap {
|
|
return fmt.Errorf("cloudHypervisor doesn't support swap")
|
|
}
|
|
|
|
if clh.config.BlockDeviceDriver != config.VirtioBlock {
|
|
return fmt.Errorf("incorrect hypervisor configuration on 'block_device_driver':"+
|
|
" using '%v' but only support '%v'", clh.config.BlockDeviceDriver, config.VirtioBlock)
|
|
}
|
|
|
|
var err error
|
|
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
driveID := clhDriveIndexToID(drive.Index)
|
|
|
|
if drive.Pmem {
|
|
return fmt.Errorf("pmem device hotplug not supported")
|
|
}
|
|
|
|
// Create the clh disk config via the constructor to ensure default values are properly assigned
|
|
clhDisk := *chclient.NewDiskConfig(drive.File)
|
|
clhDisk.Readonly = &drive.ReadOnly
|
|
clhDisk.VhostUser = func(b bool) *bool { return &b }(false)
|
|
|
|
queues := int32(clh.config.NumVCPUs)
|
|
queueSize := int32(1024)
|
|
clhDisk.NumQueues = &queues
|
|
clhDisk.QueueSize = &queueSize
|
|
|
|
diskRateLimiterConfig := clh.getDiskRateLimiterConfig()
|
|
if diskRateLimiterConfig != nil {
|
|
clhDisk.SetRateLimiterConfig(*diskRateLimiterConfig)
|
|
}
|
|
|
|
pciInfo, _, err := cl.VmAddDiskPut(ctx, clhDisk)
|
|
|
|
if err != nil {
|
|
return fmt.Errorf("failed to hotplug block device %+v %s", drive, openAPIClientError(err))
|
|
}
|
|
|
|
clh.devicesIds[driveID] = pciInfo.GetId()
|
|
drive.PCIPath, err = clhPciInfoToPath(pciInfo)
|
|
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotPlugVFIODevice(device *config.VFIODev) error {
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
// Create the clh device config via the constructor to ensure default values are properly assigned
|
|
clhDevice := *chclient.NewDeviceConfig(*(*device).GetSysfsDev())
|
|
pciInfo, _, err := cl.VmAddDevicePut(ctx, clhDevice)
|
|
if err != nil {
|
|
return fmt.Errorf("Failed to hotplug device %+v %s", device, openAPIClientError(err))
|
|
}
|
|
clh.devicesIds[*(*device).GetID()] = pciInfo.GetId()
|
|
|
|
// clh doesn't use bridges, so the PCI path is simply the slot
|
|
// number of the device. This will break if clh starts using
|
|
// bridges (including PCI-E root ports), but so will the clh
|
|
// API, since there's no way it can reliably predict a guest
|
|
// Bdf when bridges are present.
|
|
tokens := strings.Split(pciInfo.Bdf, ":")
|
|
if len(tokens) != 3 || tokens[0] != "0000" || tokens[1] != "00" {
|
|
return fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
tokens = strings.Split(tokens[2], ".")
|
|
if len(tokens) != 2 || tokens[1] != "0" || len(tokens[0]) != 2 {
|
|
return fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
|
|
}
|
|
|
|
guestPciPath, err := types.PciPathFromString(tokens[0])
|
|
|
|
pciDevice, ok := (*device).(config.VFIOPCIDev)
|
|
if !ok {
|
|
return fmt.Errorf("VFIO device %+v is not PCI, only PCI is supported in Cloud Hypervisor", device)
|
|
}
|
|
pciDevice.GuestPciPath = guestPciPath
|
|
*device = pciDevice
|
|
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) hotplugAddNetDevice(e Endpoint) error {
|
|
err := clh.addNet(e)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
return clh.vmAddNetPut()
|
|
}
|
|
|
|
func (clh *cloudHypervisor) HotplugAddDevice(ctx context.Context, devInfo interface{}, devType DeviceType) (interface{}, error) {
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "HotplugAddDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
switch devType {
|
|
case BlockDev:
|
|
drive := devInfo.(*config.BlockDrive)
|
|
return nil, clh.hotplugAddBlockDevice(drive)
|
|
case VfioDev:
|
|
device := devInfo.(*config.VFIODev)
|
|
return nil, clh.hotPlugVFIODevice(device)
|
|
case NetDev:
|
|
device := devInfo.(Endpoint)
|
|
return nil, clh.hotplugAddNetDevice(device)
|
|
default:
|
|
return nil, fmt.Errorf("cannot hotplug device: unsupported device type '%v'", devType)
|
|
}
|
|
|
|
}
|
|
|
|
func (clh *cloudHypervisor) HotplugRemoveDevice(ctx context.Context, devInfo interface{}, devType DeviceType) (interface{}, error) {
