Files
kata-containers/src/runtime/virtcontainers/clh.go
Zvonko Kaiser 55a66eb7fb gpu: Add config to TOML
Update cold-plug and hot-plug setting to include bridge, root and
switch-port

Signed-off-by: Zvonko Kaiser <zkaiser@nvidia.com>
2023-06-14 08:20:24 +00:00

1752 lines
51 KiB
Go

//go:build linux
// Copyright (c) 2019 Ericsson Eurolab Deutschland GmbH
//
// SPDX-License-Identifier: Apache-2.0
//
package virtcontainers
import (
"bufio"
"bytes"
"context"
"encoding/json"
"fmt"
"io"
"net"
"net/http"
"net/http/httputil"
"os"
"os/exec"
"os/user"
"path/filepath"
"regexp"
"strconv"
"strings"
"sync"
"sync/atomic"
"syscall"
"time"
"github.com/containerd/console"
chclient "github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/cloud-hypervisor/client"
"github.com/opencontainers/selinux/go-selinux/label"
"github.com/pkg/errors"
log "github.com/sirupsen/logrus"
"github.com/kata-containers/kata-containers/src/runtime/pkg/device/config"
hv "github.com/kata-containers/kata-containers/src/runtime/pkg/hypervisors"
"github.com/kata-containers/kata-containers/src/runtime/pkg/katautils/katatrace"
pkgUtils "github.com/kata-containers/kata-containers/src/runtime/pkg/utils"
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/pkg/rootless"
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/types"
"github.com/kata-containers/kata-containers/src/runtime/virtcontainers/utils"
)
// clhTracingTags defines tags for the trace span
var clhTracingTags = map[string]string{
"source": "runtime",
"package": "virtcontainers",
"subsystem": "hypervisor",
"type": "clh",
}
//
// Constants and type definitions related to cloud hypervisor
//
type clhState uint8
const (
clhNotReady clhState = iota
clhReady
)
const (
clhStateCreated = "Created"
clhStateRunning = "Running"
)
const (
// Values are mandatory by http API
// Values based on:
clhTimeout = 10
clhAPITimeout = 1
clhAPITimeoutConfidentialGuest = 20
// Timeout for hot-plug - hotplug devices can take more time, than usual API calls
// Use longer time timeout for it.
clhHotPlugAPITimeout = 5
clhStopSandboxTimeout = 3
clhStopSandboxTimeoutConfidentialGuest = 10
clhSocket = "clh.sock"
clhAPISocket = "clh-api.sock"
virtioFsSocket = "virtiofsd.sock"
defaultClhPath = "/usr/local/bin/cloud-hypervisor"
)
// Interface that hides the implementation of openAPI client
// If the client changes its methods, this interface should do it as well,
// The main purpose is to hide the client in an interface to allow mock testing.
// This is an interface that has to match with OpenAPI CLH client
type clhClient interface {
// Check for the REST API availability
VmmPingGet(ctx context.Context) (chclient.VmmPingResponse, *http.Response, error)
// Shut the VMM down
ShutdownVMM(ctx context.Context) (*http.Response, error)
// Create the VM
CreateVM(ctx context.Context, vmConfig chclient.VmConfig) (*http.Response, error)
// Dump the VM information
// No lint: golint suggest to rename to VMInfoGet.
VmInfoGet(ctx context.Context) (chclient.VmInfo, *http.Response, error) //nolint:golint
// Boot the VM
BootVM(ctx context.Context) (*http.Response, error)
// Add/remove CPUs to/from the VM
VmResizePut(ctx context.Context, vmResize chclient.VmResize) (*http.Response, error)
// Add VFIO PCI device to the VM
VmAddDevicePut(ctx context.Context, deviceConfig chclient.DeviceConfig) (chclient.PciDeviceInfo, *http.Response, error)
// Add a new disk device to the VM
VmAddDiskPut(ctx context.Context, diskConfig chclient.DiskConfig) (chclient.PciDeviceInfo, *http.Response, error)
// Remove a device from the VM
VmRemoveDevicePut(ctx context.Context, vmRemoveDevice chclient.VmRemoveDevice) (*http.Response, error)
}
type clhClientApi struct {
ApiInternal *chclient.DefaultApiService
}
func (c *clhClientApi) VmmPingGet(ctx context.Context) (chclient.VmmPingResponse, *http.Response, error) {
return c.ApiInternal.VmmPingGet(ctx).Execute()
}
func (c *clhClientApi) ShutdownVMM(ctx context.Context) (*http.Response, error) {
return c.ApiInternal.ShutdownVMM(ctx).Execute()
}
func (c *clhClientApi) CreateVM(ctx context.Context, vmConfig chclient.VmConfig) (*http.Response, error) {
return c.ApiInternal.CreateVM(ctx).VmConfig(vmConfig).Execute()
}
//nolint:golint
func (c *clhClientApi) VmInfoGet(ctx context.Context) (chclient.VmInfo, *http.Response, error) {
return c.ApiInternal.VmInfoGet(ctx).Execute()
}
func (c *clhClientApi) BootVM(ctx context.Context) (*http.Response, error) {
return c.ApiInternal.BootVM(ctx).Execute()
}
func (c *clhClientApi) VmResizePut(ctx context.Context, vmResize chclient.VmResize) (*http.Response, error) {
return c.ApiInternal.VmResizePut(ctx).VmResize(vmResize).Execute()
}
func (c *clhClientApi) VmAddDevicePut(ctx context.Context, deviceConfig chclient.DeviceConfig) (chclient.PciDeviceInfo, *http.Response, error) {
return c.ApiInternal.VmAddDevicePut(ctx).DeviceConfig(deviceConfig).Execute()
}
func (c *clhClientApi) VmAddDiskPut(ctx context.Context, diskConfig chclient.DiskConfig) (chclient.PciDeviceInfo, *http.Response, error) {
return c.ApiInternal.VmAddDiskPut(ctx).DiskConfig(diskConfig).Execute()
}
func (c *clhClientApi) VmRemoveDevicePut(ctx context.Context, vmRemoveDevice chclient.VmRemoveDevice) (*http.Response, error) {
return c.ApiInternal.VmRemoveDevicePut(ctx).VmRemoveDevice(vmRemoveDevice).Execute()
}
// This is done in order to be able to override such a function as part of
// our unit tests, as when testing bootVM we're on a mocked scenario already.
var vmAddNetPutRequest = func(clh *cloudHypervisor) error {
if clh.netDevices == nil {
clh.Logger().Info("No network device has been configured by the upper layer")
return nil
}
addr, err := net.ResolveUnixAddr("unix", clh.state.apiSocket)
if err != nil {
return err
}
conn, err := net.DialUnix("unix", nil, addr)
if err != nil {
return err
}
defer conn.Close()
for _, netDevice := range *clh.netDevices {
clh.Logger().Infof("Adding the net device to the Cloud Hypervisor VM configuration: %+v", netDevice)
netDeviceAsJson, err := json.Marshal(netDevice)
if err != nil {
return err
}
netDeviceAsIoReader := bytes.NewBuffer(netDeviceAsJson)
req, err := http.NewRequest(http.MethodPut, "http://localhost/api/v1/vm.add-net", netDeviceAsIoReader)
if err != nil {
return err
}
req.Header.Set("Accept", "application/json")
req.Header.Set("Content-Type", "application/json")
req.Header.Set("Content-Length", strconv.Itoa(int(netDeviceAsIoReader.Len())))
payload, err := httputil.DumpRequest(req, true)
if err != nil {
return err
}
files := clh.netDevicesFiles[*netDevice.Mac]
var fds []int
for _, f := range files {
fds = append(fds, int(f.Fd()))
}
oob := syscall.UnixRights(fds...)
