runtime: move all code to src/runtime

To prepare for merging into kata-containers repository.

Signed-off-by: Peng Tao <bergwolf@hyper.sh>

src/runtime/vendor/github.com/BurntSushi/toml/COPYING

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013 TOML authors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

src/runtime/vendor/github.com/BurntSushi/toml/cmd/toml-test-decoder/COPYING

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013 TOML authors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

src/runtime/vendor/github.com/BurntSushi/toml/cmd/toml-test-encoder/COPYING

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013 TOML authors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

src/runtime/vendor/github.com/BurntSushi/toml/cmd/tomlv/COPYING

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013 TOML authors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

src/runtime/vendor/github.com/BurntSushi/toml/decode.go

@@ -0,0 +1,509 @@
+package toml
+
+import (
+	"fmt"
+	"io"
+	"io/ioutil"
+	"math"
+	"reflect"
+	"strings"
+	"time"
+)
+
+func e(format string, args ...interface{}) error {
+	return fmt.Errorf("toml: "+format, args...)
+}
+
+// Unmarshaler is the interface implemented by objects that can unmarshal a
+// TOML description of themselves.
+type Unmarshaler interface {
+	UnmarshalTOML(interface{}) error
+}
+
+// Unmarshal decodes the contents of `p` in TOML format into a pointer `v`.
+func Unmarshal(p []byte, v interface{}) error {
+	_, err := Decode(string(p), v)
+	return err
+}
+
+// Primitive is a TOML value that hasn't been decoded into a Go value.
+// When using the various `Decode*` functions, the type `Primitive` may
+// be given to any value, and its decoding will be delayed.
+//
+// A `Primitive` value can be decoded using the `PrimitiveDecode` function.
+//
+// The underlying representation of a `Primitive` value is subject to change.
+// Do not rely on it.
+//
+// N.B. Primitive values are still parsed, so using them will only avoid
+// the overhead of reflection. They can be useful when you don't know the
+// exact type of TOML data until run time.
+type Primitive struct {
+	undecoded interface{}
+	context   Key
+}
+
+// DEPRECATED!
+//
+// Use MetaData.PrimitiveDecode instead.
+func PrimitiveDecode(primValue Primitive, v interface{}) error {
+	md := MetaData{decoded: make(map[string]bool)}
+	return md.unify(primValue.undecoded, rvalue(v))
+}
+
+// PrimitiveDecode is just like the other `Decode*` functions, except it
+// decodes a TOML value that has already been parsed. Valid primitive values
+// can *only* be obtained from values filled by the decoder functions,
+// including this method. (i.e., `v` may contain more `Primitive`
+// values.)
+//
+// Meta data for primitive values is included in the meta data returned by
+// the `Decode*` functions with one exception: keys returned by the Undecoded
+// method will only reflect keys that were decoded. Namely, any keys hidden
+// behind a Primitive will be considered undecoded. Executing this method will
+// update the undecoded keys in the meta data. (See the example.)
+func (md *MetaData) PrimitiveDecode(primValue Primitive, v interface{}) error {
+	md.context = primValue.context
+	defer func() { md.context = nil }()
+	return md.unify(primValue.undecoded, rvalue(v))
+}
+
+// Decode will decode the contents of `data` in TOML format into a pointer
+// `v`.
+//
+// TOML hashes correspond to Go structs or maps. (Dealer's choice. They can be
+// used interchangeably.)
+//
+// TOML arrays of tables correspond to either a slice of structs or a slice
+// of maps.
+//
+// TOML datetimes correspond to Go `time.Time` values.
+//
+// All other TOML types (float, string, int, bool and array) correspond
+// to the obvious Go types.
+//
+// An exception to the above rules is if a type implements the
+// encoding.TextUnmarshaler interface. In this case, any primitive TOML value
+// (floats, strings, integers, booleans and datetimes) will be converted to
+// a byte string and given to the value's UnmarshalText method. See the
+// Unmarshaler example for a demonstration with time duration strings.
+//
+// Key mapping
+//
+// TOML keys can map to either keys in a Go map or field names in a Go
+// struct. The special `toml` struct tag may be used to map TOML keys to
+// struct fields that don't match the key name exactly. (See the example.)
+// A case insensitive match to struct names will be tried if an exact match
+// can't be found.
+//
+// The mapping between TOML values and Go values is loose. That is, there
+// may exist TOML values that cannot be placed into your representation, and
+// there may be parts of your representation that do not correspond to
+// TOML values. This loose mapping can be made stricter by using the IsDefined
+// and/or Undecoded methods on the MetaData returned.
+//
+// This decoder will not handle cyclic types. If a cyclic type is passed,
+// `Decode` will not terminate.
+func Decode(data string, v interface{}) (MetaData, error) {
+	rv := reflect.ValueOf(v)
+	if rv.Kind() != reflect.Ptr {
+		return MetaData{}, e("Decode of non-pointer %s", reflect.TypeOf(v))
+	}
+	if rv.IsNil() {
+		return MetaData{}, e("Decode of nil %s", reflect.TypeOf(v))
+	}
+	p, err := parse(data)
+	if err != nil {
+		return MetaData{}, err
+	}
+	md := MetaData{
+		p.mapping, p.types, p.ordered,
+		make(map[string]bool, len(p.ordered)), nil,
+	}
+	return md, md.unify(p.mapping, indirect(rv))
+}
+
+// DecodeFile is just like Decode, except it will automatically read the
+// contents of the file at `fpath` and decode it for you.
+func DecodeFile(fpath string, v interface{}) (MetaData, error) {
+	bs, err := ioutil.ReadFile(fpath)
+	if err != nil {
+		return MetaData{}, err
+	}
+	return Decode(string(bs), v)
+}
+
+// DecodeReader is just like Decode, except it will consume all bytes
+// from the reader and decode it for you.
+func DecodeReader(r io.Reader, v interface{}) (MetaData, error) {
+	bs, err := ioutil.ReadAll(r)
+	if err != nil {
+		return MetaData{}, err
+	}
+	return Decode(string(bs), v)
+}
+
+// unify performs a sort of type unification based on the structure of `rv`,
+// which is the client representation.
+//
+// Any type mismatch produces an error. Finding a type that we don't know
+// how to handle produces an unsupported type error.
+func (md *MetaData) unify(data interface{}, rv reflect.Value) error {
+
+	// Special case. Look for a `Primitive` value.
+	if rv.Type() == reflect.TypeOf((*Primitive)(nil)).Elem() {
+		// Save the undecoded data and the key context into the primitive
+		// value.
+		context := make(Key, len(md.context))
+		copy(context, md.context)
+		rv.Set(reflect.ValueOf(Primitive{
+			undecoded: data,
+			context:   context,
+		}))
+		return nil
+	}
+
+	// Special case. Unmarshaler Interface support.
+	if rv.CanAddr() {
+		if v, ok := rv.Addr().Interface().(Unmarshaler); ok {
+			return v.UnmarshalTOML(data)
+		}
+	}
+
+	// Special case. Handle time.Time values specifically.
+	// TODO: Remove this code when we decide to drop support for Go 1.1.
+	// This isn't necessary in Go 1.2 because time.Time satisfies the encoding
+	// interfaces.
+	if rv.Type().AssignableTo(rvalue(time.Time{}).Type()) {
+		return md.unifyDatetime(data, rv)
+	}
+
+	// Special case. Look for a value satisfying the TextUnmarshaler interface.
+	if v, ok := rv.Interface().(TextUnmarshaler); ok {
+		return md.unifyText(data, v)
+	}
+	// BUG(burntsushi)
+	// The behavior here is incorrect whenever a Go type satisfies the
+	// encoding.TextUnmarshaler interface but also corresponds to a TOML
+	// hash or array. In particular, the unmarshaler should only be applied
+	// to primitive TOML values. But at this point, it will be applied to
+	// all kinds of values and produce an incorrect error whenever those values
+	// are hashes or arrays (including arrays of tables).
+
+	k := rv.Kind()
+
+	// laziness
+	if k >= reflect.Int && k <= reflect.Uint64 {
+		return md.unifyInt(data, rv)
+	}
+	switch k {
+	case reflect.Ptr:
+		elem := reflect.New(rv.Type().Elem())
+		err := md.unify(data, reflect.Indirect(elem))
+		if err != nil {
+			return err
+		}
+		rv.Set(elem)
+		return nil
+	case reflect.Struct:
+		return md.unifyStruct(data, rv)
+	case reflect.Map:
+		return md.unifyMap(data, rv)
+	case reflect.Array:
+		return md.unifyArray(data, rv)
+	case reflect.Slice:
+		return md.unifySlice(data, rv)
+	case reflect.String:
+		return md.unifyString(data, rv)
+	case reflect.Bool:
+		return md.unifyBool(data, rv)
+	case reflect.Interface:
+		// we only support empty interfaces.
+		if rv.NumMethod() > 0 {
+			return e("unsupported type %s", rv.Type())
+		}
+		return md.unifyAnything(data, rv)
+	case reflect.Float32:
+		fallthrough
+	case reflect.Float64:
+		return md.unifyFloat64(data, rv)
+	}
+	return e("unsupported type %s", rv.Kind())
+}
+
+func (md *MetaData) unifyStruct(mapping interface{}, rv reflect.Value) error {
+	tmap, ok := mapping.(map[string]interface{})
+	if !ok {
+		if mapping == nil {
+			return nil
+		}
+		return e("type mismatch for %s: expected table but found %T",
+			rv.Type().String(), mapping)
+	}
+
+	for key, datum := range tmap {
+		var f *field
+		fields := cachedTypeFields(rv.Type())
+		for i := range fields {
+			ff := &fields[i]
+			if ff.name == key {
+				f = ff
+				break
+			}
+			if f == nil && strings.EqualFold(ff.name, key) {
+				f = ff
+			}
+		}
+		if f != nil {
+			subv := rv
+			for _, i := range f.index {
+				subv = indirect(subv.Field(i))
+			}
+			if isUnifiable(subv) {
+				md.decoded[md.context.add(key).String()] = true
+				md.context = append(md.context, key)
+				if err := md.unify(datum, subv); err != nil {
+					return err
+				}
+				md.context = md.context[0 : len(md.context)-1]
+			} else if f.name != "" {
+				// Bad user! No soup for you!
+				return e("cannot write unexported field %s.%s",
+					rv.Type().String(), f.name)
+			}
+		}
+	}
+	return nil
+}
+
+func (md *MetaData) unifyMap(mapping interface{}, rv reflect.Value) error {
+	tmap, ok := mapping.(map[string]interface{})
+	if !ok {
+		if tmap == nil {
+			return nil
+		}
+		return badtype("map", mapping)
+	}
+	if rv.IsNil() {
+		rv.Set(reflect.MakeMap(rv.Type()))
+	}
+	for k, v := range tmap {
+		md.decoded[md.context.add(k).String()] = true
+		md.context = append(md.context, k)
+
+		rvkey := indirect(reflect.New(rv.Type().Key()))
+		rvval := reflect.Indirect(reflect.New(rv.Type().Elem()))
+		if err := md.unify(v, rvval); err != nil {
+			return err
+		}
+		md.context = md.context[0 : len(md.context)-1]
+
+		rvkey.SetString(k)
+		rv.SetMapIndex(rvkey, rvval)
+	}
+	return nil
+}
+
+func (md *MetaData) unifyArray(data interface{}, rv reflect.Value) error {
+	datav := reflect.ValueOf(data)
+	if datav.Kind() != reflect.Slice {
+		if !datav.IsValid() {
+			return nil
+		}
+		return badtype("slice", data)
+	}
+	sliceLen := datav.Len()
+	if sliceLen != rv.Len() {
+		return e("expected array length %d; got TOML array of length %d",
+			rv.Len(), sliceLen)
+	}
+	return md.unifySliceArray(datav, rv)
+}
+
+func (md *MetaData) unifySlice(data interface{}, rv reflect.Value) error {
+	datav := reflect.ValueOf(data)
+	if datav.Kind() != reflect.Slice {
+		if !datav.IsValid() {
+			return nil
+		}
+		return badtype("slice", data)
+	}
+	n := datav.Len()
+	if rv.IsNil() || rv.Cap() < n {
+		rv.Set(reflect.MakeSlice(rv.Type(), n, n))
+	}
+	rv.SetLen(n)
+	return md.unifySliceArray(datav, rv)
+}
+
+func (md *MetaData) unifySliceArray(data, rv reflect.Value) error {
+	sliceLen := data.Len()
+	for i := 0; i < sliceLen; i++ {
+		v := data.Index(i).Interface()
+		sliceval := indirect(rv.Index(i))
+		if err := md.unify(v, sliceval); err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+func (md *MetaData) unifyDatetime(data interface{}, rv reflect.Value) error {
+	if _, ok := data.(time.Time); ok {
+		rv.Set(reflect.ValueOf(data))
+		return nil
+	}
+	return badtype("time.Time", data)
+}
+
+func (md *MetaData) unifyString(data interface{}, rv reflect.Value) error {
+	if s, ok := data.(string); ok {
+		rv.SetString(s)
+		return nil
+	}
+	return badtype("string", data)
+}
+
+func (md *MetaData) unifyFloat64(data interface{}, rv reflect.Value) error {
+	if num, ok := data.(float64); ok {
+		switch rv.Kind() {
+		case reflect.Float32:
+			fallthrough
+		case reflect.Float64:
+			rv.SetFloat(num)
+		default:
+			panic("bug")
+		}
+		return nil
+	}
+	return badtype("float", data)
+}
+
+func (md *MetaData) unifyInt(data interface{}, rv reflect.Value) error {
+	if num, ok := data.(int64); ok {
+		if rv.Kind() >= reflect.Int && rv.Kind() <= reflect.Int64 {
+			switch rv.Kind() {
+			case reflect.Int, reflect.Int64:
+				// No bounds checking necessary.
+			case reflect.Int8:
+				if num < math.MinInt8 || num > math.MaxInt8 {
+					return e("value %d is out of range for int8", num)
+				}
+			case reflect.Int16:
+				if num < math.MinInt16 || num > math.MaxInt16 {
+					return e("value %d is out of range for int16", num)
+				}
+			case reflect.Int32:
+				if num < math.MinInt32 || num > math.MaxInt32 {
+					return e("value %d is out of range for int32", num)
+				}
+			}
+			rv.SetInt(num)
+		} else if rv.Kind() >= reflect.Uint && rv.Kind() <= reflect.Uint64 {
+			unum := uint64(num)
+			switch rv.Kind() {
+			case reflect.Uint, reflect.Uint64:
+				// No bounds checking necessary.
+			case reflect.Uint8:
+				if num < 0 || unum > math.MaxUint8 {
+					return e("value %d is out of range for uint8", num)
+				}
+			case reflect.Uint16:
+				if num < 0 || unum > math.MaxUint16 {
+					return e("value %d is out of range for uint16", num)
+				}
+			case reflect.Uint32:
+				if num < 0 || unum > math.MaxUint32 {
+					return e("value %d is out of range for uint32", num)
+				}
+			}
+			rv.SetUint(unum)
+		} else {
+			panic("unreachable")
+		}
+		return nil
+	}
+	return badtype("integer", data)
+}
+
+func (md *MetaData) unifyBool(data interface{}, rv reflect.Value) error {
+	if b, ok := data.(bool); ok {
+		rv.SetBool(b)
+		return nil
+	}
+	return badtype("boolean", data)
+}
+
+func (md *MetaData) unifyAnything(data interface{}, rv reflect.Value) error {
+	rv.Set(reflect.ValueOf(data))
+	return nil
+}
+
+func (md *MetaData) unifyText(data interface{}, v TextUnmarshaler) error {
+	var s string
+	switch sdata := data.(type) {
+	case TextMarshaler:
+		text, err := sdata.MarshalText()
+		if err != nil {
+			return err
+		}
+		s = string(text)
+	case fmt.Stringer:
+		s = sdata.String()
+	case string:
+		s = sdata
+	case bool:
+		s = fmt.Sprintf("%v", sdata)
+	case int64:
+		s = fmt.Sprintf("%d", sdata)
+	case float64:
+		s = fmt.Sprintf("%f", sdata)
+	default:
+		return badtype("primitive (string-like)", data)
+	}
+	if err := v.UnmarshalText([]byte(s)); err != nil {
+		return err
+	}
+	return nil
+}
+
+// rvalue returns a reflect.Value of `v`. All pointers are resolved.
+func rvalue(v interface{}) reflect.Value {
+	return indirect(reflect.ValueOf(v))
+}
+
+// indirect returns the value pointed to by a pointer.
+// Pointers are followed until the value is not a pointer.
+// New values are allocated for each nil pointer.
+//
+// An exception to this rule is if the value satisfies an interface of
+// interest to us (like encoding.TextUnmarshaler).
+func indirect(v reflect.Value) reflect.Value {
+	if v.Kind() != reflect.Ptr {
+		if v.CanSet() {
+			pv := v.Addr()
+			if _, ok := pv.Interface().(TextUnmarshaler); ok {
+				return pv
+			}
+		}
+		return v
+	}
+	if v.IsNil() {
+		v.Set(reflect.New(v.Type().Elem()))
+	}
+	return indirect(reflect.Indirect(v))
+}
+
+func isUnifiable(rv reflect.Value) bool {
+	if rv.CanSet() {
+		return true
+	}
+	if _, ok := rv.Interface().(TextUnmarshaler); ok {
+		return true
+	}
+	return false
+}
+
+func badtype(expected string, data interface{}) error {
+	return e("cannot load TOML value of type %T into a Go %s", data, expected)
+}

src/runtime/vendor/github.com/BurntSushi/toml/decode_meta.go

@@ -0,0 +1,121 @@
+package toml
+
+import "strings"
+
+// MetaData allows access to meta information about TOML data that may not
+// be inferrable via reflection. In particular, whether a key has been defined
+// and the TOML type of a key.
+type MetaData struct {
+	mapping map[string]interface{}
+	types   map[string]tomlType
+	keys    []Key
+	decoded map[string]bool
+	context Key // Used only during decoding.
+}
+
+// IsDefined returns true if the key given exists in the TOML data. The key
+// should be specified hierarchially. e.g.,
+//
+//	// access the TOML key 'a.b.c'
+//	IsDefined("a", "b", "c")
+//
+// IsDefined will return false if an empty key given. Keys are case sensitive.
+func (md *MetaData) IsDefined(key ...string) bool {
+	if len(key) == 0 {
+		return false
+	}
+
+	var hash map[string]interface{}
+	var ok bool
+	var hashOrVal interface{} = md.mapping
+	for _, k := range key {
+		if hash, ok = hashOrVal.(map[string]interface{}); !ok {
+			return false
+		}
+		if hashOrVal, ok = hash[k]; !ok {
+			return false
+		}
+	}
+	return true
+}
+
+// Type returns a string representation of the type of the key specified.
+//
+// Type will return the empty string if given an empty key or a key that
+// does not exist. Keys are case sensitive.
+func (md *MetaData) Type(key ...string) string {
+	fullkey := strings.Join(key, ".")
+	if typ, ok := md.types[fullkey]; ok {
+		return typ.typeString()
+	}
+	return ""
+}
+
+// Key is the type of any TOML key, including key groups. Use (MetaData).Keys
+// to get values of this type.
+type Key []string
+
+func (k Key) String() string {
+	return strings.Join(k, ".")
+}
+
+func (k Key) maybeQuotedAll() string {
+	var ss []string
+	for i := range k {
+		ss = append(ss, k.maybeQuoted(i))
+	}
+	return strings.Join(ss, ".")
+}
+
+func (k Key) maybeQuoted(i int) string {
+	quote := false
+	for _, c := range k[i] {
+		if !isBareKeyChar(c) {
+			quote = true
+			break
+		}
+	}
+	if quote {
+		return "\"" + strings.Replace(k[i], "\"", "\\\"", -1) + "\""
+	}
+	return k[i]
+}
+
+func (k Key) add(piece string) Key {
+	newKey := make(Key, len(k)+1)
+	copy(newKey, k)
+	newKey[len(k)] = piece
+	return newKey
+}
+
+// Keys returns a slice of every key in the TOML data, including key groups.
+// Each key is itself a slice, where the first element is the top of the
+// hierarchy and the last is the most specific.
+//
+// The list will have the same order as the keys appeared in the TOML data.
+//
+// All keys returned are non-empty.
+func (md *MetaData) Keys() []Key {
+	return md.keys
+}
+
+// Undecoded returns all keys that have not been decoded in the order in which
+// they appear in the original TOML document.
+//
+// This includes keys that haven't been decoded because of a Primitive value.
+// Once the Primitive value is decoded, the keys will be considered decoded.
+//
+// Also note that decoding into an empty interface will result in no decoding,
+// and so no keys will be considered decoded.
+//
+// In this sense, the Undecoded keys correspond to keys in the TOML document
+// that do not have a concrete type in your representation.
+func (md *MetaData) Undecoded() []Key {
+	undecoded := make([]Key, 0, len(md.keys))
+	for _, key := range md.keys {
+		if !md.decoded[key.String()] {
+			undecoded = append(undecoded, key)
+		}
+	}
+	return undecoded
+}

src/runtime/vendor/github.com/BurntSushi/toml/doc.go

@@ -0,0 +1,27 @@
+/*
+Package toml provides facilities for decoding and encoding TOML configuration
+files via reflection. There is also support for delaying decoding with
+the Primitive type, and querying the set of keys in a TOML document with the
+MetaData type.
+
+The specification implemented: https://github.com/toml-lang/toml
+
+The sub-command github.com/BurntSushi/toml/cmd/tomlv can be used to verify
+whether a file is a valid TOML document. It can also be used to print the
+type of each key in a TOML document.
+
+Testing
+
+There are two important types of tests used for this package. The first is
+contained inside '*_test.go' files and uses the standard Go unit testing
+framework. These tests are primarily devoted to holistically testing the
+decoder and encoder.
+
+The second type of testing is used to verify the implementation's adherence
+to the TOML specification. These tests have been factored into their own
+project: https://github.com/BurntSushi/toml-test
+
+The reason the tests are in a separate project is so that they can be used by
+any implementation of TOML. Namely, it is language agnostic.
+*/
+package toml