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "HotplugRemoveDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
var deviceID string
|
|
|
|
switch devType {
|
|
case BlockDev:
|
|
deviceID = clhDriveIndexToID(devInfo.(*config.BlockDrive).Index)
|
|
case VfioDev:
|
|
deviceID = *devInfo.(config.VFIODev).GetID()
|
|
default:
|
|
clh.Logger().WithFields(log.Fields{"devInfo": devInfo,
|
|
"deviceType": devType}).Error("HotplugRemoveDevice: unsupported device")
|
|
return nil, fmt.Errorf("Could not hot remove device: unsupported device: %v, type: %v",
|
|
devInfo, devType)
|
|
}
|
|
|
|
cl := clh.client()
|
|
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
|
|
defer cancel()
|
|
|
|
originalDeviceID := clh.devicesIds[deviceID]
|
|
remove := *chclient.NewVmRemoveDevice()
|
|
remove.Id = &originalDeviceID
|
|
_, err := cl.VmRemoveDevicePut(ctx, remove)
|
|
if err != nil {
|
|
err = fmt.Errorf("failed to hotplug remove (unplug) device %+v: %s", devInfo, openAPIClientError(err))
|
|
}
|
|
|
|
delete(clh.devicesIds, deviceID)
|
|
return nil, err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) HypervisorConfig() HypervisorConfig {
|
|
return clh.config
|
|
}
|
|
|
|
func (clh *cloudHypervisor) ResizeMemory(ctx context.Context, reqMemMB uint32, memoryBlockSizeMB uint32, probe bool) (uint32, MemoryDevice, error) {
|
|
|
|
// TODO: Add support for virtio-mem
|
|
|
|
if probe {
|
|
return 0, MemoryDevice{}, errors.New("probe memory is not supported for cloud-hypervisor")
|
|
}
|
|
|
|
if reqMemMB == 0 {
|
|
// This is a corner case if requested to resize to 0 means something went really wrong.
|
|
return 0, MemoryDevice{}, errors.New("Can not resize memory to 0")
|
|
}
|
|
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
return 0, MemoryDevice{}, err
|
|
}
|
|
|
|
// HotplugSize can be nil in cases where Hotplug is not supported, as Cloud Hypervisor API
|
|
// does *not* allow us to set 0 as the HotplugSize.
|
|
maxHotplugSize := 0 * utils.Byte
|
|
if info.Config.Memory.HotplugSize != nil {
|
|
maxHotplugSize = utils.MemUnit(*info.Config.Memory.HotplugSize) * utils.Byte
|
|
}
|
|
|
|
if reqMemMB > uint32(maxHotplugSize.ToMiB()) {
|
|
reqMemMB = uint32(maxHotplugSize.ToMiB())
|
|
}
|
|
|
|
currentMem := utils.MemUnit(info.Config.Memory.Size) * utils.Byte
|
|
newMem := utils.MemUnit(reqMemMB) * utils.MiB
|
|
|
|
// Early Check to verify if boot memory is the same as requested
|
|
if currentMem == newMem {
|
|
clh.Logger().WithField("memory", reqMemMB).Debugf("VM already has requested memory")
|
|
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
|
|
}
|
|
|
|
if currentMem > newMem {
|
|
clh.Logger().Warn("Remove memory is not supported, nothing to do")
|
|
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
|
|
}
|
|
|
|
blockSize := utils.MemUnit(memoryBlockSizeMB) * utils.MiB
|
|
hotplugSize := (newMem - currentMem).AlignMem(blockSize)
|
|
|
|
// Update memory request to increase memory aligned block
|
|
alignedRequest := currentMem + hotplugSize
|
|
if newMem != alignedRequest {
|
|
clh.Logger().WithFields(log.Fields{"request": newMem, "aligned-request": alignedRequest}).Debug("aligning VM memory request")
|
|
newMem = alignedRequest
|
|
}
|
|
|
|
// Check if memory is the same as requested, a second Check is done
|
|
// to consider the memory request now that is updated to be memory aligned
|
|
if currentMem == newMem {
|
|
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("VM already has requested memory(after alignment)")
|
|
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
|
|
}
|
|
|
|
cl := clh.client()
|
|
ctx, cancelResize := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
|
|
defer cancelResize()
|
|
|
|
resize := *chclient.NewVmResize()
|
|
// OpenApi does not support uint64, convert to int64
|
|
resize.DesiredRam = func(i int64) *int64 { return &i }(int64(newMem.ToBytes()))
|
|
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("updating VM memory")
|
|
if _, err = cl.VmResizePut(ctx, resize); err != nil {
|
|