payloadn, oobn, err := conn.WriteMsgUnix([]byte(payload), oob, nil)
if err != nil {
return err
}
if payloadn != len(payload) || oobn != len(oob) {
return fmt.Errorf("Failed to send all the request to Cloud Hypervisor. %d bytes expect to send as payload, %d bytes expect to send as oob date, but only %d sent as payload, and %d sent as oob", len(payload), len(oob), payloadn, oobn)
}
reader := bufio.NewReader(conn)
resp, err := http.ReadResponse(reader, req)
if err != nil {
return err
}
respBody, err := io.ReadAll(resp.Body)
if err != nil {
return err
}
resp.Body.Close()
resp.Body = io.NopCloser(bytes.NewBuffer(respBody))
if resp.StatusCode != 200 && resp.StatusCode != 204 {
clh.Logger().Errorf("vmAddNetPut failed with error '%d'. Response: %+v", resp.StatusCode, resp)
return fmt.Errorf("Failed to add the network device '%+v' to Cloud Hypervisor: %v", netDevice, resp.StatusCode)
}
}
return nil
}
// Cloud hypervisor state
type CloudHypervisorState struct {
apiSocket string
PID int
VirtiofsDaemonPid int
state clhState
}
func (s *CloudHypervisorState) reset() {
s.PID = 0
s.VirtiofsDaemonPid = 0
s.state = clhNotReady
}
type cloudHypervisor struct {
console console.Console
virtiofsDaemon VirtiofsDaemon
APIClient clhClient
ctx context.Context
id string
netDevices *[]chclient.NetConfig
devicesIds map[string]string
netDevicesFiles map[string][]*os.File
vmconfig chclient.VmConfig
state CloudHypervisorState
config HypervisorConfig
stopped int32
mu sync.Mutex
}
var clhKernelParams = []Param{
{"panic", "1"}, // upon kernel panic wait 1 second before reboot
{"no_timer_check", ""}, // do not Check broken timer IRQ resources
{"noreplace-smp", ""}, // do not replace SMP instructions
}
var clhDebugKernelParams = []Param{
{"console", "ttyS0,115200n8"}, // enable serial console
}
var clhDebugConfidentialGuestKernelParams = []Param{
{"console", "hvc0"}, // enable HVC console
}
var clhDebugKernelParamsCommon = []Param{
{"systemd.log_target", "console"}, // send loggng to the console
}
//###########################################################
//
// hypervisor interface implementation for cloud-hypervisor
//
//###########################################################
func (clh *cloudHypervisor) getClhAPITimeout() time.Duration {
// Increase the APITimeout when dealing with a Confidential Guest.
// The value has been chosen based on tests using `ctr`, and hopefully
// this change can be dropped in further steps of the development.
if clh.config.ConfidentialGuest {
return clhAPITimeoutConfidentialGuest
}
return clhAPITimeout
}
func (clh *cloudHypervisor) getClhStopSandboxTimeout() time.Duration {
// Increase the StopSandboxTimeout when dealing with a Confidential Guest.
// The value has been chosen based on tests using `ctr`, and hopefully
// this change can be dropped in further steps of the development.
if clh.config.ConfidentialGuest {
return clhStopSandboxTimeoutConfidentialGuest
}
return clhStopSandboxTimeout
}
func (clh *cloudHypervisor) setConfig(config *HypervisorConfig) error {
clh.config = *config
return nil
}
func (clh *cloudHypervisor) createVirtiofsDaemon(sharedPath string) (VirtiofsDaemon, error) {
virtiofsdSocketPath, err := clh.virtioFsSocketPath(clh.id)
if err != nil {
return nil, err
}
if clh.config.SharedFS == config.VirtioFSNydus {
apiSockPath, err := clh.nydusdAPISocketPath(clh.id)
if err != nil {
clh.Logger().WithError(err).Error("Invalid api socket path for nydusd")
return nil, err
}
nd := &nydusd{
path: clh.config.VirtioFSDaemon,
sockPath: virtiofsdSocketPath,
apiSockPath: apiSockPath,
sourcePath: sharedPath,
debug: clh.config.Debug,
extraArgs: clh.config.VirtioFSExtraArgs,
startFn: startInShimNS,
}
nd.setupShareDirFn = nd.setupPassthroughFS
return nd, nil
}
// default: use virtiofsd
return &virtiofsd{
path: clh.config.VirtioFSDaemon,
sourcePath: sharedPath,
socketPath: virtiofsdSocketPath,
extraArgs: clh.config.VirtioFSExtraArgs,
cache: clh.config.VirtioFSCache,
}, nil
}
func (clh *cloudHypervisor) setupVirtiofsDaemon(ctx context.Context) error {
if clh.config.SharedFS == config.Virtio9P {
return errors.New("cloud-hypervisor only supports virtio based file sharing")
}
// virtioFS or virtioFsNydus
clh.Logger().WithField("function", "setupVirtiofsDaemon").Info("Starting virtiofsDaemon")
if clh.virtiofsDaemon == nil {
return errors.New("Missing virtiofsDaemon configuration")
}
pid, err := clh.virtiofsDaemon.Start(ctx, func() {
clh.StopVM(ctx, false)
})
if err != nil {
return err
}
clh.state.VirtiofsDaemonPid = pid
return nil
}
func (clh *cloudHypervisor) stopVirtiofsDaemon(ctx context.Context) (err error) {
if clh.state.VirtiofsDaemonPid == 0 {
clh.Logger().Warn("The virtiofsd had stopped")
return nil
}
err = clh.virtiofsDaemon.Stop(ctx)
if err != nil {
return err
}
clh.state.VirtiofsDaemonPid = 0
return nil
}
func (clh *cloudHypervisor) loadVirtiofsDaemon(sharedPath string) (VirtiofsDaemon, error) {
virtiofsdSocketPath, err := clh.virtioFsSocketPath(clh.id)
if err != nil {
return nil, err
}
return &virtiofsd{
PID: clh.state.VirtiofsDaemonPid,
sourcePath: sharedPath,
socketPath: virtiofsdSocketPath,
}, nil
}
func (clh *cloudHypervisor) nydusdAPISocketPath(id string) (string, error) {
return utils.BuildSocketPath(clh.config.VMStorePath, id, nydusdAPISock)
}
func (clh *cloudHypervisor) enableProtection() error {
protection, err := availableGuestProtection()
if err != nil {
return err
}
switch protection {
case tdxProtection:
firmwarePath, err := clh.config.FirmwareAssetPath()
if err != nil {
return err
}
if firmwarePath == "" {
return errors.New("Firmware path is not specified")
}
clh.vmconfig.Payload.SetFirmware(firmwarePath)
if clh.vmconfig.Platform == nil {
clh.vmconfig.Platform = chclient.NewPlatformConfig()
}
clh.vmconfig.Platform.SetTdx(true)
return nil
case sevProtection:
return errors.New("SEV protection is not supported by Cloud Hypervisor")
case snpProtection:
return errors.New("SEV-SNP protection is not supported by Cloud Hypervisor")
default:
return errors.New("This system doesn't support Confidential Computing (Guest Protection)")
}
}
// For cloudHypervisor this call only sets the internal structure up.