src/runtime/vendor/github.com/BurntSushi/toml/encode.go

@@ -0,0 +1,568 @@
+package toml
+
+import (
+	"bufio"
+	"errors"
+	"fmt"
+	"io"
+	"reflect"
+	"sort"
+	"strconv"
+	"strings"
+	"time"
+)
+
+type tomlEncodeError struct{ error }
+
+var (
+	errArrayMixedElementTypes = errors.New(
+		"toml: cannot encode array with mixed element types")
+	errArrayNilElement = errors.New(
+		"toml: cannot encode array with nil element")
+	errNonString = errors.New(
+		"toml: cannot encode a map with non-string key type")
+	errAnonNonStruct = errors.New(
+		"toml: cannot encode an anonymous field that is not a struct")
+	errArrayNoTable = errors.New(
+		"toml: TOML array element cannot contain a table")
+	errNoKey = errors.New(
+		"toml: top-level values must be Go maps or structs")
+	errAnything = errors.New("") // used in testing
+)
+
+var quotedReplacer = strings.NewReplacer(
+	"\t", "\\t",
+	"\n", "\\n",
+	"\r", "\\r",
+	"\"", "\\\"",
+	"\\", "\\\\",
+)
+
+// Encoder controls the encoding of Go values to a TOML document to some
+// io.Writer.
+//
+// The indentation level can be controlled with the Indent field.
+type Encoder struct {
+	// A single indentation level. By default it is two spaces.
+	Indent string
+
+	// hasWritten is whether we have written any output to w yet.
+	hasWritten bool
+	w          *bufio.Writer
+}
+
+// NewEncoder returns a TOML encoder that encodes Go values to the io.Writer
+// given. By default, a single indentation level is 2 spaces.
+func NewEncoder(w io.Writer) *Encoder {
+	return &Encoder{
+		w:      bufio.NewWriter(w),
+		Indent: "  ",
+	}
+}
+
+// Encode writes a TOML representation of the Go value to the underlying
+// io.Writer. If the value given cannot be encoded to a valid TOML document,
+// then an error is returned.
+//
+// The mapping between Go values and TOML values should be precisely the same
+// as for the Decode* functions. Similarly, the TextMarshaler interface is
+// supported by encoding the resulting bytes as strings. (If you want to write
+// arbitrary binary data then you will need to use something like base64 since
+// TOML does not have any binary types.)
+//
+// When encoding TOML hashes (i.e., Go maps or structs), keys without any
+// sub-hashes are encoded first.
+//
+// If a Go map is encoded, then its keys are sorted alphabetically for
+// deterministic output. More control over this behavior may be provided if
+// there is demand for it.
+//
+// Encoding Go values without a corresponding TOML representation---like map
+// types with non-string keys---will cause an error to be returned. Similarly
+// for mixed arrays/slices, arrays/slices with nil elements, embedded
+// non-struct types and nested slices containing maps or structs.
+// (e.g., [][]map[string]string is not allowed but []map[string]string is OK
+// and so is []map[string][]string.)
+func (enc *Encoder) Encode(v interface{}) error {
+	rv := eindirect(reflect.ValueOf(v))
+	if err := enc.safeEncode(Key([]string{}), rv); err != nil {
+		return err
+	}
+	return enc.w.Flush()
+}
+
+func (enc *Encoder) safeEncode(key Key, rv reflect.Value) (err error) {
+	defer func() {
+		if r := recover(); r != nil {
+			if terr, ok := r.(tomlEncodeError); ok {
+				err = terr.error
+				return
+			}
+			panic(r)
+		}
+	}()
+	enc.encode(key, rv)
+	return nil
+}
+
+func (enc *Encoder) encode(key Key, rv reflect.Value) {
+	// Special case. Time needs to be in ISO8601 format.
+	// Special case. If we can marshal the type to text, then we used that.
+	// Basically, this prevents the encoder for handling these types as
+	// generic structs (or whatever the underlying type of a TextMarshaler is).
+	switch rv.Interface().(type) {
+	case time.Time, TextMarshaler:
+		enc.keyEqElement(key, rv)
+		return
+	}
+
+	k := rv.Kind()
+	switch k {
+	case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32,
+		reflect.Int64,
+		reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32,
+		reflect.Uint64,
+		reflect.Float32, reflect.Float64, reflect.String, reflect.Bool:
+		enc.keyEqElement(key, rv)
+	case reflect.Array, reflect.Slice:
+		if typeEqual(tomlArrayHash, tomlTypeOfGo(rv)) {
+			enc.eArrayOfTables(key, rv)
+		} else {
+			enc.keyEqElement(key, rv)
+		}
+	case reflect.Interface:
+		if rv.IsNil() {
+			return
+		}
+		enc.encode(key, rv.Elem())
+	case reflect.Map:
+		if rv.IsNil() {
+			return
+		}
+		enc.eTable(key, rv)
+	case reflect.Ptr:
+		if rv.IsNil() {
+			return
+		}
+		enc.encode(key, rv.Elem())
+	case reflect.Struct:
+		enc.eTable(key, rv)
+	default:
+		panic(e("unsupported type for key '%s': %s", key, k))
+	}
+}
+
+// eElement encodes any value that can be an array element (primitives and
+// arrays).
+func (enc *Encoder) eElement(rv reflect.Value) {
+	switch v := rv.Interface().(type) {
+	case time.Time:
+		// Special case time.Time as a primitive. Has to come before
+		// TextMarshaler below because time.Time implements
+		// encoding.TextMarshaler, but we need to always use UTC.
+		enc.wf(v.UTC().Format("2006-01-02T15:04:05Z"))
+		return
+	case TextMarshaler:
+		// Special case. Use text marshaler if it's available for this value.
+		if s, err := v.MarshalText(); err != nil {
+			encPanic(err)
+		} else {
+			enc.writeQuoted(string(s))
+		}
+		return
+	}
+	switch rv.Kind() {
+	case reflect.Bool:
+		enc.wf(strconv.FormatBool(rv.Bool()))
+	case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32,
+		reflect.Int64:
+		enc.wf(strconv.FormatInt(rv.Int(), 10))
+	case reflect.Uint, reflect.Uint8, reflect.Uint16,
+		reflect.Uint32, reflect.Uint64:
+		enc.wf(strconv.FormatUint(rv.Uint(), 10))
+	case reflect.Float32:
+		enc.wf(floatAddDecimal(strconv.FormatFloat(rv.Float(), 'f', -1, 32)))
+	case reflect.Float64:
+		enc.wf(floatAddDecimal(strconv.FormatFloat(rv.Float(), 'f', -1, 64)))
+	case reflect.Array, reflect.Slice:
+		enc.eArrayOrSliceElement(rv)
+	case reflect.Interface:
+		enc.eElement(rv.Elem())
+	case reflect.String:
+		enc.writeQuoted(rv.String())
+	default:
+		panic(e("unexpected primitive type: %s", rv.Kind()))
+	}
+}
+
+// By the TOML spec, all floats must have a decimal with at least one
+// number on either side.
+func floatAddDecimal(fstr string) string {
+	if !strings.Contains(fstr, ".") {
+		return fstr + ".0"
+	}
+	return fstr
+}
+
+func (enc *Encoder) writeQuoted(s string) {
+	enc.wf("\"%s\"", quotedReplacer.Replace(s))
+}
+
+func (enc *Encoder) eArrayOrSliceElement(rv reflect.Value) {
+	length := rv.Len()
+	enc.wf("[")
+	for i := 0; i < length; i++ {
+		elem := rv.Index(i)
+		enc.eElement(elem)
+		if i != length-1 {
+			enc.wf(", ")
+		}
+	}
+	enc.wf("]")
+}
+
+func (enc *Encoder) eArrayOfTables(key Key, rv reflect.Value) {
+	if len(key) == 0 {
+		encPanic(errNoKey)
+	}
+	for i := 0; i < rv.Len(); i++ {
+		trv := rv.Index(i)
+		if isNil(trv) {
+			continue
+		}
+		panicIfInvalidKey(key)
+		enc.newline()
+		enc.wf("%s[[%s]]", enc.indentStr(key), key.maybeQuotedAll())
+		enc.newline()
+		enc.eMapOrStruct(key, trv)
+	}
+}
+
+func (enc *Encoder) eTable(key Key, rv reflect.Value) {
+	panicIfInvalidKey(key)
+	if len(key) == 1 {
+		// Output an extra newline between top-level tables.
+		// (The newline isn't written if nothing else has been written though.)
+		enc.newline()
+	}
+	if len(key) > 0 {
+		enc.wf("%s[%s]", enc.indentStr(key), key.maybeQuotedAll())
+		enc.newline()
+	}
+	enc.eMapOrStruct(key, rv)
+}
+
+func (enc *Encoder) eMapOrStruct(key Key, rv reflect.Value) {
+	switch rv := eindirect(rv); rv.Kind() {
+	case reflect.Map:
+		enc.eMap(key, rv)
+	case reflect.Struct:
+		enc.eStruct(key, rv)
+	default:
+		panic("eTable: unhandled reflect.Value Kind: " + rv.Kind().String())
+	}
+}
+
+func (enc *Encoder) eMap(key Key, rv reflect.Value) {
+	rt := rv.Type()
+	if rt.Key().Kind() != reflect.String {
+		encPanic(errNonString)
+	}
+
+	// Sort keys so that we have deterministic output. And write keys directly
+	// underneath this key first, before writing sub-structs or sub-maps.
+	var mapKeysDirect, mapKeysSub []string
+	for _, mapKey := range rv.MapKeys() {
+		k := mapKey.String()
+		if typeIsHash(tomlTypeOfGo(rv.MapIndex(mapKey))) {
+			mapKeysSub = append(mapKeysSub, k)
+		} else {
+			mapKeysDirect = append(mapKeysDirect, k)
+		}
+	}
+
+	var writeMapKeys = func(mapKeys []string) {
+		sort.Strings(mapKeys)
+		for _, mapKey := range mapKeys {
+			mrv := rv.MapIndex(reflect.ValueOf(mapKey))
+			if isNil(mrv) {
+				// Don't write anything for nil fields.
+				continue
+			}
+			enc.encode(key.add(mapKey), mrv)
+		}
+	}
+	writeMapKeys(mapKeysDirect)
+	writeMapKeys(mapKeysSub)
+}
+
+func (enc *Encoder) eStruct(key Key, rv reflect.Value) {
+	// Write keys for fields directly under this key first, because if we write
+	// a field that creates a new table, then all keys under it will be in that
+	// table (not the one we're writing here).
+	rt := rv.Type()
+	var fieldsDirect, fieldsSub [][]int
+	var addFields func(rt reflect.Type, rv reflect.Value, start []int)
+	addFields = func(rt reflect.Type, rv reflect.Value, start []int) {
+		for i := 0; i < rt.NumField(); i++ {
+			f := rt.Field(i)
+			// skip unexported fields
+			if f.PkgPath != "" && !f.Anonymous {
+				continue
+			}
+			frv := rv.Field(i)
+			if f.Anonymous {
+				t := f.Type
+				switch t.Kind() {
+				case reflect.Struct:
+					// Treat anonymous struct fields with
+					// tag names as though they are not
+					// anonymous, like encoding/json does.
+					if getOptions(f.Tag).name == "" {
+						addFields(t, frv, f.Index)
+						continue
+					}
+				case reflect.Ptr:
+					if t.Elem().Kind() == reflect.Struct &&
+						getOptions(f.Tag).name == "" {
+						if !frv.IsNil() {
+							addFields(t.Elem(), frv.Elem(), f.Index)
+						}
+						continue
+					}
+					// Fall through to the normal field encoding logic below
+					// for non-struct anonymous fields.
+				}
+			}
+
+			if typeIsHash(tomlTypeOfGo(frv)) {
+				fieldsSub = append(fieldsSub, append(start, f.Index...))
+			} else {
+				fieldsDirect = append(fieldsDirect, append(start, f.Index...))
+			}
+		}
+	}
+	addFields(rt, rv, nil)
+
+	var writeFields = func(fields [][]int) {
+		for _, fieldIndex := range fields {
+			sft := rt.FieldByIndex(fieldIndex)
+			sf := rv.FieldByIndex(fieldIndex)
+			if isNil(sf) {
+				// Don't write anything for nil fields.
+				continue
+			}
+
+			opts := getOptions(sft.Tag)
+			if opts.skip {
+				continue
+			}
+			keyName := sft.Name
+			if opts.name != "" {
+				keyName = opts.name
+			}
+			if opts.omitempty && isEmpty(sf) {
+				continue
+			}
+			if opts.omitzero && isZero(sf) {
+				continue
+			}
+
+			enc.encode(key.add(keyName), sf)
+		}
+	}
+	writeFields(fieldsDirect)
+	writeFields(fieldsSub)
+}
+
+// tomlTypeName returns the TOML type name of the Go value's type. It is
+// used to determine whether the types of array elements are mixed (which is
+// forbidden). If the Go value is nil, then it is illegal for it to be an array
+// element, and valueIsNil is returned as true.
+
+// Returns the TOML type of a Go value. The type may be `nil`, which means
+// no concrete TOML type could be found.
+func tomlTypeOfGo(rv reflect.Value) tomlType {
+	if isNil(rv) || !rv.IsValid() {
+		return nil
+	}
+	switch rv.Kind() {
+	case reflect.Bool:
+		return tomlBool
+	case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32,
+		reflect.Int64,
+		reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32,
+		reflect.Uint64:
+		return tomlInteger
+	case reflect.Float32, reflect.Float64:
+		return tomlFloat
+	case reflect.Array, reflect.Slice:
+		if typeEqual(tomlHash, tomlArrayType(rv)) {
+			return tomlArrayHash
+		}
+		return tomlArray
+	case reflect.Ptr, reflect.Interface:
+		return tomlTypeOfGo(rv.Elem())
+	case reflect.String:
+		return tomlString
+	case reflect.Map:
+		return tomlHash
+	case reflect.Struct:
+		switch rv.Interface().(type) {
+		case time.Time:
+			return tomlDatetime
+		case TextMarshaler:
+			return tomlString
+		default:
+			return tomlHash
+		}
+	default:
+		panic("unexpected reflect.Kind: " + rv.Kind().String())
+	}
+}
+
+// tomlArrayType returns the element type of a TOML array. The type returned
+// may be nil if it cannot be determined (e.g., a nil slice or a zero length
+// slize). This function may also panic if it finds a type that cannot be
+// expressed in TOML (such as nil elements, heterogeneous arrays or directly
+// nested arrays of tables).
+func tomlArrayType(rv reflect.Value) tomlType {
+	if isNil(rv) || !rv.IsValid() || rv.Len() == 0 {
+		return nil
+	}
+	firstType := tomlTypeOfGo(rv.Index(0))
+	if firstType == nil {
+		encPanic(errArrayNilElement)
+	}
+
+	rvlen := rv.Len()
+	for i := 1; i < rvlen; i++ {
+		elem := rv.Index(i)
+		switch elemType := tomlTypeOfGo(elem); {
+		case elemType == nil:
+			encPanic(errArrayNilElement)
+		case !typeEqual(firstType, elemType):
+			encPanic(errArrayMixedElementTypes)
+		}
+	}
+	// If we have a nested array, then we must make sure that the nested
+	// array contains ONLY primitives.
+	// This checks arbitrarily nested arrays.
+	if typeEqual(firstType, tomlArray) || typeEqual(firstType, tomlArrayHash) {
+		nest := tomlArrayType(eindirect(rv.Index(0)))
+		if typeEqual(nest, tomlHash) || typeEqual(nest, tomlArrayHash) {
+			encPanic(errArrayNoTable)
+		}
+	}
+	return firstType
+}
+
+type tagOptions struct {
+	skip      bool // "-"
+	name      string
+	omitempty bool
+	omitzero  bool
+}
+
+func getOptions(tag reflect.StructTag) tagOptions {
+	t := tag.Get("toml")
+	if t == "-" {
+		return tagOptions{skip: true}
+	}
+	var opts tagOptions
+	parts := strings.Split(t, ",")
+	opts.name = parts[0]
+	for _, s := range parts[1:] {
+		switch s {
+		case "omitempty":
+			opts.omitempty = true
+		case "omitzero":
+			opts.omitzero = true
+		}
+	}
+	return opts
+}
+
+func isZero(rv reflect.Value) bool {
+	switch rv.Kind() {
+	case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64:
+		return rv.Int() == 0
+	case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64:
+		return rv.Uint() == 0
+	case reflect.Float32, reflect.Float64:
+		return rv.Float() == 0.0
+	}
+	return false
+}
+
+func isEmpty(rv reflect.Value) bool {
+	switch rv.Kind() {
+	case reflect.Array, reflect.Slice, reflect.Map, reflect.String:
+		return rv.Len() == 0
+	case reflect.Bool:
+		return !rv.Bool()
+	}
+	return false
+}
+
+func (enc *Encoder) newline() {
+	if enc.hasWritten {
+		enc.wf("\n")
+	}
+}
+
+func (enc *Encoder) keyEqElement(key Key, val reflect.Value) {
+	if len(key) == 0 {
+		encPanic(errNoKey)
+	}
+	panicIfInvalidKey(key)
+	enc.wf("%s%s = ", enc.indentStr(key), key.maybeQuoted(len(key)-1))
+	enc.eElement(val)
+	enc.newline()
+}
+
+func (enc *Encoder) wf(format string, v ...interface{}) {
+	if _, err := fmt.Fprintf(enc.w, format, v...); err != nil {
+		encPanic(err)
+	}
+	enc.hasWritten = true
+}
+
+func (enc *Encoder) indentStr(key Key) string {
+	return strings.Repeat(enc.Indent, len(key)-1)
+}
+
+func encPanic(err error) {
+	panic(tomlEncodeError{err})
+}
+
+func eindirect(v reflect.Value) reflect.Value {
+	switch v.Kind() {
+	case reflect.Ptr, reflect.Interface:
+		return eindirect(v.Elem())
+	default:
+		return v
+	}
+}
+
+func isNil(rv reflect.Value) bool {
+	switch rv.Kind() {
+	case reflect.Interface, reflect.Map, reflect.Ptr, reflect.Slice:
+		return rv.IsNil()
+	default:
+		return false
+	}
+}
+
+func panicIfInvalidKey(key Key) {
+	for _, k := range key {
+		if len(k) == 0 {
+			encPanic(e("Key '%s' is not a valid table name. Key names "+
+				"cannot be empty.", key.maybeQuotedAll()))
+		}
+	}
+}
+
+func isValidKeyName(s string) bool {
+	return len(s) != 0
+}

src/runtime/vendor/github.com/BurntSushi/toml/encoding_types.go

@@ -0,0 +1,19 @@
+// +build go1.2
+
+package toml
+
+// In order to support Go 1.1, we define our own TextMarshaler and
+// TextUnmarshaler types. For Go 1.2+, we just alias them with the
+// standard library interfaces.
+
+import (
+	"encoding"
+)
+
+// TextMarshaler is a synonym for encoding.TextMarshaler. It is defined here
+// so that Go 1.1 can be supported.
+type TextMarshaler encoding.TextMarshaler
+
+// TextUnmarshaler is a synonym for encoding.TextUnmarshaler. It is defined
+// here so that Go 1.1 can be supported.
+type TextUnmarshaler encoding.TextUnmarshaler

src/runtime/vendor/github.com/BurntSushi/toml/encoding_types_1.1.go

@@ -0,0 +1,18 @@
+// +build !go1.2
+
+package toml
+
+// These interfaces were introduced in Go 1.2, so we add them manually when
+// compiling for Go 1.1.
+
+// TextMarshaler is a synonym for encoding.TextMarshaler. It is defined here
+// so that Go 1.1 can be supported.
+type TextMarshaler interface {
+	MarshalText() (text []byte, err error)
+}
+
+// TextUnmarshaler is a synonym for encoding.TextUnmarshaler. It is defined
+// here so that Go 1.1 can be supported.
+type TextUnmarshaler interface {
+	UnmarshalText(text []byte) error
+}