clh.Logger().WithError(err).WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Warnf("failed to update memory %s", openAPIClientError(err))
|
|
err = fmt.Errorf("Failed to resize memory from %d to %d: %s", currentMem, newMem, openAPIClientError(err))
|
|
return uint32(currentMem.ToMiB()), MemoryDevice{}, openAPIClientError(err)
|
|
}
|
|
|
|
return uint32(newMem.ToMiB()), MemoryDevice{SizeMB: int(hotplugSize.ToMiB())}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) ResizeVCPUs(ctx context.Context, reqVCPUs uint32) (currentVCPUs uint32, newVCPUs uint32, err error) {
|
|
cl := clh.client()
|
|
|
|
// Retrieve the number of current vCPUs via HTTP API
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
clh.Logger().WithField("function", "ResizeVCPUs").WithError(err).Info("[clh] vmInfo failed")
|
|
return 0, 0, openAPIClientError(err)
|
|
}
|
|
|
|
currentVCPUs = uint32(info.Config.Cpus.BootVcpus)
|
|
newVCPUs = currentVCPUs
|
|
|
|
// Sanity Check
|
|
if reqVCPUs == 0 {
|
|
clh.Logger().WithField("function", "ResizeVCPUs").Debugf("Cannot resize vCPU to 0")
|
|
return currentVCPUs, newVCPUs, fmt.Errorf("Cannot resize vCPU to 0")
|
|
}
|
|
if reqVCPUs > uint32(info.Config.Cpus.MaxVcpus) {
|
|
clh.Logger().WithFields(log.Fields{
|
|
"function": "ResizeVCPUs",
|
|
"reqVCPUs": reqVCPUs,
|
|
"clhMaxVCPUs": info.Config.Cpus.MaxVcpus,
|
|
}).Warn("exceeding the 'clhMaxVCPUs' (resizing to 'clhMaxVCPUs')")
|
|
|
|
reqVCPUs = uint32(info.Config.Cpus.MaxVcpus)
|
|
}
|
|
|
|
// Resize (hot-plug) vCPUs via HTTP API
|
|
ctx, cancel := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
|
|
defer cancel()
|
|
resize := *chclient.NewVmResize()
|
|
resize.DesiredVcpus = func(i int32) *int32 { return &i }(int32(reqVCPUs))
|
|
if _, err = cl.VmResizePut(ctx, resize); err != nil {
|
|
return currentVCPUs, newVCPUs, errors.Wrap(err, "[clh] VmResizePut failed")
|
|
}
|
|
|
|
newVCPUs = reqVCPUs
|
|
|
|
return currentVCPUs, newVCPUs, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) Cleanup(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "Cleanup").Info("Cleanup")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) PauseVM(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "PauseVM").Info("Pause Sandbox")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) SaveVM() error {
|
|
clh.Logger().WithField("function", "saveSandboxC").Info("Save Sandbox")
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) ResumeVM(ctx context.Context) error {
|
|
clh.Logger().WithField("function", "ResumeVM").Info("Resume Sandbox")
|
|
return nil
|
|
}
|
|
|
|
// StopVM will stop the Sandbox's VM.
|
|
func (clh *cloudHypervisor) StopVM(ctx context.Context, waitOnly bool) (err error) {
|
|
clh.mu.Lock()
|
|
defer func() {
|
|
if err == nil {
|
|
atomic.StoreInt32(&clh.stopped, 1)
|
|
}
|
|
clh.mu.Unlock()
|
|
}()
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "StopVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
clh.Logger().WithField("function", "StopVM").Info("Stop Sandbox")
|
|
if atomic.LoadInt32(&clh.stopped) != 0 {
|
|
clh.Logger().Info("Already stopped")
|
|
return nil
|
|
}
|
|
|
|
return clh.terminate(ctx, waitOnly)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) fromGrpc(ctx context.Context, hypervisorConfig *HypervisorConfig, j []byte) error {
|
|
return errors.New("cloudHypervisor is not supported by VM cache")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) toGrpc(ctx context.Context) ([]byte, error) {
|
|
return nil, errors.New("cloudHypervisor is not supported by VM cache")
|
|
}
|
|
|
|
func (clh *cloudHypervisor) Save() (s hv.HypervisorState) {
|
|
s.Pid = clh.state.PID
|
|
s.Type = string(ClhHypervisor)
|
|
s.VirtiofsDaemonPid = clh.state.VirtiofsDaemonPid
|
|
s.APISocket = clh.state.apiSocket
|
|
return
|
|
}
|
|
|
|
func (clh *cloudHypervisor) Load(s hv.HypervisorState) {
|
|
clh.state.PID = s.Pid
|
|
clh.state.VirtiofsDaemonPid = s.VirtiofsDaemonPid
|
|
clh.state.apiSocket = s.APISocket
|
|
}
|
|
|
|
// Check is the implementation of Check from the Hypervisor interface.