// The VM will be created and started through StartVM().
func (clh *cloudHypervisor) CreateVM(ctx context.Context, id string, network Network, hypervisorConfig *HypervisorConfig) error {
clh.ctx = ctx
span, newCtx := katatrace.Trace(clh.ctx, clh.Logger(), "CreateVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
clh.ctx = newCtx
defer span.End()
if err := clh.setConfig(hypervisorConfig); err != nil {
return err
}
clh.id = id
clh.state.state = clhNotReady
clh.devicesIds = make(map[string]string)
clh.netDevicesFiles = make(map[string][]*os.File)
clh.Logger().WithField("function", "CreateVM").Info("creating Sandbox")
if clh.state.PID > 0 {
clh.Logger().WithField("function", "CreateVM").Info("Sandbox already exist, loading from state")
virtiofsDaemon, err := clh.loadVirtiofsDaemon(hypervisorConfig.SharedFS)
if err != nil {
return err
}
clh.virtiofsDaemon = virtiofsDaemon
return nil
}
// No need to return an error from there since there might be nothing
// to fetch if this is the first time the hypervisor is created.
clh.Logger().WithField("function", "CreateVM").Info("Sandbox not found creating")
// Create the VM config via the constructor to ensure default values are properly assigned
clh.vmconfig = *chclient.NewVmConfig(*chclient.NewPayloadConfig())
// Make sure the kernel path is valid
kernelPath, err := clh.config.KernelAssetPath()
if err != nil {
return err
}
clh.vmconfig.Payload.SetKernel(kernelPath)
if clh.config.ConfidentialGuest {
if err := clh.enableProtection(); err != nil {
return err
}
}
// Create the VM memory config via the constructor to ensure default values are properly assigned
clh.vmconfig.Memory = chclient.NewMemoryConfig(int64((utils.MemUnit(clh.config.MemorySize) * utils.MiB).ToBytes()))
// shared memory should be enabled if using vhost-user(kata uses virtiofsd)
clh.vmconfig.Memory.Shared = func(b bool) *bool { return &b }(true)
// Enable hugepages if needed
clh.vmconfig.Memory.Hugepages = func(b bool) *bool { return &b }(clh.config.HugePages)
if !clh.config.ConfidentialGuest {
hotplugSize := clh.config.DefaultMaxMemorySize
// OpenAPI only supports int64 values
clh.vmconfig.Memory.HotplugSize = func(i int64) *int64 { return &i }(int64((utils.MemUnit(hotplugSize) * utils.MiB).ToBytes()))
}
// Set initial amount of cpu's for the virtual machine
clh.vmconfig.Cpus = chclient.NewCpusConfig(int32(clh.config.NumVCPUs), int32(clh.config.DefaultMaxVCPUs))
params, err := GetKernelRootParams(hypervisorConfig.RootfsType, clh.config.ConfidentialGuest, false)
if err != nil {
return err
}
params = append(params, clhKernelParams...)
// Followed by extra debug parameters if debug enabled in configuration file
if clh.config.Debug {
if clh.config.ConfidentialGuest {
params = append(params, clhDebugConfidentialGuestKernelParams...)
} else {
params = append(params, clhDebugKernelParams...)
}
params = append(params, clhDebugKernelParamsCommon...)
} else {
// start the guest kernel with 'quiet' in non-debug mode
params = append(params, Param{"quiet", ""})
}
// Followed by extra kernel parameters defined in the configuration file
params = append(params, clh.config.KernelParams...)
clh.vmconfig.Payload.SetCmdline(kernelParamsToString(params))
// set random device generator to hypervisor
clh.vmconfig.Rng = chclient.NewRngConfig(clh.config.EntropySource)
// set the initial root/boot disk of hypervisor
imagePath, err := clh.config.ImageAssetPath()
if err != nil {
return err
}
if imagePath != "" {
if clh.config.ConfidentialGuest {
disk := chclient.NewDiskConfig(imagePath)
disk.SetReadonly(true)
diskRateLimiterConfig := clh.getDiskRateLimiterConfig()
if diskRateLimiterConfig != nil {
disk.SetRateLimiterConfig(*diskRateLimiterConfig)
}
if clh.vmconfig.Disks != nil {
*clh.vmconfig.Disks = append(*clh.vmconfig.Disks, *disk)
} else {
clh.vmconfig.Disks = &[]chclient.DiskConfig{*disk}
}
} else {
pmem := chclient.NewPmemConfig(imagePath)
*pmem.DiscardWrites = true
if clh.vmconfig.Pmem != nil {
*clh.vmconfig.Pmem = append(*clh.vmconfig.Pmem, *pmem)
} else {
clh.vmconfig.Pmem = &[]chclient.PmemConfig{*pmem}
}
}
} else {
initrdPath, err := clh.config.InitrdAssetPath()
if err != nil {
return err
}
clh.vmconfig.Payload.SetInitramfs(initrdPath)
}
if clh.config.ConfidentialGuest {
// Use HVC as the guest console only in debug mode, only
// for Confidential Guests
if clh.config.Debug {
clh.vmconfig.Console = chclient.NewConsoleConfig(cctTTY)
} else {
clh.vmconfig.Console = chclient.NewConsoleConfig(cctOFF)
}
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctOFF)
} else {
// Use serial port as the guest console only in debug mode,
// so that we can gather early OS booting log
if clh.config.Debug {
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctTTY)
} else {
clh.vmconfig.Serial = chclient.NewConsoleConfig(cctOFF)
}
clh.vmconfig.Console = chclient.NewConsoleConfig(cctOFF)
}
cpu_topology := chclient.NewCpuTopology()
cpu_topology.ThreadsPerCore = func(i int32) *int32 { return &i }(1)
cpu_topology.CoresPerDie = func(i int32) *int32 { return &i }(int32(clh.config.DefaultMaxVCPUs))
cpu_topology.DiesPerPackage = func(i int32) *int32 { return &i }(1)
cpu_topology.Packages = func(i int32) *int32 { return &i }(1)
clh.vmconfig.Cpus.Topology = cpu_topology
// Overwrite the default value of HTTP API socket path for cloud hypervisor
apiSocketPath, err := clh.apiSocketPath(id)
if err != nil {
clh.Logger().WithError(err).Info("Invalid api socket path for cloud-hypervisor")
return err
}
clh.state.apiSocket = apiSocketPath
cfg := chclient.NewConfiguration()
cfg.HTTPClient = &http.Client{
Transport: &http.Transport{
DialContext: func(ctx context.Context, network, path string) (net.Conn, error) {
addr, err := net.ResolveUnixAddr("unix", clh.state.apiSocket)
if err != nil {
return nil, err
}
return net.DialUnix("unix", nil, addr)
},
},
}
clh.APIClient = &clhClientApi{
ApiInternal: chclient.NewAPIClient(cfg).DefaultApi,
}
clh.virtiofsDaemon, err = clh.createVirtiofsDaemon(filepath.Join(GetSharePath(clh.id)))
if err != nil {
return err
}
if clh.config.SGXEPCSize > 0 {
epcSection := chclient.NewSgxEpcConfig("kata-epc", clh.config.SGXEPCSize)
epcSection.Prefault = func(b bool) *bool { return &b }(true)
if clh.vmconfig.SgxEpc != nil {
*clh.vmconfig.SgxEpc = append(*clh.vmconfig.SgxEpc, *epcSection)
} else {
clh.vmconfig.SgxEpc = &[]chclient.SgxEpcConfig{*epcSection}
}
}
return nil
}
// StartVM will start the VMM and boot the virtual machine for the given sandbox.