src/runtime/vendor/github.com/BurntSushi/toml/lex.go

@@ -0,0 +1,953 @@
+package toml
+
+import (
+	"fmt"
+	"strings"
+	"unicode"
+	"unicode/utf8"
+)
+
+type itemType int
+
+const (
+	itemError itemType = iota
+	itemNIL            // used in the parser to indicate no type
+	itemEOF
+	itemText
+	itemString
+	itemRawString
+	itemMultilineString
+	itemRawMultilineString
+	itemBool
+	itemInteger
+	itemFloat
+	itemDatetime
+	itemArray // the start of an array
+	itemArrayEnd
+	itemTableStart
+	itemTableEnd
+	itemArrayTableStart
+	itemArrayTableEnd
+	itemKeyStart
+	itemCommentStart
+	itemInlineTableStart
+	itemInlineTableEnd
+)
+
+const (
+	eof              = 0
+	comma            = ','
+	tableStart       = '['
+	tableEnd         = ']'
+	arrayTableStart  = '['
+	arrayTableEnd    = ']'
+	tableSep         = '.'
+	keySep           = '='
+	arrayStart       = '['
+	arrayEnd         = ']'
+	commentStart     = '#'
+	stringStart      = '"'
+	stringEnd        = '"'
+	rawStringStart   = '\''
+	rawStringEnd     = '\''
+	inlineTableStart = '{'
+	inlineTableEnd   = '}'
+)
+
+type stateFn func(lx *lexer) stateFn
+
+type lexer struct {
+	input string
+	start int
+	pos   int
+	line  int
+	state stateFn
+	items chan item
+
+	// Allow for backing up up to three runes.
+	// This is necessary because TOML contains 3-rune tokens (""" and ''').
+	prevWidths [3]int
+	nprev      int // how many of prevWidths are in use
+	// If we emit an eof, we can still back up, but it is not OK to call
+	// next again.
+	atEOF bool
+
+	// A stack of state functions used to maintain context.
+	// The idea is to reuse parts of the state machine in various places.
+	// For example, values can appear at the top level or within arbitrarily
+	// nested arrays. The last state on the stack is used after a value has
+	// been lexed. Similarly for comments.
+	stack []stateFn
+}
+
+type item struct {
+	typ  itemType
+	val  string
+	line int
+}
+
+func (lx *lexer) nextItem() item {
+	for {
+		select {
+		case item := <-lx.items:
+			return item
+		default:
+			lx.state = lx.state(lx)
+		}
+	}
+}
+
+func lex(input string) *lexer {
+	lx := &lexer{
+		input: input,
+		state: lexTop,
+		line:  1,
+		items: make(chan item, 10),
+		stack: make([]stateFn, 0, 10),
+	}
+	return lx
+}
+
+func (lx *lexer) push(state stateFn) {
+	lx.stack = append(lx.stack, state)
+}
+
+func (lx *lexer) pop() stateFn {
+	if len(lx.stack) == 0 {
+		return lx.errorf("BUG in lexer: no states to pop")
+	}
+	last := lx.stack[len(lx.stack)-1]
+	lx.stack = lx.stack[0 : len(lx.stack)-1]
+	return last
+}
+
+func (lx *lexer) current() string {
+	return lx.input[lx.start:lx.pos]
+}
+
+func (lx *lexer) emit(typ itemType) {
+	lx.items <- item{typ, lx.current(), lx.line}
+	lx.start = lx.pos
+}
+
+func (lx *lexer) emitTrim(typ itemType) {
+	lx.items <- item{typ, strings.TrimSpace(lx.current()), lx.line}
+	lx.start = lx.pos
+}
+
+func (lx *lexer) next() (r rune) {
+	if lx.atEOF {
+		panic("next called after EOF")
+	}
+	if lx.pos >= len(lx.input) {
+		lx.atEOF = true
+		return eof
+	}
+
+	if lx.input[lx.pos] == '\n' {
+		lx.line++
+	}
+	lx.prevWidths[2] = lx.prevWidths[1]
+	lx.prevWidths[1] = lx.prevWidths[0]
+	if lx.nprev < 3 {
+		lx.nprev++
+	}
+	r, w := utf8.DecodeRuneInString(lx.input[lx.pos:])
+	lx.prevWidths[0] = w
+	lx.pos += w
+	return r
+}
+
+// ignore skips over the pending input before this point.
+func (lx *lexer) ignore() {
+	lx.start = lx.pos
+}
+
+// backup steps back one rune. Can be called only twice between calls to next.
+func (lx *lexer) backup() {
+	if lx.atEOF {
+		lx.atEOF = false
+		return
+	}
+	if lx.nprev < 1 {
+		panic("backed up too far")
+	}
+	w := lx.prevWidths[0]
+	lx.prevWidths[0] = lx.prevWidths[1]
+	lx.prevWidths[1] = lx.prevWidths[2]
+	lx.nprev--
+	lx.pos -= w
+	if lx.pos < len(lx.input) && lx.input[lx.pos] == '\n' {
+		lx.line--
+	}
+}
+
+// accept consumes the next rune if it's equal to `valid`.
+func (lx *lexer) accept(valid rune) bool {
+	if lx.next() == valid {
+		return true
+	}
+	lx.backup()
+	return false
+}
+
+// peek returns but does not consume the next rune in the input.
+func (lx *lexer) peek() rune {
+	r := lx.next()
+	lx.backup()
+	return r
+}
+
+// skip ignores all input that matches the given predicate.
+func (lx *lexer) skip(pred func(rune) bool) {
+	for {
+		r := lx.next()
+		if pred(r) {
+			continue
+		}
+		lx.backup()
+		lx.ignore()
+		return
+	}
+}
+
+// errorf stops all lexing by emitting an error and returning `nil`.
+// Note that any value that is a character is escaped if it's a special
+// character (newlines, tabs, etc.).
+func (lx *lexer) errorf(format string, values ...interface{}) stateFn {
+	lx.items <- item{
+		itemError,
+		fmt.Sprintf(format, values...),
+		lx.line,
+	}
+	return nil
+}
+
+// lexTop consumes elements at the top level of TOML data.
+func lexTop(lx *lexer) stateFn {
+	r := lx.next()
+	if isWhitespace(r) || isNL(r) {
+		return lexSkip(lx, lexTop)
+	}
+	switch r {
+	case commentStart:
+		lx.push(lexTop)
+		return lexCommentStart
+	case tableStart:
+		return lexTableStart
+	case eof:
+		if lx.pos > lx.start {
+			return lx.errorf("unexpected EOF")
+		}
+		lx.emit(itemEOF)
+		return nil
+	}
+
+	// At this point, the only valid item can be a key, so we back up
+	// and let the key lexer do the rest.
+	lx.backup()
+	lx.push(lexTopEnd)
+	return lexKeyStart
+}
+
+// lexTopEnd is entered whenever a top-level item has been consumed. (A value
+// or a table.) It must see only whitespace, and will turn back to lexTop
+// upon a newline. If it sees EOF, it will quit the lexer successfully.
+func lexTopEnd(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case r == commentStart:
+		// a comment will read to a newline for us.
+		lx.push(lexTop)
+		return lexCommentStart
+	case isWhitespace(r):
+		return lexTopEnd
+	case isNL(r):
+		lx.ignore()
+		return lexTop
+	case r == eof:
+		lx.emit(itemEOF)
+		return nil
+	}
+	return lx.errorf("expected a top-level item to end with a newline, "+
+		"comment, or EOF, but got %q instead", r)
+}
+
+// lexTable lexes the beginning of a table. Namely, it makes sure that
+// it starts with a character other than '.' and ']'.
+// It assumes that '[' has already been consumed.
+// It also handles the case that this is an item in an array of tables.
+// e.g., '[[name]]'.
+func lexTableStart(lx *lexer) stateFn {
+	if lx.peek() == arrayTableStart {
+		lx.next()
+		lx.emit(itemArrayTableStart)
+		lx.push(lexArrayTableEnd)
+	} else {
+		lx.emit(itemTableStart)
+		lx.push(lexTableEnd)
+	}
+	return lexTableNameStart
+}
+
+func lexTableEnd(lx *lexer) stateFn {
+	lx.emit(itemTableEnd)
+	return lexTopEnd
+}
+
+func lexArrayTableEnd(lx *lexer) stateFn {
+	if r := lx.next(); r != arrayTableEnd {
+		return lx.errorf("expected end of table array name delimiter %q, "+
+			"but got %q instead", arrayTableEnd, r)
+	}
+	lx.emit(itemArrayTableEnd)
+	return lexTopEnd
+}
+
+func lexTableNameStart(lx *lexer) stateFn {
+	lx.skip(isWhitespace)
+	switch r := lx.peek(); {
+	case r == tableEnd || r == eof:
+		return lx.errorf("unexpected end of table name " +
+			"(table names cannot be empty)")
+	case r == tableSep:
+		return lx.errorf("unexpected table separator " +
+			"(table names cannot be empty)")
+	case r == stringStart || r == rawStringStart:
+		lx.ignore()
+		lx.push(lexTableNameEnd)
+		return lexValue // reuse string lexing
+	default:
+		return lexBareTableName
+	}
+}
+
+// lexBareTableName lexes the name of a table. It assumes that at least one
+// valid character for the table has already been read.
+func lexBareTableName(lx *lexer) stateFn {
+	r := lx.next()
+	if isBareKeyChar(r) {
+		return lexBareTableName
+	}
+	lx.backup()
+	lx.emit(itemText)
+	return lexTableNameEnd
+}
+
+// lexTableNameEnd reads the end of a piece of a table name, optionally
+// consuming whitespace.
+func lexTableNameEnd(lx *lexer) stateFn {
+	lx.skip(isWhitespace)
+	switch r := lx.next(); {
+	case isWhitespace(r):
+		return lexTableNameEnd
+	case r == tableSep:
+		lx.ignore()
+		return lexTableNameStart
+	case r == tableEnd:
+		return lx.pop()
+	default:
+		return lx.errorf("expected '.' or ']' to end table name, "+
+			"but got %q instead", r)
+	}
+}
+
+// lexKeyStart consumes a key name up until the first non-whitespace character.
+// lexKeyStart will ignore whitespace.
+func lexKeyStart(lx *lexer) stateFn {
+	r := lx.peek()
+	switch {
+	case r == keySep:
+		return lx.errorf("unexpected key separator %q", keySep)
+	case isWhitespace(r) || isNL(r):
+		lx.next()
+		return lexSkip(lx, lexKeyStart)
+	case r == stringStart || r == rawStringStart:
+		lx.ignore()
+		lx.emit(itemKeyStart)
+		lx.push(lexKeyEnd)
+		return lexValue // reuse string lexing
+	default:
+		lx.ignore()
+		lx.emit(itemKeyStart)
+		return lexBareKey
+	}
+}
+
+// lexBareKey consumes the text of a bare key. Assumes that the first character
+// (which is not whitespace) has not yet been consumed.
+func lexBareKey(lx *lexer) stateFn {
+	switch r := lx.next(); {
+	case isBareKeyChar(r):
+		return lexBareKey
+	case isWhitespace(r):
+		lx.backup()
+		lx.emit(itemText)
+		return lexKeyEnd
+	case r == keySep:
+		lx.backup()
+		lx.emit(itemText)
+		return lexKeyEnd
+	default:
+		return lx.errorf("bare keys cannot contain %q", r)
+	}
+}
+
+// lexKeyEnd consumes the end of a key and trims whitespace (up to the key
+// separator).
+func lexKeyEnd(lx *lexer) stateFn {
+	switch r := lx.next(); {
+	case r == keySep:
+		return lexSkip(lx, lexValue)
+	case isWhitespace(r):
+		return lexSkip(lx, lexKeyEnd)
+	default:
+		return lx.errorf("expected key separator %q, but got %q instead",
+			keySep, r)
+	}
+}
+
+// lexValue starts the consumption of a value anywhere a value is expected.
+// lexValue will ignore whitespace.
+// After a value is lexed, the last state on the next is popped and returned.
+func lexValue(lx *lexer) stateFn {
+	// We allow whitespace to precede a value, but NOT newlines.
+	// In array syntax, the array states are responsible for ignoring newlines.
+	r := lx.next()
+	switch {
+	case isWhitespace(r):
+		return lexSkip(lx, lexValue)
+	case isDigit(r):
+		lx.backup() // avoid an extra state and use the same as above
+		return lexNumberOrDateStart
+	}
+	switch r {
+	case arrayStart:
+		lx.ignore()
+		lx.emit(itemArray)
+		return lexArrayValue
+	case inlineTableStart:
+		lx.ignore()
+		lx.emit(itemInlineTableStart)
+		return lexInlineTableValue
+	case stringStart:
+		if lx.accept(stringStart) {
+			if lx.accept(stringStart) {
+				lx.ignore() // Ignore """
+				return lexMultilineString
+			}
+			lx.backup()
+		}
+		lx.ignore() // ignore the '"'
+		return lexString
+	case rawStringStart:
+		if lx.accept(rawStringStart) {
+			if lx.accept(rawStringStart) {
+				lx.ignore() // Ignore """
+				return lexMultilineRawString
+			}
+			lx.backup()
+		}
+		lx.ignore() // ignore the "'"
+		return lexRawString
+	case '+', '-':
+		return lexNumberStart
+	case '.': // special error case, be kind to users
+		return lx.errorf("floats must start with a digit, not '.'")
+	}
+	if unicode.IsLetter(r) {
+		// Be permissive here; lexBool will give a nice error if the
+		// user wrote something like
+		//   x = foo
+		// (i.e. not 'true' or 'false' but is something else word-like.)
+		lx.backup()
+		return lexBool
+	}
+	return lx.errorf("expected value but found %q instead", r)
+}
+
+// lexArrayValue consumes one value in an array. It assumes that '[' or ','
+// have already been consumed. All whitespace and newlines are ignored.
+func lexArrayValue(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case isWhitespace(r) || isNL(r):
+		return lexSkip(lx, lexArrayValue)
+	case r == commentStart:
+		lx.push(lexArrayValue)
+		return lexCommentStart
+	case r == comma:
+		return lx.errorf("unexpected comma")
+	case r == arrayEnd:
+		// NOTE(caleb): The spec isn't clear about whether you can have
+		// a trailing comma or not, so we'll allow it.
+		return lexArrayEnd
+	}
+
+	lx.backup()
+	lx.push(lexArrayValueEnd)
+	return lexValue
+}
+
+// lexArrayValueEnd consumes everything between the end of an array value and
+// the next value (or the end of the array): it ignores whitespace and newlines
+// and expects either a ',' or a ']'.
+func lexArrayValueEnd(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case isWhitespace(r) || isNL(r):
+		return lexSkip(lx, lexArrayValueEnd)
+	case r == commentStart:
+		lx.push(lexArrayValueEnd)
+		return lexCommentStart
+	case r == comma:
+		lx.ignore()
+		return lexArrayValue // move on to the next value
+	case r == arrayEnd:
+		return lexArrayEnd
+	}
+	return lx.errorf(
+		"expected a comma or array terminator %q, but got %q instead",
+		arrayEnd, r,
+	)
+}
+
+// lexArrayEnd finishes the lexing of an array.
+// It assumes that a ']' has just been consumed.
+func lexArrayEnd(lx *lexer) stateFn {
+	lx.ignore()
+	lx.emit(itemArrayEnd)
+	return lx.pop()
+}
+
+// lexInlineTableValue consumes one key/value pair in an inline table.
+// It assumes that '{' or ',' have already been consumed. Whitespace is ignored.
+func lexInlineTableValue(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case isWhitespace(r):
+		return lexSkip(lx, lexInlineTableValue)
+	case isNL(r):
+		return lx.errorf("newlines not allowed within inline tables")
+	case r == commentStart:
+		lx.push(lexInlineTableValue)
+		return lexCommentStart
+	case r == comma:
+		return lx.errorf("unexpected comma")
+	case r == inlineTableEnd:
+		return lexInlineTableEnd
+	}
+	lx.backup()
+	lx.push(lexInlineTableValueEnd)
+	return lexKeyStart
+}
+
+// lexInlineTableValueEnd consumes everything between the end of an inline table
+// key/value pair and the next pair (or the end of the table):
+// it ignores whitespace and expects either a ',' or a '}'.
+func lexInlineTableValueEnd(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case isWhitespace(r):
+		return lexSkip(lx, lexInlineTableValueEnd)
+	case isNL(r):
+		return lx.errorf("newlines not allowed within inline tables")
+	case r == commentStart:
+		lx.push(lexInlineTableValueEnd)
+		return lexCommentStart
+	case r == comma:
+		lx.ignore()
+		return lexInlineTableValue
+	case r == inlineTableEnd:
+		return lexInlineTableEnd
+	}
+	return lx.errorf("expected a comma or an inline table terminator %q, "+
+		"but got %q instead", inlineTableEnd, r)
+}
+
+// lexInlineTableEnd finishes the lexing of an inline table.
+// It assumes that a '}' has just been consumed.
+func lexInlineTableEnd(lx *lexer) stateFn {
+	lx.ignore()
+	lx.emit(itemInlineTableEnd)
+	return lx.pop()
+}
+
+// lexString consumes the inner contents of a string. It assumes that the
+// beginning '"' has already been consumed and ignored.
+func lexString(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case r == eof:
+		return lx.errorf("unexpected EOF")
+	case isNL(r):
+		return lx.errorf("strings cannot contain newlines")
+	case r == '\\':
+		lx.push(lexString)
+		return lexStringEscape
+	case r == stringEnd:
+		lx.backup()
+		lx.emit(itemString)
+		lx.next()
+		lx.ignore()
+		return lx.pop()
+	}
+	return lexString
+}
+
+// lexMultilineString consumes the inner contents of a string. It assumes that
+// the beginning '"""' has already been consumed and ignored.
+func lexMultilineString(lx *lexer) stateFn {
+	switch lx.next() {
+	case eof:
+		return lx.errorf("unexpected EOF")
+	case '\\':
+		return lexMultilineStringEscape
+	case stringEnd:
+		if lx.accept(stringEnd) {
+			if lx.accept(stringEnd) {
+				lx.backup()
+				lx.backup()
+				lx.backup()
+				lx.emit(itemMultilineString)
+				lx.next()
+				lx.next()
+				lx.next()
+				lx.ignore()
+				return lx.pop()
+			}
+			lx.backup()
+		}
+	}
+	return lexMultilineString
+}
+
+// lexRawString consumes a raw string. Nothing can be escaped in such a string.
+// It assumes that the beginning "'" has already been consumed and ignored.
+func lexRawString(lx *lexer) stateFn {
+	r := lx.next()
+	switch {
+	case r == eof:
+		return lx.errorf("unexpected EOF")
+	case isNL(r):
+		return lx.errorf("strings cannot contain newlines")
+	case r == rawStringEnd:
+		lx.backup()
+		lx.emit(itemRawString)
+		lx.next()
+		lx.ignore()
+		return lx.pop()
+	}
+	return lexRawString
+}
+
+// lexMultilineRawString consumes a raw string. Nothing can be escaped in such
+// a string. It assumes that the beginning "'''" has already been consumed and
+// ignored.
+func lexMultilineRawString(lx *lexer) stateFn {
+	switch lx.next() {
+	case eof:
+		return lx.errorf("unexpected EOF")
+	case rawStringEnd:
+		if lx.accept(rawStringEnd) {
+			if lx.accept(rawStringEnd) {
+				lx.backup()
+				lx.backup()
+				lx.backup()
+				lx.emit(itemRawMultilineString)
+				lx.next()
+				lx.next()
+				lx.next()
+				lx.ignore()
+				return lx.pop()
+			}
+			lx.backup()
+		}
+	}
+	return lexMultilineRawString
+}
+
+// lexMultilineStringEscape consumes an escaped character. It assumes that the
+// preceding '\\' has already been consumed.
+func lexMultilineStringEscape(lx *lexer) stateFn {
+	// Handle the special case first:
+	if isNL(lx.next()) {
+		return lexMultilineString
+	}
+	lx.backup()
+	lx.push(lexMultilineString)
+	return lexStringEscape(lx)
+}
+
+func lexStringEscape(lx *lexer) stateFn {
+	r := lx.next()
+	switch r {
+	case 'b':
+		fallthrough
+	case 't':
+		fallthrough
+	case 'n':
+		fallthrough
+	case 'f':
+		fallthrough
+	case 'r':
+		fallthrough
+	case '"':
+		fallthrough
+	case '\\':
+		return lx.pop()
+	case 'u':
+		return lexShortUnicodeEscape
+	case 'U':
+		return lexLongUnicodeEscape
+	}
+	return lx.errorf("invalid escape character %q; only the following "+
+		"escape characters are allowed: "+
+		`\b, \t, \n, \f, \r, \", \\, \uXXXX, and \UXXXXXXXX`, r)
+}
+
+func lexShortUnicodeEscape(lx *lexer) stateFn {
+	var r rune
+	for i := 0; i < 4; i++ {
+		r = lx.next()
+		if !isHexadecimal(r) {
+			return lx.errorf(`expected four hexadecimal digits after '\u', `+
+				"but got %q instead", lx.current())
+		}
+	}
+	return lx.pop()
+}
+
+func lexLongUnicodeEscape(lx *lexer) stateFn {
+	var r rune
+	for i := 0; i < 8; i++ {
+		r = lx.next()
+		if !isHexadecimal(r) {
+			return lx.errorf(`expected eight hexadecimal digits after '\U', `+
+				"but got %q instead", lx.current())
+		}
+	}
+	return lx.pop()
+}
+
+// lexNumberOrDateStart consumes either an integer, a float, or datetime.
+func lexNumberOrDateStart(lx *lexer) stateFn {
+	r := lx.next()
+	if isDigit(r) {
+		return lexNumberOrDate
+	}
+	switch r {
+	case '_':
+		return lexNumber
+	case 'e', 'E':
+		return lexFloat
+	case '.':
+		return lx.errorf("floats must start with a digit, not '.'")
+	}
+	return lx.errorf("expected a digit but got %q", r)
+}
+
+// lexNumberOrDate consumes either an integer, float or datetime.
+func lexNumberOrDate(lx *lexer) stateFn {
+	r := lx.next()
+	if isDigit(r) {
+		return lexNumberOrDate
+	}
+	switch r {
+	case '-':
+		return lexDatetime
+	case '_':
+		return lexNumber
+	case '.', 'e', 'E':
+		return lexFloat
+	}
+
+	lx.backup()
+	lx.emit(itemInteger)
+	return lx.pop()
+}
+
+// lexDatetime consumes a Datetime, to a first approximation.
+// The parser validates that it matches one of the accepted formats.
+func lexDatetime(lx *lexer) stateFn {
+	r := lx.next()
+	if isDigit(r) {
+		return lexDatetime
+	}
+	switch r {
+	case '-', 'T', ':', '.', 'Z', '+':
+		return lexDatetime
+	}
+
+	lx.backup()
+	lx.emit(itemDatetime)
+	return lx.pop()
+}
+
+// lexNumberStart consumes either an integer or a float. It assumes that a sign
+// has already been read, but that *no* digits have been consumed.
+// lexNumberStart will move to the appropriate integer or float states.
+func lexNumberStart(lx *lexer) stateFn {
+	// We MUST see a digit. Even floats have to start with a digit.
+	r := lx.next()
+	if !isDigit(r) {
+		if r == '.' {
+			return lx.errorf("floats must start with a digit, not '.'")
+		}
+		return lx.errorf("expected a digit but got %q", r)
+	}
+	return lexNumber
+}
+
+// lexNumber consumes an integer or a float after seeing the first digit.
+func lexNumber(lx *lexer) stateFn {
+	r := lx.next()
+	if isDigit(r) {
+		return lexNumber
+	}
+	switch r {
+	case '_':
+		return lexNumber
+	case '.', 'e', 'E':
+		return lexFloat
+	}
+
+	lx.backup()
+	lx.emit(itemInteger)
+	return lx.pop()
+}
+
+// lexFloat consumes the elements of a float. It allows any sequence of
+// float-like characters, so floats emitted by the lexer are only a first
+// approximation and must be validated by the parser.
+func lexFloat(lx *lexer) stateFn {
+	r := lx.next()
+	if isDigit(r) {
+		return lexFloat
+	}
+	switch r {
+	case '_', '.', '-', '+', 'e', 'E':
+		return lexFloat
+	}
+
+	lx.backup()
+	lx.emit(itemFloat)
+	return lx.pop()
+}
+
+// lexBool consumes a bool string: 'true' or 'false.
+func lexBool(lx *lexer) stateFn {
+	var rs []rune
+	for {
+		r := lx.next()
+		if !unicode.IsLetter(r) {
+			lx.backup()
+			break
+		}
+		rs = append(rs, r)
+	}
+	s := string(rs)
+	switch s {
+	case "true", "false":
+		lx.emit(itemBool)
+		return lx.pop()
+	}
+	return lx.errorf("expected value but found %q instead", s)
+}
+
+// lexCommentStart begins the lexing of a comment. It will emit
+// itemCommentStart and consume no characters, passing control to lexComment.
+func lexCommentStart(lx *lexer) stateFn {
+	lx.ignore()
+	lx.emit(itemCommentStart)
+	return lexComment
+}
+
+// lexComment lexes an entire comment. It assumes that '#' has been consumed.
+// It will consume *up to* the first newline character, and pass control
+// back to the last state on the stack.
+func lexComment(lx *lexer) stateFn {
+	r := lx.peek()
+	if isNL(r) || r == eof {
+		lx.emit(itemText)
+		return lx.pop()
+	}
+	lx.next()
+	return lexComment
+}
+
+// lexSkip ignores all slurped input and moves on to the next state.
+func lexSkip(lx *lexer, nextState stateFn) stateFn {
+	return func(lx *lexer) stateFn {
+		lx.ignore()
+		return nextState
+	}
+}
+
+// isWhitespace returns true if `r` is a whitespace character according
+// to the spec.
+func isWhitespace(r rune) bool {
+	return r == '\t' || r == ' '
+}
+
+func isNL(r rune) bool {
+	return r == '\n' || r == '\r'
+}
+
+func isDigit(r rune) bool {
+	return r >= '0' && r <= '9'
+}
+
+func isHexadecimal(r rune) bool {
+	return (r >= '0' && r <= '9') ||
+		(r >= 'a' && r <= 'f') ||
+		(r >= 'A' && r <= 'F')
+}
+
+func isBareKeyChar(r rune) bool {
+	return (r >= 'A' && r <= 'Z') ||
+		(r >= 'a' && r <= 'z') ||
+		(r >= '0' && r <= '9') ||
+		r == '_' ||
+		r == '-'
+}
+
+func (itype itemType) String() string {
+	switch itype {
+	case itemError:
+		return "Error"
+	case itemNIL:
+		return "NIL"
+	case itemEOF:
+		return "EOF"
+	case itemText:
+		return "Text"
+	case itemString, itemRawString, itemMultilineString, itemRawMultilineString:
+		return "String"
+	case itemBool:
+		return "Bool"
+	case itemInteger:
+		return "Integer"
+	case itemFloat:
+		return "Float"
+	case itemDatetime:
+		return "DateTime"
+	case itemTableStart:
+		return "TableStart"
+	case itemTableEnd:
+		return "TableEnd"
+	case itemKeyStart:
+		return "KeyStart"
+	case itemArray:
+		return "Array"
+	case itemArrayEnd:
+		return "ArrayEnd"
+	case itemCommentStart:
+		return "CommentStart"
+	}
+	panic(fmt.Sprintf("BUG: Unknown type '%d'.", int(itype)))
+}
+
+func (item item) String() string {
+	return fmt.Sprintf("(%s, %s)", item.typ.String(), item.val)
+}

src/runtime/vendor/github.com/BurntSushi/toml/parse.go

@@ -0,0 +1,592 @@
+package toml
+
+import (
+	"fmt"
+	"strconv"
+	"strings"
+	"time"
+	"unicode"
+	"unicode/utf8"
+)
+
+type parser struct {
+	mapping map[string]interface{}
+	types   map[string]tomlType
+	lx      *lexer
+
+	// A list of keys in the order that they appear in the TOML data.
+	ordered []Key
+
+	// the full key for the current hash in scope
+	context Key
+
+	// the base key name for everything except hashes
+	currentKey string
+
+	// rough approximation of line number
+	approxLine int
+
+	// A map of 'key.group.names' to whether they were created implicitly.
+	implicits map[string]bool
+}
+
+type parseError string
+
+func (pe parseError) Error() string {
+	return string(pe)
+}
+
+func parse(data string) (p *parser, err error) {
+	defer func() {
+		if r := recover(); r != nil {
+			var ok bool
+			if err, ok = r.(parseError); ok {
+				return
+			}
+			panic(r)
+		}
+	}()
+
+	p = &parser{
+		mapping:   make(map[string]interface{}),
+		types:     make(map[string]tomlType),
+		lx:        lex(data),
+		ordered:   make([]Key, 0),
+		implicits: make(map[string]bool),
+	}
+	for {
+		item := p.next()
+		if item.typ == itemEOF {
+			break
+		}
+		p.topLevel(item)
+	}
+
+	return p, nil
+}
+
+func (p *parser) panicf(format string, v ...interface{}) {
+	msg := fmt.Sprintf("Near line %d (last key parsed '%s'): %s",
+		p.approxLine, p.current(), fmt.Sprintf(format, v...))
+	panic(parseError(msg))
+}
+
+func (p *parser) next() item {
+	it := p.lx.nextItem()
+	if it.typ == itemError {
+		p.panicf("%s", it.val)
+	}
+	return it
+}
+
+func (p *parser) bug(format string, v ...interface{}) {
+	panic(fmt.Sprintf("BUG: "+format+"\n\n", v...))
+}
+
+func (p *parser) expect(typ itemType) item {
+	it := p.next()
+	p.assertEqual(typ, it.typ)
+	return it
+}
+
+func (p *parser) assertEqual(expected, got itemType) {
+	if expected != got {
+		p.bug("Expected '%s' but got '%s'.", expected, got)
+	}
+}
+
+func (p *parser) topLevel(item item) {
+	switch item.typ {
+	case itemCommentStart:
+		p.approxLine = item.line
+		p.expect(itemText)
+	case itemTableStart:
+		kg := p.next()
+		p.approxLine = kg.line
+
+		var key Key
+		for ; kg.typ != itemTableEnd && kg.typ != itemEOF; kg = p.next() {
+			key = append(key, p.keyString(kg))
+		}
+		p.assertEqual(itemTableEnd, kg.typ)
+
+		p.establishContext(key, false)
+		p.setType("", tomlHash)
+		p.ordered = append(p.ordered, key)
+	case itemArrayTableStart:
+		kg := p.next()
+		p.approxLine = kg.line
+
+		var key Key
+		for ; kg.typ != itemArrayTableEnd && kg.typ != itemEOF; kg = p.next() {
+			key = append(key, p.keyString(kg))
+		}
+		p.assertEqual(itemArrayTableEnd, kg.typ)
+
+		p.establishContext(key, true)
+		p.setType("", tomlArrayHash)
+		p.ordered = append(p.ordered, key)
+	case itemKeyStart:
+		kname := p.next()
+		p.approxLine = kname.line
+		p.currentKey = p.keyString(kname)
+
+		val, typ := p.value(p.next())
+		p.setValue(p.currentKey, val)
+		p.setType(p.currentKey, typ)
+		p.ordered = append(p.ordered, p.context.add(p.currentKey))
+		p.currentKey = ""
+	default:
+		p.bug("Unexpected type at top level: %s", item.typ)
+	}
+}
+
+// Gets a string for a key (or part of a key in a table name).
+func (p *parser) keyString(it item) string {
+	switch it.typ {
+	case itemText:
+		return it.val
+	case itemString, itemMultilineString,
+		itemRawString, itemRawMultilineString:
+		s, _ := p.value(it)
+		return s.(string)
+	default:
+		p.bug("Unexpected key type: %s", it.typ)
+		panic("unreachable")
+	}
+}
+
+// value translates an expected value from the lexer into a Go value wrapped
+// as an empty interface.
+func (p *parser) value(it item) (interface{}, tomlType) {
+	switch it.typ {
+	case itemString:
+		return p.replaceEscapes(it.val), p.typeOfPrimitive(it)
+	case itemMultilineString:
+		trimmed := stripFirstNewline(stripEscapedWhitespace(it.val))
+		return p.replaceEscapes(trimmed), p.typeOfPrimitive(it)
+	case itemRawString:
+		return it.val, p.typeOfPrimitive(it)
+	case itemRawMultilineString:
+		return stripFirstNewline(it.val), p.typeOfPrimitive(it)
+	case itemBool:
+		switch it.val {
+		case "true":
+			return true, p.typeOfPrimitive(it)
+		case "false":
+			return false, p.typeOfPrimitive(it)
+		}
+		p.bug("Expected boolean value, but got '%s'.", it.val)
+	case itemInteger:
+		if !numUnderscoresOK(it.val) {
+			p.panicf("Invalid integer %q: underscores must be surrounded by digits",
+				it.val)
+		}
+		val := strings.Replace(it.val, "_", "", -1)
+		num, err := strconv.ParseInt(val, 10, 64)
+		if err != nil {
+			// Distinguish integer values. Normally, it'd be a bug if the lexer
+			// provides an invalid integer, but it's possible that the number is
+			// out of range of valid values (which the lexer cannot determine).
+			// So mark the former as a bug but the latter as a legitimate user
+			// error.
+			if e, ok := err.(*strconv.NumError); ok &&
+				e.Err == strconv.ErrRange {
+
+				p.panicf("Integer '%s' is out of the range of 64-bit "+
+					"signed integers.", it.val)
+			} else {
+				p.bug("Expected integer value, but got '%s'.", it.val)
+			}
+		}
+		return num, p.typeOfPrimitive(it)
+	case itemFloat:
+		parts := strings.FieldsFunc(it.val, func(r rune) bool {
+			switch r {
+			case '.', 'e', 'E':
+				return true
+			}
+			return false
+		})
+		for _, part := range parts {
+			if !numUnderscoresOK(part) {
+				p.panicf("Invalid float %q: underscores must be "+
+					"surrounded by digits", it.val)
+			}
+		}
+		if !numPeriodsOK(it.val) {
+			// As a special case, numbers like '123.' or '1.e2',
+			// which are valid as far as Go/strconv are concerned,
+			// must be rejected because TOML says that a fractional
+			// part consists of '.' followed by 1+ digits.
+			p.panicf("Invalid float %q: '.' must be followed "+
+				"by one or more digits", it.val)
+		}
+		val := strings.Replace(it.val, "_", "", -1)
+		num, err := strconv.ParseFloat(val, 64)
+		if err != nil {
+			if e, ok := err.(*strconv.NumError); ok &&
+				e.Err == strconv.ErrRange {
+
+				p.panicf("Float '%s' is out of the range of 64-bit "+
+					"IEEE-754 floating-point numbers.", it.val)
+			} else {
+				p.panicf("Invalid float value: %q", it.val)
+			}
+		}
+		return num, p.typeOfPrimitive(it)
+	case itemDatetime:
+		var t time.Time
+		var ok bool
+		var err error
+		for _, format := range []string{
+			"2006-01-02T15:04:05Z07:00",
+			"2006-01-02T15:04:05",
+			"2006-01-02",
+		} {
+			t, err = time.ParseInLocation(format, it.val, time.Local)
+			if err == nil {
+				ok = true
+				break
+			}
+		}
+		if !ok {
+			p.panicf("Invalid TOML Datetime: %q.", it.val)
+		}
+		return t, p.typeOfPrimitive(it)
+	case itemArray:
+		array := make([]interface{}, 0)
+		types := make([]tomlType, 0)
+
+		for it = p.next(); it.typ != itemArrayEnd; it = p.next() {
+			if it.typ == itemCommentStart {
+				p.expect(itemText)
+				continue
+			}
+
+			val, typ := p.value(it)
+			array = append(array, val)
+			types = append(types, typ)
+		}
+		return array, p.typeOfArray(types)
+	case itemInlineTableStart:
+		var (
+			hash         = make(map[string]interface{})
+			outerContext = p.context
+			outerKey     = p.currentKey
+		)
+
+		p.context = append(p.context, p.currentKey)
+		p.currentKey = ""
+		for it := p.next(); it.typ != itemInlineTableEnd; it = p.next() {
+			if it.typ != itemKeyStart {
+				p.bug("Expected key start but instead found %q, around line %d",
+					it.val, p.approxLine)
+			}
+			if it.typ == itemCommentStart {
+				p.expect(itemText)
+				continue
+			}
+
+			// retrieve key
+			k := p.next()
+			p.approxLine = k.line
+			kname := p.keyString(k)
+
+			// retrieve value
+			p.currentKey = kname
+			val, typ := p.value(p.next())
+			// make sure we keep metadata up to date
+			p.setType(kname, typ)
+			p.ordered = append(p.ordered, p.context.add(p.currentKey))
+			hash[kname] = val
+		}
+		p.context = outerContext
+		p.currentKey = outerKey
+		return hash, tomlHash
+	}
+	p.bug("Unexpected value type: %s", it.typ)
+	panic("unreachable")
+}
+
+// numUnderscoresOK checks whether each underscore in s is surrounded by
+// characters that are not underscores.
+func numUnderscoresOK(s string) bool {
+	accept := false
+	for _, r := range s {
+		if r == '_' {
+			if !accept {
+				return false
+			}
+			accept = false
+			continue
+		}
+		accept = true
+	}
+	return accept
+}
+
+// numPeriodsOK checks whether every period in s is followed by a digit.
+func numPeriodsOK(s string) bool {
+	period := false
+	for _, r := range s {
+		if period && !isDigit(r) {
+			return false
+		}
+		period = r == '.'
+	}
+	return !period
+}
+
+// establishContext sets the current context of the parser,
+// where the context is either a hash or an array of hashes. Which one is
+// set depends on the value of the `array` parameter.
+//
+// Establishing the context also makes sure that the key isn't a duplicate, and
+// will create implicit hashes automatically.
+func (p *parser) establishContext(key Key, array bool) {
+	var ok bool
+
+	// Always start at the top level and drill down for our context.
+	hashContext := p.mapping
+	keyContext := make(Key, 0)
+
+	// We only need implicit hashes for key[0:-1]
+	for _, k := range key[0 : len(key)-1] {
+		_, ok = hashContext[k]
+		keyContext = append(keyContext, k)
+
+		// No key? Make an implicit hash and move on.
+		if !ok {
+			p.addImplicit(keyContext)
+			hashContext[k] = make(map[string]interface{})
+		}
+
+		// If the hash context is actually an array of tables, then set
+		// the hash context to the last element in that array.
+		//
+		// Otherwise, it better be a table, since this MUST be a key group (by
+		// virtue of it not being the last element in a key).
+		switch t := hashContext[k].(type) {
+		case []map[string]interface{}:
+			hashContext = t[len(t)-1]
+		case map[string]interface{}:
+			hashContext = t
+		default:
+			p.panicf("Key '%s' was already created as a hash.", keyContext)
+		}
+	}
+
+	p.context = keyContext
+	if array {
+		// If this is the first element for this array, then allocate a new
+		// list of tables for it.
+		k := key[len(key)-1]
+		if _, ok := hashContext[k]; !ok {
+			hashContext[k] = make([]map[string]interface{}, 0, 5)
+		}
+
+		// Add a new table. But make sure the key hasn't already been used
+		// for something else.
+		if hash, ok := hashContext[k].([]map[string]interface{}); ok {
+			hashContext[k] = append(hash, make(map[string]interface{}))
+		} else {
+			p.panicf("Key '%s' was already created and cannot be used as "+
+				"an array.", keyContext)
+		}
+	} else {
+		p.setValue(key[len(key)-1], make(map[string]interface{}))
+	}
+	p.context = append(p.context, key[len(key)-1])
+}
+
+// setValue sets the given key to the given value in the current context.
+// It will make sure that the key hasn't already been defined, account for
+// implicit key groups.
+func (p *parser) setValue(key string, value interface{}) {
+	var tmpHash interface{}
+	var ok bool
+
+	hash := p.mapping
+	keyContext := make(Key, 0)
+	for _, k := range p.context {
+		keyContext = append(keyContext, k)
+		if tmpHash, ok = hash[k]; !ok {
+			p.bug("Context for key '%s' has not been established.", keyContext)
+		}
+		switch t := tmpHash.(type) {
+		case []map[string]interface{}:
+			// The context is a table of hashes. Pick the most recent table
+			// defined as the current hash.
+			hash = t[len(t)-1]
+		case map[string]interface{}:
+			hash = t
+		default:
+			p.bug("Expected hash to have type 'map[string]interface{}', but "+
+				"it has '%T' instead.", tmpHash)
+		}
+	}
+	keyContext = append(keyContext, key)
+
+	if _, ok := hash[key]; ok {
+		// Typically, if the given key has already been set, then we have
+		// to raise an error since duplicate keys are disallowed. However,
+		// it's possible that a key was previously defined implicitly. In this
+		// case, it is allowed to be redefined concretely. (See the
+		// `tests/valid/implicit-and-explicit-after.toml` test in `toml-test`.)
+		//
+		// But we have to make sure to stop marking it as an implicit. (So that
+		// another redefinition provokes an error.)
+		//
+		// Note that since it has already been defined (as a hash), we don't
+		// want to overwrite it. So our business is done.
+		if p.isImplicit(keyContext) {
+			p.removeImplicit(keyContext)
+			return
+		}
+
+		// Otherwise, we have a concrete key trying to override a previous
+		// key, which is *always* wrong.
+		p.panicf("Key '%s' has already been defined.", keyContext)
+	}
+	hash[key] = value
+}
+
+// setType sets the type of a particular value at a given key.
+// It should be called immediately AFTER setValue.
+//
+// Note that if `key` is empty, then the type given will be applied to the
+// current context (which is either a table or an array of tables).
+func (p *parser) setType(key string, typ tomlType) {
+	keyContext := make(Key, 0, len(p.context)+1)
+	for _, k := range p.context {
+		keyContext = append(keyContext, k)
+	}
+	if len(key) > 0 { // allow type setting for hashes
+		keyContext = append(keyContext, key)
+	}
+	p.types[keyContext.String()] = typ
+}
+
+// addImplicit sets the given Key as having been created implicitly.
+func (p *parser) addImplicit(key Key) {
+	p.implicits[key.String()] = true
+}
+
+// removeImplicit stops tagging the given key as having been implicitly
+// created.
+func (p *parser) removeImplicit(key Key) {
+	p.implicits[key.String()] = false
+}
+
+// isImplicit returns true if the key group pointed to by the key was created
+// implicitly.
+func (p *parser) isImplicit(key Key) bool {
+	return p.implicits[key.String()]
+}
+
+// current returns the full key name of the current context.
+func (p *parser) current() string {
+	if len(p.currentKey) == 0 {
+		return p.context.String()
+	}
+	if len(p.context) == 0 {
+		return p.currentKey
+	}
+	return fmt.Sprintf("%s.%s", p.context, p.currentKey)
+}
+
+func stripFirstNewline(s string) string {
+	if len(s) == 0 || s[0] != '\n' {
+		return s
+	}
+	return s[1:]
+}
+
+func stripEscapedWhitespace(s string) string {
+	esc := strings.Split(s, "\\\n")
+	if len(esc) > 1 {
+		for i := 1; i < len(esc); i++ {
+			esc[i] = strings.TrimLeftFunc(esc[i], unicode.IsSpace)
+		}
+	}
+	return strings.Join(esc, "")
+}
+
+func (p *parser) replaceEscapes(str string) string {
+	var replaced []rune
+	s := []byte(str)
+	r := 0
+	for r < len(s) {
+		if s[r] != '\\' {
+			c, size := utf8.DecodeRune(s[r:])
+			r += size
+			replaced = append(replaced, c)
+			continue
+		}
+		r += 1
+		if r >= len(s) {
+			p.bug("Escape sequence at end of string.")
+			return ""
+		}
+		switch s[r] {
+		default:
+			p.bug("Expected valid escape code after \\, but got %q.", s[r])
+			return ""
+		case 'b':
+			replaced = append(replaced, rune(0x0008))
+			r += 1
+		case 't':
+			replaced = append(replaced, rune(0x0009))
+			r += 1
+		case 'n':
+			replaced = append(replaced, rune(0x000A))
+			r += 1
+		case 'f':
+			replaced = append(replaced, rune(0x000C))
+			r += 1
+		case 'r':
+			replaced = append(replaced, rune(0x000D))
+			r += 1
+		case '"':
+			replaced = append(replaced, rune(0x0022))
+			r += 1
+		case '\\':
+			replaced = append(replaced, rune(0x005C))
+			r += 1
+		case 'u':
+			// At this point, we know we have a Unicode escape of the form
+			// `uXXXX` at [r, r+5). (Because the lexer guarantees this
+			// for us.)
+			escaped := p.asciiEscapeToUnicode(s[r+1 : r+5])
+			replaced = append(replaced, escaped)
+			r += 5
+		case 'U':
+			// At this point, we know we have a Unicode escape of the form
+			// `uXXXX` at [r, r+9). (Because the lexer guarantees this
+			// for us.)
+			escaped := p.asciiEscapeToUnicode(s[r+1 : r+9])
+			replaced = append(replaced, escaped)
+			r += 9
+		}
+	}
+	return string(replaced)
+}
+
+func (p *parser) asciiEscapeToUnicode(bs []byte) rune {
+	s := string(bs)
+	hex, err := strconv.ParseUint(strings.ToLower(s), 16, 32)
+	if err != nil {
+		p.bug("Could not parse '%s' as a hexadecimal number, but the "+
+			"lexer claims it's OK: %s", s, err)
+	}
+	if !utf8.ValidRune(rune(hex)) {
+		p.panicf("Escaped character '\\u%s' is not valid UTF-8.", s)
+	}
+	return rune(hex)
+}
+
+func isStringType(ty itemType) bool {
+	return ty == itemString || ty == itemMultilineString ||
+		ty == itemRawString || ty == itemRawMultilineString
+}