|
|
// Check if the VMM API is working.
|
|
|
|
func (clh *cloudHypervisor) Check() error {
|
|
// Use a long timeout to check if the VMM is running:
|
|
// Check is used by the monitor thread(a background thread). If the
|
|
// monitor thread calls Check() during the Container boot, it will take
|
|
// longer than usual specially if there is a hot-plug request in progress.
|
|
running, err := clh.isClhRunning(10)
|
|
if !running {
|
|
return fmt.Errorf("clh is not running: %s", err)
|
|
}
|
|
return err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) GetPids() []int {
|
|
return []int{clh.state.PID}
|
|
}
|
|
|
|
func (clh *cloudHypervisor) GetVirtioFsPid() *int {
|
|
return &clh.state.VirtiofsDaemonPid
|
|
}
|
|
|
|
func (clh *cloudHypervisor) AddDevice(ctx context.Context, devInfo interface{}, devType DeviceType) error {
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "AddDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
var err error
|
|
|
|
switch v := devInfo.(type) {
|
|
case Endpoint:
|
|
if err := clh.addNet(v); err != nil {
|
|
return err
|
|
}
|
|
case types.HybridVSock:
|
|
clh.addVSock(defaultGuestVSockCID, v.UdsPath)
|
|
case types.Volume:
|
|
err = clh.addVolume(v)
|
|
default:
|
|
clh.Logger().WithField("function", "AddDevice").Warnf("Add device of type %v is not supported.", v)
|
|
return fmt.Errorf("Not implemented support for %s", v)
|
|
}
|
|
|
|
return err
|
|
}
|
|
|
|
//###########################################################################
|
|
//
|
|
// Local helper methods related to the hypervisor interface implementation
|
|
//
|
|
//###########################################################################
|
|
|
|
func (clh *cloudHypervisor) Logger() *log.Entry {
|
|
return hvLogger.WithField("subsystem", "cloudHypervisor")
|
|
}
|
|
|
|
// Adds all capabilities supported by cloudHypervisor implementation of hypervisor interface
|
|
func (clh *cloudHypervisor) Capabilities(ctx context.Context) types.Capabilities {
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "Capabilities", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
clh.Logger().WithField("function", "Capabilities").Info("get Capabilities")
|
|
var caps types.Capabilities
|
|
caps.SetFsSharingSupport()
|
|
caps.SetBlockDeviceHotplugSupport()
|
|
return caps
|
|
}
|
|
|
|
func (clh *cloudHypervisor) terminate(ctx context.Context, waitOnly bool) (err error) {
|
|
span, _ := katatrace.Trace(ctx, clh.Logger(), "terminate", clhTracingTags, map[string]string{"sandbox_id": clh.id})
|
|
defer span.End()
|
|
|
|
pid := clh.state.PID
|
|
pidRunning := true
|
|
if pid == 0 {
|
|
pidRunning = false
|
|
}
|
|
|
|
defer func() {
|
|
clh.Logger().Debug("Cleanup VM")
|
|
if err1 := clh.cleanupVM(true); err1 != nil {
|
|
clh.Logger().WithError(err1).Error("failed to cleanupVM")
|
|
}
|
|
}()
|
|
|
|
clh.Logger().Debug("Stopping Cloud Hypervisor")
|
|
|
|
if pidRunning && !waitOnly {
|
|
clhRunning, _ := clh.isClhRunning(uint(clh.getClhStopSandboxTimeout()))
|
|
if clhRunning {
|
|
ctx, cancel := context.WithTimeout(context.Background(), clh.getClhStopSandboxTimeout()*time.Second)
|
|
defer cancel()
|
|
if _, err = clh.client().ShutdownVMM(ctx); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
}
|
|
|
|