func (clh *cloudHypervisor) StartVM(ctx context.Context, timeout int) error {
span, ctx := katatrace.Trace(ctx, clh.Logger(), "StartVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
clh.Logger().WithField("function", "StartVM").Info("starting Sandbox")
vmPath := filepath.Join(clh.config.VMStorePath, clh.id)
err := utils.MkdirAllWithInheritedOwner(vmPath, DirMode)
if err != nil {
return err
}
// This needs to be done as late as possible, just before launching
// virtiofsd are executed by kata-runtime after this call, run with
// the SELinux label. If these processes require privileged, we do
// notwant to run them under confinement.
if !clh.config.DisableSeLinux {
if err := label.SetProcessLabel(clh.config.SELinuxProcessLabel); err != nil {
return err
}
defer label.SetProcessLabel("")
}
err = clh.setupVirtiofsDaemon(ctx)
if err != nil {
return err
}
defer func() {
if err != nil {
if shutdownErr := clh.stopVirtiofsDaemon(ctx); shutdownErr != nil {
clh.Logger().WithError(shutdownErr).Warn("error shutting down VirtiofsDaemon")
}
}
}()
pid, err := clh.launchClh()
if err != nil {
return fmt.Errorf("failed to launch cloud-hypervisor: %q", err)
}
clh.state.PID = pid
ctx, cancel := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
defer cancel()
if err := clh.bootVM(ctx); err != nil {
return err
}
clh.state.state = clhReady
return nil
}
// GetVMConsole builds the path of the console where we can read logs coming
// from the sandbox.
func (clh *cloudHypervisor) GetVMConsole(ctx context.Context, id string) (string, string, error) {
clh.Logger().WithField("function", "GetVMConsole").WithField("id", id).Info("Get Sandbox Console")
master, slave, err := console.NewPty()
if err != nil {
clh.Logger().WithError(err).Error("Error create pseudo tty")
return consoleProtoPty, "", err
}
clh.console = master
return consoleProtoPty, slave, nil
}
func (clh *cloudHypervisor) Disconnect(ctx context.Context) {
clh.Logger().WithField("function", "Disconnect").Info("Disconnecting Sandbox Console")
}
func (clh *cloudHypervisor) GetThreadIDs(ctx context.Context) (VcpuThreadIDs, error) {
clh.Logger().WithField("function", "GetThreadIDs").Info("get thread ID's")
var vcpuInfo VcpuThreadIDs
vcpuInfo.vcpus = make(map[int]int)
getVcpus := func(pid int) (map[int]int, error) {
vcpus := make(map[int]int)
dir := fmt.Sprintf("/proc/%d/task", pid)
files, err := os.ReadDir(dir)
if err != nil {
return vcpus, err
}
pattern, err := regexp.Compile(`^vcpu\d+$`)
if err != nil {
return vcpus, err
}
for _, file := range files {
comm, err := os.ReadFile(fmt.Sprintf("%s/%s/comm", dir, file.Name()))
if err != nil {
return vcpus, err
}
pName := strings.TrimSpace(string(comm))
if !pattern.MatchString(pName) {
continue
}
cpuID := strings.TrimPrefix(pName, "vcpu")
threadID := file.Name()
k, err := strconv.Atoi(cpuID)
if err != nil {
return vcpus, err
}
v, err := strconv.Atoi(threadID)
if err != nil {
return vcpus, err
}
vcpus[k] = v
}
return vcpus, nil
}
if clh.state.PID == 0 {
return vcpuInfo, nil
}
vcpus, err := getVcpus(clh.state.PID)
if err != nil {
return vcpuInfo, err
}
vcpuInfo.vcpus = vcpus
return vcpuInfo, nil
}
func clhDriveIndexToID(i int) string {
return "clh_drive_" + strconv.Itoa(i)
}
// Various cloud-hypervisor APIs report a PCI address in "BB:DD.F"
// form within the PciDeviceInfo struct. This is a broken API,
// because there's no way clh can reliably know the guest side bdf for
// a device, since the bus number depends on how the guest firmware
// and/or kernel enumerates it. They get away with it only because
// they don't use bridges, and so the bus is always 0. Under that
// assumption convert a clh PciDeviceInfo into a PCI path
func clhPciInfoToPath(pciInfo chclient.PciDeviceInfo) (types.PciPath, error) {
tokens := strings.Split(pciInfo.Bdf, ":")
if len(tokens) != 3 || tokens[0] != "0000" || tokens[1] != "00" {
return types.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
}
tokens = strings.Split(tokens[2], ".")
if len(tokens) != 2 || tokens[1] != "0" || len(tokens[0]) != 2 {
return types.PciPath{}, fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
}
return types.PciPathFromString(tokens[0])
}
func (clh *cloudHypervisor) hotplugAddBlockDevice(drive *config.BlockDrive) error {
if drive.Swap {
return fmt.Errorf("cloudHypervisor doesn't support swap")
}
if clh.config.BlockDeviceDriver != config.VirtioBlock {
return fmt.Errorf("incorrect hypervisor configuration on 'block_device_driver':"+
" using '%v' but only support '%v'", clh.config.BlockDeviceDriver, config.VirtioBlock)
}
var err error
cl := clh.client()
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
defer cancel()
driveID := clhDriveIndexToID(drive.Index)
if drive.Pmem {
return fmt.Errorf("pmem device hotplug not supported")
}
// Create the clh disk config via the constructor to ensure default values are properly assigned
clhDisk := *chclient.NewDiskConfig(drive.File)
clhDisk.Readonly = &drive.ReadOnly
clhDisk.VhostUser = func(b bool) *bool { return &b }(false)
queues := int32(clh.config.NumVCPUs)
queueSize := int32(1024)
clhDisk.NumQueues = &queues
clhDisk.QueueSize = &queueSize
diskRateLimiterConfig := clh.getDiskRateLimiterConfig()
if diskRateLimiterConfig != nil {
clhDisk.SetRateLimiterConfig(*diskRateLimiterConfig)
}
pciInfo, _, err := cl.VmAddDiskPut(ctx, clhDisk)
if err != nil {
return fmt.Errorf("failed to hotplug block device %+v %s", drive, openAPIClientError(err))
}
clh.devicesIds[driveID] = pciInfo.GetId()
drive.PCIPath, err = clhPciInfoToPath(pciInfo)
return err
}
func (clh *cloudHypervisor) hotPlugVFIODevice(device *config.VFIODev) error {
cl := clh.client()
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
defer cancel()
// Create the clh device config via the constructor to ensure default values are properly assigned
clhDevice := *chclient.NewDeviceConfig(device.SysfsDev)
pciInfo, _, err := cl.VmAddDevicePut(ctx, clhDevice)
if err != nil {
return fmt.Errorf("Failed to hotplug device %+v %s", device, openAPIClientError(err))
}
clh.devicesIds[device.ID] = pciInfo.GetId()
// clh doesn't use bridges, so the PCI path is simply the slot
// number of the device. This will break if clh starts using
// bridges (including PCI-E root ports), but so will the clh
// API, since there's no way it can reliably predict a guest
// Bdf when bridges are present.