src/runtime/vendor/github.com/BurntSushi/toml/type_check.go

@@ -0,0 +1,91 @@
+package toml
+
+// tomlType represents any Go type that corresponds to a TOML type.
+// While the first draft of the TOML spec has a simplistic type system that
+// probably doesn't need this level of sophistication, we seem to be militating
+// toward adding real composite types.
+type tomlType interface {
+	typeString() string
+}
+
+// typeEqual accepts any two types and returns true if they are equal.
+func typeEqual(t1, t2 tomlType) bool {
+	if t1 == nil || t2 == nil {
+		return false
+	}
+	return t1.typeString() == t2.typeString()
+}
+
+func typeIsHash(t tomlType) bool {
+	return typeEqual(t, tomlHash) || typeEqual(t, tomlArrayHash)
+}
+
+type tomlBaseType string
+
+func (btype tomlBaseType) typeString() string {
+	return string(btype)
+}
+
+func (btype tomlBaseType) String() string {
+	return btype.typeString()
+}
+
+var (
+	tomlInteger   tomlBaseType = "Integer"
+	tomlFloat     tomlBaseType = "Float"
+	tomlDatetime  tomlBaseType = "Datetime"
+	tomlString    tomlBaseType = "String"
+	tomlBool      tomlBaseType = "Bool"
+	tomlArray     tomlBaseType = "Array"
+	tomlHash      tomlBaseType = "Hash"
+	tomlArrayHash tomlBaseType = "ArrayHash"
+)
+
+// typeOfPrimitive returns a tomlType of any primitive value in TOML.
+// Primitive values are: Integer, Float, Datetime, String and Bool.
+//
+// Passing a lexer item other than the following will cause a BUG message
+// to occur: itemString, itemBool, itemInteger, itemFloat, itemDatetime.
+func (p *parser) typeOfPrimitive(lexItem item) tomlType {
+	switch lexItem.typ {
+	case itemInteger:
+		return tomlInteger
+	case itemFloat:
+		return tomlFloat
+	case itemDatetime:
+		return tomlDatetime
+	case itemString:
+		return tomlString
+	case itemMultilineString:
+		return tomlString
+	case itemRawString:
+		return tomlString
+	case itemRawMultilineString:
+		return tomlString
+	case itemBool:
+		return tomlBool
+	}
+	p.bug("Cannot infer primitive type of lex item '%s'.", lexItem)
+	panic("unreachable")
+}
+
+// typeOfArray returns a tomlType for an array given a list of types of its
+// values.
+//
+// In the current spec, if an array is homogeneous, then its type is always
+// "Array". If the array is not homogeneous, an error is generated.
+func (p *parser) typeOfArray(types []tomlType) tomlType {
+	// Empty arrays are cool.
+	if len(types) == 0 {
+		return tomlArray
+	}
+
+	theType := types[0]
+	for _, t := range types[1:] {
+		if !typeEqual(theType, t) {
+			p.panicf("Array contains values of type '%s' and '%s', but "+
+				"arrays must be homogeneous.", theType, t)
+		}
+	}
+	return tomlArray
+}

src/runtime/vendor/github.com/BurntSushi/toml/type_fields.go

@@ -0,0 +1,242 @@
+package toml
+
+// Struct field handling is adapted from code in encoding/json:
+//
+// Copyright 2010 The Go Authors.  All rights reserved.
+// Use of this source code is governed by a BSD-style
+// license that can be found in the Go distribution.
+
+import (
+	"reflect"
+	"sort"
+	"sync"
+)
+
+// A field represents a single field found in a struct.
+type field struct {
+	name  string       // the name of the field (`toml` tag included)
+	tag   bool         // whether field has a `toml` tag
+	index []int        // represents the depth of an anonymous field
+	typ   reflect.Type // the type of the field
+}
+
+// byName sorts field by name, breaking ties with depth,
+// then breaking ties with "name came from toml tag", then
+// breaking ties with index sequence.
+type byName []field
+
+func (x byName) Len() int { return len(x) }
+
+func (x byName) Swap(i, j int) { x[i], x[j] = x[j], x[i] }
+
+func (x byName) Less(i, j int) bool {
+	if x[i].name != x[j].name {
+		return x[i].name < x[j].name
+	}
+	if len(x[i].index) != len(x[j].index) {
+		return len(x[i].index) < len(x[j].index)
+	}
+	if x[i].tag != x[j].tag {
+		return x[i].tag
+	}
+	return byIndex(x).Less(i, j)
+}
+
+// byIndex sorts field by index sequence.
+type byIndex []field
+
+func (x byIndex) Len() int { return len(x) }
+
+func (x byIndex) Swap(i, j int) { x[i], x[j] = x[j], x[i] }
+
+func (x byIndex) Less(i, j int) bool {
+	for k, xik := range x[i].index {
+		if k >= len(x[j].index) {
+			return false
+		}
+		if xik != x[j].index[k] {
+			return xik < x[j].index[k]
+		}
+	}
+	return len(x[i].index) < len(x[j].index)
+}
+
+// typeFields returns a list of fields that TOML should recognize for the given
+// type. The algorithm is breadth-first search over the set of structs to
+// include - the top struct and then any reachable anonymous structs.
+func typeFields(t reflect.Type) []field {
+	// Anonymous fields to explore at the current level and the next.
+	current := []field{}
+	next := []field{{typ: t}}
+
+	// Count of queued names for current level and the next.
+	count := map[reflect.Type]int{}
+	nextCount := map[reflect.Type]int{}
+
+	// Types already visited at an earlier level.
+	visited := map[reflect.Type]bool{}
+
+	// Fields found.
+	var fields []field
+
+	for len(next) > 0 {
+		current, next = next, current[:0]
+		count, nextCount = nextCount, map[reflect.Type]int{}
+
+		for _, f := range current {
+			if visited[f.typ] {
+				continue
+			}
+			visited[f.typ] = true
+
+			// Scan f.typ for fields to include.
+			for i := 0; i < f.typ.NumField(); i++ {
+				sf := f.typ.Field(i)
+				if sf.PkgPath != "" && !sf.Anonymous { // unexported
+					continue
+				}
+				opts := getOptions(sf.Tag)
+				if opts.skip {
+					continue
+				}
+				index := make([]int, len(f.index)+1)
+				copy(index, f.index)
+				index[len(f.index)] = i
+
+				ft := sf.Type
+				if ft.Name() == "" && ft.Kind() == reflect.Ptr {
+					// Follow pointer.
+					ft = ft.Elem()
+				}
+
+				// Record found field and index sequence.
+				if opts.name != "" || !sf.Anonymous || ft.Kind() != reflect.Struct {
+					tagged := opts.name != ""
+					name := opts.name
+					if name == "" {
+						name = sf.Name
+					}
+					fields = append(fields, field{name, tagged, index, ft})
+					if count[f.typ] > 1 {
+						// If there were multiple instances, add a second,
+						// so that the annihilation code will see a duplicate.
+						// It only cares about the distinction between 1 or 2,
+						// so don't bother generating any more copies.
+						fields = append(fields, fields[len(fields)-1])
+					}
+					continue
+				}
+
+				// Record new anonymous struct to explore in next round.
+				nextCount[ft]++
+				if nextCount[ft] == 1 {
+					f := field{name: ft.Name(), index: index, typ: ft}
+					next = append(next, f)
+				}
+			}
+		}
+	}
+
+	sort.Sort(byName(fields))
+
+	// Delete all fields that are hidden by the Go rules for embedded fields,
+	// except that fields with TOML tags are promoted.
+
+	// The fields are sorted in primary order of name, secondary order
+	// of field index length. Loop over names; for each name, delete
+	// hidden fields by choosing the one dominant field that survives.
+	out := fields[:0]
+	for advance, i := 0, 0; i < len(fields); i += advance {
+		// One iteration per name.
+		// Find the sequence of fields with the name of this first field.
+		fi := fields[i]
+		name := fi.name
+		for advance = 1; i+advance < len(fields); advance++ {
+			fj := fields[i+advance]
+			if fj.name != name {
+				break
+			}
+		}
+		if advance == 1 { // Only one field with this name
+			out = append(out, fi)
+			continue
+		}
+		dominant, ok := dominantField(fields[i : i+advance])
+		if ok {
+			out = append(out, dominant)
+		}
+	}
+
+	fields = out
+	sort.Sort(byIndex(fields))
+
+	return fields
+}
+
+// dominantField looks through the fields, all of which are known to
+// have the same name, to find the single field that dominates the
+// others using Go's embedding rules, modified by the presence of
+// TOML tags. If there are multiple top-level fields, the boolean
+// will be false: This condition is an error in Go and we skip all
+// the fields.
+func dominantField(fields []field) (field, bool) {
+	// The fields are sorted in increasing index-length order. The winner
+	// must therefore be one with the shortest index length. Drop all
+	// longer entries, which is easy: just truncate the slice.
+	length := len(fields[0].index)
+	tagged := -1 // Index of first tagged field.
+	for i, f := range fields {
+		if len(f.index) > length {
+			fields = fields[:i]
+			break
+		}
+		if f.tag {
+			if tagged >= 0 {
+				// Multiple tagged fields at the same level: conflict.
+				// Return no field.
+				return field{}, false
+			}
+			tagged = i
+		}
+	}
+	if tagged >= 0 {
+		return fields[tagged], true
+	}
+	// All remaining fields have the same length. If there's more than one,
+	// we have a conflict (two fields named "X" at the same level) and we
+	// return no field.
+	if len(fields) > 1 {
+		return field{}, false
+	}
+	return fields[0], true
+}
+
+var fieldCache struct {
+	sync.RWMutex
+	m map[reflect.Type][]field
+}
+
+// cachedTypeFields is like typeFields but uses a cache to avoid repeated work.
+func cachedTypeFields(t reflect.Type) []field {
+	fieldCache.RLock()
+	f := fieldCache.m[t]
+	fieldCache.RUnlock()
+	if f != nil {
+		return f
+	}
+
+	// Compute fields without lock.
+	// Might duplicate effort but won't hold other computations back.
+	f = typeFields(t)
+	if f == nil {
+		f = []field{}
+	}
+
+	fieldCache.Lock()
+	if fieldCache.m == nil {
+		fieldCache.m = map[reflect.Type][]field{}
+	}
+	fieldCache.m[t] = f
+	fieldCache.Unlock()
+	return f
+}

src/runtime/vendor/github.com/Microsoft/go-winio/LICENSE

@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+

src/runtime/vendor/github.com/Microsoft/go-winio/archive/tar/LICENSE

@@ -0,0 +1,27 @@
+Copyright (c) 2012 The Go Authors. All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are
+met:
+
+   * Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+   * Redistributions in binary form must reproduce the above
+copyright notice, this list of conditions and the following disclaimer
+in the documentation and/or other materials provided with the
+distribution.
+   * Neither the name of Google Inc. nor the names of its
+contributors may be used to endorse or promote products derived from
+this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

src/runtime/vendor/github.com/Microsoft/go-winio/backup.go

@@ -0,0 +1,280 @@
+// +build windows
+
+package winio
+
+import (
+	"encoding/binary"
+	"errors"
+	"fmt"
+	"io"
+	"io/ioutil"
+	"os"
+	"runtime"
+	"syscall"
+	"unicode/utf16"
+)
+
+//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
+//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
+
+const (
+	BackupData = uint32(iota + 1)
+	BackupEaData
+	BackupSecurity
+	BackupAlternateData
+	BackupLink
+	BackupPropertyData
+	BackupObjectId
+	BackupReparseData
+	BackupSparseBlock
+	BackupTxfsData
+)
+
+const (
+	StreamSparseAttributes = uint32(8)
+)
+
+const (
+	WRITE_DAC              = 0x40000
+	WRITE_OWNER            = 0x80000
+	ACCESS_SYSTEM_SECURITY = 0x1000000
+)
+
+// BackupHeader represents a backup stream of a file.
+type BackupHeader struct {
+	Id         uint32 // The backup stream ID
+	Attributes uint32 // Stream attributes
+	Size       int64  // The size of the stream in bytes
+	Name       string // The name of the stream (for BackupAlternateData only).
+	Offset     int64  // The offset of the stream in the file (for BackupSparseBlock only).
+}
+
+type win32StreamId struct {
+	StreamId   uint32
+	Attributes uint32
+	Size       uint64
+	NameSize   uint32
+}
+
+// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
+// of BackupHeader values.
+type BackupStreamReader struct {
+	r         io.Reader
+	bytesLeft int64
+}
+
+// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
+func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
+	return &BackupStreamReader{r, 0}
+}
+
+// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
+// it was not completely read.
+func (r *BackupStreamReader) Next() (*BackupHeader, error) {
+	if r.bytesLeft > 0 {
+		if s, ok := r.r.(io.Seeker); ok {
+			// Make sure Seek on io.SeekCurrent sometimes succeeds
+			// before trying the actual seek.
+			if _, err := s.Seek(0, io.SeekCurrent); err == nil {
+				if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
+					return nil, err
+				}
+				r.bytesLeft = 0
+			}
+		}
+		if _, err := io.Copy(ioutil.Discard, r); err != nil {
+			return nil, err
+		}
+	}
+	var wsi win32StreamId
+	if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
+		return nil, err
+	}
+	hdr := &BackupHeader{
+		Id:         wsi.StreamId,
+		Attributes: wsi.Attributes,
+		Size:       int64(wsi.Size),
+	}
+	if wsi.NameSize != 0 {
+		name := make([]uint16, int(wsi.NameSize/2))
+		if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
+			return nil, err
+		}
+		hdr.Name = syscall.UTF16ToString(name)
+	}
+	if wsi.StreamId == BackupSparseBlock {
+		if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
+			return nil, err
+		}
+		hdr.Size -= 8
+	}
+	r.bytesLeft = hdr.Size
+	return hdr, nil
+}
+
+// Read reads from the current backup stream.
+func (r *BackupStreamReader) Read(b []byte) (int, error) {
+	if r.bytesLeft == 0 {
+		return 0, io.EOF
+	}
+	if int64(len(b)) > r.bytesLeft {
+		b = b[:r.bytesLeft]
+	}
+	n, err := r.r.Read(b)
+	r.bytesLeft -= int64(n)
+	if err == io.EOF {
+		err = io.ErrUnexpectedEOF
+	} else if r.bytesLeft == 0 && err == nil {
+		err = io.EOF
+	}
+	return n, err
+}
+
+// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
+type BackupStreamWriter struct {
+	w         io.Writer
+	bytesLeft int64
+}
+
+// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
+func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
+	return &BackupStreamWriter{w, 0}
+}
+
+// WriteHeader writes the next backup stream header and prepares for calls to Write().
+func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
+	if w.bytesLeft != 0 {
+		return fmt.Errorf("missing %d bytes", w.bytesLeft)
+	}
+	name := utf16.Encode([]rune(hdr.Name))
+	wsi := win32StreamId{
+		StreamId:   hdr.Id,
+		Attributes: hdr.Attributes,
+		Size:       uint64(hdr.Size),
+		NameSize:   uint32(len(name) * 2),
+	}
+	if hdr.Id == BackupSparseBlock {
+		// Include space for the int64 block offset
+		wsi.Size += 8
+	}
+	if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
+		return err
+	}
+	if len(name) != 0 {
+		if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
+			return err
+		}
+	}
+	if hdr.Id == BackupSparseBlock {
+		if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
+			return err
+		}
+	}
+	w.bytesLeft = hdr.Size
+	return nil
+}
+
+// Write writes to the current backup stream.
+func (w *BackupStreamWriter) Write(b []byte) (int, error) {
+	if w.bytesLeft < int64(len(b)) {
+		return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
+	}
+	n, err := w.w.Write(b)
+	w.bytesLeft -= int64(n)
+	return n, err
+}
+
+// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
+type BackupFileReader struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
+// Read will attempt to read the security descriptor of the file.
+func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
+	r := &BackupFileReader{f, includeSecurity, 0}
+	return r
+}
+
+// Read reads a backup stream from the file by calling the Win32 API BackupRead().
+func (r *BackupFileReader) Read(b []byte) (int, error) {
+	var bytesRead uint32
+	err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupRead", r.f.Name(), err}
+	}
+	runtime.KeepAlive(r.f)
+	if bytesRead == 0 {
+		return 0, io.EOF
+	}
+	return int(bytesRead), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileReader. It does not close
+// the underlying file.
+func (r *BackupFileReader) Close() error {
+	if r.ctx != 0 {
+		backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
+		runtime.KeepAlive(r.f)
+		r.ctx = 0
+	}
+	return nil
+}
+
+// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
+type BackupFileWriter struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
+// Write() will attempt to restore the security descriptor from the stream.
+func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
+	w := &BackupFileWriter{f, includeSecurity, 0}
+	return w
+}
+
+// Write restores a portion of the file using the provided backup stream.
+func (w *BackupFileWriter) Write(b []byte) (int, error) {
+	var bytesWritten uint32
+	err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
+	}
+	runtime.KeepAlive(w.f)
+	if int(bytesWritten) != len(b) {
+		return int(bytesWritten), errors.New("not all bytes could be written")
+	}
+	return len(b), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileWriter. It does not
+// close the underlying file.
+func (w *BackupFileWriter) Close() error {
+	if w.ctx != 0 {
+		backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
+		runtime.KeepAlive(w.f)
+		w.ctx = 0
+	}
+	return nil
+}
+
+// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
+// or restore privileges have been acquired.
+//
+// If the file opened was a directory, it cannot be used with Readdir().
+func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
+	winPath, err := syscall.UTF16FromString(path)
+	if err != nil {
+		return nil, err
+	}
+	h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: path, Err: err}
+		return nil, err
+	}
+	return os.NewFile(uintptr(h), path), nil
+}

src/runtime/vendor/github.com/Microsoft/go-winio/ea.go

@@ -0,0 +1,137 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"errors"
+)
+
+type fileFullEaInformation struct {
+	NextEntryOffset uint32
+	Flags           uint8
+	NameLength      uint8
+	ValueLength     uint16
+}
+
+var (
+	fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
+
+	errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
+	errEaNameTooLarge  = errors.New("extended attribute name too large")
+	errEaValueTooLarge = errors.New("extended attribute value too large")
+)
+
+// ExtendedAttribute represents a single Windows EA.
+type ExtendedAttribute struct {
+	Name  string
+	Value []byte
+	Flags uint8
+}
+
+func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
+	var info fileFullEaInformation
+	err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
+	if err != nil {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	nameOffset := fileFullEaInformationSize
+	nameLen := int(info.NameLength)
+	valueOffset := nameOffset + int(info.NameLength) + 1
+	valueLen := int(info.ValueLength)
+	nextOffset := int(info.NextEntryOffset)
+	if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	ea.Name = string(b[nameOffset : nameOffset+nameLen])
+	ea.Value = b[valueOffset : valueOffset+valueLen]
+	ea.Flags = info.Flags
+	if info.NextEntryOffset != 0 {
+		nb = b[info.NextEntryOffset:]
+	}
+	return
+}
+
+// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
+// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
+func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
+	for len(b) != 0 {
+		ea, nb, err := parseEa(b)
+		if err != nil {
+			return nil, err
+		}
+
+		eas = append(eas, ea)
+		b = nb
+	}
+	return
+}
+
+func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
+	if int(uint8(len(ea.Name))) != len(ea.Name) {
+		return errEaNameTooLarge
+	}
+	if int(uint16(len(ea.Value))) != len(ea.Value) {
+		return errEaValueTooLarge
+	}
+	entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
+	withPadding := (entrySize + 3) &^ 3
+	nextOffset := uint32(0)
+	if !last {
+		nextOffset = withPadding
+	}
+	info := fileFullEaInformation{
+		NextEntryOffset: nextOffset,
+		Flags:           ea.Flags,
+		NameLength:      uint8(len(ea.Name)),
+		ValueLength:     uint16(len(ea.Value)),
+	}
+
+	err := binary.Write(buf, binary.LittleEndian, &info)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte(ea.Name))
+	if err != nil {
+		return err
+	}
+
+	err = buf.WriteByte(0)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write(ea.Value)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
+// buffer for use with BackupWrite, ZwSetEaFile, etc.
+func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
+	var buf bytes.Buffer
+	for i := range eas {
+		last := false
+		if i == len(eas)-1 {
+			last = true
+		}
+
+		err := writeEa(&buf, &eas[i], last)
+		if err != nil {
+			return nil, err
+		}
+	}
+	return buf.Bytes(), nil
+}