if err = utils.WaitLocalProcess(pid, uint(clh.getClhStopSandboxTimeout()), syscall.Signal(0), clh.Logger()); err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debug("stop virtiofsDaemon")
|
|
|
|
if err = clh.stopVirtiofsDaemon(ctx); err != nil {
|
|
clh.Logger().WithError(err).Error("failed to stop virtiofsDaemon")
|
|
}
|
|
|
|
return
|
|
}
|
|
|
|
func (clh *cloudHypervisor) reset() {
|
|
clh.state.reset()
|
|
}
|
|
|
|
func (clh *cloudHypervisor) GenerateSocket(id string) (interface{}, error) {
|
|
udsPath, err := clh.vsockSocketPath(id)
|
|
if err != nil {
|
|
clh.Logger().Info("Can't generate socket path for cloud-hypervisor")
|
|
return types.HybridVSock{}, err
|
|
}
|
|
|
|
return types.HybridVSock{
|
|
UdsPath: udsPath,
|
|
Port: uint32(vSockPort),
|
|
}, nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) virtioFsSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.config.VMStorePath, id, virtioFsSocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) vsockSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.config.VMStorePath, id, clhSocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) apiSocketPath(id string) (string, error) {
|
|
return utils.BuildSocketPath(clh.config.VMStorePath, id, clhAPISocket)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) waitVMM(timeout uint) error {
|
|
clhRunning, err := clh.isClhRunning(timeout)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
if !clhRunning {
|
|
return fmt.Errorf("CLH is not running")
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) clhPath() (string, error) {
|
|
p, err := clh.config.HypervisorAssetPath()
|
|
if err != nil {
|
|
return "", err
|
|
}
|
|
|
|
if p == "" {
|
|
p = defaultClhPath
|
|
}
|
|
|
|
if _, err = os.Stat(p); os.IsNotExist(err) {
|
|
return "", fmt.Errorf("Cloud-Hypervisor path (%s) does not exist", p)
|
|
}
|
|
|
|
return p, err
|
|
}
|
|
|
|
func (clh *cloudHypervisor) launchClh() (int, error) {
|
|
|
|
clhPath, err := clh.clhPath()
|
|
if err != nil {
|
|
return -1, err
|
|
}
|
|
|
|
args := []string{cscAPIsocket, clh.state.apiSocket}
|
|
if clh.config.Debug {
|
|
// Cloud hypervisor log levels
|
|
// 'v' occurrences increase the level
|
|
//0 => Error
|
|
//1 => Warn
|
|
//2 => Info
|
|
//3 => Debug
|
|
//4+ => Trace
|
|
// Use Info, the CI runs with debug enabled
|
|
// a high level of logging increases the boot time
|
|
// and in a nested environment this could increase
|
|
// the chances to fail because agent is not
|
|
// ready on time.
|
|
//
|
|
// Note that for debugging CLH boot failures, the Info level
|
|
// should be sufficient: Debug level generates so many
|
|
// messages it floods the output stream to the extent that it
|
|
// is almost impossible to view the guest kernel and userland
|
|
// output. For further details, see the discussion on:
|
|
//
|
|
// https://github.com/kata-containers/kata-containers/pull/2751
|
|
args = append(args, "-v")
|
|
}
|
|
|
|
// Enable the `seccomp` feature from Cloud Hypervisor by default
|
|
// Disable it only when requested by users for debugging purposes
|
|
if clh.config.DisableSeccomp {
|
|
args = append(args, "--seccomp", "false")
|
|
}
|
|
|
|
clh.Logger().WithField("path", clhPath).Info()
|
|
clh.Logger().WithField("args", strings.Join(args, " ")).Info()
|
|
|
|
cmdHypervisor := exec.Command(clhPath, args...)