tokens := strings.Split(pciInfo.Bdf, ":")
if len(tokens) != 3 || tokens[0] != "0000" || tokens[1] != "00" {
return fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
}
tokens = strings.Split(tokens[2], ".")
if len(tokens) != 2 || tokens[1] != "0" || len(tokens[0]) != 2 {
return fmt.Errorf("Unexpected PCI address %q from clh hotplug", pciInfo.Bdf)
}
if device.Type == config.VFIOAPDeviceMediatedType {
return fmt.Errorf("VFIO device %+v is not PCI, only PCI is supported in Cloud Hypervisor", device)
}
device.GuestPciPath, err = types.PciPathFromString(tokens[0])
return err
}
func (clh *cloudHypervisor) hotplugAddNetDevice(e Endpoint) error {
err := clh.addNet(e)
if err != nil {
return err
}
return clh.vmAddNetPut()
}
func (clh *cloudHypervisor) HotplugAddDevice(ctx context.Context, devInfo interface{}, devType DeviceType) (interface{}, error) {
span, _ := katatrace.Trace(ctx, clh.Logger(), "HotplugAddDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
switch devType {
case BlockDev:
drive := devInfo.(*config.BlockDrive)
return nil, clh.hotplugAddBlockDevice(drive)
case VfioDev:
device := devInfo.(*config.VFIODev)
return nil, clh.hotPlugVFIODevice(device)
case NetDev:
device := devInfo.(Endpoint)
return nil, clh.hotplugAddNetDevice(device)
default:
return nil, fmt.Errorf("cannot hotplug device: unsupported device type '%v'", devType)
}
}
func (clh *cloudHypervisor) HotplugRemoveDevice(ctx context.Context, devInfo interface{}, devType DeviceType) (interface{}, error) {
span, _ := katatrace.Trace(ctx, clh.Logger(), "HotplugRemoveDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
var deviceID string
switch devType {
case BlockDev:
deviceID = clhDriveIndexToID(devInfo.(*config.BlockDrive).Index)
case VfioDev:
deviceID = devInfo.(*config.VFIODev).ID
default:
clh.Logger().WithFields(log.Fields{"devInfo": devInfo,
"deviceType": devType}).Error("HotplugRemoveDevice: unsupported device")
return nil, fmt.Errorf("Could not hot remove device: unsupported device: %v, type: %v",
devInfo, devType)
}
cl := clh.client()
ctx, cancel := context.WithTimeout(context.Background(), clhHotPlugAPITimeout*time.Second)
defer cancel()
originalDeviceID := clh.devicesIds[deviceID]
remove := *chclient.NewVmRemoveDevice()
remove.Id = &originalDeviceID
_, err := cl.VmRemoveDevicePut(ctx, remove)
if err != nil {
err = fmt.Errorf("failed to hotplug remove (unplug) device %+v: %s", devInfo, openAPIClientError(err))
}
delete(clh.devicesIds, deviceID)
return nil, err
}
func (clh *cloudHypervisor) HypervisorConfig() HypervisorConfig {
return clh.config
}
func (clh *cloudHypervisor) ResizeMemory(ctx context.Context, reqMemMB uint32, memoryBlockSizeMB uint32, probe bool) (uint32, MemoryDevice, error) {
// TODO: Add support for virtio-mem
if probe {
return 0, MemoryDevice{}, errors.New("probe memory is not supported for cloud-hypervisor")
}
if reqMemMB == 0 {
// This is a corner case if requested to resize to 0 means something went really wrong.
return 0, MemoryDevice{}, errors.New("Can not resize memory to 0")
}
info, err := clh.vmInfo()
if err != nil {
return 0, MemoryDevice{}, err
}
// HotplugSize can be nil in cases where Hotplug is not supported, as Cloud Hypervisor API
// does *not* allow us to set 0 as the HotplugSize.
maxHotplugSize := 0 * utils.Byte
if info.Config.Memory.HotplugSize != nil {
maxHotplugSize = utils.MemUnit(*info.Config.Memory.HotplugSize) * utils.Byte
}
if reqMemMB > uint32(maxHotplugSize.ToMiB()) {
reqMemMB = uint32(maxHotplugSize.ToMiB())
}
currentMem := utils.MemUnit(info.Config.Memory.Size) * utils.Byte
newMem := utils.MemUnit(reqMemMB) * utils.MiB
// Early Check to verify if boot memory is the same as requested
if currentMem == newMem {
clh.Logger().WithField("memory", reqMemMB).Debugf("VM already has requested memory")
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
}
if currentMem > newMem {
clh.Logger().Warn("Remove memory is not supported, nothing to do")
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
}
blockSize := utils.MemUnit(memoryBlockSizeMB) * utils.MiB
hotplugSize := (newMem - currentMem).AlignMem(blockSize)
// Update memory request to increase memory aligned block
alignedRequest := currentMem + hotplugSize
if newMem != alignedRequest {
clh.Logger().WithFields(log.Fields{"request": newMem, "aligned-request": alignedRequest}).Debug("aligning VM memory request")
newMem = alignedRequest
}
// Check if memory is the same as requested, a second Check is done
// to consider the memory request now that is updated to be memory aligned
if currentMem == newMem {
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("VM already has requested memory(after alignment)")
return uint32(currentMem.ToMiB()), MemoryDevice{}, nil
}
cl := clh.client()
ctx, cancelResize := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
defer cancelResize()
resize := *chclient.NewVmResize()
// OpenApi does not support uint64, convert to int64
resize.DesiredRam = func(i int64) *int64 { return &i }(int64(newMem.ToBytes()))
clh.Logger().WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Debug("updating VM memory")
if _, err = cl.VmResizePut(ctx, resize); err != nil {
clh.Logger().WithError(err).WithFields(log.Fields{"current-memory": currentMem, "new-memory": newMem}).Warnf("failed to update memory %s", openAPIClientError(err))
err = fmt.Errorf("Failed to resize memory from %d to %d: %s", currentMem, newMem, openAPIClientError(err))
return uint32(currentMem.ToMiB()), MemoryDevice{}, openAPIClientError(err)
}
return uint32(newMem.ToMiB()), MemoryDevice{SizeMB: int(hotplugSize.ToMiB())}, nil
}
func (clh *cloudHypervisor) ResizeVCPUs(ctx context.Context, reqVCPUs uint32) (currentVCPUs uint32, newVCPUs uint32, err error) {
cl := clh.client()
// Retrieve the number of current vCPUs via HTTP API
info, err := clh.vmInfo()
if err != nil {
clh.Logger().WithField("function", "ResizeVCPUs").WithError(err).Info("[clh] vmInfo failed")
return 0, 0, openAPIClientError(err)
}
currentVCPUs = uint32(info.Config.Cpus.BootVcpus)
newVCPUs = currentVCPUs
// Sanity Check
if reqVCPUs == 0 {
clh.Logger().WithField("function", "ResizeVCPUs").Debugf("Cannot resize vCPU to 0")
return currentVCPUs, newVCPUs, fmt.Errorf("Cannot resize vCPU to 0")
}
if reqVCPUs > uint32(info.Config.Cpus.MaxVcpus) {
clh.Logger().WithFields(log.Fields{
"function": "ResizeVCPUs",
"reqVCPUs": reqVCPUs,
"clhMaxVCPUs": info.Config.Cpus.MaxVcpus,
}).Warn("exceeding the 'clhMaxVCPUs' (resizing to 'clhMaxVCPUs')")
reqVCPUs = uint32(info.Config.Cpus.MaxVcpus)
}
// Resize (hot-plug) vCPUs via HTTP API
ctx, cancel := context.WithTimeout(ctx, clh.getClhAPITimeout()*time.Second)
defer cancel()
resize := *chclient.NewVmResize()
resize.DesiredVcpus = func(i int32) *int32 { return &i }(int32(reqVCPUs))
if _, err = cl.VmResizePut(ctx, resize); err != nil {
return currentVCPUs, newVCPUs, errors.Wrap(err, "[clh] VmResizePut failed")
}
newVCPUs = reqVCPUs
return currentVCPUs, newVCPUs, nil
}
func (clh *cloudHypervisor) Cleanup(ctx context.Context) error {
clh.Logger().WithField("function", "Cleanup").Info("Cleanup")
return nil
}
func (clh *cloudHypervisor) PauseVM(ctx context.Context) error {
clh.Logger().WithField("function", "PauseVM").Info("Pause Sandbox")
return nil
}
func (clh *cloudHypervisor) SaveVM() error {
clh.Logger().WithField("function", "saveSandboxC").Info("Save Sandbox")
return nil
}
func (clh *cloudHypervisor) ResumeVM(ctx context.Context) error {
clh.Logger().WithField("function", "ResumeVM").Info("Resume Sandbox")
return nil
}
// StopVM will stop the Sandbox's VM.