src/runtime/vendor/github.com/Microsoft/go-winio/file.go

@@ -0,0 +1,307 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"runtime"
+	"sync"
+	"sync/atomic"
+	"syscall"
+	"time"
+)
+
+//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
+//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
+//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
+//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
+
+type atomicBool int32
+
+func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
+func (b *atomicBool) setFalse()   { atomic.StoreInt32((*int32)(b), 0) }
+func (b *atomicBool) setTrue()    { atomic.StoreInt32((*int32)(b), 1) }
+func (b *atomicBool) swap(new bool) bool {
+	var newInt int32
+	if new {
+		newInt = 1
+	}
+	return atomic.SwapInt32((*int32)(b), newInt) == 1
+}
+
+const (
+	cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
+	cFILE_SKIP_SET_EVENT_ON_HANDLE        = 2
+)
+
+var (
+	ErrFileClosed = errors.New("file has already been closed")
+	ErrTimeout    = &timeoutError{}
+)
+
+type timeoutError struct{}
+
+func (e *timeoutError) Error() string   { return "i/o timeout" }
+func (e *timeoutError) Timeout() bool   { return true }
+func (e *timeoutError) Temporary() bool { return true }
+
+type timeoutChan chan struct{}
+
+var ioInitOnce sync.Once
+var ioCompletionPort syscall.Handle
+
+// ioResult contains the result of an asynchronous IO operation
+type ioResult struct {
+	bytes uint32
+	err   error
+}
+
+// ioOperation represents an outstanding asynchronous Win32 IO
+type ioOperation struct {
+	o  syscall.Overlapped
+	ch chan ioResult
+}
+
+func initIo() {
+	h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
+	if err != nil {
+		panic(err)
+	}
+	ioCompletionPort = h
+	go ioCompletionProcessor(h)
+}
+
+// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
+// It takes ownership of this handle and will close it if it is garbage collected.
+type win32File struct {
+	handle        syscall.Handle
+	wg            sync.WaitGroup
+	wgLock        sync.RWMutex
+	closing       atomicBool
+	readDeadline  deadlineHandler
+	writeDeadline deadlineHandler
+}
+
+type deadlineHandler struct {
+	setLock     sync.Mutex
+	channel     timeoutChan
+	channelLock sync.RWMutex
+	timer       *time.Timer
+	timedout    atomicBool
+}
+
+// makeWin32File makes a new win32File from an existing file handle
+func makeWin32File(h syscall.Handle) (*win32File, error) {
+	f := &win32File{handle: h}
+	ioInitOnce.Do(initIo)
+	_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
+	if err != nil {
+		return nil, err
+	}
+	err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
+	if err != nil {
+		return nil, err
+	}
+	f.readDeadline.channel = make(timeoutChan)
+	f.writeDeadline.channel = make(timeoutChan)
+	return f, nil
+}
+
+func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
+	return makeWin32File(h)
+}
+
+// closeHandle closes the resources associated with a Win32 handle
+func (f *win32File) closeHandle() {
+	f.wgLock.Lock()
+	// Atomically set that we are closing, releasing the resources only once.
+	if !f.closing.swap(true) {
+		f.wgLock.Unlock()
+		// cancel all IO and wait for it to complete
+		cancelIoEx(f.handle, nil)
+		f.wg.Wait()
+		// at this point, no new IO can start
+		syscall.Close(f.handle)
+		f.handle = 0
+	} else {
+		f.wgLock.Unlock()
+	}
+}
+
+// Close closes a win32File.
+func (f *win32File) Close() error {
+	f.closeHandle()
+	return nil
+}
+
+// prepareIo prepares for a new IO operation.
+// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
+func (f *win32File) prepareIo() (*ioOperation, error) {
+	f.wgLock.RLock()
+	if f.closing.isSet() {
+		f.wgLock.RUnlock()
+		return nil, ErrFileClosed
+	}
+	f.wg.Add(1)
+	f.wgLock.RUnlock()
+	c := &ioOperation{}
+	c.ch = make(chan ioResult)
+	return c, nil
+}
+
+// ioCompletionProcessor processes completed async IOs forever
+func ioCompletionProcessor(h syscall.Handle) {
+	for {
+		var bytes uint32
+		var key uintptr
+		var op *ioOperation
+		err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
+		if op == nil {
+			panic(err)
+		}
+		op.ch <- ioResult{bytes, err}
+	}
+}
+
+// asyncIo processes the return value from ReadFile or WriteFile, blocking until
+// the operation has actually completed.
+func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
+	if err != syscall.ERROR_IO_PENDING {
+		return int(bytes), err
+	}
+
+	if f.closing.isSet() {
+		cancelIoEx(f.handle, &c.o)
+	}
+
+	var timeout timeoutChan
+	if d != nil {
+		d.channelLock.Lock()
+		timeout = d.channel
+		d.channelLock.Unlock()
+	}
+
+	var r ioResult
+	select {
+	case r = <-c.ch:
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			if f.closing.isSet() {
+				err = ErrFileClosed
+			}
+		}
+	case <-timeout:
+		cancelIoEx(f.handle, &c.o)
+		r = <-c.ch
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			err = ErrTimeout
+		}
+	}
+
+	// runtime.KeepAlive is needed, as c is passed via native
+	// code to ioCompletionProcessor, c must remain alive
+	// until the channel read is complete.
+	runtime.KeepAlive(c)
+	return int(r.bytes), err
+}
+
+// Read reads from a file handle.
+func (f *win32File) Read(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.readDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
+	runtime.KeepAlive(b)
+
+	// Handle EOF conditions.
+	if err == nil && n == 0 && len(b) != 0 {
+		return 0, io.EOF
+	} else if err == syscall.ERROR_BROKEN_PIPE {
+		return 0, io.EOF
+	} else {
+		return n, err
+	}
+}
+
+// Write writes to a file handle.
+func (f *win32File) Write(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.writeDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
+	runtime.KeepAlive(b)
+	return n, err
+}
+
+func (f *win32File) SetReadDeadline(deadline time.Time) error {
+	return f.readDeadline.set(deadline)
+}
+
+func (f *win32File) SetWriteDeadline(deadline time.Time) error {
+	return f.writeDeadline.set(deadline)
+}
+
+func (f *win32File) Flush() error {
+	return syscall.FlushFileBuffers(f.handle)
+}
+
+func (d *deadlineHandler) set(deadline time.Time) error {
+	d.setLock.Lock()
+	defer d.setLock.Unlock()
+
+	if d.timer != nil {
+		if !d.timer.Stop() {
+			<-d.channel
+		}
+		d.timer = nil
+	}
+	d.timedout.setFalse()
+
+	select {
+	case <-d.channel:
+		d.channelLock.Lock()
+		d.channel = make(chan struct{})
+		d.channelLock.Unlock()
+	default:
+	}
+
+	if deadline.IsZero() {
+		return nil
+	}
+
+	timeoutIO := func() {
+		d.timedout.setTrue()
+		close(d.channel)
+	}
+
+	now := time.Now()
+	duration := deadline.Sub(now)
+	if deadline.After(now) {
+		// Deadline is in the future, set a timer to wait
+		d.timer = time.AfterFunc(duration, timeoutIO)
+	} else {
+		// Deadline is in the past. Cancel all pending IO now.
+		timeoutIO()
+	}
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/go-winio/fileinfo.go

@@ -0,0 +1,61 @@
+// +build windows
+
+package winio
+
+import (
+	"os"
+	"runtime"
+	"syscall"
+	"unsafe"
+)
+
+//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
+//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
+
+const (
+	fileBasicInfo = 0
+	fileIDInfo    = 0x12
+)
+
+// FileBasicInfo contains file access time and file attributes information.
+type FileBasicInfo struct {
+	CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
+	FileAttributes                                          uint32
+	pad                                                     uint32 // padding
+}
+
+// GetFileBasicInfo retrieves times and attributes for a file.
+func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
+	bi := &FileBasicInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return bi, nil
+}
+
+// SetFileBasicInfo sets times and attributes for a file.
+func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
+	if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return nil
+}
+
+// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
+// unique on a system.
+type FileIDInfo struct {
+	VolumeSerialNumber uint64
+	FileID             [16]byte
+}
+
+// GetFileID retrieves the unique (volume, file ID) pair for a file.
+func GetFileID(f *os.File) (*FileIDInfo, error) {
+	fileID := &FileIDInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return fileID, nil
+}

src/runtime/vendor/github.com/Microsoft/go-winio/pipe.go

@@ -0,0 +1,421 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"net"
+	"os"
+	"syscall"
+	"time"
+	"unsafe"
+)
+
+//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
+//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error)  [failretval==syscall.InvalidHandle] = CreateNamedPipeW
+//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
+//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
+//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
+//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
+
+const (
+	cERROR_PIPE_BUSY      = syscall.Errno(231)
+	cERROR_NO_DATA        = syscall.Errno(232)
+	cERROR_PIPE_CONNECTED = syscall.Errno(535)
+	cERROR_SEM_TIMEOUT    = syscall.Errno(121)
+
+	cPIPE_ACCESS_DUPLEX            = 0x3
+	cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
+	cSECURITY_SQOS_PRESENT         = 0x100000
+	cSECURITY_ANONYMOUS            = 0
+
+	cPIPE_REJECT_REMOTE_CLIENTS = 0x8
+
+	cPIPE_UNLIMITED_INSTANCES = 255
+
+	cNMPWAIT_USE_DEFAULT_WAIT = 0
+	cNMPWAIT_NOWAIT           = 1
+
+	cPIPE_TYPE_MESSAGE = 4
+
+	cPIPE_READMODE_MESSAGE = 2
+)
+
+var (
+	// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
+	// This error should match net.errClosing since docker takes a dependency on its text.
+	ErrPipeListenerClosed = errors.New("use of closed network connection")
+
+	errPipeWriteClosed = errors.New("pipe has been closed for write")
+)
+
+type win32Pipe struct {
+	*win32File
+	path string
+}
+
+type win32MessageBytePipe struct {
+	win32Pipe
+	writeClosed bool
+	readEOF     bool
+}
+
+type pipeAddress string
+
+func (f *win32Pipe) LocalAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) RemoteAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) SetDeadline(t time.Time) error {
+	f.SetReadDeadline(t)
+	f.SetWriteDeadline(t)
+	return nil
+}
+
+// CloseWrite closes the write side of a message pipe in byte mode.
+func (f *win32MessageBytePipe) CloseWrite() error {
+	if f.writeClosed {
+		return errPipeWriteClosed
+	}
+	err := f.win32File.Flush()
+	if err != nil {
+		return err
+	}
+	_, err = f.win32File.Write(nil)
+	if err != nil {
+		return err
+	}
+	f.writeClosed = true
+	return nil
+}
+
+// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
+// they are used to implement CloseWrite().
+func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
+	if f.writeClosed {
+		return 0, errPipeWriteClosed
+	}
+	if len(b) == 0 {
+		return 0, nil
+	}
+	return f.win32File.Write(b)
+}
+
+// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
+// mode pipe will return io.EOF, as will all subsequent reads.
+func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
+	if f.readEOF {
+		return 0, io.EOF
+	}
+	n, err := f.win32File.Read(b)
+	if err == io.EOF {
+		// If this was the result of a zero-byte read, then
+		// it is possible that the read was due to a zero-size
+		// message. Since we are simulating CloseWrite with a
+		// zero-byte message, ensure that all future Read() calls
+		// also return EOF.
+		f.readEOF = true
+	} else if err == syscall.ERROR_MORE_DATA {
+		// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
+		// and the message still has more bytes. Treat this as a success, since
+		// this package presents all named pipes as byte streams.
+		err = nil
+	}
+	return n, err
+}
+
+func (s pipeAddress) Network() string {
+	return "pipe"
+}
+
+func (s pipeAddress) String() string {
+	return string(s)
+}
+
+// DialPipe connects to a named pipe by path, timing out if the connection
+// takes longer than the specified duration. If timeout is nil, then we use
+// a default timeout of 5 seconds.  (We do not use WaitNamedPipe.)
+func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
+	var absTimeout time.Time
+	if timeout != nil {
+		absTimeout = time.Now().Add(*timeout)
+	} else {
+		absTimeout = time.Now().Add(time.Second * 2)
+	}
+	var err error
+	var h syscall.Handle
+	for {
+		h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+		if err != cERROR_PIPE_BUSY {
+			break
+		}
+		if time.Now().After(absTimeout) {
+			return nil, ErrTimeout
+		}
+
+		// Wait 10 msec and try again. This is a rather simplistic
+		// view, as we always try each 10 milliseconds.
+		time.Sleep(time.Millisecond * 10)
+	}
+	if err != nil {
+		return nil, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+
+	var flags uint32
+	err = getNamedPipeInfo(h, &flags, nil, nil, nil)
+	if err != nil {
+		return nil, err
+	}
+
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+
+	// If the pipe is in message mode, return a message byte pipe, which
+	// supports CloseWrite().
+	if flags&cPIPE_TYPE_MESSAGE != 0 {
+		return &win32MessageBytePipe{
+			win32Pipe: win32Pipe{win32File: f, path: path},
+		}, nil
+	}
+	return &win32Pipe{win32File: f, path: path}, nil
+}
+
+type acceptResponse struct {
+	f   *win32File
+	err error
+}
+
+type win32PipeListener struct {
+	firstHandle        syscall.Handle
+	path               string
+	securityDescriptor []byte
+	config             PipeConfig
+	acceptCh           chan (chan acceptResponse)
+	closeCh            chan int
+	doneCh             chan int
+}
+
+func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
+	var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
+	if first {
+		flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
+	}
+
+	var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
+	if c.MessageMode {
+		mode |= cPIPE_TYPE_MESSAGE
+	}
+
+	sa := &syscall.SecurityAttributes{}
+	sa.Length = uint32(unsafe.Sizeof(*sa))
+	if securityDescriptor != nil {
+		len := uint32(len(securityDescriptor))
+		sa.SecurityDescriptor = localAlloc(0, len)
+		defer localFree(sa.SecurityDescriptor)
+		copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
+	}
+	h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
+	if err != nil {
+		return 0, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+	return h, nil
+}
+
+func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
+	h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
+	if err != nil {
+		return nil, err
+	}
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	return f, nil
+}
+
+func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
+	p, err := l.makeServerPipe()
+	if err != nil {
+		return nil, err
+	}
+
+	// Wait for the client to connect.
+	ch := make(chan error)
+	go func(p *win32File) {
+		ch <- connectPipe(p)
+	}(p)
+
+	select {
+	case err = <-ch:
+		if err != nil {
+			p.Close()
+			p = nil
+		}
+	case <-l.closeCh:
+		// Abort the connect request by closing the handle.
+		p.Close()
+		p = nil
+		err = <-ch
+		if err == nil || err == ErrFileClosed {
+			err = ErrPipeListenerClosed
+		}
+	}
+	return p, err
+}
+
+func (l *win32PipeListener) listenerRoutine() {
+	closed := false
+	for !closed {
+		select {
+		case <-l.closeCh:
+			closed = true
+		case responseCh := <-l.acceptCh:
+			var (
+				p   *win32File
+				err error
+			)
+			for {
+				p, err = l.makeConnectedServerPipe()
+				// If the connection was immediately closed by the client, try
+				// again.
+				if err != cERROR_NO_DATA {
+					break
+				}
+			}
+			responseCh <- acceptResponse{p, err}
+			closed = err == ErrPipeListenerClosed
+		}
+	}
+	syscall.Close(l.firstHandle)
+	l.firstHandle = 0
+	// Notify Close() and Accept() callers that the handle has been closed.
+	close(l.doneCh)
+}
+
+// PipeConfig contain configuration for the pipe listener.
+type PipeConfig struct {
+	// SecurityDescriptor contains a Windows security descriptor in SDDL format.
+	SecurityDescriptor string
+
+	// MessageMode determines whether the pipe is in byte or message mode. In either
+	// case the pipe is read in byte mode by default. The only practical difference in
+	// this implementation is that CloseWrite() is only supported for message mode pipes;
+	// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
+	// transferred to the reader (and returned as io.EOF in this implementation)
+	// when the pipe is in message mode.
+	MessageMode bool
+
+	// InputBufferSize specifies the size the input buffer, in bytes.
+	InputBufferSize int32
+
+	// OutputBufferSize specifies the size the input buffer, in bytes.
+	OutputBufferSize int32
+}
+
+// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
+// The pipe must not already exist.
+func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
+	var (
+		sd  []byte
+		err error
+	)
+	if c == nil {
+		c = &PipeConfig{}
+	}
+	if c.SecurityDescriptor != "" {
+		sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
+		if err != nil {
+			return nil, err
+		}
+	}
+	h, err := makeServerPipeHandle(path, sd, c, true)
+	if err != nil {
+		return nil, err
+	}
+	// Create a client handle and connect it.  This results in the pipe
+	// instance always existing, so that clients see ERROR_PIPE_BUSY
+	// rather than ERROR_FILE_NOT_FOUND.  This ties the first instance
+	// up so that no other instances can be used.  This would have been
+	// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
+	// instead of CreateNamedPipe.  (Apparently created named pipes are
+	// considered to be in listening state regardless of whether any
+	// active calls to ConnectNamedPipe are outstanding.)
+	h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	// Close the client handle. The server side of the instance will
+	// still be busy, leading to ERROR_PIPE_BUSY instead of
+	// ERROR_NOT_FOUND, as long as we don't close the server handle,
+	// or disconnect the client with DisconnectNamedPipe.
+	syscall.Close(h2)
+	l := &win32PipeListener{
+		firstHandle:        h,
+		path:               path,
+		securityDescriptor: sd,
+		config:             *c,
+		acceptCh:           make(chan (chan acceptResponse)),
+		closeCh:            make(chan int),
+		doneCh:             make(chan int),
+	}
+	go l.listenerRoutine()
+	return l, nil
+}
+
+func connectPipe(p *win32File) error {
+	c, err := p.prepareIo()
+	if err != nil {
+		return err
+	}
+	defer p.wg.Done()
+
+	err = connectNamedPipe(p.handle, &c.o)
+	_, err = p.asyncIo(c, nil, 0, err)
+	if err != nil && err != cERROR_PIPE_CONNECTED {
+		return err
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Accept() (net.Conn, error) {
+	ch := make(chan acceptResponse)
+	select {
+	case l.acceptCh <- ch:
+		response := <-ch
+		err := response.err
+		if err != nil {
+			return nil, err
+		}
+		if l.config.MessageMode {
+			return &win32MessageBytePipe{
+				win32Pipe: win32Pipe{win32File: response.f, path: l.path},
+			}, nil
+		}
+		return &win32Pipe{win32File: response.f, path: l.path}, nil
+	case <-l.doneCh:
+		return nil, ErrPipeListenerClosed
+	}
+}
+
+func (l *win32PipeListener) Close() error {
+	select {
+	case l.closeCh <- 1:
+		<-l.doneCh
+	case <-l.doneCh:
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Addr() net.Addr {
+	return pipeAddress(l.path)
+}

src/runtime/vendor/github.com/Microsoft/go-winio/privilege.go

@@ -0,0 +1,202 @@
+// +build windows
+
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"runtime"
+	"sync"
+	"syscall"
+	"unicode/utf16"
+
+	"golang.org/x/sys/windows"
+)
+
+//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
+//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
+//sys revertToSelf() (err error) = advapi32.RevertToSelf
+//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
+//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
+//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
+//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
+//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
+
+const (
+	SE_PRIVILEGE_ENABLED = 2
+
+	ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
+
+	SeBackupPrivilege  = "SeBackupPrivilege"
+	SeRestorePrivilege = "SeRestorePrivilege"
+)
+
+const (
+	securityAnonymous = iota
+	securityIdentification
+	securityImpersonation
+	securityDelegation
+)
+
+var (
+	privNames     = make(map[string]uint64)
+	privNameMutex sync.Mutex
+)
+
+// PrivilegeError represents an error enabling privileges.
+type PrivilegeError struct {
+	privileges []uint64
+}
+
+func (e *PrivilegeError) Error() string {
+	s := ""
+	if len(e.privileges) > 1 {
+		s = "Could not enable privileges "
+	} else {
+		s = "Could not enable privilege "
+	}
+	for i, p := range e.privileges {
+		if i != 0 {
+			s += ", "
+		}
+		s += `"`
+		s += getPrivilegeName(p)
+		s += `"`
+	}
+	return s
+}
+
+// RunWithPrivilege enables a single privilege for a function call.
+func RunWithPrivilege(name string, fn func() error) error {
+	return RunWithPrivileges([]string{name}, fn)
+}
+
+// RunWithPrivileges enables privileges for a function call.
+func RunWithPrivileges(names []string, fn func() error) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+	runtime.LockOSThread()
+	defer runtime.UnlockOSThread()
+	token, err := newThreadToken()
+	if err != nil {
+		return err
+	}
+	defer releaseThreadToken(token)
+	err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
+	if err != nil {
+		return err
+	}
+	return fn()
+}
+
+func mapPrivileges(names []string) ([]uint64, error) {
+	var privileges []uint64
+	privNameMutex.Lock()
+	defer privNameMutex.Unlock()
+	for _, name := range names {
+		p, ok := privNames[name]
+		if !ok {
+			err := lookupPrivilegeValue("", name, &p)
+			if err != nil {
+				return nil, err
+			}
+			privNames[name] = p
+		}
+		privileges = append(privileges, p)
+	}
+	return privileges, nil
+}
+
+// EnableProcessPrivileges enables privileges globally for the process.
+func EnableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
+}
+
+// DisableProcessPrivileges disables privileges globally for the process.
+func DisableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, 0)
+}
+
+func enableDisableProcessPrivilege(names []string, action uint32) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+
+	p, _ := windows.GetCurrentProcess()
+	var token windows.Token
+	err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
+	if err != nil {
+		return err
+	}
+
+	defer token.Close()
+	return adjustPrivileges(token, privileges, action)
+}
+
+func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
+	for _, p := range privileges {
+		binary.Write(&b, binary.LittleEndian, p)
+		binary.Write(&b, binary.LittleEndian, action)
+	}
+	prevState := make([]byte, b.Len())
+	reqSize := uint32(0)
+	success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
+	if !success {
+		return err
+	}
+	if err == ERROR_NOT_ALL_ASSIGNED {
+		return &PrivilegeError{privileges}
+	}
+	return nil
+}
+
+func getPrivilegeName(luid uint64) string {
+	var nameBuffer [256]uint16
+	bufSize := uint32(len(nameBuffer))
+	err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %d>", luid)
+	}
+
+	var displayNameBuffer [256]uint16
+	displayBufSize := uint32(len(displayNameBuffer))
+	var langID uint32
+	err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
+	}
+
+	return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
+}
+
+func newThreadToken() (windows.Token, error) {
+	err := impersonateSelf(securityImpersonation)
+	if err != nil {
+		return 0, err
+	}
+
+	var token windows.Token
+	err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
+	if err != nil {
+		rerr := revertToSelf()
+		if rerr != nil {
+			panic(rerr)
+		}
+		return 0, err
+	}
+	return token, nil
+}
+
+func releaseThreadToken(h windows.Token) {
+	err := revertToSelf()
+	if err != nil {
+		panic(err)
+	}
+	h.Close()
+}

src/runtime/vendor/github.com/Microsoft/go-winio/reparse.go

@@ -0,0 +1,128 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"strings"
+	"unicode/utf16"
+	"unsafe"
+)
+
+const (
+	reparseTagMountPoint = 0xA0000003
+	reparseTagSymlink    = 0xA000000C
+)
+
+type reparseDataBuffer struct {
+	ReparseTag           uint32
+	ReparseDataLength    uint16
+	Reserved             uint16
+	SubstituteNameOffset uint16
+	SubstituteNameLength uint16
+	PrintNameOffset      uint16
+	PrintNameLength      uint16
+}
+
+// ReparsePoint describes a Win32 symlink or mount point.
+type ReparsePoint struct {
+	Target       string
+	IsMountPoint bool
+}
+
+// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
+// mount point reparse point.
+type UnsupportedReparsePointError struct {
+	Tag uint32
+}
+
+func (e *UnsupportedReparsePointError) Error() string {
+	return fmt.Sprintf("unsupported reparse point %x", e.Tag)
+}
+
+// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
+// or a mount point.
+func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
+	tag := binary.LittleEndian.Uint32(b[0:4])
+	return DecodeReparsePointData(tag, b[8:])
+}
+
+func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
+	isMountPoint := false
+	switch tag {
+	case reparseTagMountPoint:
+		isMountPoint = true
+	case reparseTagSymlink:
+	default:
+		return nil, &UnsupportedReparsePointError{tag}
+	}
+	nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
+	if !isMountPoint {
+		nameOffset += 4
+	}
+	nameLength := binary.LittleEndian.Uint16(b[6:8])
+	name := make([]uint16, nameLength/2)
+	err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
+	if err != nil {
+		return nil, err
+	}
+	return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
+}
+
+func isDriveLetter(c byte) bool {
+	return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
+}
+
+// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
+// mount point.
+func EncodeReparsePoint(rp *ReparsePoint) []byte {
+	// Generate an NT path and determine if this is a relative path.
+	var ntTarget string
+	relative := false
+	if strings.HasPrefix(rp.Target, `\\?\`) {
+		ntTarget = `\??\` + rp.Target[4:]
+	} else if strings.HasPrefix(rp.Target, `\\`) {
+		ntTarget = `\??\UNC\` + rp.Target[2:]
+	} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
+		ntTarget = `\??\` + rp.Target
+	} else {
+		ntTarget = rp.Target
+		relative = true
+	}
+
+	// The paths must be NUL-terminated even though they are counted strings.
+	target16 := utf16.Encode([]rune(rp.Target + "\x00"))
+	ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
+
+	size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
+	size += len(ntTarget16)*2 + len(target16)*2
+
+	tag := uint32(reparseTagMountPoint)
+	if !rp.IsMountPoint {
+		tag = reparseTagSymlink
+		size += 4 // Add room for symlink flags
+	}
+
+	data := reparseDataBuffer{
+		ReparseTag:           tag,
+		ReparseDataLength:    uint16(size),
+		SubstituteNameOffset: 0,
+		SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
+		PrintNameOffset:      uint16(len(ntTarget16) * 2),
+		PrintNameLength:      uint16((len(target16) - 1) * 2),
+	}
+
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, &data)
+	if !rp.IsMountPoint {
+		flags := uint32(0)
+		if relative {
+			flags |= 1
+		}
+		binary.Write(&b, binary.LittleEndian, flags)
+	}
+
+	binary.Write(&b, binary.LittleEndian, ntTarget16)
+	binary.Write(&b, binary.LittleEndian, target16)
+	return b.Bytes()
+}

src/runtime/vendor/github.com/Microsoft/go-winio/sd.go

@@ -0,0 +1,98 @@
+// +build windows
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
+//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
+//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
+//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
+//sys localFree(mem uintptr) = LocalFree
+//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
+
+const (
+	cERROR_NONE_MAPPED = syscall.Errno(1332)
+)
+
+type AccountLookupError struct {
+	Name string
+	Err  error
+}
+
+func (e *AccountLookupError) Error() string {
+	if e.Name == "" {
+		return "lookup account: empty account name specified"
+	}
+	var s string
+	switch e.Err {
+	case cERROR_NONE_MAPPED:
+		s = "not found"
+	default:
+		s = e.Err.Error()
+	}
+	return "lookup account " + e.Name + ": " + s
+}
+
+type SddlConversionError struct {
+	Sddl string
+	Err  error
+}
+
+func (e *SddlConversionError) Error() string {
+	return "convert " + e.Sddl + ": " + e.Err.Error()
+}
+
+// LookupSidByName looks up the SID of an account by name
+func LookupSidByName(name string) (sid string, err error) {
+	if name == "" {
+		return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
+	}
+
+	var sidSize, sidNameUse, refDomainSize uint32
+	err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
+	if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
+		return "", &AccountLookupError{name, err}
+	}
+	sidBuffer := make([]byte, sidSize)
+	refDomainBuffer := make([]uint16, refDomainSize)
+	err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	var strBuffer *uint16
+	err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
+	localFree(uintptr(unsafe.Pointer(strBuffer)))
+	return sid, nil
+}
+
+func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
+	var sdBuffer uintptr
+	err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
+	if err != nil {
+		return nil, &SddlConversionError{sddl, err}
+	}
+	defer localFree(sdBuffer)
+	sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
+	copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
+	return sd, nil
+}
+
+func SecurityDescriptorToSddl(sd []byte) (string, error) {
+	var sddl *uint16
+	// The returned string length seems to including an aribtrary number of terminating NULs.
+	// Don't use it.
+	err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
+	if err != nil {
+		return "", err
+	}
+	defer localFree(uintptr(unsafe.Pointer(sddl)))
+	return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
+}

src/runtime/vendor/github.com/Microsoft/go-winio/syscall.go

@@ -0,0 +1,3 @@
+package winio
+
+//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go