|
|
if clh.config.Debug {
|
|
cmdHypervisor.Env = os.Environ()
|
|
cmdHypervisor.Env = append(cmdHypervisor.Env, "RUST_BACKTRACE=full")
|
|
if clh.console != nil {
|
|
cmdHypervisor.Stderr = clh.console
|
|
cmdHypervisor.Stdout = clh.console
|
|
}
|
|
}
|
|
cmdHypervisor.Stderr = cmdHypervisor.Stdout
|
|
|
|
attr := syscall.SysProcAttr{}
|
|
attr.Credential = &syscall.Credential{
|
|
Uid: clh.config.Uid,
|
|
Gid: clh.config.Gid,
|
|
Groups: clh.config.Groups,
|
|
}
|
|
cmdHypervisor.SysProcAttr = &attr
|
|
|
|
err = utils.StartCmd(cmdHypervisor)
|
|
if err != nil {
|
|
return -1, err
|
|
}
|
|
|
|
if err := clh.waitVMM(clhTimeout); err != nil {
|
|
clh.Logger().WithError(err).Warn("cloud-hypervisor init failed")
|
|
return -1, err
|
|
}
|
|
|
|
return cmdHypervisor.Process.Pid, nil
|
|
}
|
|
|
|
//###########################################################################
|
|
//
|
|
// Cloud-hypervisor CLI builder
|
|
//
|
|
//###########################################################################
|
|
|
|
const (
|
|
cctOFF string = "Off"
|
|
cctTTY string = "Tty"
|
|
)
|
|
|
|
const (
|
|
cscAPIsocket string = "--api-socket"
|
|
)
|
|
|
|
//****************************************
|
|
// The kernel command line
|
|
//****************************************
|
|
|
|
func kernelParamsToString(params []Param) string {
|
|
|
|
var paramBuilder strings.Builder
|
|
for _, p := range params {
|
|
paramBuilder.WriteString(p.Key)
|
|
if len(p.Value) > 0 {
|
|
paramBuilder.WriteString("=")
|
|
paramBuilder.WriteString(p.Value)
|
|
}
|
|
paramBuilder.WriteString(" ")
|
|
}
|
|
return strings.TrimSpace(paramBuilder.String())
|
|
}
|
|
|
|
// ****************************************
|
|
// API calls
|
|
// ****************************************
|
|
func (clh *cloudHypervisor) isClhRunning(timeout uint) (bool, error) {
|
|
|
|
pid := clh.state.PID
|
|
|
|
if atomic.LoadInt32(&clh.stopped) != 0 {
|
|
return false, nil
|
|
}
|
|
|
|
timeStart := time.Now()
|
|
cl := clh.client()
|
|
for {
|
|
err := syscall.Kill(pid, syscall.Signal(0))
|
|
if err != nil {
|
|
return false, nil
|
|
}
|
|
ctx, cancel := context.WithTimeout(context.Background(), clh.getClhAPITimeout()*time.Second)
|
|
_, _, err = cl.VmmPingGet(ctx)
|
|
cancel()
|
|
if err == nil {
|
|
return true, nil
|
|
} else {
|
|
clh.Logger().WithError(err).Warning("clh.VmmPingGet API call failed")
|
|
}
|
|
|
|
if time.Since(timeStart).Seconds() > float64(timeout) {
|
|
return false, fmt.Errorf("Failed to connect to API (timeout %ds): %s", timeout, openAPIClientError(err))
|
|
}
|
|
|
|
time.Sleep(time.Duration(10) * time.Millisecond)
|
|
}
|
|
|
|
}
|
|
|
|
func (clh *cloudHypervisor) client() clhClient {
|
|
return clh.APIClient
|
|
}
|
|
|
|
func openAPIClientError(err error) error {
|
|
|
|
if err == nil {
|
|
return nil
|
|
}
|
|
|
|
reason := ""
|
|
if apierr, ok := err.(chclient.GenericOpenAPIError); ok {
|
|
reason = string(apierr.Body())
|
|
}
|
|
|
|
return fmt.Errorf("error: %v reason: %s", err, reason)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) vmAddNetPut() error {
|
|
return vmAddNetPutRequest(clh)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) bootVM(ctx context.Context) error {
|
|
|
|
cl := clh.client()
|
|
|
|
if clh.config.Debug {
|
|
bodyBuf, err := json.Marshal(clh.vmconfig)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
clh.Logger().WithField("body", string(bodyBuf)).Debug("VM config")
|
|
}
|
|
_, err := cl.CreateVM(ctx, clh.vmconfig)
|
|
if err != nil {
|
|
return openAPIClientError(err)
|
|
}
|
|
|
|
info, err := clh.vmInfo()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debugf("VM state after create: %#v", info)
|
|
|
|
if info.State != clhStateCreated {
|
|
return fmt.Errorf("VM state is not 'Created' after 'CreateVM'")
|
|
}
|
|
|
|
err = clh.vmAddNetPut()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debug("Booting VM")
|
|
_, err = cl.BootVM(ctx)
|
|
if err != nil {
|
|
return openAPIClientError(err)
|
|
}
|
|
|
|
info, err = clh.vmInfo()
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
clh.Logger().Debugf("VM state after boot: %#v", info)
|
|
|
|
if info.State != clhStateRunning {
|
|
return fmt.Errorf("VM state is not 'Running' after 'BootVM'")
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) addVSock(cid int64, path string) {
|
|
clh.Logger().WithFields(log.Fields{
|
|