func (clh *cloudHypervisor) StopVM(ctx context.Context, waitOnly bool) (err error) {
clh.mu.Lock()
defer func() {
if err == nil {
atomic.StoreInt32(&clh.stopped, 1)
}
clh.mu.Unlock()
}()
span, _ := katatrace.Trace(ctx, clh.Logger(), "StopVM", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
clh.Logger().WithField("function", "StopVM").Info("Stop Sandbox")
if atomic.LoadInt32(&clh.stopped) != 0 {
clh.Logger().Info("Already stopped")
return nil
}
return clh.terminate(ctx, waitOnly)
}
func (clh *cloudHypervisor) fromGrpc(ctx context.Context, hypervisorConfig *HypervisorConfig, j []byte) error {
return errors.New("cloudHypervisor is not supported by VM cache")
}
func (clh *cloudHypervisor) toGrpc(ctx context.Context) ([]byte, error) {
return nil, errors.New("cloudHypervisor is not supported by VM cache")
}
func (clh *cloudHypervisor) Save() (s hv.HypervisorState) {
s.Pid = clh.state.PID
s.Type = string(ClhHypervisor)
s.VirtiofsDaemonPid = clh.state.VirtiofsDaemonPid
s.APISocket = clh.state.apiSocket
return
}
func (clh *cloudHypervisor) Load(s hv.HypervisorState) {
clh.state.PID = s.Pid
clh.state.VirtiofsDaemonPid = s.VirtiofsDaemonPid
clh.state.apiSocket = s.APISocket
}
// Check is the implementation of Check from the Hypervisor interface.
// Check if the VMM API is working.
func (clh *cloudHypervisor) Check() error {
// Use a long timeout to check if the VMM is running:
// Check is used by the monitor thread(a background thread). If the
// monitor thread calls Check() during the Container boot, it will take
// longer than usual specially if there is a hot-plug request in progress.
running, err := clh.isClhRunning(10)
if !running {
return fmt.Errorf("clh is not running: %s", err)
}
return err
}
func (clh *cloudHypervisor) GetPids() []int {
return []int{clh.state.PID}
}
func (clh *cloudHypervisor) GetVirtioFsPid() *int {
return &clh.state.VirtiofsDaemonPid
}
func (clh *cloudHypervisor) AddDevice(ctx context.Context, devInfo interface{}, devType DeviceType) error {
span, _ := katatrace.Trace(ctx, clh.Logger(), "AddDevice", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
var err error
switch v := devInfo.(type) {
case Endpoint:
if err := clh.addNet(v); err != nil {
return err
}
case types.HybridVSock:
clh.addVSock(defaultGuestVSockCID, v.UdsPath)
case types.Volume:
err = clh.addVolume(v)
default:
clh.Logger().WithField("function", "AddDevice").Warnf("Add device of type %v is not supported.", v)
return fmt.Errorf("Not implemented support for %s", v)
}
return err
}
//###########################################################################
//
// Local helper methods related to the hypervisor interface implementation
//
//###########################################################################
func (clh *cloudHypervisor) Logger() *log.Entry {
return hvLogger.WithField("subsystem", "cloudHypervisor")
}
// Adds all capabilities supported by cloudHypervisor implementation of hypervisor interface
func (clh *cloudHypervisor) Capabilities(ctx context.Context) types.Capabilities {
span, _ := katatrace.Trace(ctx, clh.Logger(), "Capabilities", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
clh.Logger().WithField("function", "Capabilities").Info("get Capabilities")
var caps types.Capabilities
caps.SetFsSharingSupport()
caps.SetBlockDeviceHotplugSupport()
return caps
}
func (clh *cloudHypervisor) terminate(ctx context.Context, waitOnly bool) (err error) {
span, _ := katatrace.Trace(ctx, clh.Logger(), "terminate", clhTracingTags, map[string]string{"sandbox_id": clh.id})
defer span.End()
pid := clh.state.PID
pidRunning := true
if pid == 0 {
pidRunning = false
}
defer func() {
clh.Logger().Debug("Cleanup VM")
if err1 := clh.cleanupVM(true); err1 != nil {
clh.Logger().WithError(err1).Error("failed to cleanupVM")
}
}()
clh.Logger().Debug("Stopping Cloud Hypervisor")
if pidRunning && !waitOnly {
clhRunning, _ := clh.isClhRunning(uint(clh.getClhStopSandboxTimeout()))
if clhRunning {
ctx, cancel := context.WithTimeout(context.Background(), clh.getClhStopSandboxTimeout()*time.Second)
defer cancel()
if _, err = clh.client().ShutdownVMM(ctx); err != nil {
return err
}
}
}
if err = utils.WaitLocalProcess(pid, uint(clh.getClhStopSandboxTimeout()), syscall.Signal(0), clh.Logger()); err != nil {
return err
}
clh.Logger().Debug("stop virtiofsDaemon")
if err = clh.stopVirtiofsDaemon(ctx); err != nil {
clh.Logger().WithError(err).Error("failed to stop virtiofsDaemon")
}
return
}
func (clh *cloudHypervisor) reset() {
clh.state.reset()
}
func (clh *cloudHypervisor) GenerateSocket(id string) (interface{}, error) {
udsPath, err := clh.vsockSocketPath(id)
if err != nil {
clh.Logger().Info("Can't generate socket path for cloud-hypervisor")
return types.HybridVSock{}, err
}
return types.HybridVSock{
UdsPath: udsPath,
Port: uint32(vSockPort),
}, nil
}
func (clh *cloudHypervisor) virtioFsSocketPath(id string) (string, error) {
return utils.BuildSocketPath(clh.config.VMStorePath, id, virtioFsSocket)
}
func (clh *cloudHypervisor) vsockSocketPath(id string) (string, error) {
return utils.BuildSocketPath(clh.config.VMStorePath, id, clhSocket)
}
func (clh *cloudHypervisor) apiSocketPath(id string) (string, error) {
return utils.BuildSocketPath(clh.config.VMStorePath, id, clhAPISocket)
}
func (clh *cloudHypervisor) waitVMM(timeout uint) error {
clhRunning, err := clh.isClhRunning(timeout)
if err != nil {
return err
}
if !clhRunning {
return fmt.Errorf("CLH is not running")
}
return nil
}
func (clh *cloudHypervisor) clhPath() (string, error) {
p, err := clh.config.HypervisorAssetPath()
if err != nil {
return "", err
}
if p == "" {
p = defaultClhPath
}
if _, err = os.Stat(p); os.IsNotExist(err) {
return "", fmt.Errorf("Cloud-Hypervisor path (%s) does not exist", p)
}
return p, err
}
func (clh *cloudHypervisor) launchClh() (int, error) {
clhPath, err := clh.clhPath()
if err != nil {
return -1, err
}
args := []string{cscAPIsocket, clh.state.apiSocket}
if clh.config.Debug {
// Cloud hypervisor log levels
// 'v' occurrences increase the level
//0 => Error
//1 => Warn
//2 => Info
//3 => Debug
//4+ => Trace
// Use Info, the CI runs with debug enabled
// a high level of logging increases the boot time
// and in a nested environment this could increase
// the chances to fail because agent is not
// ready on time.