src/runtime/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go

@@ -0,0 +1,520 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+	modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
+
+	procCancelIoEx                                           = modkernel32.NewProc("CancelIoEx")
+	procCreateIoCompletionPort                               = modkernel32.NewProc("CreateIoCompletionPort")
+	procGetQueuedCompletionStatus                            = modkernel32.NewProc("GetQueuedCompletionStatus")
+	procSetFileCompletionNotificationModes                   = modkernel32.NewProc("SetFileCompletionNotificationModes")
+	procConnectNamedPipe                                     = modkernel32.NewProc("ConnectNamedPipe")
+	procCreateNamedPipeW                                     = modkernel32.NewProc("CreateNamedPipeW")
+	procCreateFileW                                          = modkernel32.NewProc("CreateFileW")
+	procWaitNamedPipeW                                       = modkernel32.NewProc("WaitNamedPipeW")
+	procGetNamedPipeInfo                                     = modkernel32.NewProc("GetNamedPipeInfo")
+	procGetNamedPipeHandleStateW                             = modkernel32.NewProc("GetNamedPipeHandleStateW")
+	procLocalAlloc                                           = modkernel32.NewProc("LocalAlloc")
+	procLookupAccountNameW                                   = modadvapi32.NewProc("LookupAccountNameW")
+	procConvertSidToStringSidW                               = modadvapi32.NewProc("ConvertSidToStringSidW")
+	procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
+	procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
+	procLocalFree                                            = modkernel32.NewProc("LocalFree")
+	procGetSecurityDescriptorLength                          = modadvapi32.NewProc("GetSecurityDescriptorLength")
+	procGetFileInformationByHandleEx                         = modkernel32.NewProc("GetFileInformationByHandleEx")
+	procSetFileInformationByHandle                           = modkernel32.NewProc("SetFileInformationByHandle")
+	procAdjustTokenPrivileges                                = modadvapi32.NewProc("AdjustTokenPrivileges")
+	procImpersonateSelf                                      = modadvapi32.NewProc("ImpersonateSelf")
+	procRevertToSelf                                         = modadvapi32.NewProc("RevertToSelf")
+	procOpenThreadToken                                      = modadvapi32.NewProc("OpenThreadToken")
+	procGetCurrentThread                                     = modkernel32.NewProc("GetCurrentThread")
+	procLookupPrivilegeValueW                                = modadvapi32.NewProc("LookupPrivilegeValueW")
+	procLookupPrivilegeNameW                                 = modadvapi32.NewProc("LookupPrivilegeNameW")
+	procLookupPrivilegeDisplayNameW                          = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
+	procBackupRead                                           = modkernel32.NewProc("BackupRead")
+	procBackupWrite                                          = modkernel32.NewProc("BackupWrite")
+)
+
+func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
+	newport = syscall.Handle(r0)
+	if newport == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
+	r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
+}
+
+func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
+}
+
+func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func waitNamedPipe(name string, timeout uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _waitNamedPipe(_p0, timeout)
+}
+
+func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(accountName)
+	if err != nil {
+		return
+	}
+	return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
+}
+
+func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSidToStringSid(sid *byte, str **uint16) (err error) {
+	r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(str)
+	if err != nil {
+		return
+	}
+	return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
+}
+
+func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localFree(mem uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
+	return
+}
+
+func getSecurityDescriptorLength(sd uintptr) (len uint32) {
+	r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
+	len = uint32(r0)
+	return
+}
+
+func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
+	var _p0 uint32
+	if releaseAll {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
+	success = r0 != 0
+	if true {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func impersonateSelf(level uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func revertToSelf() (err error) {
+	r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
+	var _p0 uint32
+	if openAsSelf {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getCurrentThread() (h syscall.Handle) {
+	r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
+	h = syscall.Handle(r0)
+	return
+}
+
+func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeValue(_p0, _p1, luid)
+}
+
+func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
+	r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeName(_p0, luid, buffer, size)
+}
+
+func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
+}
+
+func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

src/runtime/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/LICENSE

@@ -0,0 +1,191 @@
+
+                                 Apache License
+                           Version 2.0, January 2004
+                        http://www.apache.org/licenses/
+
+   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+   1. Definitions.
+
+      "License" shall mean the terms and conditions for use, reproduction,
+      and distribution as defined by Sections 1 through 9 of this document.
+
+      "Licensor" shall mean the copyright owner or entity authorized by
+      the copyright owner that is granting the License.
+
+      "Legal Entity" shall mean the union of the acting entity and all
+      other entities that control, are controlled by, or are under common
+      control with that entity. For the purposes of this definition,
+      "control" means (i) the power, direct or indirect, to cause the
+      direction or management of such entity, whether by contract or
+      otherwise, or (ii) ownership of fifty percent (50%) or more of the
+      outstanding shares, or (iii) beneficial ownership of such entity.
+
+      "You" (or "Your") shall mean an individual or Legal Entity
+      exercising permissions granted by this License.
+
+      "Source" form shall mean the preferred form for making modifications,
+      including but not limited to software source code, documentation
+      source, and configuration files.
+
+      "Object" form shall mean any form resulting from mechanical
+      transformation or translation of a Source form, including but
+      not limited to compiled object code, generated documentation,
+      and conversions to other media types.
+
+      "Work" shall mean the work of authorship, whether in Source or
+      Object form, made available under the License, as indicated by a
+      copyright notice that is included in or attached to the work
+      (an example is provided in the Appendix below).
+
+      "Derivative Works" shall mean any work, whether in Source or Object
+      form, that is based on (or derived from) the Work and for which the
+      editorial revisions, annotations, elaborations, or other modifications
+      represent, as a whole, an original work of authorship. For the purposes
+      of this License, Derivative Works shall not include works that remain
+      separable from, or merely link (or bind by name) to the interfaces of,
+      the Work and Derivative Works thereof.
+
+      "Contribution" shall mean any work of authorship, including
+      the original version of the Work and any modifications or additions
+      to that Work or Derivative Works thereof, that is intentionally
+      submitted to Licensor for inclusion in the Work by the copyright owner
+      or by an individual or Legal Entity authorized to submit on behalf of
+      the copyright owner. For the purposes of this definition, "submitted"
+      means any form of electronic, verbal, or written communication sent
+      to the Licensor or its representatives, including but not limited to
+      communication on electronic mailing lists, source code control systems,
+      and issue tracking systems that are managed by, or on behalf of, the
+      Licensor for the purpose of discussing and improving the Work, but
+      excluding communication that is conspicuously marked or otherwise
+      designated in writing by the copyright owner as "Not a Contribution."
+
+      "Contributor" shall mean Licensor and any individual or Legal Entity
+      on behalf of whom a Contribution has been received by Licensor and
+      subsequently incorporated within the Work.
+
+   2. Grant of Copyright License. Subject to the terms and conditions of
+      this License, each Contributor hereby grants to You a perpetual,
+      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+      copyright license to reproduce, prepare Derivative Works of,
+      publicly display, publicly perform, sublicense, and distribute the
+      Work and such Derivative Works in Source or Object form.
+
+   3. Grant of Patent License. Subject to the terms and conditions of
+      this License, each Contributor hereby grants to You a perpetual,
+      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+      (except as stated in this section) patent license to make, have made,
+      use, offer to sell, sell, import, and otherwise transfer the Work,
+      where such license applies only to those patent claims licensable
+      by such Contributor that are necessarily infringed by their
+      Contribution(s) alone or by combination of their Contribution(s)
+      with the Work to which such Contribution(s) was submitted. If You
+      institute patent litigation against any entity (including a
+      cross-claim or counterclaim in a lawsuit) alleging that the Work
+      or a Contribution incorporated within the Work constitutes direct
+      or contributory patent infringement, then any patent licenses
+      granted to You under this License for that Work shall terminate
+      as of the date such litigation is filed.
+
+   4. Redistribution. You may reproduce and distribute copies of the
+      Work or Derivative Works thereof in any medium, with or without
+      modifications, and in Source or Object form, provided that You
+      meet the following conditions:
+
+      (a) You must give any other recipients of the Work or
+          Derivative Works a copy of this License; and
+
+      (b) You must cause any modified files to carry prominent notices
+          stating that You changed the files; and
+
+      (c) You must retain, in the Source form of any Derivative Works
+          that You distribute, all copyright, patent, trademark, and
+          attribution notices from the Source form of the Work,
+          excluding those notices that do not pertain to any part of
+          the Derivative Works; and
+
+      (d) If the Work includes a "NOTICE" text file as part of its
+          distribution, then any Derivative Works that You distribute must
+          include a readable copy of the attribution notices contained
+          within such NOTICE file, excluding those notices that do not
+          pertain to any part of the Derivative Works, in at least one
+          of the following places: within a NOTICE text file distributed
+          as part of the Derivative Works; within the Source form or
+          documentation, if provided along with the Derivative Works; or,
+          within a display generated by the Derivative Works, if and
+          wherever such third-party notices normally appear. The contents
+          of the NOTICE file are for informational purposes only and
+          do not modify the License. You may add Your own attribution
+          notices within Derivative Works that You distribute, alongside
+          or as an addendum to the NOTICE text from the Work, provided
+          that such additional attribution notices cannot be construed
+          as modifying the License.
+
+      You may add Your own copyright statement to Your modifications and
+      may provide additional or different license terms and conditions
+      for use, reproduction, or distribution of Your modifications, or
+      for any such Derivative Works as a whole, provided Your use,
+      reproduction, and distribution of the Work otherwise complies with
+      the conditions stated in this License.
+
+   5. Submission of Contributions. Unless You explicitly state otherwise,
+      any Contribution intentionally submitted for inclusion in the Work
+      by You to the Licensor shall be under the terms and conditions of
+      this License, without any additional terms or conditions.
+      Notwithstanding the above, nothing herein shall supersede or modify
+      the terms of any separate license agreement you may have executed
+      with Licensor regarding such Contributions.
+
+   6. Trademarks. This License does not grant permission to use the trade
+      names, trademarks, service marks, or product names of the Licensor,
+      except as required for reasonable and customary use in describing the
+      origin of the Work and reproducing the content of the NOTICE file.
+
+   7. Disclaimer of Warranty. Unless required by applicable law or
+      agreed to in writing, Licensor provides the Work (and each
+      Contributor provides its Contributions) on an "AS IS" BASIS,
+      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+      implied, including, without limitation, any warranties or conditions
+      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+      PARTICULAR PURPOSE. You are solely responsible for determining the
+      appropriateness of using or redistributing the Work and assume any
+      risks associated with Your exercise of permissions under this License.
+
+   8. Limitation of Liability. In no event and under no legal theory,
+      whether in tort (including negligence), contract, or otherwise,
+      unless required by applicable law (such as deliberate and grossly
+      negligent acts) or agreed to in writing, shall any Contributor be
+      liable to You for damages, including any direct, indirect, special,
+      incidental, or consequential damages of any character arising as a
+      result of this License or out of the use or inability to use the
+      Work (including but not limited to damages for loss of goodwill,
+      work stoppage, computer failure or malfunction, or any and all
+      other commercial damages or losses), even if such Contributor
+      has been advised of the possibility of such damages.
+
+   9. Accepting Warranty or Additional Liability. While redistributing
+      the Work or Derivative Works thereof, You may choose to offer,
+      and charge a fee for, acceptance of support, warranty, indemnity,
+      or other liability obligations and/or rights consistent with this
+      License. However, in accepting such obligations, You may act only
+      on Your own behalf and on Your sole responsibility, not on behalf
+      of any other Contributor, and only if You agree to indemnify,
+      defend, and hold each Contributor harmless for any liability
+      incurred by, or claims asserted against, such Contributor by reason
+      of your accepting any such warranty or additional liability.
+
+   END OF TERMS AND CONDITIONS
+
+   Copyright 2014 Docker, Inc.
+
+   Licensed under the Apache License, Version 2.0 (the "License");
+   you may not use this file except in compliance with the License.
+   You may obtain a copy of the License at
+
+       http://www.apache.org/licenses/LICENSE-2.0
+
+   Unless required by applicable law or agreed to in writing, software
+   distributed under the License is distributed on an "AS IS" BASIS,
+   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+   See the License for the specific language governing permissions and
+   limitations under the License.

src/runtime/vendor/github.com/Microsoft/hcsshim/cmd/runhcs/NOTICE

@@ -0,0 +1,22 @@
+runhcs is a fork of runc.
+
+The following is runc's legal notice.
+
+---
+
+runc
+
+Copyright 2012-2015 Docker, Inc.
+
+This product includes software developed at Docker, Inc. (http://www.docker.com).
+
+The following is courtesy of our legal counsel:
+
+Use and transfer of Docker may be subject to certain restrictions by the
+United States and other governments.
+It is your responsibility to ensure that your use and/or transfer does not
+violate applicable laws.
+
+For more information, please see http://www.bis.doc.gov
+
+See also http://www.apache.org/dev/crypto.html and/or seek legal counsel.

src/runtime/vendor/github.com/Microsoft/hcsshim/container.go

@@ -0,0 +1,192 @@
+package hcsshim
+
+import (
+	"fmt"
+	"os"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/mergemaps"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties = schema1.ContainerProperties
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats = schema1.MemoryStats
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats = schema1.ProcessorStats
+
+// StorageStats holds the storage statistics for a container
+type StorageStats = schema1.StorageStats
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats = schema1.NetworkStats
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics = schema1.Statistics
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem = schema1.ProcessListItem
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController = schema1.MappedVirtualDiskController
+
+// Type of Request Support in ModifySystem
+type RequestType = schema1.RequestType
+
+// Type of Resource Support in ModifySystem
+type ResourceType = schema1.ResourceType
+
+// RequestType const
+const (
+	Add     = schema1.Add
+	Remove  = schema1.Remove
+	Network = schema1.Network
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
+
+type container struct {
+	system *hcs.System
+}
+
+// createComputeSystemAdditionalJSON is read from the environment at initialisation
+// time. It allows an environment variable to define additional JSON which
+// is merged in the CreateComputeSystem call to HCS.
+var createContainerAdditionalJSON []byte
+
+func init() {
+	createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
+}
+
+// CreateContainer creates a new container with the given configuration but does not start it.
+func CreateContainer(id string, c *ContainerConfig) (Container, error) {
+	fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
+	if err != nil {
+		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
+	}
+
+	system, err := hcs.CreateComputeSystem(id, fullConfig)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// OpenContainer opens an existing container by ID.
+func OpenContainer(id string) (Container, error) {
+	system, err := hcs.OpenComputeSystem(id)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// GetContainers gets a list of the containers on the system that match the query
+func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
+	return hcs.GetComputeSystems(q)
+}
+
+// Start synchronously starts the container.
+func (container *container) Start() error {
+	return convertSystemError(container.system.Start(), container)
+}
+
+// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+func (container *container) Shutdown() error {
+	return convertSystemError(container.system.Shutdown(), container)
+}
+
+// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+func (container *container) Terminate() error {
+	return convertSystemError(container.system.Terminate(), container)
+}
+
+// Waits synchronously waits for the container to shutdown or terminate.
+func (container *container) Wait() error {
+	return convertSystemError(container.system.Wait(), container)
+}
+
+// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+// returns false if timeout occurs.
+func (container *container) WaitTimeout(t time.Duration) error {
+	return convertSystemError(container.system.WaitTimeout(t), container)
+}
+
+// Pause pauses the execution of a container.
+func (container *container) Pause() error {
+	return convertSystemError(container.system.Pause(), container)
+}
+
+// Resume resumes the execution of a container.
+func (container *container) Resume() error {
+	return convertSystemError(container.system.Resume(), container)
+}
+
+// HasPendingUpdates returns true if the container has updates pending to install
+func (container *container) HasPendingUpdates() (bool, error) {
+	return false, nil
+}
+
+// Statistics returns statistics for the container. This is a legacy v1 call
+func (container *container) Statistics() (Statistics, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
+	if err != nil {
+		return Statistics{}, convertSystemError(err, container)
+	}
+
+	return properties.Statistics, nil
+}
+
+// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
+func (container *container) ProcessList() ([]ProcessListItem, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.ProcessList, nil
+}
+
+// This is a legacy v1 call
+func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.MappedVirtualDiskControllers, nil
+}
+
+// CreateProcess launches a new process within the container.
+func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
+	p, err := container.system.CreateProcess(c)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// OpenProcess gets an interface to an existing process within the container.
+func (container *container) OpenProcess(pid int) (Process, error) {
+	p, err := container.system.OpenProcess(pid)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// Close cleans up any state associated with the container but does not terminate or wait for it.
+func (container *container) Close() error {
+	return convertSystemError(container.system.Close(), container)
+}
+
+// Modify the System
+func (container *container) Modify(config *ResourceModificationRequestResponse) error {
+	return convertSystemError(container.system.Modify(config), container)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/errors.go

@@ -0,0 +1,257 @@
+package hcsshim
+
+import (
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hns"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
+	ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = hcs.ErrElementNotFound
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = hcs.ErrNotSupported
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = hcs.ErrInvalidData
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = hcs.ErrHandleClose
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = hcs.ErrAlreadyClosed
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = hcs.ErrInvalidProcessState
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = hcs.ErrTimeout
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = hcs.ErrUnexpectedValue
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = hcs.ErrProcNotFound
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
+)
+
+type EndpointNotFoundError = hns.EndpointNotFoundError
+type NetworkNotFoundError = hns.NetworkNotFoundError
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	Process   *process
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+// ContainerError is an error encountered in HCS during an operation on a Container object
+type ContainerError struct {
+	Container *container
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+func (e *ContainerError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Container == nil {
+		return "unexpected nil container for error: " + e.Err.Error()
+	}
+
+	s := "container " + e.Container.system.ID()
+
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	if e.ExtraInfo != "" {
+		s += " extra info: " + e.ExtraInfo
+	}
+
+	return s
+}
+
+func makeContainerError(container *container, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ContainerError); ok {
+		return err
+	}
+	containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return containerError
+}
+
+func (e *ProcessError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Process == nil {
+		return "Unexpected nil process for error: " + e.Err.Error()
+	}
+
+	s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	return s
+}
+
+func makeProcessError(process *process, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return processError
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	if _, ok := err.(EndpointNotFoundError); ok {
+		return true
+	}
+	if _, ok := err.(NetworkNotFoundError); ok {
+		return true
+	}
+	return hcs.IsNotExist(getInnerError(err))
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	return hcs.IsAlreadyClosed(getInnerError(err))
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	return hcs.IsPending(getInnerError(err))
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	return hcs.IsTimeout(getInnerError(err))
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	return hcs.IsAlreadyStopped(getInnerError(err))
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	return hcs.IsNotSupported(getInnerError(err))
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *ContainerError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}
+
+func convertSystemError(err error, c *container) error {
+	if serr, ok := err.(*hcs.SystemError); ok {
+		return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
+	}
+	return err
+}
+
+func convertProcessError(err error, p *process) error {
+	if perr, ok := err.(*hcs.ProcessError); ok {
+		return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
+	}
+	return err
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/hcsshim.go

@@ -0,0 +1,28 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcsshim
+
+import (
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
+
+//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
+
+const (
+	// Specific user-visible exit codes
+	WaitErrExecFailed = 32767
+
+	ERROR_GEN_FAILURE          = hcserror.ERROR_GEN_FAILURE
+	ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
+	WSAEINVAL                  = syscall.Errno(10022)
+
+	// Timeout on wait calls
+	TimeoutInfinite = 0xFFFFFFFF
+)
+
+type HcsError = hcserror.HcsError

src/runtime/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go

@@ -0,0 +1,94 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint = hns.HNSEndpoint
+
+// Namespace represents a Compartment.
+type Namespace = hns.Namespace
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse = hns.EndpointResquestResponse
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	return hns.HNSEndpointRequest(method, path, request)
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	return hns.HNSListEndpointRequest()
+}
+
+// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
+func HotAttachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Add)
+}
+
+// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
+func HotDetachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Remove)
+}
+
+// ModifyContainer corresponding to the container id, by sending a request
+func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
+	container, err := OpenContainer(id)
+	if err != nil {
+		if IsNotExist(err) {
+			return ErrComputeSystemDoesNotExist
+		}
+		return getInnerError(err)
+	}
+	defer container.Close()
+	err = container.Modify(request)
+	if err != nil {
+		if IsNotSupported(err) {
+			return ErrPlatformNotSupported
+		}
+		return getInnerError(err)
+	}
+
+	return nil
+}
+
+func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
+	requestMessage := &ResourceModificationRequestResponse{
+		Resource: Network,
+		Request:  request,
+		Data:     endpointID,
+	}
+	err := modifyContainer(containerID, requestMessage)
+
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByID(endpointID)
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByName(endpointName)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/hnsglobals.go

@@ -0,0 +1,16 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSGlobals = hns.HNSGlobals
+type HNSVersion = hns.HNSVersion
+
+var (
+	HNSVersion1803 = hns.HNSVersion1803
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	return hns.GetHNSGlobals()
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go

@@ -0,0 +1,36 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet = hns.Subnet
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool = hns.MacPool
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork = hns.HNSNetwork
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	return hns.HNSNetworkRequest(method, path, request)
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	return hns.HNSListNetworkRequest(method, path, request)
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByID(networkID)
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByName(networkName)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/hnspolicy.go

@@ -0,0 +1,57 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Type of Request Support in ModifySystem
+type PolicyType = hns.PolicyType
+
+// RequestType const
+const (
+	Nat                  = hns.Nat
+	ACL                  = hns.ACL
+	PA                   = hns.PA
+	VLAN                 = hns.VLAN
+	VSID                 = hns.VSID
+	VNet                 = hns.VNet
+	L2Driver             = hns.L2Driver
+	Isolation            = hns.Isolation
+	QOS                  = hns.QOS
+	OutboundNat          = hns.OutboundNat
+	ExternalLoadBalancer = hns.ExternalLoadBalancer
+	Route                = hns.Route
+)
+
+type NatPolicy = hns.NatPolicy
+
+type QosPolicy = hns.QosPolicy
+
+type IsolationPolicy = hns.IsolationPolicy
+
+type VlanPolicy = hns.VlanPolicy
+
+type VsidPolicy = hns.VsidPolicy
+
+type PaPolicy = hns.PaPolicy
+
+type OutboundNatPolicy = hns.OutboundNatPolicy
+
+type ActionType = hns.ActionType
+type DirectionType = hns.DirectionType
+type RuleType = hns.RuleType
+
+const (
+	Allow = hns.Allow
+	Block = hns.Block
+
+	In  = hns.In
+	Out = hns.Out
+
+	Host   = hns.Host
+	Switch = hns.Switch
+)
+
+type ACLPolicy = hns.ACLPolicy
+
+type Policy = hns.Policy

src/runtime/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go

@@ -0,0 +1,47 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy = hns.RoutePolicy
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy = hns.ELBPolicy
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy = hns.LBPolicy
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList = hns.PolicyList
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.HNSPolicyListRequest(method, path, request)
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	return hns.HNSListPolicyListRequest()
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.PolicyListRequest(method, path, request)
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return hns.GetPolicyListByID(policyListID)
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/hnssupport.go

@@ -0,0 +1,13 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSSupportedFeatures = hns.HNSSupportedFeatures
+
+type HNSAclFeatures = hns.HNSAclFeatures
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	return hns.GetHNSSupportedFeatures()
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/interface.go

@@ -0,0 +1,114 @@
+package hcsshim
+
+import (
+	"io"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig = schema1.ProcessConfig
+
+type Layer = schema1.Layer
+type MappedDir = schema1.MappedDir
+type MappedPipe = schema1.MappedPipe
+type HvRuntime = schema1.HvRuntime
+type MappedVirtualDisk = schema1.MappedVirtualDisk
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice = schema1.AssignedDevice
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig = schema1.ContainerConfig
+
+type ComputeSystemQuery = schema1.ComputeSystemQuery
+
+// Container represents a created (but not necessarily running) container.
+type Container interface {
+	// Start synchronously starts the container.
+	Start() error
+
+	// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+	Shutdown() error
+
+	// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+	Terminate() error
+
+	// Waits synchronously waits for the container to shutdown or terminate.
+	Wait() error
+
+	// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+	// returns false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// Pause pauses the execution of a container.
+	Pause() error
+
+	// Resume resumes the execution of a container.
+	Resume() error
+
+	// HasPendingUpdates returns true if the container has updates pending to install.
+	HasPendingUpdates() (bool, error)
+
+	// Statistics returns statistics for a container.
+	Statistics() (Statistics, error)
+
+	// ProcessList returns details for the processes in a container.
+	ProcessList() ([]ProcessListItem, error)
+
+	// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
+	MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
+
+	// CreateProcess launches a new process within the container.
+	CreateProcess(c *ProcessConfig) (Process, error)
+
+	// OpenProcess gets an interface to an existing process within the container.
+	OpenProcess(pid int) (Process, error)
+
+	// Close cleans up any state associated with the container but does not terminate or wait for it.
+	Close() error
+
+	// Modify the System
+	Modify(config *ResourceModificationRequestResponse) error
+}
+
+// Process represents a running or exited process.
+type Process interface {
+	// Pid returns the process ID of the process within the container.
+	Pid() int
+
+	// Kill signals the process to terminate but does not wait for it to finish terminating.
+	Kill() error
+
+	// Wait waits for the process to exit.
+	Wait() error
+
+	// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+	// false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// ExitCode returns the exit code of the process. The process must have
+	// already terminated.
+	ExitCode() (int, error)
+
+	// ResizeConsole resizes the console of the process.
+	ResizeConsole(width, height uint16) error
+
+	// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+	// these pipes does not close the underlying pipes; it should be possible to
+	// call this multiple times to get multiple interfaces.
+	Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
+
+	// CloseStdin closes the write side of the stdin pipe so that the process is
+	// notified on the read side that there is no more data in stdin.
+	CloseStdin() error
+
+	// Close cleans up any state associated with the process but does not kill
+	// or wait on it.
+	Close() error
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go

@@ -0,0 +1,100 @@
+package guestrequest
+
+import (
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// Arguably, many of these (at least CombinedLayers) should have been generated
+// by swagger.
+//
+// This will also change package name due to an inbound breaking change.
+
+// This class is used by a modify request to add or remove a combined layers
+// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
+// using the specified layers as the parent content. Ignores property ScratchPath
+// since the container path is already the scratch path. For linux, the GCS unions
+// the specified layers and ScratchPath together, placing the resulting union
+// filesystem at ContainerRootPath.
+type CombinedLayers struct {
+	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
+	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
+	ScratchPath       string            `json:"ScratchPath,omitempty"`
+}
+
+// Defines the schema for hosted settings passed to GCS and/or OpenGCS
+
+// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
+type LCOWMappedVirtualDisk struct {
+	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
+	Lun        uint8  `json:"Lun,omitempty"`
+	Controller uint8  `json:"Controller,omitempty"`
+	ReadOnly   bool   `json:"ReadOnly,omitempty"`
+}
+
+type WCOWMappedVirtualDisk struct {
+	ContainerPath string `json:"ContainerPath,omitempty"`
+	Lun           int32  `json:"Lun,omitempty"`
+}
+
+type LCOWMappedDirectory struct {
+	MountPath string `json:"MountPath,omitempty"`
+	Port      int32  `json:"Port,omitempty"`
+	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
+	ReadOnly  bool   `json:"ReadOnly,omitempty"`
+}
+
+// Read-only layers over VPMem
+type LCOWMappedVPMemDevice struct {
+	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
+	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
+}
+
+type LCOWNetworkAdapter struct {
+	NamespaceID     string `json:",omitempty"`
+	ID              string `json:",omitempty"`
+	MacAddress      string `json:",omitempty"`
+	IPAddress       string `json:",omitempty"`
+	PrefixLength    uint8  `json:",omitempty"`
+	GatewayAddress  string `json:",omitempty"`
+	DNSSuffix       string `json:",omitempty"`
+	DNSServerList   string `json:",omitempty"`
+	EnableLowMetric bool   `json:",omitempty"`
+	EncapOverhead   uint16 `json:",omitempty"`
+}
+
+type ResourceType string
+
+const (
+	// These are constants for v2 schema modify guest requests.
+	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
+	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
+	ResourceTypeNetwork           ResourceType = "Network"
+	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
+	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
+	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
+)
+
+// GuestRequest is for modify commands passed to the guest.
+type GuestRequest struct {
+	RequestType  string       `json:"RequestType,omitempty"`
+	ResourceType ResourceType `json:"ResourceType,omitempty"`
+	Settings     interface{}  `json:"Settings,omitempty"`
+}
+
+type NetworkModifyRequest struct {
+	AdapterId   string      `json:"AdapterId,omitempty"`
+	RequestType string      `json:"RequestType,omitempty"`
+	Settings    interface{} `json:"Settings,omitempty"`
+}
+
+type RS4NetworkModifyRequest struct {
+	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
+	RequestType       string      `json:"RequestType,omitempty"`
+	Settings          interface{} `json:"Settings,omitempty"`
+}
+
+// SignalProcessOptions is the options passed to either WCOW or LCOW
+// to signal a given process.
+type SignalProcessOptions struct {
+	Signal int `json:,omitempty`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go