"path": path,
|
|
"cid": cid,
|
|
}).Info("Adding HybridVSock")
|
|
|
|
clh.vmconfig.Vsock = chclient.NewVsockConfig(cid, path)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getRateLimiterConfig(bwSize, bwOneTimeBurst, opsSize, opsOneTimeBurst int64) *chclient.RateLimiterConfig {
|
|
if bwSize == 0 && opsSize == 0 {
|
|
return nil
|
|
}
|
|
|
|
rateLimiterConfig := chclient.NewRateLimiterConfig()
|
|
|
|
if bwSize != 0 {
|
|
bwTokenBucket := chclient.NewTokenBucket(bwSize, int64(utils.DefaultRateLimiterRefillTimeMilliSecs))
|
|
|
|
if bwOneTimeBurst != 0 {
|
|
bwTokenBucket.SetOneTimeBurst(bwOneTimeBurst)
|
|
}
|
|
|
|
rateLimiterConfig.SetBandwidth(*bwTokenBucket)
|
|
}
|
|
|
|
if opsSize != 0 {
|
|
opsTokenBucket := chclient.NewTokenBucket(opsSize, int64(utils.DefaultRateLimiterRefillTimeMilliSecs))
|
|
|
|
if opsOneTimeBurst != 0 {
|
|
opsTokenBucket.SetOneTimeBurst(opsOneTimeBurst)
|
|
}
|
|
|
|
rateLimiterConfig.SetOps(*opsTokenBucket)
|
|
}
|
|
|
|
return rateLimiterConfig
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getNetRateLimiterConfig() *chclient.RateLimiterConfig {
|
|
return clh.getRateLimiterConfig(
|
|
int64(utils.RevertBytes(uint64(clh.config.NetRateLimiterBwMaxRate/8))),
|
|
int64(utils.RevertBytes(uint64(clh.config.NetRateLimiterBwOneTimeBurst/8))),
|
|
clh.config.NetRateLimiterOpsMaxRate,
|
|
clh.config.NetRateLimiterOpsOneTimeBurst)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) getDiskRateLimiterConfig() *chclient.RateLimiterConfig {
|
|
return clh.getRateLimiterConfig(
|
|
int64(utils.RevertBytes(uint64(clh.config.DiskRateLimiterBwMaxRate/8))),
|
|
int64(utils.RevertBytes(uint64(clh.config.DiskRateLimiterBwOneTimeBurst/8))),
|
|
clh.config.DiskRateLimiterOpsMaxRate,
|
|
clh.config.DiskRateLimiterOpsOneTimeBurst)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) addNet(e Endpoint) error {
|
|
clh.Logger().WithField("endpoint-type", e).Debugf("Adding Endpoint of type %v", e)
|
|
|
|
mac := e.HardwareAddr()
|
|
netPair := e.NetworkPair()
|
|
if netPair == nil {
|
|
return errors.New("net Pair to be added is nil, needed to get TAP file descriptors")
|
|
}
|
|
|
|
if len(netPair.TapInterface.VMFds) == 0 {
|
|
return errors.New("The file descriptors for the network pair are not present")
|
|
}
|
|
clh.netDevicesFiles[mac] = netPair.TapInterface.VMFds
|
|
|
|
netRateLimiterConfig := clh.getNetRateLimiterConfig()
|
|
|
|
net := chclient.NewNetConfig()
|
|
net.Mac = &mac
|
|
if netRateLimiterConfig != nil {
|
|
net.SetRateLimiterConfig(*netRateLimiterConfig)
|
|
}
|
|
|
|
if clh.netDevices != nil {
|
|
*clh.netDevices = append(*clh.netDevices, *net)
|
|
} else {
|
|
clh.netDevices = &[]chclient.NetConfig{*net}
|
|
}
|
|
|
|
clh.Logger().Infof("Storing the Cloud Hypervisor network configuration: %+v", net)
|
|
|
|
return nil
|
|
}
|
|
|
|
// Add shared Volume using virtiofs
|
|
func (clh *cloudHypervisor) addVolume(volume types.Volume) error {
|
|
if clh.config.SharedFS != config.VirtioFS && clh.config.SharedFS != config.VirtioFSNydus {
|
|
return fmt.Errorf("shared fs method not supported %s", clh.config.SharedFS)
|
|
}
|
|
|
|
vfsdSockPath, err := clh.virtioFsSocketPath(clh.id)
|
|
if err != nil {
|
|
return err
|
|
}
|
|
|
|
// numQueues and queueSize are required, let's use the
|
|
// default values defined by cloud-hypervisor
|
|
numQueues := int32(1)
|
|
queueSize := int32(1024)
|
|
if clh.config.VirtioFSQueueSize != 0 {
|
|
queueSize = int32(clh.config.VirtioFSQueueSize)
|
|
}
|
|
|
|
fs := chclient.NewFsConfig(volume.MountTag, vfsdSockPath, numQueues, queueSize)
|
|
clh.vmconfig.Fs = &[]chclient.FsConfig{*fs}
|
|
|
|
clh.Logger().Debug("Adding share volume to hypervisor: ", volume.MountTag)
|
|
return nil
|
|
}
|
|
|
|
// cleanupVM will remove generated files and directories related with the virtual machine
|
|
func (clh *cloudHypervisor) cleanupVM(force bool) error {
|
|
|
|
if clh.id == "" {
|
|
return errors.New("Hypervisor ID is empty")
|
|
}
|
|
|
|
clh.Logger().Debug("removing vm sockets")
|
|
|
|
path, err := clh.vsockSocketPath(clh.id)
|
|
if err == nil {
|
|
if err := os.Remove(path); err != nil {
|
|
clh.Logger().WithError(err).WithField("path", path).Warn("removing vm socket failed")
|
|
}
|
|
}
|
|
|
|
// Cleanup vm path
|
|
dir := filepath.Join(clh.config.VMStorePath, clh.id)
|
|
|
|
// If it's a symlink, remove both dir and the target.