//
// Note that for debugging CLH boot failures, the Info level
// should be sufficient: Debug level generates so many
// messages it floods the output stream to the extent that it
// is almost impossible to view the guest kernel and userland
// output. For further details, see the discussion on:
//
// https://github.com/kata-containers/kata-containers/pull/2751
args = append(args, "-v")
}
// Enable the `seccomp` feature from Cloud Hypervisor by default
// Disable it only when requested by users for debugging purposes
if clh.config.DisableSeccomp {
args = append(args, "--seccomp", "false")
}
clh.Logger().WithField("path", clhPath).Info()
clh.Logger().WithField("args", strings.Join(args, " ")).Info()
cmdHypervisor := exec.Command(clhPath, args...)
if clh.config.Debug {
cmdHypervisor.Env = os.Environ()
cmdHypervisor.Env = append(cmdHypervisor.Env, "RUST_BACKTRACE=full")
if clh.console != nil {
cmdHypervisor.Stderr = clh.console
cmdHypervisor.Stdout = clh.console
}
}
cmdHypervisor.Stderr = cmdHypervisor.Stdout
attr := syscall.SysProcAttr{}
attr.Credential = &syscall.Credential{
Uid: clh.config.Uid,
Gid: clh.config.Gid,
Groups: clh.config.Groups,
}
cmdHypervisor.SysProcAttr = &attr
err = utils.StartCmd(cmdHypervisor)
if err != nil {
return -1, err
}
if err := clh.waitVMM(clhTimeout); err != nil {
clh.Logger().WithError(err).Warn("cloud-hypervisor init failed")
return -1, err
}
return cmdHypervisor.Process.Pid, nil
}
//###########################################################################
//
// Cloud-hypervisor CLI builder
//
//###########################################################################
const (
cctOFF string = "Off"
cctTTY string = "Tty"
)
const (
cscAPIsocket string = "--api-socket"
)
//****************************************
// The kernel command line
//****************************************
func kernelParamsToString(params []Param) string {
var paramBuilder strings.Builder
for _, p := range params {
paramBuilder.WriteString(p.Key)
if len(p.Value) > 0 {
paramBuilder.WriteString("=")
paramBuilder.WriteString(p.Value)
}
paramBuilder.WriteString(" ")
}
return strings.TrimSpace(paramBuilder.String())
}
// ****************************************
// API calls
// ****************************************
func (clh *cloudHypervisor) isClhRunning(timeout uint) (bool, error) {
pid := clh.state.PID
if atomic.LoadInt32(&clh.stopped) != 0 {
return false, nil
}
timeStart := time.Now()
cl := clh.client()
for {
err := syscall.Kill(pid, syscall.Signal(0))
if err != nil {
return false, nil
}
ctx, cancel := context.WithTimeout(context.Background(), clh.getClhAPITimeout()*time.Second)
_, _, err = cl.VmmPingGet(ctx)
cancel()
if err == nil {
return true, nil
} else {
clh.Logger().WithError(err).Warning("clh.VmmPingGet API call failed")
}
if time.Since(timeStart).Seconds() > float64(timeout) {
return false, fmt.Errorf("Failed to connect to API (timeout %ds): %s", timeout, openAPIClientError(err))
}
time.Sleep(time.Duration(10) * time.Millisecond)
}
}
func (clh *cloudHypervisor) client() clhClient {
return clh.APIClient
}
func openAPIClientError(err error) error {
if err == nil {
return nil
}
reason := ""
if apierr, ok := err.(chclient.GenericOpenAPIError); ok {
reason = string(apierr.Body())
}
return fmt.Errorf("error: %v reason: %s", err, reason)
}
func (clh *cloudHypervisor) vmAddNetPut() error {
return vmAddNetPutRequest(clh)
}
func (clh *cloudHypervisor) bootVM(ctx context.Context) error {
cl := clh.client()
if clh.config.Debug {
bodyBuf, err := json.Marshal(clh.vmconfig)
if err != nil {
return err
}
clh.Logger().WithField("body", string(bodyBuf)).Debug("VM config")
}
_, err := cl.CreateVM(ctx, clh.vmconfig)
if err != nil {
return openAPIClientError(err)
}
info, err := clh.vmInfo()
if err != nil {
return err
}
clh.Logger().Debugf("VM state after create: %#v", info)
if info.State != clhStateCreated {
return fmt.Errorf("VM state is not 'Created' after 'CreateVM'")
}
err = clh.vmAddNetPut()
if err != nil {
return err
}
clh.Logger().Debug("Booting VM")
_, err = cl.BootVM(ctx)
if err != nil {
return openAPIClientError(err)
}
info, err = clh.vmInfo()
if err != nil {
return err
}
clh.Logger().Debugf("VM state after boot: %#v", info)
if info.State != clhStateRunning {
return fmt.Errorf("VM state is not 'Running' after 'BootVM'")
}
return nil
}
func (clh *cloudHypervisor) addVSock(cid int64, path string) {
clh.Logger().WithFields(log.Fields{
"path": path,
"cid": cid,
}).Info("Adding HybridVSock")
clh.vmconfig.Vsock = chclient.NewVsockConfig(cid, path)
}
func (clh *cloudHypervisor) getRateLimiterConfig(bwSize, bwOneTimeBurst, opsSize, opsOneTimeBurst int64) *chclient.RateLimiterConfig {
if bwSize == 0 && opsSize == 0 {
return nil
}
rateLimiterConfig := chclient.NewRateLimiterConfig()
if bwSize != 0 {
bwTokenBucket := chclient.NewTokenBucket(bwSize, int64(utils.DefaultRateLimiterRefillTimeMilliSecs))
if bwOneTimeBurst != 0 {
bwTokenBucket.SetOneTimeBurst(bwOneTimeBurst)
}
rateLimiterConfig.SetBandwidth(*bwTokenBucket)
}
if opsSize != 0 {
opsTokenBucket := chclient.NewTokenBucket(opsSize, int64(utils.DefaultRateLimiterRefillTimeMilliSecs))
if opsOneTimeBurst != 0 {
opsTokenBucket.SetOneTimeBurst(opsOneTimeBurst)
}