@@ -0,0 +1,69 @@
+package guid
+
+import (
+	"crypto/rand"
+	"encoding/json"
+	"fmt"
+	"io"
+	"strconv"
+	"strings"
+)
+
+var _ = (json.Marshaler)(&GUID{})
+var _ = (json.Unmarshaler)(&GUID{})
+
+type GUID [16]byte
+
+func New() GUID {
+	g := GUID{}
+	_, err := io.ReadFull(rand.Reader, g[:])
+	if err != nil {
+		panic(err)
+	}
+	return g
+}
+
+func (g GUID) String() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
+
+func FromString(s string) GUID {
+	if len(s) != 36 {
+		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
+	}
+	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
+		panic("invalid GUID format")
+	}
+	indexOrder := [16]int{
+		0, 2, 4, 6,
+		9, 11,
+		14, 16,
+		19, 21,
+		24, 26, 28, 30, 32, 34,
+	}
+	byteOrder := [16]int{
+		3, 2, 1, 0,
+		5, 4,
+		7, 6,
+		8, 9,
+		10, 11, 12, 13, 14, 15,
+	}
+	var g GUID
+	for i, x := range indexOrder {
+		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
+		if err != nil {
+			panic(err)
+		}
+		g[byteOrder[i]] = byte(b)
+	}
+	return g
+}
+
+func (g GUID) MarshalJSON() ([]byte, error) {
+	return json.Marshal(g.String())
+}
+
+func (g *GUID) UnmarshalJSON(data []byte) error {
+	*g = FromString(strings.Trim(string(data), "\""))
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go

@@ -0,0 +1,104 @@
+package hcs
+
+import (
+	"sync"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	nextCallback    uintptr
+	callbackMap     = map[uintptr]*notifcationWatcherContext{}
+	callbackMapLock = sync.RWMutex{}
+
+	notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
+
+	// Notifications for HCS_SYSTEM handles
+	hcsNotificationSystemExited                      hcsNotification = 0x00000001
+	hcsNotificationSystemCreateCompleted             hcsNotification = 0x00000002
+	hcsNotificationSystemStartCompleted              hcsNotification = 0x00000003
+	hcsNotificationSystemPauseCompleted              hcsNotification = 0x00000004
+	hcsNotificationSystemResumeCompleted             hcsNotification = 0x00000005
+	hcsNotificationSystemCrashReport                 hcsNotification = 0x00000006
+	hcsNotificationSystemSiloJobCreated              hcsNotification = 0x00000007
+	hcsNotificationSystemSaveCompleted               hcsNotification = 0x00000008
+	hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
+	hcsNotificationSystemShutdownFailed              hcsNotification = 0x0000000A
+	hcsNotificationSystemGetPropertiesCompleted      hcsNotification = 0x0000000B
+	hcsNotificationSystemModifyCompleted             hcsNotification = 0x0000000C
+	hcsNotificationSystemCrashInitiated              hcsNotification = 0x0000000D
+	hcsNotificationSystemGuestConnectionClosed       hcsNotification = 0x0000000E
+
+	// Notifications for HCS_PROCESS handles
+	hcsNotificationProcessExited hcsNotification = 0x00010000
+
+	// Common notifications
+	hcsNotificationInvalid           hcsNotification = 0x00000000
+	hcsNotificationServiceDisconnect hcsNotification = 0x01000000
+)
+
+type hcsNotification uint32
+type notificationChannel chan error
+
+type notifcationWatcherContext struct {
+	channels notificationChannels
+	handle   hcsCallback
+}
+
+type notificationChannels map[hcsNotification]notificationChannel
+
+func newChannels() notificationChannels {
+	channels := make(notificationChannels)
+
+	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
+
+	return channels
+}
+
+func closeChannels(channels notificationChannels) {
+	for _, c := range channels {
+		close(c)
+	}
+}
+
+func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
+	var result error
+	if int32(notificationStatus) < 0 {
+		result = interop.Win32FromHresult(notificationStatus)
+	}
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return 0
+	}
+
+	if channel, ok := context.channels[notificationType]; ok {
+		channel <- result
+	} else {
+		logrus.WithFields(logrus.Fields{
+			"notification-type": notificationType,
+		}).Warn("Received a callback of an unsupported type")
+	}
+
+	return 0
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go

@@ -0,0 +1,7 @@
+package hcs
+
+import "C"
+
+// This import is needed to make the library compile as CGO because HCSSHIM
+// only works with CGO due to callbacks from HCS comming back from a C thread
+// which is not supported without CGO. See https://github.com/golang/go/issues/10973

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go

@@ -0,0 +1,287 @@
+package hcs
+
+import (
+	"encoding/json"
+	"errors"
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
+	ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+type ErrorEvent struct {
+	Message    string `json:"Message,omitempty"`    // Fully formated error message
+	StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
+	Provider   string `json:"Provider,omitempty"`
+	EventID    uint16 `json:"EventId,omitempty"`
+	Flags      uint32 `json:"Flags,omitempty"`
+	Source     string `json:"Source,omitempty"`
+	//Data       []EventData `json:"Data,omitempty"`  // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
+}
+
+type hcsResult struct {
+	Error        int32
+	ErrorMessage string
+	ErrorEvents  []ErrorEvent `json:"ErrorEvents,omitempty"`
+}
+
+func (ev *ErrorEvent) String() string {
+	evs := "[Event Detail: " + ev.Message
+	if ev.StackTrace != "" {
+		evs += " Stack Trace: " + ev.StackTrace
+	}
+	if ev.Provider != "" {
+		evs += " Provider: " + ev.Provider
+	}
+	if ev.EventID != 0 {
+		evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
+	}
+	if ev.Flags != 0 {
+		evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
+	}
+	if ev.Source != "" {
+		evs += " Source: " + ev.Source
+	}
+	evs += "]"
+	return evs
+}
+
+func processHcsResult(resultp *uint16) []ErrorEvent {
+	if resultp != nil {
+		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
+		logrus.WithField(logfields.JSON, resultj).
+			Debug("HCS Result")
+		result := &hcsResult{}
+		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+			logrus.WithFields(logrus.Fields{
+				logfields.JSON:  resultj,
+				logrus.ErrorKey: err,
+			}).Warning("Could not unmarshal HCS result")
+			return nil
+		}
+		return result.ErrorEvents
+	}
+	return nil
+}
+
+type HcsError struct {
+	Op     string
+	Err    error
+	Events []ErrorEvent
+}
+
+func (e *HcsError) Error() string {
+	s := e.Op + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	SystemID string
+	Pid      int
+	Op       string
+	Err      error
+	Events   []ErrorEvent
+}
+
+// SystemError is an error encountered in HCS during an operation on a Container object
+type SystemError struct {
+	ID     string
+	Op     string
+	Err    error
+	Extra  string
+	Events []ErrorEvent
+}
+
+func (e *SystemError) Error() string {
+	s := e.Op + " " + e.ID + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	if e.Extra != "" {
+		s += "\n(extra info: " + e.Extra + ")"
+	}
+	return s
+}
+
+func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*SystemError); ok {
+		return err
+	}
+	return &SystemError{
+		ID:     system.ID(),
+		Op:     op,
+		Extra:  extra,
+		Err:    err,
+		Events: events,
+	}
+}
+
+func (e *ProcessError) Error() string {
+	s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	return &ProcessError{
+		Pid:      process.Pid(),
+		SystemID: process.SystemID(),
+		Op:       op,
+		Err:      err,
+		Events:   events,
+	}
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *HcsError:
+		err = pe.Err
+	case *SystemError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go

@@ -0,0 +1,48 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcs
+
+import (
+	"syscall"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go

@@ -0,0 +1,20 @@
+package hcs
+
+import "github.com/sirupsen/logrus"
+
+func logOperationBegin(ctx logrus.Fields, msg string) {
+	logrus.WithFields(ctx).Debug(msg)
+}
+
+func logOperationEnd(ctx logrus.Fields, msg string, err error) {
+	// Copy the log and fields first.
+	log := logrus.WithFields(ctx)
+	if err == nil {
+		log.Debug(msg)
+	} else {
+		// Edit only the copied field data to avoid race conditions on the
+		// write.
+		log.Data[logrus.ErrorKey] = err
+		log.Error(msg)
+	}
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go

@@ -0,0 +1,459 @@
+package hcs
+
+import (
+	"encoding/json"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/guestrequest"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type Process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	system         *System
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+	return &Process{
+		handle:    process,
+		processID: processID,
+		system:    computeSystem,
+		logctx: logrus.Fields{
+			logfields.ContainerID: computeSystem.ID(),
+			logfields.ProcessID:   processID,
+		},
+	}
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type ProcessStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *Process) Pid() int {
+	return process.processID
+}
+
+// SystemID returns the ID of the process's compute system.
+func (process *Process) SystemID() string {
+	return process.system.ID()
+}
+
+func (process *Process) logOperationBegin(operation string) {
+	logOperationBegin(
+		process.logctx,
+		operation+" - Begin Operation")
+}
+
+func (process *Process) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		process.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// Signal signals the process with `options`.
+func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Signal"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	optionsb, err := json.Marshal(options)
+	if err != nil {
+		return err
+	}
+
+	optionsStr := string(optionsb)
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsSignalProcess(process.handle, optionsStr, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *Process) Kill() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Kill"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsTerminateProcess(process.handle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *Process) Wait() (err error) {
+	operation := "hcsshim::Process::Wait"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcssshim::Process::WaitTimeout"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *Process) ResizeConsole(width, height uint16) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::ResizeConsole"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+func (process *Process) Properties() (_ *ProcessStatus, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Properties"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	syscallWatcher(process.logctx, func() {
+		err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeProcessError(process, operation, err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &ProcessStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return properties, nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *Process) ExitCode() (_ int, err error) {
+	operation := "hcsshim::Process::ExitCode"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	properties, err := process.Properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, err, nil)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+	}
+
+	return int(properties.ExitCode), nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Stdio"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		events := processHcsResult(resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, err, events)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *Process) CloseStdin() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::CloseStdin"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *Process) Close() (err error) {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+
+	operation := "hcsshim::Process::Close"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err = process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	if err = hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	process.handle = 0
+
+	return nil
+}
+
+func (process *Process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *Process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go

@@ -0,0 +1,685 @@
+package hcs
+
+import (
+	"encoding/json"
+	"os"
+	"strconv"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// currentContainerStarts is used to limit the number of concurrent container
+// starts.
+var currentContainerStarts containerStarts
+
+type containerStarts struct {
+	maxParallel int
+	inProgress  int
+	sync.Mutex
+}
+
+func init() {
+	mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
+	if len(mpsS) > 0 {
+		mpsI, err := strconv.Atoi(mpsS)
+		if err != nil || mpsI < 0 {
+			return
+		}
+		currentContainerStarts.maxParallel = mpsI
+	}
+}
+
+type System struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newSystem(id string) *System {
+	return &System{
+		id: id,
+		logctx: logrus.Fields{
+			logfields.ContainerID: id,
+		},
+	}
+}
+
+func (computeSystem *System) logOperationBegin(operation string) {
+	logOperationBegin(
+		computeSystem.logctx,
+		operation+" - Begin Operation")
+}
+
+func (computeSystem *System) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		computeSystem.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
+func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+	operation := "hcsshim::CreateComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
+	if err != nil {
+		return nil, err
+	}
+
+	hcsDocument := string(hcsDocumentB)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, hcsDocument).
+		Debug("HCS ComputeSystem Document")
+
+	var (
+		resultp     *uint16
+		identity    syscall.Handle
+		createError error
+	)
+	syscallWatcher(computeSystem.logctx, func() {
+		createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
+	})
+
+	if createError == nil || IsPending(createError) {
+		if err = computeSystem.registerCallback(); err != nil {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+			return nil, makeSystemError(computeSystem, operation, "", err, nil)
+		}
+	}
+
+	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	if err != nil {
+		if err == ErrTimeout {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+		}
+		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
+	}
+
+	return computeSystem, nil
+}
+
+// OpenComputeSystem opens an existing compute system by ID.
+func OpenComputeSystem(id string) (_ *System, err error) {
+	operation := "hcsshim::OpenComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsNotExist(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err = hcsOpenComputeSystem(id, &handle, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	computeSystem.handle = handle
+
+	if err = computeSystem.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return computeSystem, nil
+}
+
+// GetComputeSystems gets a list of the compute systems on the system that match the query
+func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+	operation := "hcsshim::GetComputeSystems"
+	fields := logrus.Fields{}
+	logOperationBegin(
+		fields,
+		operation+" - Begin Operation")
+
+	defer func() {
+		var result string
+		if err == nil {
+			result = "Success"
+		} else {
+			result = "Error"
+		}
+
+		logOperationEnd(
+			fields,
+			operation+" - End Operation - "+result,
+			err)
+	}()
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+
+	logrus.WithFields(fields).
+		WithField(logfields.JSON, query).
+		Debug("HCS ComputeSystem Query")
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+
+	syscallWatcher(fields, func() {
+		err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, &HcsError{Op: operation, Err: err, Events: events}
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []schema1.ContainerProperties{}
+	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	return computeSystems, nil
+}
+
+// Start synchronously starts the computeSystem.
+func (computeSystem *System) Start() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Start"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+	}
+
+	// This is a very simple backoff-retry loop to limit the number
+	// of parallel container starts if environment variable
+	// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
+	// It should generally only be used as a workaround to various
+	// platform issues that exist between RS1 and RS4 as of Aug 2018
+	if currentContainerStarts.maxParallel > 0 {
+		for {
+			currentContainerStarts.Lock()
+			if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
+				currentContainerStarts.inProgress++
+				currentContainerStarts.Unlock()
+				break
+			}
+			if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
+				currentContainerStarts.Unlock()
+				time.Sleep(100 * time.Millisecond)
+			}
+		}
+		// Make sure we decrement the count when we are done.
+		defer func() {
+			currentContainerStarts.Lock()
+			currentContainerStarts.inProgress--
+			currentContainerStarts.Unlock()
+		}()
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	if err != nil {
+		return makeSystemError(computeSystem, "Start", "", err, events)
+	}
+
+	return nil
+}
+
+// ID returns the compute system's identifier.
+func (computeSystem *System) ID() string {
+	return computeSystem.id
+}
+
+// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Shutdown"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsAlreadyStopped(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	}
+
+	return nil
+}
+
+// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Terminate"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsPending(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil && err != ErrVmcomputeAlreadyStopped {
+		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	}
+
+	return nil
+}
+
+// Wait synchronously waits for the compute system to shutdown or terminate.
+func (computeSystem *System) Wait() (err error) {
+	operation := "hcsshim::ComputeSystem::Wait"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeSystemError(computeSystem, "Wait", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitExpectedError synchronously waits for the compute system to shutdown or
+// terminate, and ignores the passed error if it occurs.
+func (computeSystem *System) WaitExpectedError(expected error) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitExpectedError"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil && getInnerError(err) != expected {
+		return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitTimeout"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+	}
+
+	return nil
+}
+
+func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Properties"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, queryj).
+		Debug("HCS ComputeSystem Properties Query")
+
+	var resultp, propertiesp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	return properties, nil
+}
+
+// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Pause() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Pause"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	if err != nil {
+		return makeSystemError(computeSystem, "Pause", "", err, events)
+	}
+
+	return nil
+}
+
+// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Resume() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Resume"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	if err != nil {
+		return makeSystemError(computeSystem, "Resume", "", err, events)
+	}
+
+	return nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::CreateProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	configuration := string(configurationb)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, configuration).
+		Debug("HCS ComputeSystem Process Document")
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.ProcessID, processInfo.ProcessId).
+		Debug("HCS ComputeSystem CreateProcess PID")
+
+	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
+	process.cachedPipes = &cachedPipes{
+		stdIn:  processInfo.StdInput,
+		stdOut: processInfo.StdOutput,
+		stdErr: processInfo.StdError,
+	}
+
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the computeSystem.
+func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	// Add PID for the context of this operation
+	computeSystem.logctx[logfields.ProcessID] = pid
+	defer delete(computeSystem.logctx, logfields.ProcessID)
+
+	operation := "hcsshim::ComputeSystem::OpenProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+	}
+
+	process := newProcess(processHandle, pid, computeSystem)
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// Close cleans up any state associated with the compute system but does not terminate or wait for it.
+func (computeSystem *System) Close() (err error) {
+	computeSystem.handleLock.Lock()
+	defer computeSystem.handleLock.Unlock()
+
+	operation := "hcsshim::ComputeSystem::Close"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if computeSystem.handle == 0 {
+		return nil
+	}
+
+	if err = computeSystem.unregisterCallback(); err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCloseComputeSystem(computeSystem.handle)
+	})
+	if err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	computeSystem.handle = 0
+
+	return nil
+}
+
+func (computeSystem *System) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	computeSystem.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (computeSystem *System) unregisterCallback() error {
+	callbackNumber := computeSystem.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modify the System by sending a request to HCS
+func (computeSystem *System) Modify(config interface{}) (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Modify"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, requestString).
+		Debug("HCS ComputeSystem Modify Document")
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+	}
+
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go

@@ -0,0 +1,33 @@
+package hcs
+
+import (
+	"io"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
+// if there is an error.
+func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
+	fs := make([]io.ReadWriteCloser, len(hs))
+	for i, h := range hs {
+		if h != syscall.Handle(0) {
+			if err == nil {
+				fs[i], err = winio.MakeOpenFile(h)
+			}
+			if err != nil {
+				syscall.Close(h)
+			}
+		}
+	}
+	if err != nil {
+		for _, f := range fs {
+			if f != nil {
+				f.Close()
+			}
+		}
+		return nil, err
+	}
+	return fs, nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go

@@ -0,0 +1,63 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(resultp)
+	if IsPending(err) {
+		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+	}
+
+	return events, err
+}
+
+func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	callbackMapLock.RLock()
+	channels := callbackMap[callbackNumber].channels
+	callbackMapLock.RUnlock()
+
+	expectedChannel := channels[expectedNotification]
+	if expectedChannel == nil {
+		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		return ErrInvalidNotificationType
+	}
+
+	var c <-chan time.Time
+	if timeout != nil {
+		timer := time.NewTimer(*timeout)
+		c = timer.C
+		defer timer.Stop()
+	}
+
+	select {
+	case err, ok := <-expectedChannel:
+		if !ok {
+			return ErrHandleClose
+		}
+		return err
+	case err, ok := <-channels[hcsNotificationSystemExited]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// If the expected notification is hcsNotificationSystemExited which of the two selects
+		// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
+		if channels[hcsNotificationSystemExited] == expectedChannel {
+			return err
+		}
+		return ErrUnexpectedContainerExit
+	case _, ok := <-channels[hcsNotificationServiceDisconnect]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// hcsNotificationServiceDisconnect should never be an expected notification
+		// it does not need the same handling as hcsNotificationSystemExited
+		return ErrUnexpectedProcessAbort
+	case <-c:
+		return ErrTimeout
+	}
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go

@@ -0,0 +1,41 @@
+package hcs
+
+import (
+	"context"
+
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// syscallWatcher is used as a very simple goroutine around calls into
+// the platform. In some cases, we have seen HCS APIs not returning due to
+// various bugs, and the goroutine making the syscall ends up not returning,
+// prior to its async callback. By spinning up a syscallWatcher, it allows
+// us to at least log a warning if a syscall doesn't complete in a reasonable
+// amount of time.
+//
+// Usage is:
+//
+// syscallWatcher(logContext, func() {
+//    err = <syscall>(args...)
+// })
+//
+
+func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
+	ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
+	defer cancel()
+	go watchFunc(ctx, logContext)
+	syscallLambda()
+}
+
+func watchFunc(ctx context.Context, logContext logrus.Fields) {
+	select {
+	case <-ctx.Done():
+		if ctx.Err() != context.Canceled {
+			logrus.WithFields(logContext).
+				WithField(logfields.Timeout, timeout.SyscallWatcher).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+	}
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go

@@ -0,0 +1,533 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hcs
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+
+	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsSignalProcess(process, _p0, result)
+}
+
+func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go

@@ -0,0 +1,47 @@
+package hcserror
+
+import (
+	"fmt"
+	"syscall"
+)
+
+const ERROR_GEN_FAILURE = syscall.Errno(31)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func New(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func Win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return Win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go

@@ -0,0 +1,23 @@
+package hns
+
+import "fmt"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+type EndpointNotFoundError struct {
+	EndpointName string
+}
+
+func (e EndpointNotFoundError) Error() string {
+	return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
+}
+
+type NetworkNotFoundError struct {
+	NetworkName string
+}
+
+func (e NetworkNotFoundError) Error() string {
+	return fmt.Sprintf("Network %s not found", e.NetworkName)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go

@@ -0,0 +1,262 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+	EnableLowMetric    bool              `json:",omitempty"`
+	Namespace          *Namespace        `json:",omitempty"`
+	EncapOverhead      uint16            `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, EndpointNotFoundError{EndpointName: endpointName}
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	for _, policy := range policies {
+		if policy == nil {
+			continue
+		}
+		jsonString, err := json.Marshal(policy)
+		if err != nil {
+			return err
+		}
+		endpoint.Policies = append(endpoint.Policies, jsonString)
+	}
+
+	_, err := endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go

@@ -0,0 +1,42 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	var responseBuffer *uint16
+	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
+
+	err := _hnsCall(method, path, request, &responseBuffer)
+	if err != nil {
+		return hcserror.New(err, "hnsCall ", "")
+	}
+	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
+
+	hnsresponse := &hnsResponse{}
+	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
+		return err
+	}
+
+	if !hnsresponse.Success {
+		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+	}
+
+	if len(hnsresponse.Output) == 0 {
+		return nil
+	}
+
+	logrus.Debugf("Network Response : %s", hnsresponse.Output)
+	err = json.Unmarshal(hnsresponse.Output, returnResponse)
+	if err != nil {
+		return err
+	}
+
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go

@@ -0,0 +1,28 @@
+package hns
+
+type HNSGlobals struct {
+	Version HNSVersion `json:"Version"`
+}
+
+type HNSVersion struct {
+	Major int `json:"Major"`
+	Minor int `json:"Minor"`
+}
+
+var (
+	HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	var version HNSVersion
+	err := hnsCall("GET", "/globals/version", "", &version)
+	if err != nil {
+		return nil, err
+	}
+
+	globals := &HNSGlobals{
+		Version: version,
+	}
+
+	return globals, nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go

@@ -0,0 +1,141 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, NetworkNotFoundError{NetworkName: networkName}
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go

@@ -0,0 +1,98 @@
+package hns
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type            PolicyType `json:"Type"`
+	Id              string     `json:"Id,omitempty"`
+	Protocol        uint16
+	Protocols       string `json:"Protocols,omitempty"`
+	InternalPort    uint16
+	Action          ActionType
+	Direction       DirectionType
+	LocalAddresses  string
+	RemoteAddresses string
+	LocalPorts      string `json:"LocalPorts,omitempty"`
+	LocalPort       uint16
+	RemotePorts     string `json:"RemotePorts,omitempty"`
+	RemotePort      uint16
+	RuleType        RuleType `json:"RuleType,omitempty"`
+	Priority        uint16
+	ServiceName     string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go

@@ -0,0 +1,201 @@
+package hns
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+	DSR       bool     `json:"IsDSR,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		SourceVIP: sourceVIP,
+		ILB:       isILB,
+	}
+
+	if len(vip) > 0 {
+		elbPolicy.VIPs = []string{vip}
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go

@@ -0,0 +1,49 @@
+package hns
+
+import (
+	"github.com/sirupsen/logrus"
+)
+
+type HNSSupportedFeatures struct {
+	Acl HNSAclFeatures `json:"ACL"`
+}
+
+type HNSAclFeatures struct {
+	AclAddressLists       bool `json:"AclAddressLists"`
+	AclNoHostRulePriority bool `json:"AclHostRulePriority"`
+	AclPortRanges         bool `json:"AclPortRanges"`
+	AclRuleId             bool `json:"AclRuleId"`
+}
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	var hnsFeatures HNSSupportedFeatures
+
+	globals, err := GetHNSGlobals()
+	if err != nil {
+		// Expected on pre-1803 builds, all features will be false/unsupported
+		logrus.Debugf("Unable to obtain HNS globals: %s", err)
+		return hnsFeatures
+	}
+
+	hnsFeatures.Acl = HNSAclFeatures{
+		AclAddressLists:       isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclPortRanges:         isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclRuleId:             isHNSFeatureSupported(globals.Version, HNSVersion1803),
+	}
+
+	return hnsFeatures
+}
+
+func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
+	if currentVersion.Major < minVersionSupported.Major {
+		return false
+	}
+	if currentVersion.Major > minVersionSupported.Major {
+		return true
+	}
+	if currentVersion.Minor < minVersionSupported.Minor {
+		return false
+	}
+	return true
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go

@@ -0,0 +1,110 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"path"
+	"strings"
+)
+
+type namespaceRequest struct {
+	IsDefault bool `json:",omitempty"`
+}
+
+type namespaceEndpointRequest struct {
+	ID string `json:"Id"`
+}
+
+type NamespaceResource struct {
+	Type string
+	Data json.RawMessage
+}
+
+type namespaceResourceRequest struct {
+	Type string
+	Data interface{}
+}
+
+type Namespace struct {
+	ID           string
+	IsDefault    bool                `json:",omitempty"`
+	ResourceList []NamespaceResource `json:",omitempty"`
+}
+
+func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
+	var err error
+	hnspath := "/namespaces/"
+	if id != nil {
+		hnspath = path.Join(hnspath, *id)
+	}
+	if subpath != "" {
+		hnspath = path.Join(hnspath, subpath)
+	}
+	var reqJSON []byte
+	if request != nil {
+		if reqJSON, err = json.Marshal(request); err != nil {
+			return nil, err
+		}
+	}
+	var ns Namespace
+	err = hnsCall(method, hnspath, string(reqJSON), &ns)
+	if err != nil {
+		if strings.Contains(err.Error(), "Element not found.") {
+			return nil, os.ErrNotExist
+		}
+		return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
+	}
+	return &ns, err
+}
+
+func CreateNamespace() (string, error) {
+	req := namespaceRequest{}
+	ns, err := issueNamespaceRequest(nil, "POST", "", &req)
+	if err != nil {
+		return "", err
+	}
+	return ns.ID, nil
+}
+
+func RemoveNamespace(id string) error {
+	_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
+	return err
+}
+
+func GetNamespaceEndpoints(id string) ([]string, error) {
+	ns, err := issueNamespaceRequest(&id, "GET", "", nil)
+	if err != nil {
+		return nil, err
+	}
+	var endpoints []string
+	for _, rsrc := range ns.ResourceList {
+		if rsrc.Type == "Endpoint" {
+			var endpoint namespaceEndpointRequest
+			err = json.Unmarshal(rsrc.Data, &endpoint)
+			if err != nil {
+				return nil, fmt.Errorf("unmarshal endpoint: %s", err)
+			}
+			endpoints = append(endpoints, endpoint.ID)
+		}
+	}
+	return endpoints, nil
+}
+
+func AddNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
+	return err
+}
+
+func RemoveNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
+	return err
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go