|
|
link, err := filepath.EvalSymlinks(dir)
|
|
if err != nil {
|
|
clh.Logger().WithError(err).WithField("dir", dir).Warn("failed to resolve vm path")
|
|
}
|
|
|
|
clh.Logger().WithFields(log.Fields{
|
|
"link": link,
|
|
"dir": dir,
|
|
}).Infof("Cleanup vm path")
|
|
|
|
if err := os.RemoveAll(dir); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).Warnf("failed to remove vm path %s", dir)
|
|
}
|
|
if link != dir && link != "" {
|
|
if err := os.RemoveAll(link); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).WithField("link", link).Warn("failed to remove resolved vm path")
|
|
}
|
|
}
|
|
|
|
if clh.config.VMid != "" {
|
|
dir = filepath.Join(clh.config.VMStorePath, clh.config.VMid)
|
|
if err := os.RemoveAll(dir); err != nil {
|
|
if !force {
|
|
return err
|
|
}
|
|
clh.Logger().WithError(err).WithField("path", dir).Warnf("failed to remove vm path")
|
|
}
|
|
}
|
|
if rootless.IsRootless() {
|
|
if _, err := user.Lookup(clh.config.User); err != nil {
|
|
clh.Logger().WithError(err).WithFields(
|
|
log.Fields{
|
|
"user": clh.config.User,
|
|
"uid": clh.config.Uid,
|
|
}).Warn("failed to find the user, it might have been removed")
|
|
return nil
|
|
}
|
|
|
|
if err := pkgUtils.RemoveVmmUser(clh.config.User); err != nil {
|
|
clh.Logger().WithError(err).WithFields(
|
|
log.Fields{
|
|
"user": clh.config.User,
|
|
"uid": clh.config.Uid,
|
|
}).Warn("failed to delete the user")
|
|
return nil
|
|
}
|
|
clh.Logger().WithFields(
|
|
log.Fields{
|
|
"user": clh.config.User,
|
|
"uid": clh.config.Uid,
|
|
}).Debug("successfully removed the non root user")
|
|
}
|
|
|
|
clh.reset()
|
|
|
|
return nil
|
|
}
|
|
|
|
func (clh *cloudHypervisor) GetTotalMemoryMB(ctx context.Context) uint32 {
|
|
vminfo, err := clh.vmInfo()
|
|
if err != nil {
|
|
clh.Logger().WithError(err).Error("failed to get vminfo")
|
|
return 0
|
|
}
|
|
|
|
return uint32(vminfo.GetMemoryActualSize() >> utils.MibToBytesShift)
|
|
}
|
|
|
|
// vmInfo ask to hypervisor for current VM status
|
|
func (clh *cloudHypervisor) vmInfo() (chclient.VmInfo, error) {
|
|
cl := clh.client()
|
|
ctx, cancelInfo := context.WithTimeout(context.Background(), clh.getClhAPITimeout()*time.Second)
|
|
defer cancelInfo()
|
|
|
|
info, _, err := cl.VmInfoGet(ctx)
|
|
if err != nil {
|
|
clh.Logger().WithError(openAPIClientError(err)).Warn("VmInfoGet failed")
|
|
}
|
|
return info, openAPIClientError(err)
|
|
}
|
|
|
|
func (clh *cloudHypervisor) IsRateLimiterBuiltin() bool {
|
|
return true
|
|
}
|