rateLimiterConfig.SetOps(*opsTokenBucket)
}
return rateLimiterConfig
}
func (clh *cloudHypervisor) getNetRateLimiterConfig() *chclient.RateLimiterConfig {
return clh.getRateLimiterConfig(
int64(utils.RevertBytes(uint64(clh.config.NetRateLimiterBwMaxRate/8))),
int64(utils.RevertBytes(uint64(clh.config.NetRateLimiterBwOneTimeBurst/8))),
clh.config.NetRateLimiterOpsMaxRate,
clh.config.NetRateLimiterOpsOneTimeBurst)
}
func (clh *cloudHypervisor) getDiskRateLimiterConfig() *chclient.RateLimiterConfig {
return clh.getRateLimiterConfig(
int64(utils.RevertBytes(uint64(clh.config.DiskRateLimiterBwMaxRate/8))),
int64(utils.RevertBytes(uint64(clh.config.DiskRateLimiterBwOneTimeBurst/8))),
clh.config.DiskRateLimiterOpsMaxRate,
clh.config.DiskRateLimiterOpsOneTimeBurst)
}
func (clh *cloudHypervisor) addNet(e Endpoint) error {
clh.Logger().WithField("endpoint-type", e).Debugf("Adding Endpoint of type %v", e)
mac := e.HardwareAddr()
netPair := e.NetworkPair()
if netPair == nil {
return errors.New("net Pair to be added is nil, needed to get TAP file descriptors")
}
if len(netPair.TapInterface.VMFds) == 0 {
return errors.New("The file descriptors for the network pair are not present")
}
clh.netDevicesFiles[mac] = netPair.TapInterface.VMFds
netRateLimiterConfig := clh.getNetRateLimiterConfig()
net := chclient.NewNetConfig()
net.Mac = &mac
if netRateLimiterConfig != nil {
net.SetRateLimiterConfig(*netRateLimiterConfig)
}
if clh.netDevices != nil {
*clh.netDevices = append(*clh.netDevices, *net)
} else {
clh.netDevices = &[]chclient.NetConfig{*net}
}
clh.Logger().Infof("Storing the Cloud Hypervisor network configuration: %+v", net)
return nil
}
// Add shared Volume using virtiofs
func (clh *cloudHypervisor) addVolume(volume types.Volume) error {
if clh.config.SharedFS != config.VirtioFS && clh.config.SharedFS != config.VirtioFSNydus {
return fmt.Errorf("shared fs method not supported %s", clh.config.SharedFS)
}
vfsdSockPath, err := clh.virtioFsSocketPath(clh.id)
if err != nil {
return err
}
// numQueues and queueSize are required, let's use the
// default values defined by cloud-hypervisor
numQueues := int32(1)
queueSize := int32(1024)
if clh.config.VirtioFSQueueSize != 0 {
queueSize = int32(clh.config.VirtioFSQueueSize)
}
fs := chclient.NewFsConfig(volume.MountTag, vfsdSockPath, numQueues, queueSize)
clh.vmconfig.Fs = &[]chclient.FsConfig{*fs}
clh.Logger().Debug("Adding share volume to hypervisor: ", volume.MountTag)
return nil
}
// cleanupVM will remove generated files and directories related with the virtual machine
func (clh *cloudHypervisor) cleanupVM(force bool) error {
if clh.id == "" {
return errors.New("Hypervisor ID is empty")
}
clh.Logger().Debug("removing vm sockets")
path, err := clh.vsockSocketPath(clh.id)
if err == nil {
if err := os.Remove(path); err != nil {
clh.Logger().WithError(err).WithField("path", path).Warn("removing vm socket failed")
}
}
// Cleanup vm path
dir := filepath.Join(clh.config.VMStorePath, clh.id)
// If it's a symlink, remove both dir and the target.
link, err := filepath.EvalSymlinks(dir)
if err != nil {
clh.Logger().WithError(err).WithField("dir", dir).Warn("failed to resolve vm path")
}
clh.Logger().WithFields(log.Fields{
"link": link,
"dir": dir,
}).Infof("Cleanup vm path")
if err := os.RemoveAll(dir); err != nil {
if !force {
return err
}
clh.Logger().WithError(err).Warnf("failed to remove vm path %s", dir)
}
if link != dir && link != "" {
if err := os.RemoveAll(link); err != nil {
if !force {
return err
}
clh.Logger().WithError(err).WithField("link", link).Warn("failed to remove resolved vm path")
}
}
if clh.config.VMid != "" {
dir = filepath.Join(clh.config.VMStorePath, clh.config.VMid)
if err := os.RemoveAll(dir); err != nil {
if !force {
return err
}
clh.Logger().WithError(err).WithField("path", dir).Warnf("failed to remove vm path")
}
}
if rootless.IsRootless() {
if _, err := user.Lookup(clh.config.User); err != nil {
clh.Logger().WithError(err).WithFields(
log.Fields{
"user": clh.config.User,
"uid": clh.config.Uid,
}).Warn("failed to find the user, it might have been removed")
return nil
}
if err := pkgUtils.RemoveVmmUser(clh.config.User); err != nil {
clh.Logger().WithError(err).WithFields(
log.Fields{
"user": clh.config.User,
"uid": clh.config.Uid,
}).Warn("failed to delete the user")
return nil
}
clh.Logger().WithFields(
log.Fields{
"user": clh.config.User,
"uid": clh.config.Uid,
}).Debug("successfully removed the non root user")
}
clh.reset()
return nil
}
func (clh *cloudHypervisor) GetTotalMemoryMB(ctx context.Context) uint32 {
vminfo, err := clh.vmInfo()
if err != nil {
clh.Logger().WithError(err).Error("failed to get vminfo")
return 0
}
return uint32(vminfo.GetMemoryActualSize() >> utils.MibToBytesShift)
}
// vmInfo ask to hypervisor for current VM status
func (clh *cloudHypervisor) vmInfo() (chclient.VmInfo, error) {
cl := clh.client()
ctx, cancelInfo := context.WithTimeout(context.Background(), clh.getClhAPITimeout()*time.Second)
defer cancelInfo()
info, _, err := cl.VmInfoGet(ctx)
if err != nil {
clh.Logger().WithError(openAPIClientError(err)).Warn("VmInfoGet failed")
}
return info, openAPIClientError(err)
}
func (clh *cloudHypervisor) IsRateLimiterBuiltin() bool {
return true
}