@@ -0,0 +1,76 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hns
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHNSCall = modvmcompute.NewProc("HNSCall")
+)
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go

@@ -0,0 +1,27 @@
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree
+
+func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(ConvertAndFreeCoTaskMemString(buffer))
+}
+
+func Win32FromHresult(hr uintptr) syscall.Errno {
+	if hr&0x1fff0000 == 0x00070000 {
+		return syscall.Errno(hr & 0xffff)
+	}
+	return syscall.Errno(hr)
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go

@@ -0,0 +1,48 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll")
+
+	procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go

@@ -0,0 +1,32 @@
+package logfields
+
+const (
+	// Identifiers
+
+	ContainerID = "cid"
+	UVMID       = "uvm-id"
+	ProcessID   = "pid"
+
+	// Common Misc
+
+	// Timeout represents an operation timeout.
+	Timeout = "timeout"
+	JSON    = "json"
+
+	// Keys/values
+
+	Field         = "field"
+	OCIAnnotation = "oci-annotation"
+	Value         = "value"
+
+	// Golang type's
+
+	ExpectedType = "expected-type"
+	Bool         = "bool"
+	Uint32       = "uint32"
+	Uint64       = "uint64"
+
+	// runhcs
+
+	VMShimOperation = "vmshim-op"
+)

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go

@@ -0,0 +1,24 @@
+package longpath
+
+import (
+	"path/filepath"
+	"strings"
+)
+
+// LongAbs makes a path absolute and returns it in NT long path form.
+func LongAbs(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go

@@ -0,0 +1,52 @@
+package mergemaps
+
+import "encoding/json"
+
+// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func Merge(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// MergeJSON merges the contents of a JSON string into an object representation,
+// returning a new object suitable for translating to JSON.
+func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
+	if len(additionalJSON) == 0 {
+		return object, nil
+	}
+	objectJSON, err := json.Marshal(object)
+	if err != nil {
+		return nil, err
+	}
+	var objectMap, newMap map[string]interface{}
+	err = json.Unmarshal(objectJSON, &objectMap)
+	if err != nil {
+		return nil, err
+	}
+	err = json.Unmarshal(additionalJSON, &newMap)
+	if err != nil {
+		return nil, err
+	}
+	return Merge(newMap, objectMap), nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go

@@ -0,0 +1,431 @@
+package safefile
+
+import (
+	"errors"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+	"unicode/utf16"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/longpath"
+
+	winio "github.com/Microsoft/go-winio"
+)
+
+//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
+
+//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
+//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
+//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
+//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
+//sys localFree(ptr uintptr) = kernel32.LocalFree
+
+type ioStatusBlock struct {
+	Status, Information uintptr
+}
+
+type objectAttributes struct {
+	Length             uintptr
+	RootDirectory      uintptr
+	ObjectName         uintptr
+	Attributes         uintptr
+	SecurityDescriptor uintptr
+	SecurityQoS        uintptr
+}
+
+type unicodeString struct {
+	Length        uint16
+	MaximumLength uint16
+	Buffer        uintptr
+}
+
+type fileLinkInformation struct {
+	ReplaceIfExists bool
+	RootDirectory   uintptr
+	FileNameLength  uint32
+	FileName        [1]uint16
+}
+
+type fileDispositionInformationEx struct {
+	Flags uintptr
+}
+
+const (
+	_FileLinkInformation          = 11
+	_FileDispositionInformationEx = 64
+
+	FILE_READ_ATTRIBUTES  = 0x0080
+	FILE_WRITE_ATTRIBUTES = 0x0100
+	DELETE                = 0x10000
+
+	FILE_OPEN   = 1
+	FILE_CREATE = 2
+
+	FILE_DIRECTORY_FILE          = 0x00000001
+	FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
+	FILE_DELETE_ON_CLOSE         = 0x00001000
+	FILE_OPEN_FOR_BACKUP_INTENT  = 0x00004000
+	FILE_OPEN_REPARSE_POINT      = 0x00200000
+
+	FILE_DISPOSITION_DELETE = 0x00000001
+
+	_OBJ_DONT_REPARSE = 0x1000
+
+	_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
+)
+
+func OpenRoot(path string) (*os.File, error) {
+	longpath, err := longpath.LongAbs(path)
+	if err != nil {
+		return nil, err
+	}
+	return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
+}
+
+func ntRelativePath(path string) ([]uint16, error) {
+	path = filepath.Clean(path)
+	if strings.Contains(path, ":") {
+		// Since alternate data streams must follow the file they
+		// are attached to, finding one here (out of order) is invalid.
+		return nil, errors.New("path contains invalid character `:`")
+	}
+	fspath := filepath.FromSlash(path)
+	if len(fspath) > 0 && fspath[0] == '\\' {
+		return nil, errors.New("expected relative path")
+	}
+
+	path16 := utf16.Encode(([]rune)(fspath))
+	if len(path16) > 32767 {
+		return nil, syscall.ENAMETOOLONG
+	}
+
+	return path16, nil
+}
+
+// openRelativeInternal opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	var (
+		h    uintptr
+		iosb ioStatusBlock
+		oa   objectAttributes
+	)
+
+	path16, err := ntRelativePath(path)
+	if err != nil {
+		return nil, err
+	}
+
+	if root == nil || root.Fd() == 0 {
+		return nil, errors.New("missing root directory")
+	}
+
+	upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
+	defer localFree(upathBuffer)
+
+	upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
+	upath.Length = uint16(len(path16) * 2)
+	upath.MaximumLength = upath.Length
+	upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
+	copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
+
+	oa.Length = unsafe.Sizeof(oa)
+	oa.ObjectName = upathBuffer
+	oa.RootDirectory = uintptr(root.Fd())
+	oa.Attributes = _OBJ_DONT_REPARSE
+	status := ntCreateFile(
+		&h,
+		accessMask|syscall.SYNCHRONIZE,
+		&oa,
+		&iosb,
+		nil,
+		0,
+		shareFlags,
+		createDisposition,
+		FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
+		nil,
+		0,
+	)
+	if status != 0 {
+		return nil, rtlNtStatusToDosError(status)
+	}
+
+	fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
+	if err != nil {
+		syscall.Close(syscall.Handle(h))
+		return nil, err
+	}
+
+	return os.NewFile(h, fullPath), nil
+}
+
+// OpenRelative opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return f, err
+}
+
+// LinkRelative creates a hard link from oldname to newname (relative to oldroot
+// and newroot), failing if any of the intermediate path components are reparse
+// points.
+func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
+	// Open the old file.
+	oldf, err := openRelativeInternal(
+		oldname,
+		oldroot,
+		syscall.FILE_WRITE_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0,
+	)
+	if err != nil {
+		return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
+	}
+	defer oldf.Close()
+
+	// Open the parent of the new file.
+	var parent *os.File
+	parentPath := filepath.Dir(newname)
+	if parentPath != "." {
+		parent, err = openRelativeInternal(
+			parentPath,
+			newroot,
+			syscall.GENERIC_READ,
+			syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+			FILE_OPEN,
+			FILE_DIRECTORY_FILE)
+		if err != nil {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
+		}
+		defer parent.Close()
+
+		fi, err := winio.GetFileBasicInfo(parent)
+		if err != nil {
+			return err
+		}
+		if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
+		}
+
+	} else {
+		parent = newroot
+	}
+
+	// Issue an NT call to create the link. This will be safe because NT will
+	// not open any more directories to create the link, so it cannot walk any
+	// more reparse points.
+	newbase := filepath.Base(newname)
+	newbase16, err := ntRelativePath(newbase)
+	if err != nil {
+		return err
+	}
+
+	size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
+	linkinfoBuffer := localAlloc(0, size)
+	defer localFree(linkinfoBuffer)
+	linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
+	linkinfo.RootDirectory = parent.Fd()
+	linkinfo.FileNameLength = uint32(len(newbase16) * 2)
+	copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
+
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		oldf.Fd(),
+		&iosb,
+		linkinfoBuffer,
+		uint32(size),
+		_FileLinkInformation,
+	)
+	if status != 0 {
+		return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
+	}
+
+	return nil
+}
+
+// deleteOnClose marks a file to be deleted when the handle is closed.
+func deleteOnClose(f *os.File) error {
+	disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		f.Fd(),
+		&iosb,
+		uintptr(unsafe.Pointer(&disposition)),
+		uint32(unsafe.Sizeof(disposition)),
+		_FileDispositionInformationEx,
+	)
+	if status != 0 {
+		return rtlNtStatusToDosError(status)
+	}
+	return nil
+}
+
+// clearReadOnly clears the readonly attribute on a file.
+func clearReadOnly(f *os.File) error {
+	bi, err := winio.GetFileBasicInfo(f)
+	if err != nil {
+		return err
+	}
+	if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
+		return nil
+	}
+	sbi := winio.FileBasicInfo{
+		FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
+	}
+	if sbi.FileAttributes == 0 {
+		sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
+	}
+	return winio.SetFileBasicInfo(f, &sbi)
+}
+
+// RemoveRelative removes a file or directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err == nil {
+		defer f.Close()
+		err = deleteOnClose(f)
+		if err == syscall.ERROR_ACCESS_DENIED {
+			// Maybe the file is marked readonly. Clear the bit and retry.
+			clearReadOnly(f)
+			err = deleteOnClose(f)
+		}
+	}
+	if err != nil {
+		return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return nil
+}
+
+// RemoveAllRelative removes a directory tree relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveAllRelative(path string, root *os.File) error {
+	fi, err := LstatRelative(path, root)
+	if err != nil {
+		if os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+	fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+	if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
+		// If this is a reparse point, it can't have children. Simple remove will do.
+		err := RemoveRelative(path, root)
+		if err == nil || os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+
+	// It is necessary to use os.Open as Readdirnames does not work with
+	// OpenRelative. This is safe because the above lstatrelative fails
+	// if the target is outside the root, and we know this is not a
+	// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
+	fd, err := os.Open(filepath.Join(root.Name(), path))
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Race. It was deleted between the Lstat and Open.
+			// Return nil per RemoveAll's docs.
+			return nil
+		}
+		return err
+	}
+
+	// Remove contents & return first error.
+	for {
+		names, err1 := fd.Readdirnames(100)
+		for _, name := range names {
+			err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
+			if err == nil {
+				err = err1
+			}
+		}
+		if err1 == io.EOF {
+			break
+		}
+		// If Readdirnames returned an error, use it.
+		if err == nil {
+			err = err1
+		}
+		if len(names) == 0 {
+			break
+		}
+	}
+	fd.Close()
+
+	// Remove directory.
+	err1 := RemoveRelative(path, root)
+	if err1 == nil || os.IsNotExist(err1) {
+		return nil
+	}
+	if err == nil {
+		err = err1
+	}
+	return err
+}
+
+// MkdirRelative creates a directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func MkdirRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_CREATE,
+		FILE_DIRECTORY_FILE)
+	if err == nil {
+		f.Close()
+	} else {
+		err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return err
+}
+
+// LstatRelative performs a stat operation on a file relative to a root, failing
+// if any intermediate path components are reparse points.
+func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err != nil {
+		return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	defer f.Close()
+	return f.Stat()
+}
+
+// EnsureNotReparsePointRelative validates that a given file (relative to a
+// root) and all intermediate path components are not a reparse points.
+func EnsureNotReparsePointRelative(path string, root *os.File) error {
+	// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
+	f, err := OpenRelative(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0)
+	if err != nil {
+		return err
+	}
+	f.Close()
+	return nil
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go

@@ -0,0 +1,79 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package safefile
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modntdll    = windows.NewLazySystemDLL("ntdll.dll")
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+
+	procNtCreateFile               = modntdll.NewProc("NtCreateFile")
+	procNtSetInformationFile       = modntdll.NewProc("NtSetInformationFile")
+	procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
+	procLocalAlloc                 = modkernel32.NewProc("LocalAlloc")
+	procLocalFree                  = modkernel32.NewProc("LocalFree")
+)
+
+func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
+	status = uint32(r0)
+	return
+}
+
+func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
+	status = uint32(r0)
+	return
+}
+
+func rtlNtStatusToDosError(status uint32) (winerr error) {
+	r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
+	if r0 != 0 {
+		winerr = syscall.Errno(r0)
+	}
+	return
+}
+
+func localAlloc(flags uint32, size int) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func localFree(ptr uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
+	return
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go

@@ -0,0 +1,245 @@
+package schema1
+
+import (
+	"encoding/json"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig struct {
+	ApplicationName   string            `json:",omitempty"`
+	CommandLine       string            `json:",omitempty"`
+	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
+	User              string            `json:",omitempty"`
+	WorkingDirectory  string            `json:",omitempty"`
+	Environment       map[string]string `json:",omitempty"`
+	EmulateConsole    bool              `json:",omitempty"`
+	CreateStdInPipe   bool              `json:",omitempty"`
+	CreateStdOutPipe  bool              `json:",omitempty"`
+	CreateStdErrPipe  bool              `json:",omitempty"`
+	ConsoleSize       [2]uint           `json:",omitempty"`
+	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
+	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
+}
+
+type Layer struct {
+	ID   string
+	Path string
+}
+
+type MappedDir struct {
+	HostPath          string
+	ContainerPath     string
+	ReadOnly          bool
+	BandwidthMaximum  uint64
+	IOPSMaximum       uint64
+	CreateInUtilityVM bool
+	// LinuxMetadata - Support added in 1803/RS4+.
+	LinuxMetadata bool `json:",omitempty"`
+}
+
+type MappedPipe struct {
+	HostPath          string
+	ContainerPipeName string
+}
+
+type HvRuntime struct {
+	ImagePath           string `json:",omitempty"`
+	SkipTemplate        bool   `json:",omitempty"`
+	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
+	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
+	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
+	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
+	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
+}
+
+type MappedVirtualDisk struct {
+	HostPath          string `json:",omitempty"` // Path to VHD on the host
+	ContainerPath     string // Platform-specific mount point path in the container
+	CreateInUtilityVM bool   `json:",omitempty"`
+	ReadOnly          bool   `json:",omitempty"`
+	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
+	AttachOnly        bool   `json:",omitempty:`
+}
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice struct {
+	//  InterfaceClassGUID of the device to assign to container.
+	InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
+}
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig struct {
+	SystemType                  string              // HCS requires this to be hard-coded to "Container"
+	Name                        string              // Name of the container. We use the docker ID.
+	Owner                       string              `json:",omitempty"` // The management platform that created this container
+	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
+	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
+	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
+	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
+	Credentials                 string              `json:",omitempty"` // Credentials information
+	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
+	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
+	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
+	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
+	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
+	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
+	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
+	HostName                    string              `json:",omitempty"` // Hostname
+	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
+	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
+	HvPartition                 bool                // True if it a Hyper-V Container
+	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
+	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
+	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
+	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
+	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
+	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
+	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
+	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
+	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
+	AssignedDevices             []AssignedDevice    `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
+}
+
+type ComputeSystemQuery struct {
+	IDs    []string `json:"Ids,omitempty"`
+	Types  []string `json:",omitempty"`
+	Names  []string `json:",omitempty"`
+	Owners []string `json:",omitempty"`
+}
+
+type PropertyType string
+
+const (
+	PropertyTypeStatistics        PropertyType = "Statistics"        // V1 and V2
+	PropertyTypeProcessList                    = "ProcessList"       // V1 and V2
+	PropertyTypeMappedVirtualDisk              = "MappedVirtualDisk" // Not supported in V2 schema call
+	PropertyTypeGuestConnection                = "GuestConnection"   // V1 and V2. Nil return from HCS before RS5
+)
+
+type PropertyQuery struct {
+	PropertyTypes []PropertyType `json:",omitempty"`
+}
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties struct {
+	ID                           string `json:"Id"`
+	State                        string
+	Name                         string
+	SystemType                   string
+	Owner                        string
+	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
+	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	IsRuntimeTemplate            bool                                `json:",omitempty"`
+	RuntimeImagePath             string                              `json:",omitempty"`
+	Stopped                      bool                                `json:",omitempty"`
+	ExitType                     string                              `json:",omitempty"`
+	AreUpdatesPending            bool                                `json:",omitempty"`
+	ObRoot                       string                              `json:",omitempty"`
+	Statistics                   Statistics                          `json:",omitempty"`
+	ProcessList                  []ProcessListItem                   `json:",omitempty"`
+	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
+	GuestConnectionInfo          GuestConnectionInfo                 `json:",omitempty"`
+}
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats struct {
+	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
+	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats struct {
+	TotalRuntime100ns  uint64 `json:",omitempty"`
+	RuntimeUser100ns   uint64 `json:",omitempty"`
+	RuntimeKernel100ns uint64 `json:",omitempty"`
+}
+
+// StorageStats holds the storage statistics for a container
+type StorageStats struct {
+	ReadCountNormalized  uint64 `json:",omitempty"`
+	ReadSizeBytes        uint64 `json:",omitempty"`
+	WriteCountNormalized uint64 `json:",omitempty"`
+	WriteSizeBytes       uint64 `json:",omitempty"`
+}
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats struct {
+	BytesReceived          uint64 `json:",omitempty"`
+	BytesSent              uint64 `json:",omitempty"`
+	PacketsReceived        uint64 `json:",omitempty"`
+	PacketsSent            uint64 `json:",omitempty"`
+	DroppedPacketsIncoming uint64 `json:",omitempty"`
+	DroppedPacketsOutgoing uint64 `json:",omitempty"`
+	EndpointId             string `json:",omitempty"`
+	InstanceId             string `json:",omitempty"`
+}
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics struct {
+	Timestamp          time.Time      `json:",omitempty"`
+	ContainerStartTime time.Time      `json:",omitempty"`
+	Uptime100ns        uint64         `json:",omitempty"`
+	Memory             MemoryStats    `json:",omitempty"`
+	Processor          ProcessorStats `json:",omitempty"`
+	Storage            StorageStats   `json:",omitempty"`
+	Network            []NetworkStats `json:",omitempty"`
+}
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem struct {
+	CreateTimestamp              time.Time `json:",omitempty"`
+	ImageName                    string    `json:",omitempty"`
+	KernelTime100ns              uint64    `json:",omitempty"`
+	MemoryCommitBytes            uint64    `json:",omitempty"`
+	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
+	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
+	ProcessId                    uint32    `json:",omitempty"`
+	UserTime100ns                uint64    `json:",omitempty"`
+}
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController struct {
+	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
+}
+
+// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
+type GuestDefinedCapabilities struct {
+	NamespaceAddRequestSupported bool `json:",omitempty"`
+	SignalProcessSupported       bool `json:",omitempty"`
+}
+
+// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
+type GuestConnectionInfo struct {
+	SupportedSchemaVersions  []hcsschema.Version      `json:",omitempty"`
+	ProtocolVersion          uint32                   `json:",omitempty"`
+	GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
+}
+
+// Type of Request Support in ModifySystem
+type RequestType string
+
+// Type of Resource Support in ModifySystem
+type ResourceType string
+
+// RequestType const
+const (
+	Add     RequestType  = "Add"
+	Remove  RequestType  = "Remove"
+	Network ResourceType = "Network"
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse struct {
+	Resource ResourceType `json:"ResourceType"`
+	Data     interface{}  `json:"Settings"`
+	Request  RequestType  `json:"RequestType,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go

@@ -0,0 +1,31 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Attachment struct {
+
+	Type_ string `json:"Type,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
+
+	CachingMode string `json:"CachingMode,omitempty"`
+
+	NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
+
+	DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
+
+	IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
+
+	CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go

@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Battery struct {
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CacheQueryStatsResponse struct {
+
+	L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
+
+	L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
+
+	L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go

@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Chipset struct {
+	Uefi *Uefi `json:"Uefi,omitempty"`
+
+	IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
+
+	BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
+
+	ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
+
+	ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
+
+	UseUtc bool `json:"UseUtc,omitempty"`
+
+	// LinuxKernelDirect - Added in v2.2 Builds >=181117
+	LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CloseHandle struct {
+
+	Handle string `json:"Handle,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
+type ComPort struct {
+
+	NamedPipe string `json:"NamedPipe,omitempty"`
+
+	OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go

@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ComputeSystem struct {
+
+	Owner string `json:"Owner,omitempty"`
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	HostingSystemId string `json:"HostingSystemId,omitempty"`
+
+	HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+
+	VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
+
+	ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go

@@ -0,0 +1,72 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"net/http"
+)
+
+// contextKeys are used to identify the type of value in the context.
+// Since these are string, it is possible to get a short description of the
+// context key for logging and debugging using key.String().
+
+type contextKey string
+
+func (c contextKey) String() string {
+	return "auth " + string(c)
+}
+
+var (
+	// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
+	ContextOAuth2    	= contextKey("token")
+
+	// ContextBasicAuth takes BasicAuth as authentication for the request.
+	ContextBasicAuth 	= contextKey("basic")
+
+	// ContextAccessToken takes a string oauth2 access token as authentication for the request.
+	ContextAccessToken 	= contextKey("accesstoken")
+
+	// ContextAPIKey takes an APIKey as authentication for the request
+ 	ContextAPIKey 		= contextKey("apikey")
+)
+
+// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth 
+type BasicAuth struct {
+	UserName      string            `json:"userName,omitempty"`
+	Password      string            `json:"password,omitempty"`	
+}
+
+// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
+type APIKey struct {
+	Key 	string
+	Prefix	string
+}
+
+type Configuration struct {
+	BasePath      string            	`json:"basePath,omitempty"`
+	Host          string            	`json:"host,omitempty"`
+	Scheme        string            	`json:"scheme,omitempty"`
+	DefaultHeader map[string]string 	`json:"defaultHeader,omitempty"`
+	UserAgent     string            	`json:"userAgent,omitempty"`
+	HTTPClient 	  *http.Client
+}
+
+func NewConfiguration() *Configuration {
+	cfg := &Configuration{
+		BasePath:      "https://localhost",
+		DefaultHeader: make(map[string]string),
+		UserAgent:     "Swagger-Codegen/2.1.0/go",
+	}
+	return cfg
+}
+
+func (c *Configuration) AddDefaultHeader(key string, value string) {
+	c.DefaultHeader[key] = value
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ConsoleSize struct {
+
+	Height int32 `json:"Height,omitempty"`
+
+	Width int32 `json:"Width,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go

@@ -0,0 +1,35 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Container struct {
+
+	GuestOs *GuestOs `json:"GuestOs,omitempty"`
+
+	Storage *Storage `json:"Storage,omitempty"`
+
+	MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
+
+	MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
+
+	Memory *Memory `json:"Memory,omitempty"`
+
+	Processor *Processor `json:"Processor,omitempty"`
+
+	Networking *Networking `json:"Networking,omitempty"`
+
+	HvSocket *HvSocket `json:"HvSocket,omitempty"`
+
+	ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
+
+	RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
+
+	AssignedDevices []Device `json:"AssignedDevices,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go

@@ -0,0 +1,25 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ContainerCredentialGuardState struct {
+
+	//  Authentication cookie for calls to a Container Credential Guard instance.
+	Cookie string `json:"Cookie,omitempty"`
+
+	//  Name of the RPC endpoint of the Container Credential Guard instance.
+	RpcEndpoint string `json:"RpcEndpoint,omitempty"`
+
+	//  Transport used for the configured Container Credential Guard instance.
+	Transport string `json:"Transport,omitempty"`
+
+	//  Credential spec used for the configured Container Credential Guard instance.
+	CredentialSpec string `json:"CredentialSpec,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go

@@ -0,0 +1,26 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  memory usage as viewed from within the container
+type ContainerMemoryInformation struct {
+
+	TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
+
+	TotalUsage int32 `json:"TotalUsage,omitempty"`
+
+	CommittedBytes int32 `json:"CommittedBytes,omitempty"`
+
+	SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
+
+	CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
+
+	PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Device struct {
+
+	//  The interface class guid of the device to assign to container.
+	InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go

@@ -0,0 +1,43 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Devices struct {
+
+	ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
+
+	Scsi map[string]Scsi `json:"Scsi,omitempty"`
+
+	VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"`
+
+	NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"`
+
+	VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"`
+
+	Keyboard *Keyboard `json:"Keyboard,omitempty"`
+
+	Mouse *Mouse `json:"Mouse,omitempty"`
+
+	HvSocket *HvSocket2 `json:"HvSocket,omitempty"`
+
+	EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"`
+
+	GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"`
+
+	VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"`
+
+	Plan9 *Plan9 `json:"Plan9,omitempty"`
+
+	Battery *Battery `json:"Battery,omitempty"`
+
+	FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"`
+
+	SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type EnhancedModeVideo struct {
+
+	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type FlexibleIoDevice struct {
+
+	EmulatorId string `json:"EmulatorId,omitempty"`
+
+	HostingModel string `json:"HostingModel,omitempty"`
+
+	Configuration []string `json:"Configuration,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestConnection struct {
+
+	//  Use Vsock rather than Hyper-V sockets to communicate with the guest service.
+	UseVsock bool `json:"UseVsock,omitempty"`
+
+	//  Don't disconnect the guest connection when pausing the virtual machine.
+	UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go

@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Information about the guest.
+type GuestConnectionInfo struct {
+
+	//  Each schema version x.y stands for the range of versions a.b where a==x  and b<=y. This list comes from the SupportedSchemaVersions field in  GcsCapabilities.
+	SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"`
+
+	ProtocolVersion int32 `json:"ProtocolVersion,omitempty"`
+
+	GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestCrashReporting struct {
+
+	WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestOs struct {
+
+	HostName string `json:"HostName,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestState struct {
+
+	//  The path to an existing file uses for persistent guest state storage.  An empty string indicates the system should initialize new transient, in-memory guest state.
+	GuestStateFilePath string `json:"GuestStateFilePath,omitempty"`
+
+	//  The path to an existing file for persistent runtime state storage.  An empty string indicates the system should initialize new transient, in-memory runtime state.
+	RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"`
+
+	//  If true, the guest state and runtime state files will be used as templates  to populate transient, in-memory state instead of using the files as persistent backing store.
+	ForceTransientState bool `json:"ForceTransientState,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HostedSystem struct {
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocket struct {
+
+	Config *HvSocketSystemConfig `json:"Config,omitempty"`
+
+	EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  HvSocket configuration for a VM
+type HvSocket2 struct {
+
+	HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocketServiceConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to this specific service.  If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to this specific service.  If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"`
+
+	//  If true, HvSocket will process wildcard binds for this service/system combination.  Wildcard binds are secured in the registry at  SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors
+	AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  This is the HCS Schema version of the HvSocket configuration. The VMWP version is  located in Config.Devices.IC in V1.
+type HvSocketSystemConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to an unlisted service for this specific container/VM (not wildcard binds).
+	DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to an unlisted service in the VM/container.
+	DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"`
+
+	ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go

@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Keyboard struct {
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Layer struct {
+
+	Id string `json:"Id,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	PathType string `json:"PathType,omitempty"`
+
+	//  Unspecified defaults to Enabled
+	Cache string `json:"Cache,omitempty"`
+}

src/runtime/vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.2
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type LinuxKernelDirect struct {
+	KernelFilePath string `json:"KernelFilePath,omitempty"`
+
+	InitRdPath string `json:"InitRdPath,omitempty"`
+
+	KernelCmdLine string `json:"KernelCmdLine,omitempty"`
+}